Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SO4(g) + O2(g) + H2O(l) = H2SO4(aq)2SO4(g) - O2(g) + 2H2O(l) = 2H2SO4(aq)
Sb2S3+HNO=HSbO3+H2SO4+NO+H2O-1Sb2S3 + 28HNO = -2HSbO3 - 3H2SO4 + 28NO + 18H2O
SO3+NH3=NO+SO2+H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
SO2Cl2 + H2O = H2SO4 + HClSO2Cl2 + 2H2O = H2SO4 + 2HCl
S2Cl2 + NH3 = NH4Cl + S4N4 + S6S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + 8S
SiO2+Ca3(PO4)2+C=CaSiO3+P4+CO6SiO2 + 2Ca3(PO4)2 + 10C = 6CaSiO3 + P4 + 10CO
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
SbI3+Sb(IO3)3+H4SiO4=I2+Sb4(SiO4)3+H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+Cu = SO4 + Cu0SO3 + Cu = 0SO4 + Cu
Si4H10 + O2= SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn+ H2O = SnOH+ H22Sn + 2H2O = 2SnOH + H2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SbI3+Sb(IO3)3+H4SiO4=I2+Sb4(SiO4)3+H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
Sb2S3 + KNO3 + HCl=Sb2O5 + NO2 + K2SO4 + KCl + H2OSb2S3 + 28KNO3 + 22HCl = Sb2O5 + 28NO2 + 3K2SO4 + 22KCl + 11H2O
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SIH4 +O2= SIO2 +H205SIH4 + 5O2 = 5SIO2 + H20
SO3 (g) + H2O (l) = H2SO4 (aq) SO3(g) + H2O(l) = H2SO4(aq)
SO2+O2=SO2SO2 - O2 = 2SO
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO3 + NH3 = NO + SO2 + H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
S+Cl2=S2Cl22S + Cl2 = S2Cl2
SiH4 +N2O = SiO2 + H2 + N2SiH4 + 2N2O = SiO2 + 2H2 + 2N2
SiH4 + NH3 = SiN +H22SiH4 + 2NH3 = 2SiN + 7H2
SF6 + SiO2 = SiF + O2 + SSF6 + 6SiO2 = 6SiF + 6O2 + S
SF6 + SiO2 = SiF + O + SSF6 + 6SiO2 = 6SiF + 12O + S
SF6 + SiN = SiF + S + N2SF6 + 6SiN = 6SiF + S + 3N2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8+SrBr2=Sr+S8Br2S8 + SrBr2 = Sr + S8Br2
Sn(NO3)4 + K2SO3 = KNO3 + Sn(SO3)2Sn(NO3)4 + 2K2SO3 = 4KNO3 + Sn(SO3)2
SCl4+H2O=H2SO3+HClSCl4 + 3H2O = H2SO3 + 4HCl
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2 + NO2 + H2O = H2SO4 + NOSO2 + NO2 + H2O = H2SO4 + NO
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
SO + H2S = H2O + SSO + H2S = H2O + 2S
SnCl4 + NaOH = NaCl+ Sn(OH)4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S + O2 = SO2S + O2 = SO2
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SO2 + KMnO4 + KOH = K2SO4 + MnO2 +H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SnCl4 + NaOH = NaCl + Sn ( OH) 4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Se+HNO3=SeO2+NO+H2O3Se + 4HNO3 = 3SeO2 + 4NO + 2H2O
SO4-2 + H+ = HSO4-SO4-2 + H+ = HSO4-
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2(SO3)5+Al=Al2(SO3)3+Sb 3Sb2(SO3)5 + 10Al = 5Al2(SO3)3 + 6Sb
Sr(NO3)2 + Na2SO4 = SrSO4 + NaNO3Sr(NO3)2 + Na2SO4 = SrSO4 + 2NaNO3
SO2+O2 = SO32SO2 + O2 = 2SO3
S2Cl2+NH3=S4N4+S8+NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S2Cl2+NH3=NH4Cl+S4N4+S86S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + S8
