Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S + O2 = SO2S + O2 = SO2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2= SO32SO2 + O2 = 2SO3
S+HNO3=SO3+H20+NO220S + 60HNO3 = 20SO3 + 3H20 + 60NO2
S+NaOH=Na2SO4+NaS+H2O7S + 8NaOH = Na2SO4 + 6NaS + 4H2O
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
SnCl4+NaOH=NaCl+Sn(OH)4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S8+O2=SO3S8 + 12O2 = 8SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + OH- = S2O32- + S2- + H2O16S8 + 64OH- = S2O32- + 63S2- + 32H2O
Sb + Cl = SbCl3Sb + 3Cl = SbCl3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl = SbClSb + Cl = SbCl
Sb(NO3)3 + Na3PO4 = NaNO3 + SbPO4Sb(NO3)3 + Na3PO4 = 3NaNO3 + SbPO4
SO2+O2=SO32SO2 + O2 = 2SO3
S8+Cu=Cu2SS8 + 16Cu = 8Cu2S
S8+Cu=Cu2SS8 + 16Cu = 8Cu2S
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SnO+C=Sn+CO22SnO + C = 2Sn + CO2
SO2 + O2 + 2H2O = 4H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+O2=SO2S + O2 = SO2
SiCl4=Si + Cl2SiCl4 = Si + 2Cl2
SiCl4=Si + Cl2SiCl4 = Si + 2Cl2
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3+H2O=H2SnO3+N5Sn + 4HNO3 + 3H2O = 5H2SnO3 + 4N
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S+H2=SH2S + H2 = SH2
SiF4 + H2O = SiO2 +H2SiF63SiF4 + 2H2O = SiO2 + 2H2SiF6
SiF4 +Al = Si + AlF33SiF4 + 4Al = 3Si + 4AlF3
SeCl6 + O2 = SeO2 + 3Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnS + H2O2 + KOH =K2SnS3 + K2SnO3 + H2030SnS + 0H2O2 + 60KOH = 10K2SnS3 + 20K2SnO3 + 3H20
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S+O2=SO32S + 3O2 = 2SO3
Sr+O2=2SrO2Sr + O2 = 2SrO
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + HF = SnF2 + H2Sn + 2HF = SnF2 + H2
S+O2=SO2S + O2 = SO2
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S + O2 = SO32S + 3O2 = 2SO3
SO3(g) + 2 NaOH(aq) = Na2SO4(aq) + H2O(l)SO3(g) + 2NaOH(aq) = Na2SO4(aq) + H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+XeF6=XeOF4+SiF4SiO2 + 2XeF6 = 2XeOF4 + SiF4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SbCl3 + H2O= Sb2O3 + HCl2SbCl3 + 3H2O = Sb2O3 + 6HCl
Sn3(PO4)4+Na2CO3=Sn(CO3)2+Na3PO4Sn3(PO4)4 + 6Na2CO3 = 3Sn(CO3)2 + 4Na3PO4
SO4-2+H+HCHO=HS+CO2+H2O0SO4-2 + 4H - HCHO = 0HS - CO2 + H2O
SO4+H+HCHO=HSCO+H2OSO4 + 7H + HCHO = HSCO + 4H2O
SO4-- + H+ + HCHO = HS- + CO2 + H2OSO4-- + H+ + 2HCHO = HS- + 2CO2 + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + HF = SF4 + H2OSO2 + 4HF = SF4 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+NaOH=Na2SO4+Na2S2O3+H2O4S + 2NaOH = -2Na2SO4 + 3Na2S2O3 + H2O
S+NaOH=Na2SO4+Na2S+H2O4S + 8NaOH = Na2SO4 + 3Na2S + 4H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S+Hg=Hg2SS + 2Hg = Hg2S
SO2+ O2+ H2O= H2SO42SO2 + O2 + 2H2O = 2H2SO4
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SO2Cl2 + HI = H2S + H2O + HCl + I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
