Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+KMnO4 = K2SO4+MnO2S + 2KMnO4 = K2SO4 + 2MnO2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+Na2CrO4+H2SO4= Na2SO4+Cr(SO4)3+H2O0SO2 + Na2CrO4 + 4H2SO4 = Na2SO4 + Cr(SO4)3 + 4H2O
SO4 + NH3 = SO3 + H2O + N23SO4 + 2NH3 = 3SO3 + 3H2O + N2
SO2+H2O=H2SO4+SO2SO2 + H2O = H2SO4 + SO
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SiO2 +HF =SiF4 +H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 +HF =SiF4 +H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2O3+NaOH=NaSbO2+H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
SnCl4 +K3PO4 = Sn3(PO4)4 + KCl3SnCl4 + 4K3PO4 = Sn3(PO4)4 + 12KCl
SnO+O2=SnO22SnO + O2 = 2SnO2
S8+H2SO4=SO2+H2OS8 + 16H2SO4 = 24SO2 + 16H2O
Sn+KOH=K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
Sr(OH)2+FeCl3=SrCl2+Fe(OH)33Sr(OH)2 + 2FeCl3 = 3SrCl2 + 2Fe(OH)3
Sr(OH)2+ FeCl3 = SrCl2 + Fe(OH)33Sr(OH)2 + 2FeCl3 = 3SrCl2 + 2Fe(OH)3
Sb2O3+NaOH = NaSbO2+H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
SiCl4(l) + H2O = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O = SiO2(s) + 4HCl(aq)
SiCl4(l) + H2O = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O = SiO2(s) + 4HCl(aq)
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
SbCl3 + Na3PO4 = Sb(PO4) + NaClSbCl3 + Na3PO4 = Sb(PO4) + 3NaCl
SbCl3 + Na3PO4 = Sb3(PO4)3 + NaCl3SbCl3 + 3Na3PO4 = Sb3(PO4)3 + 9NaCl
SnCl2 + Na2S = SnS + NaClSnCl2 + Na2S = SnS + 2NaCl
SnF4+O2=SnO + F2SnF4 + O2 = 2SnO + 8F
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SO2(g) + H2(g) = H2S(g) + H2O(g)SO2(g) + 3H2(g) = H2S(g) + 2H2O(g)
SiI4+Mg = Si+MgI2SiI4 + 2Mg = Si + 2MgI2
SO2 + O2= SO2SO2 + 0O2 = SO2
Sr + H2O= Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
SO2 + O2 = SO2SO2 + 0O2 = SO2
S + KNO3 = K2SO4 + SO2 + N22S + 2KNO3 = K2SO4 + SO2 + N2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + H2(CO3) = Sn(CO3) + H2Sn + H2(CO3) = Sn(CO3) + H2
SnCl2 + NaOH = Na2Sn(OH)4 + NaClSnCl2 + 4NaOH = Na2Sn(OH)4 + 2NaCl
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g)+O2(g)=SO2(g)SO2(g) + 0O2(g) = SO2(g)
SiCl4(l)+H2O(l) = SiO2(s)+HCl(g)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(g)
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SiO2 +Mg = Si + MgOSiO2 + 2Mg = Si + 2MgO
S + O2 = SO2S + O2 = SO2
S8 + F2 = 8SF6S8 + 24F2 = 8SF6
S8+O2=SO3S8 + 12O2 = 8SO3
SO4+NH3=SO3+H20+N20SO4 + 20NH3 = 0SO3 + 3H20 + 10N2
Sn + Au(NO3)3=Sn(NO3) + Au3Sn + Au(NO3)3 = 3Sn(NO3) + Au
Sn + 4 Au(NO3)3=Sn(NO3) + Au3Sn + Au(NO3)3 = 3Sn(NO3) + Au
S + O2 = SO2S + O2 = SO2
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
S+O2=SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(OH)2 + H2O = HSr(OH)2 + OHSr(OH)2 + H2O = HSr(OH)2 + OH
SO3 + Cu = SO4 + Cu0SO3 + Cu = 0SO4 + Cu
SiO+3C=SiC+2COSiO + 2C = SiC + CO
Sn + KOH = K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
