Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SiO2+KOH=K2SiO3+H2OSiO2 + 2KOH = K2SiO3 + H2O
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO3(g) SO2(g) + O2(g) = SO3(g)2SO3(g)SO2(g) + O2(g) = 4SO3(g)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn+KOH= K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+O2 = SO2S + O2 = SO2
S+O2=SO32S + 3O2 = 2SO3
SO4+CaCO3+O2=CaSO4+CO22SO4 + 2CaCO3 - O2 = 2CaSO4 + 2CO2
SO3- - + I2+H2O=SO4- - +H+ +I-SO3-- + I2 + H2O = SO4-- + 2H+ + 2I-
S2O3- - + Cl2+H2O=SO4- - +H+ +Cl-S2O3-- + 4Cl2 + 5H2O = 2SO4-- + 10H+ + 8Cl-
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g) + O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2Cl2 + Ag2S = SO + AgCl SO2Cl2 + Ag2S = 2SO + 2AgCl
SrCO3+HNO3=Sr(NO3)2+CO2+H2OSrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2O
SbI3 + Sb(IO3)3 + H4SiO4 = Sb4(SiO4)3 + I2 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 3Sb4(SiO4)3 + 18I2 + 18H2O
Sn + H3PO4 = H2 + Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
SO2+O2=SO32SO2 + O2 = 2SO3
Sn2(SO4)3+ NaBr=SnBr3+Na2SO4Sn2(SO4)3 + 6NaBr = 2SnBr3 + 3Na2SO4
Sr+C+O2=SrCO32Sr + 2C + 3O2 = 2SrCO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si (s) + CO = SiO2+CSi(s) + 2CO = SiO2 + 2C
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb2O3+ 3C= 2Sb+2COSb2O3 + 3C = 2Sb + 3CO
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
Sn(s) + HNO3(aq) = SnO2(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnCl4(aq)+2(NH4)2S(aq)=4NH4Cl(aq)+SnS2(s)SnCl4(aq) + 2(NH4)2S(aq) = 4NH4Cl(aq) + SnS2(s)
SnCl4(aq)+2(NH4)2S(aq)=4NH4Cl(aq)+SnS2(s)SnCl4(aq) + 2(NH4)2S(aq) = 4NH4Cl(aq) + SnS2(s)
Sn(s)+ O2(g)=SnO(s)2Sn(s) + O2(g) = 2SnO(s)
S8+O2=SO3S8 + 12O2 = 8SO3
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+O2= SO32S + 3O2 = 2SO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiH4+NH3=Si3N4+H23SiH4 + 4NH3 = Si3N4 + 12H2
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O=SeO2+Cl2SeCl6 + 2O = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S8+Cl2=SCl2S8 + 8Cl2 = 8SCl2
S8+O2=SO2S8 + 8O2 = 8SO2
S+O2=SO32S + 3O2 = 2SO3
Sn + Cl2 = SnCl2Sn + Cl2 = SnCl2
SiF4(s)+NaOH(aq)=Na4SiO4(s)+NaF(aq)+H2O(l)SiF4(s) + 8NaOH(aq) = Na4SiO4(s) + 4NaF(aq) + 4H2O(l)
SnCl4+Cu3(PO4)2=CuCl2+Sn3(PO4)43SnCl4 + 2Cu3(PO4)2 = 6CuCl2 + Sn3(PO4)4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2Cl2+ HBr= H2S + HCl + Br2+ H2OSO2Cl2 + 8HBr = H2S + 2HCl + 4Br2 + 2H2O
S+H2SO=SO2+H2O-1S + H2SO = 0SO2 + H2O
SnCl + H2SO3 + HCl = H2S + SnCl4 + H2O 2SnCl + H2SO3 + 6HCl = H2S + 2SnCl4 + 3H2O
S2Cl5 (s) + O2 (g) = SO2 (g) + Cl2 (g)2S2Cl5(s) + 4O2(g) = 4SO2(g) + 5Cl2(g)
SO2 + O2 = SO2SO2 + 0O2 = SO2
SO2 + Mg(OH)2 = MgSO3 + H2OSO2 + Mg(OH)2 = MgSO3 + H2O
SO2 + O2= SO32SO2 + O2 = 2SO3
