Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Si2O(OH)6 + H2O = Si(OH)4Si2O(OH)6 + H2O = 2Si(OH)4
SmCl3*6H2O + H2O + SO3H = SO3Sm + HCl + O2 2SmCl3*6H2O - 10H2O + 2SO3H = 2SO3Sm + 6HCl + O2
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2 + H2O + HNO3 = H2SO4 + NO3SO2 + 2H2O + 2HNO3 = 3H2SO4 + 2NO
S8 + F2 = SF6S8 + 24F2 = 8SF6
SbCl5 + KI = SbCl3 + KCl + I2SbCl5 + 2KI = SbCl3 + 2KCl + I2
SnO2 + C = Sn + COSnO2 + 2C = Sn + 2CO
SO2(g)+HNO3(aq)+H2O(l)=H2SO4(aq)+NO(g)3SO2(g) + 2HNO3(aq) + 2H2O(l) = 3H2SO4(aq) + 2NO(g)
S8 + O2 = SOS8 + 4O2 = 8SO
S8 + O2 = SOS8 + 4O2 = 8SO
SiO2 + C = Si + COSiO2 + 2C = Si + 2CO
SiO2+HF=H2O+SiF4SiO2 + 4HF = 2H2O + SiF4
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO3 (g)=SO2 (g) + O2 (g) =2SO3(g) = 2SO2(g) + O2(g)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sr + I2 = SrI2Sr + I2 = 2SrI
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO4 + H2 + CO(OH)3 = CO2(SO4)3 + H2O6SO4 + H2 + 2CO(OH)3 = 2CO2(SO4)3 + 4H2O
SO4 + H2 + CO2(OH)3 = CO2(SO4)3 + H2O6SO4 + 3H2 + 2CO2(OH)3 = 2CO2(SO4)3 + 6H2O
S +O2 = SO2S + O2 = SO2
SO3 +O2 = SO42SO3 + O2 = 2SO4
S + O2 = SO2S + O2 = SO2
S + O2 = SO2S + O2 = SO2
S + O2 = SO2S + O2 = SO2
S+HNO3=H2SO4+SO3+NOS + 2HNO3 = H2SO4 + 0SO3 + 2NO
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
Sn(CO3)2 = SnO2 + CO2Sn(CO3)2 = SnO2 + 2CO2
S+HNO3=H2SO4+SO3+NOS + 2HNO3 = H2SO4 + 0SO3 + 2NO
S+HNO3=H2SO4+SO3+NOS + 2HNO3 = H2SO4 + 0SO3 + 2NO
S+HNO3=H2SO4+SO3+NOS + 2HNO3 = H2SO4 + 0SO3 + 2NO
S+HNO3=H2SO4+SO3+NOS + 2HNO3 = H2SO4 + 0SO3 + 2NO
S+HNO3=H2SO4+SO3+NOS + 2HNO3 = H2SO4 + 0SO3 + 2NO
S+HNO3=H2SO4+SO3+NOS + 2HNO3 = H2SO4 + 0SO3 + 2NO
S + Cl2 = SCl2S + Cl2 = SCl2
S+O2 = SO2S + O2 = SO2
SrBr2 + AgNO3 = Sr(NO3)2 + AgBrSrBr2 + 2AgNO3 = Sr(NO3)2 + 2AgBr
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+H2SO4=H2O+SO2S + 2H2SO4 = 2H2O + 3SO2
Sn + O2 = SnO2Sn + O2 = 2SnO
Sb2O3+NaOH=NaSbO2+H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
SNO2+H2=SN+H2OSNO2 + 2H2 = SN + 2H2O
SNO2+H2=SN+H2OSNO2 + 2H2 = SN + 2H2O
SNO2+H2=SN+H2OSNO2 + 2H2 = SN + 2H2O
SNO2+H2=SN+H2OSNO2 + 2H2 = SN + 2H2O
SO3(g)+H2O(l)=H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SiCl4+Mg=Si+MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiO2+2NaOH = H2O+Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SiO2 +HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Si(s) + HBr(aq)=SiBr(aq)+H2(g)2Si(s) + 2HBr(aq) = 2SiBr(aq) + H2(g)
Sr(NO3)2(aq) + K3PO4(aq) = Sr3(PO4)2(s) + KNO3(aq)3Sr(NO3)2(aq) + 2K3PO4(aq) = Sr3(PO4)2(s) + 6KNO3(aq)
Sr(NO3)2(aq) + K3PO4(aq) = Sr3(PO4)2(s) + KNO3(aq)3Sr(NO3)2(aq) + 2K3PO4(aq) = Sr3(PO4)2(s) + 6KNO3(aq)
SiO2 + C = CSi + COSiO2 + 3C = CSi + 2CO
SiO2 + C = CSi + COSiO2 + 3C = CSi + 2CO
SO2(s)+O2=SO32SO2(s) + O2 = 2SO3
S+H=H6SS + 6H = H6S
S+O2=S2O62S + 3O2 = S2O6
Sb+HNO3=SbO5+NO+H2O3Sb + 10HNO3 = 3SbO5 + 10NO + 5H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Sb + HNO3 = Sb2O5 + NO + H2016Sb + 20HNO3 = 8Sb2O5 + 20NO + H20
