Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SO2 (g) + O2 (g) = SO3 (g) 2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g) Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SF6+Li = Li2S +LiFSF6 + 8Li = Li2S + 6LiF
SF6+Li = LiS +LiFSF6 + 7Li = LiS + 6LiF
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sb2S3(s)+O2(g) = Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
Sn(s) + Pb(NO3)2(aq) =Sn(NO3)2(aq) + Pb(s)Sn(s) + Pb(NO3)2(aq) = Sn(NO3)2(aq) + Pb(s)
SiCl4(l)+H2O(l)=SiO2+HCl(aq)SiCl4(l) + 2H2O(l) = SiO2 + 4HCl(aq)
S + HNO3 = H2SO4+ NO2+ H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(OH)2(aq) + H2SO4(aq) = SrSO4(s) + H2O(l)Sr(OH)2(aq) + H2SO4(aq) = SrSO4(s) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2 + C = CS2 + CO2SO2 + 5C = CS2 + 4CO
SnO2(s)+2C(s)=Sn(l)+2CO(g)SnO2(s) + 2C(s) = Sn(l) + 2CO(g)
S(s)+H2SO4(aq)=SO2(g)+H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
S + 6HNO3 = H2SO4 + 6NO2 + 2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr+P4=Sr3P43Sr + P4 = Sr3P4
SiF4(g) + H2O(l) = H2SiF6(aq) + H2SiO3(s)3SiF4(g) + 3H2O(l) = 2H2SiF6(aq) + H2SiO3(s)
S+O2=SO32S + 3O2 = 2SO3
S b 2 S 3 (s)+ O 2 (g)=S b 2 O 3 (s)+S O 2 (g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + H2SO4 =SnSO4 + SO2 +H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8(s)+Cu(s)=Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S(s)+ O2(g)= SO2S(s) + O2(g) = SO2
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SF6(g) + Li(s) = Li2S(s) + LiF(s)SF6(g) + 8Li(s) = Li2S(s) + 6LiF(s)
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SO3(g)+2H2O(l)=H2SO4SO3(g) + H2O(l) = H2SO4
SnCl2 + S8 = SnS2 + SCl28SnCl2 + 3S8 = 8SnS2 + 8SCl2
SO2+O2=SO32SO2 + O2 = 2SO3
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sr(OH)2 + H3PO4 = Sr3(PO4)2 + H2O3Sr(OH)2 + 2H3PO4 = Sr3(PO4)2 + 6H2O
SO2 + KMnO4 + H2O=MnSO4 + K2SO4 + H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SO2 + KMnO4 + H2O=MnSO4 + K2SO4 + H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
S8+O2=SO2S8 + 8O2 = 8SO2
S8(s)+Cu(s)=Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
S+O2=SO2S + O2 = SO2
SrO + H2O = Sr(OH)2SrO + H2O = Sr(OH)2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
SO2 + 3H2 = H2S + 2H2OSO2 + 3H2 = H2S + 2H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S5+O2=SO32S5 + 15O2 = 10SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiO2+Al=Si+Al2O33SiO2 + 4Al = 3Si + 2Al2O3
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
SF6 + Li = Li2S + LiFSF6 + 8Li = Li2S + 6LiF
SnO2 + Cl- + H+= SnCl2 + Cl2 + H2OSnO2 + 4Cl- + 4H+ = SnCl2 + Cl2 + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sn + HNO3= Sn(NO3)4 +NO2 +H2OSn + 8HNO3 = Sn(NO3)4 + 4NO2 + 4H2O
Sn(NO3)4 = SnO2 +NO2+O2 Sn(NO3)4 = SnO2 + 4NO2 + O2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiCl4+H2O=SiO2+HCl SiCl4 + 2H2O = SiO2 + 4HCl
