Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Sn+Zn(NO3)2 = 2Sn(NO3) +Zn2Sn + Zn(NO3)2 = 2Sn(NO3) + Zn
SO2+O2=SO32SO2 + O2 = 2SO3
Si + F2 = SiF4Si + 2F2 = SiF4
Sb2S3 + Fe = Sb + FeSSb2S3 + 3Fe = 2Sb + 3FeS
Sb2S3 + Fe = Sb + FeSSb2S3 + 3Fe = 2Sb + 3FeS
Sn(NO3)2(aq)+Na2S(aq)=SnS(s)+2NaNO3(aq)Sn(NO3)2(aq) + Na2S(aq) = SnS(s) + 2NaNO3(aq)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=S2O4S8 + 8O2 = 4S2O4
S(s) + O2(g) = SO2(g) S(s) + O2(g) = SO2(g)
Sn(s)+P(s) = Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
S8 + F2 = 8SF6S8 + 24F2 = 8SF6
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2=SO2SO2 + 0O2 = SO2
Sb2S3 +HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sn(OH)2=SnO+H2OSn(OH)2 = SnO + H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SnO2(s)+2H2(g)=Sn(s)+2H2O(g)SnO2(s) + 2H2(g) = Sn(s) + 2H2O(g)
S+CO=SO2+CS + 2CO = SO2 + 2C
Sn+P=Sn3P23Sn + 2P = Sn3P2
Sn+P=Sn3P23Sn + 2P = Sn3P2
SrCl2+K3PO4=Sr3PO4+KCl23SrCl2 + K3PO4 = Sr3PO4 + 3KCl2
S8+Na2SO3+H2O = Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SnCl2+2FeCl3=2FeCl2+SnCl4SnCl2 + 2FeCl3 = 2FeCl2 + SnCl4
SrCl2+NaOH=SrOH+NaCl2SrCl2 + NaOH = SrOH + NaCl2
SrCl2+Na2CO3=SrCO3+Na2Cl2SrCl2 + Na2CO3 = SrCO3 + Na2Cl2
SrCl2+Mg(NO3)2=Sr(NO3)2+MgCl2SrCl2 + Mg(NO3)2 = Sr(NO3)2 + MgCl2
SrCl2+Li2SO4=Sr2SO4+LiCl22SrCl2 + Li2SO4 = Sr2SO4 + 2LiCl2
Sb2O3+Fe=Sb+FeOSb2O3 + 3Fe = 2Sb + 3FeO
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn + O2 = Sn2O42Sn + 2O2 = Sn2O4
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+C= SiC+ COSiO2 + 3C = SiC + 2CO
S+O2 = SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn(ClO3)4 = SnCl4 + O2Sn(ClO3)4 = SnCl4 + 6O2
SiO2 + C = CO + SiSiO2 + 2C = 2CO + Si
S + O2 = SO2S + O2 = SO2
Sb2S3(s)+HCl(aq) = SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sn+2NaOH = Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SCl2(l ) + NaF(s) =S2Cl2(l ) + SF4(g) + NaCl(s)3SCl2(l) + 4NaF(s) = S2Cl2(l) + SF4(g) + 4NaCl(s)
SnCl2 + Na2SO3 = Na2SO4 + SnSO4 + NaCl SnCl2 + 0Na2SO3 = -1Na2SO4 + SnSO4 + 2NaCl
SnCl2 + Na2SO3 = NaCl + SnSO4+ Na2SO4-1SnCl2 + 0Na2SO3 = -2NaCl - SnSO4 + Na2SO4
SnCl2 + Na2SO3 + H2O = Sn(OH)2 + Na2SO4 + HClSnCl2 + 0Na2SO3 + 2H2O = Sn(OH)2 + 0Na2SO4 + 2HCl
Si2H3(s) + O2 = SiO2 + H2O4Si2H3(s) + 11O2 = 8SiO2 + 6H2O
So 4+Sn Fe So 4+Sn No 3 =Fe No 3 +Sn So 4So4 + SnFeSo4 + SnNo3 = FeNo3 + 2SnSo4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SnO2+H2O=Sn+H2O0SnO2 + H2O = 0Sn + H2O
SrBr2 (aq) + (NH4)2CO3 (aq) = SrCO3 + NH4Br SrBr2(aq) + (NH4)2CO3(aq) = SrCO3 + 2NH4Br
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
SnO2 + H2O = Sn + H2O0SnO2 + H2O = 0Sn + H2O
Si2Cl6 + H2O = SiO2 + HCl + H2Si2Cl6 + 4H2O = 2SiO2 + 6HCl + H2
S2Cl2(l)+NH3(g)=NH4Cl(s)+S4N4(s)+S8(s)6S2Cl2(l) + 16NH3(g) = 12NH4Cl(s) + S4N4(s) + S8(s)
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
Sc(OH)3 + H2 = Sc + H2O2Sc(OH)3 + 3H2 = 2Sc + 6H2O
