Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SiO2 + 2NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 + Mg=Si+ MgOSiO2 + 2Mg = Si + 2MgO
SnCl4(aq)+Al(s)=AlCl3+Sn3SnCl4(aq) + 4Al(s) = 4AlCl3 + 3Sn
Sn+HNO3=Sn(NO3)+NH4NO3+H2O8Sn + 10HNO3 = 8Sn(NO3) + NH4NO3 + 3H2O
Sn+HNO3=Sn(NO3)+NH4NO3+H2O8Sn + 10HNO3 = 8Sn(NO3) + NH4NO3 + 3H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2=SO3S8 + 12O2 = 8SO3
Sn + H2SO4 = Sn(SO4)2 + H2SO3 + H2OSn + 4H2SO4 = Sn(SO4)2 + 2H2SO3 + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn +HNO3 =SnO2 +NO2 +H2O Sn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO3 + H2SO4 = H2S2O7SO3 + H2SO4 = H2S2O7
Sn +HNO3 =SnO2 +NO2 +H2O Sn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
SO4(g)+Br2(aq)+H2O(l)=HBr(aq)+H2SO4(aq)SO4(g) - Br2(aq) + 0H2O(l) = -2HBr(aq) + H2SO4(aq)
S8 +O2 = SO2S8 + 8O2 = 8SO2
SiH4(g) + NH3(g) = Si3N4(s) + H2(g)3SiH4(g) + 4NH3(g) = Si3N4(s) + 12H2(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr(s) + P4(s) =Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sn+HCl=ClSn+H22Sn + 2HCl = 2ClSn + H2
Sn+HCl=ClSn+2H22Sn + 2HCl = 2ClSn + H2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + H2 = H2S + H2OSO2 + 3H2 = H2S + 2H2O
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sn + NaOH= Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH= Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr(s) + P4(s)= Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiO2(s) + 2C(s) = Si(l) + 2CO(g)SiO2(s) + 2C(s) = Si(l) + 2CO(g)
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SnCl2 + Pb = PbCl4 + Sn2SnCl2 + Pb = PbCl4 + 2Sn
SnCl2 + Pb = PbCl4 + 2Sn2SnCl2 + Pb = PbCl4 + 2Sn
SnCl2 + Pb = PbCl4 + 2Sn2SnCl2 + Pb = PbCl4 + 2Sn
SnCl4+NH3+H2O=H2SnO3+NH4Cl SnCl4 + 4NH3 + 3H2O = H2SnO3 + 4NH4Cl
S + O2 = SO2S + O2 = SO2
S+HNO3=H2SO4+H20+NO210S + 40HNO3 = 10H2SO4 + H20 + 40NO2
Sb2O3 + SbCl3 = Sb4O5Cl25Sb2O3 + 2SbCl3 = 3Sb4O5Cl2
SO2+ O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn + H+ = Sn4+ + H28Sn + 2H+ = 2Sn4+ + H2
Sb+Hg(NO3)2=Hg2+Sb(NO3)22Sb + 2Hg(NO3)2 = Hg2 + 2Sb(NO3)2
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2=SO32SO2 + O2 = 2SO3
S+O2 = SO32S + 3O2 = 2SO3
SO2(g) + O2(g) + H2O(g)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(g) = 2H2SO4(aq)
SO2(g) + O2(g) + H2O(g)= H2SO4(aq)2SO2(g) + O2(g) + 2H2O(g) = 2H2SO4(aq)
S+HNO3=H2SO4+HNO2+H2O-1S - 3HNO3 = -1H2SO4 - 3HNO2 + H2O
SO3+ H2O + C2H6 = SO2 + CH3OHSO3 + H2O + C2H6 = SO2 + 2CH3OH
SO2+ H2O + C2H6 = SO3 + CH3OH-1SO2 + H2O + C2H6 = -1SO3 + 2CH3OH
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Sr(s)+2H2O(l) = Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO+ H2S= 2S+ H2OSO + H2S = 2S + H2O
Sb + O2 = Sb4O6 4Sb + 3O2 = Sb4O6
S+H2O+O2=H2SO42S + 2H2O + 3O2 = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO3=SO2+O22SO3 = 2SO2 + O2
Sn + Cl2 = SnCl4Sn + 2Cl2 = SnCl4
SiBr4+H2O=SiO2+HBrSiBr4 + 2H2O = SiO2 + 4HBr
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO3+HNO3= H2 SO4 +N2 O5SO3 + 2HNO3 = H2SO4 + N2O5