Sb + Cl2 = Sb Cl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb + SO3 = Sb4O6 + S816Sb + 8SO3 = 4Sb4O6 + S8
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S + K2Cr2O7 + H2O = SO2 + KOH + Cr2O33S + 2K2Cr2O7 + 2H2O = 3SO2 + 4KOH + 2Cr2O3
SiO2+C=Si+COSiO2 + 2C = Si + 2CO
SiH4+O2=SiO2+H2OSiH4 + 2O2 = SiO2 + 2H2O
SO2+H2O=H2SO3SO2 + H2O = H2SO3
Sr(C2H3O2)2+Fe(HCO3)3=Fe(C2H3O2)3+Sr(HCO3)23Sr(C2H3O2)2 + 2Fe(HCO3)3 = 2Fe(C2H3O2)3 + 3Sr(HCO3)2
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
Sn + 2KOH = K2SnO2 + 2H2Sn + 2KOH = K2SnO2 + H2
Sn + HClO4 = Sn(ClO4)4 + H2Sn + 4HClO4 = Sn(ClO4)4 + 2H2
SiO2+HF=H2O+SiF4SiO2 + 4HF = 2H2O + SiF4
S+H2SO4 = SO2+H2010S + 10H2SO4 = 20SO2 + H20
SiO2+HF=H2O+SiF4SiO2 + 4HF = 2H2O + SiF4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S8 + C =CS2S8 + 4C = 4CS2
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
SO2+KOH=K2SO3+H2OSO2 + 2KOH = K2SO3 + H2O
S8 + F2 = SF6S8 + 24F2 = 8SF6
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Si O2 + C = Si C + COSiO2 + 3C = SiC + 2CO
Sn(C2H3O2)2 + HNO3 = Sn(NO3)2 + C2H4O2Sn(C2H3O2)2 + 2HNO3 = Sn(NO3)2 + 2C2H4O2
Sn(C2H3O2) + HNO3 = Sn(NO3) + C2H4O2Sn(C2H3O2) + HNO3 = Sn(NO3) + C2H4O2
S+H2O+O2= H2SO42S + 2H2O + 3O2 = 2H2SO4
Si O2 + C = Si C + COSiO2 + 3C = SiC + 2CO
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 +O2 = SO32SO2 + O2 = 2SO3
S + CO = SO2 + CS + 2CO = SO2 + 2C
S8+O2=SO2S8 + 8O2 = 8SO2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SbCl3+H2S=Sb2S3+HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
SbCl3+H2S=Sb2S3+HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
SO2 + Na2CrO4 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O3SO2 + 2Na2CrO4 + 2H2SO4 = 2Na2SO4 + Cr2(SO4)3 + 2H2O
Sb2S3(s) + HCl (aq) =SbCl3(s) + H2S (g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO3 (g) = SO2 (g) + O2 (g)2SO3(g) = 2SO2(g) + O2(g)
SnCl 4 + NaOH=NaCl+Sn(OH)4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SF4+I2O5=IF5+SO25SF4 + 2I2O5 = 4IF5 + 5SO2
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SO2(g) + O2(g) = SO32SO2(g) + O2(g) = 2SO3
SO2(g) + O2(g) = SO32SO2(g) + O2(g) = 2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+Cl2+H2O=H2SO4+HClSO2 + Cl2 + 2H2O = H2SO4 + 2HCl
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
SF4(g)+2F2(g)=SF6(g)SF4(g) + F2(g) = SF6(g)
SF4(g)+2F2(g)=SF6(g)SF4(g) + F2(g) = SF6(g)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SiF4+NaOH=Na4SiO4+NaF+H2OSiF4 + 8NaOH = Na4SiO4 + 4NaF + 4H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SeCl6 + O2 = SeO2 + Cl2 SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
Sn+O2 = SnO2Sn + O2 = 2SnO
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + CaCO3 + O2 = CaSO4 + CO22SO2 + 2CaCO3 + O2 = 2CaSO4 + 2CO2
SR+H3PO4=SR(H2PO4)2+H2SR + 2H3PO4 = SR(H2PO4)2 + H2
SiO2 + Al = Al2O3 + Si3SiO2 + 4Al = 2Al2O3 + 3Si