S+O2 =SO32S + 3O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO3(g)=SO2(g)+O2(g)2SO3(g) = 2SO2(g) + O2(g)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Sn + HNO3 = SnO2 + NO + H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
SrCl2 + KMnO4 + H3PO4 = Cl2 + Mn3(PO4)2 + Sr3(PO4)2 + K3PO4 + H2O15SrCl2 + 6KMnO4 + 16H3PO4 = 15Cl2 + 2Mn3(PO4)2 + 5Sr3(PO4)2 + 2K3PO4 + 24H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SeO2(s) + H2O(l) + SO2(g) = Se(s) + H2SO4(aq)SeO2(s) + 2H2O(l) + 2SO2(g) = Se(s) + 2H2SO4(aq)
SCN- = S++++++ + CN- + eSCN- = S++++++ + CN- + 6e
SnO2+CO=Sn+CO2SnO2 + 2CO = Sn + 2CO2
Sb2S3+6HCl=2SbCl3+3H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
S+NaOH=Na2SO4+Na2S+H2O4S + 8NaOH = Na2SO4 + 3Na2S + 4H2O
SO2 + O2 +H2O =H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
S8+F2=SF6S8 + 24F2 = 8SF6
Sn+CuCl2=SnCl2+CuSn + CuCl2 = SnCl2 + Cu
Sn+CuCl2=SnCl2+CuSn + CuCl2 = SnCl2 + Cu
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn+Cl2=Sn2Cl42Sn + 2Cl2 = Sn2Cl4
Sb2O5 + Cr = SbO + Cr2O77Sb2O5 + 6Cr = 14SbO + 3Cr2O7
S8+O2=SO3S8 + 12O2 = 8SO3
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S+O2=SO32S + 3O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Sb+Ci=SbCi3Sb + 3Ci = SbCi3
Sb+Ci=3SbCiSb + Ci = SbCi
Sr(NO3)2(aq) + Li3PO4(aq) = Sr3(PO4)2 + LiNO33Sr(NO3)2(aq) + 2Li3PO4(aq) = Sr3(PO4)2 + 6LiNO3
SeO2+H2Se=Se+H2OSeO2 + 2H2Se = 3Se + 2H2O
S+NO3=SO4+NOS + 2NO3 = SO4 + 2NO
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + H2O = S + H2O0SO2 + H2O = 0S + H2O
S3(s)+Cu(s)=Cu2S(s)S3(s) + 6Cu(s) = 3Cu2S(s)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S(s)+O2(g) =SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sr3P2+Cl2= SrCl+P22Sr3P2 + 3Cl2 = 6SrCl + 2P2
S + O2 = SO2S + O2 = SO2
S + O2 = SO2S + O2 = SO2
Sn + P4 = Sn3P43Sn + P4 = Sn3P4
SO2+KMnO4+H2O= H2SO4+K2SO4+MnSO45SO2 + 2KMnO4 + 2H2O = 2H2SO4 + K2SO4 + 2MnSO4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiH4 + NH3 = Si3N4 + H23SiH4 + 4NH3 = Si3N4 + 12H2
S+H(NO3)=SO2+NO+H2O3S + 4H(NO3) = 3SO2 + 4NO + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2(g)+O(g) =SO3(g)SO2(g) + O(g) = SO3(g)
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
Sr + O2 = Sr2O22Sr + O2 = Sr2O2
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
SnCl2+ K3PO4= Sn3(PO4)2+ KCl3SnCl2 + 2K3PO4 = Sn3(PO4)2 + 6KCl
S8+O2=SO3S8 + 12O2 = 8SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SO2 + O2 = S O32SO2 + O2 = 2SO3
Sb + O =Sb2O32Sb + 3O = Sb2O3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sc + SnBr2 = SnSc + BrSc + SnBr2 = SnSc + 2Br
Sc + SnBr2 = ScBr + Sn2Sc + SnBr2 = 2ScBr + Sn
SO2+HCl=SCl4+H2OSO2 + 4HCl = SCl4 + 2H2O
Sr(OH)2 + H2O= SrOH + H3O-1Sr(OH)2 + 2H2O = -1SrOH + H3O
