Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:

Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2+Br2+H2O=HBr+H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
S+HNO3=NO2+H2SO4+H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SiO2+C=CO+SiCSiO2 + 3C = 2CO + SiC
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 + H2O =SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO+H2 = Sn +H2OSnO + H2 = Sn + H2O
SnO2 + CO = Sn + CO2SnO2 + 2CO = Sn + 2CO2
Si2H3 + O2= SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SF4 + H2O = H2SO3 + HF SF4 + 3H2O = H2SO3 + 4HF
SrS + Sn(NO3)2 = Sr(NO3)2 + SnSSrS + Sn(NO3)2 = Sr(NO3)2 + SnS
Si O2 + C = Si C + CO SiO2 + 3C = SiC + 2CO
SiO2 + 4HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO3+Cu = SO4+Cu0SO3 + Cu = 0SO4 + Cu
SO2 + Na2CO3 + H2O = NaHSO3 + CO22SO2 + Na2CO3 + H2O = 2NaHSO3 + CO2
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4 + H2O=H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+Pb(NO3)2+H2O=H2SO3+Pb+HNO3S + 2Pb(NO3)2 + 3H2O = H2SO3 + 2Pb + 4HNO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sb2O3 + S + Na2S = SO2 + Na3SbS42Sb2O3 + 13S + 6Na2S = 3SO2 + 4Na3SbS4
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+LI2Se=SSe2+LI2OSO2 + 2LI2Se = SSe2 + 2LI2O
Sn3N2 + H2O = Sn(OH)2 + NH3Sn3N2 + 6H2O = 3Sn(OH)2 + 2NH3
SO2 + Ca(IO3)2 + H2O + CaCl2 = CaSO4 + I2 + HCl5SO2 + Ca(IO3)2 + 4H2O + 4CaCl2 = 5CaSO4 + I2 + 8HCl
S + O2 = SO32S + 3O2 = 2SO3
SF4 + H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
S8 + O2 = SO3S8 + 12O2 = 8SO3
Si4H10(l)+O2(g) = SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S8+ASF5=S16(ASF6)2+ASF32S8 + 3ASF5 = S16(ASF6)2 + ASF3
SnSO4+FeSO4 = Sn+Fe2(SO4)3SnSO4 + 2FeSO4 = Sn + Fe2(SO4)3
SnSO4+FeSO4 = Sn+Fe(SO4)32SnSO4 + FeSO4 = 2Sn + Fe(SO4)3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8 +F2=SF6 S8 + 24F2 = 8SF6
Sr + HNO3 = Sr(NO3)2 + H2Sr + 2HNO3 = Sr(NO3)2 + H2
SO2+O2=SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SO3=S+O22SO3 = 2S + 3O2
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S + O2 = SO32S + 3O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+ H2O = H2SO3SO2 + H2O = H2SO3
Sr + F2 = SrF2Sr + F2 = SrF2
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S + O2 = S2O42S + 2O2 = S2O4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn(SeO4)2+Fe(IO3)3=Sn(IO3)4+Fe2(SeO4)33Sn(SeO4)2 + 4Fe(IO3)3 = 3Sn(IO3)4 + 2Fe2(SeO4)3
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SrCO3 + Na2HPO4 = SrHPO4 + Na2CO3SrCO3 + Na2HPO4 = SrHPO4 + Na2CO3
S8+O2=SO3S8 + 12O2 = 8SO3
Si+Cl2=SiCl4Si + 2Cl2 = SiCl4
S + HNO3 = H2SO4 +H2O + N2O4S + 6HNO3 = 4H2SO4 - H2O + 3N2O
Sr+O2=2SrO2Sr + O2 = SrO2
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
S+O2=SO2S + O2 = SO2
S+O2=SO32S + 3O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiI4+Mg=Si+MgI2SiI4 + 2Mg = Si + 2MgI2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiO2 + 4 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
