Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SiF4 +2NH3 + 2HF=(NH4)2SiF6SiF4 + 2NH3 + 2HF = (NH4)2SiF6
Sr+O2=2SrO2Sr + O2 = 2SrO
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO3+2NaOH=NaSO3 +2OHSO3 + NaOH = NaSO3 + OH
SO3+2NaOH=2NaSO3 +2OHSO3 + NaOH = NaSO3 + OH
SO3+2NaOH=2NaSO3 +OHSO3 + NaOH = NaSO3 + OH
SO2 + NO3- + H2O = SO4-- + N2O + H+4SO2 + 2NO3- + 3H2O = 4SO4-- + N2O + 6H+
SO2 + NO3 + H2O = SO4-- + N2O + H+5SO2 + 2NO3 + 5H2O = 5SO4-- + N2O + 10H+
SO2 + NO3 + H2O = SO4-- + N2O + H+5SO2 + 2NO3 + 5H2O = 5SO4-- + N2O + 10H+
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SrCl2 + KMnO + H3PO4 = Cl2 + Mn3(PO4)2 + Sr(PO4)2 + K3PO4 + H2O-1SrCl2 + 6KMnO + 4H3PO4 = -1Cl2 + 2Mn3(PO4)2 - Sr(PO4)2 + 2K3PO4 + 6H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8 +F2=SF4S8 + 16F2 = 8SF4
SO2+O2=SO32SO2 + O2 = 2SO3
SiH4+NH3=Si3N4+H23SiH4 + 4NH3 = Si3N4 + 12H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S=S88S = S8
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+H2+O=H2SO4S + H2 + 4O = H2SO4
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
Sb2O5=Sb5+O210Sb2O5 = 4Sb5 + 25O2
SO2 + Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+O2=O8S2S8 + 16O2 = 4O8S2
S8+O2=O8S2S8 + 16O2 = 4O8S2
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sr(NO3)2 (aq) + K2SO4 (aq) = SrSO4 (aq) + K2(NO3)2 (aq)Sr(NO3)2(aq) + K2SO4(aq) = SrSO4(aq) + K2(NO3)2(aq)
SO2+O2 = SO32SO2 + O2 = 2SO3
Sn(s) + 2 AgClO4(aq) = 2 Ag(s) + 2 Sn(ClO4)2(aq) Sn(s) + 2AgClO4(aq) = 2Ag(s) + Sn(ClO4)2(aq)
Sn(s) + 2 NaOH(aq) = Na2SnO2(aq) + 4 H2(g) Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
SF 4 (s) + 2H 2 O(l) = SO 2 (g) + 4HF(aq)SF4(s) + 2H2O(l) = SO2(g) + 4HF(aq)
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+MnO4=SO4+MnO22SO3 + MnO4 = 2SO4 + MnO2
SO3+MnO4=SO4+MnO22SO3 + MnO4 = 2SO4 + MnO2
S+6HNO3=H2SO4+6NO2+3H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn +2HBr = SnBr2 +H2Sn + 2HBr = SnBr2 + H2
SiO2 (l) + Al (l) = Al2O3 (s) + Si (l)3SiO2(l) + 4Al(l) = 2Al2O3(s) + 3Si(l)
SCl2 +NaF = SF4 + S2Cl2 +Na-1SCl2 + 4NaF = SF4 - S2Cl2 + 4Na
SCl2 +NaF = SF4 + S2Cl2=Na-1SCl2 + 4NaF = SF4 - S2Cl2 + 4Na
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
Sn(ClO3)2 + Na2CrO4 = SnCrO4 + Na(ClO3)Sn(ClO3)2 + Na2CrO4 = SnCrO4 + 2Na(ClO3)
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8 + Na2SO3 + H2O = Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2+O2=SO4SO2 + O2 = SO4
SeO2 + H2Se = Se + H2OSeO2 + 2H2Se = 3Se + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
Sr(NO3)2 + FeSO4 = SrSO4 + Fe(NO3)2Sr(NO3)2 + FeSO4 = SrSO4 + Fe(NO3)2
S2Cl2 + H2SO4 = SO2 + H2O + HClS2Cl2 + 3H2SO4 = 5SO2 + 2H2O + 2HCl
SO2+AL2O3=AL2(SO3)33SO2 + AL2O3 = AL2(SO3)3
S2O4+O2=SO4S2O4 + 2O2 = 2SO4
SeCl6+F2=SeF2+3Cl2SeCl6 + F2 = SeF2 + 3Cl2
SO2+O=SO3SO2 + O = SO3
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
