Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiF4(g) + H2O(l) = H2SiF6(aq) + H2SiO3(s)3SiF4(g) + 3H2O(l) = 2H2SiF6(aq) + H2SiO3(s)
Sr(s) + P4(s) =Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SN+HNO3+H2O=H2SNO3+NO3SN + 4HNO3 + H2O = 3H2SNO3 + 4NO
SiCl4 + O2 = SiO2 + Cl2SiCl4 + O2 = SiO2 + 2Cl2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + 2CO2SiO2 + C = Si + CO2
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO3 + KOH = K2SO4 + H2OSO3 + 2KOH = K2SO4 + H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SF4 + 2F2 = SF6SF4 + F2 = SF6
Sn+HNO3+H2O=H2SnO3+NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
Sn + 4 HNO3 = SnO2 + 4 NO2 + 2 H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn(s) + HNO3(aq) = SnO2H2O(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2H2O(s) + 4NO2(g) + H2O(l)
Sn(s) + HNO3(aq) = SnO2H2O(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2H2O(s) + 4NO2(g) + H2O(l)
Sn(OH)2+ 2H= Sn+ 2H2OSn(OH)2 + 2H = Sn + 2H2O
SbCl3 + Na2S = Sb2S3 + NaCl2SbCl3 + 3Na2S = Sb2S3 + 6NaCl
Sc2O3(s)+SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sn+HNO3+H2O=H2SnO3+NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
S+ 6HCl= H2+SCl2S + 2HCl = H2 + 2SCl
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr + O2=2SrO2Sr + O2 = 2SrO
SnCl3 + KCl + CrCl3 + H2O = SnCl2 + HCl + K2Cr2O76SnCl3 + 2KCl + 2CrCl3 + 7H2O = 6SnCl2 + 14HCl + K2Cr2O7
S8 + NO3- + H+ = S4O6-- + NO2 + H2OS8 + 20NO3- + 16H+ = 2S4O6-- + 20NO2 + 8H2O
S+HNO3=H2SO4+NO2+12H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 =2SrO2Sr + O2 = 2SrO
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Sr(OH)2 + Fe(NO3)3 = Fe(OH)3 + Sr(NO3)23Sr(OH)2 + 2Fe(NO3)3 = 2Fe(OH)3 + 3Sr(NO3)2
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S8(s) + 8O2(g) =8SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SrCl2+Li3(PO4)=Sr3(PO4)2+LiCl3SrCl2 + 2Li3(PO4) = Sr3(PO4)2 + 6LiCl
S8 + 12 O2 = 8 SO3S8 + 12O2 = 8SO3
S8 + 12 O2 = 8 SO3S8 + 12O2 = 8SO3
SnS+NF3=SnF2+N2S33SnS + 2NF3 = 3SnF2 + N2S3
S8+BaO=BaS+O2S8 + 8BaO = 8BaS + 4O2
SrCl2+Li3(PO4)=Sr3(PO4)2+LiCl3SrCl2 + 2Li3(PO4) = Sr3(PO4)2 + 6LiCl
SiCl4(s) + H2O(g) = SiO2(s) + HCl(g)SiCl4(s) + 2H2O(g) = SiO2(s) + 4HCl(g)
Sb2(SO4)3 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2(g)+O2(g)= SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8+O2= SO3S8 + 12O2 = 8SO3
Sb2(SO4)3 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SO2 + 2Li2Se = SSe2 + 2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
SnCl2 +Co = SnCo +ClSnCl2 + Co = SnCo + 2Cl
Sn(s) + HNO3(aq) = SnO2(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SrS (aq) + CuSO4 (aq) = SrSO4 (s) + CuS (s)SrS(aq) + CuSO4(aq) = SrSO4(s) + CuS(s)
SrS (s) + CuSO4 (aq) = SrSO4 (s) + CuS (s)SrS(s) + CuSO4(aq) = SrSO4(s) + CuS(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2= SO2S8 + 8O2 = 8SO2
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S + SO3 = SO30S + SO3 = SO3
S + SO3 = SO30S + SO3 = SO3
S + O2 = SO2S + O2 = SO2
SO2 + O = SO3SO2 + O = SO3