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(NO3)2 + LiI = SrI2 + LiNO3Sr(NO3)2 + 2LiI = SrI2 + 2LiNO3
Sn+AgNO3=Sn(NO3)4+AgSn + 4AgNO3 = Sn(NO3)4 + 4Ag
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2=SO2S + O2 = SO2
S + O2= SO2S + O2 = SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3+HNO3 = Sb2O5+NO2+S+H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sn + 4HNO3 = SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + KOH = K2S + K2SO3 + H2O3S + 6KOH = 2K2S + K2SO3 + 3H2O
Sn+Fe2(SO4)3=Sn(SO4)2+Fe3Sn + 2Fe2(SO4)3 = 3Sn(SO4)2 + 4Fe
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S8 + AsF5 = S16(AsF6) + AsF34S8 + 3AsF5 = 2S16(AsF6) + AsF3
Sr(C2H3O2)2+MgSO4= SrSO4+Mg(C2H3O2)2Sr(C2H3O2)2 + MgSO4 = SrSO4 + Mg(C2H3O2)2
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S2+O2=SO3S2 + 3O2 = 2SO3
SeF6 + H2O = HF + H6SeO6SeF6 + 6H2O = 6HF + H6SeO6
S+NO2=SO2+N(g)S + NO2 = SO2 + N(g)
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S + HNO3 = NO2 + H2O + H2SO4S + 6HNO3 = 6NO2 + 2H2O + H2SO4
SO2 + MnO4- + H2O = SO4-- + Mn++ + H+5SO2 + 2MnO4- + 2H2O = 5SO4-- + 2Mn++ + 4H+
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SH2+HNO3= H2SO4+NO+H2SH2 + 2HNO3 = H2SO4 + 2NO + H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
Sn(s) + HCl(aq) = SnCl (s) +H2 2Sn(s) + 2HCl(aq) = 2SnCl(s) + H2
SeCl6 + O2 = SeO2 + Cl2 SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S2Cl2 + NH3 = NH4Cl + S4N4 + S86S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + S8
SnO2+H2 = Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sn+HNO3=SnO2+NO+H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2 + Li2Se = SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+O2=SO3S8 + 12O2 = 8SO3
S + O2 = SO2S + O2 = SO2
Si + S8 = SiS24Si + S8 = 4SiS2
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2 = SO32SO2 + O2 = 2SO3
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SO + O2 = SO3SO + O2 = SO3
SO2(g)+H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + H2O= H2SO3SO2 + H2O = H2SO3
SO2 + H2O= H2SO3SO2 + H2O = H2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Si+4F2=SiF4Si + 2F2 = SiF4
Sb2S3(s)+Fe(s)=Sb(s)+FeS(s)Sb2S3(s) + 3Fe(s) = 2Sb(s) + 3FeS(s)
Sb2S3(s)+Fe(s)=Sb(s)+FeS(s)Sb2S3(s) + 3Fe(s) = 2Sb(s) + 3FeS(s)
S+O2=SO32S + 3O2 = 2SO3
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SbCl5=SbCl3+Cl2SbCl5 = SbCl3 + Cl2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SrO+2HCl= H2O+SrCl2SrO + 2HCl = H2O + SrCl2
Sn(s)+HNO 3 (aq)=SnO 2 (s)+NO 2 (g)+H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
Sr + HNO3 = Sr(NO3)2 + H2Sr + 2HNO3 = Sr(NO3)2 + H2
Sr + HNO3 = Sr(NO3)2 + H2Sr + 2HNO3 = Sr(NO3)2 + H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = SO2
Sb +Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S4O6-- + Cl2 + H2O = SO4-- + Cl- + H+S4O6-- + 7Cl2 + 10H2O = 4SO4-- + 14Cl- + 20H+
Sb2S3(s)+HCl(aq) = SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SnCl4+2FeCl2 = SnCl2+FeCl3SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
