Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO4+H2S=O2+HSO3SO4 + H2S = -1O2 + 2HSO3
SiI4(s) + H2O(l) = HI(aq) + H2SiO3(s)SiI4(s) + 3H2O(l) = 4HI(aq) + H2SiO3(s)
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SOS8 + 4O2 = 8SO
S8+O2=SO2S8 + 8O2 = 8SO2
SnCl2(aq)+Co(s)=2CoCl+SnSnCl2(aq) + 2Co(s) = 2CoCl + Sn
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiC + 2O2 + 2NaOH = Na2SiO3 + CO2 + H2OSiC + 2O2 + 2NaOH = Na2SiO3 + CO2 + H2O
SO3(l)+ H2O(l) =H2SO4(aq)SO3(l) + H2O(l) = H2SO4(aq)
S+HNO3=H2SO4+NO3+H2O-1S + 6HNO3 = -1H2SO4 + 6NO3 + 4H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
SO2Cl2(I)+ HI(aq) = H2S(g)+H2O(I)+HCl(aq)+I2(s)2SO2Cl2(I) + 16HI(aq) = 2H2S(g) + 4H2O(I) + 4HCl(aq) + 7I2(s)
SO2(g)+H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
Sb+O2=Sb2O34Sb + 3O2 = 2Sb2O3
SO2+KMnO4+H2O=H2O4+MnSO4+K2SO49SO2 + 6KMnO4 + 2H2O = 2H2O4 + 6MnSO4 + 3K2SO4
SO2+Br2+H2O=H2SO4+HBrSO2 + Br2 + 2H2O = H2SO4 + 2HBr
S+O2=SO32S + 3O2 = 2SO3
SO2+Br2+H2O=H2SO4+HBrSO2 + Br2 + 2H2O = H2SO4 + 2HBr
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO3+3H2= Sn+3H2OSnO3 + 3H2 = Sn + 3H2O
SnO3+3H2= Sn+3H2OSnO3 + 3H2 = Sn + 3H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SO3 + Sn(OH)4 = Sn(SO4)2 + H2O2SO3 + Sn(OH)4 = Sn(SO4)2 + 2H2O
SO2 +O2 = SO32SO2 + O2 = 2SO3
SO2 +O2 = SO32SO2 + O2 = 2SO3
SO2 +O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2 = SO32SO2 + O2 = 2SO3
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3 + H3O = H2O + SO2SO3 + 2H3O = 3H2O + SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3+H2O=2H2SO4SO3 + H2O = H2SO4
S + 6HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SO3 = SO2 + O22SO3 = 2SO2 + O2
Sr(HSO3)2 = SrSO3 + SO2 + H2OSr(HSO3)2 = SrSO3 + SO2 + H2O
SO3 + H2O= H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnCl4 + Pb(NO3)2 = Sn(NO3)4 + PbCl2SnCl4 + 2Pb(NO3)2 = Sn(NO3)4 + 2PbCl2
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SrCl2 + LiPO4 = SrPO4 +LiCl2SrCl2 + LiPO4 = SrPO4 + LiCl2
S02(g)+O2(g)+H2O(l)=H2SO4S02(g) + 3O2(g) + 2H2O(l) = 2H2SO4
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S + HNO3= H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(s) + 4 HNO3(aq) = SnO2(s) + 4 NO2(g) + 2 H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S+O2=SO32S + 3O2 = 2SO3
S+NO3= NO+SS + 0NO3 = 0NO + S
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S8 (g) + O2 (g) = SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sr(OH)2+BaCl2=Ba(OH)2+SrCl2Sr(OH)2 + BaCl2 = Ba(OH)2 + SrCl2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S(s)+HNO3(aq)=H2SO4(aq)+H2O(l)+NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SiF4+NaOH=Na4SiO4+NaF+H2OSiF4 + 8NaOH = Na4SiO4 + 4NaF + 4H2O
Sb2O3 + HF = SbF3 + H2OSb2O3 + 6HF = 2SbF3 + 3H2O
Sb2S3 + HF = SbF3 + H2SSb2S3 + 6HF = 2SbF3 + 3H2S
SnCl4 + C2O4 = Sn(C2O4) + ClSnCl4 + C2O4 = Sn(C2O4) + 4Cl
S + 6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnCl4 + FeCl2 = SnCl2 + FeCl3 SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
SnCl4 + FeCl2 = SnCl2 + FeCl3 SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