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+SrBr2=S8Br2+Sr22S8 + 2SrBr2 = 2S8Br2 + Sr2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnOF2 + H2SiF6 = SnSiF6 + HF + O22SnOF2 + 2H2SiF6 = 2SnSiF6 + 4HF + O2
SnOF2 + H2SiF6 = SnSiF6 + HF + O22SnOF2 + 2H2SiF6 = 2SnSiF6 + 4HF + O2
Sn3O2(OH)2 + H2SiF6 = SnSiF6 + H2OSn3O2(OH)2 + 3H2SiF6 = 3SnSiF6 + 4H2O
SiF4+H2O= H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sn6O4(OH)4 + H2SiF6 = SnSiF6 + H2OSn6O4(OH)4 + 6H2SiF6 = 6SnSiF6 + 8H2O
SnOF2 + H2SO4 = SnF2 + SO4 + H2OSnOF2 + H2SO4 = SnF2 + SO4 + H2O
SnOF2 + H2SO4 = SnSO4 + HF + O22SnOF2 + 2H2SO4 = 2SnSO4 + 4HF + O2
SnOF2 + H2SO4 = SnSO4 + HF + OSnOF2 + H2SO4 = SnSO4 + 2HF + O
SnOF2 + H2SO4 = SnSO4 + HF + O22SnOF2 + 2H2SO4 = 2SnSO4 + 4HF + O2
Sn3O2(OH)2 + H2SO4 = SnSO4 + H2OSn3O2(OH)2 + 3H2SO4 = 3SnSO4 + 4H2O
Sn6O4(OH)4 + H2SO4 = SnSO4 + H2OSn6O4(OH)4 + 6H2SO4 = 6SnSO4 + 8H2O
Sn6O4(OH)4 + H2SO4 = SnSO4 + H + OSn6O4(OH)4 + 6H2SO4 = 6SnSO4 + 16H + 8O
Sn6O4(OH)4 + H2SO4 = SnSO4 + 2H2OSn6O4(OH)4 + 6H2SO4 = 6SnSO4 + 8H2O
SiCl4+NH3=Si3N4+NH4Cl3SiCl4 + 16NH3 = Si3N4 + 12NH4Cl
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
S + HNO3 = H2SO4 + NO2 +H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
SnOF2 + e = Sn++ + O-- + F-SnOF2 + 2e = Sn++ + O-- + 2F-
SnOF2 + e = Sn++ + O-- + FSnOF2 + 0e = Sn++ + O-- + 2F
SnOF2 = Sn + O + FSnOF2 = Sn + O + 2F
Sn6H4(OH)4 + H2SO4 + e = Sn++ + HSO4- + O2Sn6H4(OH)4 - 8H2SO4 - 20e = 6Sn++ - 8HSO4- + 2O2
Sn6H4(OH)4 + H2SO4 = Sn + HSO4 + O2Sn6H4(OH)4 - 8H2SO4 = 6Sn - 8HSO4 + 2O2
Sn6H4(OH)4 + H2SO4 = Sn + SO4 + H2OSn6H4(OH)4 + 0H2SO4 = 6Sn + 0SO4 + 4H2O
Sn6H4(OH)4 + e = Sn++++ + H2OSn6H4(OH)4 - 24e = 6Sn++++ + 4H2O
Sn6H4(OH)4 + e = Sn++ + H2OSn6H4(OH)4 - 12e = 6Sn++ + 4H2O
Sn6H4(OH)4 = Sn + H2OSn6H4(OH)4 = 6Sn + 4H2O
SiCl4 + NH3 = NH4Cl + Si3N43SiCl4 + 16NH3 = 12NH4Cl + Si3N4
SiCl4+Mg=MgCl2+SiSiCl4 + 2Mg = 2MgCl2 + Si
SCl2 + NH3 = S4N4 + NH4Cl + S6SCl2 + 16NH3 = S4N4 + 12NH4Cl + 2S
SO2+O2=SO32SO2 + O2 = 2SO3
SO4+O2=SO32SO4 - O2 = 2SO3
SrCO3 + HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
Sb + O2 = Sb2O34Sb + 3O2 = 2Sb2O3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S8 + O2 =SO2 S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(NO3)2 + Na2SO4 = NaNO3 + SrSO4Sr(NO3)2 + Na2SO4 = 2NaNO3 + SrSO4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn + H2SO4 = SnSO4 + SO2 + H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
S+HNO3 =SO2+NO2+H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(NO3)2 + Na3PO4 = Sr3 (PO4)2 + NaNO33Sr(NO3)2 + 2Na3PO4 = Sr3(PO4)2 + 6NaNO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
S+O2=SO32S + 3O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S + O2 = SO2S + O2 = SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(OH)2 + HI = SrI2 + H2OSr(OH)2 + 2HI = SrI2 + 2H2O
