Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Sr(OH)2 + Fe2(SO4)3=Sr2(SO4)2 + Fe(OH)36Sr(OH)2 + 2Fe2(SO4)3 = 3Sr2(SO4)2 + 4Fe(OH)3
SrBr2 (aq) + (NH4)2CO3 (aq) = SrCO3 (s) + NH4Br (aq)SrBr2(aq) + (NH4)2CO3(aq) = SrCO3(s) + 2NH4Br(aq)
S+O2=SO2S + O2 = SO2
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2 = SO2S + O2 = SO2
SO3 2-+Fe3=SO4 +Fe20SO32- + 2Fe3 = 0SO4 + 3Fe2
SbS3 + O2= Sb2 O3+SO24SbS3 + 15O2 = 2Sb2O3 + 12SO2
SO2 + HIO3 + H2O = H2SO4 + I25SO2 + 2HIO3 + 4H2O = 5H2SO4 + I2
SiO2 + C = Si + COSiO2 + 2C = Si + 2CO
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SnCl4 +FeCl2=SnCl2 +FeCl3SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
SiCl4+4H2O=SiO2+4HClSiCl4 + 2H2O = SiO2 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
Sc2O3+ H2O=Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S8 + Na2SO3 + H2O = Na2S2O3 * 5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
S8 + Na2SO3 + H2O = Na2S2O3 * 5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SiCl4+NaH=SiH4+NaClSiCl4 + 4NaH = SiH4 + 4NaCl
SO2(g)+O2(g)=SO(g)2SO2(g) - O2(g) = 2SO(g)
SO2(g)+O2(g)=SO(g)2SO2(g) - O2(g) = 2SO(g)
SO2(g)+O2(g)=SO4(g)SO2(g) + O2(g) = SO4(g)
SO2(g)+O2(g)=SO4(g)SO2(g) + O2(g) = SO4(g)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SO2+O2 = SO32SO2 + O2 = 2SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb + Br2 = SbBr32Sb + 3Br2 = 2SbBr3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
SiO2 + 4HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
S + O = SO3S + 3O = SO3
Si4H10 + O2 = SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
SrBr2 (aq) + (NH4)2CO3 (aq) = SrCO3 (s) + NH4Br (aq)SrBr2(aq) + (NH4)2CO3(aq) = SrCO3(s) + 2NH4Br(aq)
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
SrS(aq)+CuSO4(aq)=SrSO4(s)+CuS(s)SrS(aq) + CuSO4(aq) = SrSO4(s) + CuS(s)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2O5 + H = Sb4O6 +H2O2Sb2O5 + 8H = Sb4O6 + 4H2O
Sb2O5 + H2 = Sb4O6 +H2O2Sb2O5 + 4H2 = Sb4O6 + 4H2O
Sr(s) + HNO3(aq) = Sr(NO3)2(aq) + H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
SO3 = SO2 + O22SO3 = 2SO2 + O2
SiO2+2C=Si+2COSiO2 + 2C = Si + 2CO
S(s) + O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S+O2(g)=SO32S + 3O2(g) = 2SO3
Se Cl6 + O2 = Se O2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sr(s) + HNO3(aq) = Sr(NO3)2(aq) + H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
Sr(s) + HNO3(aq) = Sr(NO3)2(aq) + H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
SO3+H2O = H2SO4SO3 + H2O = H2SO4
SnO2+H2= Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2= Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S + 4HNO3 = H2SO4 + 3NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 4HNO3 = H2SO4 + 3NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 4HNO3 = H2SO4 + 3NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 4HNO3 = H2SO4 + 3NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 4HNO3 = H2SO4 + 3NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 4HNO3 = H2SO4 + 3NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 4HNO3 = H2SO4 + 3NO2 + 2H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sn + N2 = Sn3N43Sn + 2N2 = Sn3N4
Sn + AgNO3 = SnNO3 + AgSn + AgNO3 = SnNO3 + Ag