SO2 + O = SO3SO2 + O = SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiO2(s)+HF(aq)=SiF4(g)+H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sn + HNO3 = SnO + NO2 + H2OSn + 2HNO3 = SnO + 2NO2 + H2O
SiCl4(l)+H2O(l)=SiO2(s)+HCl(aq) SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SiO2 + 4 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
S2Cl2 + NH3 = N4S4 + NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
SO2+Br2+H2O=HBr4+H2SO4SO2 + 4Br2 + 2H2O = 2HBr4 + H2SO4
SO2+Br2+H2O=HBr4+H2SO4SO2 + 4Br2 + 2H2O = 2HBr4 + H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SnCl2+HNO3+HCl=SnCl4+N2O+H2O4SnCl2 + 2HNO3 + 8HCl = 4SnCl4 + N2O + 5H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 + H2O = H2 + SO4SO3 + H2O = H2 + SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr + HNO3 = Sr(NO3)3 + NO2 + H2OSr + 6HNO3 = Sr(NO3)3 + 3NO2 + 3H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sn3P2 + NaF = SnF2 + Na3PSn3P2 + 6NaF = 3SnF2 + 2Na3P
Sb2S3 + (H)+ + (NO3)- = Sb2S5 + (HSO4)- + NO-1Sb2S3 + 2(H)+ + 4(NO3)- = -1Sb2S5 + 2(HSO4)- + 4NO
Sb2S3 + (H)+ + (NO3)- = Sb2S5 + (HSO4)- + NO-1Sb2S3 + 2(H)+ + 4(NO3)- = -1Sb2S5 + 2(HSO4)- + 4NO
Sr(OH)2+LiNO3=SrNO3+Li (OH)2Sr(OH)2 + LiNO3 = SrNO3 + Li(OH)2
S+O2=SO32S + 3O2 = 2SO3
SO2 + H2O = H2SO3 SO2 + H2O = H2SO3
Sb2S3 + H+ + NO3- = Sb2S2 + HSO4- + NOSb2S3 + H+ + 2NO3- = Sb2S2 + HSO4- + 2NO
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Si+S8=Si2S44Si + S8 = 2Si2S4
Sb2S3 + H+ + NO3- = Sb2S5 + HSO4- + NO-1Sb2S3 + 2H+ + 4NO3- = -1Sb2S5 + 2HSO4- + 4NO
Sb2S3 + H+ + NO3- = Sb2S5 + HSO4- + NO-1Sb2S3 + 2H+ + 4NO3- = -1Sb2S5 + 2HSO4- + 4NO
SO4+CH2O=H2S+CO2+H2O2SO4 + 5CH2O = 2H2S + 5CO2 + 3H2O
Sr(OH)2+HBr=SrBr2+H2OSr(OH)2 + 2HBr = SrBr2 + 2H2O
SH2+Br=S+BrHSH2 + 2Br = S + 2BrH
Sn + HNO3 =SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sb2S3 + HNO3 + H2O = H2SO4 + H3SbO4 + NO3Sb2S3 + 28HNO3 + 4H2O = 9H2SO4 + 6H3SbO4 + 28NO
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S(s) + NaCl (aq) = Na2S (aq) + Cl2 (g)S(s) + 2NaCl(aq) = Na2S(aq) + Cl2(g)
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6+O2=SeO2+3Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+3Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+3Cl2SeCl6 + O2 = SeO2 + 3Cl2
SiCl4 + H2O= H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2+O=SO3SO2 + O = SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr + Cl2 = SrCl2Sr + Cl2 = SrCl2
S8 + 8O2=8SOS8 + 4O2 = 8SO
Sn+2HBr=SnBr+H22Sn + 2HBr = 2SnBr + H2
Sn+2HBr=BrSn+H22Sn + 2HBr = 2BrSn + H2
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2+C=CO+SnSnO2 + 2C = 2CO + Sn
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO4 + NaOH = NaSO4 + OHSO4 + NaOH = NaSO4 + OH
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S + O2 + H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
S + O2+ H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
SO2+O2+4H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + N2O = SO3 + N2SO2 + N2O = SO3 + N2
S8(s) + O2(g) = 8SO2S8(s) + 8O2(g) = 8SO2
S8(s) + O2(g) = 8SO2S8(s) + 8O2(g) = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2 + HNO3 = Sn(NO3)4 + H2O SnO2 + 4HNO3 = Sn(NO3)4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2 + C = SiC + CO SiO2 + 3C = SiC + 2CO