Sr(NO3)2+Na2CO3=SrCO3+NaNO3Sr(NO3)2 + Na2CO3 = SrCO3 + 2NaNO3
SO2 (g) + O2 (g) + H2O (l) = H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2 (g) + O2 (g) + H2O (l) = H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2 (g) + O2 (g) + H2O (l) = H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Sn+ KOH= K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Se(s) + O2(g) = SeO32Se(s) + 3O2(g) = 2SeO3
SO2 (g) + O2 (g) + H2O (l) = H2SO4 (aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Sn+HNO3=Sn(NO3)2+NH4NO3+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SnCl4 * 5H2O = SnO2 + HCl + H2OSnCl4*5H2O = SnO2 + 4HCl + 3H2O
S + O2 + H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HNO3 = NO2 + H2O + SnO2Sn + 4HNO3 = 4NO2 + 2H2O + SnO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2= SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
S + O2 = SO2S + O2 = SO2
Sr(s)+O2(g)=SrO2(s)Sr(s) + O2(g) = SrO2(s)
Sn2+ + NO2- = Sn4+ + N2 +O4Sn2+ + 2NO2- = 2Sn4+ + N2 + 4O
SnCl4 * 6H2O = SnO2 + HCl + H2OSnCl4*6H2O = SnO2 + 4HCl + 4H2O
Sc2O3+SO3 =Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
Sc2O3(s)+SO3(l) =Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SnO2 +2 H2 = Sn +2H2OSnO2 + 2H2 = Sn + 2H2O
S8 (s) + O2 (g) = SO3(g)S8(s) + 12O2(g) = 8SO3(g)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SrCl2+LiOH=LiCl=Sr(OH)2SrCl2 + 2LiOH = 2LiCl + Sr(OH)2
S8 + H3PO4 = H2SO4 + P4 + H2O5S8 + 48H3PO4 = 40H2SO4 + 12P4 + 32H2O
Sr + H2O = H2 + Sr(OH)2Sr + 2H2O = H2 + Sr(OH)2
S + 6HNO3=H2SO4 +6NO2 +2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
Si (s) + 2 Cl (g) = SiCl4 (l) Si(s) + 4Cl(g) = SiCl4(l)
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SiCl4 + H2O = SiO2 +2HClSiCl4 + 2H2O = SiO2 + 4HCl
SrO+H2O=Sr(OH)2SrO + H2O = Sr(OH)2
S8+O2=SO3S8 + 12O2 = 8SO3
Sn +HNO3 =SnO2 +NO2 +H2O Sn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sr3N2 + K3PO4 = Sr3(PO4)2 + K3NSr3N2 + 2K3PO4 = Sr3(PO4)2 + 2K3N
SO+HNO3+H2O=NO+H2SO43SO + 4HNO3 + H2O = 4NO + 3H2SO4
SrS(aq)+CuSO4(s)=SrSO4(s)+CuS(aq)SrS(aq) + CuSO4(s) = SrSO4(s) + CuS(aq)
S8(s) + H3PO4(aq) = H2SO4(aq) + P4(s) + H2O(l)5S8(s) + 48H3PO4(aq) = 40H2SO4(aq) + 12P4(s) + 32H2O(l)
Sn(s)+O2(g)=SnO(s)2Sn(s) + O2(g) = 2SnO(s)
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2 =SO3S8 + 12O2 = 8SO3
SO3 + KOH = K2SO4 + H2OSO3 + 2KOH = K2SO4 + H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sc2 O3 (s) + SO3 (l) =Sc2 (SO4 )3 (s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sc2 O3 (s) + SO3 (l) = Sc2 (SO4 )3 (s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3 + H2 = SO2 + H2OSO3 + H2 = SO2 + H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+H2O=HSO3+H3OSO2 + 2H2O = HSO3 + H3O
Si4H10 + O2 = SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + O2 = SO32S + 3O2 = 2SO3
SeO2 + KOH = KSeO3 + H2020SeO2 + 20KOH = 20KSeO3 + H20
S+O2=SO32S + 3O2 = 2SO3
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SeCl6+O(g)=SeO2+Cl(g)SeCl6 + 2O(g) = SeO2 + 6Cl(g)