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
S(s) + O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S+O2=S2O42S + 2O2 = S2O4
SiI4(s)+Mg(s)=Si(s)+MgI2(s)SiI4(s) + 2Mg(s) = Si(s) + 2MgI2(s)
SO2 +O2=SO32SO2 + O2 = 2SO3
SF4 + H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
Sb(NO2)5+RaI2=SbI5+Ra(NO2)22Sb(NO2)5 + 5RaI2 = 2SbI5 + 5Ra(NO2)2
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sr+P=SrPSr + P = SrP
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb+ Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sb+HNO3=Sb2O5+NO+H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Sb+HNO3=Sb2O5+NO+H2016Sb + 20HNO3 = 8Sb2O5 + 20NO + H20
SF4 + 3 H2O = H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + O2 =SO32S + 3O2 = 2SO3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S8 + O3 = SO3S8 + 8O3 = 8SO3
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SiO2(s) + C(s) = Si(l) + CO(g)SiO2(s) + 2C(s) = Si(l) + 2CO(g)
S8 + O2 + H2O=H2SO4S8 + 12O2 + 8H2O = 8H2SO4
SiO2(s)+C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb2O5 + H2 = Sb4O6 +H2O2Sb2O5 + 4H2 = Sb4O6 + 4H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+F2=SF6S8 + 24F2 = 8SF6
SbPO4+HNO3=H3PO4+Sb(NO3)3SbPO4 + 3HNO3 = H3PO4 + Sb(NO3)3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SrBr2 (aq) + (NH4)2CO3 (aq) = SrCO3 + NH4BrSrBr2(aq) + (NH4)2CO3(aq) = SrCO3 + 2NH4Br
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
S + O2 + H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
Sn(ClO3)4 = SnCl4 + O2Sn(ClO3)4 = SnCl4 + 6O2
SiO2 + C = CO + SiSiO2 + 2C = 2CO + Si
S + O2 = SO2S + O2 = SO2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sn+P=Sn3P23Sn + 2P = Sn3P2
SO3+H2O= H2SO4SO3 + H2O = H2SO4
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + O2 + H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
S2O3 + I2 = I S4O64S2O3 + I2 = 2IS4O6
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2 = SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s) + HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2Cl2+HI=H2S+H2O+HCl+I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SO3+H2SO4 =H2S2O7SO3 + H2SO4 = H2S2O7
SnO + NF3=SnF2 + N2O33SnO + 2NF3 = 3SnF2 + N2O3
S8 + O2=SO2S8 + 8O2 = 8SO2
Si3N4(s) = Si(s) + N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Si3N4(s) = Si(s) + N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SiO2+HF = SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(OH)2 + 2 FeSO4 = Sr(SO4)2 + 2 FeOHSr(OH)2 + 2FeSO4 = Sr(SO4)2 + 2FeOH
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
S8 + O2 = SO2S8 + 8O2 = 8SO2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO4SO2 + O2 = SO4
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SnO2+ H2 = Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2 + Na2O = Na2SO3SO2 + Na2O = Na2SO3
SbO+Fe2=Sb2O5 + Fe 0SbO + Fe2 = 0Sb2O5 + 2Fe
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2(g)+O2(g)=OSO42SO2(g) + 3O2(g) = 2OSO4
SrCl2 + K3PO4=Sr3(PO4)2 + KCl3SrCl2 + 2K3PO4 = Sr3(PO4)2 + 6KCl
S2 + O2 = SO2S2 + 2O2 = 2SO2
SO2+O2= SO32SO2 + O2 = 2SO3
SO4+O2= SO32SO4 - O2 = 2SO3
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SO2(g)+O2(g) = SO32SO2(g) + O2(g) = 2SO3