SO4 2- + NH3=SO3 2- +H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
Sr + O2= 2SrO2Sr + O2 = 2SrO
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S+O2= SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S+ HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2+2Mg=2MgO+SiSiO2 + 2Mg = 2MgO + Si
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+K2Cr2O7+H2O=SO2+Cr2O3+KOH3S + 2K2Cr2O7 + 2H2O = 3SO2 + 2Cr2O3 + 4KOH
SO2 + O = SO3SO2 + O = SO3
SO2 + O= SO3SO2 + O = SO3
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnO2+HNO3=Sn(NO3)4+H2OSnO2 + 4HNO3 = Sn(NO3)4 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn + HCl = SnCl2 +H2Sn + 2HCl = SnCl2 + H2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S8 + 8O2 = 8SO2S8 + 8O2 = 8SO2
SiCl4 + H2O = H2SiO3 + HClSiCl4 + 3H2O = H2SiO3 + 4HCl
SiCl4+H2O=H2SiO3+HClSiCl4 + 3H2O = H2SiO3 + 4HCl
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiO2(s) + C(s) =Si(s) + CO(g)SiO2(s) + 2C(s) = Si(s) + 2CO(g)
Sn(NO3)2(Aq)+HCl(Aq)=SnCl2+HNO3Sn(NO3)2(Aq) + 2HCl(Aq) = SnCl2 + 2HNO3
S + HNO3 =NO2 + H2O + H2SO4 S + 6HNO3 = 6NO2 + 2H2O + H2SO4
S + HNO3 = NO2 + H2O + H2SO4 S + 6HNO3 = 6NO2 + 2H2O + H2SO4
Sr(OH)2(aq) + H3PO4(aq) = Sr3 (PO4)2 + H2O(l)3Sr(OH)2(aq) + 2H3PO4(aq) = Sr3(PO4)2 + 6H2O(l)
S+H2SO4=SO2+H2010S + 10H2SO4 = 20SO2 + H20
S(s)+ HNO3 (aq)= SO3 (g) + H20 (l) +NO220S(s) + 60HNO3(aq) = 20SO3(g) + 3H20(l) + 60NO2
SiO2 + F = SiF4 + O2SiO2 + 4F = SiF4 + O2
Sb+I2=SbI32Sb + 3I2 = 2SbI3
Sn + HNO3=SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 =SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 =SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SF4 + 3 H2O = H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
Se+NO3= SeO2+NOSe + NO3 = SeO2 + NO
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
Sn + HNO3 = SnO2 + NO2 + 3H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
S2O7 + H2O = H2SO4 + O22S2O7 + 4H2O = 4H2SO4 + O2
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2= SO32SO2 + O2 = 2SO3
Sc2O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
S8+O2 = SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SnCl2+O3+HCl=SnCl4+H2O3SnCl2 + O3 + 6HCl = 3SnCl4 + 3H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3=SO2+O22SO3 = 2SO2 + O2
Sn + KOH = K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + C = SiC + 2COSiO2 + 3C = SiC + 2CO
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+LiOH=Li2SO4+Li2S+H2O4S + 8LiOH = Li2SO4 + 3Li2S + 4H2O
S(s)+KClO3(s)=SO2(g)+KCl(s)3S(s) + 2KClO3(s) = 3SO2(g) + 2KCl(s)
SO2+O2=SO2SO2 + 0O2 = SO2
SO2 + Br2 + 2H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
SnO2 + H2 =Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 =Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sb2S3+HNO3=H3SbO4+SO2+NO+H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
Sb2S3+HNO3=H3SbO4+SO2+NO+H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
SbS3+HNO3=H3SbO4+SO2+NO+H2O3SbS3 + 17HNO3 = 3H3SbO4 + 9SO2 + 17NO + 4H2O