Sn+ZnSO4=Zn+SnSO4Sn + ZnSO4 = Zn + SnSO4
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 (l) + Al (l) = Al2O3 (s) + Si (l)3SiO2(l) + 4Al(l) = 2Al2O3(s) + 3Si(l)
Sn+HCl+NO=SnCl2+NH2OH3Sn + 6HCl + 2NO = 3SnCl2 + 2NH2OH
SO4-2 = SO2 + O2 + 2eSO4-2 = SO2 + O2 + 2e
SO2+O2=SO32SO2 + O2 = 2SO3
Si + HNO3 + HF = H2O + NO + SiF43Si + 4HNO3 + 12HF = 8H2O + 4NO + 3SiF4
Si + HNO3 + HF = H2O + NO + SiF43Si + 4HNO3 + 12HF = 8H2O + 4NO + 3SiF4
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + Na = Na2SS + 2Na = Na2S
S8+Cl2=S2Cl2S8 + 4Cl2 = 4S2Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+C=CO+SiSiO2 + 2C = 2CO + Si
S8+O2=SO3S8 + 12O2 = 8SO3
Sr + SO2 = SrO + S2Sr + SO2 = 2SrO + S
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4+H2O=SiO2+4HClSiCl4 + 2H2O = SiO2 + 4HCl
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SnCl2 + K2Cr2O7 + HCl = CrCl3 + KCl + SnCl4 + H2O 3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
SbCl5 + KI = KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O 2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
S8+H2SO4=SO2+H2OS8 + 16H2SO4 = 24SO2 + 16H2O
S8 + 12O2=8SO3S8 + 12O2 = 8SO3
SiO2+HF=SiF4=H2OSiO2 + 4HF = SiF4 + 2H2O
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sr + O2 = SrO2Sr + O2 = 2SrO
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + O2 = OSF42SF4 + O2 = 2OSF4
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
SO2 = O2 = SO3 2SO2 = -1O2 + 2SO3
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
S + O2 = SO32S + 3O2 = 2SO3
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
S + Fe = SFeS + Fe = SFe
S8(s) + 4O2(g) = 8SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sn + HCl + K2Cr2O7 = SnCl4 + CrCl3+ KCl + H2O3Sn + 28HCl + 2K2Cr2O7 = 3SnCl4 + 4CrCl3 + 4KCl + 14H2O
SiCl4 + Na = NaCl + SiSiCl4 + 4Na = 4NaCl + Si
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2+H2S=S8+H2O8SO2 + 16H2S = 3S8 + 16H2O
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
SO+KMnO4+KO2H = K2SO4+MnO2+H2OSO + 0KMnO4 + 2KO2H = K2SO4 + 0MnO2 + H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
SO3 + H2O =H2SO4SO3 + H2O = H2SO4
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
SrO+HCl=HSr+ClOSrO + HCl = HSr + ClO
S + 6HNO3 = SO3 + 3H20 + 6NO220S + 60HNO3 = 20SO3 + 3H20 + 60NO2
Sn+HNO3=Sn(NO3)2+NH4NO3+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn+2HNO3=SnO2+2NO+H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
Sn+2HNO3=SnO2+2NO+H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SiO+C=SiC+COSiO + 2C = SiC + CO
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Sb2S3+Fe=3FeS+2SbSb2S3 + 3Fe = 3FeS + 2Sb
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
Sn+4HNO3=SnO2+4NO2+2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+4HNO3=SnO2+4NO2+2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+4HNO3=SnO2+4NO2+2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