Sc(OH)3 + H2 = Sc + H2O2Sc(OH)3 + 3H2 = 2Sc + 6H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SF4 + 3 H2O = H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
SiF4 + H2O = H4SiO4 +H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
S+CO2=SO2+CS + CO2 = SO2 + C
SO3 + MgO = MgSO4SO3 + MgO = MgSO4
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SO3=SO2+O22SO3 = 2SO2 + O2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO2 S8 + 8O2 = 8SO2
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S+O2= SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO2SO2 + 0O2 = SO2
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
S+O2=SO32S + 3O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
S8+Na2SO3+H2O=Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
Sn(OH)4+HNO3=Sn (NO3)4 + H2OSn(OH)4 + 4HNO3 = Sn(NO3)4 + 4H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sc + H2O = Sc(OH)3 + H22Sc + 6H2O = 2Sc(OH)3 + 3H2
SnCl2 + Na2SO3 = NaCl + SnSO4+ Na2SO4-1SnCl2 + 0Na2SO3 = -2NaCl - SnSO4 + Na2SO4
SO3 + O2 = SO42SO3 + O2 = 2SO4
S + O3 + AQ = SO3 (AQ)S + O3 + AQ = SO3(AQ)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO4SO2 + O2 = SO4
SO2+O2=SO2SO2 - O2 = 2SO
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
SiO2(s)+6 C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sc2O3(s) + 6 HNO3(aq) =2 Sc(NO3)3(aq) + 3 H2O(l)Sc2O3(s) + 6HNO3(aq) = 2Sc(NO3)3(aq) + 3H2O(l)
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2+H2O =SO(OH)2SO2 + H2O = SO(OH)2
S(s) + O2(g)=SO2S(s) + O2(g) = SO2
S8 + Fe = Fe2S3 3S8 + 16Fe = 8Fe2S3
SnO2 + H2O = Sn + H2O0SnO2 + H2O = 0Sn + H2O
Sn + H+ = Sn2+ +H24Sn + 2H+ = 2Sn2+ + H2
Si(OH) 4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6 + O2 = SeO2 +Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sr(OH)2+H3SbO3=Sr3(SbO3)2+H2O3Sr(OH)2 + 2H3SbO3 = Sr3(SbO3)2 + 6H2O
SnO2 +H2 = Sn +H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+2C=Si+COSiO2 + 2C = Si + 2CO
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sn(SO4)2+Fe(SO4)3=Sn(SO4)4+Fe(SO4)2Sn(SO4)2 + 2Fe(SO4)3 = Sn(SO4)4 + 2Fe(SO4)2
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Si2H3+5O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sn + P = Sn3P23Sn + 2P = Sn3P2
S8+O2=SO3S8 + 12O2 = 8SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2Cl2+HI=H2S+H2O+HCl+I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
Sn +H2O = Sn3(OH)4 +4H3Sn + 4H2O = Sn3(OH)4 + 4H
SiO2+Mg=Si+MgOSiO2 + 2Mg = Si + 2MgO
S8+O2=SO3 S8 + 12O2 = 8SO3
S + HNO3 = SO2 +NO2 + H2S + 2HNO3 = SO2 + 2NO2 + H2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO3+2NH3+H2O=(NH4)2SO4SO3 + 2NH3 + H2O = (NH4)2SO4
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
SnO + O2 = SnO22SnO + O2 = 2SnO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SNO+ O2=SNO22SNO + O2 = 2SNO2