SeCl6 + O2 = SeO4 + Cl2SeCl6 + 2O2 = SeO4 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sr(OH)2+H3AsO4=Sr3(AsO4)2+H2O3Sr(OH)2 + 2H3AsO4 = Sr3(AsO4)2 + 6H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SbCl3 + H2S = Sb2S3 + HCl 2SbCl3 + 3H2S = Sb2S3 + 6HCl
S(O3) + H2O = H2SO4S(O3) + H2O = H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiF4(s)+NaOH(aq)=Na4SiO4(s)+NaF(aq)+H2OSiF4(s) + 8NaOH(aq) = Na4SiO4(s) + 4NaF(aq) + 4H2O
Si+NaOH=Na4SiO4+H2Si + 4NaOH = Na4SiO4 + 2H2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+O=SO3SO2 + O = SO3
S+O2=SO32S + 3O2 = 2SO3
SbI3 + Sb(IO4)3 + H4SiO4 = Sb4(SiO4)3 + I2 + H2O7SbI3 + Sb(IO4)3 + 6H4SiO4 = 2Sb4(SiO4)3 + 12I2 + 12H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrCO3+HCl=SrCl2+CO2+H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SO2+3O2=SO32SO2 + O2 = 2SO3
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + Na2SO3 + H2O= Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
S+O2=SO32S + 3O2 = 2SO3
SO2 +H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
S+O2=2SO2S + O2 = SO2
Sr+H3SbO4=Sr3(SbO4)2+H23Sr + 2H3SbO4 = Sr3(SbO4)2 + 3H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2S = S + H2SO2SO2 + H2S = S + H2SO2
SO2+Br2+H2O=HBr+H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+1O2=SO32SO2 + O2 = 2SO3
SiF4 +K = KF + SiSiF4 + 4K = 4KF + Si
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr (s) + P4 (s) = Sr3P2 (s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sr (s) + P4 (s) = Sr3P2 (s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sn+HF =SnF2+H2Sn + 2HF = SnF2 + H2
SO3=SO2+O22SO3 = 2SO2 + O2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S+O2=SO32S + 3O2 = 2SO3
SiO2(s) + NaCl(aq) + H2O(l) = Na2SiO3(aq) + HCl(aq)SiO2(s) + 2NaCl(aq) + H2O(l) = Na2SiO3(aq) + 2HCl(aq)
SiO2(s) + NaCl(aq) + H2O(l) = Na2SiO3(aq) + HCl(aq)SiO2(s) + 2NaCl(aq) + H2O(l) = Na2SiO3(aq) + 2HCl(aq)
SiO2(s) + NaCl(aq) + H2O(l) = Na2SiO3(aq) + HCl(aq)SiO2(s) + 2NaCl(aq) + H2O(l) = Na2SiO3(aq) + 2HCl(aq)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sr + HNO3 = Sr(NO3)2 + H2Sr + 2HNO3 = Sr(NO3)2 + H2
S2Cl2 + NH3 = NH4Cl + S4N4 + S6S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + 8S
SO2+O2=SO32SO2 + O2 = 2SO3
S+O=SO2S + 2O = SO2
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SF4+H2O = SO2+HFSF4 + 2H2O = SO2 + 4HF
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn3(PO4)4 + FeCl2 = SnCl4 + Fe3(PO4)2Sn3(PO4)4 + 6FeCl2 = 3SnCl4 + 2Fe3(PO4)2
SiI4 +Mg =Si +MgI2SiI4 + 2Mg = Si + 2MgI2
Sb + Cl2 = SbCl2Sb + Cl2 = SbCl2
Sb + Cl2 = SbCl2Sb + Cl2 = SbCl2
SnO2 + CO = Sn + CO2SnO2 + 2CO = Sn + 2CO2
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sn(C2H3O2)2 + K2CrO4 = KC2H3O2 + SnCrO4Sn(C2H3O2)2 + K2CrO4 = 2KC2H3O2 + SnCrO4