SH2+O2=SO2+H2O2SH2 + 3O2 = 2SO2 + 2H2O
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sn + HCl = SnCl2 + H2Sn + 2HCl = SnCl2 + H2
Sb2S3 + HCl = SbCl3 +H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SiCl4(l) +Mg(s) =Si(s) +MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SO2 + KMnO4 + H2O = MnSO4 + K2SO4 + H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
Sr + H3PO4 = Sr3(PO4)2 + H23Sr + 2H3PO4 = Sr3(PO4)2 + 3H2
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + Cl = S2Cl2 S8 + 8Cl = 4S2Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 +O2 = SO32SO2 + O2 = 2SO3
SiCl4(l) + Mg(s) =Si(s) + MgCl2(s)SiCl4(l) + 2Mg(s) = Si(s) + 2MgCl2(s)
SO2 (g)+NaOH (s)=Na2SO3 (s)+H2O (l)SO2(g) + 2NaOH(s) = Na2SO3(s) + H2O(l)
Si4H10(l)+O2(g)=SiO(s)+H20(l)2Si4H10(l) + 4O2(g) = 8SiO(s) + H20(l)
Si4H10(l)+O2(g)=SiO(s)+H20(l)2Si4H10(l) + 4O2(g) = 8SiO(s) + H20(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8(s) + O2(g) = SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S-2 + 2H+1+ I2 = S + 2HIS-2 + 2H+1 + I2 = S + 2HI
Sn+4Ci=SnCi4Sn + 4Ci = SnCi4
S8 + O2 = SO2S8 + 8O2 = 8SO2
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+O2=SO3SO3 + 0O2 = SO3
Sn(s) + NO3(aq)=SnO2(s) + NO(g)Sn(s) + NO3(aq) = SnO2(s) + NO(g)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrSO4 = SO4 + SrSrSO4 = SO4 + Sr
S + 3F2 = SF6S + 3F2 = SF6
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2 =SO2S + O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
S + 4 Fe+++ + 3 H2O = H2SO3 + 4 Fe++ + 4 H+S + 4Fe+++ + 3H2O = H2SO3 + 4Fe++ + 4H+
S + 4 Fe3+ + 3 H2O = H2SO3 + 4 Fe2+ + 4 H+S - 8Fe3+ + 3H2O = H2SO3 - 12Fe2+ + 4H+
S2+O2=SO3S2 + 3O2 = 2SO3
S+HNO3=H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
Sn(OH)2=Sn+(OH)2Sn(OH)2 = Sn + (OH)2
S+H2O+O2=H2SO42S + 2H2O + 3O2 = 2H2SO4
S(s) + HNO3(aq) = SO3(g) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = SO3(g) + 3H2O(l) + 6NO2(g)
S8+H2+O2= H2SO4S8 + 8H2 + 16O2 = 8H2SO4
SO4+O2+H2O= H2SO42SO4 - O2 + 2H2O = 2H2SO4
S8+Cu=Cu2SS8 + 16Cu = 8Cu2S
S8(s) + O2(g) = SO3(g)S8(s) + 12O2(g) = 8SO3(g)
SO2 + 2Cl2 = SO42- + 4Cl0SO2 + Cl2 = 0SO42- + 2Cl
SnCl2 + K2Cr2O7 + HCl =CrCl3 + KCl + SnCl4 + H2O3SnCl2 + K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
SbCl5 + KI =KCl + I2 + SbCl3 SbCl5 + 2KI = 2KCl + I2 + SbCl3
Si(s) + HF(aq) =SiF4(g) + H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SbCl5 + KI = KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
Sn(NO3)4 + K3PO4 = KNO3 + Sn3(PO4)43Sn(NO3)4 + 4K3PO4 = 12KNO3 + Sn3(PO4)4
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g) Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2(g)+O2(g)=SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnO2+2H2=Sn+2H2OSnO2 + 2H2 = Sn + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiH3+O2=SiO2+H2O4SiH3 + 7O2 = 4SiO2 + 6H2O