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
SO3 + MnO4 = SO4 + Mn4SO3 + MnO4 = 4SO4 + Mn
SO3 + MnO4 = SO4 + Mn4SO3 + MnO4 = 4SO4 + Mn
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
Sr(s) + HNO3(aq) = Sr(NO3)2(aq) + H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
SiO2(s) + C(s) = Si(l) + CO(g)SiO2(s) + 2C(s) = Si(l) + 2CO(g)
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2 + O2 + 2 H2O = 4 H2SO42SO2 + O2 + 2H2O = 2H2SO4
S + CO = SO2 + C S + 2CO = SO2 + 2C
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Sn + NaNO3 + H2SO4 = SnO2 + 2NO2 + H2O + Na2SO4Sn + 4NaNO3 + 2H2SO4 = SnO2 + 4NO2 + 2H2O + 2Na2SO4
SiO2+HF = SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF = SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn(ClO3)2 = SnCl2 + O2Sn(ClO3)2 = SnCl2 + 3O2
SO2 + O2 = SO3 2SO2 + O2 = 2SO3
SO3 + Ag = SO4 + Ag0SO3 + Ag = 0SO4 + Ag
SiO2(s) + C(s) = Si(l) + CO(g)SiO2(s) + 2C(s) = Si(l) + 2CO(g)
SO3 + H2O = 3H2SO4SO3 + H2O = H2SO4
SO3 + H2O = 3H2SO4SO3 + H2O = H2SO4
SiO2 + Mg = Si + MgOSiO2 + 2Mg = Si + 2MgO
Si+S8=Si2S44Si + S8 = 2Si2S4
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiH3+O2=SiO2+H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+NaOH=Na2SO4+NaS+H2O7S + 8NaOH = Na2SO4 + 6NaS + 4H2O
SbH3 + Cr2O7-- + H+=H3SbO4 + Cr+++ +H2O3SbH3 + 4Cr2O7-- + 32H+ = 3H3SbO4 + 8Cr+++ + 16H2O
SbH3 + Cr2O7-- + H+=SbO4--- + Cr+++ +H2O3SbH3 + 4Cr2O7-- + 23H+ = 3SbO4--- + 8Cr+++ + 16H2O
Sn + HNO3 + H2O = H2SnO3 + NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SrCr2O7+Cs2S2O3=Cs2Cr2O7+SrS2O3SrCr2O7 + Cs2S2O3 = Cs2Cr2O7 + SrS2O3
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + H2O = Si2H3 + O28SiO2 + 6H2O = 4Si2H3 + 11O2
S8+O2=SO2S8 + 8O2 = 8SO2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sn(NO3)4+4KOH=4KNO3+Sn(OH)4Sn(NO3)4 + 4KOH = 4KNO3 + Sn(OH)4
S+O2=SO32S + 3O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
Sn+I2=SnI4Sn + 2I2 = SnI4
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + O2= SO32SO2 + O2 = 2SO3
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + HF = SiF4 +H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + HF = SiF4 +H2OSiO2 + 4HF = SiF4 + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Si+HBr = H +SiBrSi + HBr = H + SiBr
Si+HBr = H +SiBrSi + HBr = H + SiBr
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + H2O = H2SO3 SO2 + H2O = H2SO3
SiH3 + O2 = SiO2 + H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
S8+BaO=BaS+O2S8 + 8BaO = 8BaS + 4O2
Sn+Na2OH=SnOH+NaSn + Na2OH = SnOH + 2Na
Sb+HCl=SbCl3+H22Sb + 6HCl = 2SbCl3 + 3H2
Sb+HCl=SbCl3+H22Sb + 6HCl = 2SbCl3 + 3H2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiCl4 = Si + Cl2SiCl4 = Si + 2Cl2
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2+H2O+KIO3=K2SO4+H2SO4+I25SO2 + 4H2O + 2KIO3 = K2SO4 + 4H2SO4 + I2
