Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S2H5 + O2 = SO2 + H2O4S2H5 + 13O2 = 8SO2 + 10H2O
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SnI4+Mg=MgI2+SnSnI4 + 2Mg = 2MgI2 + Sn
SO2 (g) +O2 (g) +CaCO3 (s)=CaSO4 (s) +CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
SiO2 + BrF3 = SiF4 + Br2 + O23SiO2 + 4BrF3 = 3SiF4 + 2Br2 + 3O2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + MgO = MgSO3SO2 + MgO = MgSO3
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SnO2 + H2 = Sn +H2OSnO2 + 2H2 = Sn + 2H2O
SCl2 + NaF = SF4 + S2Cl2 + NaCl 3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
Sn + H3PO4 = H2 + Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
Sr + S = SrSSr + S = SrS
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8+12O2=8SO3S8 + 12O2 = 8SO3
S8 + O2 = SO2 S8 + 8O2 = 8SO2
S8 + O2 = SO2 S8 + 8O2 = 8SO2
S (s) + O2 (g) = SO3 (g)2S(s) + 3O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
S2Fe+O2=Fe2O3+SO24S2Fe + 11O2 = 2Fe2O3 + 8SO2
S+O=SO2S + 2O = SO2
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SrCl2 + Li3PO4 =Sr3(PO4)2 +LiCl3SrCl2 + 2Li3PO4 = Sr3(PO4)2 + 6LiCl
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+ O2 + H2O= H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(OH)2 + H3 P O4 = Sr3 ( PO4 ) 2 + H2 O3Sr(OH)2 + 2H3PO4 = Sr3(PO4)2 + 6H2O
Sb+I2=SbI32Sb + 3I2 = 2SbI3
S8+HNO3=H2SO4+NOS8 + 16HNO3 = 8H2SO4 + 16NO
Si4 H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb2S5 + HNO3 + H2O = H3SbO4 + H2SO4 + NO3Sb2S5 + 40HNO3 + 4H2O = 6H3SbO4 + 15H2SO4 + 40NO
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10 +O2 = SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SO2+O2+CaCO3=CaSO4+CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
SCl2+NaF=SF4+S2Cl2+NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SO2 + O2 + CaCO3 = CaSO4 + CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SbCl5 + H2O = SbOCl3 + HCl SbCl5 + H2O = SbOCl3 + 2HCl
SCl2+NaF=SF4+S2Cl2+NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SCl2 + NaF = SF4 + S2Cl2 + NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2 (g) +O2 (g) + CaCO3 (s) =CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SO2 +O2 +CaCO3 =CaSO4 +CO2 2SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
SnO2 + H2 =Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SbCl5 + H2O = SbOCl3 + HClSbCl5 + H2O = SbOCl3 + 2HCl
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SCl2 +NaF =SF4+S2Cl2 +NaCl 3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2(g)+O2(g)+CaCO3(s)=CaSO4(s)+CO2(g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SCl2 + NaF = SF4 + S2Cl2 +NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2 (g) + O2 (g) + CaCO3 = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3 = 2CaSO4(s) + 2CO2(g)
SCl2+NaF=SF4+S2Cl2 +NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SbCl5 (s) + H2O (l) =SbOCl3 (s) + HCl (aq)SbCl5(s) + H2O(l) = SbOCl3(s) + 2HCl(aq)
SO2 + O2 + CaCO3 = CaSO4 + CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