SnO2+H=Sn+H2OSnO2 + 4H = Sn + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(NO3)2(aq) + Fe2(SO4)3(aq)= Sr(SO4)3+Fe2(NO3)2Sr(NO3)2(aq) + Fe2(SO4)3(aq) = Sr(SO4)3 + Fe2(NO3)2
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S+O2=SO32S + 3O2 = 2SO3
Sc2O3+3H2O=2Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
SO2+O2=SO32SO2 + O2 = 2SO3
S2 + O2 = SO2S2 + 2O2 = 2SO2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sn(ClO3)2=SnO+ClO2+O22Sn(ClO3)2 = 2SnO + 4ClO2 + O2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+Cl2 = SnCl4Sn + 2Cl2 = SnCl4
Sr(OH)2(aq)+2HNO3(aq)=Sr(NO3)2(aq)+2H2O(l)Sr(OH)2(aq) + 2HNO3(aq) = Sr(NO3)2(aq) + 2H2O(l)
S+HNO3=H2SO4+NO2+H2O S + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S (s) + O2 (g) = SO3 (g)2S(s) + 3O2(g) = 2SO3(g)
S(s) + O2(g) =SO3 (g)2S(s) + 3O2(g) = 2SO3(g)
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
S8+F2=SF6S8 + 24F2 = 8SF6
Sr+O2=2SrO2Sr + O2 = 2SrO
SiCl4(l) + Mg(s) = Si(s) + MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
S8+F2=SF6S8 + 24F2 = 8SF6
S+NaClO+NaOH=Na2SO4+NaCl+H2OS + 3NaClO + 2NaOH = Na2SO4 + 3NaCl + H2O
SO3 + Cu = SO4 + Cu0SO3 + Cu = 0SO4 + Cu
SO3 + Cu = SO4 + Cu0SO3 + Cu = 0SO4 + Cu
SiO2+C= SiC+COSiO2 + 3C = SiC + 2CO
S + 2NaF = SF2 + 2NaS + 2NaF = SF2 + 2Na
S + NaF = SF + NaS + NaF = SF + Na
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + 2NaF = SF2 + 2NaS + 2NaF = SF2 + 2Na
S + NaF = SF + NaS + NaF = SF + Na
Sr + O2= SrO2Sr + O2 = 2SrO
Sc2O3(s)+SO3(l)=Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sc2O3(s)+SO3(l)=Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SO2 + H2O = HSO3 + H3OSO2 + 2H2O = HSO3 + H3O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s) + HBr(aq) = SnBr2(aq) + H2(g)Sn(s) + 2HBr(aq) = SnBr2(aq) + H2(g)
Sr+ P4 = Sr3P26Sr + P4 = 2Sr3P2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiCl4+2Ba=2BaCl2+SiSiCl4 + 2Ba = 2BaCl2 + Si
Sn +N2 = Sn3N43Sn + 2N2 = Sn3N4
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SO3 + Al2O3 = Al2(SO4)33SO3 + Al2O3 = Al2(SO4)3
SnS2 + HCl = H2SnCl6 + H2S SnS2 + 6HCl = H2SnCl6 + 2H2S
SnS2 + HCl = H2SnCl6 + H2S SnS2 + 6HCl = H2SnCl6 + 2H2S
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb(s)+Cl2(g)=SbCl3(s) 2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2+H2O=H2 SO42S + 3O2 + 2H2O = 2H2SO4
S+ O2 =SO2S + O2 = SO2
S(s) + O2(g) =SO2(g)S(s) + O2(g) = SO2(g)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SOCl2 + KMnO4 + H2SO4 = HCl + K2SO4 + MnSO4 +H2O-5SOCl2 - 2KMnO4 + 2H2SO4 = -10HCl - K2SO4 - 2MnSO4 + 7H2O
SOCl2 + KMnO1 + H2SO4 = HCl + K2SO4 + MnSO4 +H2O-1SOCl2 + 2KMnO1 + 4H2SO4 = -2HCl + K2SO4 + 2MnSO4 + 5H2O
Sr+H2SO4=SrSO4+SO2+H2OSr + 2H2SO4 = SrSO4 + SO2 + 2H2O
Sr+H2SO4=SrSO4+SO2+H2OSr + 2H2SO4 = SrSO4 + SO2 + 2H2O
SO4+H2O=H2SO4+O22SO4 + 2H2O = 2H2SO4 + O2
SiCl4 + H2O = Si(OH)4 + HClSiCl4 + 4H2O = Si(OH)4 + 4HCl
SnCl2 + HNO3 + HCl = SnCl4 + N2O + H2O4SnCl2 + 2HNO3 + 8HCl = 4SnCl4 + N2O + 5H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3 = SO2+NO2+H20 10S + 20HNO3 = 10SO2 + 20NO2 + H20