S+ HNO3 + H+ = H2SO3 + N2O + H2O-2S - 2HNO3 + 0H+ = -2H2SO3 - N2O + H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO3=SO2+OSO3 = SO2 + O
SnCl2(aq) + FeCl3 (aq) = SnCl4 (aq) + FeCl2 (aq)SnCl2(aq) + 2FeCl3(aq) = SnCl4(aq) + 2FeCl2(aq)
SiO2(s)+C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiH4 + Cl2 = SiCl4 + 2H2SiH4 + 2Cl2 = SiCl4 + 2H2
SiH4 + Cl2 = SiCl4 + 2H2SiH4 + 2Cl2 = SiCl4 + 2H2
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S+CO=SO2+CS + 2CO = SO2 + 2C
Sn+H2SO4=Sn (SO4)+SO2+H2OSn + 2H2SO4 = Sn(SO4) + SO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SnSO4+K2Cr2O7+H2SO4=Sn (SO4)2+K2SO4+Cr2 (SO4)3+H2O3SnSO4 + K2Cr2O7 + 7H2SO4 = 3Sn(SO4)2 + K2SO4 + Cr2(SO4)3 + 7H2O
SO3 + H2O =H2SO4SO3 + H2O = H2SO4
SO2(g) +O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SnCl2(aq) + FeCl3(aq) = SnCl4(aq) + FeCl2(aq)SnCl2(aq) + 2FeCl3(aq) = SnCl4(aq) + 2FeCl2(aq)
Sr(HCO3)2 + O2 = H2O + CO2 + SrOSr(HCO3)2 + 0O2 = H2O + 2CO2 + SrO
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
SiCl4+Mg = Si+MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
Si(OH)4+4NaBr=SiBr4+4NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
Sn + 2H2So3= SnSo32+2H23Sn + 32H2So3 = 3SnSo32 + 32H2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SnCl2+K2Cr2O7+HCl = SnCl4+CrCl3+KCl+H2O3SnCl2 + K2Cr2O7 + 14HCl = 3SnCl4 + 2CrCl3 + 2KCl + 7H2O
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
S+O3=SO23S + 2O3 = 3SO2
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO2+O2+CaCO3=CaSO4+CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
S + O = SO2S + 2O = SO2
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO3=O+SO2SO3 = O + SO2
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sb2S3(s) + HCl(aq) = SbCl3 + H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3 + 3H2S(g)
Sn2O3+NaOH=NaSnO2+HOHSn2O3 + 2NaOH = 2NaSnO2 + HOH
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO2+O2=SO2SO2 + 0O2 = SO2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SnCl4 +H2S = SnS2 + HClSnCl4 + 2H2S = SnS2 + 4HCl
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S8 + O2 = SO2S8 + 8O2 = 8SO2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
Sb2S3+4O2=2Sb2O4+SO4Sb2S3 + 8O2 = Sb2O4 + 3SO4
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO3 + NO = NO2 + SO2SO3 + NO = NO2 + SO2
Sb2S3 + O2 = Sb2O4 + SO2Sb2S3 + 5O2 = Sb2O4 + 3SO2
SiO2+4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(NO2)2 = SrO + N2O = O2Sr(NO2)2 = SrO + N2O + O2
SiO2 + C = CO + SiSiO2 + 2C = 2CO + Si
SiO2 + C = CO + SiSiO2 + 2C = 2CO + Si
SiO2 + C = CO + SiSiO2 + 2C = 2CO + Si
S + HNO3= H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
Sr+S+O2=SrSO32Sr + 2S + 3O2 = 2SrSO3
Sb2S3(s)+H2(g)=Sb(s)+H2S(g)Sb2S3(s) + 3H2(g) = 2Sb(s) + 3H2S(g)
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S8 + O2 =SO2S8 + 8O2 = 8SO2
S8 + O2 =SO2S8 + 8O2 = 8SO2
Si2Cl6 + H2O = SiO2 + HCl + H2Si2Cl6 + 4H2O = 2SiO2 + 6HCl + H2