SCl2 (l) + NaF (s) = SF4 (g) + S2Cl2 (l) + NaCl (s)3SCl2(l) + 4NaF(s) = SF4(g) + S2Cl2(l) + 4NaCl(s)
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SO2 + O2 + CaCO3 = CaSO4 + CO2 2SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
SO2=O2=SO32SO2 = -1O2 + 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SbCl5 (s)+H2O (l)=SbOCl3 (s)+ HCl(aq)SbCl5(s) + H2O(l) = SbOCl3(s) + 2HCl(aq)
SCl2 (l) + NaF(s) = SF4(g) + S2Cl2 (l) + NaCl (s)3SCl2(l) + 4NaF(s) = SF4(g) + S2Cl2(l) + 4NaCl(s)
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SCl2 (l)+NaF (s)=SF4(g)+S2Cl2 (l)+NaCl (s)3SCl2(l) + 4NaF(s) = SF4(g) + S2Cl2(l) + 4NaCl(s)
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SbCl5 + H2O = SbOCl3 + HClSbCl5 + H2O = SbOCl3 + 2HCl
SCl2+NaF=SF4+S2Cl2+NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SCl2 + NaF = SF4 + S2Cl2 + NaCl 3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
Sb2S3 + O2 = 2Sb2O3 + 6SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO2 + H2O + Br2 = H+ + SO42- + Br-2SO2 + 80H2O + 79Br2 = 160H+ + 2SO42- + 158Br-
SO2 + H2O + Br2 = H+ + SO42- + Br-2SO2 + 80H2O + 79Br2 = 160H+ + 2SO42- + 158Br-
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+6NO2+2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S8+HNO3=H2SO4+NO2+H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
SnS2 + O2 = SnO2 + SO2SnS2 + 3O2 = SnO2 + 2SO2
Sn+HNO3=SnN2+NH4(NO3)+H2O4Sn - 2HNO3 = 4SnN2 - 5NH4(NO3) + 9H2O
S+O2= SO32S + 3O2 = 2SO3
S8+F2=SF6S8 + 24F2 = 8SF6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2 + Br2 + H2O = H+ + SO4-2+ Br-SO2 + Br2 + 2H2O = 4H+ + SO4-2 + 2Br-
SO2 + Br2 + H2O = H+ + SO4 2- + Br-2SO2 + 79Br2 + 80H2O = 160H+ + 2SO42- + 158Br-
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SbCl5 +H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SCl2 +NaF =SF4+S2Cl2+NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2 + O2 + CaCO3 = CaSO4 + CO2 2SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SnO2 + H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3 + Fe = 3FeS + 2SbSb2S3 + 3Fe = 3FeS + 2Sb
Si + F2 = SiF4Si + 2F2 = SiF4
S(s) + O2(g) = S2O4(s)2S(s) + 2O2(g) = S2O4(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SbCl5 (s) + H2O (l) = SbOCl3 (s) + HCl (aq)SbCl5(s) + H2O(l) = SbOCl3(s) + 2HCl(aq)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SbCl5 (s)+H2O=SbOCl3 (s)+HClSbCl5(s) + H2O = SbOCl3(s) + 2HCl
SCl2 (l) + NaF (s) = SF4 (g) + S2Cl2 (l) + NaCl (s)3SCl2(l) + 4NaF(s) = SF4(g) + S2Cl2(l) + 4NaCl(s)
SbCl5 (s) + H2O (l) = SbOCl3 (s) + HCl (aq)SbCl5(s) + H2O(l) = SbOCl3(s) + 2HCl(aq)
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SCl2 (l) + NaF (s) = SF4 (g) + S2Cl2 (l) + NaCl (s)3SCl2(l) + 4NaF(s) = SF4(g) + S2Cl2(l) + 4NaCl(s)
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
S+O2=SO32S + 3O2 = 2SO3
SO2 (g) + O2 (g) + CaCO3 (s) =CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SO2 (g) + O2 (g) + CaCO3 (g) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(g) = 2CaSO4(s) + 2CO2(g)
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sn(OH)4 + HBrO3 = Sn(BrO3)4 + H2OSn(OH)4 + 4HBrO3 = Sn(BrO3)4 + 4H2O
