Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SrCO3 + HClO4 = Sr(ClO4)2 + CO2 + H2OSrCO3 + 2HClO4 = Sr(ClO4)2 + CO2 + H2O
S8+HNO3=H2SO4+NO2+H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO2 + CaCO3 + O2 + 2H2O = CaSO4*2H2O + CO2 2SO2 + 2CaCO3 + O2 + 4H2O = 2CaSO4*2H2O + 2CO2
SO2+O2=SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = SO2
Sn + HBr = SnBr2 + H2 Sn + 2HBr = SnBr2 + H2
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SO2Ci2+ HI= H2S+H2O+HCi+I2SO2Ci2 + 8HI = H2S + 2H2O + 2HCi + 4I2
S+CO=SO2+CS + 2CO = SO2 + 2C
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+HNO3=NO+H2SO4+H2O-3SO2 - 2HNO3 = -2NO - 3H2SO4 + 2H2O
SO2 + O2 =SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S(s)+O2(g)=2SO2S(s) + O2(g) = SO2
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S(s)+O2(g)=SO2S(s) + O2(g) = SO2
Sn+P=Sn3P23Sn + 2P = Sn3P2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnO+NF3=SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SiF4+H2O=HF+SiO2SiF4 + 2H2O = 4HF + SiO2
Se+O2=SeO32Se + 3O2 = 2SeO3
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sr(CH3COO)2 + (NH4)3PO4 = NH4CH3COO + Sr3(PO4)23Sr(CH3COO)2 + 2(NH4)3PO4 = 6NH4CH3COO + Sr3(PO4)2
SrO = Sr + O22SrO = 2Sr + O2
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sr+AgBr=Ag+SrBr2Sr + 2AgBr = 2Ag + SrBr2
S8 + O2 = SO2S8 + 8O2 = 8SO2
ScCl3+Na2CO3+H2O=Sc(OH)3+CO2+NaCl2ScCl3 + 3Na2CO3 + 3H2O = 2Sc(OH)3 + 3CO2 + 6NaCl
S+O2=SO2S + O2 = SO2
S+O2=SO2S + O2 = SO2
S8+O2=SO3S8 + 12O2 = 8SO3
SF4 + 3 H2O = H2SO3 + 4HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + 3 H2O = H2SO3 + 4HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + 3 H2O = H2SO3 = 4HFSF4 + 3H2O = H2SO3 + 4HF
Sc(NO3)2(aq) + Ba(OH)2(aq) = Sc(OH)2(s) + Ba(NO3)2(aq)Sc(NO3)2(aq) + Ba(OH)2(aq) = Sc(OH)2(s) + Ba(NO3)2(aq)
Sc(NO3)2(aq)+Ba(OH)2(aq)=Sc(OH)2(s)+Ba(NO3)2(aq)Sc(NO3)2(aq) + Ba(OH)2(aq) = Sc(OH)2(s) + Ba(NO3)2(aq)
SiF4+Al= Si +AlF33SiF4 + 4Al = 3Si + 4AlF3
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sr+AgBr=Ag+SrBr2Sr + 2AgBr = 2Ag + SrBr2
S8+O2=SO2S8 + 8O2 = 8SO2
S8 (g) + O2 (g) =SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
S8 (g) + O2 (g) =SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
Sr(NO3)2 (aq) + H2SO4 (aq) = SrSO4 (s) + 2HNO3 (aq)Sr(NO3)2(aq) + H2SO4(aq) = SrSO4(s) + 2HNO3(aq)
SnO2 + C = Sn + CO SnO2 + 2C = Sn + 2CO
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S (s)+HNO3 (aq)=H2SO4 (aq)+H2O (l)+NO2 (g)=S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO2 + NaClO + H2O = H2SO4 + NaCl SO2 + NaClO + H2O = H2SO4 + NaCl
