Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S+FE=FESS + FE = FES
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb + HNO3 = Sb2O3 +NO + H2O2Sb + 2HNO3 = Sb2O3 + 2NO + H2O
SO3(g)+H2O(g)=H2SO4(aq)SO3(g) + H2O(g) = H2SO4(aq)
SO3(g)+H2O(g)=H2SO4(aq)SO3(g) + H2O(g) = H2SO4(aq)
SO2 + O2 =SO3 2SO2 + O2 = 2SO3
SiO2 (s) + 3C (s) = SiC (s) + 2CO (g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO2+H2O=H2SO4+H2O0SO2 + H2O = 0H2SO4 + H2O
SO2+H2O=H2SO4+H2O0SO2 + H2O = 0H2SO4 + H2O
Sr+F2=Sr2F4Sr + F2 = 2Sr2F
SO2 (g)+O2 (g)=SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2+2NF3+2NH3 = (NH4)2SiF(s)+2N2+2H2O6SiO2 + 2NF3 + 24NH3 = 6(NH4)2SiF(s) + 7N2 + 12H2O
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
S2- + MnO4- + 8H+ = Mn2+ + 4H2O + S13S2- + 2MnO4- + 16H+ = Mn2+ + 8H2O + 26S
SO2+2O2=SO32SO2 + O2 = 2SO3
SNO2+C=CO+SNSNO2 + 2C = 2CO + SN
SiO2 + HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
S8+12O2=8SO3S8 + 12O2 = 8SO3
Si+O2=SiO2Si + O2 = SiO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sr(NO3)2+Al(NO3)3*9H2O+(NH2)2CO = SrAl2O4+H2O+CO2+N23Sr(NO3)2 + 6Al(NO3)3*9H2O + 20(NH2)2CO = 3SrAl2O4 + 94H2O + 20CO2 + 32N2
SrCO3+Al(NO3)3*9H2O+(NH2)2CO = SrAl2O4+H2O+CO2+N2SrCO3 + 2Al(NO3)3*9H2O + 5(NH2)2CO = SrAl2O4 + 28H2O + 6CO2 + 8N2
SO2 + KMgO4 + H2SO4 = KSO4 + H2O + MgSO42SO2 + KMgO4 + 0H2SO4 = KSO4 + 0H2O + MgSO4
SO2 + KMnO4 + H2SO4 = KSO4 + H2O + MnSO42SO2 + KMnO4 + 0H2SO4 = KSO4 + 0H2O + MnSO4
Sr+P4=Sr3P26Sr + P4 = 2Sr3P2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(NO3)2 + SO3 = SrSO3 + 2NO3Sr(NO3)2 + SO3 = SrSO3 + 2NO3
S+O2=SO2S + O2 = 2SO
S2- + MnO4- + 8H+ = Mn2+ + 4H2O + S13S2- + 2MnO4- + 16H+ = Mn2+ + 8H2O + 26S
SO32- + MnO4- + H+ = Mn2+ + H2O + SO4213SO32- + 42MnO4- + 76H+ = 21Mn2+ + 38H2O + 13SO42
S2O32- + MnO4- + H+ = Mn2+ + 2H2O + 2SO42-13S2O32- + 206MnO4- + 296H+ = 103Mn2+ + 148H2O + 26SO42-
SO3=SO2+O22SO3 = 2SO2 + O2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SO2+H2S=S2+H2O2SO2 + 4H2S = 3S2 + 4H2O
SO3=SO2+O22SO3 = 2SO2 + O2
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
S8+O2=SO3S8 + 12O2 = 8SO3
Sn +HCl2=SnCl2+HSn + HCl2 = SnCl2 + H
Sn +HCl2=SnCl2+HSn + HCl2 = SnCl2 + H
Sn +HCl2=SnCl2+HSn + HCl2 = SnCl2 + H
Sb2S3 + HO = 2HSbO4 + 3S + OH2Sb2S3 + 14HO = 2HSbO4 + 3S + 6OH2
Sb2S3 + H2O = 2HSbO4 + 3S + OH-1Sb2S3 + 6H2O = -2HSbO4 - 3S + 14OH
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2+SO2Sb2S3 + 3O2 = Sb2 + 3SO2
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb2S3 + O2 = Sb2O4 + SO2Sb2S3 + 5O2 = Sb2O4 + 3SO2
Sb2S3 + O2 = Sb2O4 + SO4Sb2S3 + 8O2 = Sb2O4 + 3SO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3 + H2O= H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S2O3-- + H3O+ = SO2 + S2 + H2O2S2O3-- + 4H3O+ = 2SO2 + S2 + 6H2O
S2O32- + H3O+ = SO2 + S2 + H2O8S2O32- + 8H3O+ = 126SO2 - 55S2 + 12H2O
SO3 = SO2 + O22SO3 = 2SO2 + O2
Si + KOH + H2O = SiO2(KOH) + H2Si + KOH + 2H2O = SiO2(KOH) + 2H2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2(s)+C(s)=Si(s)+CO(g)SiO2(s) + 2C(s) = Si(s) + 2CO(g)