Sr + HIO3 = Sr(IO3)2 + H2Sr + 2HIO3 = Sr(IO3)2 + H2
SnCl4+Mg=Sn+MgCl2SnCl4 + 2Mg = Sn + 2MgCl2
Sn+H2SO4=SnSO4+SO2+H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
S8+O2=SO3S8 + 12O2 = 8SO3
SnS2 (s)+O2 (g) = SnO2(s)+SO2 (g)SnS2(s) + 3O2(g) = SnO2(s) + 2SO2(g)
Sn + H2SO4 = SnSO4 + SO2 + H2O Sn + 2H2SO4 = SnSO4 + SO2 + 2H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO2S8 + 8O2 = 8SO2
S8+4O2=4SO2S8 + 8O2 = 8SO2
SiH4(g) + NH3(g) = Si3N4(s) + H2(g)3SiH4(g) + 4NH3(g) = Si3N4(s) + 12H2(g)
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
SrSO3 + HNO3 = HSO3 + SrNO3SrSO3 + HNO3 = HSO3 + SrNO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SrBr2 + K3AsO4 = Sr3(AsO4)2 + KBr3SrBr2 + 2K3AsO4 = Sr3(AsO4)2 + 6KBr
S8 + O2 = SO3S8 + 12O2 = 8SO3
SnH2SO4=SnSO4+SO2+H2010SnH2SO4 = 10SnSO4 + 0SO2 + H20
SnH2SO4=SnSO04+SO2+H2010SnH2SO4 = 10SnSO04 + 0SO2 + H20
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sn+O2+H2=Sn (HO) 4Sn + 2O2 + 2H2 = Sn(HO)4
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S8 +O2 =SO2S8 + 8O2 = 8SO2
Sn + Hg2(NO3)2 = Sn(NO3)4 + HgSn + 2Hg2(NO3)2 = Sn(NO3)4 + 4Hg
Sn + Hg2(NO3)2 = Sn(NO3)2 + HgSn + Hg2(NO3)2 = Sn(NO3)2 + 2Hg
Si2H + O2 = SiO3 + H2O34Si2H + 15O2 = 8SiO3 + 2H2O3
SbCl5+KI=KCl+I2+SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn(OH)4 + HClO3 = H2O + SnCl4 +H2O0Sn(OH)4 + 0HClO3 = -1H2O + 0SnCl4 + H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8+F2=SF6S8 + 24F2 = 8SF6
S8 + O2 = SO3S8 + 12O2 = 8SO3
S+N2O=SO2+N2S + 2N2O = SO2 + 2N2
Sr+O2=2SrO2Sr + O2 = 2SrO
Sr+O2=2SrO2Sr + O2 = 2SrO
SO2 + O2 = SO32SO2 + O2 = 2SO3
S(s)+HNO3(aq)=H2SO4(aq)+H2O(l)+NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S(s)+HNO3(aq)=H2SO4(aq)+H2O(l)+NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S+N2O=SO2+N2S + 2N2O = SO2 + 2N2
SiF4(s)+NaOH(aq)=Na4SiO4(s)+NaF(aq)H2O(l)SiF4(s) + 8NaOH(aq) = Na4SiO4(s) + 4NaF(aq)H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(SO4) (aq) + Ca (s)= Sn (s) + Ca(SO4)Sn(SO4)(aq) + Ca(s) = Sn(s) + Ca(SO4)
Sn(SO4) (aq) + Ca (s)= Sn (s) + Ca(SO4)Sn(SO4)(aq) + Ca(s) = Sn(s) + Ca(SO4)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb+S8=Sb2S516Sb + 5S8 = 8Sb2S5
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiI4(s) + Mg(s) = Si(s) + MgI2(s)SiI4(s) + 2Mg(s) = Si(s) + 2MgI2(s)
Si2H3 +O2= SiO2 +H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO 2 (g) + O 2 (g) = SO 3 (g) 2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Si+2Cl2=SiCl4Si + 2Cl2 = SiCl4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Si O2 +HF= SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sn + HNO3 = Sn(NO3)2 + NH4NO3 + H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
Sb + S8 = Sb2S516Sb + 5S8 = 8Sb2S5
Sn + O2 = SnO2Sn + O2 = 2SnO
SiO2 + HF =SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(s) + H2O(l) = Sr(OH)2(aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
Si + O2 = SiO2Si + O2 = SiO2
Si + O2 = SiO2Si + O2 = SiO2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + HNO3= H2 SO4 + NO S + 2HNO3 = H2SO4 + 2NO