SnCl4 + FeCl2 = SnCl2 + FeCl3 SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
S+HNO3 = H2SO4 + NO2+ H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + H2O= H2SO3SO2 + H2O = H2SO3
S8 + Cl2= S2Cl2S8 + 4Cl2 = 4S2Cl2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S2Cl2 + NH3 = S4N4 + S8 + NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
SnCl 4 + NH 3 = SnCl 3 + HCl + N 26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+ NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SnO2 + 2H2= Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S2Cl2 + NH3 = S4N4 + S8 + NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
SO2  +  O2  =  SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3 =H2SO4 +NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3 =H2SO4 +NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+O2=SO32S + 3O2 = 2SO3
SnSO4 + NaOH= Sn(OH)2 + Na2SO4SnSO4 + 2NaOH = Sn(OH)2 + Na2SO4
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+H2O=SiO2+H2O0Si4H10 + H2O = 0SiO2 + H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3 = H2SO4 + NO2 +H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Se+ HNO3 = SeO2 + NO+ H2O 3Se + 4HNO3 = 3SeO2 + 4NO + 2H2O
S+6NHO3=H2SO4+NO2+H2OS + 6NHO3 = H2SO4 + 6NO2 + 2H2O
SiO2(s) + CO(s) = Si(s) + CO2(g)SiO2(s) + 2CO(s) = Si(s) + 2CO2(g)
SiO2(s) + 2C(s) = SiC(s) + CO2(g)SiO2(s) + 2C(s) = SiC(s) + CO2(g)
SiO2(s) + 2C(s) = SiC(s) + CO2(g)SiO2(s) + 2C(s) = SiC(s) + CO2(g)
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+N2O=SO2+N2S + 2N2O = SO2 + 2N2
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SiO2+ C =Si + COSiO2 + 2C = Si + 2CO
SO2(g) + H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
Sn+HCl+H2O=H2+Sn(ClO3)2Sn + 2HCl + 6H2O = 7H2 + Sn(ClO3)2
SrCO3+Mn2O3=SrMnO3+C2O32SrCO3 + Mn2O3 = 2SrMnO3 + C2O3
SrCO3+MnO2=SrMnO3+CO2SrCO3 + MnO2 = SrMnO3 + CO2
SrCO3+MnO2=SrMnO3+CO2SrCO3 + MnO2 = SrMnO3 + CO2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
SO2+H2S = H2O+SSO2 + 2H2S = 2H2O + 3S
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
S2Cl6+4H2O=SO2+HCl+H2S2Cl6 + 4H2O = 2SO2 + 6HCl + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sb(s) + O2(g) = Sb2O54Sb(s) + 5O2(g) = 2Sb2O5
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SnCl2 + Co = Sn + CoCl2SnCl2 + Co = Sn + CoCl2
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S + O2 = SO32S + 3O2 = 2SO3
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
S+6HNO3 =H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
S(s) + O2(g) =SO2(g)S(s) + O2(g) = SO2(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH =Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn+S=SnSSn + S = SnS
S(s)+O2(g)= SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2= SO3(g)2S(s) + 3O2 = 2SO3(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SbCl3+HCl+NaBrO3=SbCl5+NaBr+H2O3SbCl3 + 6HCl + NaBrO3 = 3SbCl5 + NaBr + 3H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+ H2O = H2SO3 SO2 + H2O = H2SO3
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn+HNO=SnO2+NO2+H2O-3Sn + 4HNO = -3SnO2 + 4NO2 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
S + O2 = SO2S + O2 = SO2