SiF4 + H2O = H2 + SiF6 + H2 SiO33SiF4 + 3H2O = 2H2 + 2SiF6 + H2SiO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SbCl5+H2O=SbOCl3+ HClSbCl5 + H2O = SbOCl3 + 2HCl
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
S8 + O2 = SO3S8 + 12O2 = 8SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SrC2O4+ H2O= HC2O4 +SrOHSrC2O4 + H2O = HC2O4 + SrOH
SrCO3 + H2SO4 = SrSO4 + H2CO3SrCO3 + H2SO4 = SrSO4 + H2CO3
Sc(OH)3 + HBr = Sc(Br)3 + 3H2OSc(OH)3 + 3HBr = Sc(Br)3 + 3H2O
Sb+Cl 2 = Sb Cl 2Sb + Cl2 = 2SbCl
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 + NaOH = Na2SO4 + H2OSO3 + 2NaOH = Na2SO4 + H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sn3(BO3 )4=Sn+B+O2=Sn3(BO3)4 = 3Sn + 4B + 6O2
SO2 +H2 =H2S + H2O SO2 + 3H2 = H2S + 2H2O
Si O2 + C =Si C + CO SiO2 + 3C = SiC + 2CO
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Sb +Cl2= SbCl3 2Sb + 3Cl2 = 2SbCl3
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SiO2+C=SiC+2COSiO2 + 3C = SiC + 2CO
Sr + Cu2SO4= SrSO4 + 2 Cu Sr + Cu2SO4 = SrSO4 + 2Cu
Sr + Cu2SO4= SrSO4 + 2 Cu Sr + Cu2SO4 = SrSO4 + 2Cu
S8+Na2SO3+H2O=Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
Sn+Au(NO3)3=Sn(NO3)+Au3Sn + Au(NO3)3 = 3Sn(NO3) + Au
SO2+ O2+ H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+ O2+ H2O = HSO44SO2 + 3O2 + 2H2O = 4HSO4
SrCO3 + H3PO4 = H2O + CO2 + Sr3(PO4)23SrCO3 + 2H3PO4 = 3H2O + 3CO2 + Sr3(PO4)2
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sb + O2 = Sb4O6 4Sb + 3O2 = Sb4O6
S2- +F2 = S + F-2S2- + F2 = 4S + 2F-
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sn + Au(NO3)3= Sn(NO3)2 +Au3Sn + 2Au(NO3)3 = 3Sn(NO3)2 + 2Au
SnC2O4(s) + HNO3(aq) = Sn(NO3)4(s) + NO2(g) + H2(g) + CO2(g)SnC2O4(s) + 4HNO3(aq) = Sn(NO3)4(s) + 0NO2(g) + 2H2(g) + 2CO2(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnC2O4 + HNO3 = Sn(NO3)4 + NO2 + H2 + CO2SnC2O4 + 4HNO3 = Sn(NO3)4 + 0NO2 + 2H2 + 2CO2
SnC2O4 + HNO3 = Sn(NO3)4 + NO2 + H2 + CO2SnC2O4 + 4HNO3 = Sn(NO3)4 + 0NO2 + 2H2 + 2CO2
SnC2O4 + HNO3 = Sn(NO3)4 + NO + H2 + CO2SnC2O4 + 4HNO3 = Sn(NO3)4 + 0NO + 2H2 + 2CO2
SnC2O4 + HNO3 = Sn(NO3)4 + NO2 + H2 + CO2SnC2O4 + 4HNO3 = Sn(NO3)4 + 0NO2 + 2H2 + 2CO2
SnC2O4 + HNO3 = Sn(NO3)4 + NO2 + H2 + CO2SnC2O4 + 4HNO3 = Sn(NO3)4 + 0NO2 + 2H2 + 2CO2
Sr3(PO4)2 + CO2 + Si = SrSiO3 + CO + P42Sr3(PO4)2 + 2CO2 + 6Si = 6SrSiO3 + 2CO + P4
Si2H3+O2 =SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Si2H3+O2 =SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S8(s) + P4(s) =P4S3(s) 3S8(s) + 8P4(s) = 8P4S3(s)
Sb(s) +O2 (g) =Sb2O3 (s) 4Sb(s) + 3O2(g) = 2Sb2O3(s)
Sn(s)+O2(g)=SnO(s)2Sn(s) + O2(g) = 2SnO(s)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sb(s) + O2 (g) = Sb2O5 (s) 4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiO2 + H2O = H4SiO4SiO2 + 2H2O = H4SiO4
S2- + 4H2O = H2S + HS- + OH-0S2- + H2O = H2S - HS- + OH-
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8 +O2 = SO3S8 + 12O2 = 8SO3
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