SF4 + 3 H2O = H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
Sb2S3 + HNO3 = NO2 +Sb2O5 + S + H2OSb2S3 + 10HNO3 = 10NO2 + Sb2O5 + 3S + 5H2O
Sn+L2=SnL4Sn + 2L2 = SnL4
Sr(NO3)2+Li2SO4=SrSO4+LiNO3Sr(NO3)2 + Li2SO4 = SrSO4 + 2LiNO3
Sn+P4=Sn3P43Sn + P4 = Sn3P4
SO4 + H2O = S8 + H2O 0SO4 + H2O = 0S8 + H2O
SO4 + H2O = S8 + H2O 0SO4 + H2O = 0S8 + H2O
Si3N4(s)=Si(s)+N2Si3N4(s) = 3Si(s) + 2N2
Sn + PO4 = Sn(PO4)Sn + PO4 = Sn(PO4)
S8+ O2 =SO3S8 + 12O2 = 8SO3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(NO2)4 + Pt3N4 = Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SiO2(s)+3C(s)=SiC(s)+14CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2(s)+3C(s)=SiC(s)+14CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SrBr2 +(NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(s) + HNO3(aq) = Sr(NO3)2(aq) + H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnO + H2 = Sn + H2OSnO + H2 = Sn + H2O
Sr + F = SrFSr + F = SrF
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Si+F2=SiF4Si + 2F2 = SiF4
Sb + H2O = Sb2O3 + H22Sb + 3H2O = Sb2O3 + 3H2
Sn + 2HF = SnF2 + H2Sn + 2HF = SnF2 + H2
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
S8 + Br2 = SBr2S8 + 8Br2 = 8SBr2
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
S+O2=SO2S + O2 = SO2
SnCl2+K2Cr2O7+HCl=CrCl3+SnCl4+KCl+H2O3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
SnCl2+K2Cr2O7+HCl=CrCl3+SnCl4+KCl+H2O3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
Si + 2NO2=N2O + SiO323Si + 64NO2 = 32N2O + 3SiO32
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrCO3+O2=SrO+CO32SrCO3 + O2 = 2SrO + 2CO3
S+O2=SO32S + 3O2 = 2SO3
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l) + Mg(s) = MgCl2(s) + Si(s)SiCl4(l) + 2Mg(s) = 2MgCl2(s) + Si(s)
S8 + NO3 = SO2 + NOS8 + 8NO3 = 8SO2 + 8NO
S8 + NO3 = SO2 + N3S8 + 16NO3 = 24SO2 + 16N
S8 + NO2 = SO2 + N2S8 + 8NO2 = 8SO2 + 4N2
S8 + Br2 = SBr2S8 + 8Br2 = 8SBr2
S8 + Na2SO3 + H2O = Na2S2O3 * 5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+12O2=8 SO3S8 + 12O2 = 8SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S2O32-+O2+H+=S4O62-+H2040S2O32- - 20O2 + 20H+ = 20S4O62- + H20
Sb2S5+HNO3+H2O=H3SbO4+H2SO4+NO3Sb2S5 + 40HNO3 + 4H2O = 6H3SbO4 + 15H2SO4 + 40NO
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g)+O2(g)=SO32SO2(g) + O2(g) = 2SO3
SO2 + H = H2S + H2OSO2 + 6H = H2S + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 + NaOH = Na2SO4 + H2OSO3 + 2NaOH = Na2SO4 + H2O
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiO2+H2=Si+H2OSiO2 + 2H2 = Si + 2H2O
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn+HNO3=Sn(NO3)2+N2O+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + N2O + 5H2O
S+O2=SO32S + 3O2 = 2SO3