SO3=SO2+O22SO3 = 2SO2 + O2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO3 2SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + H2SO4 = SO2 +H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
SiF4 +2NH3 + 2HF=(NH4)2SiF6SiF4 + 2NH3 + 2HF = (NH4)2SiF6
Sr+O2=2SrO2Sr + O2 = 2SrO
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO3+2NaOH=NaSO3 +2OHSO3 + NaOH = NaSO3 + OH
SO3+2NaOH=2NaSO3 +2OHSO3 + NaOH = NaSO3 + OH
SO3+2NaOH=2NaSO3 +OHSO3 + NaOH = NaSO3 + OH
SO2 + NO3- + H2O = SO4-- + N2O + H+4SO2 + 2NO3- + 3H2O = 4SO4-- + N2O + 6H+
SO2 + NO3 + H2O = SO4-- + N2O + H+5SO2 + 2NO3 + 5H2O = 5SO4-- + N2O + 10H+
SO2 + NO3 + H2O = SO4-- + N2O + H+5SO2 + 2NO3 + 5H2O = 5SO4-- + N2O + 10H+
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SrCl2 + KMnO + H3PO4 = Cl2 + Mn3(PO4)2 + Sr(PO4)2 + K3PO4 + H2O-1SrCl2 + 6KMnO + 4H3PO4 = -1Cl2 + 2Mn3(PO4)2 - Sr(PO4)2 + 2K3PO4 + 6H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8 +F2=SF4S8 + 16F2 = 8SF4
SO2+O2=SO32SO2 + O2 = 2SO3
SiH4+NH3=Si3N4+H23SiH4 + 4NH3 = Si3N4 + 12H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S=S88S = S8
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+H2+O=H2SO4S + H2 + 4O = H2SO4
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
Sb2O5=Sb5+O210Sb2O5 = 4Sb5 + 25O2
SO2 + Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+O2=O8S2S8 + 16O2 = 4O8S2
S8+O2=O8S2S8 + 16O2 = 4O8S2
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sr(NO3)2 (aq) + K2SO4 (aq) = SrSO4 (aq) + K2(NO3)2 (aq)Sr(NO3)2(aq) + K2SO4(aq) = SrSO4(aq) + K2(NO3)2(aq)
SO2+O2 = SO32SO2 + O2 = 2SO3
Sn(s) + 2 AgClO4(aq) = 2 Ag(s) + 2 Sn(ClO4)2(aq) Sn(s) + 2AgClO4(aq) = 2Ag(s) + Sn(ClO4)2(aq)
Sn(s) + 2 NaOH(aq) = Na2SnO2(aq) + 4 H2(g) Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
SF 4 (s) + 2H 2 O(l) = SO 2 (g) + 4HF(aq)SF4(s) + 2H2O(l) = SO2(g) + 4HF(aq)
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+MnO4=SO4+MnO22SO3 + MnO4 = 2SO4 + MnO2
SO3+MnO4=SO4+MnO22SO3 + MnO4 = 2SO4 + MnO2
S+6HNO3=H2SO4+6NO2+3H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn +2HBr = SnBr2 +H2Sn + 2HBr = SnBr2 + H2
SiO2 (l) + Al (l) = Al2O3 (s) + Si (l)3SiO2(l) + 4Al(l) = 2Al2O3(s) + 3Si(l)
SCl2 +NaF = SF4 + S2Cl2 +Na-1SCl2 + 4NaF = SF4 - S2Cl2 + 4Na
SCl2 +NaF = SF4 + S2Cl2=Na-1SCl2 + 4NaF = SF4 - S2Cl2 + 4Na
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
Sn(ClO3)2 + Na2CrO4 = SnCrO4 + Na(ClO3)Sn(ClO3)2 + Na2CrO4 = SnCrO4 + 2Na(ClO3)
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8 + Na2SO3 + H2O = Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2+O2=SO4SO2 + O2 = SO4
SeO2 + H2Se = Se + H2OSeO2 + 2H2Se = 3Se + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
Sr(NO3)2 + FeSO4 = SrSO4 + Fe(NO3)2Sr(NO3)2 + FeSO4 = SrSO4 + Fe(NO3)2
S2Cl2 + H2SO4 = SO2 + H2O + HClS2Cl2 + 3H2SO4 = 5SO2 + 2H2O + 2HCl
SO2+AL2O3=AL2(SO3)33SO2 + AL2O3 = AL2(SO3)3
S2O4+O2=SO4S2O4 + 2O2 = 2SO4
SeCl6+F2=SeF2+3Cl2SeCl6 + F2 = SeF2 + 3Cl2
SO2+O=SO3SO2 + O = SO3
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
Sn+ZnSO4=Zn+SnSO4Sn + ZnSO4 = Zn + SnSO4
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 (l) + Al (l) = Al2O3 (s) + Si (l)3SiO2(l) + 4Al(l) = 2Al2O3(s) + 3Si(l)
Sn+HCl+NO=SnCl2+NH2OH3Sn + 6HCl + 2NO = 3SnCl2 + 2NH2OH