SrH2(s)+H2O(l)=Sr(OH)2(s)+H2(g)SrH2(s) + 2H2O(l) = Sr(OH)2(s) + 2H2(g)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SnO + 2HNO3 = Sn(NO3)2 + H2OSnO + 2HNO3 = Sn(NO3)2 + H2O
SnO + 2HNO3 = Sn(NO3)2 + H2OSnO + 2HNO3 = Sn(NO3)2 + H2O
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiBr4+2Ba=2BaBr2+SiSiBr4 + 2Ba = 2BaBr2 + Si
S8+O2=SO2S8 + 8O2 = 8SO2
S + O2 = SO32S + 3O2 = 2SO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si4H10 +O2 = SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sr(OH)2*8H2O+NH4Cl=SrCl2+NH3+H2OSr(OH)2*8H2O + 2NH4Cl = SrCl2 + 2NH3 + 10H2O
S2Cl2+NH3=NH4Cl+S8+S4N46S2Cl2 + 16NH3 = 12NH4Cl + S8 + S4N4
S(s)+O2(g)+H2O(l)=H2SO42S(s) + 3O2(g) + 2H2O(l) = 2H2SO4
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
Sn(NO3)2 + MgO= SnMg + O(NO3)2Sn(NO3)2 + MgO = SnMg + O(NO3)2
Sn(NO3)2 + MgO= SnMg + O(NO3)2Sn(NO3)2 + MgO = SnMg + O(NO3)2
Sn(NO3)2 + MgO= SnMg + O(NO3)2Sn(NO3)2 + MgO = SnMg + O(NO3)2
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
S (s) + O2 (g)=SO2 (g)S(s) + O2(g) = SO2(g)
Sb(s) + O2(g) =Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrCl2+Al2(SO4)=Sr(SO4)+AlClSrCl2 + Al2(SO4) = Sr(SO4) + 2AlCl
SrCl+Al(SO4)=Sr(SO4)+AlClSrCl + Al(SO4) = Sr(SO4) + AlCl
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiF4 + H2O = HF + SiO2SiF4 + 2H2O = 4HF + SiO2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8+F2=SF6S8 + 24F2 = 8SF6
S8+F2=SF6S8 + 24F2 = 8SF6
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si + NO = NSi + O22Si + 2NO = 2NSi + O2
Si + NO = NSi + OSi + NO = NSi + O
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
Sn(s) + 2CuSO4(aq) = Sn(SO4)2(aq) + 2Cu(s)Sn(s) + 2CuSO4(aq) = Sn(SO4)2(aq) + 2Cu(s)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2(s)+4HF(g)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(g) = SiF4(g) + 2H2O(l)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
SrSO4+Mg(NO3)2 = Sr(NO3)2+MgSO4SrSO4 + Mg(NO3)2 = Sr(NO3)2 + MgSO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2(g)+O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
Si4H10+O2 = SiO2+ H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
SNO+ O2=SNO22SNO + O2 = 2SNO2
S2O4+O2=S2O6S2O4 + O2 = S2O6
S+O2=S2O42S + 2O2 = S2O4
SO2 + O2 =SO32SO2 + O2 = 2SO3
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO4 + O2+ 3H2O = 2H2SO42SO4 - O2 + 2H2O = 2H2SO4
SO4 + O2+ 3H2O = 2H2SO42SO4 - O2 + 2H2O = 2H2SO4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO4 +HF = SiF4 +H2O +F2SiO4 + 8HF = SiF4 + 4H2O + 2F2
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+HNO3=Sb2O3+NO+H2O2Sb + 2HNO3 = Sb2O3 + 2NO + H2O
Sr(OH)2 + HCl = SrCl2 +H2OSr(OH)2 + 2HCl = SrCl2 + 2H2O
Sn(s)+P(s)=Sn 3 P 2 (s)3Sn(s) + 2P(s) = Sn3P2(s)
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
Sb(s)+Cl2(g)=SbCl3(l)2Sb(s) + 3Cl2(g) = 2SbCl3(l)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
