Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sb4+Cl2=SbCl3Sb4 + 6Cl2 = 4SbCl3
SrCl2 + K2SO4 = SrSO4 + KClSrCl2 + K2SO4 = SrSO4 + 2KCl
SO3(g) = SO2(g) + O2(g)2SO3(g) = 2SO2(g) + O2(g)
SnCl2 + I2 = SnI4 + ClSnCl2 + 2I2 = SnI4 + 2Cl
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO3+ H2SO4=H2S2O7SO3 + H2SO4 = H2S2O7
SnSO4+K2S=SnS+K2SO4SnSO4 + K2S = SnS + K2SO4
Sn(NO3)2+Li=LiNO3+SnSn(NO3)2 + 2Li = 2LiNO3 + Sn
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
Sr3(PO4)2 + H2SO4=SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
S(s)+ 6HNO3(aq) = SO3(g)+3H2O(l)+6NO2(g) S(s) + 6HNO3(aq) = SO3(g) + 3H2O(l) + 6NO2(g)
SnF4+2(NH4)2CO3=Sn(CO3)2+4NH4FSnF4 + 2(NH4)2CO3 = Sn(CO3)2 + 4NH4F
SiH4 + O2 = SiO2 + H2OSiH4 + 2O2 = SiO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 = SO2 + O22SO3 = 2SO2 + O2
SCN- + IO4- = SO42- +CO2 + I2+ NO3- + IO4-0SCN- + IO4- = 0SO42- + 0CO2 + 0I2 + 0NO3- + IO4-
SCN- + IO4- = SO42- +CO2 + I2+ NO3- + IO4-0SCN- + IO4- = 0SO42- + 0CO2 + 0I2 + 0NO3- + IO4-
SCN- + IO4- = SO42- +CO2 + I2+ NO3- + IO4-0SCN- + IO4- = 0SO42- + 0CO2 + 0I2 + 0NO3- + IO4-
Sn(s)+ HNO 3 (aq)=SnO 2 (s)+ NO 2 (g)+ H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnO2+H2=Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
SO3=SO2+O22SO3 = 2SO2 + O2
SO3 = SO2 + O22SO3 = 2SO2 + O2
SO3 = SO2 + O22SO3 = 2SO2 + O2
Sn+Cl2=SnCl4 Sn + 2Cl2 = SnCl4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sr + N2= Sr3N23Sr + N2 = Sr3N2
Sr + N2=SrN2Sr + N2 = 2SrN
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF = SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+ H2O = SiO2(s) + HCl(aq)SiCl4 + 2H2O = SiO2(s) + 4HCl(aq)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+O2=SO2S + O2 = SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq) = SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SO3(g) + H2O(l) = H2SO4SO3(g) + H2O(l) = H2SO4
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SrBr2+ K2SO4=Sr(SO4)+ 2 KBrSrBr2 + K2SO4 = Sr(SO4) + 2KBr
SO2+O2 = SO32SO2 + O2 = 2SO3
S(s) + O2(g) + H2O(l)= H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiO2(s)+4HF(aq)=SiF4(g)+2H2OSiO2(s) + 4HF(aq) = SiF4(g) + 2H2O
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8(s)+Cu(s)=Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2+C=SiC+18COSiO2 + 3C = SiC + 2CO
SO2+KMNO4+H2O=MNSO4+K2SO4+H2SO45SO2 + 2KMNO4 + 2H2O = 2MNSO4 + K2SO4 + 2H2SO4
SO2+KMNO4+H2O=MNSO4+K2SO4+H2SO45SO2 + 2KMNO4 + 2H2O = 2MNSO4 + K2SO4 + 2H2SO4
SnCl4+4NH3+6H2O=Sn(OH)6+4NH4Cl+H2SnCl4 + 4NH3 + 6H2O = Sn(OH)6 + 4NH4Cl + H2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 +O2=SO32SO2 + O2 = 2SO3
SO2+O2 = SO3 2SO2 + O2 = 2SO3
SbCl3(s)+Cl2(g)=SbCl5(s)SbCl3(s) + Cl2(g) = SbCl5(s)
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SnCl4 + Fe = SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
Sn+H2SO4=SnSO4+SO2+H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sn2+ + Cr2O7 2- + H+ =Sn4+ + Cr3+ + H2O-854Sn2+ + 3Cr2O72- + 432H+ = -427Sn4+ + 2Cr3+ + 216H2O