SiH4 + O2 = SiO2 + 2H2SiH4 + O2 = SiO2 + 2H2
SiH4+ O2 = SiO2+ 2H2SiH4 + O2 = SiO2 + 2H2
SiH4+ O2 = SiO2+ 2H2SiH4 + O2 = SiO2 + 2H2
Si4H10 + O2=SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SrO(s)+H2O(aq)=SrO2(s)+H2(g)SrO(s) + H2O(aq) = SrO2(s) + H2(g)
SrO(s)+H2O(aq)=Sr(OH)2(aq)SrO(s) + H2O(aq) = Sr(OH)2(aq)
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Sn+4 + H2 = Sn + 2H+Sn+4 + 2H2 = Sn + 4H+
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
S8 + 12O2 = SO3S8 + 12O2 = 8SO3
Sb2S3 + Fe = 3FeS + 2SbSb2S3 + 3Fe = 3FeS + 2Sb
Sb2O3 + 3C=3CO + SbSb2O3 + 3C = 3CO + 2Sb
Si + 2F2=SiF4Si + 2F2 = SiF4
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
SO3(aq) = SO4 (aq) + S8(s)32SO3(aq) = 24SO4(aq) + S8(s)
SiO2(s)+3C(s)=SiC(s)+10CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2(s)+3C(s)=SiC(s)+10CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Si4 H10 + O2 = Si O2 +H2O 2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SF6+Li = Li2S+LiFSF6 + 8Li = Li2S + 6LiF
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb3PO4 + Al = AlPO4 + SbSb3PO4 + Al = AlPO4 + 3Sb
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
Sb2S3+HNO3=Sb2O5+NO2+S+H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb2S3+ O2 = Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Si+Cl2=SiCl4Si + 2Cl2 = SiCl4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sr + N2 = Sr3N23Sr + N2 = Sr3N2
S+HNO3=H2SO4+NO2+2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sc2 O3 (s) + SO3 (l) = Sc2 (SO4 )3 (s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
S2O3+Cl2=SO4+Cl0S2O3 + Cl2 = 0SO4 + 2Cl
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S8+O2=SO2S8 + 8O2 = 8SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S +O2 = SO2S + O2 = SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + Cu=CuSS + Cu = CuS
Sn(s)+AgNO3(aq)=SnNO3(aq)+Ag(s)Sn(s) + AgNO3(aq) = SnNO3(aq) + Ag(s)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S+ HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+ HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
SnCl4+Na=NaCl+SnSnCl4 + 4Na = 4NaCl + Sn
SO2 + O2= SO32SO2 + O2 = 2SO3
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SO2 + H2O = H2SO4 + H2SO3 SO2 + H2O = 0H2SO4 + H2SO3
SO2+H2O=H2SO4+H2SO3 SO2 + H2O = 0H2SO4 + H2SO3
Sb(s)+O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8+O2= SO3S8 + 12O2 = 8SO3
Sn + 2HCl = SnCl2 + H2Sn + 2HCl = SnCl2 + H2
S + O2 = SO2S + O2 = SO2
SO2 + O2 = SO3 2SO2 + O2 = 2SO3
Sr + Fe(No3)3= Fe +Sr (No3)23Sr + 2Fe(No3)3 = 2Fe + 3Sr(No3)2
Si4H10 + O2 = SiO2 + H202Si4H10 + 8O2 = 8SiO2 + H20
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SiO2(s) + HF (aq) = SiF4(s) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(s) + 2H2O(l)
SiO2+HF(aq)= SiF4+2H2OSiO2 + 4HF(aq) = SiF4 + 2H2O
Sr +N2 = Sr3N23Sr + N2 = Sr3N2