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + NO3 = SO2 + NOS8 + 8NO3 = 8SO2 + 8NO
Sb2O3 + H2S = Sb2S3 + H2OSb2O3 + 3H2S = Sb2S3 + 3H2O
Sb2O3 + H2S = Sb2S3 + H2OSb2O3 + 3H2S = Sb2S3 + 3H2O
SiO2 + 3C = SiC + 2COSiO2 + 3C = SiC + 2CO
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8 + O2 = SO2 S8 + 8O2 = 8SO2
SO3-- + Fe+++ + H2O = SO4-- + Fe++ + H+SO3-- + 2Fe+++ + H2O = SO4-- + 2Fe++ + 2H+
SO3-- + Fe+++ + H20 = SO4-- + Fe++ + H+0SO3-- + 20Fe+++ + H20 = 0SO4-- + 20Fe++ + 20H+
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
S8+8O2=8SO2S8 + 8O2 = 8SO2
SO3+H2O=H2SO4 SO3 + H2O = H2SO4
SO3 + H2O=H2SO4 SO3 + H2O = H2SO4
ScBr3 + NaOH = Sc2O3+ HBr + NaBr2ScBr3 + 3NaOH = Sc2O3 + 3HBr + 3NaBr
SO2+H2O+O2=H2SO22SO2 + 2H2O - O2 = 2H2SO2
SiO2+C+Ca3(PO4)=CaSiO3+P+CO3SiO2 + C + Ca3(PO4) = 3CaSiO3 + P + CO
SO2Cl2 + HBr = H2S + Br2 + H2O + HClSO2Cl2 + 8HBr = H2S + 4Br2 + 2H2O + 2HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2Cl2 + HBr = H2S + Br2 + H2O + HClSO2Cl2 + 8HBr = H2S + 4Br2 + 2H2O + 2HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2 + O2= SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn3 (BO3)4 = Sn + B + O2Sn3(BO3)4 = 3Sn + 4B + 6O2
Sn3 (BO3)4 = Sn + B + O279Sn3(BO3)4 = 27Sn + 36B + 4O27
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiF4 + H2O = H4SiO4 + H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SbH3+O2=Sb+H2O4SbH3 + 3O2 = 4Sb + 6H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sr(OH)2 + 2HCl = SrCl2 + 10 H2OSr(OH)2 + 2HCl = SrCl2 + 2H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sr(s)+P4(s) =Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SnS2(s)+O2(g)=SnO2(s)+SO2(g)SnS2(s) + 3O2(g) = SnO2(s) + 2SO2(g)
Si2H3 + O2 = SiO2 +H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SeO2 + H2Se = Se + H2OSeO2 + 2H2Se = 3Se + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO4=O2+SO2SO4 = O2 + SO2
SO2 + H2O=H2SO3SO2 + H2O = H2SO3
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + CaCO3 +O2 = CaS + CO22SO2 + 2CaCO3 - 3O2 = 2CaS + 2CO2
SO2 + H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SO3 = SO2 + O22SO3 = 2SO2 + O2
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 = SnO + NO2 + H2OSn + 2HNO3 = SnO + 2NO2 + H2O
S + O2 = SO32S + 3O2 = 2SO3
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l)+H2O(l)=SiO2(s)+HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiF4+H2O=H4SiO4+H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S + O2 = SO32S + 3O2 = 2SO3
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sn(OH)4 = SnO2 + H2OSn(OH)4 = SnO2 + 2H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2+KI+H2SO4=K2SO4+H2S+I22SO2 + 4KI + H2SO4 = 2K2SO4 + H2S + 2I2