Sn2+ + Cr2O7 2- + H+=Sn4+ + Cr3+ + H2O-854Sn2+ + 3Cr2O72- + 432H+ = -427Sn4+ + 2Cr3+ + 216H2O
S2+O2=SOS2 + O2 = 2SO
S2+O2=SO2S2 + 2O2 = 2SO2
SrBr2+MgSO4=MgBr2 +SrSO4SrBr2 + MgSO4 = MgBr2 + SrSO4
SO2+O2=SO32SO2 + O2 = 2SO3
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SnF4 + 2(NH4)2CO3= Sn(CO3)2 + 4(NH4)FSnF4 + 2(NH4)2CO3 = Sn(CO3)2 + 4(NH4)F
SO2 + NaOH = Na2SO3 +H2OSO2 + 2NaOH = Na2SO3 + H2O
Sn + HNO3= SnO2 +NO2+ H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2= O2+ SO32SO2 = -1O2 + 2SO3
SiO2(s) + C(s) =CO(g) + SiC(s)SiO2(s) + 3C(s) = 2CO(g) + SiC(s)
S(s)+KClO3(s)=SO2(g)+KCl(s)3S(s) + 2KClO3(s) = 3SO2(g) + 2KCl(s)
Sb + Cl2 = SbCl3 2Sb + 3Cl2 = 2SbCl3
SnCl2+Al=AlCl+SnSnCl2 + 2Al = 2AlCl + Sn
SnCl+Al=AlCl+SnSnCl + Al = AlCl + Sn
Si4H10(l)+O2(g) = SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
Sr+O2=2SrO2Sr + O2 = 2SrO
SO3(g)+H2O(l)=H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SnS2+HNO3=H2S+Sn(NO3)4SnS2 + 4HNO3 = 2H2S + Sn(NO3)4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SiI4(s) + H2O(l) = HI(aq) + H2SiO3(s)SiI4(s) + 3H2O(l) = 4HI(aq) + H2SiO3(s)
SnS2(s)+O2(g)=SnO2(s)+SO2(g)SnS2(s) + 3O2(g) = SnO2(s) + 2SO2(g)
SnS2(s)+O2(g)=SnO2(s)+SO2(g)SnS2(s) + 3O2(g) = SnO2(s) + 2SO2(g)
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnCl2 (aq)+ CuSO4 (aq)= SnSO4 (aq)+ CuCl2(aq)SnCl2(aq) + CuSO4(aq) = SnSO4(aq) + CuCl2(aq)
Sr(OH)2(aq) + H3PO4(aq) = Sr3(PO4)2(aq) + H2O(g)3Sr(OH)2(aq) + 2H3PO4(aq) = Sr3(PO4)2(aq) + 6H2O(g)
SiF4+H2O=H4SiO4+H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
SO2 + H3O + O2 = H2SO43SO2 + 2H3O + 2O2 = 3H2SO4
SiO2+CH4=SiC+2H2OSiO2 + CH4 = SiC + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S2Cl2+NH3=S4N4+S8+NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
Sr + Na = SrNaSr + Na = SrNa
SO2 +H2S = S + 2H2OSO2 + 2H2S = 3S + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sc2O3(s)+H2O(l)=Sc(OH)3(s)Sc2O3(s) + 3H2O(l) = 2Sc(OH)3(s)
Sr(NO3)2 + Na2SO4 = SrSO4 + NaNO3Sr(NO3)2 + Na2SO4 = SrSO4 + 2NaNO3
S8+12O2=8SO3S8 + 12O2 = 8SO3
Sn(NO3)2(aq) + H2SO4(aq)=SnSO4(s) + 2 HNO3(aq)Sn(NO3)2(aq) + H2SO4(aq) = SnSO4(s) + 2HNO3(aq)
Sb2S3 + H2 = Sb + H2SSb2S3 + 3H2 = 2Sb + 3H2S
Sr(NO3)2(Aq) + Na2SO4(aq) = SrSO4 + 2NaNO3Sr(NO3)2(Aq) + Na2SO4(aq) = SrSO4 + 2NaNO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO4S8 + 16O2 = 8SO4
S+KMnO4=K2SO4+MnO2S + 2KMnO4 = K2SO4 + 2MnO2
S+HNO3 =H2SO4+ NOS + 2HNO3 = H2SO4 + 2NO
Sr + H2SO4 = SrSO4 +H2Sr + H2SO4 = SrSO4 + H2
SnCl2 + MgI2=SnI2 + MgCl2SnCl2 + MgI2 = SnI2 + MgCl2
Sn + O2 + H2 = Sn(HO)4Sn + 2O2 + 2H2 = Sn(HO)4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2=S+H2OSO2 + 2H2 = S + 2H2O
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
SO2 +MnO4 = SO5 + MnOSO2 + MnO4 = SO5 + MnO
SO2 +MnO4 = SO5 + Mn28SO2 + 6MnO4 = 8SO5 + 3Mn2
SO2 +MnO4 = SO6 + MnSO2 + MnO4 = SO6 + Mn
SO2 +H2O = SO4 + HSO2 + 2H2O = SO4 + 4H
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+KMnO4+KOH=K2SO4+MnO2+H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