S8 + F2=SF6S8 + 24F2 = 8SF6
Sr + H2S2O3 = HSr + S2O32Sr + H2S2O3 = 2HSr + S2O3
Sb+H2O=Sb3O3+H23Sb + 3H2O = Sb3O3 + 3H2
SO2(g) + NaOH(s) = Na2SO3(s) + H2O(l)SO2(g) + 2NaOH(s) = Na2SO3(s) + H2O(l)
SiO2 +C=SiC + COSiO2 + 3C = SiC + 2CO
SiH3 + O2 = SiO2 + H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
SnCl2+K2Cr2O7+H2SO4=Sn(SO4)2+CrCl3+K2SO4+H2O3SnCl2 + K2Cr2O7 + 7H2SO4 = 3Sn(SO4)2 + 2CrCl3 + K2SO4 + 7H2O
SO42- + NH3 = SO32- +H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO2 + H2O + O2 = H2SO3SO2 + H2O + 0O2 = H2SO3
SiO2+4C=SiC+2COSiO2 + 3C = SiC + 2CO
SrSe(s) + 2 HBr(aq) = SrBr2(aq) + H2Se(g)SrSe(s) + 2HBr(aq) = SrBr2(aq) + H2Se(g)
S8+O2=SO2S8 + 8O2 = 8SO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SiC+Cl2 =SiCl4+CSiC + 2Cl2 = SiCl4 + C
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2 + KOH = KHSO3SO2 + KOH = KHSO3
SO2 + KOH = KHSO3SO2 + KOH = KHSO3
SO42- + NH3 = SO32- + H2O +N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO4 -2 +NH3 = SO3 -2 +H2O + N23SO4-2 + 2NH3 = 3SO3-2 + 3H2O + N2
SiO2 + 2C = Si + 2COSiO2 + 2C = Si + 2CO
Si + O2 = SiO2Si + O2 = SiO2
S-- + NO3- + H+ = N2O + S + H2O4S-- + 2NO3- + 10H+ = N2O + 4S + 5H2O
S2- + NO3- + H+ = N2O + S + H2O8S2- + 2NO3- + 10H+ = N2O + 16S + 5H2O
SCl2 + NaF + Cl2 = SF4 + NaClSCl2 + 4NaF + Cl2 = SF4 + 4NaCl
SCl2 + NaF + Cl2 = SF4 + NaClSCl2 + 4NaF + Cl2 = SF4 + 4NaCl
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S + H2SO4 = 3SO2 + 2H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4(l)+H2O(l) = SiO2(s)+HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + H2SO4 = SnSO4 + SO2 + H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
Sn + H2SO4 = SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
SiC + Cl2=SiCl4 + CSiC + 2Cl2 = SiCl4 + C
SO2+Ca(OH)2=CaSO3+H2OSO2 + Ca(OH)2 = CaSO3 + H2O
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S + 2 H2SO4 = 3 SO2 + 2 H2OS + 2H2SO4 = 3SO2 + 2H2O
SnO+NF3=SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + O2= SO32SO2 + O2 = 2SO3
SnO + O2 = SnO22SnO + O2 = 2SnO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiH10+O2=SiO2+H2O2SiH10 + 7O2 = 2SiO2 + 10H2O
SO2 + Li2Se = SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SbCl5 + KI = KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
SbCl5 + KI = KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
SbCl5 + KI = KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S + HNO3 = SO2 + NO+ H2O3S + 4HNO3 = 3SO2 + 4NO + 2H2O
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
S+KOH = K2S + K2S2O3 + H2050S + 60KOH = 10K2S + 20K2S2O3 + 3H20
SrCl2+(NH4)3P=NH4Cl+Sr3P23SrCl2 + 2(NH4)3P = 6NH4Cl + Sr3P2
SiCl4(l) + Mg(s) = Si(s) + MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sb2S3 + O2 = Sb2O3 + SO2 2Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sr + AgNo3 = Ag + Sr(No3)2Sr + 2AgNo3 = 2Ag + Sr(No3)2
Sn+CaCl2=SnCl2+CaSn + CaCl2 = SnCl2 + Ca