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sb2OS2 + 10O2 = 2Sb2O5 + 4SO3Sb2OS2 + 5O2 = Sb2O5 + 2SO3
S3O2+3O2=S4O24S3O2 - O2 = 3S4O2
S3O2+3O2=S4O8S3O2 - 5O2 = 6S4O
S+6HNO3=6H2SO4+6NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn4+ + H2 = Sn + 2H+2Sn4+ + H2 = 8Sn + 2H+
Sn(C2H3O2)4 (Aq) + Na2O (Aq) = SnO2 (s) + Na(C2H3O2) (Aq)Sn(C2H3O2)4(Aq) + 2Na2O(Aq) = SnO2(s) + 4Na(C2H3O2)(Aq)
S+Al2O3=Al2S3+O26S + 2Al2O3 = 2Al2S3 + 3O2
Sn(s)+H2O(l)=SnOH(aq)+H2(g)2Sn(s) + 2H2O(l) = 2SnOH(aq) + H2(g)
Sn(s)+H2O(l)=SnOH(aq)+H2(g)2Sn(s) + 2H2O(l) = 2SnOH(aq) + H2(g)
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
SiO2+2C=SiC+CO2SiO2 + 2C = SiC + CO2
S + O2 = SO32S + 3O2 = 2SO3
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 (s) + AsF5 (aq) = S16(AsF6)2 (aq) + AsF3 (s)2S8(s) + 3AsF5(aq) = S16(AsF6)2(aq) + AsF3(s)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+6HNO3 = 4H2SO4+NO2+4H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2(g)+CaCO3(s)+O2=CaSO4(s)+CO2(g)2SO2(g) + 2CaCO3(s) + O2 = 2CaSO4(s) + 2CO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SnCl + NH3 = SnCl3 + HCl + N2-3SnCl + 2NH3 = -3SnCl3 + 6HCl + N2
SnCl + NH3 = SnCl3 + HCl +N2-3SnCl + 2NH3 = -3SnCl3 + 6HCl + N2
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO4+O2=SO32SO4 - O2 = 2SO3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S + KOH = K2SO3 + K2S + H2O3S + 6KOH = K2SO3 + 2K2S + 3H2O
S + KOH = K2SO3 + K2S + H2O3S + 6KOH = K2SO3 + 2K2S + 3H2O
SO4+O2=SO32SO4 - O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb+O2=Sb2O54Sb + 5O2 = 2Sb2O5
S+6HNO3=H2SO4+NO3+H2O-1S + 6HNO3 = -1H2SO4 + 6NO3 + 4H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)=Sn(NO3)2(aq)+NO(g)+H2O(l)3Sn(s) + 8HNO3(aq) = 3Sn(NO3)2(aq) + 2NO(g) + 4H2O(l)
S8+O2=SO2S8 + 8O2 = 8SO2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=HSO+NO+HO-1S + 0HNO3 = -1HSO + 0NO + HO
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO2+4H2=2Sn + 4H2OSnO2 + 2H2 = Sn + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4 + Al(OH)3 = AlCl3 + Si(OH)43SiCl4 + 4Al(OH)3 = 4AlCl3 + 3Si(OH)4
Sn(s)+ HNO 3 (aq)=SnO 2 (s)+ NO 2 (g)+ H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sr + O2= 2SrO2Sr + O2 = 2SrO
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S+Fe=FeSS + Fe = FeS
S+Fe=FeSS + Fe = FeS
SO2+O2=SO2SO2 - O2 = 2SO
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S + 6HNO3 = H2SO4 +NO2 +H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
SO2 + Br2 + 2H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SiCl4 + H2O = H4SiO4 + 4HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sb2S3 + HNO3 = Sb(NO3)3 + H2S Sb2S3 + 6HNO3 = 2Sb(NO3)3 + 3H2S
SeCl3+O3=SeO2+Cl26SeCl3 + 4O3 = 6SeO2 + 9Cl2
SO2 + HO = H2O + SSO2 - 4HO = -2H2O + S