S + KMnO4 = K2SO4 + MnO2S + 2KMnO4 = K2SO4 + 2MnO2
SO2 + O2 + H20 = H2SO410SO2 + 10O2 + H20 = 10H2SO4
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S + 6HNO3=H2SO4 + 6NO2 + 2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2(g)+O2(g)=SO(g)2SO2(g) - O2(g) = 2SO(g)
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiO2+H2O=H4SiO4SiO2 + 2H2O = H4SiO4
SiO2+2H2O=H4SiO4SiO2 + 2H2O = H4SiO4
Sm2O3 + Ba = Sm + BaOSm2O3 + 3Ba = 2Sm + 3BaO
Sb2O3 + C = CO + SbSb2O3 + 3C = 3CO + 2Sb
SiO2(s)+3C(s)=SiC(s)+2CO(g) SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+AsF5=S16(AsF6)2+AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
Sr(OH)2+HBr=H2O+SrBr2Sr(OH)2 + 2HBr = 2H2O + SrBr2
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+H2SO4 = SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Si5H11+Br2=Si+HBr2Si5H11 + 11Br2 = 10Si + 22HBr
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sc2O3 (s) + H2O(l) = Sc(OH)3 (s)Sc2O3(s) + 3H2O(l) = 2Sc(OH)3(s)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3 (s) + H2 (g) = Sb (s) + H2S (g)Sb2S3(s) + 3H2(g) = 2Sb(s) + 3H2S(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(OH)2(aq)+HCl(aq)= 2H2O(l)+SrCl2Sr(OH)2(aq) + 2HCl(aq) = 2H2O(l) + SrCl2
Sr(OH)2+HCl= 2H2O+SrCl2Sr(OH)2 + 2HCl = 2H2O + SrCl2
SiO2+C = SiC+COSiO2 + 3C = SiC + 2CO
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S+HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+HNO2=H2SO4+NO2+H200S + 20HNO2 = 0H2SO4 + 20NO2 + H20
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3= H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2 +O2 = SO32SO2 + O2 = 2SO3
Sb + NO3- + H+ = Sb2O5 + H2O + NO22Sb + 10NO3- + 10H+ = Sb2O5 + 5H2O + 10NO2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb+O2=SbO6Sb + 3O2 = SbO6
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(OH)2+H3PO4=Sr3(PO4)2+H2O3Sr(OH)2 + 2H3PO4 = Sr3(PO4)2 + 6H2O
SO3(l)+ H2O(l) =H2SO4(aq)SO3(l) + H2O(l) = H2SO4(aq)
SeO2(g) + H2Se(g) = Se(s) + H2O(g)SeO2(g) + 2H2Se(g) = 3Se(s) + 2H2O(g)
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
Si2H3+O2=SiO2+H2020Si2H3 + 40O2 = 40SiO2 + 3H20
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Si+O2=SiO2Si + O2 = 2SiO
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SbO+H2O=Sb2O5+H2SbO + 3H2O = Sb2O5 + 6H
SrS+CuSO4=SrSO4+CuSSrS + CuSO4 = SrSO4 + CuS
SO3(g)+H2O(l) = H2SO4(l)SO3(g) + H2O(l) = H2SO4(l)
Sn(s)+ HNO 3 (aq)= SnO 2 (s)+ NO 2 (g)+ H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb3(s)+O3(g)=Sb2O3(s)2Sb3(s) + 3O3(g) = 3Sb2O3(s)
S+O2=SO32S + 3O2 = 2SO3
SO2(g) + O2(g)=SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SrCO3 + Al(NO3)3*9H2O + (NH2)2CO = Sr3Al2O6 + H2O + CO2 +N23SrCO3 + 2Al(NO3)3*9H2O + 5(NH2)2CO = Sr3Al2O6 + 28H2O + 8CO2 + 8N2
S+HNO3 =H2SO4+ NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Sr(s) + P4(s) =Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + Br2 + H2O = H+ + SO4 2- + Br-2SO2 + 79Br2 + 80H2O = 160H+ + 2SO42- + 158Br-