SO2 + HI = I2 + S + H2O SO2 + 4HI = 2I2 + S + 2H2O
S8 + O2+ H2O= H2SO4S8 + 12O2 + 8H2O = 8H2SO4
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2O Sb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SrCl2*6H2O + FeCl3 + NaOH = SrFe12O19 + Cl2 + NaCl + H2OSrCl2*6H2O + 12FeCl3 + 38NaOH = SrFe12O19 + 0Cl2 + 38NaCl + 25H2O
SnS2+HCl=H2SnCl6+H2SSnS2 + 6HCl = H2SnCl6 + 2H2S
S6+O2=SO2S6 + 6O2 = 6SO2
Sn + HNO3 = SnO2 + N2O + H2O2Sn + 2HNO3 = 2SnO2 + N2O + H2O
S8+O2+H2O = H2SO4S8 + 12O2 + 8H2O = 8H2SO4
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2(g)+HNO3(aq)+H2O(l)=H2SO4(aq)+NO(g)3SO2(g) + 2HNO3(aq) + 2H2O(l) = 3H2SO4(aq) + 2NO(g)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
Sr(s) + O2(g) =SrO(s)2Sr(s) + O2(g) = 2SrO(s)
Sr(s) + Br2(l) = SrBr2(s)Sr(s) + Br2(l) = SrBr2(s)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S(s)+HNO3(aq)=H2SO4(aq)+H2O(l)+NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C= SiC + CO SiO2 + 3C = SiC + 2CO
SiO2 + C= SiC + CO SiO2 + 3C = SiC + 2CO
SO-2+S=SO-2SO-2 + 0S = SO-2
S0-2+S=S0-2S0-2 + 0S = S0-2
Sb2O3+C4H6O6=Sb2(C4H4O6)3+H2OSb2O3 + 3C4H6O6 = Sb2(C4H4O6)3 + 3H2O
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sr(s) + O2(g) = SrO(s)2Sr(s) + O2(g) = 2SrO(s)
SO3 + Ba(OH)2 = BaSO4 + H2OSO3 + Ba(OH)2 = BaSO4 + H2O
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SiO2(s)+ 6 C(s) = SiC(s)+ CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SnO2 + CO= Sn + CO2SnO2 + 2CO = Sn + 2CO2
SnO2 + CO= Sn + CO2SnO2 + 2CO = Sn + 2CO2
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sb2S3 + HNO3 = Sb(NO3)3 + H2SSb2S3 + 6HNO3 = 2Sb(NO3)3 + 3H2S
Sb2S3 + HNO3 = Sb(NO3)3 + H2SSb2S3 + 6HNO3 = 2Sb(NO3)3 + 3H2S
Sb2S3 + O2 = Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g) 2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2+ O2=SO32SO2 + O2 = 2SO3
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
S8 +Cl2=SCl6S8 + 24Cl2 = 8SCl6
Sb + HNO3 + H2O = H3SbO4 + NO3Sb + 5HNO3 + 2H2O = 3H3SbO4 + 5NO
Sn+HNO3=SnO2+NO2+H2Sn + 2HNO3 = SnO2 + 2NO2 + H2
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sr+Se=SrSeSr + Se = SrSe
Si+NaOH=Na4SiO4+H2Si + 4NaOH = Na4SiO4 + 2H2
SrO(s) + Al(s) = Sr(s) + Al2O3(s)3SrO(s) + 2Al(s) = 3Sr(s) + Al2O3(s)
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO4+Co=CoSO4SO4 + Co = CoSO4
SnCl2+HNO3+HCl=SnCl4+N2O+H2O4SnCl2 + 2HNO3 + 8HCl = 4SnCl4 + N2O + 5H2O
SnCl2+HNO3+HCl=SnCl4+N2O+H2O4SnCl2 + 2HNO3 + 8HCl = 4SnCl4 + N2O + 5H2O
SiH4 + F2 = SiF4 + HFSiH4 + 4F2 = SiF4 + 4HF
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + HNO3 = H2SO4 + NO2SO2 + 2HNO3 = H2SO4 + 2NO2