S(s)+O2(g)+H20(l)=H2SO4(aq)10S(s) + 20O2(g) + H20(l) = 10H2SO4(aq)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Si4H10(l)+O2(g)=SiO2(s)+H20(l)2Si4H10(l) + 8O2(g) = 8SiO2(s) + H20(l)
SO3 + KOH = K2SO4 + H2OSO3 + 2KOH = K2SO4 + H2O
Sb2S3 + 3Fe = 2Sb + 3FeSSb2S3 + 3Fe = 2Sb + 3FeS
S + O2 = SO2S + O2 = SO2
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sb3S3 + HCl = H3SbCl5 + H2SSb3S3 + 15HCl = 3H3SbCl5 + 3H2S
S8 + O2 = SO2S8 + 8O2 = 8SO2
S2+2 O2 = 2SO2S2 + 2O2 = 2SO2
Sr(NO3)2+Fr2SO4=Sr(SO4)+(NO3)2(Fr2)Sr(NO3)2 + Fr2SO4 = Sr(SO4) + (NO3)2(Fr2)
Sr(NO3)2+Fr2SO4=Sr(SO4)+(NO3)2+(Fr2)Sr(NO3)2 + Fr2SO4 = Sr(SO4) + (NO3)2 + (Fr2)
Sr(NO3)2+Fr2SO4=Sr(SO4)+(NO3)2=(Fr2)Sr(NO3)2 + Fr2SO4 = Sr(SO4) + (NO3)2 + (Fr2)
SeO2+H2Se=Se+H2OSeO2 + 2H2Se = 3Se + 2H2O
S+O2=2SO32S + 3O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S2H5+O2=SO2+H2O4S2H5 + 13O2 = 8SO2 + 10H2O
SO2Cl2 + HI = H2S + H2O +HCl + I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
S8+O2=SO3S8 + 12O2 = 8SO3
Sb+O2=SbO6Sb + 3O2 = SbO6
Si2H3+O2=SiO2+H2020Si2H3 + 40O2 = 40SiO2 + 3H20
S8 + F2 = SF6S8 + 24F2 = 8SF6
SiO2+4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
Si3N4(s) = Si(s) + N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sb2S3 (s) + HCl(aq) = SbCl3 (s) + H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiO + HF2 = SiF4 + H2OSiO + 2HF2 = SiF4 + H2O
Sb2O3+KIO3+HCl+H2O=HSb(OH)6+KCl+IClSb2O3 + KIO3 + 2HCl + 6H2O = 2HSb(OH)6 + KCl + ICl
Sb +Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sn + 4 HNO3= SnO2 + 4 NO2 + 2 H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HCl=SnCl2+H2Sn + 2HCl = SnCl2 + H2
Sb + O2 = Sb2O34Sb + 3O2 = 2Sb2O3
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sr(OH)2+HCl=SrCl2+H2OSr(OH)2 + 2HCl = SrCl2 + 2H2O
SO3 = SO2 + O22SO3 = 2SO2 + O2
SO3 = SO2 + O22SO3 = 2SO2 + O2
SO3 = SO2 + O22SO3 = 2SO2 + O2
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
S8 + F2 = SF6S8 + 24F2 = 8SF6
SnO + H2 = Sn +H2OSnO + H2 = Sn + H2O
S+O2=SO32S + 3O2 = 2SO3
Sb 2 S 3 (s)+HCl(aq)=SbCl 3 (s)+H 2 S(g) Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SiO2 + 6C= SiC+ 2COSiO2 + 3C = SiC + 2CO
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SF4(g)+H2O(l)=SO2(g)+HF(l)SF4(g) + 2H2O(l) = SO2(g) + 4HF(l)
S+O =SO2S + 2O = SO2
S8+O2=SO3S8 + 12O2 = 8SO3
SnO2+H2= Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+2H= Sn+H2OSnO2 + 4H = Sn + 2H2O
SO4+H2O=H2SO3+O2SO4 + H2O = H2SO3 + O2
Sr(NO3)2 + O2 = SrO + NO32Sr(NO3)2 + O2 = 2SrO + 4NO3
Sr(NO3)2 + O2 = SrO2 + NO3Sr(NO3)2 + O2 = SrO2 + 2NO3
Sr(NO3)2 + O2 = SrO2 + NO3Sr(NO3)2 + O2 = SrO2 + 2NO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8(s) + O2(g) = SO3(g) S8(s) + 12O2(g) = 8SO3(g)
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SO2+O2=SO32SO2 + O2 = 2SO3
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S (s) + O2 (g) = SO2 (g)S(s) + O2(g) = SO2(g)
SiC + Cl2 = SiCl4 + CSiC + 2Cl2 = SiCl4 + C