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S8+O2=SO2S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SnO + NF3 = 3SnF2 + N2O33SnO + 2NF3 = 3SnF2 + N2O3
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sr + O2= SrO2Sr + O2 = SrO2
Sn(NO2)4 + Pt3N4 = Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 +O2= SO2SO2 + 0O2 = SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sr(OH)2 + NH4Cl = SrCl2 + NH3 + H2OSr(OH)2 + 2NH4Cl = SrCl2 + 2NH3 + 2H2O
Si+Cl=Si4Cl4Si + Cl = Si4Cl
Si+Cl=SiCl4Si + 4Cl = SiCl4
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + OH- = SO3H + OH-0SO2 + OH- = 0SO3H + OH-
SO2 + O2 = 2SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO8S8 + 32O2 = 8SO8
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S8+AsF5 = S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8+AsF5 = S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + AsF5 = S16(AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8+AsF5= S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
Sb2S3 +HCl = SbCl3 +H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SnO + NF3 = SnF2 + N2O33SnO + 2NF3 = 3SnF2 + N2O3
Si2H3 + O2 = SiO2 +H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiH3+O2=SiO2+H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiCl4 = Si + Cl2SiCl4 = Si + 2Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S+O2=SO32S + 3O2 = 2SO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S + O2 = SO32S + 3O2 = 2SO3
Sr(s)+HNO3(aq)=Sr(NO3)2(aq)+H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
SiO2 + HF = H2O + SiF4SiO2 + 4HF = 2H2O + SiF4
S8+O2=SO3S8 + 12O2 = 8SO3
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SO3+H2O=S2O3+OH2SO3 + 3H2O = S2O3 + 6OH
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO3+H2O=SnO2+OHSnO3 + H2O = SnO2 + 2OH
S8 + AsF5 = S16(AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
S8 + AsF5 = S16(AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2= SO2S8 + 8O2 = 8SO2
S8 + AsF5 = S16 (AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8 + AsF5 = S16 (AsF6) + AsF34S8 + 3AsF5 = 2S16(AsF6) + AsF3
SnS2+O2=SnO2+SO2SnS2 + 3O2 = SnO2 + 2SO2
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SiO2(s)+C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S8 + AsF5 = S16(AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S8 +AsF5=S16 (AsF6 ) 2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiF4+H2O=H4SiO4+H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
SiCl4+Mg=Si+MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SiCl4+Mg=Si+MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SiI4+Mg=Si+MgI2SiI4 + 2Mg = Si + 2MgI2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
SiCl4+Mg=Si+MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8 + AsF5 = S16 (AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8+O2=SO3S8 + 12O2 = 8SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sr3P2 + (NH4)2CO3 = SrCO3 + (NH4)3PSr3P2 + 3(NH4)2CO3 = 3SrCO3 + 2(NH4)3P
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
S8 + AsF = S16 (AsF6)2 + AsF0S8 + AsF = 0S16(AsF6)2 + AsF