Sn+4HCl = SnCl4+H2Sn + 4HCl = SnCl4 + 2H2
Sn + 2KOH = K2SnO2 + 2H2Sn + 2KOH = K2SnO2 + H2
S+O2=SO2S + O2 = SO2
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SrSO3 + HNO3 = SO2 + H2O +Sr(NO3)2SrSO3 + 2HNO3 = SO2 + H2O + Sr(NO3)2
SO2 + HNO3 +H2O = NO + H2SO43SO2 + 2HNO3 + 2H2O = 2NO + 3H2SO4
SO2 + HNO3 +H2O = NO2 + H2SO4SO2 + 2HNO3 + 0H2O = 2NO2 + H2SO4
S+O-O2=-SO3S + O-O2 = -SO3
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2+HS=S+H2OSO2 + 4HS = 5S + 2H2O
Sb+O2=Sb2O54Sb + 5O2 = 2Sb2O5
Sb+O2=Sb2O54Sb + 5O2 = 2Sb2O5
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2+O2 = SO32SO2 + O2 = 2SO3
Sn(s)+ HNO 3 (aq)=SnO 2 (s)+ NO 2 (g)+ H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb2S3 + HCl = SbCl3 + H2S Sb2S3 + 6HCl = 2SbCl3 + 3H2S
SO2+NO2+H2O=H2SO4+NOSO2 + NO2 + H2O = H2SO4 + NO
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8 + Br2 + KF = SF4 + KBrS8 + 16Br2 + 32KF = 8SF4 + 32KBr
S + Br2 + KF = KBr + SF4S + 2Br2 + 4KF = 4KBr + SF4
Sb + HBr = SbBr2 +H2Sb + 2HBr = SbBr2 + H2
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2+H2O2+NaOH=Na2SO4+H2OSO2 + H2O2 + 2NaOH = Na2SO4 + 2H2O
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sr(OH)2+2HNO3=Sr(NO3)2+2H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
SnS2 + HNO3 = SnO2 + H2SO4 + NO2 + H2OSnS2 + 16HNO3 = SnO2 + 2H2SO4 + 16NO2 + 6H2O
SnS2 + 4 HNO3 = 2 H2S + Sn(NO3)4 SnS2 + 4HNO3 = 2H2S + Sn(NO3)4
S b 2 S 3 (s)+HCl(aq)=SbC l 3 (aq)+ H 2 S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sb2S3+O2--+H2O-=Sb(OH)6-+SO4--+OH-0Sb2S3 + O2-- + 2H2O- = 0Sb(OH)6- + 0SO4-- + 4OH-
Sb2S3+O2--+OH-=Sb(OH)6-+SO4--+H2O-1Sb2S3 - 14O2-- + 20OH- = -2Sb(OH)6- - 3SO4-- + 16H2O
Sb2S3+H2O2+OH-=Sb(OH)6-+SO4--+H2OSb2S3 + 14H2O2 + 8OH- = 2Sb(OH)6- + 3SO4-- + 12H2O
S+6HNO3 = 2H2SO4+6NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+6HNO3 = 2H2SO4+6NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3 = H2S04 + 6NO2 +H20-40S + 0HNO3 = -10H2S04 + 0NO2 + H20
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SrI2+CaSO4=SrSO4+CaI2SrI2 + CaSO4 = SrSO4 + CaI2
Sr(NO3)2 = SrO + NO2 + O22Sr(NO3)2 = 2SrO + 4NO2 + O2
SiCl4(l) + Na(s) = Si(s) + NaCl(s) SiCl4(l) + 4Na(s) = Si(s) + 4NaCl(s)
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn(CH3COO)4 + Zn = Zn(CH3COO)4 + SnSn(CH3COO)4 + Zn = Zn(CH3COO)4 + Sn
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn+HNO3=Sn(NO3)2+NH4NO3+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
SnCl2+HNO3+HCl=SnCl4+N2O+H2O4SnCl2 + 2HNO3 + 8HCl = 4SnCl4 + N2O + 5H2O
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S2O3+H+=H2O+S+SO2(g)2S2O3 + 0H+ = 0H2O + S + 3SO2(g)
S2O3+H+=H2O+S+SO2(g)2S2O3 + 0H+ = 0H2O + S + 3SO2(g)
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Si4H10(l) + O2(g) = SiO2(s) + H20(l)2Si4H10(l) + 8O2(g) = 8SiO2(s) + H20(l)
Si4H10(l) + O2(g) = SiO2(s) + H202Si4H10(l) + 8O2(g) = 8SiO2(s) + H20
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn + 4HNO3 =SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + 2Li2Se =SSe2 + 2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2 + 2Li2Se=SSe2 + 2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SCl2 + NaF = SF4 + S2Cl2 + NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