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+O2= SO32S + 3O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb + O2 =Sb4O64Sb + 3O2 = Sb4O6
Sn++ + Cr2O7 + H2O= Cr+++ + Sn++++ + H2O0Sn++ + 0Cr2O7 + H2O = 0Cr+++ + 0Sn++++ + H2O
Sn + HNO2 = SnO2 + NO2 + H2O-1Sn + 4HNO2 = -1SnO2 + 4NO2 + 2H2O
Sn + HNO2 = SnO2 + NO2 + H2O-1Sn + 4HNO2 = -1SnO2 + 4NO2 + 2H2O
SnS04+FeS04=Sn+Fe2(S04)3SnS04 + 2FeS04 = Sn + Fe2(S04)3
SnS04+FeS04=Sn+Fe2(S04)3SnS04 + 2FeS04 = Sn + Fe2(S04)3
SnSO4 + K2Cr2O2 + H2SO4 = Cr2(SO4)3 + Sn(SO4)2 + K2SO4 + H2O-2SnSO4 + K2Cr2O2 + 2H2SO4 = Cr2(SO4)3 - 2Sn(SO4)2 + K2SO4 + 2H2O
SiF4(g) + H2O(l) = H2SiF6(aq) + H2SiO3(s)3SiF4(g) + 3H2O(l) = 2H2SiF6(aq) + H2SiO3(s)
S + O2 = SO32S + 3O2 = 2SO3
S8+O2= SO2S8 + 8O2 = 8SO2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnS2(s) + 3 O2(g) = SnO2(s) + 2 SO2(g)SnS2(s) + 3O2(g) = SnO2(s) + 2SO2(g)
S8(s) + O2(g) = SO3(g)S8(s) + 12O2(g) = 8SO3(g)
Sn(NO2)4 + Pt3N4= Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sn(NO2)4 + Pt3N4= Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(NO2)4 + Pt3N4= Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sb + HNO3 = Sb2O5 + H2O +NO22Sb + 10HNO3 = Sb2O5 + 5H2O + 10NO2
Sb + HNO3 = Sb2O5 + H2O +NO22Sb + 10HNO3 = Sb2O5 + 5H2O + 10NO2
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
Sb2S3 + HNO3 = H3SbO4 +SO2 + NO + H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
SbCl3+H2S=Sb2S3+HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
S8(s)+O2(g)=SO3(g)S8(s) + 12O2(g) = 8SO3(g)
S+O2=SO2S + O2 = SO2
SO2(g) + O2(g) = SO4(g) SO2(g) + O2(g) = SO4(g)
S8(s) + O2(g) = SO3(g)S8(s) + 12O2(g) = 8SO3(g)
SnCl2+HNO3+HCl= SnCl4+HNO30SnCl2 + HNO3 + 0HCl = 0SnCl4 + HNO3
Sn(NO3)4 (aq) + 2 H2S (aq) = SnS2 (s) + 4 HNO3 (aq)Sn(NO3)4(aq) + 2H2S(aq) = SnS2(s) + 4HNO3(aq)
Sn(s) + P(s) = Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
S8 + C = CS2S8 + 4C = 4CS2
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SiO2(s)+5C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SiO(s)+5C(s)=SiC(s)+CO(g)SiO(s) + 2C(s) = SiC(s) + CO(g)
SiO(s)+5C(s)=SiC(s)+CO(g)SiO(s) + 2C(s) = SiC(s) + CO(g)
SO3(g)+H2O(l)=H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
S8(s) + O2(g) = SO3(g)S8(s) + 12O2(g) = 8SO3(g)
Si4H10(l) + O2(g) = SiO2(s) + H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
SiO2 + 9C = SiC + 2COSiO2 + 3C = SiC + 2CO
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
SO4 + K + Fe + O2 + H2O = KFe3(SO4)2(OH)6 4SO4 + 2K + 6Fe + 3O2 + 6H2O = 2KFe3(SO4)2(OH)6
SO4 + K + Fe(OH)3 + H = KFe3(SO4)2(OH)6 + H2O2SO4 + K + 3Fe(OH)3 + 3H = KFe3(SO4)2(OH)6 + 3H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HNO3 = Sn (NO3)4 + H2Sn + 4HNO3 = Sn(NO3)4 + 2H2
Si + F2 =SiF4Si + 2F2 = SiF4
SiO2 + 4HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S8+8O2=8SO2S8 + 8O2 = 8SO2
S2H5 + O2 = SO2 + H2O 4S2H5 + 13O2 = 8SO2 + 10H2O
S+O2=SO32S + 3O2 = 2SO3
SbCl3+HCl+NaBrO3= SbCl5+NaBr+H2O3SbCl3 + 6HCl + NaBrO3 = 3SbCl5 + NaBr + 3H2O
SF4(s) + H2O(l) = HF(aq) + SO2SF4(s) + 2H2O(l) = 4HF(aq) + SO2
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
SO2(g)+CaCO3(s)+O2(g)=CaSO4(s)+2CO2(g)2SO2(g) + 2CaCO3(s) + O2(g) = 2CaSO4(s) + 2CO2(g)