SO2+H3O=HSO4+H2O-1SO2 + 3H3O = -1HSO4 + 5H2O
Si + S = Si2S42Si + 4S = Si2S4
SO2 + H2O = H2 SO3SO2 + H2O = H2SO3
Sr3(PO4)2 + Na2SO4 = Na3PO4 + SrSO4Sr3(PO4)2 + 3Na2SO4 = 2Na3PO4 + 3SrSO4
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sc+F2= ScF2Sc + F2 = 2ScF
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + Li2Se = SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiO2(s)+9C(s)=SiC(s)+10CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2(s)+9C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2(s)+9C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S2- + Al3+ = S3+Al2-15S2- + 6Al3+ = 10S3 + 9Al2-
S2- + H+ = S+H2-3S2- + 2H+ = 6S + H2-
S2- + Ba2+ = S2+Ba2-2S2- + Ba2+ = 2S2 + Ba2-
SrBr2(NH4)2CO3=SrCO3+NH4BrSrBr2(NH4)2CO3 = SrCO3 + 2NH4Br
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sn(PO4)2+K3PO4=Sn3(PO4)4+K-3Sn(PO4)2 + 2K3PO4 = -1Sn3(PO4)4 + 6K
Sr + 2H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
Sr + 2H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
SiO2 + 3C = SiC + 2COSiO2 + 3C = SiC + 2CO
S8+O2=SO3S8 + 12O2 = 8SO3
SnS2 + HNO3 + H2O = H2SnO3 + NO + H2SO43SnS2 + 16HNO3 + H2O = 3H2SnO3 + 16NO + 6H2SO4
Sn(PO4)2+K3PO4=Sn3(PO4)4+K-3Sn(PO4)2 + 2K3PO4 = -1Sn3(PO4)4 + 6K
S8 + O2 = SO2S8 + 8O2 = 8SO2
SeO2 + H2 = Se(OH)2SeO2 + H2 = Se(OH)2
S + O2 = SO32S + 3O2 = 2SO3
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 = Si + Cl2SiCl4 = Si + 2Cl2
SiCl = Si + Cl22SiCl = 2Si + Cl2
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si+NaOH=Na4SiO4+H2Si + 4NaOH = Na4SiO4 + 2H2
S8+Na2SO3+H2O=Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SO2 +O2 =SO32SO2 + O2 = 2SO3
Sn+HCl=H2+SnCl2Sn + 2HCl = H2 + 2SnCl
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq) SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Sn+HCl=SnCl+H22Sn + 2HCl = 2SnCl + H2
Sn+HCl=SnCl+HSn + HCl = SnCl + H
S+O2=SO32S + 3O2 = 2SO3
SO2+2Li2Se=SSe2+2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+F2=SF6S8 + 24F2 = 8SF6
SO2 + O2 + H20 = 4H2SO410SO2 + 10O2 + H20 = 10H2SO4
Sb+H2O=Sb2O3+H22Sb + 3H2O = Sb2O3 + 3H2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S2Cl2 + NH3 = S4N4 + NH4Cl + S6S2Cl2 + 16NH3 = S4N4 + 12NH4Cl + 8S
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sn(NO3)2=SnO+NO2+O22Sn(NO3)2 = 2SnO + 4NO2 + O2
Sn(NO3)2=SnO4+NO2+O2-1Sn(NO3)2 = -1SnO4 - 2NO2 + O2
Sn(NO3)2=SnO+NO2+O22Sn(NO3)2 = 2SnO + 4NO2 + O2
SiF4 + H2O = H4SiO4 + H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
S8+F2=SF6S8 + 24F2 = 8SF6
S8+F2=SF6S8 + 24F2 = 8SF6
SiO2+C=SiO+COSiO2 + C = SiO + CO
SiO2+C=SiO+COSiO2 + C = SiO + CO
S + HNO3 = NO + SO4 + H2O3S + 8HNO3 = 8NO + 3SO4 + 4H2O
SnCl4 + K3PO4 = Sn3(PO4)4 + KCl3SnCl4 + 4K3PO4 = Sn3(PO4)4 + 12KCl