Sn + Au(NO3)3 = SnNO3 + Au3Sn + Au(NO3)3 = 3SnNO3 + Au
Sn + Cu(No3)2 = SnNo3 +Cu2Sn + Cu(No3)2 = 2SnNo3 + Cu
Sn + AuNO3 = SnNO3 + AuSn + AuNO3 = SnNO3 + Au
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + AsF5 = S16(AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SbS2+HNO3=SbHNO3+S2SbS2 + HNO3 = SbHNO3 + S2
SbHNO3+HCl=SbCl3+H2+NO3SbHNO3 + 3HCl = SbCl3 + 2H2 + NO3
SbCl3+HNO3=SbHNO3+Cl3SbCl3 + HNO3 = SbHNO3 + Cl3
Sb2O3 + KMnO4 + HCl = MnCl2 + KCl + HSbO3 + H2O5Sb2O3 + 4KMnO4 + 12HCl = 4MnCl2 + 4KCl + 10HSbO3 + H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sr+P4=SrP4Sr + P4 = 4SrP
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb+O2= Sb4O64Sb + 3O2 = Sb4O6
SiO2 + 4 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
Sb+HNO3=Sb2O5+NO+H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Sc2O3+SO3=Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiF4 + H2O = HF + Si(OH)4SiF4 + 4H2O = 4HF + Si(OH)4
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SrCl2 + Na2CO3=SrCO3+NaClSrCl2 + Na2CO3 = SrCO3 + 2NaCl
SrCl2 + Mg (NO3)2=Sr (NO3) 2+MgCl2SrCl2 + Mg(NO3)2 = Sr(NO3)2 + MgCl2
SrCl2 + NaOH=Sr (OH) 2+NaClSrCl2 + 2NaOH = Sr(OH)2 + 2NaCl
Sn++ + Cr2O7-- + H+ = Sn++++ + Cr+++ + H2O3Sn++ + Cr2O7-- + 14H+ = 3Sn++++ + 2Cr+++ + 7H2O
SO2+H2O=H2SO3SO2 + H2O = H2SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SnCl2 + H2O = Sn(OH)Cl + HClSnCl2 + H2O = Sn(OH)Cl + HCl
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiH3+O2=SiO2+H2O34SiH3 + 13O2 = 4SiO2 + 6H2O3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sn(s)+NaOH(aq)=Na2SnO2(aq)+H2(g)Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO-2SO2 - 2KMnO4 + H2O = -2MnSO4 - K2SO4 + H2SO
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO-2SO2 - 2KMnO4 + H2O = -2MnSO4 - K2SO4 + H2SO
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
S2+Al3=AlS3S2 + 2Al3 = 6AlS
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2=SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb2S5 + HNO3 + H2O = H3SbO4 + H2SO4 + NO3Sb2S5 + 40HNO3 + 4H2O = 6H3SbO4 + 15H2SO4 + 40NO
SnCl2+Ba=BaCl2+SnSnCl2 + Ba = BaCl2 + Sn
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
Sn(NO3)2 = SnO + NO2 + O22Sn(NO3)2 = 2SnO + 4NO2 + O2
Sn+2H2O=Sn(OH)2+H2Sn + 2H2O = Sn(OH)2 + H2
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S8+SO3=SO2S8 + 16SO3 = 24SO2
SnO2+H2 = Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S+O2= SO32S + 3O2 = 2SO3
SnO2+H2 = Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S+O2=SO2S + O2 = SO2
S+O2= SO32S + 3O2 = 2SO3
S+O2= SO32S + 3O2 = 2SO3
SO3-- + CrO4-- + H+ = SO4-- + CrO2- + H2O3SO3-- + 2CrO4-- + 2H+ = 3SO4-- + 2CrO2- + H2O
Sn(s) + 2 AgClO4(aq) = 2 Ag(s) + Sn(ClO4)2(aq)Sn(s) + 2AgClO4(aq) = 2Ag(s) + Sn(ClO4)2(aq)
S8+Na2SO3+H2O=Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
Si+Cl2= SiCl4Si + 2Cl2 = SiCl4