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
S + HNO3 = 3SO2 + NO + H2O3S + 4HNO3 = 3SO2 + 4NO + 2H2O
Sn + HNO3 = Sn(NO3)2 + NO2 + H2OSn + 4HNO3 = Sn(NO3)2 + 2NO2 + 2H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SnCl2+K2Cr2O7+HCl=CrCl3+KCl+SnCl4+H2O3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
SnCl4 + Fe = SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SnCl4 + Fe = SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2H2=4Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
Si+S8=SiS42Si + S8 = 2SiS4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrO2 + H2(g) = Sr(s) +H2O(l)SrO2 + 2H2(g) = Sr(s) + 2H2O(l)
SO+H2O=H2SO2SO + H2O = H2SO2
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SrO2+H2O=Sr+H2O2SrO2 + 2H2O = Sr + 2H2O2
SO3 + H2O = H2 SO4SO3 + H2O = H2SO4
SO2 + O2 = SO2SO2 - O2 = 2SO
Sr+Se=SrSeSr + Se = SrSe
Sb2O5 + H2O = H3SbO4Sb2O5 + 3H2O = 2H3SbO4
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S + 6HNO3 = H2SO4 + 6NO2 + 2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S+O2=SO32S + 3O2 = 2SO3
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sb2O3 + NaOH = NaSbO2 + H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
Si + O2=SiO2Si + O2 = 2SiO
S+F2=SF6S + 3F2 = SF6
S8+O2=SO2S8 + 8O2 = 8SO2
S2 +Fe2 = Fe2S33S2 + 2Fe2 = 2Fe2S3
SbCl3+H2S=Sb2S3+HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
Sr(s)+P4(s)=Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl+O2=SeO2+Cl22SeCl + 2O2 = 2SeO2 + Cl2
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SF4 + I2O5 = IF5 + SO25SF4 + 2I2O5 = 4IF5 + 5SO2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2(g)+H2(g)=H2S(g)+H2O(g)SO2(g) + 3H2(g) = H2S(g) + 2H2O(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+HNO3=Sn(NO3)2+H2O+NH4NO34Sn + 10HNO3 = 4Sn(NO3)2 + 3H2O + NH4NO3
Sb2(SO4)3 + KMnO4 + H2O= H3SbO4 +MnSO4 + K2SO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 4MnSO4 + 2K2SO4 + 9H2SO4
SO2 + O2= SO32SO2 + O2 = 2SO3
SO2 + O2= SO2SO2 + 0O2 = SO2
SnO2+ 2 C = Sn + 2 COSnO2 + 2C = Sn + 2CO
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3 + Na2S + S = Na3SbS4 Sb2S3 + 3Na2S + 2S = 2Na3SbS4
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S(s) + O2(g) = 2SO3(g) 2S(s) + 3O2(g) = 2SO3(g)
SO4+O2+H2O=H2SO42SO4 - O2 + 2H2O = 2H2SO4
Sb+S=SbSSb + S = SbS
Sb + S = SbSSb + S = SbS
Sb+S=SbSSb + S = SbS
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn(NO2)4+Pt3N4= Sn3N4+ Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Si + N2 = Si3N43Si + 2N2 = Si3N4
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnO2+H2= Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2= Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S + O2+ H2O= H2SO42S + 3O2 + 2H2O = 2H2SO4
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + H2S = H2O + S88SO2 + 16H2S = 16H2O + 3S8
Sr + PO4 = Sr3(PO4)23Sr + 2PO4 = Sr3(PO4)2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SO2+H2O5=S+H2O-2SO2 + H2O5 = -2S + H2O
SO2+H2O5=S+H2O-2SO2 + H2O5 = -2S + H2O