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2010Sn + 20HNO3 = 10SnO2 + 20NO2 + H20
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+2HCl=SnCl2+H2Sn + 2HCl = SnCl2 + H2
Si+O2=SiO2Si + O2 = 2SiO
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S+6HNO3= H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO2SO2 + 0O2 = SO2
Si4Cl = Si+ClSi4Cl = 4Si + Cl
SF4+O2=OSF42SF4 + O2 = 2OSF4
Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(l)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(l)
SeO42- + Cl- + H+ = SeO32- + Cl2 + H2O SeO42- + 20Cl- + 20H+ = SeO32- + 10Cl2 + 10H2O
Sb(s) + Cl2(g) = SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO3 + LiOH = Li2SO4 + H2OSO3 + 2LiOH = Li2SO4 + H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S + K2Cr2O7 + H2O = SO2 + KOH + Cr2O33S + 2K2Cr2O7 + 2H2O = 3SO2 + 4KOH + 2Cr2O3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn+4HNO3=SnO2+4NO2+2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2 + KMnO4 + H2O = KHSO4 + H2SO4 + MnSO45SO2 + 2KMnO4 + 2H2O = 2KHSO4 + H2SO4 + 2MnSO4
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SnCl5 + KI = KCl + I2 + SnCl3SnCl5 + 2KI = 2KCl + I2 + SnCl3
Sn + O2 = SnO2Sn + O2 = 2SnO
Sn+O2= SnO2Sn + O2 = 2SnO
SbCl3+HCl+NaBrO3=SbCl5+NaBr+H2O3SbCl3 + 6HCl + NaBrO3 = 3SbCl5 + NaBr + 3H2O
S+O3 = SO23S + 2O3 = 3SO2
SnSO4(s)=SnSO3(s)+O2(g) 2SnSO4(s) = 2SnSO3(s) + O2(g)
SO2  + NaOH = Na2SO3  + H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2+NO2 = 1SO3 + NOSO2 + NO2 = SO3 + NO
SO2+NO = 1SO3 + NO2-1SO2 + NO = -1SO3 + NO2
SO2+NO = SO3 + NO2-1SO2 + NO = -1SO3 + NO2
SO2+NO=SO3 + NO2-1SO2 + NO = -1SO3 + NO2
Sb+ HNO3 +H2O = H(Sb(OH)6) + NO2Sb + 5HNO3 + H2O = H(Sb(OH)6) + 5NO2
SnO2 + H2 = Sn + H2O2SnO2 + H2 = Sn + H2O2
S8(s) +O2(g)= SO3(g) S8(s) + 12O2(g) = 8SO3(g)
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SCl2(l) + NaF(s) = S2Cl2(l) + SF4(g) + NaCl(s)3SCl2(l) + 4NaF(s) = S2Cl2(l) + SF4(g) + 4NaCl(s)
Sb2S3 + HCl = SbCl3 + H2S Sb2S3 + 6HCl = 2SbCl3 + 3H2S
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
SiC + Cl2 =SiCl4 + CSiC + 2Cl2 = SiCl4 + C
Sb2(SO4)3+KMnO4+H2O=H3SbO4+K2SO4+MnSO4+H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SO2 + O2 =SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Sr3P2+(NH4)2CO3=SrCO3+(NH4)3PSr3P2 + 3(NH4)2CO3 = 3SrCO3 + 2(NH4)3P
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
SiO2 + C = Si+ COSiO2 + 2C = Si + 2CO
SrBr2 +(NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SrBr2 +(NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SrBr2 +(NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SO2 + Li2Se = SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+O2=SO2S8 + 8O2 = 8SO2