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SnO2+H2 =Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S (s) + HNO3 (aq) = H2SO4 (aq) + NO2 (g) + H2O (l)S(s) + 6HNO3(aq) = H2SO4(aq) + 6NO2(g) + 2H2O(l)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + O2 = Sn(O2)4Sn + 4O2 = Sn(O2)4
Si(s) + HF(aq) = SiF4(g) + H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SCl2(l) + NaF(s) = S2Cl2(l) + SF4(g) + NaCl(s)3SCl2(l) + 4NaF(s) = S2Cl2(l) + SF4(g) + 4NaCl(s)
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SCl2(l) + NaF(s) = S2Cl2(l) + SF4(g) + NaCl(s)3SCl2(l) + 4NaF(s) = S2Cl2(l) + SF4(g) + 4NaCl(s)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiF4(g) + H2O(l) = H2SiF6(aq) + H2SiO3(s)3SiF4(g) + 3H2O(l) = 2H2SiF6(aq) + H2SiO3(s)
SO2(g) + H2O(l) = H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
SO2 + Li2Se = SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SO2 + 2 O2 = 2 SO32SO2 + O2 = 2SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 +O2=SO32SO2 + O2 = 2SO3
S+O2=SO2S + O2 = SO2
Sr(NO3)2 = Sr + (NO3)Sr(NO3)2 = Sr + 2(NO3)
Sc + Ca3(PO4)2 = Sc3PO4+Ca6Sc + Ca3(PO4)2 = 2Sc3PO4 + 3Ca
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SrO+N2O3=SrNO3+O2-4SrO - 2N2O3 = -4SrNO3 + O2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3(s) + 6 HCl(aq) = 2 SbCl3(s) + 3 H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SeO2(g) + H2Se(g) = Se(s) + H2O(l)SeO2(g) + 2H2Se(g) = 3Se(s) + 2H2O(l)
SeO2(g) + H2Se(g) = Se(s) + H2O(l)SeO2(g) + 2H2Se(g) = 3Se(s) + 2H2O(l)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SeO2(g) + H2Se(g) = Se(s) + H2O(l)SeO2(g) + 2H2Se(g) = 3Se(s) + 2H2O(l)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2(g)+H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO3(g)+2H2O(l)=H2SO4SO3(g) + H2O(l) = H2SO4
Si + NaOH + H2O = Na2SiO3 + H2Si + 2NaOH + H2O = Na2SiO3 + 2H2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+H2O=SO+H2O2SO2 + H2O = SO + H2O2
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO3+Fe=SO4+Fe0SO3 + Fe = 0SO4 + Fe
SiCl 4 (l)+2 H 2 O(l)=Si O 2 (s)+4HCl(g)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(g)
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SO2+O2= SO32SO2 + O2 = 2SO3
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g) 2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sr +Sn(NO3)4 = Sr(NO3)2 +Sn (s)2Sr + Sn(NO3)4 = 2Sr(NO3)2 + Sn(s)
S+HNO3=NO+H2O+S033S + 0HNO3 = 0NO + 0H2O + S03
S+HNO3=NO+H2O+S033S + 0HNO3 = 0NO + 0H2O + S03
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + H2S = S + H2O SO2 + 2H2S = 3S + 2H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Si(s) + HF(aq) = SiF4(g) + H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SO4 + C = CO2 +SO2SO4 + C = CO2 + SO2
SO4 + C = CO2 +SO2SO4 + C = CO2 + SO2
SiF4+H2O=HF+SiO2SiF4 + 2H2O = 4HF + SiO2
Sb2S3 + O2 = Sb4O6 + SO22Sb2S3 + 9O2 = Sb4O6 + 6SO2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnO2 +C=Sn +CO SnO2 + 2C = Sn + 2CO
SnO2 +C=Sn +CO SnO2 + 2C = Sn + 2CO
