Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Sn + AgNO3 = Sn(NO3)2 + AgSn + 2AgNO3 = Sn(NO3)2 + 2Ag
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn +MgCl2 = SnCl2 +MgSn + MgCl2 = SnCl2 + Mg
Sn +CuCl2 = SnCl2 +Cu22Sn + 2CuCl2 = 2SnCl2 + Cu2
S + O2 = SO2S + O2 = 2SO
S + O2 = SO2S + O2 = 2SO
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SO2Cl2+HI=H2S+H2O+HCl+I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SiC + CO2 = SiO2 + COSiC + 3CO2 = SiO2 + 4CO
SiC + CO2 = SiO2 + COSiC + 3CO2 = SiO2 + 4CO
Sn(NO3)4 + H3(PO4) = Sn3(PO4)4 + H(NO3)3Sn(NO3)4 + 4H3(PO4) = Sn3(PO4)4 + 12H(NO3)
Sn(NO3)4 + H3(PO4) = Sn3(PO4)4 + HNO33Sn(NO3)4 + 4H3(PO4) = Sn3(PO4)4 + 12HNO3
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO2+O2 = SO32SO2 + O2 = 2SO3
SiCl4 + Mg=Si +MgCl2SiCl4 + 2Mg = Si + 2MgCl2
Sr(OH)2 + HC2H3O2 = Sr(C2H3O2)2 + H2OSr(OH)2 + 2HC2H3O2 = Sr(C2H3O2)2 + 2H2O
S8+F2=SF6S8 + 24F2 = 8SF6
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sn(OH)4 +V3(PO4)5 = V(OH)5 +Sn3(PO4)415Sn(OH)4 + 4V3(PO4)5 = 12V(OH)5 + 5Sn3(PO4)4
S8 + O2 = SO3S8 + 12O2 = 8SO3
SIO2+C=SI+COSIO2 + 2C = SI + 2CO
SiBr4+H2O=SiO2+HBrSiBr4 + 2H2O = SiO2 + 4HBr
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(OH)2 + FeCl3 = SrCl2 = Fe(OH)33Sr(OH)2 + 2FeCl3 = 3SrCl2 + 2Fe(OH)3
SO2 (g) + O2 (g) = SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
SO3+2H2O=H3O+HSO3SO3 - H2O = -1H3O + HSO3
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
S+O2=SO2S + O2 = SO2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sb+HNO3=Sb2O5+N2O+H2O8Sb + 10HNO3 = 4Sb2O5 + 5N2O + 5H2O
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiO2+C+Cl2=CO+SiCl4SiO2 + 2C + 2Cl2 = 2CO + SiCl4
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
S + O2 = SO2S + O2 = SO2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SiC + CO2 = SiO2 + COSiC + 3CO2 = SiO2 + 4CO
SiO2 + 4HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
SnCl2 + SO2 + HCl = SnCl4 + SnS2 + H2O6SnCl2 + 2SO2 + 8HCl = 5SnCl4 + SnS2 + 4H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
SO2+O2+4H2O=2H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(CO3)2(s) = SnO2(s) + CO2(g)Sn(CO3)2(s) = SnO2(s) + 2CO2(g)
S+O2 = SO32S + 3O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SnCl4 + HN3 = SnCl3 + HCl + N22SnCl4 + 2HN3 = 2SnCl3 + 2HCl + 3N2
S8 + 12O2= 8SO3S8 + 12O2 = 8SO3
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
S8 + F2 = SF6S8 + 24F2 = 8SF6
SrCl2+CoSO4=SrSO4+CoCl2SrCl2 + CoSO4 = SrSO4 + CoCl2
SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sr(OH)2 + H3PO4 = Sr3(PO4)2 + H2O3Sr(OH)2 + 2H3PO4 = Sr3(PO4)2 + 6H2O
Sr(NO3)2 + K3PO4 = KNO3 +Sr3(PO4)23Sr(NO3)2 + 2K3PO4 = 6KNO3 + Sr3(PO4)2
SO2+O2=SO4SO2 + O2 = SO4
SO2+O2=SO32SO2 + O2 = 2SO3
S8+Na2SO3+H2O=Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SnSO4(s)=SnSO3(s)+O2(g) 2SnSO4(s) = 2SnSO3(s) + O2(g)
S + HNO3 = SO3 + H2O + NO2S + 6HNO3 = SO3 + 3H2O + 6NO2
S + HNO3 = SO3 + H2O + NO2S + 6HNO3 = SO3 + 3H2O + 6NO2
Sb2S3(s) + O2(g)= Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SrO(s)=Sr+OSrO(s) = Sr + O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SrBr2 + NH4OH = NH4Br + Sr(OH)2SrBr2 + 2NH4OH = 2NH4Br + Sr(OH)2
Sn +4HNO3 = SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn +4HNO3 = SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl4 + H2O = H4SiO4 + 4HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + 12O2 = 8SO3 S8 + 12O2 = 8SO3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO3 = SO2 +O22SO3 = 2SO2 + O2
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SnO2 = SnO + O22SnO2 = 2SnO + O2
S + O2 = SO2S + O2 = SO2
S + O2 = SO2S + O2 = SO2
S + O2 = SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SnO+NF3= SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
SO3(g)+H2O(I)=H(aq)+H(I)+HSO4(aq)SO3(g) + H2O(I) = 0H(aq) + H(I) + HSO4(aq)
SO3(g)+H2O(I)=H(aq)+H(I)+HSO3(aq)SO3(g) + 0H2O(I) = -1H(aq) + 0H(I) + HSO3(aq)
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SeCl6 + O2= SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2= Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sr(NO3)2 + H2S = SrS + H2(NO3)2Sr(NO3)2 + H2S = SrS + H2(NO3)2
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SnO2 +H2 =Sn +H2OSnO2 + 2H2 = Sn + 2H2O
S2H5 + O2 = SO2 + H2O4S2H5 + 13O2 = 8SO2 + 10H2O
S2H5 + O2 = SO2 + H22O44S2H5 + 93O2 = 88SO2 + 10H22O
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SnCl2+HBF4=Sn(BF4)2+HClSnCl2 + 2HBF4 = Sn(BF4)2 + 2HCl
SO2+O2=SO32SO2 + O2 = 2SO3
Sb + H2O = Sb2O3 + H22Sb + 3H2O = Sb2O3 + 3H2
S + O2 + H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SiO2+HF=SiF4+H2O SiO2 + 4HF = SiF4 + 2H2O
SiO2=Si+2O2SiO2 = Si + O2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sr(OH)2+2HCl=2H2O+SrCl2Sr(OH)2 + 2HCl = 2H2O + SrCl2
SnCl4(aq)+Fe(s)=FeCl3(aq)+SnCl2(aq)3SnCl4(aq) + 2Fe(s) = 2FeCl3(aq) + 3SnCl2(aq)
S8 + O2= SO2S8 + 8O2 = 8SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
SrCO3+H2O=Sr(OH)2+CO2SrCO3 + H2O = Sr(OH)2 + CO2
SO3 + H2O = H2SO4 SO3 + H2O = H2SO4