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO3 + Cl2 = SO4 + Cl0SO3 + Cl2 = 0SO4 + 2Cl
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SbCl5 + H2O = SbOCl3 + HClSbCl5 + H2O = SbOCl3 + 2HCl
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = 2SO
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO2+O2= SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 + HF = SiF4 +H2OSiO2 + 4HF = SiF4 + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
S+O2=SO2S + O2 = SO2
S+O2=SO2S + O2 = SO2
Sn(CO3)2+Al(NO3)3=Sn(NO3)4+Al2(CO3)33Sn(CO3)2 + 4Al(NO3)3 = 3Sn(NO3)4 + 2Al2(CO3)3
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SO2+O2=SO32SO2 + O2 = 2SO3
Si + S8 = Si2S44Si + S8 = 2Si2S4
Sn+H2SO4=SnSO4+SO2+H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S8+AsF5=S16(AsF6)2+ AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SiO2 + 3 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + 4 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
Si4H10(l) + O2(g) = SiO2(s) + H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S8+H2=H2SS8 + 8H2 = 8H2S
S+H2=H2SS + H2 = H2S
S+H2=H2SS + H2 = H2S
SnO2+HI=SnI2+I2+H2OSnO2 + 4HI = SnI2 + I2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sr(NO3)2 = Sr(NO2)2 + O2Sr(NO3)2 = Sr(NO2)2 + O2
SO4 + O2 + H2O = H2SO42SO4 - O2 + 2H2O = 2H2SO4
SbCl3 + H2S = HCl + Sb2S32SbCl3 + 3H2S = 6HCl + Sb2S3
SbCl3 + H2S = HCl + Sb2S32SbCl3 + 3H2S = 6HCl + Sb2S3
S8+O2=SO3S8 + 12O2 = 8SO3
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
Sn + HF = H2 + SnF2Sn + 2HF = H2 + SnF2
SiO2 + C = Si + COSiO2 + 2C = Si + 2CO
Sn + Cl2 = SnCl4Sn + 2Cl2 = SnCl4
SnO2 + C = Sn + COSnO2 + 2C = Sn + 2CO
Sb + CI2 = SbCI2Sb + CI2 = SbCI2
Si+S8=Si2S44Si + S8 = 2Si2S4
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SrCl2+CuNO3=Sr(NO3)2+CuClSrCl2 + 2CuNO3 = Sr(NO3)2 + 2CuCl
Sr3(PO4)2 + Mg(OH)2 = Sr3(OH)2 + Mg(PO4)2Sr3(PO4)2 + Mg(OH)2 = Sr3(OH)2 + Mg(PO4)2
Sr3(PO4)2 + Mg(OH)2 = Sr3(OH)2 + Mg(PO4)2Sr3(PO4)2 + Mg(OH)2 = Sr3(OH)2 + Mg(PO4)2
Sr(OH)2+HCl=SrCl2+H2OSr(OH)2 + 2HCl = SrCl2 + 2H2O
Sr + Cl = SrCl2Sr + 2Cl = SrCl2
Sr + Cl = SrClSr + Cl = SrCl
S + O2 = SO2S + O2 = SO2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + O2 = SO2S + O2 = SO2
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
Sn + NaOH=Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S+O2=SO32S + 3O2 = 2SO3
S + O2 = SO2S + O2 = SO2
Sr + MnP = SrP + MnSr + MnP = SrP + Mn
SO2Cl2 + HI = H2S + H2O +HCl + I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 + H2O= H2SO4SO3 + H2O = H2SO4
SNO2+H2=SN+H2OSNO2 + 2H2 = SN + 2H2O
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SCl2+Ba=BaCl2+SSCl2 + Ba = BaCl2 + S
Sr+H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Sb2(SO4)3+KMnO4+H2O=H3SbO4+K2SO4+MnSO4+H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiH3 + O2 = SiO2 + H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