S+ O2 = SO2S + O2 = SO2
S+ O2 = SO32S + 3O2 = 2SO3
Sb +Cl2 =SbCl32Sb + 3Cl2 = 2SbCl3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8 + H2SO4 = SO2 + H2S8 + 8H2SO4 = 16SO2 + 8H2
SrCO3 + HCl = SrCl2 + H2O + CO2SrCO3 + 2HCl = SrCl2 + H2O + CO2
Sb2O3+NaOH=NaSbO2+H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S2 + O2 = SO3S2 + 3O2 = 2SO3
Sr + Se = SrSeSr + Se = SrSe
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sn(OH)4+HI=SnI4+H2OSn(OH)4 + 4HI = SnI4 + 4H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
S2+O2+NaOH=Na2SO4+H2OS2 + 3O2 + 4NaOH = 2Na2SO4 + 2H2O
SiO2 + C + Cl2 = CO + SiCl4SiO2 + 2C + 2Cl2 = 2CO + SiCl4
S8 + O2 = SO3S8 + 12O2 = 8SO3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
Sb2S3(s) + HCl(aq) = SbCl3(s) + H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S+O2=SO32S + 3O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb + H+ + NO3- = Sb4O6 + NO + H2O4Sb + 4H+ + 4NO3- = Sb4O6 + 4NO + 2H2O
S8 (g) + O2 (g) = SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
S8 (g) + O2 (g)=SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
S8 (g) + O2 (g)=SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SiO2 + Na2CO3 = Na2SiO3 + CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
SiH4 + O2 = SiO2 + H2OSiH4 + 2O2 = SiO2 + 2H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S (s)+ O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S + HSO = SO + HO-1S + HSO = 0SO + HO
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3 + HCl=H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sn+2 + Ce+4 = Ce+3 + Sn+4Sn+2 + 2Ce+4 = 2Ce+3 + Sn+4
SiF4+H2O=H4SiO4+H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
Sn3(BO3)4=Sn+B+O2Sn3(BO3)4 = 3Sn + 4B + 6O2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S5O6-- + Cl2 + H2O = SO4-- + Cl- + H3O+S5O6-- + 10Cl2 + 42H2O = 5SO4-- + 20Cl- + 28H3O+
S5O6-- + Cl2 + H2O = SO4-- + Cl- + OH--1S5O6-- - 10Cl2 + 14H2O = -5SO4-- - 20Cl- + 28OH-
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + HNO3 = NO2 + H2O + H2SO4S + 6HNO3 = 6NO2 + 2H2O + H2SO4
SeCl4+O2=SeO2+Cl2SeCl4 + O2 = SeO2 + 2Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO3 +H2O=H2SO4SO3 + H2O = H2SO4
SO2 + O2 + 4 H2O =2 H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 + 4 H2O =2 H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr + Fe2(SO4)3 = SrSO4 + Fe 3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
Sr + Fe2(SO4)3 = SrSO4 + Fe 3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
Sn + HNO3 = SnO3 + NO2 + H2OSn + 6HNO3 = SnO3 + 6NO2 + 3H2O
S+O2+NaOH=Na2SO4+H2O2S + 3O2 + 4NaOH = 2Na2SO4 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
Sr(NO3)2 + Li2SO4 = SrSO4 + 2LiNO3Sr(NO3)2 + Li2SO4 = SrSO4 + 2LiNO3
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn + HNO3+ H2O = H2SnO3 + NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S5O6-- + Cl2 + H2O = SO4-- + Cl- + H+S5O6-- + 10Cl2 + 14H2O = 5SO4-- + 20Cl- + 28H+