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
Sn + HNO3 = SnO3 + NO2 + H2O Sn + 6HNO3 = SnO3 + 6NO2 + 3H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
Se(s) + O2(g) = SeO3(g)2Se(s) + 3O2(g) = 2SeO3(g)
Sb2S3 + Na2CO3 + C = Sb + Na2S + COSb2S3 + 3Na2CO3 + 6C = 2Sb + 3Na2S + 9CO
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiCl4 + H20(l) = Si02 (s) + HCl (aq)10SiCl4 + 2H20(l) = 5Si02(s) + 40HCl(aq)
Sn + HNO3 =SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SrO + H2O = Sr(OH)2SrO + H2O = Sr(OH)2
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 +O2 =SO32SO2 + O2 = 2SO3
Sb + Cl2 =SbCl32Sb + 3Cl2 = 2SbCl3
S+O2=SO32S + 3O2 = 2SO3
Sn+H2SO4=SnSO4+SO2+H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
SnCl2+H2O=Sn+2HCl+OSnCl2 + H2O = Sn + 2HCl + O
SO42-+4Fe = FeS+3FeO+O2- SO42- + 41Fe = FeS + 40FeO + O2-
SO42-+4Fe = FeS+3FeO+O2- SO42- + 41Fe = FeS + 40FeO + O2-
SiO2 + 3C(s) = SiC + 2COSiO2 + 3C(s) = SiC + 2CO
S8 + O2 = SO3S8 + 12O2 = 8SO3
Si + HNO3 + HF = H2SiF6 + NO2 + H2OSi + 4HNO3 + 6HF = H2SiF6 + 4NO2 + 4H2O
SrCl2(aq)+2AgNO3(aq)=2AgCl(s)+Sr(NO3)2(aq)SrCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Sr(NO3)2(aq)
Si+S8=Si2S44Si + S8 = 2Si2S4
SO4+Ba(NO3) = Ba(NO3)(SO4)SO4 + Ba(NO3) = Ba(NO3)(SO4)
SO4+Ba(NO3) = Ba(NO3)SO4SO4 + Ba(NO3) = Ba(NO3)SO4
So32- + Fe3+ = So42- + Fe2+-21So32- + 10Fe3+ = -16So42- + 15Fe2+
SnO + NF3 = SnF2 + N2O33SnO + 2NF3 = 3SnF2 + N2O3
SO2+O2+2H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn(OH)4 + V3(PO4)5 = Sn3(PO4)4 + V(OH)515Sn(OH)4 + 4V3(PO4)5 = 5Sn3(PO4)4 + 12V(OH)5
SNO2 + 2H2 = SN + H2OSNO2 + 2H2 = SN + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnCl4+K3PO4=Sn3(PO4)4+KCl3SnCl4 + 4K3PO4 = Sn3(PO4)4 + 12KCl
Sb+CuCrO4=Sb2(CrO4)5+Cu2Sb + 5CuCrO4 = Sb2(CrO4)5 + 5Cu
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+ O2= SO32SO2 + O2 = 2SO3
SO3+KOH=K2SO4+H2OSO3 + 2KOH = K2SO4 + H2O
SnCl2+K2Cr2O7+HCl = SnCl4+CrCl3+KCl+H2O3SnCl2 + K2Cr2O7 + 14HCl = 3SnCl4 + 2CrCl3 + 2KCl + 7H2O
Sb+HNO3=Sb2O5+NO+H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
S +H2O =S OH +H22S + 2H2O = 2SOH + H2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S + KMnO4 = K2SO4 + MnO2S + 2KMnO4 = K2SO4 + 2MnO2
Sb2(SO4)3 + KMnO4 + H2O = H3SbO4 + K2SO4 +MnSO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SnSO4 + K2Cr2O7 + H2SO4 = Sn(SO4)2 + K2SO4 + Cr2(SO4)3 + H2O3SnSO4 + K2Cr2O7 + 7H2SO4 = 3Sn(SO4)2 + K2SO4 + Cr2(SO4)3 + 7H2O
SiH4 + N2F4 = SiF4 + H2 + N2SiH4 + N2F4 = SiF4 + 2H2 + N2
SO4+Sr=SrSO4SO4 + Sr = SrSO4