SO2(g)+CaCO3(s)+O2(g)=CaSO4(s)+2CO2(g)2SO2(g) + 2CaCO3(s) + O2(g) = 2CaSO4(s) + 2CO2(g)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sn2S4 + HNO3 = Sn(NO3)4 + H2SSn2S4 + 8HNO3 = 2Sn(NO3)4 + 4H2S
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2(s)+3C(s)=SiC(s)+2CO(g) SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + 2 H2 =1 Sn + 2 H2O SnO2 + 2H2 = Sn + 2H2O
Sb + Cl2 = SbCl3 2Sb + 3Cl2 = 2SbCl3
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SeCl6 + O2 =SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S+O2 = SO32S + 3O2 = 2SO3
Sn+P=Sn3P23Sn + 2P = Sn3P2
SO2+H2O2=H2SO4SO2 + H2O2 = H2SO4
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SnCl2 + Na2SO3 + H2SO4 = Na2SO4 + SnCl4 + S + H2O0SnCl2 + 3Na2SO3 + H2SO4 = 3Na2SO4 + 0SnCl4 + S + H2O
SnCl2 + Na2SO3 = Na2SO4 + SnCl4 + S + NaCl-1SnCl2 + 4Na2SO3 = 3Na2SO4 - SnCl4 + S + 2NaCl
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SiO2 + HF = SiF4 = H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn+Zn(NO3)2 = 2Sn(NO3) +Zn2Sn + Zn(NO3)2 = 2Sn(NO3) + Zn
SO2+O2=SO32SO2 + O2 = 2SO3
Si + F2 = SiF4Si + 2F2 = SiF4
Sb2S3 + Fe = Sb + FeSSb2S3 + 3Fe = 2Sb + 3FeS
Sb2S3 + Fe = Sb + FeSSb2S3 + 3Fe = 2Sb + 3FeS
Sn(NO3)2(aq)+Na2S(aq)=SnS(s)+2NaNO3(aq)Sn(NO3)2(aq) + Na2S(aq) = SnS(s) + 2NaNO3(aq)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=S2O4S8 + 8O2 = 4S2O4
S(s) + O2(g) = SO2(g) S(s) + O2(g) = SO2(g)
Sn(s)+P(s) = Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
S8 + F2 = 8SF6S8 + 24F2 = 8SF6
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2=SO2SO2 + 0O2 = SO2
Sb2S3 +HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sn(OH)2=SnO+H2OSn(OH)2 = SnO + H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SnO2(s)+2H2(g)=Sn(s)+2H2O(g)SnO2(s) + 2H2(g) = Sn(s) + 2H2O(g)
S+CO=SO2+CS + 2CO = SO2 + 2C
Sn+P=Sn3P23Sn + 2P = Sn3P2
Sn+P=Sn3P23Sn + 2P = Sn3P2
SrCl2+K3PO4=Sr3PO4+KCl23SrCl2 + K3PO4 = Sr3PO4 + 3KCl2
S8+Na2SO3+H2O = Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SnCl2+2FeCl3=2FeCl2+SnCl4SnCl2 + 2FeCl3 = 2FeCl2 + SnCl4
SrCl2+NaOH=SrOH+NaCl2SrCl2 + NaOH = SrOH + NaCl2
SrCl2+Na2CO3=SrCO3+Na2Cl2SrCl2 + Na2CO3 = SrCO3 + Na2Cl2
SrCl2+Mg(NO3)2=Sr(NO3)2+MgCl2SrCl2 + Mg(NO3)2 = Sr(NO3)2 + MgCl2
SrCl2+Li2SO4=Sr2SO4+LiCl22SrCl2 + Li2SO4 = Sr2SO4 + 2LiCl2
Sb2O3+Fe=Sb+FeOSb2O3 + 3Fe = 2Sb + 3FeO
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn + O2 = Sn2O42Sn + 2O2 = Sn2O4
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+C= SiC+ COSiO2 + 3C = SiC + 2CO
S+O2 = SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn(ClO3)4 = SnCl4 + O2Sn(ClO3)4 = SnCl4 + 6O2
SiO2 + C = CO + SiSiO2 + 2C = 2CO + Si
S + O2 = SO2S + O2 = SO2
Sb2S3(s)+HCl(aq) = SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sn+2NaOH = Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SCl2(l ) + NaF(s) =S2Cl2(l ) + SF4(g) + NaCl(s)3SCl2(l) + 4NaF(s) = S2Cl2(l) + SF4(g) + 4NaCl(s)
SnCl2 + Na2SO3 = Na2SO4 + SnSO4 + NaCl SnCl2 + 0Na2SO3 = -1Na2SO4 + SnSO4 + 2NaCl
SnCl2 + Na2SO3 = NaCl + SnSO4+ Na2SO4-1SnCl2 + 0Na2SO3 = -2NaCl - SnSO4 + Na2SO4
SnCl2 + Na2SO3 + H2O = Sn(OH)2 + Na2SO4 + HClSnCl2 + 0Na2SO3 + 2H2O = Sn(OH)2 + 0Na2SO4 + 2HCl
Si2H3(s) + O2 = SiO2 + H2O4Si2H3(s) + 11O2 = 8SiO2 + 6H2O
So 4+Sn Fe So 4+Sn No 3 =Fe No 3 +Sn So 4So4 + SnFeSo4 + SnNo3 = FeNo3 + 2SnSo4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SnO2+H2O=Sn+H2O0SnO2 + H2O = 0Sn + H2O