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
Si2H3 + O2 = SiO2+H2020Si2H3 + 40O2 = 40SiO2 + 3H20
Sn + Br2 = SnBr2Sn + Br2 = SnBr2
Sn + Br2 = SnBr2Sn + Br2 = 2SnBr
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S8+O2=SO3S8 + 12O2 = 8SO3
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
Si (s) + F2 (g) =SiF4 (g)Si(s) + 2F2(g) = SiF4(g)
SO3+MnO=SO4+MnSO3 + MnO = SO4 + Mn
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiC + Cl2 = SiCl4 + CSiC + 2Cl2 = SiCl4 + C
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+F2=SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
S8+F2=SF6S8 + 24F2 = 8SF6
SiO + H2SO3 = H2O + SiSO3SiO + H2SO3 = H2O + SiSO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2 + O2 + CaCO3 = CaSO4 + CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
S8 + H2 = H2SS8 + 8H2 = 8H2S
SbCl5 + H2O = SbOCl3 + HClSbCl5 + H2O = SbOCl3 + 2HCl
SCl2 +NaF = SF4 + S2Cl2 + NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SiI4(s) + H2O(l) = HI(aq) + H2SiO3(s)SiI4(s) + 3H2O(l) = 4HI(aq) + H2SiO3(s)
S8+O2=SO3S8 + 12O2 = 8SO3
Sn+HNO3=Sn(NO3)2+NH4(NO3)+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4(NO3) + 3H2O
SO2 + O2 + CaCO3 = CaSO4 + CO2 2SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SbCl5 (s) + H2O (l) = SbOCl3 (s) +HCl (aq)SbCl5(s) + H2O(l) = SbOCl3(s) + 2HCl(aq)
SO2 (g) + O2 (g) + CaCO3 (s)= CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SnSO4 + 1KBr = 2SnBr2 + 3K2SO4 SnSO4 + 2KBr = SnBr2 + K2SO4
S+HNO3=H2O+H2SO4+NO2S + 6HNO3 = 2H2O + H2SO4 + 6NO2
SO2 + O2 = SO2SO2 + 0O2 = SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SnCl2 + HgCl2 = SnCl4 + HgClSnCl2 + 2HgCl2 = SnCl4 + 2HgCl
SnCl2 + HgCl2 = SnCl4 + HgClSnCl2 + 2HgCl2 = SnCl4 + 2HgCl
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SiCl4+H2O= SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
S8+F2=SF6S8 + 24F2 = 8SF6
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SeO2+H2Se=Se+H2OSeO2 + 2H2Se = 3Se + 2H2O
SeO3+H2Se=Se+H2OSeO3 + 3H2Se = 4Se + 3H2O
Sc2O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SO2(g) + O2(g)= SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S2-+I2+OH=SO4+I-+H2O2S2- + I2 + 32OH = 4SO4 + 2I- + 16H2O
Sr+P4=SrP4Sr + P4 = SrP4
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
S+O2=SO32S + 3O2 = 2SO3
SO2(g) +O2(g) = SO32SO2(g) + O2(g) = 2SO3
Sn*2+ = Sn*4+ + Sn2Sn*2+ = Sn*4+ + Sn
Sn 2+ = Sn 4+ + Sn-1Sn2+ = -1Sn4+ + 2Sn
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S+O2=SO32S + 3O2 = 2SO3
S + 6HNO3 = H2SO4 + 6NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2 +4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(ClO3)2 + C = CO2 + SrCl2Sr(ClO3)2 + 3C = 3CO2 + SrCl2
Sr(CLO3)2 + C = CO2 + SrCL2Sr(CLO3)2 + 2C = 3CO2 + SrCL2
Sr(CLO3)2 + 2C = 3CO2 + SrCL2Sr(CLO3)2 + 2C = 3CO2 + SrCL2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sn+NO3-+H+=Sn2++NH4++H2O16Sn + NO3- + 10H+ = 8Sn2+ + NH4+ + 3H2O
SiO2+H2O=H4SiO4SiO2 + 2H2O = H4SiO4
SiO2+H2O=H4SiO4SiO2 + 2H2O = H4SiO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S=S88S = S8
S=S88S = S8
S2 +O =S2OS2 + O = S2O