S8+F2=SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2Cl2 + HI = H2S + H2O + HCl +I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SnO2+H2 =Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2 + C = CSi + COSiO2 + 3C = CSi + 2CO
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
S8+O2=SO3S8 + 12O2 = 8SO3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO3 + Cl2 = SO4 + Cl0SO3 + Cl2 = 0SO4 + 2Cl
Sn + HNO3 + H2O = SnO + NH3( OH)7Sn + 2HNO3 + 3H2O = 7SnO + 2NH3(OH)
Sn + HNO3 = SnO + N2 + H26Sn + 2HNO3 = 6SnO + N2 + H2
SnCl2 + NaOH = SnO + NaCl + H2OSnCl2 + 2NaOH = SnO + 2NaCl + H2O
SnCl2 + NaOH = SnO + NaCl + H2OSnCl2 + 2NaOH = SnO + 2NaCl + H2O
SnCl2 + HCl + NaOH = SnO2 + NaCl + H2O0SnCl2 + HCl + NaOH = 0SnO2 + NaCl + H2O
SnCl2 + HCl + NaOH = SnO4 + NaCl + H2O0SnCl2 + HCl + NaOH = 0SnO4 + NaCl + H2O
SnCl + HCl + NaOH = SnO4 + NaCl + H2O0SnCl + HCl + NaOH = 0SnO4 + NaCl + H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sn + H2SO4 = SnSO4 + H2Sn + H2SO4 = SnSO4 + H2
Sn + HCl = SnCl2 = H2Sn + 2HCl = SnCl2 + H2
S8+O2=SO3S8 + 12O2 = 8SO3
Sb+O2=Sb2O34Sb + 3O2 = 2Sb2O3
SO2+O2=SO32SO2 + O2 = 2SO3
Sr+P4=Sr3P26Sr + P4 = 2Sr3P2
Sb + O2 = Sb2O34Sb + 3O2 = 2Sb2O3
SrCl2 + CuSO4 = SrSO4 + CuCl2SrCl2 + CuSO4 = SrSO4 + CuCl2
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S8+F2=SF6S8 + 24F2 = 8SF6
Si(s)+Cl2(g)=SiCl4(l)Si(s) + 2Cl2(g) = SiCl4(l)
SnO2 + H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SiI4+Mg=Si+MgI2SiI4 + 2Mg = Si + 2MgI2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
SiCl4+Mg=Si+MgCl2SiCl4 + 2Mg = Si + 2MgCl2
S8+O2=SO2S8 + 8O2 = 8SO2
Si2Cl6+H2O=SiO2+HCl+H2Si2Cl6 + 4H2O = 2SiO2 + 6HCl + H2
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
S8+O2=SO3S8 + 12O2 = 8SO3
Sn + NaOH + H 2 O =Na 2 SnO 3 + H2Sn + 2NaOH + H2O = Na2SnO3 + 2H2
Sn + NaOH + H 2 O =Na 2 SnO 3 + H2Sn + 2NaOH + H2O = Na2SnO3 + 2H2
SnCl2(aq) + Al(s)=2AlCl3 + Sn3SnCl2(aq) + 2Al(s) = 2AlCl3 + 3Sn
SnCl2(aq) + Al(s)=2AlCl3 + 3Sn3SnCl2(aq) + 2Al(s) = 2AlCl3 + 3Sn
Sn+HNO3=H2SnO3+NO2+H2OSn + 4HNO3 = H2SnO3 + 4NO2 + H2O
Sn+HNO3=Sn(NO3)2+NH4NO3+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb2S5+HNO3=Sb2O5+H2SO4+NO+H2O3Sb2S5 + 40HNO3 = 3Sb2O5 + 15H2SO4 + 40NO + 5H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S+O2=SO32S + 3O2 = 2SO3
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S8+O2=SO3S8 + 12O2 = 8SO3
SbCl3+H2S=HCl+Sb2S32SbCl3 + 3H2S = 6HCl + Sb2S3
S8+O2=SO3S8 + 12O2 = 8SO3
SbCl3+H2S=HCl+Sb2S32SbCl3 + 3H2S = 6HCl + Sb2S3
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
S8+H2O=H2S+O2S8 + 8H2O = 8H2S + 4O2
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sn+H2SO4=H+SnSO4Sn + H2SO4 = 2H + SnSO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO3(g) = SO2(g) + O2(g)2SO3(g) = 2SO2(g) + O2(g)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO3+KOH=KSO4=H2020SO3 + 20KOH = 20KSO4 + H20
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2 H2O = H2SO3SO2H2O = H2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l)+H2O(l)=SiO2(s)+HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SO4 + H2O = SO3 + OHSO4 + H2O = SO3 + 2OH