Sb2S3+O2=Sb4O6+SO22Sb2S3 + 9O2 = Sb4O6 + 6SO2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SnF4+Cr=CrF3+Sn3SnF4 + 4Cr = 4CrF3 + 3Sn
S6+O2=SO2S6 + 6O2 = 6SO2
SnS2+O2=SnO2+SO2SnS2 + 3O2 = SnO2 + 2SO2
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
S + HNO3 =H2SO4 + NOS + 2HNO3 = H2SO4 + 2NO
S2Cl2 + NH3 = S4N4 + S8 + NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiCl4 + H2O = H 4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO4 +NaO = NaO2 + 4 SSO4 + 4NaO = 4NaO2 + S
S8 + 8 O2 =8 SO2S8 + 8O2 = 8SO2
SO3(g)+H2(g)=SO2(g)+H2O(g)SO3(g) + H2(g) = SO2(g) + H2O(g)
Sr(s) + H2O(l) =Sr(OH)2(aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sr(s) + H2O(l) = Sr(OH)2(aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S + 6HNO3 = H2SO4 + 2H2O + 6NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
S8+Cu=Cu2SS8 + 16Cu = 8Cu2S
S8+Cu=Cu2SS8 + 16Cu = 8Cu2S
Sn + O2= Sn O2Sn + O2 = SnO2
S + O2 = S O2S + O2 = SO2
S + O2 = S O32S + 3O2 = 2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2SO4=H2SO40SO3 + H2SO4 = H2SO4
S + HNO3 = H2SO4 + NOS + 2HNO3 = H2SO4 + 2NO
Sr(H2H3O2)2 + Na2SO4 = SrSO4 + 2 Na(H2H3O2)Sr(H2H3O2)2 + Na2SO4 = SrSO4 + 2Na(H2H3O2)
S+O2 =SO32S + 3O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S8 + O2 =SO2S8 + 8O2 = 8SO2
S8 + HNO3 = H2SO4 + 4NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
S8 + HNO3 = H2SO4 + 4NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SbCl3+HCl + NaBrO3=SbCl5+NaBr +H2O3SbCl3 + 6HCl + NaBrO3 = 3SbCl5 + NaBr + 3H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SR+H2S=SRS+H2 SR + H2S = SRS + H2
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H2 + O2 = SiO2 + H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S+HNO3+H+=H2SO3+N2O+H2O-2S - 2HNO3 + 0H+ = -2H2SO3 - N2O + H2O
S+HNO3+H+=H2SO3+N2O+H2O-2S - 2HNO3 + 0H+ = -2H2SO3 - N2O + H2O
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SiO2 + 2Na2SO4 = Si(SO4)2 + 2Na2OSiO2 + 2Na2SO4 = Si(SO4)2 + 2Na2O
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Sc2O3+SO3=Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)= SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sr+O2=2SrO2Sr + O2 = 2SrO
S2032- + I2 = S4062- + I-4062S2032- + 1015I2 = 2032S4062- + 2030I-
S2O3 2- + I2 + H2O = S2O4 2- + I- +H+S2O32- + 10I2 + 10H2O = S2O42- + 20I- + 20H+
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SF4(g)+O2(g)=OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
SO3 + H2O = H2 SO4SO3 + H2O = H2SO4
SO2+ O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2 + HF = H2O + SiF4SiO2 + 4HF = 2H2O + SiF4
SiO2 + HF = H2O + SiF4SiO2 + 4HF = 2H2O + SiF4
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
Sn+O2=SnO2Sn + O2 = 2SnO
Sn+O2=SnO2Sn + O2 = 2SnO
Sb + O2 = Sb4 O64Sb + 3O2 = Sb4O6
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
S + (NO3) = (SO4) + NO2S + 4(NO3) = (SO4) + 4NO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl=SbCl3Sb + 3Cl = SbCl3