SnCl4+ NH3= SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sn(S) + H2SO4 (aq) = SnSO4(aq) + H20(l) + SO2(g)5Sn(S) + 10H2SO4(aq) = 5SnSO4(aq) + H20(l) + 10SO2(g)
SrO2(s)+ H2(g) = Sr(s) + H2O(l)SrO2(s) + 2H2(g) = Sr(s) + 2H2O(l)
SrO2(s)+ H2(g) = Sr(s) + H2OSrO2(s) + 2H2(g) = Sr(s) + 2H2O
SrBr2 + (NH4)2CO3= SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S + O2 =SO2S + O2 = SO2
Sr(OH)2 + HBr = H2O + Sr(Br)2Sr(OH)2 + 2HBr = 2H2O + Sr(Br)2
S+O2=SO2S + O2 = SO2
Sn +4HNO3 = H2SnO3 +4NO2 +H2OSn + 4HNO3 = H2SnO3 + 4NO2 + H2O
SO2(g)+ O2(g)= SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
S8(s)+Cu(s)= Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
Sn(OH)4 + SO2 = SSnO4 + 2H2OSn(OH)4 + SO2 = SSnO4 + 2H2O
Sn(OH)4 + SO2 = SSnO4 + 2H2OSn(OH)4 + SO2 = SSnO4 + 2H2O
Sn(OH)4 + SO2 = SSnO4 + 2H2OSn(OH)4 + SO2 = SSnO4 + 2H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
SO2+H2S=S8+H2O8SO2 + 16H2S = 3S8 + 16H2O
SbO + SO4 = SO2 + Sb2O54SbO + 3SO4 = 3SO2 + 2Sb2O5
S2 + 2NO = S NOS2 + 2NO = 2SNO
S+HNO3=NO2+H2SO4+H2010S + 40HNO3 = 40NO2 + 10H2SO4 + H20
SiCl4+H2=Si+HClSiCl4 + 2H2 = Si + 4HCl
SO2 + CrO4 + H2O = Cr2(SO4)3 + H2O0SO2 + 0CrO4 + H2O = 0Cr2(SO4)3 + H2O
SO2 + CrO4 + H2O = Cr2(SO4)3 + H2O0SO2 + 0CrO4 + H2O = 0Cr2(SO4)3 + H2O
SrCl2 + H2CO3 = HCl + SrCO3SrCl2 + H2CO3 = 2HCl + SrCO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2 + HNO3 + H2O = H2SO4 +NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
SrO+Al=Sr+Al2O33SrO + 2Al = 3Sr + Al2O3
SO3= SO2 + O22SO3 = 2SO2 + O2
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Si+HF=SiF+H22Si + 2HF = 2SiF + H2
SO2+O2=SO32SO2 + O2 = 2SO3
SnS2 + H2O = Sn(OH)4 + H2SSnS2 + 4H2O = Sn(OH)4 + 2H2S
Si(OH)4 + NaBr = SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
S + O2 =SO2S + O2 = SO2
S8+O2=SO2S8 + 8O2 = 8SO2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn +H2OSnO2 + 2H2 = Sn + 2H2O
Sb2O3+NaOH=NaSbO2+H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
Sr + HCl = H2 + SrCl2Sr + 2HCl = H2 + SrCl2
SnCl4+Fe=SnCl2+FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
SO3(g) + MgO (s) = MgSO4 SO3(g) + MgO(s) = MgSO4
S2O2-2 + Cl2 + H2O = SO4-2 + Cl-1+ H+1S2O2-2 + 5Cl2 + 6H2O = 2SO4-2 + 10Cl-1 + 12H+1
S2O2-2 + Cl2 + H2O = SO4-2 + Cl-1+ H+1S2O2-2 + 5Cl2 + 6H2O = 2SO4-2 + 10Cl-1 + 12H+1
SrCO3+IH=SrI2=CO2+H2OSrCO3 + 2IH = SrI2 + CO2 + H2O
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sn + KOH = K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S +HNO3 = H2SO4 +NO2 +H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(NO3)2 + H2O + S + NO= HNO3 + SnS3Sn(NO3)2 + 4H2O + 3S + 2NO = 8HNO3 + 3SnS
S2O4 + O2 = SO4S2O4 + 2O2 = 2SO4
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 (g) + H2O (l) =H2SO3 (g)SO2(g) + H2O(l) = H2SO3(g)
SnCl4 + Fe = SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S+O2=SO2S + O2 = SO2
Sb + HCl + H2O2 = HSbCl4 + H2O2Sb + 8HCl + 3H2O2 = 2HSbCl4 + 6H2O
Sn++ + Fe+++ = Sn++++ + Fe++ Sn++ + 2Fe+++ = Sn++++ + 2Fe++