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S8+ O2= SO2S8 + 8O2 = 8SO2
S8+ O2= SO2S8 + 8O2 = 8SO2
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sr(OH)2 +Li3PO4 = Sr3(PO4)2 +LiOH3Sr(OH)2 + 2Li3PO4 = Sr3(PO4)2 + 6LiOH
Sr(OH)2 +Li3PO4 = Sr3(PO4)2 +LiOH3Sr(OH)2 + 2Li3PO4 = Sr3(PO4)2 + 6LiOH
SO3(g)+2H2O(l)=H2SO4(l)SO3(g) + H2O(l) = H2SO4(l)
SO3(g)+2H2O(l)=H2SO4(l)SO3(g) + H2O(l) = H2SO4(l)
SO3(g)+H2O(l)=H2SO4(l)SO3(g) + H2O(l) = H2SO4(l)
S(s) + O2(g) + H2O(l) = H2SO4(aq) 2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
SO3(g)+H2O(l)=H2SO4(l)SO3(g) + H2O(l) = H2SO4(l)
S + O2 =SO2S + O2 = 2SO
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiF4(g) + H2O(l) = H2SiF6(aq) + H2SiO3(s)3SiF4(g) + 3H2O(l) = 2H2SiF6(aq) + H2SiO3(s)
SeO2(s) + H2O(l) + SO2(g) = Se(s) + H2SO4(aq)SeO2(s) + 2H2O(l) + 2SO2(g) = Se(s) + 2H2SO4(aq)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn ++ +O2 + H+ = Sn++++ +H2O2Sn++ + O2 + 4H+ = 2Sn++++ + 2H2O
SiF4+ H2O = H2SiF6 +H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
S + O2 = SO32S + 3O2 = 2SO3
S+HNO3=NO+H2O+SO3S + 2HNO3 = 2NO + H2O + SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+HNO2=H2SO4+NO2+H2O-1S + 6HNO2 = -1H2SO4 + 6NO2 + 4H2O
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SiCl4(l) + Mg(s) = MgCl2(s) + Si(s)SiCl4(l) + 2Mg(s) = 2MgCl2(s) + Si(s)
SrSO4(s) = SrO(s) + SO3(g)SrSO4(s) = SrO(s) + SO3(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
Si(s) + HF(aq) = SiF4(g) + H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
S8+ O2= SO3S8 + 12O2 = 8SO3
S8+12O2=8SO3S8 + 12O2 = 8SO3
S8+12O2=8SO4S8 + 16O2 = 8SO4
S8+12O2=8SO3S8 + 12O2 = 8SO3
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si(s) + HF(aq) = SiF4(g) + H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sn+KOH=K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2(s)+C(s)=SiC(s)+14CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SiO2 + C = CO2 + SiCSiO2 + 2C = CO2 + SiC
SF6+H2O=H2SO4+HFSF6 + 4H2O = H2SO4 + 6HF
SO2+O2=SO32SO2 + O2 = 2SO3
Sr (s) + Sn(NO3)4 (aq) = Sr(NO3)2 (aq) + Sn (s) 2Sr(s) + Sn(NO3)4(aq) = 2Sr(NO3)2(aq) + Sn(s)
Sb(s) + O2(g) = Sb2O3(s)4Sb(s) + 3O2(g) = 2Sb2O3(s)
Si(s)+O2=SiO2Si(s) + O2 = SiO2
Si(s)+O2=SiO2Si(s) + O2 = SiO2
Si(s)+Cl2 (g)=SiCl2Si(s) + Cl2(g) = SiCl2
S8+F3=SF6S8 + 16F3 = 8SF6
SnO2 + 4Cl + 4H = SnCl2 + 2H2OSnO2 + 2Cl + 4H = SnCl2 + 2H2O
S + 6HNO3 = H2SO4 + NO2 +H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnBr2 + 2NaOH = Sn(OH)2 + 2NaBrSnBr2 + 2NaOH = Sn(OH)2 + 2NaBr
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + C2 = SiC + CO2SiO2 + 3C2 = 2SiC + 4CO
SiCl4 + 2H2O = SiO2 + 4HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S + O2 = SO32S + 3O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3=SO2+O22SO3 = 2SO2 + O2
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiC + Cl2 = SiCl4 + CSiC + 2Cl2 = SiCl4 + C