Sb+Cl=SbClSb + Cl = SbCl
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+O2=SO3SO3 + 0O2 = SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
SO3+P=P2O5+S5SO3 + 6P = 3P2O5 + 5S
Si(OH)4+ NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
Si(OH)4+ NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO2 (g) + O2 (g) + CaO (s) = CaSO42SO2(g) + O2(g) + 2CaO(s) = 2CaSO4
S + O2 = SO32S + 3O2 = 2SO3
Sb2S3+HCl = SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sb+O2=SbO2Sb + O2 = SbO2
SnO2+ C = Sn + CO2SnO2 + C = Sn + CO2
SnO2+ C = Sn + CO2SnO2 + C = Sn + CO2
SnO2+ C = Sn + CO2SnO2 + C = Sn + CO2
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SCN + H2O + BrO3 = Br + SO4 + HCN6SCN + 3H2O + 7BrO3 = 7Br + 6SO4 + 6HCN
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SiF4(g) =Si(s) +2F2(g)SiF4(g) = Si(s) + 2F2(g)
S+6HNO3= H2SO4+NO2+ H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2S3 + HCl = SbCl3 + H2S Sb2S3 + 6HCl = 2SbCl3 + 3H2S
S8+O2=SO2S8 + 8O2 = 8SO2
SO3=SO2+O22SO3 = 2SO2 + O2
SiH4=Si+H2SiH4 = Si + 2H2
SiH4=Si+H2SiH4 = Si + 2H2
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S8+4O2=8SO2S8 + 8O2 = 8SO2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+ C= SiC+ COSiO2 + 3C = SiC + 2CO
Sn(s) + NaOH(aq) =Na2SnO2(s) + H2(g)Sn(s) + 2NaOH(aq) = Na2SnO2(s) + H2(g)
S+O2=SO32S + 3O2 = 2SO3
Sn(s)+P(s)=Sn3P2(s) 3Sn(s) + 2P(s) = Sn3P2(s)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g) Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2 + Br2 + H2O = SO42- + Br- + H+2SO2 + 79Br2 + 80H2O = 2SO42- + 158Br- + 160H+
SnF4+Cr=CrF3+Sn3SnF4 + 4Cr = 4CrF3 + 3Sn
S8 + NO3 = SO2 + NOS8 + 8NO3 = 8SO2 + 8NO
S8 + Br2 = SBr2S8 + 8Br2 = 8SBr2
S8 + NO2 = SO2 + NOS8 + 16NO2 = 8SO2 + 16NO
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
Sn(ClO3)2 = 3 O2 + SnCl2Sn(ClO3)2 = 3O2 + SnCl2
SO3 + 2HNO3 = 2NO + SO2+ H2O -3SO3 + 2HNO3 = 2NO - 3SO2 + H2O
SnSO4 (aq) + Fe (s) = Sn (s) + Fe(SO4)2 (aq) 2SnSO4(aq) + Fe(s) = 2Sn(s) + Fe(SO4)2(aq)
SnSO4 (aq) + Fe (s) = Sn (s) + FeSO4 (aq) SnSO4(aq) + Fe(s) = Sn(s) + FeSO4(aq)
SiC + CO2 = SiO2 + COSiC + 3CO2 = SiO2 + 4CO
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S+O2=SO2S + O2 = SO2
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+2HNO3+H2O=H2SO4+2NO2SO2 + 2HNO3 + 0H2O = H2SO4 + 2NO2
SeCl6 + O2= SeO2 +Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SCl2 + NaF = SF4 + S2Cl2 + NaCl 3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2 +HNO3 +H20 = H2SO4+NO2SO2 + 2HNO3 + 0H20 = H2SO4 + 2NO2
SO2 +HNO3 = H2SO4 + NO2SO2 + 2HNO3 = H2SO4 + 2NO2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3+HClO3 +H2O = H2SO4 +HCl +H3SbO4 3Sb2S3 + 14HClO3 + 18H2O = 9H2SO4 + 14HCl + 6H3SbO4
SO2 + O2 = 6SO32SO2 + O2 = 2SO3
SO2 + O2 = 6SO32SO2 + O2 = 2SO3