SiO2+9C=SiC+COSiO2 + 3C = SiC + 2CO
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sr(OH)2+2HNO3=Sr(NO3)2+2H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
SrS+B(PO4)=Sr(PO4)+BSSrS + B(PO4) = Sr(PO4) + BS
SO(g)+O2(g)=SO2(g)2SO(g) + O2(g) = 2SO2(g)
SrS+NH4I=SrI+NH4SSrS + NH4I = SrI + NH4S
SrS+NaOH=SrOH+NaSSrS + NaOH = SrOH + NaS
SrS+AgNO3=SrNO3+AgSSrS + AgNO3 = SrNO3 + AgS
S(s) + HNO3 (aq) = H2SO4 (aq) + H2O (l) + NO2 (g) S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4 = SO2+ H2OS + 2H2SO4 = 3SO2 + 2H2O
Sn + HCl = SnCl4 + H2Sn + 4HCl = SnCl4 + 2H2
Sb3(s) + O3(g) = Sb2O3(s)2Sb3(s) + 3O3(g) = 3Sb2O3(s)
Sc2O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SnCl4(s) + H2O(g) = SnO2(s) + HCl(g)SnCl4(s) + 2H2O(g) = SnO2(s) + 4HCl(g)
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2+H2O=H2SO3SO2 + H2O = H2SO3
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2 (s) + HF (aq) = SiF4 (s) + H2O (l) SiO2(s) + 4HF(aq) = SiF4(s) + 2H2O(l)
Si2N4=Si+N2Si2N4 = 2Si + 2N2
Sn + O2 = SnO2Sn + O2 = SnO2
SrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2OSrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO3+RbOH=Rb2SO4+H2OSO3 + 2RbOH = Rb2SO4 + H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnO+HNO3=Sn (NO3)2+H2OSnO + 2HNO3 = Sn(NO3)2 + H2O
SiO2+ 3C= SiC+ 2CO2SiO2 + 2C = SiC + CO2
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
Sr3(PO4)2 + H3PO4 = Sr(H2PO4)2Sr3(PO4)2 + 4H3PO4 = 3Sr(H2PO4)2
Sn + H2O + O2 = Sn(OH)22Sn + 2H2O + O2 = 2Sn(OH)2
Sn + H2O + O2 = Sn(OH)22Sn + 2H2O + O2 = 2Sn(OH)2
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr3(PO4)2 + H3PO4 = Sr(H2PO4)2Sr3(PO4)2 + 4H3PO4 = 3Sr(H2PO4)2
Sr3(PO4)2 + H3PO4 = Sr(H2PO4)2Sr3(PO4)2 + 4H3PO4 = 3Sr(H2PO4)2
SO4+NO2=NO+SO3SO4 - NO2 = -1NO + SO3
SO4+NO2=NO+SO3SO4 - NO2 = -1NO + SO3
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SF4 + 3 H2O=H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
SO2+O2=S2O54SO2 + O2 = 2S2O5
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s)2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
Sc2O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SCl4 + H2O = SO2 + HClSCl4 + 2H2O = SO2 + 4HCl
S8 + 12O2 = 8SO3 S8 + 12O2 = 8SO3
Sr3(PO4)2+ H2S= H3PO4+SrSSr3(PO4)2 + 3H2S = 2H3PO4 + 3SrS
Sr3(PO4)2+ H2S= H3PO4+SrSSr3(PO4)2 + 3H2S = 2H3PO4 + 3SrS
Sc2 O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
S8 + F2 = SF6S8 + 24F2 = 8SF6
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SrCO3 + 2 HBr = SrBr2 + H2O + CO2SrCO3 + 2HBr = SrBr2 + H2O + CO2
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SnO + Al(CN)3 = Sn(CN)2 + Al2O33SnO + 2Al(CN)3 = 3Sn(CN)2 + Al2O3
SnO + Al(CN)3 = Sn(CN)2 + Al2O33SnO + 2Al(CN)3 = 3Sn(CN)2 + Al2O3
SeCl2 + O2 = SeO2 + Cl2SeCl2 + O2 = SeO2 + Cl2
SeCl2 + O2 = SeO2 + Cl2SeCl2 + O2 = SeO2 + Cl2
SeCl2 + O2 = SeO2 + Cl2SeCl2 + O2 = SeO2 + Cl2
S+O2=SO2S + O2 = SO2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SF4+I2O5=IF5+SO25SF4 + 2I2O5 = 4IF5 + 5SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sc2 O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SO2+O3=SO33SO2 + O3 = 3SO3