SO4-2 = SO2 + O2 + 2eSO4-2 = SO2 + O2 + 2e
SO2+O2=SO32SO2 + O2 = 2SO3
Si + HNO3 + HF = H2O + NO + SiF43Si + 4HNO3 + 12HF = 8H2O + 4NO + 3SiF4
Si + HNO3 + HF = H2O + NO + SiF43Si + 4HNO3 + 12HF = 8H2O + 4NO + 3SiF4
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + Na = Na2SS + 2Na = Na2S
S8+Cl2=S2Cl2S8 + 4Cl2 = 4S2Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+C=CO+SiSiO2 + 2C = 2CO + Si
S8+O2=SO3S8 + 12O2 = 8SO3
Sr + SO2 = SrO + S2Sr + SO2 = 2SrO + S
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4+H2O=SiO2+4HClSiCl4 + 2H2O = SiO2 + 4HCl
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SnCl2 + K2Cr2O7 + HCl = CrCl3 + KCl + SnCl4 + H2O 3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
SbCl5 + KI = KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O 2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
S8+H2SO4=SO2+H2OS8 + 16H2SO4 = 24SO2 + 16H2O
S8 + 12O2=8SO3S8 + 12O2 = 8SO3
SiO2+HF=SiF4=H2OSiO2 + 4HF = SiF4 + 2H2O
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sr + O2 = SrO2Sr + O2 = 2SrO
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + O2 = OSF42SF4 + O2 = 2OSF4
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
SO2 = O2 = SO3 2SO2 = -1O2 + 2SO3
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
S + O2 = SO32S + 3O2 = 2SO3
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
S + Fe = SFeS + Fe = SFe
S8(s) + 4O2(g) = 8SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sn + HCl + K2Cr2O7 = SnCl4 + CrCl3+ KCl + H2O3Sn + 28HCl + 2K2Cr2O7 = 3SnCl4 + 4CrCl3 + 4KCl + 14H2O
SiCl4 + Na = NaCl + SiSiCl4 + 4Na = 4NaCl + Si
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2+H2S=S8+H2O8SO2 + 16H2S = 3S8 + 16H2O
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
SO+KMnO4+KO2H = K2SO4+MnO2+H2OSO + 0KMnO4 + 2KO2H = K2SO4 + 0MnO2 + H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
SO3 + H2O =H2SO4SO3 + H2O = H2SO4
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
SrO+HCl=HSr+ClOSrO + HCl = HSr + ClO
S + 6HNO3 = SO3 + 3H20 + 6NO220S + 60HNO3 = 20SO3 + 3H20 + 60NO2
Sn+HNO3=Sn(NO3)2+NH4NO3+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn+2HNO3=SnO2+2NO+H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
Sn+2HNO3=SnO2+2NO+H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SiO+C=SiC+COSiO + 2C = SiC + CO
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Sb2S3+Fe=3FeS+2SbSb2S3 + 3Fe = 3FeS + 2Sb
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
Sn+4HNO3=SnO2+4NO2+2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+4HNO3=SnO2+4NO2+2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+4HNO3=SnO2+4NO2+2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
SH2+O2=SO2+H2O2SH2 + 3O2 = 2SO2 + 2H2O
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sn + HCl = SnCl2 + H2Sn + 2HCl = SnCl2 + H2
Sb2S3 + HCl = SbCl3 +H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SiCl4(l) +Mg(s) =Si(s) +MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SO2 + KMnO4 + H2O = MnSO4 + K2SO4 + H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
Sr + H3PO4 = Sr3(PO4)2 + H23Sr + 2H3PO4 = Sr3(PO4)2 + 3H2