Sr(OH)2 + 2HBr = H2O + SrBr2Sr(OH)2 + 2HBr = 2H2O + SrBr2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + HNO3 = H2SnO3 + NO + O22Sn + 4HNO3 = 2H2SnO3 + 4NO + O2
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2Cl2+H2O=H2SO4+HClSO2Cl2 + 2H2O = H2SO4 + 2HCl
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Sb2S3 +HCl =H3SbCl6 +H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO3 + H2O= H2SO4SO3 + H2O = H2SO4
SO3 + H2O= H2SO4SO3 + H2O = H2SO4
Sn2+ + Cl- + As3+= As + SnCl6Sn2+ + 12Cl- + 11As3+ = 33As + 2SnCl6
Sn2+ + Cl- + As3+= As + SnCl62-Sn2+ + 124Cl- + 121As3+ = 363As + 2SnCl62-
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sn + 4HNO3 = SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb2S3(s) + O2(g) = Sb4O6(s) + SO2(g)2Sb2S3(s) + 9O2(g) = Sb4O6(s) + 6SO2(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + HNO3 = SnO2 + NO3 + 2H2O-1Sn + 4HNO3 = -1SnO2 + 4NO3 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S2+O2=SO2S2 + 2O2 = 2SO2
SnCl2+HCl+O3=SnCl4+H2O3SnCl2 + 6HCl + O3 = 3SnCl4 + 3H2O
Sh+Cl2=ShCl32Sh + 3Cl2 = 2ShCl3
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + NaOH = Na2SnO2 + H2=Sn + 2NaOH = Na2SnO2 + H2
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SiO2(s)+C(s)=SiC(s)+CO(g) SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4(s) + H2O(g) = SiO2(s) + HCl(g)SiCl4(s) + 2H2O(g) = SiO2(s) + 4HCl(g)
SiCl4(s) + H2O(g) = SiO2(s) + HCl(g)SiCl4(s) + 2H2O(g) = SiO2(s) + 4HCl(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
S+6HNO3 = H2SO4 + 6NO2 + 2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3= H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + 6HNO3= H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+CO=SO2+CS + 2CO = SO2 + 2C
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sc + F2= ScF2Sc + F2 = ScF2
Sc + F2= ScF2Sc + F2 = ScF2
Sc + F2= ScF2Sc + F2 = ScF2
Sc + F2= ScF2Sc + F2 = ScF2
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO + H2SO4 = SiO2 + SO2 + H2OSiO + H2SO4 = SiO2 + SO2 + H2O
S2O3 + O2 = SO42S2O3 + 5O2 = 4SO4
S+6HNO3 = H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S8+KF+Br2=KBr+SF4S8 + 32KF + 16Br2 = 32KBr + 8SF4
Sn(s)+AgNO3(aq)=SnNO3(aq)+Ag(s)Sn(s) + AgNO3(aq) = SnNO3(aq) + Ag(s)
Sn(s)+AgNO3(aq)=SnNO3(aq)+Ag(s)Sn(s) + AgNO3(aq) = SnNO3(aq) + Ag(s)
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2+O2=SO32SO2 + O2 = 2SO3
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SC2H6 + O2 = SO2 + CO2 + H2010SC2H6 + 30O2 = 10SO2 + 20CO2 + 3H20
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = SO3 + NO + H2OS + 2HNO3 = SO3 + 2NO + H2O
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
S8+O2=SO3S8 + 12O2 = 8SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn+HNO3=SnO2+NO2+H2010Sn + 20HNO3 = 10SnO2 + 20NO2 + H20
Si4H10(l) + O2(g) = SiO2(s) +H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sr3(PO4)2 = Sr + PO4Sr3(PO4)2 = 3Sr + 2PO4
SO2+O2=SO32SO2 + O2 = 2SO3
S2O3 + NH2Cl + H2O = SO4 + H+ + HCl + NH3S2O3 + 5NH2Cl + 5H2O = 2SO4 + 0H+ + 5HCl + 5NH3