SO2+O3=SO33SO2 + O3 = 3SO3
SiI4(s) + Mg(s) = Si(s) + MgI2(s)SiI4(s) + 2Mg(s) = Si(s) + 2MgI2(s)
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+P4=S3P23S8 + 4P4 = 8S3P2
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
SrCO3 + 2HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2(s) + C(s) = SiC(s) + CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sn(s) + CO(s) = SnO2(s) + C(s)Sn(s) + 2CO(s) = SnO2(s) + 2C(s)
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
S + O2 =SO32S + 3O2 = 2SO3
S + O2 =SO2S + O2 = 2SO
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 + C=SiC + COSiO2 + 3C = SiC + 2CO
SrCO3+Na3PO3=Sr3(PO3)2+Na2CO3 3SrCO3 + 2Na3PO3 = Sr3(PO3)2 + 3Na2CO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq) Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
SO2+O2 = SO32SO2 + O2 = 2SO3
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s) 2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr3(PO4)2(aq) + 4H3PO4= 3Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4 = 3Sr(H2PO4)2(aq)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
SnS2(s) + O2 (s) = SnO2(s) + SO2(g)SnS2(s) + 3O2(s) = SnO2(s) + 2SO2(g)
Sn + H2O + O2 = Sn(OH)22Sn + 2H2O + O2 = 2Sn(OH)2
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2=SO3+H20SO2 + H2 = 0SO3 + H2
SnI=Sn+I22SnI = 2Sn + I2
Sn + HNO3 = SnO4 + NO2 + H2OSn + 8HNO3 = SnO4 + 8NO2 + 4H2O
S+ HNO3 = H2SO4+ NO2+ H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SNi + HNO3 = Ni(NO3)2 + NO + S + H2O 3SNi + 8HNO3 = 3Ni(NO3)2 + 2NO + 3S + 4H2O
SO2 + 2H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sb2O5 + HCl = SbCl5 + H2OSb2O5 + 10HCl = 2SbCl5 + 5H2O
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
Sn + CaCO3 = SnCO3 + CaSn + CaCO3 = SnCO3 + Ca
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
SnN6 + Pb(MnO4)2 = NO + SnO2 + Pb2O3 + MnO25SnN6 + 16Pb(MnO4)2 = 30NO + 5SnO2 + 8Pb2O3 + 32MnO2
SnN6 + Pb(MnO4)2 = NO + SnO2 + PbO3 + MnO2SnN6 + 8Pb(MnO4)2 = 6NO + SnO2 + 8PbO3 + 16MnO2
SnN6 + Pb(MnO4) = NO + SnO2 + PbO3 + MnO2-1SnN6 + 8Pb(MnO4) = -6NO - SnO2 + 8PbO3 + 8MnO2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SCl4(g)+H2O(l)=SO2(g)+HCl(aq)SCl4(g) + 2H2O(l) = SO2(g) + 4HCl(aq)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Si + O 2 = SiO 2Si + O2 = SiO2
Si + O 2 = SiO 2Si + O2 = SiO2
Sb2S5+HNO3+H2O=H3SbO4+H2SO4+NO3Sb2S5 + 40HNO3 + 4H2O = 6H3SbO4 + 15H2SO4 + 40NO
Sb2S5+HNO3+H2O=H3SbO4+H2SO4+NO3Sb2S5 + 40HNO3 + 4H2O = 6H3SbO4 + 15H2SO4 + 40NO
Sr + Cl2 = Sr2Cl4Sr + Cl2 = 2Sr2Cl
Sr + Cl2 = SrCl2Sr + Cl2 = SrCl2
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8+O2=SO3S8 + 12O2 = 8SO3
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2 + Ca2CO3 + O2 = CaSO4 + CO24SO2 + 2Ca2CO3 + 3O2 = 4CaSO4 + 2CO2
SiH4+2O2 =SiO2+2H2OSiH4 + 2O2 = SiO2 + 2H2O
S8 + P4O10 = S2O8 + PO3 -1S8 + 16P4O10 = -4S2O8 + 64PO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + Cu = Cu2SS8 + 16Cu = 8Cu2S