SiO2+Ca3(PO4)2+C=P4+CaSiO3+CO6SiO2 + 2Ca3(PO4)2 + 10C = P4 + 6CaSiO3 + 10CO
S6+O2=SO3S6 + 9O2 = 6SO3
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrS+Na2SO4=SrSO4+Na2SSrS + Na2SO4 = SrSO4 + Na2S
SiO2 + 6C = SiC + 2COSiO2 + 3C = SiC + 2CO
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SnOH+++ + NH4F + OH- = SnF4 + H2O + NH3SnOH+++ + 4NH4F + 3OH- = SnF4 + 4H2O + 4NH3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S-1(aq) + Cl3-1(aq) = S(s) + Cl-1(aq)2S-1(aq) + Cl3-1(aq) = 2S(s) + 3Cl-1(aq)
Sr +N2 = Sr3N23Sr + N2 = Sr3N2
Sr +N2 = SrN2Sr + N2 = SrN2
SnO2 + CO = Sn + CO2SnO2 + 2CO = Sn + 2CO2
SnO2 + CO = Sn + CO2SnO2 + 2CO = Sn + 2CO2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SnO2+C=Sn+CO2SnO2 + C = Sn + CO2
SF4+3H2O=H2SO3+4HFSF4 + 3H2O = H2SO3 + 4HF
S8+F2 =SF6S8 + 24F2 = 8SF6
S + O2 = SO2S + O2 = SO2
SO32- + Ce4+ +H20 = SO42- + Ce3+ +H+0SO32- - 60Ce4+ + H20 = 0SO42- - 80Ce3+ + 20H+
SO32- + Ce4+ +H20 = SO42- + Ce3+ +H+0SO32- - 60Ce4+ + H20 = 0SO42- - 80Ce3+ + 20H+
SO3-2 + Ce4+ +H20 = SO42- + Ce3+ +H+0SO3-2 - 60Ce4+ + H20 = 0SO42- - 80Ce3+ + 20H+
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 (g)+ O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb + KClO4 + H2SO4 = Sb2(SO4)3 + KCl + H2O8Sb + 3KClO4 + 12H2SO4 = 4Sb2(SO4)3 + 3KCl + 12H2O
Sb + KClO4 + H2SO4 = Sb2(SO4)3 + KCl + H22Sb + 0KClO4 + 3H2SO4 = Sb2(SO4)3 + 0KCl + 3H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+Cl2+H2O=H2SO4+HClSO2 + Cl2 + 2H2O = H2SO4 + 2HCl
SnCl2+K2Cr2O7+H2SO4=Sn(SO4)2+SnCl4+Cr2(SO4)3+K2SO4+7H2O6SnCl2 + 2K2Cr2O7 + 14H2SO4 = 3Sn(SO4)2 + 3SnCl4 + 2Cr2(SO4)3 + 2K2SO4 + 14H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SnSO4+Na2S=SnS+Na2SO4SnSO4 + Na2S = SnS + Na2SO4
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8 + Cu = Cu2SS8 + 16Cu = 8Cu2S
S8+O2=SO3S8 + 12O2 = 8SO3
Sn(OH)4(s)+H2SO3(aq)=SnSO4(aq)+2H2O(l)Sn(OH)4(s) + H2SO3(aq) = SnSO4(aq) + 3H2O(l)
SO3(g)= SO2(g) + O2(g)2SO3(g) = 2SO2(g) + O2(g)
SnS2+HCl=H2SnCl6+H2SSnS2 + 6HCl = H2SnCl6 + 2H2S
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2010Sn + 20HNO3 = 10SnO2 + 20NO2 + H20
Sn+AgF=Ag+SnF2Sn + 2AgF = 2Ag + SnF2
Sb2S3 + Fe = 3FeS + SbSb2S3 + 3Fe = 3FeS + 2Sb
Se + NaOH = Na2Se + Na2SeO3 + H2O3Se + 6NaOH = 2Na2Se + Na2SeO3 + 3H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr(OH)2(aq)+ FeCl2(aq) = Fe(OH)2(s) + SrCl2(s)Sr(OH)2(aq) + FeCl2(aq) = Fe(OH)2(s) + SrCl2(s)
Sr(OH)2(aq)+ FeCl2(aq) = Fe(OH)2 + SrCl2Sr(OH)2(aq) + FeCl2(aq) = Fe(OH)2 + SrCl2
Sr(OH)2 + FeCl2 = Fe(OH)2 + SrCl2Sr(OH)2 + FeCl2 = Fe(OH)2 + SrCl2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S8+O2=SO2S8 + 8O2 = 8SO2
