Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
S8+O2=SO2S8 + 8O2 = 8SO2
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO3 + Co(OH)2 = Co + SO4+ H2OSO3 + Co(OH)2 = Co + SO4 + H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Sb+O2=Sb2O54Sb + 5O2 = 2Sb2O5
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2+HMnO2+H2O=H2SO4+Mn(OH)2SO2 + 2HMnO2 + 2H2O = H2SO4 + 2Mn(OH)2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Si4H10(l)+ O2 (g) = SiO2 (s) +H2O (l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sr(s) + H2O(l) = Sr(OH)2(aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sn + HNO3 = Sn(NO3)2 + NO +H2O3Sn + 8HNO3 = 3Sn(NO3)2 + 2NO + 4H2O
Sn + HNO3 = Sn(NO3)2 + NO +H2O3Sn + 8HNO3 = 3Sn(NO3)2 + 2NO + 4H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3 + NaOH = Na2SO4 + H2OSO3 + 2NaOH = Na2SO4 + H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.