SnSO4 + KBr = SnBr2 + K2SO4SnSO4 + 2KBr = SnBr2 + K2SO4
S+O2=SO32S + 3O2 = 2SO3
SbO3+HCl=SbCl3+H2+O22SbO3 + 6HCl = 2SbCl3 + 3H2 + 3O2
SbO3+HCl=SbCl3+H2O+O24SbO3 + 12HCl = 4SbCl3 + 6H2O + 3O2
S2O3 + H2O = SO4 + H2 S2O3 + 5H2O = 2SO4 + 5H2
SO3 = SO2 + O22SO3 = 2SO2 + O2
SiO2 + 2NaOH = Na2SiO3 + H2OSiO2 + 2NaOH = Na2SiO3 + H2O
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sb2S3 (s) + O2 (g) = Sb2O3 (s) + SO2 (g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sb2S (s) + O2 (g) = Sb2O3 (s) + SO2 (g)2Sb2S(s) + 5O2(g) = 2Sb2O3(s) + 2SO2(g)
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+4F+4NH3=SiF4+H2O+4NH30SiO2 + 0F + NH3 = 0SiF4 + 0H2O + NH3
SO2+2H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SO+2H2S=S+H2OSO + H2S = 2S + H2O
Sr+HNO3=Sr (NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SiO2 + HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
SO3 +H2SO4= H2S2O7SO3 + H2SO4 = H2S2O7
SnSO4+KBr=SnBr2+K2SO4SnSO4 + 2KBr = SnBr2 + K2SO4
SO+O2=SO3SO + O2 = SO3
S4 + F= SF2S4 + 8F = 4SF2
Sb + S8 = Sb2S316Sb + 3S8 = 8Sb2S3
Sb + S8 = SbS38Sb + 3S8 = 8SbS3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SF4 + O2= SO2 + FO2SF4 + 5O2 = SO2 + 4FO2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S+KCIO3=SO2+KCI3S + 2KCIO3 = 3SO2 + 2KCI
S+KCIO=SO+KCIS + KCIO = SO + KCI
S+KCIO=SO+KCIS + KCIO = SO + KCI
S+O2=SO32S + 3O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 + S8 = SO216SO3 + S8 = 24SO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + NO2 = SO2 + N2S8 + 8NO2 = 8SO2 + 4N2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO4 + H2S = S + H2OSO4 + 4H2S = 5S + 4H2O
S2O3-- + I2 = I- + S4O6--2S2O3-- + I2 = 2I- + S4O6--
S2O3 + I2 = I- + S4O62S2O3 + 0I2 = 0I- + S4O6
S2O3 + I2 = I- + S4O62S2O3 + 0I2 = 0I- + S4O6
Sr(NO3)2 + MgSO4 = SrSO4 + Mg(NO3)2Sr(NO3)2 + MgSO4 = SrSO4 + Mg(NO3)2
SO3 + S8 = S2O8SO3 + 5S8 = 24S2O
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO3(g) = SO2(g) + O22SO3(g) = 2SO2(g) + O2
SO2+O2=2SO32SO2 + O2 = 2SO3
S(s)+O2(g)+H2O(l)= H2SO4(l)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(l)
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sn+Cl2=SnCl2Sn + Cl2 = SnCl2
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + NO3 = SO2 + NOS8 + 8NO3 = 8SO2 + 8NO
Sr(s) + Br2(g) = SrBr2(s)Sr(s) + Br2(g) = SrBr2(s)
S+CO = SO2 + CS + 2CO = SO2 + 2C
SO3+H2O=SO+H2O0SO3 + H2O = 0SO + H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SnCl4 + K2CrO4 = K2Cl4 + SnCrO4SnCl4 + K2CrO4 = K2Cl4 + SnCrO4
SnCl4 + Na3PO4 = Na3Cl4 + SnPO4SnCl4 + Na3PO4 = Na3Cl4 + SnPO4
SnCl4 + KI = KCl4 + SnISnCl4 + KI = KCl4 + SnI
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SnO2+H2=Sn+2 H2OSnO2 + 2H2 = Sn + 2H2O
SO2(g) + O2 (g) = SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
Sr(NO3)2 + MgSO4 = SrSO4 + Mg(NO3)2 Sr(NO3)2 + MgSO4 = SrSO4 + Mg(NO3)2
Sr(NO3)2 + Na2CO3 = SrCO3 + 2 NaNO3 Sr(NO3)2 + Na2CO3 = SrCO3 + 2NaNO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SeCl6+O2= SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
S2Fe+O2=Fe2O3+SO24S2Fe + 11O2 = 2Fe2O3 + 8SO2