SnSiF6 + H2SiF6 = Sn + H2SiF60SnSiF6 + H2SiF6 = 0Sn + H2SiF6
SnSiF6 + H2SiF6 = Sn + HSiF6SnSiF6 + H2SiF6 = Sn + 2HSiF6
Sn++ + H2SO4 = Sn + SO4-- + H+0Sn++ + H2SO4 = 0Sn + SO4-- + 2H+
SnO2 + H2SO4 = SnSO4 + H + OSnO2 + H2SO4 = SnSO4 + 2H + 2O
SnO2 + H2SO4 = SnSO4 + H + OSnO2 + H2SO4 = SnSO4 + 2H + 2O
Sn++ + H2SO4 = SnSO4 + H+Sn++ + H2SO4 = SnSO4 + 2H+
Sn++ + H2SiF6 = SnSiF6 + H+Sn++ + H2SiF6 = SnSiF6 + 2H+
Sn++ + H2SiF6 = Sn + SiF6-- + H+0Sn++ + H2SiF6 = 0Sn + SiF6-- + 2H+
Sn++ + H2SO4 = Sn + SO4-- + H-1Sn++ + H2SO4 = -1Sn + SO4-- + 2H
Sn + H2SO4 = SnSO4 + HSn + H2SO4 = SnSO4 + 2H
SnO2 + H2SO4 = Sn + SO4 + H2OSnO2 + 2H2SO4 = Sn + 2SO4 + 2H2O
SnO2 + H2SiF6 = SnSiF6 + H + OSnO2 + H2SiF6 = SnSiF6 + 2H + 2O
Sn + H2SiF6 = SnSiF6 + HSn + H2SiF6 = SnSiF6 + 2H
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + Cl2 + H2O = HCl + H2SO4S + 3Cl2 + 4H2O = 6HCl + H2SO4
SiCl4+NH3=Si3N4+NH4Cl3SiCl4 + 16NH3 = Si3N4 + 12NH4Cl
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
SnCl4+(NH4)3PO4=Sn3(PO4)4+NH4Cl3SnCl4 + 4(NH4)3PO4 = Sn3(PO4)4 + 12NH4Cl
S2Cl2 +NH3 = NH4Cl + S4N4 + S86S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + S8
S2Cl2+NH3=NH4Cl+S4N4+S86S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + S8
S8(s)+8O2(g)=8SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
S8+C=CS2S8 + 4C = 4CS2
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sr + O2 = SrO2Sr + O2 = 2SrO
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO2)3 + H2O-9SO2 - Na2Cr2O7 + 5H2SO4 = -1Na2SO4 - Cr2(SO2)3 + 5H2O
S+O2=SO32S + 3O2 = 2SO3
SO2 + O = SO3SO2 + O = SO3
SO2+38O2=SO32SO2 + O2 = 2SO3
SO3+MnO4=SO4+Mn4SO3 + MnO4 = 4SO4 + Mn
SO3+MnO4=SO4+Mn4SO3 + MnO4 = 4SO4 + Mn
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb2+3Cl2=2SbCl3Sb2 + 3Cl2 = 2SbCl3
Sr(OH)2 + K2CO3 = KOH + SrCO3Sr(OH)2 + K2CO3 = 2KOH + SrCO3
SiCl4 + NH3 = Si3N4 + NH4Cl3SiCl4 + 16NH3 = Si3N4 + 12NH4Cl
SiCl4 + NH3 = Si3N4 + NH4Cl3SiCl4 + 16NH3 = Si3N4 + 12NH4Cl
Sr+H2O = Sr(H2)OSr + H2O = Sr(H2)O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S+O2=SO32S + 3O2 = 2SO3
Sn + 4HNO3=SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S+O2=SO32S + 3O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO + HCl = SnCl2 + H2OSnO + 2HCl = SnCl2 + H2O
Sb2S3 +HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO2+H2O+Cl2=H2SO4+HClSO2 + 2H2O + Cl2 = H2SO4 + 2HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SnCl4+ NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO2(g)+H2O(l)=H2SO3SO2(g) + H2O(l) = H2SO3
SO2(g)+H2O(l)=H2SO3SO2(g) + H2O(l) = H2SO3
S8 + Li = Li8SS8 + 64Li = 8Li8S
Sr + H2O = Sr(OH)2+ H2Sr + 2H2O = Sr(OH)2 + H2
Sr(OH)2 + K2CO3 = 2KOH+SrCO3Sr(OH)2 + K2CO3 = 2KOH + SrCO3
Sr+Fe2(SO4)3=SrSO4+Fe3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiF4 + H2O = H4SiO4 + H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