Sr + Cu3P =Sr3P2 + Cu3Sr + 2Cu3P = Sr3P2 + 6Cu
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+CuSO4=SnSO4+CuSn + CuSO4 = SnSO4 + Cu
Si +NaOH = Na4SiO4 + H2Si + 4NaOH = Na4SiO4 + 2H2
Si +NaOH = Na4SiO4 + H2Si + 4NaOH = Na4SiO4 + 2H2
Si +NaOH = Na4SiO4 + H2Si + 4NaOH = Na4SiO4 + 2H2
SnO2+NF3=SnF4+N2O33SnO2 + 4NF3 = 3SnF4 + 2N2O3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO2+O2=SO2SO2 + 0O2 = SO2
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr+O2=2SrO2Sr + O2 = 2SrO
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb+ O2=Sb2O34Sb + 3O2 = 2Sb2O3
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
Sr(OH)2*8H2O + NH4Cl = H2O + NH3 + SrCl2Sr(OH)2*8H2O + 2NH4Cl = 10H2O + 2NH3 + SrCl2
Sr(NO3)2+2KIO3=2KNO3+Sr(IO3)2Sr(NO3)2 + 2KIO3 = 2KNO3 + Sr(IO3)2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn+HNO3+H2O=H4SnO3+NO3Sn + 2HNO3 + 5H2O = 3H4SnO3 + 2NO
SnO2(s) + H2(g) = Sn(s) + H2O(g)SnO2(s) + 2H2(g) = Sn(s) + 2H2O(g)
SnO2(s) + H2(g) = Sn(s) + H2O(g)SnO2(s) + 2H2(g) = Sn(s) + 2H2O(g)
SO3 + 2H2O= H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SiCl4+Mg(s)=Si(s)+MgCl2(s)SiCl4 + 2Mg(s) = Si(s) + 2MgCl2(s)
Sr+Se= SrSeSr + Se = SrSe
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S2O3-- + O2 + H2O = SO4-- + H+S2O3-- + 2O2 + H2O = 2SO4-- + 2H+
SiO2+NaOH=Na2SiO3+H2OSiO2 + 2NaOH = Na2SiO3 + H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(NO3)2 + LiL = SrL2 + LiNO3Sr(NO3)2 + 2LiL = SrL2 + 2LiNO3
SrCl2+Li2SO4=2LiCl+SrSO4SrCl2 + Li2SO4 = 2LiCl + SrSO4
SrO+CO2=SrCO3SrO + CO2 = SrCO3
SiO2 + HNO3 = Si(NO3)4 + H2OSiO2 + 4HNO3 = Si(NO3)4 + 2H2O
SiO2+Al=Si+Al2O33SiO2 + 4Al = 3Si + 2Al2O3
S+O2=SO32S + 3O2 = 2SO3
Sr(NO3)2+2LiI=SrI2+2LiNO3Sr(NO3)2 + 2LiI = SrI2 + 2LiNO3
SnF2+Na3PO4=SnPO4+Na3F2SnF2 + Na3PO4 = SnPO4 + Na3F2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SbCl5 + 2KI = SbCl3 + 2KCl + I2SbCl5 + 2KI = SbCl3 + 2KCl + I2
SO2 + O2 + CaCO3 = CaSO4 + CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
Sn + HN3 + H2O = H2SnO3 + NO-7Sn + 4HN3 - 9H2O = -7H2SnO3 + 12NO
Si + F2 = SiF4Si + 2F2 = SiF4
SO2 + O2= SO32SO2 + O2 = 2SO3
SnCl2 + 2Cl = SnCl4SnCl2 + 2Cl = SnCl4
SnCl2 + Cl = SnCl4SnCl2 + 2Cl = SnCl4
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sr(NO3)2 + 2 LiI = SrI2 + 2 LiNO3Sr(NO3)2 + 2LiI = SrI2 + 2LiNO3
Si + NaOH = Na4SiO4 + H2Si + 4NaOH = Na4SiO4 + 2H2
Sr(NO3)2 + LiI = SrI2 + LiNO3Sr(NO3)2 + 2LiI = SrI2 + 2LiNO3
SO2 + O2 + 4 H2O = 2 H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn+HNO3 = SnO2 + NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sc2O3 + Br2 = ScBr3 +O22Sc2O3 + 6Br2 = 4ScBr3 + 3O2