Sb + I2 = SbI32Sb + 3I2 = 2SbI3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SiCl4(l) + Mg(s) = MgCl2(s) + Si(s)SiCl4(l) + 2Mg(s) = 2MgCl2(s) + Si(s)
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
S8 + Na2SO3 + H2O = (Na2S2O3) 5H2O5S8 + 40Na2SO3 + 8H2O = 8(Na2S2O3)5H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SO3 = SO2 + O22SO3 = 2SO2 + O2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si2H3+O2= SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3+O2= SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3+O2= SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SnO2 = SnO + O22SnO2 = 2SnO + O2
S(NH4)2+Pb(NO3)2=Pb(NH4)2+S(NO3)2S(NH4)2 + Pb(NO3)2 = Pb(NH4)2 + S(NO3)2
SiO2(s)+HF(aq)=SiF4(g)+H2O(g)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(g)
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn + HNO3 + H2O = H2SnO3 + NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
SiO2+ HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
S8+O2=SO3S8 + 12O2 = 8SO3
Sn(ClO3)4+Rb3PO4=Sn3(PO4)4+RbClO33Sn(ClO3)4 + 4Rb3PO4 = Sn3(PO4)4 + 12RbClO3
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
SO2 + H2O + O = H2SO4SO2 + H2O + O = H2SO4
SiO2+3C=SiC+2COSiO2 + 3C = SiC + 2CO
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S+O2=SO2S + O2 = SO2
Si2H3 (l) + O2 (g) = SiO2 (s) + H2O (l)4Si2H3(l) + 11O2(g) = 8SiO2(s) + 6H2O(l)
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 (s) + HF (aq) = SiF4 (g) + H2O SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O
SO2(g)+H2(g)=H2S(g)+H2O(g)SO2(g) + 3H2(g) = H2S(g) + 2H2O(g)
Sb2S3 + HNO3 = H3SbO4 + SO2 + NO + H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
S8 + O2 = SO3 S8 + 12O2 = 8SO3
Sb2S3 + HNO3 = H3SbO4 + SO2 + NO + H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
Sb2S3 + HNO3 =3 H3SbO4 + SO2 + NO + H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
S8 + O2= SO3 =S8 + 12O2 = 8SO3
SO2+O2+4H20=2H2SO410SO2 + 10O2 + H20 = 10H2SO4
S + O2 = SO3 2S + 3O2 = 2SO3
Sc + H2O =H2 + Sc (OH)32Sc + 6H2O = 3H2 + 2Sc(OH)3
SiF4+NaOH=Na4SiO4+NaF+H2OSiF4 + 8NaOH = Na4SiO4 + 4NaF + 4H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(OH)2 =SnO + H2OSn(OH)2 = SnO + H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO3+2H2O=H3O+HSO4SO3 + 2H2O = H3O + HSO4
SO3+2H2O=H3O+SO4SO3 + 3H2O = 2H3O + SO4
SO3+2H2O=H3O+SO3SO3 + 0H2O = 0H3O + SO3
SO3+2H2O=H2 SO4SO3 + H2O = H2SO4
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sn(NO3)4 + H2SO4 = Sn(SO4)2 + HNO3Sn(NO3)4 + 2H2SO4 = Sn(SO4)2 + 4HNO3
S + O2 = SO32S + 3O2 = 2SO3
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO3 (g) + H2O (l) = H2SO4SO3(g) + H2O(l) = H2SO4
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn Cl4(aq) + 4 H2 O (l)= Sn (OH)4 (s) +4 H Cl(aq)SnCl4(aq) + 4H2O(l) = Sn(OH)4(s) + 4HCl(aq)