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sb + Cl2= Sb Cl32Sb + 3Cl2 = 2SbCl3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sn(OH)3-1+Bi(OH)3+OH-1=Sn(OH)6-2+Bi3Sn(OH)3-1 + 2Bi(OH)3 + 3OH-1 = 3Sn(OH)6-2 + 2Bi
SnO2+H2 = Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SiO2+HF=H2SiF6+H2OSiO2 + 6HF = H2SiF6 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + H2SO4 = H2O + SO2S + 2H2SO4 = 2H2O + 3SO2
S + HNO3 = H2O + NO2 + H2SO4S + 6HNO3 = 2H2O + 6NO2 + H2SO4
S+O2=SO2S + O2 = SO2
Sb2S3 + Fe = Sb + FeSSb2S3 + 3Fe = 2Sb + 3FeS
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO3 + NH3 = NO + SO2 +H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
S8+SO3=SO2S8 + 16SO3 = 24SO2
Sr(NO3)2+Na2O=SrO+NaNO3Sr(NO3)2 + Na2O = SrO + 2NaNO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S8+Cu=Cu2SS8 + 16Cu = 8Cu2S
Sb + NaOH + O2 = NaSbO2 + H2O22Sb + 2NaOH + 2O2 = 2NaSbO2 + H2O2
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4+H2O= SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2Cl2 + HI = H2S +H2O + HCl + I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S+HNO3=SO3+H2O+NO2S + 6HNO3 = SO3 + 3H2O + 6NO2
SiCl4+Zn=ZnCl2+SiSiCl4 + 2Zn = 2ZnCl2 + Si
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + HNO3 + H2O = H2SO4 + NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
SnCl2+2FeCl3=2FeCl2+SnCl4SnCl2 + 2FeCl3 = 2FeCl2 + SnCl4
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S8+F2=SF6S8 + 24F2 = 8SF6
Sb + HNO3 = Sb2O5 +NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Se+NaOH=Na2Se+Na2SeO3+H2O3Se + 6NaOH = 2Na2Se + Na2SeO3 + 3H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SiO2 + F2 = SiF + O22SiO2 + F2 = 2SiF + 2O2
SiO4 + F2 = SiF + O22SiO4 + F2 = 2SiF + 4O2
Sn(OH)2+NaOH=Na2SnO2+H2OSn(OH)2 + 2NaOH = Na2SnO2 + 2H2O
S + N2O = SO2 + N2S + 2N2O = SO2 + 2N2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2= SO32SO2 + O2 = 2SO3
Sn+HNO3=Sn(NO3)4+NO2+H2OSn + 8HNO3 = Sn(NO3)4 + 4NO2 + 4H2O
S + O2 = SO2S + O2 = 2SO
S8 + O2 = SOS8 + 4O2 = 8SO
SiO2(s)+3C(s) =SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2 + 4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb2S3+O2 = Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SnCl4 + 2 H2S = 4 HCl + SnS2SnCl4 + 2H2S = 4HCl + SnS2
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S + Na2SO3 = Na2S2O3 S + Na2SO3 = Na2S2O3
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3 + H2 = Sb + H2SSb2S3 + 3H2 = 2Sb + 3H2S
SO3 = SO2 + O22SO3 = 2SO2 + O2
Sn + H3PO4 = H2 + Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
Sn + H3PO4 = H2 + Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sr+O2+C=SrCO3(s)2Sr + 3O2 + 2C = 2SrCO3(s)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnCl4 + H2S = SnS2 + HClSnCl4 + 2H2S = SnS2 + 4HCl
SiF4(s)+6H2O(l) =HF(aq)+SiO2(s)SiF4(s) + 2H2O(l) = 4HF(aq) + SiO2(s)
SO2 + 2 HIO3 + H2O = H2SO4 + I25SO2 + 2HIO3 + 4H2O = 5H2SO4 + I2