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sn(s) + 4 HNO3(aq) = SnO2(s) + 4 NO2(g) + 2 H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s) + HNO3(aq) = SnO2(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO 3 (aq)=SnO 2 (s)+NO 2 (g)+H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2= SO4SO2 + O2 = SO4
S8+ O2= SO4S8 + 16O2 = 8SO4
SO2+O2=SO32SO2 + O2 = 2SO3
S8+H2=H2SS8 + 8H2 = 8H2S
SF4+F2=SF6SF4 + F2 = SF6
SF2+F2=SF4SF2 + F2 = SF4
S+O2=SO32S + 3O2 = 2SO3
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb2S3(s) + HCl (aq) = SbCl3(s) + H2S(g) Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sr+O2=2SrO2Sr + O2 = 2SrO
S8+O2=SO2S8 + 8O2 = 8SO2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(OH)2(aq) + HBr(aq) = H2O(l) + SrBr2(aq)Sr(OH)2(aq) + 2HBr(aq) = 2H2O(l) + SrBr2(aq)
S2Cl2+NH3 = S4N4+S8+NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
S2 + H = H2SS2 + 4H = 2H2S
SF4 + H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+3C=SiC+2COSiO2 + 3C = SiC + 2CO
SO2+O2=SO32SO2 + O2 = 2SO3
SiH4 + O2 = SiO2 + H2OSiH4 + 2O2 = SiO2 + 2H2O
SnCl2+K2Cr2O7+HCl=CrCl3 + SnCl4 +H2O +KCl3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 3SnCl4 + 7H2O + 2KCl
Sr(NO3)2+K3PO4=Sr3(PO4)2+KNO33Sr(NO3)2 + 2K3PO4 = Sr3(PO4)2 + 6KNO3
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+O2=SO2S + O2 = SO2
S+O2=SO2S + O2 = SO2
SiO2 + 3C = Si + 2COSiO2 + 2C = Si + 2CO
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O3SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
Sr(NO3)2 + LiCO3 = LiNO3+ Sr(CO3)2Sr(NO3)2 + 2LiCO3 = 2LiNO3 + Sr(CO3)2
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(OH)4 = SnO2 + H2OSn(OH)4 = SnO2 + 2H2O
SO2(g)+Cl2(g)=SOCl2(l)+Cl2O(g)SO2(g) + 2Cl2(g) = SOCl2(l) + Cl2O(g)
S8+F2=SFS8 + 4F2 = 8SF
Sn(s)+ HNO3(aq)= NO2(g)+ H2O(l)+ SnOSn(s) + 2HNO3(aq) = 2NO2(g) + H2O(l) + SnO
S=S1S = S1
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2O Sn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2O Sn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sb(s) + Cl2(g) = SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2Cl2 + H2O = HCl + H2SO4SO2Cl2 + 2H2O = 2HCl + H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S5 + HNO3 = Sb2O5 + H2SO4 + NO + H2O3Sb2S5 + 40HNO3 = 3Sb2O5 + 15H2SO4 + 40NO + 5H2O
SO2 + O2 =SO32SO2 + O2 = 2SO3
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
Sr(OH)2 + FeCl3 =SrCl2 + Fe(OH)33Sr(OH)2 + 2FeCl3 = 3SrCl2 + 2Fe(OH)3
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
SiCl4+Mg=MgCl2+SiSiCl4 + 2Mg = 2MgCl2 + Si
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O = SO3SO2 + O = SO3
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2 +KMnO4 = K2SO4 + MnSO4 + SO35SO2 + 2KMnO4 = K2SO4 + 2MnSO4 + 2SO3
SiO2(s)+HF(aq)=SiF4(g)+H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SO2 + K2Cr2O7 + H2SO4 = Cr(SO4)3 + K2SO4 + H2O0SO2 + K2Cr2O7 + 7H2SO4 = 2Cr(SO4)3 + K2SO4 + 7H2O