Sn + HCl = SnCl +H22Sn + 2HCl = 2SnCl + H2
Sn + HCl = SnCl +HSn + HCl = SnCl + H
Sb+O=Sb4O64Sb + 6O = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiI4(s) + Mg(s) = Si(s)+ MgI2SiI4(s) + 2Mg(s) = Si(s) + 2MgI2
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrCl2+H2SO4=HCl+SrSO4SrCl2 + H2SO4 = 2HCl + SrSO4
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2 + NaOH = NaHSO3SO2 + NaOH = NaHSO3
SO2 + NaOH = NaHSO3SO2 + NaOH = NaHSO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si2H2 + O2 =SiO2 + H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiF4 + H2O == H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn + Cl2 = SnCl2Sn + Cl2 = SnCl2
Sn + Cl2 = SnCl2Sn + Cl2 = SnCl2
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
SO2 + HNO3 + H2O = H2SO4 + NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
SrBr2+9(NH4)2CO3= SrCO3+2NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sb2O3 + Zn + H2SO4 = ZnSO4 + SbH3 + H2OSb2O3 + 6Zn + 6H2SO4 = 6ZnSO4 + 2SbH3 + 3H2O
SbS3 + O3 = Sb2O4 + SO26SbS3 + 16O3 = 3Sb2O4 + 18SO2
SO2 + AuCl3 + H2O = H2SO4 + HCl + Au3SO2 + 2AuCl3 + 6H2O = 3H2SO4 + 6HCl + 2Au
SO2 + H2S = H2O +SSO2 + 2H2S = 2H2O + 3S
SiHCl3 + KOH = SiO2 + KCl + H2O + H2SiHCl3 + 3KOH = SiO2 + 3KCl + H2O + H2
SF4 + H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
S8+O2=SO2S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
S+O2=SO32S + 3O2 = 2SO3
SO3= SO2+O22SO3 = 2SO2 + O2
S8+O2=SO2S8 + 8O2 = 8SO2
SiF4 + KOH = SiO2 + KF + H2OSiF4 + 4KOH = SiO2 + 4KF + 2H2O
SF4 + KOH = K2SO3 + KF + H2OSF4 + 6KOH = K2SO3 + 4KF + 3H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+2Li2Se = SSe2 + 2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+F2=SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO4(NH4)2 + Ca(IO3)2 = CaSO4 + 2NH3 + 2HIO3SO4(NH4)2 + Ca(IO3)2 = CaSO4 + 2NH3 + 2HIO3
S+HNO3=SO2+NO+H2O3S + 4HNO3 = 3SO2 + 4NO + 2H2O
SO2+SeO2+H2O=Se+H2SO42SO2 + SeO2 + 2H2O = Se + 2H2SO4
SiHCl3 + H2O = SiO2 + HCl + H2SiHCl3 + 2H2O = SiO2 + 3HCl + H2
SiHCl3 + H2O = SiO2 + HCl + Cl2-1SiHCl3 - 2H2O = -1SiO2 - 5HCl + Cl2
SiHCl3 + O2 = SiO2 + HCl + Cl2SiHCl3 + O2 = SiO2 + HCl + Cl2
SiH2Cl2 + O2 = SiO2 + H2O + HClSiH2Cl2 + O2 = SiO2 + 0H2O + 2HCl
SiH2Cl2 + O2 = SiO2 + Cl2 + H2O2SiH2Cl2 + 3O2 = 2SiO2 + 2Cl2 + 2H2O
SiHCl3 + O2 = SiO2 + Cl2 + H2O4SiHCl3 + 5O2 = 4SiO2 + 6Cl2 + 2H2O
SiHCl3 + O2 = SiO2 + HCl + H2O-2SiHCl3 - O2 = -2SiO2 - 6HCl + 2H2O
SiHCl3 + O2 = SiO2 + Cl2 + H2O4SiHCl3 + 5O2 = 4SiO2 + 6Cl2 + 2H2O
SiHCl3 + O2 = SiO2 + HCl + H2O-2SiHCl3 - O2 = -2SiO2 - 6HCl + 2H2O
SiHCl3 + O2 = SiO2 + HCl + H2O-2SiHCl3 - O2 = -2SiO2 - 6HCl + 2H2O
SiH2Cl2 + H2O = SiO2 + HCl + H2SiH2Cl2 + 2H2O = SiO2 + 2HCl + 2H2
SiH2Cl2 + H2O = SiO2 + HCl + H2SiH2Cl2 + 2H2O = SiO2 + 2HCl + 2H2