S + KNO3 = SO3 + N + K2SO45S + 6KNO3 = 2SO3 + 6N + 3K2SO4
SO2+O=SO3SO2 + O = SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiH3+O2=SiO2+H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
Sr(NO3)2+KIO3=Sr(IO3)2+KNO3Sr(NO3)2 + 2KIO3 = Sr(IO3)2 + 2KNO3
SiCl4 + H2O =H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sn(NO3)4 + K+ = KNO3 + Sn++++Sn(NO3)4 + 4K+ = 4KNO3 + Sn++++
S+NaOH=Na2S2O3+Na2S+H2O4S + 6NaOH = Na2S2O3 + 2Na2S + 3H2O
S + O2 = SO32S + 3O2 = 2SO3
Sn + AgNO3 = Ag + Sn(NO3)2Sn + 2AgNO3 = 2Ag + Sn(NO3)2
SiF4+H2O= H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sb(s) + O2(g) = Sb2O34Sb(s) + 3O2(g) = 2Sb2O3
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
S+KMnO4=K2SO4+MnO2S + 2KMnO4 = K2SO4 + 2MnO2
S+KMnO4=K2SO4+MnO2S + 2KMnO4 = K2SO4 + 2MnO2
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
SiCl4 + H2O= SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sb (s) + O2 (g)= Sb2O5 (s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Si2H3+O2=SiO2=H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sn2+ + Cu = Cu2+ + SnSn2+ + 2Cu = Cu2+ + 2Sn
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn+HNO3+H2O = H2SnO3+ NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
S2Cl2 + NH3 = N4S4 + NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sn+AgNO3=Ag+Sn(NO3)2Sn + 2AgNO3 = 2Ag + Sn(NO3)2
SiCl4(l)+Mg(s)=Si(s)+MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
Sb (s) + HNO3 = Sb2O5 + NO2 + H2O2Sb(s) + 10HNO3 = Sb2O5 + 10NO2 + 5H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+F2 = SF6S8 + 24F2 = 8SF6
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SrCl2 + 2NH4NO3=Sr(NO3)2 + 2NH4ClSrCl2 + 2NH4NO3 = Sr(NO3)2 + 2NH4Cl
SrCl2 + 2NH4NO3=Sr(NO3)2 + 2NH4ClSrCl2 + 2NH4NO3 = Sr(NO3)2 + 2NH4Cl
SrCl2 + 2NH4NO3=Sr(NO3)2 + 2NH4ClSrCl2 + 2NH4NO3 = Sr(NO3)2 + 2NH4Cl
SrCl2 + 2NH4NO3=Sr(NO3)2 + 2NH4ClSrCl2 + 2NH4NO3 = Sr(NO3)2 + 2NH4Cl
SnF4 + FeSO4 = SnSO4 + FeF4SnF4 + FeSO4 = SnSO4 + FeF4
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+F2=SF6S8 + 24F2 = 8SF6
S8+F2=SF6S8 + 24F2 = 8SF6
S+++ + N++++ = S++++++ + N--2S+++ + N++++ = 2S++++++ + N--
S + O2 = SO32S + 3O2 = 2SO3
SiO2+Cl2+C = SiCl4 + CO2SiO2 + 2Cl2 + C = SiCl4 + CO2
S + O2 = SO2S + O2 = SO2
SnO2+C=Sn+CO2SnO2 + C = Sn + CO2
SO2(g)+H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
SO2(g)+H2O(l)=H2SO3(aq )SO2(g) + H2O(l) = H2SO3(aq)
SO2(g)+H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
S (s) + O2 (g) = SO3 (g)2S(s) + 3O2(g) = 2SO3(g)
S (s) + O2 (g) = SO3 (g)2S(s) + 3O2(g) = 2SO3(g)
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4 + F2 = SF6SF4 + F2 = SF6
S2Cl2(l)+NH3(l)=S4N4(s)+S8(s)+NH4Cl(s)6S2Cl2(l) + 16NH3(l) = S4N4(s) + S8(s) + 12NH4Cl(s)
Sb2S3(s) + HCl(aq) = SbCl3(s) + H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S+H2O=H2SO3+O-1S - H2O = -1H2SO3 + 2O
SN + HNO3 = SNO2 + NO2 + H2OSN + 4HNO3 = SNO2 + 4NO2 + 2H2O