S+HNO3 = SO2+NO2+H20 10S + 20HNO3 = 10SO2 + 20NO2 + H20
S + 6HNO3 = H2SO4 + 6NO2 + 2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3 = H2SO4 + 6NO2 + 2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(NO2)4 + Pt3N4 = Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
S+6HNO3= H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SF4(g)+O2(g)=OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
SiO2+2C=SiC+CO2SiO2 + 2C = SiC + CO2
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + NO3 = SO4 +NOSO2 + NO3 = SO4 + NO
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2(g)+CaO=CaSO3(g)SO2(g) + CaO = CaSO3(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+O2=SO32S + 3O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + H2S= S + 2H2OSO2 + 2H2S = 3S + 2H2O
SO3-- + MnO4 + H+ = SO4-- + Mn++ + H2040SO3-- + 10MnO4 + 20H+ = 40SO4-- + 10Mn++ + H20
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sc2O3+3H2O=2Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Si+2C=SiCSi + C = SiC
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SrO + 2HCl =H2O +SrCl2SrO + 2HCl = H2O + SrCl2
Sc2O3+3H2O=2Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SnO2 + C = Sn + CO2SnO2 + C = Sn + CO2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SbH3+Ca(OH)2=Ca3Sb2+H2O2SbH3 + 3Ca(OH)2 = Ca3Sb2 + 6H2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+F2=SF6S8 + 24F2 = 8SF6
Si+H2O=SiO3+H2Si + 3H2O = SiO3 + 3H2
S2+O2+2Zn=2ZnSO2S2 + 2O2 + 2Zn = 2ZnSO2
S2+2O2+2Zn=2ZnSO2S2 + 2O2 + 2Zn = 2ZnSO2
S2Cl2 + H2O2 = SO2 + H2O + HClS2Cl2 + 3H2O2 = 2SO2 + 2H2O + 2HCl
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SO3 + 2H2O = H2 + SO4SO3 + H2O = H2 + SO4
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SnO2 + CO =Sn +CO2SnO2 + 2CO = Sn + 2CO2
S8+O2=SO2S8 + 8O2 = 8SO2
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SF4 + 3H2O= H2SO3 + 4HFSF4 + 3H2O = H2SO3 + 4HF
SiO2+Ca3(PO4)2+C=CO+CaSiO3+P46SiO2 + 2Ca3(PO4)2 + 10C = 10CO + 6CaSiO3 + P4
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
SbO + Fe = Sb2O5 + Fe0SbO + Fe = 0Sb2O5 + Fe
SIO2 +C =SIC +COSIO2 + 3C = SIC + 2CO
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO3 = SO2 + O22SO3 = 2SO2 + O2
SO3 (g) + H2O (l) = H2SO4 (aq)SO3(g) + H2O(l) = H2SO4(aq)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3 (g) + H2O (l) = H2SO4(l)SO3(g) + H2O(l) = H2SO4(l)
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S+H2SO4=SO2+H2S2S + H2SO4 = 2SO2 + H2S
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sb2O5 + H2S = SbO + S + H2OSb2O5 + 3H2S = 2SbO + 3S + 3H2O
SO2+O2 = SO32SO2 + O2 = 2SO3
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sc2O3(s)+SO3(l)=Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SIO2+C=SIC+3COSIO2 + 3C = SIC + 2CO
SnO2 + Na2CO3 + S = Na2SnS3 + SO2 + CO22SnO2 + 2Na2CO3 + 9S = 2Na2SnS3 + 3SO2 + 2CO2
S+H2SO4=SO2+H 2 OS + 2H2SO4 = 3SO2 + 2H2O
SCN- + IO3- + OH- = CN- + SO4-- + I- + H2OSCN- + IO3- + 2OH- = CN- + SO4-- + I- + H2O