SeCl6 + O2 = SeO2 +Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 = SeO2 +Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sb2S3+HNO3=HSbO3+H2SO4+NO+H2O3Sb2S3 + 28HNO3 = 6HSbO3 + 9H2SO4 + 28NO + 2H2O
ScF3 + K = Sc +KFScF3 + 3K = Sc + 3KF
ScF3 + K = Sc + KFScF3 + 3K = Sc + 3KF
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
ScF3 + K =Sc +KFScF3 + 3K = Sc + 3KF
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SrNO3 + Na PO4- = SrPO4- + NaNO3SrNO3 + NaPO4- = SrPO4- + NaNO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sc+F2=ScF2Sc + F2 = ScF2
Si2H6+H2O=Si(OH)4+H2Si2H6 + 8H2O = 2Si(OH)4 + 7H2
SO2 + Na2SO4 =Na+ SO3SO2 + Na2SO4 = 2Na + 2SO3
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SBr2 + Fe2(SO4)3 = 3SSO4 + FeBr33SBr2 + Fe2(SO4)3 = 3SSO4 + 2FeBr3
S8 + O2 =SO3S8 + 12O2 = 8SO3
SnF4 +Cr = CrF3 +Sn3SnF4 + 4Cr = 4CrF3 + 3Sn
S2+Br2=SBr2S2 + 2Br2 = 2SBr2
Sn + HNO3 = SnO2 + NO + H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
Sb2O3+KIO3+HCl+H2O=HSb(OH)6+KCl+IClSb2O3 + KIO3 + 2HCl + 6H2O = 2HSb(OH)6 + KCl + ICl
Sb2O3+KIO3+HCl+H2O=HSb(OH)6+KCl+IClSb2O3 + KIO3 + 2HCl + 6H2O = 2HSb(OH)6 + KCl + ICl
SiCl4+H2O = H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sn+KOH=K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SO3=SO2+O22SO3 = 2SO2 + O2
SO3=SO2+O22SO3 = 2SO2 + O2
SO3=SO2+O22SO3 = 2SO2 + O2
SO3=SO2+O22SO3 = 2SO2 + O2
SO3=SO2+O22SO3 = 2SO2 + O2
SO3=SO2+O22SO3 = 2SO2 + O2
SO3=SO2+O22SO3 = 2SO2 + O2
Si2H6 + H2O = Si(OH)4 + H2Si2H6 + 8H2O = 2Si(OH)4 + 7H2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+H2O=Sb2O3+H22Sb + 3H2O = Sb2O3 + 3H2
Sr(ClO3)2+NaOH=Sr(OH)2+2NaClO3Sr(ClO3)2 + 2NaOH = Sr(OH)2 + 2NaClO3
Sr(ClO3)2+H2SO4=HClO3+SrSO4Sr(ClO3)2 + H2SO4 = 2HClO3 + SrSO4
S2Cl2 + NH3 = S4N4 + S8 + NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sr + OH = Sr(OH)Sr + OH = Sr(OH)
SO3 + NO3 = NO + SO42SO3 + NO3 = NO + 2SO4
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2 + HI = I2 + S + H2OSO2 + 4HI = 2I2 + S + 2H2O
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S+O2=SO2S + O2 = SO2
S+O2=SO2S + O2 = SO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S + HNO3 =H2SO4+NH2+H2O-7S - 6HNO3 = -7H2SO4 - 6NH2 + 10H2O
S + HNO3 =H2SO4+NH2+H2O-7S - 6HNO3 = -7H2SO4 - 6NH2 + 10H2O
S + HNO3 =H2SO4+NH2+H2O-7S - 6HNO3 = -7H2SO4 - 6NH2 + 10H2O
S + HNO3 =H2SO4+NH2+H2O-7S - 6HNO3 = -7H2SO4 - 6NH2 + 10H2O
S + HNO3 =H2SO4+NH2+H2O-7S - 6HNO3 = -7H2SO4 - 6NH2 + 10H2O
S + HNO3 =H2SO4+NH2+H2O-7S - 6HNO3 = -7H2SO4 - 6NH2 + 10H2O
SiO2 + H2O = H4O4SiSiO2 + 2H2O = H4O4Si
S8 +O2 = SO3S8 + 12O2 = 8SO3
S+CO=SO2+CS + 2CO = SO2 + 2C
SO2+H2SO4= 2H2SO40SO2 + H2SO4 = H2SO4
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
S+O2=SO32S + 3O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO2S + O2 = SO2