SO2 + O2 = 6SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2 =SO32SO2 + O2 = 2SO3
SiO2 + NaOH = Na2O3Si + H2OSiO2 + 2NaOH = Na2O3Si + H2O
SO4+NH3=SO3+H2O+N23SO4 + 2NH3 = 3SO3 + 3H2O + N2
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO2 + Br2 + 2H2O = H+ + SO42- + Br-2SO2 + 79Br2 + 80H2O = 160H+ + 2SO42- + 158Br-
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SnO3 + H2O = SnO2 + OHSnO3 + H2O = SnO2 + 2OH
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
Sb 2 (SO 4 ) 3 + KMnO 4 + H 2 O = H 3 SbO 4 + K 2 SO 4 + MnSO 4 + H 2 SO 45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SCN- + (NO3)- + H3O+ = NO +SO42- + H2O +CO2SCN- + 30(NO3)- + 30H3O+ = 31NO + SO42- + 45H2O + CO2
Sb(s) + NO3 = (aq) Sb4O6(s) + NO(g)4Sb(s) + 3NO3 = (aq)Sb4O6(s) + 3NO(g)
Sb2S3+HCl= H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sb2S3+HCl= H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S + N2O = SO2 + NS + 2N2O = SO2 + 4N
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S + N2O = SO2 + N2S + 2N2O = SO2 + 2N2
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SiO2 + Na2CO3 = Na2SiO3 + CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
SF4(g)+O2(g)=OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SeO42- + Cl- + H+ = SeO32- + Cl2 + H2O SeO42- + 20Cl- + 20H+ = SeO32- + 10Cl2 + 10H2O
S8+F2 = SF6S8 + 24F2 = 8SF6
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + CL2 = S2CL2S8 + 4CL2 = 4S2CL2
SeO42- + Cl- + H+ = SeO32- + Cl2 + H2OSeO42- + 20Cl- + 20H+ = SeO32- + 10Cl2 + 10H2O
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sn(ClO3)2(aq)=SnCl2(aq)+O2(g)Sn(ClO3)2(aq) = SnCl2(aq) + 3O2(g)
Sr+O2=SrO2Sr + O2 = SrO2
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2(s) + 3 C(s) = SiC(s) + 2 CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO4+NH3=SO3+H2O+N23SO4 + 2NH3 = 3SO3 + 3H2O + N2
S2- + Cl2 = S + Cl-2S2- + Cl2 = 4S + 2Cl-
S2- + Cl2 = S + Cl-2S2- + Cl2 = 4S + 2Cl-
S 2- + Cl2 = S + Cl-2S2- + Cl2 = 4S + 2Cl-
Sn+AgNO3=Ag+SnNO3Sn + AgNO3 = Ag + SnNO3
Sn+NO3+OH=SnO2+NH33Sn + NO3 + 3OH = 3SnO2 + NH3
Sn+NO3+H2O=SnO2+NH39Sn + 4NO3 + 6H2O = 9SnO2 + 4NH3
Sr(NO3)2(aq) + Li2SO4(aq) = SrSO4(s) + 2 LiNO3(aq)Sr(NO3)2(aq) + Li2SO4(aq) = SrSO4(s) + 2LiNO3(aq)
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SiO2 (s) + C (s) = SiC (s) + CO (g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sn+HNO3=SnO2+NO2+H2010Sn + 20HNO3 = 10SnO2 + 20NO2 + H20
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
Sn(s)+Cl2(g) = SnCl4(s)Sn(s) + 2Cl2(g) = SnCl4(s)
Sn(s)+Cl2(g) = SnCl4(s)Sn(s) + 2Cl2(g) = SnCl4(s)
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
Sb2S3 + HNO3 + H2O = H3SbO4 + H2SO4 + NO3Sb2S3 + 28HNO3 + 4H2O = 6H3SbO4 + 9H2SO4 + 28NO
SnCl4 + NaOH = Sn(OH)4 + NaClSnCl4 + 4NaOH = Sn(OH)4 + 4NaCl
S+KClO3=KClO3SS + KClO3 = KClO3S
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.