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S8+F2=SF6S8 + 24F2 = 8SF6
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrCO3 + HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SbCl5+KI=KCl+I2+SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
Sr(OH)2 + HBr = SrBr2 + H2OSr(OH)2 + 2HBr = SrBr2 + 2H2O
SnAu= Sn+AuSnAu = Sn + Au
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+Na2CO3=Na2SiO3+CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
SiO2+Ca(OH)2=CaSiO3+H2OSiO2 + Ca(OH)2 = CaSiO3 + H2O
Sr + Se = SrSeSr + Se = SrSe
Si+Cl2=SiCl4Si + 2Cl2 = SiCl4
SO2 + MnO4= S(O4)2 + Mn2 4SO2 + 6MnO4 = 4S(O4)2 + 3Mn2
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
Sr + ALCL3 = SrCL3 + ALSr + ALCL3 = SrCL3 + AL
S8 + O2 = SO3S8 + 12O2 = 8SO3
SbCl3 + KI = I2 + KCl + SbCl22SbCl3 + 2KI = I2 + 2KCl + 2SbCl2
SbCl3 + KI = I2 + KCl + SbCl3SbCl3 + 0KI = 0I2 + 0KCl + SbCl3
SbCl3 + KI = I2 + KCl + SbClSbCl3 + 2KI = I2 + 2KCl + SbCl
Sb2S3+NaOH=Sb(OH)3+Na2SSb2S3 + 6NaOH = 2Sb(OH)3 + 3Na2S
S8 +F2 = SF6S8 + 24F2 = 8SF6
SO2+Br2+H2O=HBr+H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl3 + O2 = SeO2 + Cl22SeCl3 + 2O2 = 2SeO2 + 3Cl2
SnO2 + H2 = Sn +H2OSnO2 + 2H2 = Sn + 2H2O
S+HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S +HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+1O2 = SO2SO2 + 0O2 = SO2
SO2+O2 = SO2SO2 + 0O2 = SO2
S+HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2O +Cl = H2SO4 + HClSO2 + 2H2O + 2Cl = H2SO4 + 2HCl
SO2(g)+H2(g)=H2S(g)+H2O(g)SO2(g) + 3H2(g) = H2S(g) + 2H2O(g)
SnCl2 + O2 =SnO + ClO22SnCl2 + 5O2 = 2SnO + 4ClO2
S(s)+O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SnCl2 + Co(NO3)2 = SnCo2O4 + NO2 + CoCl2 + O2SnCl2 + 3Co(NO3)2 = SnCo2O4 + 6NO2 + CoCl2 + O2
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO3 2- + MnO4- + H2O = SO42- + MnO2 + OH-3SO32- + 20MnO4- + 10H2O = 3SO42- + 20MnO2 + 20OH-
SO32- + MnO4- + H2O = SO42- + MnO2 + OH-3SO32- + 20MnO4- + 10H2O = 3SO42- + 20MnO2 + 20OH-
S8 + O2 + H2 = H2SO4S8 + 16O2 + 8H2 = 8H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(OH)2 +H3PO4 = Sr3(PO4)2 + H2O3Sr(OH)2 + 2H3PO4 = Sr3(PO4)2 + 6H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2+H2O=H2SO4S8 + 12O2 + 8H2O = 8H2SO4
SO3+2H2O=H3O+SO3SO3 + 0H2O = 0H3O + SO3
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
S8 + O2 + H2O = H2SO4S8 + 12O2 + 8H2O = 8H2SO4
SO2(s)+H2O(l)=H2SO3SO2(s) + H2O(l) = H2SO3
S(s) + O2 = SO3 (g)2S(s) + 3O2 = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SiCl4 = Si + Cl2SiCl4 = Si + 2Cl2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S8 + H2 = H2SS8 + 8H2 = 8H2S
S8 + H2 = H2SS8 + 8H2 = 8H2S
S8 + H2 = H2SS8 + 8H2 = 8H2S
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S+O2=SO32S + 3O2 = 2SO3
SnCl2 + O2 + HCl= H2SnCl6 + H2O2SnCl2 + O2 + 8HCl = 2H2SnCl6 + 2H2O
SO2 (s) + O2 (g) = SO3 (g)2SO2(s) + O2(g) = 2SO3(g)
Sr +H2O = Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