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S8 (s) + O2(g) = SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
SO2+H2=S+H2OSO2 + 2H2 = S + 2H2O
SO2 + O2= SO32SO2 + O2 = 2SO3
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SiI4 + 2Mg = Si + 2MgI2SiI4 + 2Mg = Si + 2MgI2
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=SO2+NO3+H2O-1S + 4HNO3 = -1SO2 + 4NO3 + 2H2O
Sn(CH3COO)2+2H(OH)=CH3COOH+Sn(OH)2Sn(CH3COO)2 + 2H(OH) = 2CH3COOH + Sn(OH)2
Sn(CH3COO)2+2H(OH)=2CH3COOH+Sn(OH)2Sn(CH3COO)2 + 2H(OH) = 2CH3COOH + Sn(OH)2
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SnCl4+2SeO2 + (CH2OH)2 = SnSe2 + H2O + HCl + CO25SnCl4 + 10SeO2 + 6(CH2OH)2 = 5SnSe2 + 8H2O + 20HCl + 12CO2
SnCl2+2SeO2 + (CH2OH)2 = SnSe2 + H2O + HCl + CO2SnCl2 + 2SeO2 + (CH2OH)2 = SnSe2 + 2H2O + 2HCl + 2CO2
SnCl4+2SeO2 + (CH2OH)2 = SnSe2 + H2O + HCl + CO25SnCl4 + 10SeO2 + 6(CH2OH)2 = 5SnSe2 + 8H2O + 20HCl + 12CO2
SnCl4+2SeO2 + (CH2OH)2 = SnSe2 + H2O + HCl + CSnCl4 + 2SeO2 + 6(CH2OH)2 = SnSe2 + 16H2O + 4HCl + 12C
Sc2O3(s) + H2O(l) =Sc(OH)3(s)Sc2O3(s) + 3H2O(l) = 2Sc(OH)3(s)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Si (s) + Cl2 (g) = SiCl4 (l) Si(s) + 2Cl2(g) = SiCl4(l)
SiO2 (l) + C (s) = Si (l) + 2CO (g) SiO2(l) + 2C(s) = Si(l) + 2CO(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
SiO 2 (s)+4HF(aq)= SiF 4 (g)+2 H 2 O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SnSO4+KBr=SnBr2+K2SO4SnSO4 + 2KBr = SnBr2 + K2SO4
S(s)+HNO3(aq)=H2SO4(aq)+H2O+NO2S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O + 6NO2
Sb2O3 + H2S = Sb2S3 + H2OSb2O3 + 3H2S = Sb2S3 + 3H2O
SnCl+NiS=NiCl+SnSSnCl + NiS = NiCl + SnS
Sb2S3 + HCl =SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sb2S3 + HCl =SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sc + C = Sc4C34Sc + 3C = Sc4C3
S + F2 = SF4S + 2F2 = SF4
Sn + O2 = SnO2Sn + O2 = SnO2
Sn + O2 = SnO2Sn + O2 = SnO2
SO2+O2=SO32SO2 + O2 = 2SO3
S + LiNO3 = SO3 + N2 + Li2S + 2LiNO3 = 2SO3 + N2 + 2Li
S8+O2=SO2S8 + 8O2 = 8SO2
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S+Sn4+=S3+ + Sn2+-3S + Sn4+ = -1S3+ + 2Sn2+
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO3 = SO2 + 3O22SO3 = 2SO2 + O2
SnS + Cl2 + LiOH + KNO3 = SnCl2 + NO3 + KOH + LiSSnS + Cl2 + LiOH + KNO3 = SnCl2 + NO3 + KOH + LiS
Sb + I2 = SbI32Sb + 3I2 = 2SbI3
Sb + S = SbSSb + S = SbS
S8+F2= SF6S8 + 24F2 = 8SF6
SO2+NO=SO3+N22SO2 + 2NO = 2SO3 + N2
SO2+NO=SO3+NSO2 + NO = SO3 + N
Sc2O3(s)+SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sn(OH)3 = Sn + Sn(OH)62Sn(OH)3 = Sn + Sn(OH)6
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Sr(NO3)2 + Al(NO3)3 +NaOH = Sr3Al2(OH)12 + NaNO3 3Sr(NO3)2 + 2Al(NO3)3 + 12NaOH = Sr3Al2(OH)12 + 12NaNO3
SnCl4+2H2 O=SnO2+4HClSnCl4 + 2H2O = SnO2 + 4HCl
SO2+O2=SO32SO2 + O2 = 2SO3
SO3(g)+2H2O(l)=H2SO4SO3(g) + H2O(l) = H2SO4
SO3(g)+2H2O(l)=H2SO4SO3(g) + H2O(l) = H2SO4
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SnSO4 + KBr = SnBr2 + K2SO4SnSO4 + 2KBr = SnBr2 + K2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 (g)+ O2 (g)=SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