Sr(NO3)2(aq) + Li2SO4(aq) = SrSO4(s) + 2 LiNO3(aq) Sr(NO3)2(aq) + Li2SO4(aq) = SrSO4(s) + 2LiNO3(aq)
Sb+O2=Sb2O54Sb + 5O2 = 2Sb2O5
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S2 + CO = SO2 + CS2 + 4CO = 2SO2 + 4C
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3=S+O22SO3 = 2S + 3O2
Sr(NO3)2 + LiI = SrI2 + LiNO3Sr(NO3)2 + 2LiI = SrI2 + 2LiNO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + H2O + O2=H2SO4 2SO2 + 2H2O + O2 = 2H2SO4
Sr(NO3)2 + LiL = SrL2 + LiNO3Sr(NO3)2 + 2LiL = SrL2 + 2LiNO3
SO3+H2O =H2SO4SO3 + H2O = H2SO4
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+Na2CO3=Na4SiO4+CO2SiO2 + 2Na2CO3 = Na4SiO4 + 2CO2
Si + HF = H2 + SiF4Si + 4HF = 2H2 + SiF4
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn + HNO3 = Sn(NO3)4 + NO2 + H2OSn + 8HNO3 = Sn(NO3)4 + 4NO2 + 4H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sr+H2O=SrH2OSr + H2O = SrH2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SrCl2 + Fe2(SO4)3 = SrSO4 + FeCl33SrCl2 + Fe2(SO4)3 = 3SrSO4 + 2FeCl3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + H2O = H2SO3 SO2 + H2O = H2SO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S(s)+O2(g)+H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
SO3 + HOCl= SO4 + Cl + HSO3 + HOCl = SO4 + Cl + H
SO2+O2=SO32SO2 + O2 = 2SO3
SrCl2+FeCl3= FeCl2+SrCl3SrCl2 + FeCl3 = FeCl2 + SrCl3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S(s) + HNO3(aq) = SO3(g) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = SO3(g) + 3H2O(l) + 6NO2(g)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+ O2 =SO32SO2 + O2 = 2SO3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2+H2O=H2SO4S8 + 12O2 + 8H2O = 8H2SO4
S + O2 = SO2S + O2 = SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S + KClO3 = SKCl + O22S + 2KClO3 = 2SKCl + 3O2
SO2+O2=SO32SO2 + O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
SO2+O2= SO32SO2 + O2 = 2SO3
SO2 + H2O = SO3 + H2SO2 + H2O = SO3 + H2
SO2 + H2O = SO3 + H2SO2 + H2O = SO3 + H2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn(NO3)2 + HCl = SnCl2 + HNO3Sn(NO3)2 + 2HCl = SnCl2 + 2HNO3
S8 + O = S3O3S8 + 8O = 8S3O
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O 2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
Si2H6 + O2 = SiO2 + H2O2Si2H6 + 7O2 = 4SiO2 + 6H2O
Sn+H2SO4=Sn(SO4)2+SO2+H2OSn + 4H2SO4 = Sn(SO4)2 + 2SO2 + 4H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S-- + NO3- + H+ = S + NO + H2O3S-- + 2NO3- + 8H+ = 3S + 2NO + 4H2O
S-- + NO3- + H+ = SO4-- + NO2 + H2OS-- + 8NO3- + 8H+ = SO4-- + 8NO2 + 4H2O