SO2+O2 = SO32SO2 + O2 = 2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2O+O2=H2(SO4)2SO2 + 2H2O + O2 = 2H2(SO4)
S + O2 = SO32S + 3O2 = 2SO3
SO2+H2O+O2=H(SO4)4SO2 + 2H2O + 3O2 = 4H(SO4)
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2 + O2 + 2 H2O=4 H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+O2=SO2S + O2 = SO2
S +O2=SO32S + 3O2 = 2SO3
Sn + HNO3 = Sn(NO3)2 + NO + H2O3Sn + 8HNO3 = 3Sn(NO3)2 + 2NO + 4H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
ScF3 + HNO3 = HF + Sc(NO3)3ScF3 + 3HNO3 = 3HF + Sc(NO3)3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + Cl2 = 2SO + 2Cl0SO2 + Cl2 = 0SO + 2Cl
S+O2=SO32S + 3O2 = 2SO3
Si+O2+F+C=SiOCF2Si + O2 + 2F + 2C = 2SiOCF
SO2+O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sc+ HBr= ScBr3 +H22Sc + 6HBr = 2ScBr3 + 3H2
SO3 + NaOH = Na2SO4 + H2OSO3 + 2NaOH = Na2SO4 + H2O
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 + Cu = SO4 + Cu0SO3 + Cu = 0SO4 + Cu
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S+HNO3=NO2+H2SO4+H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
SbS5 + SbO5 + H = Sb2S5 + H2OSbS5 + SbO5 + 10H = Sb2S5 + 5H2O
SbS5 + SbO3 + H = Sb2S5 + H2OSbS5 + SbO3 + 6H = Sb2S5 + 3H2O
SO3+O2=SO3SO3 + 0O2 = SO3
SO3+O2=SOSO3 - O2 = SO
Sr(OH)2 + FeCl3 = SrCl2 + Fe(OH)33Sr(OH)2 + 2FeCl3 = 3SrCl2 + 2Fe(OH)3
Sn(s) + O2(g) = SnO(s)2Sn(s) + O2(g) = 2SnO(s)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S8+H2 =H2SS8 + 8H2 = 8H2S
SiO2 + 3C = SiC + 2COSiO2 + 3C = SiC + 2CO
S02+Br2+H2O=HBr+H2SO4S02 + 6Br2 + 8H2O = 12HBr + 2H2SO4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S8+O2=SO2S8 + 8O2 = 8SO2
Sn+HNO3 = SnO2+NO+H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C = SiO + COSiO2 + C = SiO + CO
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S + HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn+H2SO4=Sn(SO4)2+SO2+H2OSn + 4H2SO4 = Sn(SO4)2 + 2SO2 + 4H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn(s) + O2(g) = SnO(s)2Sn(s) + O2(g) = 2SnO(s)
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sr(NO3)2 + Na2SO4=SrSO4+NaNO3Sr(NO3)2 + Na2SO4 = SrSO4 + 2NaNO3
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SrCl2 + KNO3 = Sr(NO3)2 + KClSrCl2 + 2KNO3 = Sr(NO3)2 + 2KCl
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2(g) + NaOH(s) = Na2SO3(s) + H2O(l) SO2(g) + 2NaOH(s) = Na2SO3(s) + H2O(l)
SrCl2 + Na2SO4 = SrSO4 + Na2Cl2SrCl2 + Na2SO4 = SrSO4 + Na2Cl2
SO2+HNO3+H2O=H2SO4+NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
Sr(s) + 2HOH (l) = Sr(OH)2 (aq) + H2 (g)Sr(s) + 2HOH(l) = Sr(OH)2(aq) + H2(g)
SiO2 + 4HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SO2(g) + NaOH(s) = Na2SO3(s) + H2O(l)SO2(g) + 2NaOH(s) = Na2SO3(s) + H2O(l)
SnCl2 +K2S = K2Cl2 + SnSSnCl2 + K2S = K2Cl2 + SnS
SiO2 + HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 + 2H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sr+HNO3=Sr (NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
Sb2O3 + C = Sb + COSb2O3 + 3C = 2Sb + 3CO
SO2 + I2 + H2O = H2SO4 + HISO2 + I2 + 2H2O = H2SO4 + 2HI