Sn+ HNO3+ HCl= SnCl4+ NO+ H2O3Sn + 4HNO3 + 12HCl = 3SnCl4 + 4NO + 8H2O
Sr(s) + Cl2(l) = SrCl2(s)Sr(s) + Cl2(l) = SrCl2(s)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S2+Br2=SBr2S2 + 2Br2 = 2SBr2
S2 + Br2 = SBr2S2 + 2Br2 = 2SBr2
S2+Br2 = SBr2S2 + 2Br2 = 2SBr2
SiO2 + H2O = H4O4SiSiO2 + 2H2O = H4O4Si
S8 + O2 = SO3S8 + 12O2 = 8SO3
SrCl2 + Na2CO3 = SrCO3 + Na2Cl2SrCl2 + Na2CO3 = SrCO3 + Na2Cl2
SO2 + H2O +HNO3 = H2SO4 +NO3SO2 + 2H2O + 2HNO3 = 3H2SO4 + 2NO
SO2 + O2 + 2 H2O = 4 H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SiCl + C12 = SiCl4 + C0SiCl + C12 = 0SiCl4 + 12C
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sc2O3(s) + H2O(l) =Sc(OH)3(s)Sc2O3(s) + 3H2O(l) = 2Sc(OH)3(s)
Sb2 S3+HCl=H3 SbCl6+H2 SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sr(OH)2 + 2 HNO3 (aq) = Sr(NO3)2 (aq) + 2 HOH (s) Sr(OH)2 + 2HNO3(aq) = Sr(NO3)2(aq) + 2HOH(s)
Sr(OH)2 (aq) + 2 HNO3 (aq) = Sr(NO3)2 (aq) + 2 HOH (s) Sr(OH)2(aq) + 2HNO3(aq) = Sr(NO3)2(aq) + 2HOH(s)
Sr(OH)2 (aq) + 2 HNO3 (aq) = Sr(NO3)2 (aq) + 2 HOH (s) Sr(OH)2(aq) + 2HNO3(aq) = Sr(NO3)2(aq) + 2HOH(s)
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
S+Zn=ZnSS + Zn = ZnS
Sc+F2=ScF2Sc + F2 = ScF2
Sb + HNO3 = NO + Sb2O5 + H2O6Sb + 10HNO3 = 10NO + 3Sb2O5 + 5H2O
S + O2 = SO2S + O2 = SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S-- + I2 + OH- = SO4-- + I- + H205S-- + 10I2 + 20OH- = 5SO4-- + 20I- + H20
S+O2=SO32S + 3O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8+C=CS2S8 + 4C = 4CS2
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SiO2 + C = Si + COSiO2 + 2C = Si + 2CO
S+O2=SO2S + O2 = SO2
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO3+H2O=H2S+OHSO3 + 5H2O = H2S + 8OH
Si2H3 + O2 = SiO2 + H2O3 4Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 =SO3S8 + 12O2 = 8SO3
Si4 + F = SiF4Si4 + 16F = 4SiF4
Si4 + F = SiF4Si4 + 16F = 4SiF4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr+Fe2(SO4)3=SrSO4+Fe3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
SeCl6+O2 = SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb2S3+H2=Sb+H2SSb2S3 + 3H2 = 2Sb + 3H2S
Sb+HNO3=Sb2O5+NO+H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sb + H2SO4 = Sb2S3 + SO2 + H2O-2Sb + 6H2SO4 = -1Sb2S3 + 9SO2 + 6H2O
SO3=SO2+O22SO3 = 2SO2 + O2
SeCl6 + O2 = SeO2 + Cl3SeCl6 + O2 = SeO2 + 2Cl3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO3=SO2+O22SO3 = 2SO2 + O2
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
S2Cl2 + H2O = SO2 + HCl + S2S2Cl2 + 2H2O = SO2 + 4HCl + 3S
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl6+H2O=SiO2+HCl+H-1SiCl6 - 2H2O = -1SiO2 - 6HCl + 2H
Sb + H2O = Sb2O3 + H22Sb + 3H2O = Sb2O3 + 3H2
Se + H = SeH2Se + 2H = SeH2
SO2 + O2 + 4 H2O = 2 H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S8+O2=SO3S8 + 12O2 = 8SO3