S + H2SO4 = SO2 + H2O S + 2H2SO4 = 3SO2 + 2H2O
S+H2SO4=SO2+H2O S + 2H2SO4 = 3SO2 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
SO4 + H2O = H2S + O22SO4 + 2H2O = 2H2S + 5O2
S2O3-- + I2 = S4O6-- +2I-2S2O3-- + I2 = S4O6-- + 2I-
Sc2(CO3)3 = Sc2O3 + CO2Sc2(CO3)3 = Sc2O3 + 3CO2
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SnCl4 + NaOH = NaCl + Sn(OH) 4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SnCl4 + NaOH = NaCl + Sn (OH) 4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SnCl 4 + NaOH = NaCl + Sn(OH)4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SO3 + Al (OH)3 = Al2 (SO4)3 + H2O3SO3 + 2Al(OH)3 = Al2(SO4)3 + 3H2O
S+HNO3=NO2+H2SO4+H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
Sb2(SO4)3+KMnO4+H2O= H3SbO4+K2SO4+MnSO4+H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
S2H + Cl2 = HCl + S2S2H + Cl2 = 2HCl + 4S
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = SO2
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
Sb + HNO3 =Sb4O10 + NO2 + H2O4Sb + 20HNO3 = Sb4O10 + 20NO2 + 10H2O
SO3+ H2O = H2SO4SO3 + H2O = H2SO4
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn + H+= Sn++ + H2Sn + 2H+ = Sn++ + H2
Sn + H+= Sn++ + H2Sn + 2H+ = Sn++ + H2
Sn + H+ = Sn2++ H24Sn + 2H+ = 2Sn2+ + H2
S8+Fe=Fe2S33S8 + 16Fe = 8Fe2S3
Si(s) +Cl2(g) = SiCl4(l)Si(s) + 2Cl2(g) = SiCl4(l)
S2Cl2 + H2SO4 = SO4 + H2O+ HClS2Cl2 - 7H2SO4 = -5SO4 - 8H2O + 2HCl
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sn(NO3)2 + Fe(NO3)3 = Sn(NO3)4 + Fe(NO3)2 Sn(NO3)2 + 2Fe(NO3)3 = Sn(NO3)4 + 2Fe(NO3)2
Sn(s) + NaOH(aq) = Na2SnO2(aq) + H2(g)Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S2Fe+O2=SO2+Fe2O34S2Fe + 11O2 = 8SO2 + 2Fe2O3
Sn+HNO3+H2O = H2SnO3+NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
Sn+HNO3+H20 = H2SnO3+NO40Sn + 60HNO3 + H20 = 40H2SnO3 + 60NO
Sb + O2 (g) = Sb2O5 (s)4Sb + 5O2(g) = 2Sb2O5(s)
S8+F2=SF6S8 + 24F2 = 8SF6
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn+O2=SnO2Sn + O2 = 2SnO
S+Fe = FeSS + Fe = FeS
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l) SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sr + O2 = SrO2Sr + O2 = SrO2
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq) SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Si4H10(l) + O2(g) = SiO2(s) + H2O(l) 2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sb2S3 (s)+12HCl (aq)=2H3SbCl6 (s)+3H2S (g)Sb2S3(s) + 12HCl(aq) = 2H3SbCl6(s) + 3H2S(g)
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
S+2F2=SF4S + 2F2 = SF4
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+NO2=SO3+NOSO2 + NO2 = SO3 + NO