S2O3 + NH2Cl + H2O = SO4 + H+ + HCl + NH3S2O3 + 5NH2Cl + 5H2O = 2SO4 + 0H+ + 5HCl + 5NH3
S + O2 = SO32S + 3O2 = 2SO3
Sn+HNO3=SnO2+H2O+NO2Sn + 4HNO3 = SnO2 + 2H2O + 4NO2
SiF4+H2O=HF+SiO2SiF4 + 2H2O = 4HF + SiO2
S (s) + CO (g)= SO2 (g) + C (s)S(s) + 2CO(g) = SO2(g) + 2C(s)
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sn + 2H2SO4 = SnSO4 + SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S+HNO3=SO3+NO2+H2OS + 6HNO3 = SO3 + 6NO2 + 3H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + 6HNO3 = H2SO4 +NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SiO2(s) + C(s) = Si(s) + CO(g)SiO2(s) + 2C(s) = Si(s) + 2CO(g)
SO3(g)+H2O(l)=H2SO4(l)SO3(g) + H2O(l) = H2SO4(l)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(NO3)2 = Sr++ + NO3-Sr(NO3)2 = Sr++ + 2NO3-
S2O3+CL2+H2O=HSO4+CL+HS2O3 + 0CL2 + 5H2O = 2HSO4 + 0CL + 8H
S+6HNO3= H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3= H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2 + H2O = H4SiO4SiO2 + 2H2O = H4SiO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S = S88S = S8
S (s) + HNO3 (aq) = H2SO4 (aq) + NO2 (g) + H2O (g)S(s) + 6HNO3(aq) = H2SO4(aq) + 6NO2(g) + 2H2O(g)
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Sn+Cl2=SnCl4Sn + 2Cl2 = SnCl4
SnO2+ C=Sn+COSnO2 + 2C = Sn + 2CO
SO2+O2+4H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SiCl4 (l) + H2O(l) = SiO2 (s) + HCl (aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
S+6HNO3=H2SO4+N6O2+2H2O6S + 6HNO3 = H2SO4 + N6O2 + 2H2O6
S+6HNO3=H2SO4+N6O2+2H2O6S + 6HNO3 = H2SO4 + N6O2 + 2H2O6
SO2+O2 = SO32SO2 + O2 = 2SO3
Sr(OH)2+2H2CO3=SrCO3+H2OSr(OH)2 + H2CO3 = SrCO3 + 2H2O
Sr(OH)2+2H2CO3=SrCO3+H2OSr(OH)2 + H2CO3 = SrCO3 + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnCl4+(NH4)3PO4=Sn3(PO4)4+NH4Cl3SnCl4 + 4(NH4)3PO4 = Sn3(PO4)4 + 12NH4Cl
Sc2O3+SO3=Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2S3(s)+HCl(aq) = SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S2O3 2- + Cl2 + H2O =HSO4 1- + Cl1- + H +2S2O32- + 97Cl2 + 100H2O = 4HSO41- + 194Cl1- + 196H+
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+ 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SCl4 + H2O=SO2+ HClSCl4 + 2H2O = SO2 + 4HCl
S+6HNO3=2H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnCl4 + NH3= SnCl3+ HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO2 + OH- = (SO4)2- + (HS)- + H2O19SO2 + 13OH- = 6(SO4)2- + 7(HS)- + 3H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb + HNO3 = Sb2O5 + H2O + NO6Sb + 10HNO3 = 3Sb2O5 + 5H2O + 10NO
ScF3 + Na2S =Sc2S3 +NaF2ScF3 + 3Na2S = Sc2S3 + 6NaF
SO2 + H2O =H2SO3SO2 + H2O = H2SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S + 6HNO2=H2SO4 + NO2 +H200S + 20HNO2 = 0H2SO4 + 20NO2 + H20
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=3H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Sn(NO3)2 (aq) + 2LiOH (aq) = Sn(OH)2 + 2LiNO3Sn(NO3)2(aq) + 2LiOH(aq) = Sn(OH)2 + 2LiNO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3+2H=SO2+H2OSO3 + 2H = SO2 + H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+6(HNO3)=H2SO4+NO2+H2OS + 6(HNO3) = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+6(HNO3)=H2SO4+NO2+H2010S + 40(HNO3) = 10H2SO4 + 40NO2 + H20