Sn Cl4(aq) + 4 H2 O (l)= Sn (OH)4 (s) +4 H Cl(aq)SnCl4(aq) + 4H2O(l) = Sn(OH)4(s) + 4HCl(aq)
SnCl4(aq)+4H2O = Sn(OH)4(s)+4HCl(aq)SnCl4(aq) + 4H2O = Sn(OH)4(s) + 4HCl(aq)
SnCl4(aq)+4H2O(l) = Sn(OH)4(s)+4HCl(aq)SnCl4(aq) + 4H2O(l) = Sn(OH)4(s) + 4HCl(aq)
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
Sn+O=SnOSn + O = SnO
SrCO3 + HBr = CO2 + H2CO3 + SrBr2SrCO3 + 2HBr = 0CO2 + H2CO3 + SrBr2
SrCO3 + HBr = CO2 + H2CO3 + SrBr2SrCO3 + 2HBr = 0CO2 + H2CO3 + SrBr2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO3+H2O=SO4+H3OSO3 + 3H2O = SO4 + 2H3O
Sr(s) + HNO3(aq) = Sr(NO3)2(aq) + H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Si3N4=Si+N2Si3N4 = 3Si + 2N2
SO2+NO2=SO3+NOSO2 + NO2 = SO3 + NO
Sr(OH)2 + NaCl = SrCl2 +NaOHSr(OH)2 + 2NaCl = SrCl2 + 2NaOH
SO2+H2SO4+NA2CR2O7=NA2SO4+CR2(SO4)3+H2O3SO2 + H2SO4 + NA2CR2O7 = NA2SO4 + CR2(SO4)3 + H2O
S+H2SO4 = SO2 +H2OS + 2H2SO4 = 3SO2 + 2H2O
S+H2SO4 = SO2 +H2OS + 2H2SO4 = 3SO2 + 2H2O
Si+S8=Si2S44Si + S8 = 2Si2S4
SrO+Al=Sr+Al2O33SrO + 2Al = 3Sr + Al2O3
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+O2 = SO32S + 3O2 = 2SO3
Si(s) + S8(s) = Si2S4 4Si(s) + S8(s) = 2Si2S4
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl2 = SbCl2Sb + Cl2 = SbCl2
SiI4+Mg=Si+MgI2SiI4 + 2Mg = Si + 2MgI2
SN+HNO3=SN(NO3)4+H2SN + 4HNO3 = SN(NO3)4 + 2H2
S+O=SO2S + 2O = SO2
S8+Br2=SBr2S8 + 8Br2 = 8SBr2
S2O3 + Cl2 = SO4 + Cl0S2O3 + Cl2 = 0SO4 + 2Cl
S8+F2=SF6S8 + 24F2 = 8SF6
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+C=CS2 +CO2SO2 + 5C = CS2 + 4CO
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO2 + C = CS2 + CO2SO2 + 5C = CS2 + 4CO
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO4+NH3 = SO3+H20+N20SO4 + 20NH3 = 0SO3 + 3H20 + 10N2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SiC+Cl=SiCl4+CSiC + 4Cl = SiCl4 + C
Si+S8=Si2S44Si + S8 = 2Si2S4
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8 + H2O = H2S8OS8 + H2O = H2S8O
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S+O2=SO32S + 3O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiF4+ H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + H2 = S + H2O SO2 + 2H2 = S + 2H2O
SO2 + H2 = H2S = H2OSO2 + 3H2 = H2S + 2H2O
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO2 + H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
SF4 (g) + 2H2O (l) = SO2(g) + 4HF(aq)SF4(g) + 2H2O(l) = SO2(g) + 4HF(aq)
SO2 + H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sc2O3+SO3=Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2(s) + C(s) = SiC (s) + CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
SO2+H2=H2S+H1OSO2 + 2H2 = H2S + 2H1O
SO2+H2=H2S+H1OSO2 + 2H2 = H2S + 2H1O
SF4(g)+O2(g)=OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
Sn(ClO3)4=SnCl4+O2Sn(ClO3)4 = SnCl4 + 6O2