Sb2S3+HNO3=NO2+H2SO4+Sb2O5+H2OSb2S3 + 28HNO3 = 28NO2 + 3H2SO4 + Sb2O5 + 11H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+H2O= SO2 +H2S + 2H2O = SO2 + 2H2
SnSO4+Ba(NO3)2=Sn(NO3)2+BaSO4SnSO4 + Ba(NO3)2 = Sn(NO3)2 + BaSO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SO2+ 3Zn + 6H+ = S2- + 2H2O + 3Zn0SO2 + Zn + 0H+ = 0S2- + 0H2O + Zn
SO2 + NaHCO3 = NaSO4 + Na2CO3 + H2O + CO20SO2 + 2NaHCO3 = 0NaSO4 + Na2CO3 + H2O + CO2
SO2 + NaHCO3 = NaSO4 + Na2CO3 + H2O + CO20SO2 + 2NaHCO3 = 0NaSO4 + Na2CO3 + H2O + CO2
S+Cu+AgNO3=Ag+CuSO4+N3S + 3Cu + 4AgNO3 = 4Ag + 3CuSO4 + 4N
Sc2O3 = Sc3 + O26Sc2O3 = 4Sc3 + 9O2
Sn+H2SO4=Sn(SO4)2+SO2+H2O Sn + 4H2SO4 = Sn(SO4)2 + 2SO2 + 4H2O
Sn(s) + 2 NaOH(aq) = Na2SnO2(aq) + H2(g) Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
SiO2+H2F2 = SiF4+H2OSiO2 + 2H2F2 = SiF4 + 2H2O
SiO2+4HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn(s) + 3 Ag+= 2 Ag(s) + Sn2+2Sn(s) + Ag+ = Ag(s) + Sn2+
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S8+O2 = SO3S8 + 12O2 = 8SO3
SO2+H2O+KMnO4 = MnSO4+K2SO4+H2SO45SO2 + 2H2O + 2KMnO4 = 2MnSO4 + K2SO4 + 2H2SO4
SO2+H2O+KMnO4 = MnSO4+K2SO4+H2SO45SO2 + 2H2O + 2KMnO4 = 2MnSO4 + K2SO4 + 2H2SO4
S+ Mg = SMgS + Mg = SMg
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SnCl4 + Fe = SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
SiCl4 = Si + Cl2 SiCl4 = Si + 2Cl2
SO2+ 2 H2S = 3S + 2H2OSO2 + 2H2S = 3S + 2H2O
SO2+H2O+O2=H2SO3SO2 + H2O + 0O2 = H2SO3
SB2S3 + O2 = SBO2 SO2SB2S3 + 4O2 = 2SBO2SO2
SiH5+O2=H2O+SiO24SiH5 + 9O2 = 10H2O + 4SiO2
S + HNO3 + H2O = H2SO4 + NOS + 2HNO3 + 0H2O = H2SO4 + 2NO
S+ Na2SiO4 + (CH3COO)2Zn = (CH3COO)2Na + ZnS + Zn2SiO40S + Na2SiO4 + 2(CH3COO)2Zn = 2(CH3COO)2Na + 0ZnS + Zn2SiO4
S2Fe + O2 = Fe2O3 + SO24S2Fe + 11O2 = 2Fe2O3 + 8SO2
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sc(CO3) = ScO + CO2Sc(CO3) = ScO + CO2
Sc(NO3) + Ca(CO3)2 = Ca(NO3) + Sc(CO3)2Sc(NO3) + Ca(CO3)2 = Ca(NO3) + Sc(CO3)2
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+Cu=CuSS + Cu = CuS
S+Hg=HgSS + Hg = HgS
S+O2=SO2S + O2 = SO2
SiO2+4HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+2H2O=SiO2+2HClSiCl4 + 2H2O = SiO2 + 4HCl
SiCl4+2H2O=SiO2+4HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn(NO3)2 (aq) + HCl (aq) = SnCl2 (s) + HNO3 (aq)Sn(NO3)2(aq) + 2HCl(aq) = SnCl2(s) + 2HNO3(aq)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
Sc2O3(s)+H2O(l)=Sc(OH)3(s)Sc2O3(s) + 3H2O(l) = 2Sc(OH)3(s)
SO2+O2=2SO32SO2 + O2 = 2SO3
SiF4 + H2O + KCl = Si(OH)4 + K2SiF6 + HCl3SiF4 + 4H2O + 4KCl = Si(OH)4 + 2K2SiF6 + 4HCl
SO2=SO3+O2-2SO2 = -2SO3 + O2