SiH4 + O2 = SiO2 + H2OSiH4 + 2O2 = SiO2 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S b 2 S 3 (s)+HCl(aq)=SbC l 3 (aq)+ H 2 S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S+O2=SO32S + 3O2 = 2SO3
Sr(NO3)2(aq) + Na3PO4(aq)= Sr3(PO4)2(s) + NaNO3(aq)3Sr(NO3)2(aq) + 2Na3PO4(aq) = Sr3(PO4)2(s) + 6NaNO3(aq)
Sn + HCl + HNO3 = H2SnCl6 + NO2 + H2OSn + 6HCl + 4HNO3 = H2SnCl6 + 4NO2 + 4H2O
Sn+H2SO4=SnSO4+SO2+H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S+H2SO4=HS+HSO4S + H2SO4 = HS + HSO4
S i 3 N 4 (s)=Si(s)+ N 2 (g)Si3N4(s) = 3Si(s) + 2N2(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+H2SO4=SnSO4+SO2+H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
Sn+H2SO4=SnSO4+SO2+H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SrCO3 + HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
SiO2 + FH = SiF4 + H2OSiO2 + 4FH = SiF4 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + KClO4 = KCl + SO34SO2 + KClO4 = KCl + 4SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3(g)=O2(g)+SO2(g)2SO3(g) = O2(g) + 2SO2(g)
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
Sr(s)+F2(g)=SrF2(s)Sr(s) + F2(g) = SrF2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn(s)+AgNO3(aq)=Sn(NO3)2(aq)+Ag(s)Sn(s) + 2AgNO3(aq) = Sn(NO3)2(aq) + 2Ag(s)
S2O3 2 + H = S (s) + HSO33S2O32 + 32H = -26S(s) + 32HSO3
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
S+6HNO3=H2SO4+HNO2+H2O-1S - 3HNO3 = -1H2SO4 - 3HNO2 + H2O
SO3+Ag=SO4+Ag0SO3 + Ag = 0SO4 + Ag
Sn+LiNO3=Sn(NO3)2+LiSn + 2LiNO3 = Sn(NO3)2 + 2Li
Sn+LiNO3=Sn(NO3)2+LiSn + 2LiNO3 = Sn(NO3)2 + 2Li
Sn(s)+AgNO3(aq)=Sn(NO3)2(aq)+Ag(s)Sn(s) + 2AgNO3(aq) = Sn(NO3)2(aq) + 2Ag(s)
Sn+LiNO3=Sn(NO3)2+LiSn + 2LiNO3 = Sn(NO3)2 + 2Li
S + O2 = SO2S + O2 = SO2
S(s) + 3O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s) + O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s) + O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SiO2 + 4HF = SiF4 +2H2OSiO2 + 4HF = SiF4 + 2H2O
S+O2=SO32S + 3O2 = 2SO3
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+AgNO3=Sn (NO3)2+AgSn + 2AgNO3 = Sn(NO3)2 + 2Ag
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SrCO3(s) = SrO(s) + CO2(g)SrCO3(s) = SrO(s) + CO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Sc2O3+HBr=ScBr3+H2OSc2O3 + 6HBr = 2ScBr3 + 3H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2(g)+O(g)=SO3(g)SO2(g) + O(g) = SO3(g)
SO2+O=SO3SO2 + O = SO3
SO2+O=SO3SO2 + O = SO3
SO2+O=SO3SO2 + O = SO3
Sn3(BO3)4= Sn + B +O2Sn3(BO3)4 = 3Sn + 4B + 6O2
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO2(g)+H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
S+ 6HNO3 = H2SO4 + NO2+ H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S+O2=SO32S + 3O2 = 2SO3
SO3+H2O = H2SO4SO3 + H2O = H2SO4
SO3+H2O = H2S+H2SO4SO3 + H2O = 0H2S + H2SO4
Se2N55 = Se + NSe2N55 = 2Se + 55N
Se2 = SeSe2 = 2Se