SO2 + 2 HIO3 + H2O = H2SO4 + I25SO2 + 2HIO3 + 4H2O = 5H2SO4 + I2
S8+F2=SF6S8 + 24F2 = 8SF6
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si(s) + 4HF(aq)=SiF4(g) + 2H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
S + HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S + KClO3 = KCl + SO23S + 2KClO3 = 2KCl + 3SO2
S + HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
S8+F2=SF6S8 + 24F2 = 8SF6
SO2(g)+O2 = SO3(g)2SO2(g) + O2 = 2SO3(g)
SiO2 + NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
Sc+NaOH+3H2O=Na3(Sc(OH)6)+3H22Sc + 6NaOH + 6H2O = 2Na3(Sc(OH)6) + 3H2
SbCl5 + 2KBr = SbCl3 + 2KCl + Br2SbCl5 + 2KBr = SbCl3 + 2KCl + Br2
Si4H10+O2= SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8+2O2=4S2OS8 + 2O2 = 4S2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3=SO2+O22SO3 = 2SO2 + O2
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sn+NaOH = Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
S + O2 = SO32S + 3O2 = 2SO3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 =SO32SO2 + O2 = 2SO3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3+Fe=FeS+SbSb2S3 + 3Fe = 3FeS + 2Sb
SO3 + 2H20 = H2SO4 + H200SO3 + H20 = 0H2SO4 + H20
SiCl4(l)+Mg(s)=Si(s)+MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
S8+O2=SO2S8 + 8O2 = 8SO2
SrCl2+H2SO4=HCl+SrSO4SrCl2 + H2SO4 = 2HCl + SrSO4
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SnCl6 + Na2S = SnS + Na + ClSnCl6 + Na2S = SnS + 2Na + 6Cl
Sn(s)+ NaOH(aq)=Na2SnO2(aq)+H2(g)Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
SbF3 + SnCl2 = SbCl3 + SnF22SbF3 + 3SnCl2 = 2SbCl3 + 3SnF2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S + NO3- + H+ = SO2 + NO + H2O3S + 4NO3- + 4H+ = 3SO2 + 4NO + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn2++ IO4- + H+ =Sn4+ + I-+ H2O-16Sn2+ + IO4- + 8H+ = -8Sn4+ + I- + 4H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Si4H10(l) + O2(g) = SiO2(s) + H2O(l) 2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SO2 + O2 = SO3 2SO2 + O2 = 2SO3
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
S+O2=SO2S + O2 = 2SO
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SnO2 + Al=Sn + Al2O33SnO2 + 4Al = 3Sn + 2Al2O3
SnCl2 + H3PO4 + H2O = HCl + Sn + H3PO40SnCl2 + H3PO4 + 0H2O = 0HCl + 0Sn + H3PO4
S8 + SO3 = SO2S8 + 16SO3 = 24SO2
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
S8+O2=SO3S8 + 12O2 = 8SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2 +H2O = H2SO3SO2 + H2O = H2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
SiO2+3C=SiC+2COSiO2 + 3C = SiC + 2CO
SOCl2+2NaOH=Na2SO3+HClSOCl2 + 2NaOH = Na2SO3 + 2HCl
SF4 + O2 + CH4 = SO2 + HF + CO2SF4 + 2O2 + CH4 = SO2 + 4HF + CO2
SiF4 + O2 + CH4 = SiO2 + HF + CO2SiF4 + 2O2 + CH4 = SiO2 + 4HF + CO2
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Si + S8 = Si2S44Si + S8 = 2Si2S4
Si + F2 = SiF4Si + 2F2 = SiF4
SiCl4 = Si + Cl2SiCl4 = Si + 2Cl2
S8+O2=SO2S8 + 8O2 = 8SO2