SiF4 + H2O + KCl = Si(OH)4 + K2SiF6 + HCl3SiF4 + 4H2O + 4KCl = Si(OH)4 + 2K2SiF6 + 4HCl
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
S + NaOH = Na2O + Na2S2O3 + H2O0S + 2NaOH = Na2O + 0Na2S2O3 + H2O
SiO2+HBr=SiBr4+H2OSiO2 + 4HBr = SiBr4 + 2H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Si2H3+ O2 = SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S+O2=SO32S + 3O2 = 2SO3
S+FE=FESS + FE = FES
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb + HNO3 = Sb2O3 +NO + H2O2Sb + 2HNO3 = Sb2O3 + 2NO + H2O
SO3(g)+H2O(g)=H2SO4(aq)SO3(g) + H2O(g) = H2SO4(aq)
SO3(g)+H2O(g)=H2SO4(aq)SO3(g) + H2O(g) = H2SO4(aq)
SO2 + O2 =SO3 2SO2 + O2 = 2SO3
SiO2 (s) + 3C (s) = SiC (s) + 2CO (g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO2+H2O=H2SO4+H2O0SO2 + H2O = 0H2SO4 + H2O
SO2+H2O=H2SO4+H2O0SO2 + H2O = 0H2SO4 + H2O
Sr+F2=Sr2F4Sr + F2 = 2Sr2F
SO2 (g)+O2 (g)=SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2+2NF3+2NH3 = (NH4)2SiF(s)+2N2+2H2O6SiO2 + 2NF3 + 24NH3 = 6(NH4)2SiF(s) + 7N2 + 12H2O
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
S2- + MnO4- + 8H+ = Mn2+ + 4H2O + S13S2- + 2MnO4- + 16H+ = Mn2+ + 8H2O + 26S
SO2+2O2=SO32SO2 + O2 = 2SO3
SNO2+C=CO+SNSNO2 + 2C = 2CO + SN
SiO2 + HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
S8+12O2=8SO3S8 + 12O2 = 8SO3
Si+O2=SiO2Si + O2 = SiO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sr(NO3)2+Al(NO3)3*9H2O+(NH2)2CO = SrAl2O4+H2O+CO2+N23Sr(NO3)2 + 6Al(NO3)3*9H2O + 20(NH2)2CO = 3SrAl2O4 + 94H2O + 20CO2 + 32N2
SrCO3+Al(NO3)3*9H2O+(NH2)2CO = SrAl2O4+H2O+CO2+N2SrCO3 + 2Al(NO3)3*9H2O + 5(NH2)2CO = SrAl2O4 + 28H2O + 6CO2 + 8N2
SO2 + KMgO4 + H2SO4 = KSO4 + H2O + MgSO42SO2 + KMgO4 + 0H2SO4 = KSO4 + 0H2O + MgSO4
SO2 + KMnO4 + H2SO4 = KSO4 + H2O + MnSO42SO2 + KMnO4 + 0H2SO4 = KSO4 + 0H2O + MnSO4
Sr+P4=Sr3P26Sr + P4 = 2Sr3P2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(NO3)2 + SO3 = SrSO3 + 2NO3Sr(NO3)2 + SO3 = SrSO3 + 2NO3
S+O2=SO2S + O2 = 2SO
S2- + MnO4- + 8H+ = Mn2+ + 4H2O + S13S2- + 2MnO4- + 16H+ = Mn2+ + 8H2O + 26S
SO32- + MnO4- + H+ = Mn2+ + H2O + SO4213SO32- + 42MnO4- + 76H+ = 21Mn2+ + 38H2O + 13SO42
S2O32- + MnO4- + H+ = Mn2+ + 2H2O + 2SO42-13S2O32- + 206MnO4- + 296H+ = 103Mn2+ + 148H2O + 26SO42-
SO3=SO2+O22SO3 = 2SO2 + O2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SO2+H2S=S2+H2O2SO2 + 4H2S = 3S2 + 4H2O
SO3=SO2+O22SO3 = 2SO2 + O2
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
S8+O2=SO3S8 + 12O2 = 8SO3
Sn +HCl2=SnCl2+HSn + HCl2 = SnCl2 + H
Sn +HCl2=SnCl2+HSn + HCl2 = SnCl2 + H
Sn +HCl2=SnCl2+HSn + HCl2 = SnCl2 + H
Sb2S3 + HO = 2HSbO4 + 3S + OH2Sb2S3 + 14HO = 2HSbO4 + 3S + 6OH2