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Si6H6+H2O=Si(OH)4+H2O0Si6H6 + H2O = 0Si(OH)4 + H2O
Si6H6+H2O=Si(OH)4+H2O0Si6H6 + H2O = 0Si(OH)4 + H2O
SbCl5 + H2O = SbOCl3 + HClSbCl5 + H2O = SbOCl3 + 2HCl
S8+F2=SF6S8 + 24F2 = 8SF6
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO3=SO2+O22SO3 = 2SO2 + O2
SO2 + Li2Se = SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2 + NaIO3 + H2O = H2SO4 + Na2SO4 + I25SO2 + 2NaIO3 + 4H2O = 4H2SO4 + Na2SO4 + I2
S+O2=SO32S + 3O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
Sn (s) + O2 (g) = SnO2 (s)Sn(s) + O2(g) = SnO2(s)
S8 (s) + O2 (g) = SO2 (g)S8(s) + 8O2(g) = 8SO2(g)
S8 (s) + O2 (g) = SO2 (g)S8(s) + 8O2(g) = 8SO2(g)
S2O8 + C14H30 + H2O = CO2 + HSO443S2O8 + C14H30 + 28H2O = 14CO2 + 86HSO4
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + HF=SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + HF= SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8 + Fe = Fe2S33S8 + 16Fe = 8Fe2S3
SHg + CaO = SCa + HgOSHg + CaO = SCa + HgO
S2Fe + O2 = SO2 + Fe2O34S2Fe + 11O2 = 8SO2 + 2Fe2O3
S + O2 = SO32S + 3O2 = 2SO3
SiO2 + Ca3(PO4)2 = CaSiO3 + P2O53SiO2 + Ca3(PO4)2 = 3CaSiO3 + P2O5
SCu2 + O2 = SO2 + Cu2O2SCu2 + 3O2 = 2SO2 + 2Cu2O
Sb2S3+HNO3=H3SbO4+SO2+NO+H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb2S3(s) + HCl(aq) = SbCl3(s) + H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO3 = S8 + O28SO3 = S8 + 12O2
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
SO2+O2= SO32SO2 + O2 = 2SO3
SnCl2 + CH3OCH2CH2OH + O2 = SnO2 + CO2 + HCl4SnCl2 + CH3OCH2CH2OH + 6O2 = 4SnO2 + 3CO2 + 8HCl
SnCl2 + CH3OCH2CH2OH + O2 = SnO2 + CO2 + HCl4SnCl2 + CH3OCH2CH2OH + 6O2 = 4SnO2 + 3CO2 + 8HCl
SnCl2 + CH3OCH2CH2OH + O2 = SnO2 + CO2 + HCl4SnCl2 + CH3OCH2CH2OH + 6O2 = 4SnO2 + 3CO2 + 8HCl
SnCl2 + CH3OCH2CH2OH + NH4NO3 = SnO2 + CO2 + NH3 + HCl8SnCl2 + 5CH3OCH2CH2OH + 12NH4NO3 = 8SnO2 + 15CO2 + 24NH3 + 16HCl
SnCl2 + CH3OCH2CH2OH = SnO2 + CO2 + H2O + HCl8SnCl2 - CH3OCH2CH2OH = 8SnO2 - 3CO2 - 12H2O + 16HCl
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S8 + O2 = SO2S8 + 8O2 = 8SO2
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiO2(s)+C(s)=Si(s)+CO(g)SiO2(s) + 2C(s) = Si(s) + 2CO(g)
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S + O3= SO3S + O3 = SO3
Sb+Cl2= SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2= SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S+O2=SO2S + O2 = SO2
S2+O2=SO3S2 + 3O2 = 2SO3