SiO2+C=CO+SiSiO2 + 2C = 2CO + Si
S+O2=SO2S + O2 = SO2
S8+O2=SO3S8 + 12O2 = 8SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SiH4+H2O=SiO2+H2SiH4 + 2H2O = SiO2 + 4H2
SiH4+H2O=SiO2+H2O0SiH4 + H2O = 0SiO2 + H2O
SiH4+H2O=SiO2+H2O0SiH4 + H2O = 0SiO2 + H2O
Si+Mg=Mg2SiSi + 2Mg = Mg2Si
S2+ HNO3 =HSO3+ NO2+H2OS2 + 10HNO3 = 2HSO3 + 10NO2 + 4H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2 + H2=Sn + H2O SnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SiO2+C=Si+COSiO2 + 2C = Si + 2CO
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiI4(s)+Mg(s)= Si (s) + MgI2(s)SiI4(s) + 2Mg(s) = Si(s) + 2MgI2(s)
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SCl2+NaF=S2Cl2+SF4+NaCl3SCl2 + 4NaF = S2Cl2 + SF4 + 4NaCl
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 +H2O=H2SO4SO3 + H2O = H2SO4
Sn + AgNO = Sn(NO) + AgSn + AgNO = Sn(NO) + Ag
SbSO4 + O2 + H2O = Sb(OH)3 + H2SO44SbSO4 + O2 + 10H2O = 4Sb(OH)3 + 4H2SO4
SeSO4 + O2 + H2O = Se(OH)3 + H2SO44SeSO4 + O2 + 10H2O = 4Se(OH)3 + 4H2SO4
SeSO4 + O2 + H2O = Se(OH)3 + H2SO44SeSO4 + O2 + 10H2O = 4Se(OH)3 + 4H2SO4
SO2 + O2= SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SiI4+Mg=Si=MgI2SiI4 + 2Mg = Si + 2MgI2
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SiCl4=Si+2Cl2SiCl4 = Si + 2Cl2
SnCl2+AgNO3=SnNO3+Cl2AgSnCl2 + AgNO3 = SnNO3 + Cl2Ag
S + O2 = SO2S + O2 = 2SO
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2(g)+O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SrNO3 + NaC2O4 = SrC2O4 + NaNO3SrNO3 + NaC2O4 = SrC2O4 + NaNO3
Sb2S3 + HCl=SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SOS8 + 4O2 = 8SO
Sb2O3 + NaOH = NaSbO2 + H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
SiCl4 = Si + Cl2SiCl4 = Si + 2Cl2
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sr(NO3)2 + (NH4)2SO4 = SrSO4 + NH4NO3Sr(NO3)2 + (NH4)2SO4 = SrSO4 + 2NH4NO3
Sr(NO3)2 + (NH4)2C2O4 = SrC2O4 + NH4NO3Sr(NO3)2 + (NH4)2C2O4 = SrC2O4 + 2NH4NO3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO3(g)+H2O(l)=H2(g)+SO3(g)SO3(g) + 0H2O(l) = 0H2(g) + SO3(g)
SbCl3 + H2S = Sb2S3 + HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
Si2H3 + O2=SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8+O2=SOS8 + 4O2 = 8SO
Sb + NaOH = NaSb + NaSbO + H2O2Sb + 2NaOH = NaSb + NaSbO + H2O
SO3=SO4+O2-2SO3 = -2SO4 + O2
SrOH + H(NO3)2 = Sr(NO3)2 + H2OSrOH + H(NO3)2 = Sr(NO3)2 + H2O
Sr(OH)2 + H(NO3) = Sr(NO3)2 + H2OSr(OH)2 + 2H(NO3) = Sr(NO3)2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S2H5 (s) + O2 (g) = SO2 (g) + H2O (l)4S2H5(s) + 13O2(g) = 8SO2(g) + 10H2O(l)
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+O2+HCl=Sn(Cl)2+H2O2Sn + O2 + 4HCl = 2Sn(Cl)2 + 2H2O
S(NH4)2 + Pb(NO3)2 = PbS + NH4NO3S(NH4)2 + Pb(NO3)2 = PbS + 2NH4NO3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.