Sb2S3 + H2O = 2HSbO4 + 3S + OH-1Sb2S3 + 6H2O = -2HSbO4 - 3S + 14OH
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2+SO2Sb2S3 + 3O2 = Sb2 + 3SO2
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb2S3 + O2 = Sb2O4 + SO2Sb2S3 + 5O2 = Sb2O4 + 3SO2
Sb2S3 + O2 = Sb2O4 + SO4Sb2S3 + 8O2 = Sb2O4 + 3SO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3 + H2O= H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S2O3-- + H3O+ = SO2 + S2 + H2O2S2O3-- + 4H3O+ = 2SO2 + S2 + 6H2O
S2O32- + H3O+ = SO2 + S2 + H2O8S2O32- + 8H3O+ = 126SO2 - 55S2 + 12H2O
SO3 = SO2 + O22SO3 = 2SO2 + O2
Si + KOH + H2O = SiO2(KOH) + H2Si + KOH + 2H2O = SiO2(KOH) + 2H2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2(s)+C(s)=Si(s)+CO(g)SiO2(s) + 2C(s) = Si(s) + 2CO(g)
S8 + F2=SF6S8 + 24F2 = 8SF6
Sr + H2S2O3 = HSr + S2O32Sr + H2S2O3 = 2HSr + S2O3
Sb+H2O=Sb3O3+H23Sb + 3H2O = Sb3O3 + 3H2
SO2(g) + NaOH(s) = Na2SO3(s) + H2O(l)SO2(g) + 2NaOH(s) = Na2SO3(s) + H2O(l)
SiO2 +C=SiC + COSiO2 + 3C = SiC + 2CO
SiH3 + O2 = SiO2 + H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
SnCl2+K2Cr2O7+H2SO4=Sn(SO4)2+CrCl3+K2SO4+H2O3SnCl2 + K2Cr2O7 + 7H2SO4 = 3Sn(SO4)2 + 2CrCl3 + K2SO4 + 7H2O
SO42- + NH3 = SO32- +H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO2 + H2O + O2 = H2SO3SO2 + H2O + 0O2 = H2SO3
SiO2+4C=SiC+2COSiO2 + 3C = SiC + 2CO
SrSe(s) + 2 HBr(aq) = SrBr2(aq) + H2Se(g)SrSe(s) + 2HBr(aq) = SrBr2(aq) + H2Se(g)
S8+O2=SO2S8 + 8O2 = 8SO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SiC+Cl2 =SiCl4+CSiC + 2Cl2 = SiCl4 + C
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2 + KOH = KHSO3SO2 + KOH = KHSO3
SO2 + KOH = KHSO3SO2 + KOH = KHSO3
SO42- + NH3 = SO32- + H2O +N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO4 -2 +NH3 = SO3 -2 +H2O + N23SO4-2 + 2NH3 = 3SO3-2 + 3H2O + N2
SiO2 + 2C = Si + 2COSiO2 + 2C = Si + 2CO
Si + O2 = SiO2Si + O2 = SiO2
S-- + NO3- + H+ = N2O + S + H2O4S-- + 2NO3- + 10H+ = N2O + 4S + 5H2O
S2- + NO3- + H+ = N2O + S + H2O8S2- + 2NO3- + 10H+ = N2O + 16S + 5H2O
SCl2 + NaF + Cl2 = SF4 + NaClSCl2 + 4NaF + Cl2 = SF4 + 4NaCl
SCl2 + NaF + Cl2 = SF4 + NaClSCl2 + 4NaF + Cl2 = SF4 + 4NaCl
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S + H2SO4 = 3SO2 + 2H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4(l)+H2O(l) = SiO2(s)+HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + H2SO4 = SnSO4 + SO2 + H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
Sn + H2SO4 = SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S + O2 = SO32S + 3O2 = 2SO3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.