SCN- + IO3- + OH- = CN- + SO4-- + I- + H2OSCN- + IO3- + 2OH- = CN- + SO4-- + I- + H2O
SbS04 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO4-10SbS04 - 58KMnO4 + 32H2O = -10H3SbO4 - 29K2SO4 - 58MnSO4 + 47H2SO4
SrF2 + H2O = SrO + HFSrF2 + H2O = SrO + 2HF
S8 + O2 + NaOH= Na2SO4 + H2O S8 + 12O2 + 16NaOH = 8Na2SO4 + 8H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2S = S+ H2OSO2 + 2H2S = 3S + 2H2O
SiO2 + C = Si + COSiO2 + 2C = Si + 2CO
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sn(NO3)4 + Al2(SO4)3 = Sn(SO4)2 + Al(NO3)33Sn(NO3)4 + 2Al2(SO4)3 = 3Sn(SO4)2 + 4Al(NO3)3
SiC + Cl2 = SiCl4 + CSiC + 2Cl2 = SiCl4 + C
Sb(s) + O2(g) = Sb2O3(s)4Sb(s) + 3O2(g) = 2Sb2O3(s)
SrSO4 + HCl = SrCl2 + H2SO4SrSO4 + 2HCl = SrCl2 + H2SO4
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
S8 + O2 + NaOH = Na2SO4 + H2OS8 + 12O2 + 16NaOH = 8Na2SO4 + 8H2O
SO2Cl2 + HI = H2S + H2O + HCl + I2 SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
S+O2=SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO3=SO2+O22SO3 = 2SO2 + O2
S+O2=SO32S + 3O2 = 2SO3
SO2 + 5HNO2 = H2SO4 + 5NOSO2 + 2HNO2 = H2SO4 + 2NO
SiH3 + O2 = SiO2 + H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
Sb2O3 + C = 3CO + SbSb2O3 + 3C = 3CO + 2Sb
S8+O2 = SO3S8 + 12O2 = 8SO3
SnO2+CO =Sn+CO2SnO2 + 2CO = Sn + 2CO2
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SNO2+2H2=SN+2H2OSNO2 + 2H2 = SN + 2H2O
S8 + O2 =SO3S8 + 12O2 = 8SO3
SO3+Al=SO2 +AlOSO3 + Al = SO2 + AlO
SiCl4 + H2O = H2SiO3 + HClSiCl4 + 3H2O = H2SiO3 + 4HCl
Sb2S3 + O2 = Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
S+O2=SO32S + 3O2 = 2SO3
Sn+O2=SnO2Sn + O2 = SnO2
SnSO4 + Al = AlSO4 + SnSnSO4 + Al = AlSO4 + Sn
S(s)+6HNO3(aq)=H2SO4(aq)+6NO2(g)+2H2O(l)S(s) + 6HNO3(aq) = H2SO4(aq) + 6NO2(g) + 2H2O(l)
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2= SO32SO2 + O2 = 2SO3
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
Sr(NO3)2+Li2CO3(H2O)=LiNO3+SrCO3+H2OSr(NO3)2 + Li2CO3(H2O) = 2LiNO3 + SrCO3 + H2O
Sn + HNO3 = Sn(NO3)2 + NH4NO3 + H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Si +O2 = SiO2Si + O2 = SiO2
Sb2O3 + C = CO + 2SbSb2O3 + 3C = 3CO + 2Sb
Sn + Li(SO4)2 = SnSO4 + Li2Sn + Li(SO4)2 = 2SnSO4 + Li
Sn + Li(SO4)2 = Sn2SO4 + Li4Sn + Li(SO4)2 = 2Sn2SO4 + Li
SiO2 + 2C = Si + 2COSiO2 + 2C = Si + 2CO
SO2 + HOH = H2SO3SO2 + HOH = H2SO3
SF4 + H2O = SF4H2OSF4 + H2O = SF4H2O
SeO3(aq)+Cl2(g)=SeO4(aq)+Cl(aq)0SeO3(aq) + Cl2(g) = 0SeO4(aq) + 2Cl(aq)
SO2Cl2+HBr=H2S+HCl+Br2+H2OSO2Cl2 + 8HBr = H2S + 2HCl + 4Br2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SeCl6 + O2 =SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sn + Fe2O3 =SnO2 + Fe 3Sn + 2Fe2O3 = 3SnO2 + 4Fe
Sr(OH)2+H3PO4=SrPO4+H+H200Sr(OH)2 + 0H3PO4 = 0SrPO4 - 20H + H20
SO2(g)+O2(g)+H2O(g)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(g) = 2H2SO4(aq)
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2(g)+O2(g)+H2O(g)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(g) = 2H2SO4(aq)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2O3 + KIO3 + HCl + H2O = HSb(OH)6 + KCl + IClSb2O3 + KIO3 + 2HCl + 6H2O = 2HSb(OH)6 + KCl + ICl