Sc2O3 + H2O = Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 + Al = Si + Al2O33SiO2 + 4Al = 3Si + 2Al2O3
Sr(IO3)2 = SrI2 + O2Sr(IO3)2 = SrI2 + 3O2
SO2 + O2 + 4 H2O=2 H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnCl2+H2S=SnS+HClSnCl2 + H2S = SnS + 2HCl
SiO2 + Ca3(PO4)2 = P2O5 + CaSiO33SiO2 + Ca3(PO4)2 = P2O5 + 3CaSiO3
SnCl2 + O2 + HCl = H2SnCl6 + H2O2SnCl2 + O2 + 8HCl = 2H2SnCl6 + 2H2O
SnCl4+(NH4)3PO4=Sn3(PO4)4+NH4Cl3SnCl4 + 4(NH4)3PO4 = Sn3(PO4)4 + 12NH4Cl
SO4 + Ba(NO3) = BaSO4 + NO3SO4 + Ba(NO3) = BaSO4 + NO3
S8+O2=SO3S8 + 12O2 = 8SO3
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
Sr(NO3)2 + Na2CrO4 = SrCrO4 + NaNO3Sr(NO3)2 + Na2CrO4 = SrCrO4 + 2NaNO3
SF4 + H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8+O2 = SO3S8 + 12O2 = 8SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO2S + O2 = 2SO
S+O2=SO2S + O2 = SO2
S + O2 + H = SO4-- + H+S + 2O2 + 2H = SO4-- + 2H+
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8(s) + O2(g) =SO3(g)S8(s) + 12O2(g) = 8SO3(g)
SiCl4(l ) + Mg(s) = Si(s) + MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SiO2 + H2O = H4SiO4(aq)SiO2 + 2H2O = H4SiO4(aq)
SO3 (g) + H2O (l) = H2SO4 (aq)SO3(g) + H2O(l) = H2SO4(aq)
SO2+Ca(OH)2=CaSO3+H2OSO2 + Ca(OH)2 = CaSO3 + H2O
S+O=SO3S + 3O = SO3
SnCl2 + HNO3 + HCl = SnCl4 + NO + H2O3SnCl2 + 2HNO3 + 6HCl = 3SnCl4 + 2NO + 4H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 + Ca3(PO4)2=P2O5+CaSiO33SiO2 + Ca3(PO4)2 = P2O5 + 3CaSiO3
S8+O2=SO3S8 + 12O2 = 8SO3
SNO2+H2=SN+H2OSNO2 + 2H2 = SN + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=SO3+H2O+2NOS + 2HNO3 = SO3 + H2O + 2NO
So2+Na2Cr2O7+H2So4= Na2So4+Cr2(So4)2+H2O-8So2 + Na2Cr2O7 + 7H2So4 = Na2So4 + Cr2(So4)2 + 7H2O
SiO2(s)+C(s) = SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SbCl3 + H2S = Sb2S3 + HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
Sr+Cl2+O2=Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
Sr + Cl +O = Sr(ClO3)2Sr + 2Cl + 6O = Sr(ClO3)2
Sr+Cl2+O2=Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O3SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr+Cl2+O2=Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
Sr + Cl2 + O2 = Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
SH2+O2=H2SO4SH2 + 2O2 = H2SO4
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
Sb2O3 +H2O = H4Sb2O5Sb2O3 + 2H2O = H4Sb2O5
S+O2=SO2S + O2 = SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+2H2O+2NH3=(NH4)2SO4+2HSO2 + 2H2O + 2NH3 = (NH4)2SO4 + 2H
SiCl4+ Mg= Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + 2Li2Se = SSe2 + 2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S+O2=SO32S + 3O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 + H2O = H2SO4 SO3 + H2O = H2SO4
SO3 + H2O = H2SO4 SO3 + H2O = H2SO4
Sr+H2O=Sr(OH)=H22Sr + 2H2O = 2Sr(OH) + H2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