S(s) + HNO3(aq) = SO2(g) + NO(g) + H2O(l)3S(s) + 4HNO3(aq) = 3SO2(g) + 4NO(g) + 2H2O(l)
Sn(s) + HF(s) = SnF2(s) +H2(g)Sn(s) + 2HF(s) = SnF2(s) + H2(g)
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 =SO3 2SO2 + O2 = 2SO3
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SnCl2*2H2O + C2H6O = SnO2 + HCl + H2O +CO2-6SnCl2*2H2O + C2H6O = -6SnO2 - 12HCl - 3H2O + 2CO2
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s) 2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
Sb(s) + H2O(l) = Sb3O4(s) + H2(g)3Sb(s) + 4H2O(l) = Sb3O4(s) + 4H2(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 + H2O = H2OSO4SO2 + O2 + H2O = H2OSO4
SO2 + O2 + H2O = H2OSO4SO2 + O2 + H2O = H2OSO4
S8(s) + O2(g) = SO2(g)S8(s) + 8O2(g) = 8SO2(g)
Sc2O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
SnCl4(s) + H2O(g) = SnO2(s) + HCl(g)SnCl4(s) + 2H2O(g) = SnO2(s) + 4HCl(g)
SiO 2 (s)+4HF(aq)=SiF 4 (g)+2 H 2 O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
S+6HNO3 = H2SO4+6NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnCl4(s) + H2O(g) =SnO2(s) + HCl(g)SnCl4(s) + 2H2O(g) = SnO2(s) + 4HCl(g)
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
Sn(s) + H2O(l) + O2(g)=Sn(OH)2(s)2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
SN+HNO3=3SN(NO3)2+2NO+4H2O3SN + 8HNO3 = 3SN(NO3)2 + 2NO + 4H2O
Sb(s) + H2O(l) = Sb3O4(s) + H2(g)3Sb(s) + 4H2O(l) = Sb3O4(s) + 4H2(g)
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiCl4(l)+Mg(s)=Si(s)+MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnBr2+Na3PO4=SnNa3+Br2PO4SnBr2 + Na3PO4 = SnNa3 + Br2PO4
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s)2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
Sr3(PO4)2 + H3PO4 = Sr(H2PO4)2Sr3(PO4)2 + 4H3PO4 = 3Sr(H2PO4)2
SO2 + O2 +H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2 = SO3S8 + 12O2 = 8SO3
S8+O2 =SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + Pb++ = Sn++ + PbSn + Pb++ = Sn++ + Pb
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s) 2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
SnSO4+ KBr = SnBr2 + K2SO4SnSO4 + 2KBr = SnBr2 + K2SO4
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
SnCl4(s) + H2O(g) = SnO2(s) + HCl(g)SnCl4(s) + 2H2O(g) = SnO2(s) + 4HCl(g)
Sn + HCl + K2Cr2O7 = SnCl4 + CrCl3 + KCl + H2O3Sn + 28HCl + 2K2Cr2O7 = 3SnCl4 + 4CrCl3 + 4KCl + 14H2O
SO2 + 2NaS + Na2CO3 = CO2 + 3Na2S2O36SO2 + 4NaS + 3Na2CO3 = 3CO2 + 5Na2S2O3
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
Sb + H2O = Sb3O4 + H23Sb + 4H2O = Sb3O4 + 4H2
S+O2=SO2S + O2 = SO2
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn(s)+ HNO 3 (aq)=SnO 2 (s)+ NO 2 (g)+ H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S + H2SO4 = SO2 +H2OS + 2H2SO4 = 3SO2 + 2H2O
SiCl4 + 2H2O = SiO2 + 4HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2= SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiCl4 + H2O(l) = SiO2(s) + HCl(aq)SiCl4 + 2H2O(l) = SiO2(s) + 4HCl(aq)