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + Cl = S2Cl2 S8 + 8Cl = 4S2Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 +O2 = SO32SO2 + O2 = 2SO3
SiCl4(l) + Mg(s) =Si(s) + MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SO2 (g)+NaOH (s)=Na2SO3 (s)+H2O (l)SO2(g) + 2NaOH(s) = Na2SO3(s) + H2O(l)
Si4H10(l)+O2(g)=SiO(s)+H20(l)2Si4H10(l) + 4O2(g) = 8SiO(s) + H20(l)
Si4H10(l)+O2(g)=SiO(s)+H20(l)2Si4H10(l) + 4O2(g) = 8SiO(s) + H20(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8(s) + O2(g) = SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S-2 + 2H+1+ I2 = S + 2HIS-2 + 2H+1 + I2 = S + 2HI
Sn+4Ci=SnCi4Sn + 4Ci = SnCi4
S8 + O2 = SO2S8 + 8O2 = 8SO2
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+O2=SO3SO3 + 0O2 = SO3
Sn(s) + NO3(aq)=SnO2(s) + NO(g)Sn(s) + NO3(aq) = SnO2(s) + NO(g)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrSO4 = SO4 + SrSrSO4 = SO4 + Sr
S + 3F2 = SF6S + 3F2 = SF6
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2 =SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
S + 4 Fe+++ + 3 H2O = H2SO3 + 4 Fe++ + 4 H+S + 4Fe+++ + 3H2O = H2SO3 + 4Fe++ + 4H+
S + 4 Fe3+ + 3 H2O = H2SO3 + 4 Fe2+ + 4 H+S - 8Fe3+ + 3H2O = H2SO3 - 12Fe2+ + 4H+
S2+O2=SO3S2 + 3O2 = 2SO3
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
Sn(OH)2=Sn+(OH)2Sn(OH)2 = Sn + (OH)2
S+H2O+O2=H2SO42S + 2H2O + 3O2 = 2H2SO4
S(s) + HNO3(aq) = SO3(g) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = SO3(g) + 3H2O(l) + 6NO2(g)
S8+H2+O2= H2SO4S8 + 8H2 + 16O2 = 8H2SO4
SO4+O2+H2O= H2SO42SO4 - O2 + 2H2O = 2H2SO4
S8+Cu=Cu2SS8 + 16Cu = 8Cu2S
S8(s) + O2(g) = SO3(g)S8(s) + 12O2(g) = 8SO3(g)
SO2 + 2Cl2 = SO42- + 4Cl0SO2 + Cl2 = 0SO42- + 2Cl
SnCl2 + K2Cr2O7 + HCl =CrCl3 + KCl + SnCl4 + H2O3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
SbCl5 + KI =KCl + I2 + SbCl3 SbCl5 + 2KI = 2KCl + I2 + SbCl3
Si(s) + HF(aq) =SiF4(g) + H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SbCl5 + KI = KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
Sn(NO3)4 + K3PO4 = KNO3 + Sn3(PO4)43Sn(NO3)4 + 4K3PO4 = 12KNO3 + Sn3(PO4)4
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g) Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2(g)+O2(g)=SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnO2+2H2=Sn+2H2OSnO2 + 2H2 = Sn + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiH3+O2=SiO2+H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2010Sn + 20HNO3 = 10SnO2 + 20NO2 + H20
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+2HCl=SnCl2+H2Sn + 2HCl = SnCl2 + H2
Si+O2=SiO2Si + O2 = 2SiO
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S+6HNO3= H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO2SO2 + 0O2 = SO2
Si4Cl = Si+ClSi4Cl = 4Si + Cl
SF4+O2=OSF42SF4 + O2 = 2OSF4
Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(l)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(l)
SeO42- + Cl- + H+ = SeO32- + Cl2 + H2O SeO42- + 20Cl- + 20H+ = SeO32- + 10Cl2 + 10H2O
Sb(s) + Cl2(g) = SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO3 + LiOH = Li2SO4 + H2OSO3 + 2LiOH = Li2SO4 + H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.