SO2 + K2Cr2O7 + H2SO4 = Cr(SO4)3 + K2SO4 + H2O0SO2 + K2Cr2O7 + 7H2SO4 = 2Cr(SO4)3 + K2SO4 + 7H2O
SO2 + K2Cr2O7 + H2SO4 = Cr(SO4)3 + K2SO4 + H2O0SO2 + K2Cr2O7 + 7H2SO4 = 2Cr(SO4)3 + K2SO4 + 7H2O
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb2S5 + HNO3 = Sb2O5 + H2SO4 + NO + H2O3Sb2S5 + 40HNO3 = 3Sb2O5 + 15H2SO4 + 40NO + 5H2O
Sb2S5 + HNO3 = Sb2O5 + H2SO4 + N0 + H2O0Sb2S5 + 0HNO3 = 0Sb2O5 + 0H2SO4 - N0 + H2O
SO2+ O2= SO32SO2 + O2 = 2SO3
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S2Cl2 +NH3 = N4S4 + NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sn + CuCl2 = SnCl2 + CuSn + CuCl2 = SnCl2 + Cu
SiO2+HF= SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l)+H2O(l)= SiO2(s)+HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SO2 + N2O = SO3 + NO-1SO2 + N2O = -1SO3 + 2NO
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb2S5 + HNO3 = Sb2O5 + H2SO4 +N0 + H2O0Sb2S5 + 0HNO3 = 0Sb2O5 + 0H2SO4 - N0 + H2O
Sb2S5 + HNO3 = Sb2O5 + H2SO4 + N0 + H2O0Sb2S5 + 0HNO3 = 0Sb2O5 + 0H2SO4 - N0 + H2O
Sb2S5+HNO3=Sb2O5+H2SO4+N0+H2O 0Sb2S5 + 0HNO3 = 0Sb2O5 + 0H2SO4 - N0 + H2O
Sb2S5+HNO3=Sb2O5+H2SO4+N0+H2O 0Sb2S5 + 0HNO3 = 0Sb2O5 + 0H2SO4 - N0 + H2O
Sb2S5 + HNO3 = Sb2O5 + H2SO4 + N0 +H2O 0Sb2S5 + 0HNO3 = 0Sb2O5 + 0H2SO4 - N0 + H2O
Sb2S5 +HNO3 = Sb2O5 + H2SO4 + N0 +H2O 0Sb2S5 + 0HNO3 = 0Sb2O5 + 0H2SO4 - N0 + H2O
SO2 +N2O =SO3+N2SO2 + N2O = SO3 + N2
SO2Cl2 + HI = H2S + H2O + HCl + I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SiO2+C=Si+CO2SiO2 + C = Si + CO2
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S+O2=SO32S + 3O2 = 2SO3
S8(s) + F2(g) = SF6(g)S8(s) + 24F2(g) = 8SF6(g)
Sb(s) + Cl2(g) = SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SiC(s) + Cl2(g) = SiCl4(l) + C(s)SiC(s) + 2Cl2(g) = SiCl4(l) + C(s)
SiC(s) + Cl2(g) = SiCl4(l) + C(s)SiC(s) + 2Cl2(g) = SiCl4(l) + C(s)
S8+O2=SO3S8 + 12O2 = 8SO3
SrCl2 + Na2(CO3) = Sr(CO3) + NaClSrCl2 + Na2(CO3) = Sr(CO3) + 2NaCl
Sn(SO4)2+K3PO4=Sn3(PO4)4+K2SO43Sn(SO4)2 + 4K3PO4 = Sn3(PO4)4 + 6K2SO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+ O2= SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnO(s) + C(s) = Sn(s) + CO2(g)2SnO(s) + C(s) = 2Sn(s) + CO2(g)
S(s)+O2(g)=SO2S(s) + O2(g) = SO2
S(s)+O2(g)=SO2S(s) + O2(g) = 2SO
S8 + O2 = SO2S8 + 8O2 = 8SO2
S + O2 + H2O = H20 SO4S - 3O2 + 10H2O = H20SO4
S+O2=SO2S + O2 = SO2
S8(s)+Cl2(g)=SCl2(g)S8(s) + 8Cl2(g) = 8SCl2(g)
S8(s)+Cl2(g)=SCl2(g)S8(s) + 8Cl2(g) = 8SCl2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+O2=SO3SO3 + 0O2 = SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sn(NO3)2+Na3PO4=Sn3(PO4)2+NaNO33Sn(NO3)2 + 2Na3PO4 = Sn3(PO4)2 + 6NaNO3
S + H2SO4 = SO2 + H2O S + 2H2SO4 = 3SO2 + 2H2O
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sn(NO2)4+K3PO4=KNO2+Sn3(PO4)43Sn(NO2)4 + 4K3PO4 = 12KNO2 + Sn3(PO4)4
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SnCl2 + HgCl2 = SnCl4 + Hg2Cl2SnCl2 + 2HgCl2 = SnCl4 + Hg2Cl2