SO2+ Li2Se= SSe2+ Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S + HNO3 = H2SO4 + NO2 + H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SF6+H2O=H2SO4+HFSF6 + 4H2O = H2SO4 + 6HF
SF6+H2O=H2SO4+HFSF6 + 4H2O = H2SO4 + 6HF
SF6+H2O=H2SO4+HFSF6 + 4H2O = H2SO4 + 6HF
SF6+H2O=H2SO4+HFSF6 + 4H2O = H2SO4 + 6HF
S8+O2=SO2S8 + 8O2 = 8SO2
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2(g)+O2(g)=SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
SO2+ Cl2 + H2O = HCl + H2SO4SO2 + Cl2 + 2H2O = 2HCl + H2SO4
SO2+ Cl2 + H2O = HCl + H2SO4SO2 + Cl2 + 2H2O = 2HCl + H2SO4
Sr+Cu2SO4=SrSO4+CuSr + Cu2SO4 = SrSO4 + 2Cu
SiCl4 (l) + H2O (l) = SiO2 (s) + HCl (aq) SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S2 + O2 = SO2S2 + 2O2 = 2SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Si + HNO3 + HF = H2SiF6 +NO2 + H205Si + 0HNO3 + 30HF = 5H2SiF6 + 0NO2 + H20
Sn(s)+NaOH(aq)=Na2SnO2+H2Sn(s) + 2NaOH(aq) = Na2SnO2 + H2
Sn(s)+NaOH(aq)=Na2SnO2+H2Sn(s) + 2NaOH(aq) = Na2SnO2 + H2
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sn2+ + MnO4- = Sn4+ + Mn2+ + O6Sn2+ + 2MnO4- = 3Sn4+ + Mn2+ + 8O
SrS + Cu(SO4) = SrSO4 + CuSSrS + Cu(SO4) = SrSO4 + CuS
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + Na2SO3 = Na2S2O3S8 + 8Na2SO3 = 8Na2S2O3
SO2 + AuCl3 + H2O = Au + H2SO4 + HCl3SO2 + 2AuCl3 + 6H2O = 2Au + 3H2SO4 + 6HCl
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + AuCl3 + H2O = Au + H2SO4 + HCl3SO2 + 2AuCl3 + 6H2O = 2Au + 3H2SO4 + 6HCl
SO3 + Al (OH)3 = Al2 (SO4)3 + H2O3SO3 + 2Al(OH)3 = Al2(SO4)3 + 3H2O
SnO2 + H2 =Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3 + HCl =SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SeO2+H2O=H2O3+SeSeO2 + H2O = H2O3 + Se
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SeCl6 +O2=SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SnO + NH3 = N2 + H2O + Sn3SnO + 2NH3 = N2 + 3H2O + 3Sn
Sn(No3)2 + LiCl = SnCl2 + LiNo3Sn(No3)2 + 2LiCl = SnCl2 + 2LiNo3
Sn(NO3)4 + Na3PO4 =NaNO3 + Sn3(PO4)4 3Sn(NO3)4 + 4Na3PO4 = 12NaNO3 + Sn3(PO4)4
Sr(OH)2*8H2O + 2 NH4Cl = SrCl2 + 2 NH3 + 10 H2OSr(OH)2*8H2O + 2NH4Cl = SrCl2 + 2NH3 + 10H2O
SO3 = SO4 + O2-2SO3 = -2SO4 + O2
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S + O2 = SO2S + O2 = SO2
Sr + N2 = Sr3N23Sr + N2 = Sr3N2
Sb2O3 + 3C = CO + SbSb2O3 + 3C = 3CO + 2Sb
Sm2O3 + Ba = 2Sm + 3BaOSm2O3 + 3Ba = 2Sm + 3BaO
SiO2 + NaOH = H2O +Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = SO2
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2 + H2O + Br2 = H+ + SO4 2- + Br-2SO2 + 80H2O + 79Br2 = 160H+ + 2SO42- + 158Br-