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SnCl4+F=SnF4+Cl SnCl4 + 4F = SnF4 + 4Cl
SeO3+Cl2= SeO4+Cl0SeO3 + Cl2 = 0SeO4 + 2Cl
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO2 +Li=Sn+Li2OSnO2 + 4Li = Sn + 2Li2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiCl4 +H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S(s) + O2(g) + H2O(l) = H2SO4(aq)=2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2=SO2S8 + 8O2 = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrS+H2O=HS+SrOHSrS + H2O = HS + SrOH
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(NO3)2+ K2SO4 = SrSO4 + K2(NO3)2Sr(NO3)2 + K2SO4 = SrSO4 + K2(NO3)2
S +O2 = S-- + SO4S + 2O2 = 0S-- + SO4
SO4 + Ca=CaSO4SO4 + Ca = CaSO4
SiO2(s) + 4 HF(aq) = SiF4(g) + 2 H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2(s) + 4 HF(aq) = SiF4(g) + 2 H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SnCl4(s) + H2O(g) = SnO2(s) + HCl(g)SnCl4(s) + 2H2O(g) = SnO2(s) + 4HCl(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb(s) + H2O(l) = Sb3O4(s) + H2(g)3Sb(s) + 4H2O(l) = Sb3O4(s) + 4H2(g)
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
Sr(NO3)2 + S = S(NO3)2 + SrSr(NO3)2 + S = S(NO3)2 + Sr
Sn + Al(NO3)3 = Sn(NO3)3 + AlSn + Al(NO3)3 = Sn(NO3)3 + Al
Sn + Al(NO3)3 = Sn(NO3) + Al3Sn + Al(NO3)3 = 3Sn(NO3) + Al
S2Fe + O2 = Fe2O3 + 4SO24S2Fe + 11O2 = 2Fe2O3 + 8SO2
S2- + ClO- + OH- = H2O + Cl- + S84S2- + 2ClO- - 4OH- = -2H2O + 2Cl- + S8
SO2+NO3+H2O=HSO4+NO4SO2 + 3NO3 + 2H2O = 4HSO4 + 3NO
Sr+HI=H2+I2SrSr + 2HI = H2 + I2Sr
SiO2 + 2C = SiC + 2COSiO2 + 3C = SiC + 2CO
Sr+HI=H2+I2SrSr + 2HI = H2 + I2Sr
Sr+HI=H2+SrI 2Sr + 2HI = H2 + 2SrI
SO2 + H2O = S8 + H2O0SO2 + H2O = 0S8 + H2O
SO2 + H2S = S8 + H2O8SO2 + 16H2S = 3S8 + 16H2O
Sb(s) + O2(g) = Sb2O3(s)4Sb(s) + 3O2(g) = 2Sb2O3(s)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sb(s) + O2(g) = Sb2O3(s)4Sb(s) + 3O2(g) = 2Sb2O3(s)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2 + 4Cl- + 4H+ = SnCl2 + Cl2 + 2H2OSnO2 + 4Cl- + 4H+ = SnCl2 + Cl2 + 2H2O
SnO2 + 4Cl- + 4H+ = SnCl2 + Cl2 + 2H2OSnO2 + 4Cl- + 4H+ = SnCl2 + Cl2 + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO3(g) = SO2(g) + O2(g)2SO3(g) = 2SO2(g) + O2(g)
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
S8+H2=H2SS8 + 8H2 = 8H2S
S8+O2= SO2S8 + 8O2 = 8SO2
SO3(g) + 2H2O(l) = H2SO4SO3(g) + H2O(l) = H2SO4
Si O2 + C = Si C + COSiO2 + 3C = SiC + 2CO
Si O2 + C = Si C + COSiO2 + 3C = SiC + 2CO
Si+S8=Si2S44Si + S8 = 2Si2S4
SnBr2 + 2KOH = Sn(OH)2 + 2KBrSnBr2 + 2KOH = Sn(OH)2 + 2KBr
SiO2 + CaF2 + H2SO4 = CaSO4 + SiF4 + H2OSiO2 + 2CaF2 + 2H2SO4 = 2CaSO4 + SiF4 + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S(O)42-+NH3=S(O)32-+H2O+N23S(O)42- + 20NH3 = 3S(O)32- + 30H2O + 10N2
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S-- + (NO3)- + H+ = S + NO + H2O3S-- + 2(NO3)- + 8H+ = 3S + 2NO + 4H2O