S+HNO3=H2SO4+NO2+H2S + 4HNO3 = H2SO4 + 4NO2 + H2
S+HNO3=H2SO4+NO2+H2S + 4HNO3 = H2SO4 + 4NO2 + H2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+O2=SO2S + O2 = SO2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SnS+HNO3=Sn(NO3)4+Sn(SO4)2+NO+H2O6SnS + 32HNO3 = 3Sn(NO3)4 + 3Sn(SO4)2 + 20NO + 16H2O
SiO2 + Ca(OH)2 = CaSiO3 + H2OSiO2 + Ca(OH)2 = CaSiO3 + H2O
Sb + HNO3 = Sb2O5 + NO + H2016Sb + 20HNO3 = 8Sb2O5 + 20NO + H20
SO2+O2 =SO32SO2 + O2 = 2SO3
Sn + NO3- + H+ = SnO2 + H2O + NO2Sn + 4NO3- + 4H+ = SnO2 + 2H2O + 4NO2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+ O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO4+NO2=SO3+NO-1SO4 + NO2 = -1SO3 + NO
SO4+NO2=SO3+NO-1SO4 + NO2 = -1SO3 + NO
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si+O2=SiO2Si + O2 = SiO2
SnO + HCl = SnCl2 + H2O SnO + 2HCl = SnCl2 + H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr(OH)2+HBr=H2O+SrBr2Sr(OH)2 + 2HBr = 2H2O + SrBr2
SiO2 + H2O = H2SiO3SiO2 + H2O = H2SiO3
Si4H10 + O2 = SiO2 + H202Si4H10 + 8O2 = 8SiO2 + H20
Si4H10 + O2 = SiO2 + H202Si4H10 + 8O2 = 8SiO2 + H20
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S+HNO3 = H2SO4+NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sc+CuSO4=Sc2(SO4)3+Cu2Sc + 3CuSO4 = Sc2(SO4)3 + 3Cu
Sc+CuSO4=ScSO4+CuSc + CuSO4 = ScSO4 + Cu
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SO2 + O2 + 2H2O = 4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn + H2S = SnS + HSn + H2S = SnS + 2H
Sn + H2S = SnS2 + HSn + 2H2S = SnS2 + 4H
Sb + H2S = Sb2S3 + H2Sb + 3H2S = Sb2S3 + 6H
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S2O3 + OCl = Cl + S4O62S2O3 + 0OCl = 0Cl + S4O6
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + KOH = K2SO3 + H2OSO2 + 2KOH = K2SO3 + H2O
SrCO3 = SrO + CO2SrCO3 = SrO + CO2
S + O2 = SO32S + 3O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SrCO3 = SrO + CO2SrCO3 = SrO + CO2
SrCO3=SrO+CO2SrCO3 = SrO + CO2
SrCO3=SrO+CO2SrCO3 = SrO + CO2
S + O2 = SO2S + O2 = SO2
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2+C=Si+CO2SiO2 + C = Si + CO2
SiO2+C=Si+CO2SiO2 + C = Si + CO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SnCl2 + HCl + H2O = SnCl4 + H2O 0SnCl2 + 0HCl + H2O = 0SnCl4 + H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SbCl3+H2S=HCl+Sb2S32SbCl3 + 3H2S = 6HCl + Sb2S3
SRCO3 = SRO+ CO2SRCO3 = SRO + CO2
SRCO3 = SRO+ CO2SRCO3 = SRO + CO2
S8(s)+O2=SO3S8(s) + 12O2 = 8SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
S(s)+O2(G)=SO2(G)S(s) + O2(G) = SO2(G)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3+KClO3=Sb4O6+SO2+KCl2Sb2S3 + 6KClO3 = Sb4O6 + 6SO2 + 6KCl
Sb2S3+KClO3=Sb4O6+SO2+KCl2Sb2S3 + 6KClO3 = Sb4O6 + 6SO2 + 6KCl
Sb2S3+KClO3=Sb4O6+SO2+KCl2Sb2S3 + 6KClO3 = Sb4O6 + 6SO2 + 6KCl
SO2 + HNO3 + H2O = H2SO4+NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.