SO2 + H2O + Br2 = H+ + SO42- + Br-2SO2 + 80H2O + 79Br2 = 160H+ + 2SO42- + 158Br-
S+O2=SO32S + 3O2 = 2SO3
SO2(g)+HNO3(aq)+H2O(l)=H2SO4(aq)+NO(g)3SO2(g) + 2HNO3(aq) + 2H2O(l) = 3H2SO4(aq) + 2NO(g)
SiF4+H2O=H2SiO3+HFSiF4 + 3H2O = H2SiO3 + 4HF
SnO2+ CO =Sn+ CO2SnO2 + 2CO = Sn + 2CO2
SiF4+H2O=H2SiO3+H2SiF63SiF4 + 3H2O = H2SiO3 + 2H2SiF6
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3 + HCl = SbCl3 + 3H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sr(OH)2(aq) + H3PO4(aq) = Sr3(PO4)2(s) + H2O(l)3Sr(OH)2(aq) + 2H3PO4(aq) = Sr3(PO4)2(s) + 6H2O(l)
SnO2 = SnO + O22SnO2 = 2SnO + O2
Sb2S3+6HCl=2SbCl3+3H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SnO2 +CO = Sn + CO2SnO2 + 2CO = Sn + 2CO2
SiH4+O2=SiO2+H2OSiH4 + 2O2 = SiO2 + 2H2O
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn+H2SO4=Sn(SO4)2+SO2+H2OSn + 4H2SO4 = Sn(SO4)2 + 2SO2 + 4H2O
Sn+H2SO4=Sn(SO4)2+SO2+H205Sn + 10H2SO4 = 5Sn(SO4)2 + 0SO2 + H20
Sn+H2SO4=Sn(SO4)2+SO2+H2211Sn + 22H2SO4 = 11Sn(SO4)2 + 0SO2 + 2H22
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO3(g)+H2O(l)=H2SO4SO3(g) + H2O(l) = H2SO4
Sb + HNO3 = Sb2O5 + NO +H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
SbO33- + I2 + HCO3 = SbO43- + I- + CO2 + H2OSbO33- + 0I2 + 20HCO3 = SbO43- + 0I- + 20CO2 + 10H2O
SnCl2 + 2 HCl + H2O2 = SnCl4 + 2 H2OSnCl2 + 2HCl + H2O2 = SnCl4 + 2H2O
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
S8 + 12O2 = 8SO3 S8 + 12O2 = 8SO3
SO4 + Ba = BaSO4SO4 + Ba = BaSO4
S8 + NO3 = SO3 + NOS8 + 12NO3 = 8SO3 + 12NO
Sn + CuSO4= SnSO4 + CuSn + CuSO4 = SnSO4 + Cu
Sn + O2 + CaCl = SnCl4 + CaOSn + 2O2 + 4CaCl = SnCl4 + 4CaO
Sn + O2 + CaCl = SnCl4 + CaOSn + 2O2 + 4CaCl = SnCl4 + 4CaO
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnO2 + NaOH = Sn(OH)4 + Na+ + H2O-1SnO2 + 0NaOH = -1Sn(OH)4 + 0Na+ + 2H2O
Sr(OH)2 + H2S = Sr2S2 + H2O2Sr(OH)2 + 2H2S = Sr2S2 + 4H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
Sn(OH)2 + 2H=Sn + 2H2OSn(OH)2 + 2H = Sn + 2H2O
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S8+O2=SO2S8 + 8O2 = 8SO2
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO2+O2=2SO32SO2 + O2 = 2SO3
Sb + I2 = SbI32Sb + 3I2 = 2SbI3
SO2+O2=(SO2)O2SO2 + O2 = (SO2)O2
SO3=SO2+O22SO3 = 2SO2 + O2
SO2+H2=S+ H2O SO2 + 2H2 = S + 2H2O
SO2+H2=S+ H2O SO2 + 2H2 = S + 2H2O
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SnO2 = SnO + O22SnO2 = 2SnO + O2
SiCl4(l ) + Mg(s) = Si(s) + MgCl2SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2
S + O2 + H2O = SO42- + H+4S + 83O2 + 2H2O = 4SO42- + 4H+
SnO2 + C = Sn + COSnO2 + 2C = Sn + 2CO