S + O2 = SO2S + O2 = SO2
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SO2 + H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
Se 4 + O2 = SeOSe4 + 2O2 = 4SeO
Si + O2 = SiO2Si + O2 = 2SiO
Se 4 + O2 = Se O2Se4 + 4O2 = 4SeO2
Se 4 + O2 = Se O2 Se4 + 4O2 = 4SeO2
S8+O2=SO4S8 + 16O2 = 8SO4
Sb 3 + H2 = SbH 2Sb3 + 3H2 = 6SbH
SiO2 + 3C = SiC + 2COSiO2 + 3C = SiC + 2CO
SIO2 + 3C = SIC + 2COSIO2 + 3C = SIC + 2CO
SrO + HCl = SrCl2 + H2OSrO + 2HCl = SrCl2 + H2O
SrO + HCl = SrCl2 + H2OSrO + 2HCl = SrCl2 + H2O
SnCl2 +O2 = SnO + ClO22SnCl2 + 5O2 = 2SnO + 4ClO2
Si + Br2 = SiBr2Si + Br2 = SiBr2
SO2+O2 = SO32SO2 + O2 = 2SO3
S + HNO3 = SO2 + NO +H2O3S + 4HNO3 = 3SO2 + 4NO + 2H2O
S + HNO3 = SO2 + NO +H2O3S + 4HNO3 = 3SO2 + 4NO + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SrCl2 + CrSO4 = SrSO4 + Cl2CrSrCl2 + CrSO4 = SrSO4 + Cl2Cr
SrCO3+HCl=SrCl2+CO2+H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
SrCl2 + CrSO4 = SrSO4 + Cl2CrSrCl2 + CrSO4 = SrSO4 + Cl2Cr
SrCl2 + CrSO4 = SrSO4 + Cl2CrSrCl2 + CrSO4 = SrSO4 + Cl2Cr
Sb(NO3)3+H2S=Sb2S3+HNO32Sb(NO3)3 + 3H2S = Sb2S3 + 6HNO3
S+O2=SO2S + O2 = SO2
S+HNO3=NO+H2SO4S + 2HNO3 = 2NO + H2SO4
SF4 + H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
S8(s)+H2(g)=H2S(g)S8(s) + 8H2(g) = 8H2S(g)
S+O2+2H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
Sb2S3+O2=SbO3+SO2Sb2S3 + 6O2 = 2SbO3 + 3SO2
Sb2S3+O2=SbO3+SO2Sb2S3 + 6O2 = 2SbO3 + 3SO2
Sr+P+Ca+Br=SrPCaBrSr + P + Ca + Br = SrPCaBr
SiO2 + HCl = SiCl4 + H2OSiO2 + 4HCl = SiCl4 + 2H2O
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g) 2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 = SO2 +O22SO3 = 2SO2 + O2
SO3+H2O=SO4+2HSO3 + H2O = SO4 + 2H
S + HNO3 = H2SO4 + NO2 +H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+O=SO3S + 3O = SO3
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO2S + O2 = SO2
Si(s)+O2(g)=Si2O42Si(s) + 2O2(g) = Si2O4
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO3 + O2 = SO42SO3 + O2 = 2SO4
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
SiO2+HF = SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF = SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn + HNO3 = Sn(NO3)2 + NO + H2O3Sn + 8HNO3 = 3Sn(NO3)2 + 2NO + 4H2O
S + O2 + KOH = K2SO4 + H2O2S + 3O2 + 4KOH = 2K2SO4 + 2H2O
S + O2 + KOH = K2SO4 + H2O2S + 3O2 + 4KOH = 2K2SO4 + 2H2O
S + O2 + KOH = K2SO4+H2O2S + 3O2 + 4KOH = 2K2SO4 + 2H2O
S8 + 12O2 = SO3S8 + 12O2 = 8SO3
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2+H2O+O2=2H2SO42SO2 + 2H2O + O2 = 2H2SO4
SO2+H2O+O2=H2SO3SO2 + H2O + 0O2 = H2SO3
S+O2+KOH=K2SO4+H2O2S + 3O2 + 4KOH = 2K2SO4 + 2H2O
SrCO3 + HNO3 = Sr(NO3)2 + CO2 + H2OSrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2O
SF4+O2=OSF42SF4 + O2 = 2OSF4
SO3 + Fe (OH)3 = Fe2 (SO4)3+ H2O3SO3 + 2Fe(OH)3 = Fe2(SO4)3 + 3H2O
Sb+Cl2= SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 + H20 = H2SO410SO2 + 10O2 + H20 = 10H2SO4
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.