Sn + HCl=SnCl2 + H2Sn + 2HCl = SnCl2 + H2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sr + Cu(NO3)2 = Sr(NO3)2 +Cu22Sr + 2Cu(NO3)2 = 2Sr(NO3)2 + Cu2
Sr + Cu(NO3)2 = Sr(NO3)2 +CuSr + Cu(NO3)2 = Sr(NO3)2 + Cu
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2S = 3S + H2OSO2 + 2H2S = 3S + 2H2O
SnCl2 + HgCl2 = SnCl4 + Hg2Cl2SnCl2 + 2HgCl2 = SnCl4 + Hg2Cl2
SnCl2 + HgCl2 = SnCl4 + Hg2Cl2 68-132SnCl2 + 2HgCl2 = -132SnCl4 + Hg2Cl268
Si + NaOH + H2O = Na2SiO3 + H2Si + 2NaOH + H2O = Na2SiO3 + 2H2
Sn + NaOH + H2O = Na2SnO3 + H2Sn + 2NaOH + H2O = Na2SnO3 + 2H2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8 + AsF5 = S16(AsF6)2 + AsF3 2S8 + 3AsF5 = S16(AsF6)2 + AsF3
SO4 + H = H2SO3 + H2OSO4 + 4H = H2SO3 + H2O
SnCl2 + HCl + Na2S = H2S + Sn + NaCl0SnCl2 + 2HCl + Na2S = H2S + 0Sn + 2NaCl
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO4-2 +Sn+2 +4H= H2SO3 + Sn+4 + H2OSO4-2 - Sn+2 + 4H = H2SO3 - Sn+4 + H2O
SO42-+Sn2+ +H= H2SO3 + Sn4+ H2O2SO42- + 2Sn2+ + 160H = 2H2SO3 + Sn4 + 78H2O
SO42-+Sn+2+4H+= H2SO3+ Sn+4+ H2O 2SO42- + 79Sn+2 + 160H+ = 2H2SO3 + 79Sn+4 + 78H2O
SO4-2+Sn+2+4H+= H2SO3+ Sn+4+ H2O SO4-2 + Sn+2 + 4H+ = H2SO3 + Sn+4 + H2O
SiCl4(l)+Mg(s)=Si(s)+MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S8 + O2= SO2S8 + 8O2 = 8SO2
SiF4 + NaOH = Na4SiO4 +NaF + H2OSiF4 + 8NaOH = Na4SiO4 + 4NaF + 4H2O
Sn+HCl=SnCl+HSn + HCl = SnCl + H
Sr(s)+O2(g)+C(s)=SrCO3(s)2Sr(s) + 3O2(g) + 2C(s) = 2SrCO3(s)
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO2+O2=SO32SO2 + O2 = 2SO3
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sn (s) + P (s) = Sn3 P23Sn(s) + 2P(s) = Sn3P2
SO2 + O = SO3SO2 + O = SO3
S8 +O2=SO3S8 + 12O2 = 8SO3
SO3 + Cl2 = SO4 + Cl0SO3 + Cl2 = 0SO4 + 2Cl
SO2+O2=SO32SO2 + O2 = 2SO3
SrS (aq) + CuSO4 (aq) = SrSO4 (s) + CuS (s)SrS(aq) + CuSO4(aq) = SrSO4(s) + CuS(s)
S2O3 + H2O = HSO4 + OH-1S2O3 + 3H2O = -2HSO4 + 8OH
S2O3 + H2O = HSO4 + HS2O3 + 5H2O = 2HSO4 + 8H
S2O3 + H2O = HSO4 + HS2O3 + 5H2O = 2HSO4 + 8H
S2O3 + H2O = HSO4 + HS2O3 + 5H2O = 2HSO4 + 8H
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2 = SO3S8 + 12O2 = 8SO3
S + O2 = SO32S + 3O2 = 2SO3
S(s)+O 2 (g)=SO2(s)S(s) + O2(g) = SO2(s)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SbCl3+H2S=Sb2S3+HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
S8 + O2 = SO2S8 + 8O2 = 8SO2
SnCl2+HNO2+HCl=SnCl4+NO+H2OSnCl2 + 2HNO2 + 2HCl = SnCl4 + 2NO + 2H2O
SnCl4+Fe=SnCl2+FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
S8 + AsF5 = S16(AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
Si + S8 = Si2S44Si + S8 = 2Si2S4
SiO2+2C=SiC=2COSiO2 + 3C = SiC + 2CO
S2O82- + I- + H+ = SO4 2- + I3 - + H2O-2S2O82- + 9I- + 8H+ = -4SO42- + 3I3- + 4H2O
S2O82- + I- + H+ = SO4 2- + I3 - + H2O-2S2O82- + 9I- + 8H+ = -4SO42- + 3I3- + 4H2O
SnO2-- + ClO3- = SnO3-- + Cl-3SnO2-- + ClO3- = 3SnO3-- + Cl-

This program was created with a lot of help from:

Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer

Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.