Si2H3+ O2=SiO2+ H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO3 +2H2O = H2SO4SO3 + H2O = H2SO4
SO2 + O2 + H20 = H2SO410SO2 + 10O2 + H20 = 10H2SO4
SnCl6 + S = SnS2 + ClSnCl6 + 2S = SnS2 + 6Cl
SnCl6 + S = SnS + ClSnCl6 + S = SnS + 6Cl
Sn + Cl = SnCl6Sn + 6Cl = SnCl6
Sb2O5 + S = SbS5 + OSb2O5 + 10S = 2SbS5 + 5O
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(C2H3O2)2 + K2SO4= KC2H3O2 + SrSO4Sr(C2H3O2)2 + K2SO4 = 2KC2H3O2 + SrSO4
Sr + N2 = Sr3N23Sr + N2 = Sr3N2
Sn + O2 = SnO2Sn + O2 = SnO2
Sn + O2 = SnO2Sn + O2 = 2SnO
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HCl = SnCl2 + H2Sn + 2HCl = SnCl2 + H2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO2S + O2 = SO2
Sn+HNO3= SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sr(CO3) = SrO +CO2Sr(CO3) = SrO + CO2
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
S2+3O2=2SO3S2 + 3O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S(s) + O2 = SO2S(s) + O2 = SO2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Sb+Cl2= SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2= SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2= SbCl32Sb + 3Cl2 = 2SbCl3
S(s)+O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sr(NO3)2+Cs2SO4= SrSO4+CsNO3Sr(NO3)2 + Cs2SO4 = SrSO4 + 2CsNO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SF4+H2O=SO2+HFSF4 + 2H2O = SO2 + 4HF
S8 + O2 =SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
S + HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S2- + NO3 + H = SO42- + H2O + N20S2- + 2NO3 + 12H = 0SO42- + 6H2O + N2
S8 + O2 = SO3S8 + 12O2 = 8SO3
Se + NaOH = Na2Se + Na2SeO3 + H2O3Se + 6NaOH = 2Na2Se + Na2SeO3 + 3H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+NaNO3+NaOH=Na2SO4+NaNO2+H2OS + 3NaNO3 + 2NaOH = Na2SO4 + 3NaNO2 + H2O
S + NaNO3 + NaOH = Na2SO4 + NaNO2 + H2OS + 3NaNO3 + 2NaOH = Na2SO4 + 3NaNO2 + H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SiO2+HF = SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiH4 + F = SiF4 + H2SiH4 + 4F = SiF4 + 2H2
SiO2 + H2 = SiH4 + O2SiO2 + 2H2 = SiH4 + O2
SF4+H2O=SO2+HFSF4 + 2H2O = SO2 + 4HF
S8+NO3-+H+=S4O6-2+NO2+H2OS8 + 20NO3- + 16H+ = 2S4O6-2 + 20NO2 + 8H2O
S8+NO3- +H+=S4O62-+NO2+H2OS8 + 246NO3- + 244H+ = 2S4O62- + 246NO2 + 122H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SbF3 + SnCl2 =SbCl3 + SnF22SbF3 + 3SnCl2 = 2SbCl3 + 3SnF2
SO2 + KMnO4 + H2O = K2SO4 + MnSO4 + H2SO45SO2 + 2KMnO4 + 2H2O = K2SO4 + 2MnSO4 + 2H2SO4
SO2(g) + O2(g) =  SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO(g) + O2(g) = SO3(g)SO(g) + O2(g) = SO3(g)
S(s) + O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sn+Au(NO3)3=Au+Sn(NO3)23Sn + 2Au(NO3)3 = 2Au + 3Sn(NO3)2
Sn + Pb(C2H3O2)2 = Sn(C2H3O2)4 +PbSn + 2Pb(C2H3O2)2 = Sn(C2H3O2)4 + 2Pb
S8 + O2 = SO3 S8 + 12O2 = 8SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S8+O2=SO3S8 + 12O2 = 8SO3
S+NaNO3+NaOH=Na2SO4+NaNO2+H2OS + 3NaNO3 + 2NaOH = Na2SO4 + 3NaNO2 + H2O