Sn2+ + HgCl2 +H2O = Hg2Cl2 + Sn4+ HCl + H2O0Sn2+ + 0HgCl2 + H2O = 0Hg2Cl2 + 0Sn4 + 0HCl + H2O
Sn2+ + HgCl2 + HCl = Hg2Cl2 + Sn4+ HCl0Sn2+ + 0HgCl2 + HCl = 0Hg2Cl2 + 0Sn4 + HCl
Sn2+ + HgCl2 = Hg2Cl2 + Sn2+Sn2+ + 0HgCl2 = 0Hg2Cl2 + Sn2+
SnS + NH3 + H2O = Sn(OH)2 + (NH4)2S SnS + 2NH3 + 2H2O = Sn(OH)2 + (NH4)2S
S + O2 = SO2S + O2 = 2SO
Sc2O3+H2O=Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
S+2CO=SO2+2CS + 2CO = SO2 + 2C
SiO2 + Ca(PO4)2 + C = CaSiO3 + P4 + CO2SiO2 + 2Ca(PO4)2 + 14C = 2CaSiO3 + P4 + 14CO
S + KMnO4 = K2SO4 + MnO2S + 2KMnO4 = K2SO4 + 2MnO2
Sn3P4 + N2 = Sn3N4 + P4Sn3P4 + 2N2 = Sn3N4 + P4
SiO2(s)+C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SiO2 + 3C = SiC + 2COSiO2 + 3C = SiC + 2CO
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sr + F2 = SrF2Sr + F2 = SrF2
S(S) + 2O2(g) = 2SO2(g)S(S) + 2O2(g) = 2SO2(g)
SiO2(s)+3C(s)=SiC(s)+2CO(g) SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SrO(s) + H2O(aq) = Sr(OH)2(aq) SrO(s) + H2O(aq) = Sr(OH)2(aq)
SnCl2+2KOH=Sn(OH)2+2KClSnCl2 + 2KOH = Sn(OH)2 + 2KCl
SnCl2+2KOH=Sn(OH)2+2KClSnCl2 + 2KOH = Sn(OH)2 + 2KCl
SnCl2+2KOH=Sn(OH)2+2KClSnCl2 + 2KOH = Sn(OH)2 + 2KCl
S8 + O2 = SO2S8 + 8O2 = 8SO2
SrBr2(aq)+AgNO3(aq)=Sr(NO3)2(aq)+AgBr(s)SrBr2(aq) + 2AgNO3(aq) = Sr(NO3)2(aq) + 2AgBr(s)
Si 3 N 4 (s)=Si(s)+N 2 (g)Si3N4(s) = 3Si(s) + 2N2(g)
SO2 + N2O = SO3 + N2SO2 + N2O = SO3 + N2
Si + S8= Si2S44Si + S8 = 2Si2S4
Sb(s) + Cl2(g)= SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2+ O2 = SO32SO2 + O2 = 2SO3
S+O=SO2S + 2O = SO2
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SrO(s)+H2O(l)= Sr+(OH)2SrO(s) + H2O(l) = Sr + (OH)2
SO2 + O2= SO32SO2 + O2 = 2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn3P4+N2=Sn3N4+P4Sn3P4 + 2N2 = Sn3N4 + P4
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SF4 + 3 H2O = H2SO3 + 4 HF SF4 + 3H2O = H2SO3 + 4HF
SF4 + 3 H2O = H2SO3 + 4 HF SF4 + 3H2O = H2SO3 + 4HF
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SF4 + 3 H2O = H2SO3 + 4 HF SF4 + 3H2O = H2SO3 + 4HF
Sn3P4 + N2 = Sn3N4 + P4Sn3P4 + 2N2 = Sn3N4 + P4
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SnCl2 + K2Cr2O7 + HCl = CrCl3 + KCl + SnCl4 + H2O 3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
SnCl2 + K2Cr2O7 + HCl = CrCl3 + KCl + SnCl4 + H2O 3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Si3N4(s)= Si(s) +N2 (g)Si3N4(s) = 3Si(s) + 2N2(g)
SO2 + H2S = S8 + H2O8SO2 + 16H2S = 3S8 + 16H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SiF4 + H2O = HF + SiO2SiF4 + 2H2O = 4HF + SiO2
Sn+H2(SO4)=Sn(SO4)2+SO2+H205Sn + 10H2(SO4) = 5Sn(SO4)2 + 0SO2 + H20
S8+ O2=SO2S8 + 8O2 = 8SO2
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
S(S)+ O2(g) =SO2(g)S(S) + 2O2(g) = 2SO2(g)
SrCO3+H2CO3=Sr(HCO3)2SrCO3 + H2CO3 = Sr(HCO3)2
SnO2 + H2 =Sn + H2O SnO2 + 2H2 = Sn + 2H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.