SN + HNO3 = SNO2 + NO2 + H2OSN + 4HNO3 = SNO2 + 4NO2 + 2H2O
SPb+H2O2=PbSO4+H2OSPb + 4H2O2 = PbSO4 + 4H2O
SN + HNO3 = SNO2 + NO2 + H2OSN + 4HNO3 = SNO2 + 4NO2 + 2H2O
S + K2(Cr2O7) + H2O = SO2 + K(OH) + Cr2O33S + 2K2(Cr2O7) + 2H2O = 3SO2 + 4K(OH) + 2Cr2O3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S2Cl2+NH3=N4S4+NH4Cl+S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
Se + O2 = SeO32Se + 3O2 = 2SeO3
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SnO2 + H2 =Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + CaO + NaOH = CaS + NaS + H2OSO2 - 5CaO + 6NaOH = -5CaS + 6NaS + 3H2O
SbCl5+KOH=K(Sb(OH)6) + KClSbCl5 + 6KOH = K(Sb(OH)6) + 5KCl
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SrCl2 + Fe2(SO4)3 = Sr2(SO4)2 + FeCl36SrCl2 + 2Fe2(SO4)3 = 3Sr2(SO4)2 + 4FeCl3
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb(s) + Cl2(g) = SbCl3(s) 2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sb2S3+O2=SO2+Sb2O32Sb2S3 + 9O2 = 6SO2 + 2Sb2O3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S+HNO3=H2SO4+NOS + 2HNO3 = H2SO4 + 2NO
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO3=SO2+O22SO3 = 2SO2 + O2
Sn + HNO3 + H2O = H2SnO3 + NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S+H2SO4=2SO3+2H2O0S + H2SO4 = SO3 + H2O
SiO2(s)+9C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnSO4+FeSO4=Sn+Fe(SO4)32SnSO4 + FeSO4 = 2Sn + Fe(SO4)3
SO3(g) + H2O(l) =H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Si+Cl2=SiCl4Si + 2Cl2 = SiCl4
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn(s)+P(s)=Sn 3 P 2 (s) 3Sn(s) + 2P(s) = Sn3P2(s)
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
S+O2=SO2S + O2 = SO2
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO2S + O2 = SO2
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2(g) + H2O(l) = H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(OH)4 + N2H4= Sn + N2 + H2OSn(OH)4 + N2H4 = Sn + N2 + 4H2O
S + NaOH = Na2S + Na2SO4 + H2O4S + 8NaOH = 3Na2S + Na2SO4 + 4H2O
SO3+H2O+O2=H2SO4SO3 + H2O + 0O2 = H2SO4
SO3+H2O+O2=H2SO4SO3 + H2O + 0O2 = H2SO4
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sb(s) + O2(g) = Sb2O3(s)4Sb(s) + 3O2(g) = 2Sb2O3(s)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
S2H5+O2=SO2+H2O4S2H5 + 13O2 = 8SO2 + 10H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S2O(l)+H2O(l) = H2S2O2(aq)S2O(l) + H2O(l) = H2S2O2(aq)
SO2(g)+H2O(l) = H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
SO2+CaO=CaSO3SO2 + CaO = CaSO3
S8+O2=SO2S8 + 8O2 = 8SO2
S + O2 = SO2S + O2 = SO2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2 O5 + H2O = H3SbO4Sb2O5 + 3H2O = 2H3SbO4
Sb2 O5 + H2O = H3SbO4Sb2O5 + 3H2O = 2H3SbO4
S8 + O2 = SO2S8 + 8O2 = 8SO2
S4N4 = N2 + S82S4N4 = 4N2 + S8
Sb + H2O = Sb2O3 + H2O0Sb + H2O = 0Sb2O3 + H2O
Sb + H2O = Sb2O3 + H2O0Sb + H2O = 0Sb2O3 + H2O
Sb + H2O = Sb2O3 + H2O0Sb + H2O = 0Sb2O3 + H2O
SrCl2 + Fe2(SO4)3 = Sr (SO4)3 + FeClSrCl2 + Fe2(SO4)3 = Sr(SO4)3 + 2FeCl
Sn + 2 NaCl = Na + SnClSn + NaCl = Na + SnCl