SnO2 + C = Sn + COSnO2 + 2C = Sn + 2CO
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
SbCl3+AgNO3=AgCl+Sb(NO3)3SbCl3 + 3AgNO3 = 3AgCl + Sb(NO3)3
SO2+O2=SO32SO2 + O2 = 2SO3
SrCl2+Li2PO4=SrPO4+2LiClSrCl2 + Li2PO4 = SrPO4 + 2LiCl
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + C = SiO +COSiO2 + C = SiO + CO
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb + I2 = SbI32Sb + 3I2 = 2SbI3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiCl4+2Mg= Si+ MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SiO2+Na2O=NaSiO3+O2-4SiO2 - 2Na2O = -4NaSiO3 + O2
SO + H20 = S + H2O220SO + H20 = 20S + 10H2O2
SO + H20 = S8 + H2O240SO + 2H20 = 5S8 + 20H2O2
Si+H2=Si2H42Si + 2H2 = Si2H4
SiO2 + C=SiC + COSiO2 + 3C = SiC + 2CO
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO3 + Al (OH)3 = Al2 (SO4)3 + H2O3SO3 + 2Al(OH)3 = Al2(SO4)3 + 3H2O
SO2+K2Cr2O7+H2SO4=K2SO4+Cr2(SO4)3+H2O3SO2 + K2Cr2O7 + H2SO4 = K2SO4 + Cr2(SO4)3 + H2O
S + O2 = SO2 S + O2 = SO2
SnO2 + CO = Sn + CO2SnO2 + 2CO = Sn + 2CO2
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S8 (l) + Cl2 (g) = S2Cl2 (l)S8(l) + 4Cl2(g) = 4S2Cl2(l)
S+O2=SO32S + 3O2 = 2SO3
S8 (l) + Cl2 (g) = S2Cl2 (l)S8(l) + 4Cl2(g) = 4S2Cl2(l)
S+O2=SO32S + 3O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SnCl4 + FeCl2 = SnCl2 + FeCl3SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
SnCl4 + FeCl2 = SnCl2 + FeCl3SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SiF4 + K = KF + SiSiF4 + 4K = 4KF + Si
Sb2S3 + O2 = Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
Sr + O2 = SrO2Sr + O2 = 2SrO
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Sb2O3 + C = 3CO + SbSb2O3 + 3C = 3CO + 2Sb
S8 + F2 = SF6S8 + 24F2 = 8SF6
SrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2OSrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2O
S+O2+NaOH=NaSO4+H2O4S + 7O2 + 4NaOH = 4NaSO4 + 2H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S + O2 = SO2S + O2 = SO2
S + O2 = SO2S + O2 = SO2
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sn+HBr=H2+SnBr2Sn + 2HBr = H2 + SnBr2
Sb+I2=SbI32Sb + 3I2 = 2SbI3
S8+F2=SF6S8 + 24F2 = 8SF6
S8+F2=SF4S8 + 16F2 = 8SF4
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2 = SO2S8 + 8O2 = 8SO2
SbCl5 + H2O = SbOCl3 + HClSbCl5 + H2O = SbOCl3 + 2HCl
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb + H2O = Sb2 O3 + H22Sb + 3H2O = Sb2O3 + 3H2
S8 (l) + Cl2 (g) = S2Cl2 (l)S8(l) + 4Cl2(g) = 4S2Cl2(l)
S8 (l) + Cl2 (g) = S2Cl2 (l)S8(l) + 4Cl2(g) = 4S2Cl2(l)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.