SrBr2 (aq) + (NH4)2CO3 (aq) = SrCO3 + NH4Br SrBr2(aq) + (NH4)2CO3(aq) = SrCO3 + 2NH4Br
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
SnO2 + H2O = Sn + H2O0SnO2 + H2O = 0Sn + H2O
Si2Cl6 + H2O = SiO2 + HCl + H2Si2Cl6 + 4H2O = 2SiO2 + 6HCl + H2
S2Cl2(l)+NH3(g)=NH4Cl(s)+S4N4(s)+S8(s)6S2Cl2(l) + 16NH3(g) = 12NH4Cl(s) + S4N4(s) + S8(s)
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
Sc(OH)3 + H2 = Sc + H2O2Sc(OH)3 + 3H2 = 2Sc + 6H2O
Sc(OH)3 + H2 = Sc + H2O2Sc(OH)3 + 3H2 = 2Sc + 6H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SF4 + 3 H2O = H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
SiF4 + H2O = H4SiO4 +H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
S+CO2=SO2+CS + CO2 = SO2 + C
SO3 + MgO = MgSO4SO3 + MgO = MgSO4
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SnO2+C=Sn+COSnO2 + 2C = Sn + 2CO
SO3=SO2+O22SO3 = 2SO2 + O2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO2 S8 + 8O2 = 8SO2
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S+O2= SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO2SO2 + 0O2 = SO2
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SiO2 + C = SiO + COSiO2 + C = SiO + CO
S+O2=SO32S + 3O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
S8+Na2SO3+H2O=Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
Sn(OH)4+HNO3=Sn (NO3)4 + H2OSn(OH)4 + 4HNO3 = Sn(NO3)4 + 4H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sc + H2O = Sc(OH)3 + H22Sc + 6H2O = 2Sc(OH)3 + 3H2
SnCl2 + Na2SO3 = NaCl + SnSO4+ Na2SO4-1SnCl2 + 0Na2SO3 = -2NaCl - SnSO4 + Na2SO4
SO3 + O2 = SO42SO3 + O2 = 2SO4
S + O3 + AQ = SO3 (AQ)S + O3 + AQ = SO3(AQ)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO4SO2 + O2 = SO4
SO2+O2=SO2SO2 - O2 = 2SO
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
SiO2(s)+6 C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sc2O3(s) + 6 HNO3(aq) =2 Sc(NO3)3(aq) + 3 H2O(l)Sc2O3(s) + 6HNO3(aq) = 2Sc(NO3)3(aq) + 3H2O(l)
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2+H2O =SO(OH)2SO2 + H2O = SO(OH)2
S(s) + O2(g)=SO2S(s) + O2(g) = SO2
S8 + Fe = Fe2S3 3S8 + 16Fe = 8Fe2S3
SnO2 + H2O = Sn + H2O0SnO2 + H2O = 0Sn + H2O
Sn + H+ = Sn2+ +H24Sn + 2H+ = 2Sn2+ + H2
Si(OH) 4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6 + O2 = SeO2 +Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sr(OH)2+H3SbO3=Sr3(SbO3)2+H2O3Sr(OH)2 + 2H3SbO3 = Sr3(SbO3)2 + 6H2O
SnO2 +H2 = Sn +H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+2C=Si+COSiO2 + 2C = Si + 2CO
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sn(SO4)2+Fe(SO4)3=Sn(SO4)4+Fe(SO4)2Sn(SO4)2 + 2Fe(SO4)3 = Sn(SO4)4 + 2Fe(SO4)2
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Si2H3+5O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sn + P = Sn3P23Sn + 2P = Sn3P2
S8+O2=SO3S8 + 12O2 = 8SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2Cl2+HI=H2S+H2O+HCl+I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
Sn +H2O = Sn3(OH)4 +4H3Sn + 4H2O = Sn3(OH)4 + 4H
SiO2+Mg=Si+MgOSiO2 + 2Mg = Si + 2MgO
S8+O2=SO3 S8 + 12O2 = 8SO3
S + HNO3 = SO2 +NO2 + H2S + 2HNO3 = SO2 + 2NO2 + H2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO3+2NH3+H2O=(NH4)2SO4SO3 + 2NH3 + H2O = (NH4)2SO4