SrCl2(aq) + H2SO4(aq) = SrSO4 + HClSrCl2(aq) + H2SO4(aq) = SrSO4 + 2HCl
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2 + Ca2MgSi2O7 = Mg2SiO4 + CaSiO3SiO2 + 2Ca2MgSi2O7 = Mg2SiO4 + 4CaSiO3
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SIF4+H2O=H4SIO4+H2SIF63SIF4 + 4H2O = H4SIO4 + 2H2SIF6
SrCO3 + H2CO3 = Sr(HCO3)2SrCO3 + H2CO3 = Sr(HCO3)2
Sb2S3+HNO3=Sb2O5+NO2+S+H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+CuCl2= SnCl2+CuSn + CuCl2 = SnCl2 + Cu
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
Sb+Cl2=SbCl2Sb + Cl2 = SbCl2
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SrH2 + H2O = Sr2+ + H2 +OH-4SrH2 + 2H2O = 2Sr2+ + 5H2 + 2OH-
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiO2(s) + 4 HI(aq) = SiI4(g) + 2 H2O(l)SiO2(s) + 4HI(aq) = SiI4(g) + 2H2O(l)
SiHCl3 = SiH4 + SiCl44SiHCl3 = SiH4 + 3SiCl4
SO2 + H2O + O = H2SO4SO2 + H2O + O = H2SO4
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiO2(s)+6C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sn(NO3)4(aq)+H2S(aq)=HNO3(aq)+SnS2(s)Sn(NO3)4(aq) + 2H2S(aq) = 4HNO3(aq) + SnS2(s)
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
S8(s) + O2(g) =SO2S8(s) + 8O2(g) = 8SO2
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si(s)+Cl2(g)=SiCl4(l)Si(s) + 2Cl2(g) = SiCl4(l)
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
SO3 + 2H2O =2H2SO4SO3 + H2O = H2SO4
Sn(s) + HF(g) = SnF2 (s) + H2(g)Sn(s) + 2HF(g) = SnF2(s) + H2(g)
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + Li2Se = 2 SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SCl2+ NaF= S2Cl2+SF4+NaCl3SCl2 + 4NaF = S2Cl2 + SF4 + 4NaCl
SnCl4 (s) + F2 (g) = SnF4 (s) + Cl2 (g)SnCl4(s) + 2F2(g) = SnF4(s) + 2Cl2(g)
SO2+O2=SO2SO2 + 0O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S(s)+O2(g)+H2O(l)=H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S+KOH=K2S2O3+K2S+H2O4S + 6KOH = K2S2O3 + 2K2S + 3H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl 4 + Mg = Si + MgCl 2 SiCl4 + 2Mg = Si + 2MgCl2
Sr(IO3)2 = SrI2 + O2Sr(IO3)2 = SrI2 + 3O2
SiO2 + Al = Si + Al2O33SiO2 + 4Al = 3Si + 2Al2O3
SnCl2 + KNO3 = Sn(NO3)2 + KClSnCl2 + 2KNO3 = Sn(NO3)2 + 2KCl
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+2C= SiC+ COSiO2 + 3C = SiC + 2CO
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
SrCl2 + H3PO4 = SrPO4 + H3Cl2SrCl2 + H3PO4 = SrPO4 + H3Cl2
SO2(g) + H2O(l) = H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
Sn + HNO3 + HCl = NO4 + SnCl4 + H2O 3Sn - 4HNO3 + 12HCl = -4NO4 + 3SnCl4 + 4H2O
SO2+O2 = SO32SO2 + O2 = 2SO3
Sc2O3 + 6HCl = 2ScCl3 + 3H2OSc2O3 + 6HCl = 2ScCl3 + 3H2O
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb(s) + O2(g)=Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb2S3 + HNO3 = HSbO3 + S + NO + H2O3Sb2S3 + 10HNO3 = 6HSbO3 + 9S + 10NO + 2H2O
Sr+O2=2SrO2Sr + O2 = 2SrO
Sr+O2=2SrO2Sr + O2 = 2SrO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.