Si2H2  +  O2  =  SiO2  +  H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
S  +  HNO3  =  H2SO4  +  NO2  +  H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
SiCl4  +  H2O  =  H4SiO4  +  HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si2H2  +  O2  =  SiO2  +  H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
Sb  +  O2  =  Sb4O64Sb + 3O2 = Sb4O6
Si2H2 + O2 = SiO2 + H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
Si2H2 + O2 = SiO2 + H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
Si2H2 + O2 = SiO2 + H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
SrCl2 + O2 = SrO + Cl22SrCl2 + O2 = 2SrO + 2Cl2
Sb(s) + H2O(l) = Sb3O4(s) + H2(g)3Sb(s) + 4H2O(l) = Sb3O4(s) + 4H2(g)
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO3+ NO2+ H2O= HNO3+ H2SO4SO3 + 0NO2 + H2O = 0HNO3 + H2SO4
SnCl4(s) + H2O(g) = SnO2(s) + HCl(g)SnCl4(s) + 2H2O(g) = SnO2(s) + 4HCl(g)
SnN6 + Pb(MnO4)2 = NO + SnO2 + Pb2O3 + MnO25SnN6 + 16Pb(MnO4)2 = 30NO + 5SnO2 + 8Pb2O3 + 32MnO2
Sc2O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s)2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO2SO2 - O2 = 2SO
SbCl5 = SbCl3 + Cl SbCl5 = SbCl3 + 2Cl
Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO2+O2=SO2SO2 + 0O2 = SO2
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO2+O2=SO2SO2 + 0O2 = SO2
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq)Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
Sb2O5 + HCl = SbCl5 + H2OSb2O5 + 10HCl = 2SbCl5 + 5H2O
S + O2 + H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s) 2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
SnO2+H2O=Sn(OH)4SnO2 + 2H2O = Sn(OH)4
Sr3(PO4)2(aq) + H3PO4(aq) = Sr(H2PO4)2(aq) Sr3(PO4)2(aq) + 4H3PO4(aq) = 3Sr(H2PO4)2(aq)
S + O=SO2S + 2O = SO2
S + O=SOS + O = SO
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiH4 + NH3 = Si3N4 + H23SiH4 + 4NH3 = Si3N4 + 12H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s)2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
Sb(s) + H2O(l) = Sb3O4(s) +H2(g)3Sb(s) + 4H2O(l) = Sb3O4(s) + 4H2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+HNO3=SO3+NO+H2O3SO2 + 2HNO3 = 3SO3 + 2NO + H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
Sn(NO3)4 + Na2CO3 = Sn2(CO3)4 + Na(NO3)2Sn(NO3)4 + 4Na2CO3 = Sn2(CO3)4 + 8Na(NO3)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb2S3+O2=Sb4O6+SO22Sb2S3 + 9O2 = Sb4O6 + 6SO2
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SeCl6+O2 =SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sn(s)+HNO3(aq) = SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn(s) + H2O(l) + O2(g) = Sn(OH)2(s)2Sn(s) + 2H2O(l) + O2(g) = 2Sn(OH)2(s)
SiCl4+Si=Si2Cl63SiCl4 + Si = 2Si2Cl6
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+H2O=H2S+OS + H2O = H2S + O
S+H2O = H2S + OS + H2O = H2S + O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
Si2H3 + O2= SiO2 +H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sn2O4 + H2O = Sn(OH)4Sn2O4 + 4H2O = 2Sn(OH)4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.