SO2 + KOH = K2SO3 + H2OSO2 + 2KOH = K2SO3 + H2O
SnS + HNO3 = Sn(SO4)2 + Sn(NO3)4 + NO + H2O6SnS + 32HNO3 = 3Sn(SO4)2 + 3Sn(NO3)4 + 20NO + 16H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S+O2=SO32S + 3O2 = 2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + Cl2 = SnCl4Sn + 2Cl2 = SnCl4
SnO2 + C = Sn + COSnO2 + 2C = Sn + 2CO
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sn(SO4)2 + K3 PO4 = Sn3(PO4)4 + K2 SO43Sn(SO4)2 + 4K3PO4 = Sn3(PO4)4 + 6K2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6+O2=1SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + Cl2 = SnCl4Sn + 2Cl2 = SnCl4
Si + O2 = SiO2Si + O2 = SiO2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8 + Cl2 = S2Cl2S8 + 4Cl2 = 4S2Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn(SO4)2 + Al = Al2(SO4)3 + Sn3Sn(SO4)2 + 4Al = 2Al2(SO4)3 + 3Sn
Sn3(Po4)2 + Fe(ClO3)3 = Sn(ClO3)2 + FePo4Sn3(Po4)2 + 2Fe(ClO3)3 = 3Sn(ClO3)2 + 2FePo4
S + Fe = Fe2S33S + 2Fe = Fe2S3
SO2+ H2O = H2SO3SO2 + H2O = H2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SnCl+ HCl+O2= SnCl4+ H2O4SnCl + 12HCl + 3O2 = 4SnCl4 + 6H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SnCl4 + (NH4)3PO4 = Sn3(PO4)4 + NH4Cl3SnCl4 + 4(NH4)3PO4 = Sn3(PO4)4 + 12NH4Cl
SiCl4 + 3H2O = H2SiO3 + 4HClSiCl4 + 3H2O = H2SiO3 + 4HCl
SiCl4(g) + 2H2 (g)=Si(s) + 4HCl(g)SiCl4(g) + 2H2(g) = Si(s) + 4HCl(g)
Sn + HNO3 = Sn(NO3)2 + H2O + NH4NO34Sn + 10HNO3 = 4Sn(NO3)2 + 3H2O + NH4NO3
Si2 + HF = SiF4 + HSi2 + 8HF = 2SiF4 + 8H
S+O2=SO32S + 3O2 = 2SO3
SiCl4(g) + 2H2(g) = Si(s) + 4HCl(g)SiCl4(g) + 2H2(g) = Si(s) + 4HCl(g)
SiO2 + CH3COOH = SiCH3COOH + O2SiO2 + CH3COOH = SiCH3COOH + O2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2+ CO = Sn+ CO2SnO2 + 2CO = Sn + 2CO2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S+HNO3=H2SO4+NO2+H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2+O2+2H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+2H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr3P2+K2Se=3SrSe+3K3PSr3P2 + 3K2Se = 3SrSe + 2K3P
Si(OH)4+NaBr=SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
S+O2=SO2S + O2 = SO2
Sb2S3 + Fe = 3FeS + 2SbSb2S3 + 3Fe = 3FeS + 2Sb
SnO+NF3=SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
S+ HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn + AgPO3 = Sn3(PO3)4 + Ag3Sn + 4AgPO3 = Sn3(PO3)4 + 4Ag
SO2+O2+CaCO3=CaSO4+CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
Si2H3 + O2= SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S+O2=SO32S + 3O2 = 2SO3
SbCl3+H2O=Sb(O)Cl+HClSbCl3 + H2O = Sb(O)Cl + 2HCl
S+H2SO4=SO2+2H2OS + 2H2SO4 = 3SO2 + 2H2O
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 =SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl + O2 =SeO2 + Cl22SeCl + 2O2 = 2SeO2 + Cl2