SO2+Na2Cr2O7+H2SO4=Na2SO4+Cr2(SO4)3+H2O 3SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb2O5 + HI = Sb2O3 + H2O + ISb2O5 + 4HI = Sb2O3 + 2H2O + 4I
SCl4 + H2O = SO2 + HClSCl4 + 2H2O = SO2 + 4HCl
SF4+ H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
S+O2=SO32S + 3O2 = 2SO3
SnCl2+I2+HCl=SnCl4+HISnCl2 + I2 + 2HCl = SnCl4 + 2HI
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S8 + F2 = SF6S8 + 24F2 = 8SF6
S + 6HNO3 = H2SO4 + NO2 +H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10+O2(g)=SiO2(s)+H2O(l)2Si4H10 + 13O2(g) = 8SiO2(s) + 10H2O(l)
SO3+NH3= NO+SO2+H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
Sn + Zn(NO3)2 = Sn(NO3)4 + ZnSn + 2Zn(NO3)2 = Sn(NO3)4 + 2Zn
Sn + Zn(NO3)2 = Sn(NO3)4 + ZnSn + 2Zn(NO3)2 = Sn(NO3)4 + 2Zn
SO3 + NH3 = NO + SO2 + H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S2O3 + Cl2 + H2O =HSO4 + Cl1- + HS2O3 + 0Cl2 + 5H2O = 2HSO4 + 0Cl1- + 8H
Sn3(OH)4(NO3)2= SnO2+NO+H2OSn3(OH)4(NO3)2 = 3SnO2 + 2NO + 2H2O
Sr(OH)2+HNO3=Sr(NO3)2+HOHSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2HOH
SF4 + 3 H2O = H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
SO3 + NH3 = NO + SO2 + H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
SO2(g)+O2(g)+H2O(l) = H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
S8 + H2O2 = H2SO4 + H2OS8 + 24H2O2 = 8H2SO4 + 16H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SeO3 + Ni = SeO4 + Ni 0SeO3 + Ni = 0SeO4 + Ni
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SnCl4 + ZnS = SnS+ Cl4ZnSnCl4 + ZnS = SnS + Cl4Zn
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3+NH3=NO+SO2+H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SO3 + 2H2O= H2SO4SO3 + H2O = H2SO4
SO3 + 2H2O= H2SO4SO3 + H2O = H2SO4
S + O2 = SO2S + O2 = SO2
S+O2=SO32S + 3O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SiO2 +HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2(g)+O2(g)+H2O(l)=H2SO4(aq) 2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O=SO3SO2 + O = SO3
SnCl2+2NaOH=Sn(OH)2+2NaClSnCl2 + 2NaOH = Sn(OH)2 + 2NaCl
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SFe+O2=Fe2O3+SO24SFe + 7O2 = 2Fe2O3 + 4SO2
Si + 4HNO3 + 4HCl = SiCl4 + 4NO + 4H2O3Si + 4HNO3 + 12HCl = 3SiCl4 + 4NO + 8H2O
Si + 4HNO3 + 4HCl = SiCl4 + 4NO + 4H2O3Si + 4HNO3 + 12HCl = 3SiCl4 + 4NO + 8H2O
Si + 4HNO3 + 4HCl = SiCl4 + 4NO2 + 4H2OSi + 4HNO3 + 4HCl = SiCl4 + 4NO2 + 4H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2+HCl(aq)=SiCl4+H2OSiO2 + 4HCl(aq) = SiCl4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S + NaOH = Na2S + Na2SO4 + H2O4S + 8NaOH = 3Na2S + Na2SO4 + 4H2O
Si4H10+O2 = Si4O2+H2O2Si4H10 + 7O2 = 2Si4O2 + 10H2O
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
SeO2+O2 = SeO32SeO2 + O2 = 2SeO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SnS2 + HCl = H2SnCl6 + H2S SnS2 + 6HCl = H2SnCl6 + 2H2S
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SnS2 + HCl = H2SnCl6 + H2S SnS2 + 6HCl = H2SnCl6 + 2H2S
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SiO2 + C =SiC + COSiO2 + 3C = SiC + 2CO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.