S + 6HNO3 = H2SO4 + 6NO2 + 2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(NO3)2+TiO2+CH4N2O=SrTiO3+CO+N+H2O2Sr(NO3)2 + 2TiO2 + 5CH4N2O = 2SrTiO3 + 5CO + 14N + 10H2O
S+KOH = K2SO3+K2S+H2O3S + 6KOH = K2SO3 + 2K2S + 3H2O
S + O2 = SO2S + O2 = SO2
SO2 + O2= SO32SO2 + O2 = 2SO3
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S8+O2=S2O3S8 + 6O2 = 4S2O3
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
Sn + HNO3 = NO2 + H2O +Sn2O32Sn + 6HNO3 = 6NO2 + 3H2O + Sn2O3
S8+F2=SF6S8 + 24F2 = 8SF6
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+O2=SO2S + O2 = SO2
Sc2O3+Cl2+S2Cl2=ScCl3+SOCl22Sc2O3 + 9Cl2 + 3S2Cl2 = 4ScCl3 + 6SOCl2
S8+SO2=SO3-1S8 + 24SO2 = 16SO3
S+O2=SO2S + O2 = SO2
S8(s) + Na2SO3(aq) + H2O(l) = (Na2S2O3)5H2O(s)5S8(s) + 40Na2SO3(aq) + 8H2O(l) = 8(Na2S2O3)5H2O(s)
Sn(s) + 2HF(aq) = SnF2(aq) + H2(g)Sn(s) + 2HF(aq) = SnF2(aq) + H2(g)
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiO2 + C + Cl2 = CO + SiCl4SiO2 + 2C + 2Cl2 = 2CO + SiCl4
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn(s) + 2HF(aq) = SnF2(aq) + H2(g)Sn(s) + 2HF(aq) = SnF2(aq) + H2(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sc2 O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sr(OH)2+2HNO3=Sr(NO3)2+2H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
SiH4+ O2 = SiO2+ H2OSiH4 + 2O2 = SiO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+12O2 = 8SO3S8 + 12O2 = 8SO3
Sb2S3+ O2 = Sb2O3+ SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SO3(g)+2H2O(l)=H+SO3SO3(g) + 0H2O(l) = 0H + SO3
SiO2+HF(aq)=SiF4+H2OSiO2 + 4HF(aq) = SiF4 + 2H2O
SbBr3(s) + H2S(g) = Sb2S3(s) + HBr(g)2SbBr3(s) + 3H2S(g) = Sb2S3(s) + 6HBr(g)
Sr(NO3)2(aq) + K3PO4(aq)=Sr3(PO4)2(s) + KNO3(aq)3Sr(NO3)2(aq) + 2K3PO4(aq) = Sr3(PO4)2(s) + 6KNO3(aq)
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2SO4 + NOS + 2HNO3 = H2SO4 + 2NO
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnS2+Al2(SiO3)3=Sn(SiO3)2+Al2S33SnS2 + 2Al2(SiO3)3 = 3Sn(SiO3)2 + 2Al2S3
SO3(g)+H2O=H2SO4(aq)SO3(g) + H2O = H2SO4(aq)
SO3 (g) + H2O (l) = H2SO4 (aq)SO3(g) + H2O(l) = H2SO4(aq)
Sb2S5 + 6HCl = 2SbCl3 + 2S + 3 H2SSb2S5 + 6HCl = 2SbCl3 + 2S + 3H2S
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO2(g) + O2(g) +H2O(l) = H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Sn3(BO3)4 = Sn + B + O2Sn3(BO3)4 = 3Sn + 4B + 6O2
SiF4 + H2O = H4SiO4 + H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S2+O2=SO2S2 + 2O2 = 2SO2
SO2+ H2O=H2SO3SO2 + H2O = H2SO3
SO2(g)+ H2O(l)=H2SO3 (aq)SO2(g) + H2O(l) = H2SO3(aq)
S + O2 = SO32S + 3O2 = 2SO3
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
S+NHO3=SO3+H2O+NO2S + 6NHO3 = SO3 + 3H2O + 6NO2
SO2 +O2=SO32SO2 + O2 = 2SO3
SO2 + 2HNO2 = H2SO4 + NOSO2 + 2HNO2 = H2SO4 + 2NO
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
S+6HNO3=H2SO4+NO4+H2O-1S + 2HNO3 = -1H2SO4 + 2NO4 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.