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
SnO + O2 = SnO22SnO + O2 = 2SnO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SNO+ O2=SNO22SNO + O2 = 2SNO2
SrH2(s)+H2O(l)=Sr(OH)2(s)+H2(g)SrH2(s) + 2H2O(l) = Sr(OH)2(s) + 2H2(g)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SnO + 2HNO3 = Sn(NO3)2 + H2OSnO + 2HNO3 = Sn(NO3)2 + H2O
SnO + 2HNO3 = Sn(NO3)2 + H2OSnO + 2HNO3 = Sn(NO3)2 + H2O
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiBr4+2Ba=2BaBr2+SiSiBr4 + 2Ba = 2BaBr2 + Si
S8+O2=SO2S8 + 8O2 = 8SO2
S + O2 = SO32S + 3O2 = 2SO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si4H10 +O2 = SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sr(OH)2*8H2O+NH4Cl=SrCl2+NH3+H2OSr(OH)2*8H2O + 2NH4Cl = SrCl2 + 2NH3 + 10H2O
S2Cl2+NH3=NH4Cl+S8+S4N46S2Cl2 + 16NH3 = 12NH4Cl + S8 + S4N4
S(s)+O2(g)+H2O(l)=H2SO42S(s) + 3O2(g) + 2H2O(l) = 2H2SO4
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
Sn(NO3)2 + MgO= SnMg + O(NO3)2Sn(NO3)2 + MgO = SnMg + O(NO3)2
Sn(NO3)2 + MgO= SnMg + O(NO3)2Sn(NO3)2 + MgO = SnMg + O(NO3)2
Sn(NO3)2 + MgO= SnMg + O(NO3)2Sn(NO3)2 + MgO = SnMg + O(NO3)2
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
S (s) + O2 (g)=SO2 (g)S(s) + O2(g) = SO2(g)
Sb(s) + O2(g) =Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrCl2+Al2(SO4)=Sr(SO4)+AlClSrCl2 + Al2(SO4) = Sr(SO4) + 2AlCl
SrCl+Al(SO4)=Sr(SO4)+AlClSrCl + Al(SO4) = Sr(SO4) + AlCl
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiF4 + H2O = HF + SiO2SiF4 + 2H2O = 4HF + SiO2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8+F2=SF6S8 + 24F2 = 8SF6
S8+F2=SF6S8 + 24F2 = 8SF6
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si + NO = NSi + O22Si + 2NO = 2NSi + O2
Si + NO = NSi + OSi + NO = NSi + O
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
Sn(s) + 2CuSO4(aq) = Sn(SO4)2(aq) + 2Cu(s)Sn(s) + 2CuSO4(aq) = Sn(SO4)2(aq) + 2Cu(s)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2(s)+4HF(g)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(g) = SiF4(g) + 2H2O(l)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
SrSO4+Mg(NO3)2 = Sr(NO3)2+MgSO4SrSO4 + Mg(NO3)2 = Sr(NO3)2 + MgSO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2(g)+O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
Si4H10+O2 = SiO2+ H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
SNO+ O2=SNO22SNO + O2 = 2SNO2
S2O4+O2=S2O6S2O4 + O2 = S2O6
S+O2=S2O42S + 2O2 = S2O4
SO2 + O2 =SO32SO2 + O2 = 2SO3
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO4 + O2+ 3H2O = 2H2SO42SO4 - O2 + 2H2O = 2H2SO4
SO4 + O2+ 3H2O = 2H2SO42SO4 - O2 + 2H2O = 2H2SO4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO4 +HF = SiF4 +H2O +F2SiO4 + 8HF = SiF4 + 4H2O + 2F2
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+HNO3=Sb2O3+NO+H2O2Sb + 2HNO3 = Sb2O3 + 2NO + H2O
Sr(OH)2 + HCl = SrCl2 +H2OSr(OH)2 + 2HCl = SrCl2 + 2H2O
Sn(s)+P(s)=Sn 3 P 2 (s)3Sn(s) + 2P(s) = Sn3P2(s)
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
Sb(s)+Cl2(g)=SbCl3(l)2Sb(s) + 3Cl2(g) = 2SbCl3(l)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Si(s)+O2(g)=SiO2(s)Si(s) + O2(g) = SiO2(s)
S(s)+O2(g)+H20(l)=H2SO4(aq)10S(s) + 20O2(g) + H20(l) = 10H2SO4(aq)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.