Sn(OH)4 + N2H4= Sn + N2 + H2OSn(OH)4 + N2H4 = Sn + N2 + 4H2O
SH2+H2SO4+K2Cr2O7=KHSO4+Cr2(SO4)3+S9SH2 - 13H2SO4 - 4K2Cr2O7 = -8KHSO4 - 4Cr2(SO4)3 + 16S
S + O2 = SO2S + O2 = SO2
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sn(s) + 2HNO3(aq) = SnO2(s) + 2NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8+O2=8SO2S8 + 8O2 = 8SO2
Sn(NO3)4 + CoCl2 = SnCl4 + Co(NO3)2Sn(NO3)4 + 2CoCl2 = SnCl4 + 2Co(NO3)2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
S+Fe=Fe2S33S + 2Fe = Fe2S3
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SnS + O2 = SnO + SO3SnS + 2O2 = SnO + SO3
Sn(NO3)4 + K3PO4 = KNO3 + Sn3(PO4)43Sn(NO3)4 + 4K3PO4 = 12KNO3 + Sn3(PO4)4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiO2 + NaF + HCl = SiF4 + NaCl + H2OSiO2 + 4NaF + 4HCl = SiF4 + 4NaCl + 2H2O
SiO2 + NaF + HCl = Na2SiF6 + NaCl + H2OSiO2 + 6NaF + 4HCl = Na2SiF6 + 4NaCl + 2H2O
Sn(CO3)2 = SnO2 + CO2Sn(CO3)2 = SnO2 + 2CO2
Sn+H2SO4=SnSO4+H2Sn + H2SO4 = SnSO4 + H2
Sn+H2SO4=SnSO4+H2Sn + H2SO4 = SnSO4 + H2
Si + H2SO4 = SiO2 + SO2 +H2OSi + 2H2SO4 = SiO2 + 2SO2 + 2H2O
Si O2 + H2O = SiO2H2OSiO2 + H2O = SiO2H2O
S + C2 = SC2S + C2 = SC2
S + C2 = SC2S + C2 = 2SC
S + C2 = 2SC2S + C2 = 2SC
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
SiCl4 + 2H2O = 4HCl + SiO2SiCl4 + 2H2O = 4HCl + SiO2
Sn + O2 = SnO2Sn + O2 = 2SnO
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + 3C = SiC + 2CO2SiO2 + 2C = SiC + CO2
Sb2S3 + NO3- + H+ = S + H3SbO4 + NO + H2O-3Sb2S3 - 10NO3- - 10H+ = -9S - 6H3SbO4 - 10NO + 4H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S + NaNO3 + NaOH = Na2SO2 + NH3 + H2O4S + NaNO3 + 7NaOH = 4Na2SO2 + NH3 + 2H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Se + O2 = Se O32Se + 3O2 = 2SeO3
Sb + H+ + NO3- = Sb4O6 + NO + H2O4Sb + 4H+ + 4NO3- = Sb4O6 + 4NO + 2H2O
Si2H3 + O2= SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8 + O2= SO3S8 + 12O2 = 8SO3
Sb2O3 + NaOH + Cl2 = Na3SbO4 + NaCl + H2OSb2O3 + 10NaOH + 2Cl2 = 2Na3SbO4 + 4NaCl + 5H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sb + H+ + NO3- = Sb4O6 + NO + H2O4Sb + 4H+ + 4NO3- = Sb4O6 + 4NO + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnF2 + HF = SnH + F2 2SnF2 + 2HF = 2SnH + 3F2
SO2+O2=SO32SO2 + O2 = 2SO3
S8+F2=SF6S8 + 24F2 = 8SF6
SO2+O2+CaCO3=CaSO4+CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2 + O2 =SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SnCl4 +Fe = SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S8+O2= SO2S8 + 8O2 = 8SO2
SO3 = SO2 + O22SO3 = 2SO2 + O2
S8(s) + P4(s) = P4S3(s)3S8(s) + 8P4(s) = 8P4S3(s)
Sn+O2=SnO2Sn + O2 = SnO2
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Sr(NO3)2+K3PO4=Sr3(PO4)2+KNO33Sr(NO3)2 + 2K3PO4 = Sr3(PO4)2 + 6KNO3
S+Fe= FeSS + Fe = FeS
SO2+O2+H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 (g) + O2 (g) = SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
S+O2=2SO2S + O2 = 2SO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.