Sb2S3 + O2 = Sb4O6 + SO2 2Sb2S3 + 9O2 = Sb4O6 + 6SO2
SnCl4=Sn+Cl2SnCl4 = Sn + 2Cl2
SnCl4=Sn+Cl2SnCl4 = Sn + 2Cl2
S8+O2=SO3S8 + 12O2 = 8SO3
SrO + Al = Sr + Al2O33SrO + 2Al = 3Sr + Al2O3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SeCl6+O2=SeO2=Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S2- + I2 + OH- = SO4 2- + I- +H2O2S2- + 167I2 + 336OH- = 4SO42- + 334I- + 168H2O
S2- + I2 + OH- = SO4 2- + I- +H2O2S2- + 167I2 + 336OH- = 4SO42- + 334I- + 168H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SbCL5+KI=KCI+I2 =SbCL5SbCL5 + 0KI = 0KCI + 0I2 + SbCL5
Sr+O2=2SrO2Sr + O2 = 2SrO
SiCl4 = Si + Cl2SiCl4 = Si + 2Cl2
S2O32- + ClO3- + H+ = S4O62- + Cl- +H2O4S2O32- - ClO3- + 2H+ = 2S4O62- - Cl- + H2O
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sn + KOH = K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
SiI4(s)+Mg(s)=Si(s)+MgI2(s)SiI4(s) + 2Mg(s) = Si(s) + 2MgI2(s)
S+O2=SO32S + 3O2 = 2SO3
Sb2S3 + Fe = Sb + FeSSb2S3 + 3Fe = 2Sb + 3FeS
Sb2S3 + Fe = Sb + FeSSb2S3 + 3Fe = 2Sb + 3FeS
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sn+HNO3=Sn (NO3)2+H2O+NH4NO34Sn + 10HNO3 = 4Sn(NO3)2 + 3H2O + NH4NO3
S8+F2=SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2(g) +O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S8 + F2 = SF6S8 + 24F2 = 8SF6
SnO2+ H2= Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO4 +O2 = SO32SO4 - O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S8+O2=SO2S8 + 8O2 = 8SO2
S+O2=SO32S + 3O2 = 2SO3
SR(s) + H2O=SR(OH)2(aq)+H2(g)SR(s) + 2H2O = SR(OH)2(aq) + H2(g)
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + HF = H2O + SiF4SiO2 + 4HF = 2H2O + SiF4
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sr+P4=Sr3P26Sr + P4 = 2Sr3P2
Sn + H3PO4 = H3 + Sn3(PO4)43Sn + 4H3PO4 = 4H3 + Sn3(PO4)4
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiO2 + 2NaOH =H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
SnCl 2 (g) + O 2 (g) =SnO 2 (s) + Cl 2 SnCl2(g) + O2(g) = SnO2(s) + Cl2
Sn(NO2)4 + Pt3N4 = Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sn+Cu(NO3)2=Sn(NO3)4+CuSn + 2Cu(NO3)2 = Sn(NO3)4 + 2Cu
S8 +F2 =SF6S8 + 24F2 = 8SF6
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S2Cl2+H2O=SO2+HCl+S2S2Cl2 + 2H2O = SO2 + 4HCl + 3S
Sr + O2 = SrO2Sr + O2 = SrO2
SnO2 + (NH4)NO3 = Sn(NO3)2 + (NH4)OSnO2 + 2(NH4)NO3 = Sn(NO3)2 + 2(NH4)O
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
S8+O2=SO2S8 + 8O2 = 8SO2
S2Cl2 + H2O = SO2 + HCl + S2S2Cl2 + 2H2O = SO2 + 4HCl + 3S
S+O2= SO32S + 3O2 = 2SO3
SrO + 2Al = 3Sr + Al2O33SrO + 2Al = 3Sr + Al2O3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S2Cl2 + H2O = SO2 + HCl + S2S2Cl2 + 2H2O = SO2 + 4HCl + 3S

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.