SiCl4 + H2O =H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO2S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO3(g)+H2O(l)=H2SO4SO3(g) + H2O(l) = H2SO4
Sn + H2PO2 = SnPO2H2Sn + H2PO2 = SnPO2H2
SiO2 + 4HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
SrCO3 + HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Sb2S3 + 9O2 = Sb2O3 + 6SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
Sn + Cl2 = SnCl4Sn + 2Cl2 = SnCl4
Sc2O3 + H2O=Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr3P2 + Cl2 = SrCl2 + PSr3P2 + 3Cl2 = 3SrCl2 + 2P
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) + CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S + HNO3 = H2SO4 + NO2 = H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S2O3 + OH = SO4+ H2OS2O3 + 10OH = 2SO4 + 5H2O
SO2 + O2 + CaCO3 = CaSO4 + CO2 2SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
S2Fe+O2=Fe2O3+SO24S2Fe + 11O2 = 2Fe2O3 + 8SO2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3+H2O = H2SO4SO3 + H2O = H2SO4
SO3+H2O = H2SO4SO3 + H2O = H2SO4
SiBr4 + Mg = Si + MgBr2SiBr4 + 2Mg = Si + 2MgBr2
SO2 + O2 =SO32SO2 + O2 = 2SO3
SiO+C=SiC+COSiO + 2C = SiC + CO
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
Sn3(PO4)4 + 4Zn = 3Sn + 4Zn(PO4)Sn3(PO4)4 + 4Zn = 3Sn + 4Zn(PO4)
Sr3N2+Na2O=SrO+Na3NSr3N2 + 3Na2O = 3SrO + 2Na3N
Sn+AlCl3=Al+SnCl23Sn + 2AlCl3 = 2Al + 3SnCl2
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+HNO2=Sb2O5+NO2+H2O-2Sb + 10HNO2 = -1Sb2O5 + 10NO2 + 5H2O
Sb+HNO2=Sb2O5+NO2+H2O-2Sb + 10HNO2 = -1Sb2O5 + 10NO2 + 5H2O
SO3 + 2(H2O) = H2SO4SO3 + (H2O) = H2SO4
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiH3+O2=SiO2+H2O34SiH3 + 13O2 = 4SiO2 + 6H2O3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2+O2+CaCO3=CaSO4+CO22SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
S8 (s) + O2 (g) = SO3 (g)S8(s) + 12O2(g) = 8SO3(g)
SO4= O2+ SO2SO4 = O2 + SO2
SO4= O2+ SO2SO4 = O2 + SO2
Si2H3 (l) + O2 (g) = SiO2 (s) + H2O (l)4Si2H3(l) + 11O2(g) = 8SiO2(s) + 6H2O(l)
Si2H3 (l) + O2 (g) = SiO2 (s) + H2O (l)4Si2H3(l) + 11O2(g) = 8SiO2(s) + 6H2O(l)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8(s) +Cu(s)=Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 (g) + O2 (g) + CaCO3 (s) = CaSO4 (s) +CO2 (g)2SO2(g) + O2(g) + 2CaCO3(s) = 2CaSO4(s) + 2CO2(g)
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si+S8=Si2S28Si + S8 = 4Si2S2
Si+NaOH+H2O=Na2SiO3+H2Si + 2NaOH + H2O = Na2SiO3 + 2H2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8 + C = CS2S8 + 4C = 4CS2
Sr(s) + F2(g)=Sr2F4Sr(s) + F2(g) = 2Sr2F
SCl2(l) + NaF(s) = S2Cl2(l) + SF4(g) + NaCl(s)3SCl2(l) + 4NaF(s) = S2Cl2(l) + SF4(g) + 4NaCl(s)
SCl2(l) + NaF(s) = S2Cl2(l) + SF4(g) + NaCl(s)3SCl2(l) + 4NaF(s) = S2Cl2(l) + SF4(g) + 4NaCl(s)
S + O2 = SO32S + 3O2 = 2SO3
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SO2 + O2 =SO32SO2 + O2 = 2SO3
SbCl5 + 2KI =SbCl3 + 2KCl + I2SbCl5 + 2KI = SbCl3 + 2KCl + I2
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2SO44 + NO2 + H2OS + 86HNO3 = H2SO44 + 86NO2 + 42H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.