S2- + (NO3)- + H+ = S + NO + H2O3S2- + (NO3)- + 4H+ = 6S + NO + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SeO2(g) + 2 H2Se(g) = 3 Se(s) + 2 H2O(g)SeO2(g) + 2H2Se(g) = 3Se(s) + 2H2O(g)
Sb2O3 + C = Sb + CO22Sb2O3 + 3C = 4Sb + 3CO2
Sn(s) + O(g)= SnO(aq)Sn(s) + O(g) = SnO(aq)
Sr + 2H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
Sb + H2O = Sb2O3 + H22Sb + 3H2O = Sb2O3 + 3H2
S8+O2=S2O4S8 + 8O2 = 4S2O4
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SrO + H2O = Sr(OH)2SrO + H2O = Sr(OH)2
SrO + H2O = Sr(OH)2SrO + H2O = Sr(OH)2
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnCl2 + AgNO3 = AgCl + Sn(NO3)2SnCl2 + 2AgNO3 = 2AgCl + Sn(NO3)2
S8 + F2 = SF6S8 + 24F2 = 8SF6
SiH10 + O2 = SiO2 +H2O2SiH10 + 7O2 = 2SiO2 + 10H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SeO2(g) + H2Se(g) = Se(s) + H2O(g)SeO2(g) + 2H2Se(g) = 3Se(s) + 2H2O(g)
S+O2=SO32S + 3O2 = 2SO3
Sb2S3(s) + HCl (aq)= SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sr + H2O = Sr (OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SnCl4+NH3=SnCl+HCl+N22SnCl4 + 2NH3 = 2SnCl + 6HCl + N2
SO2+NO3+H2O=HSO4+NO4SO2 + 3NO3 + 2H2O = 4HSO4 + 3NO
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 +O2 = SO32SO2 + O2 = 2SO3
Sr +O2 + C = SrCO32Sr + 3O2 + 2C = 2SrCO3
Sr(NO3)2 + CuSO4 = SrSO4 + Cu(NO3)2Sr(NO3)2 + CuSO4 = SrSO4 + Cu(NO3)2
Sr(NO3)2 + Na2CO3 = SrCO3 + NaNO3Sr(NO3)2 + Na2CO3 = SrCO3 + 2NaNO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr+N2+O2=Sr(NO3)2Sr + N2 + 3O2 = Sr(NO3)2
SOCl2(l) + H2O(l) = SO2(g) + HCl (g)SOCl2(l) + H2O(l) = SO2(g) + 2HCl(g)
S2 + O2 = SO2S2 + 2O2 = 2SO2
SiO2 + NaOH = H2O + Na2SiO3SiO2 + 2NaOH = H2O + Na2SiO3
SiF4 + K = KF + SiSiF4 + 4K = 4KF + Si
Sr + N2 = Sr3N23Sr + N2 = Sr3N2
S+6HNO3= H2SO4+6NO2+2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3= H2SO4+6NO2+2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sc2O3 + SO3 = Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
SO2+O2=SO32SO2 + O2 = 2SO3
S+ 6HNO3 = H2SO4 + NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4 + 4H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si + S8 = Si2S44Si + S8 = 2Si2S4
Se(s)+NO3(aq)=SeO2(s)+NO(g)Se(s) + NO3(aq) = SeO2(s) + NO(g)
SO2 + Cl2 = SOCl2 + Cl2OSO2 + 2Cl2 = SOCl2 + Cl2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiO2 (s) + HF (g) = SiF4(g) + H2O (l)SiO2(s) + 4HF(g) = SiF4(g) + 2H2O(l)
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Si O2 + C = Si C + CO SiO2 + 3C = SiC + 2CO
SiCl4 +H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2 + H2S = S8 + H2O8SO2 + 16H2S = 3S8 + 16H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SiC + Cl2 = SiCl4 + CSiC + 2Cl2 = SiCl4 + C
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SiO2+4HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
Si+S8=Si2S44Si + S8 = 2Si2S4
Sb+O2=Sb4O58Sb + 5O2 = 2Sb4O5
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2 + NO = N2 + SO32SO2 + 2NO = N2 + 2SO3
Si + F2 = SiF4Si + 2F2 = SiF4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.