Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S8 + O2 =SO2S8 + 8O2 = 8SO2
S8 + HNO3 = H2SO4 + 4NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
S8 + HNO3 = H2SO4 + 4NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SbCl3+HCl + NaBrO3=SbCl5+NaBr +H2O3SbCl3 + 6HCl + NaBrO3 = 3SbCl5 + NaBr + 3H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SR+H2S=SRS+H2 SR + H2S = SRS + H2
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H2 + O2 = SiO2 + H2O2Si2H2 + 5O2 = 4SiO2 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S+HNO3+H+=H2SO3+N2O+H2O-2S - 2HNO3 + 0H+ = -2H2SO3 - N2O + H2O
S+HNO3+H+=H2SO3+N2O+H2O-2S - 2HNO3 + 0H+ = -2H2SO3 - N2O + H2O
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SiO2 + 2Na2SO4 = Si(SO4)2 + 2Na2OSiO2 + 2Na2SO4 = Si(SO4)2 + 2Na2O
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Sc2O3+SO3=Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)= SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sr+O2=2SrO2Sr + O2 = 2SrO
S2032- + I2 = S4062- + I-4062S2032- + 1015I2 = 2032S4062- + 2030I-
S2O3 2- + I2 + H2O = S2O4 2- + I- +H+S2O32- + 10I2 + 10H2O = S2O42- + 20I- + 20H+
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SF4(g)+O2(g)=OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
SO3 + H2O = H2 SO4SO3 + H2O = H2SO4
SO2+ O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2 + HF = H2O + SiF4SiO2 + 4HF = 2H2O + SiF4
SiO2 + HF = H2O + SiF4SiO2 + 4HF = 2H2O + SiF4
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
Sn+O2=SnO2Sn + O2 = 2SnO
Sn+O2=SnO2Sn + O2 = 2SnO
Sb + O2 = Sb4 O64Sb + 3O2 = Sb4O6
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
S + (NO3) = (SO4) + NO2S + 4(NO3) = (SO4) + 4NO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb+Cl=SbCl3Sb + 3Cl = SbCl3
Sb+Cl=SbClSb + Cl = SbCl
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+O2=SO3SO3 + 0O2 = SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
SO3+P=P2O5+S5SO3 + 6P = 3P2O5 + 5S
Si(OH)4+ NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
Si(OH)4+ NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO2 (g) + O2 (g) + CaO (s) = CaSO42SO2(g) + O2(g) + 2CaO(s) = 2CaSO4
S + O2 = SO32S + 3O2 = 2SO3
Sb2S3+HCl = SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sb+O2=SbO2Sb + O2 = SbO2
SnO2+ C = Sn + CO2SnO2 + C = Sn + CO2
SnO2+ C = Sn + CO2SnO2 + C = Sn + CO2
SnO2+ C = Sn + CO2SnO2 + C = Sn + CO2
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SCN + H2O + BrO3 = Br + SO4 + HCN6SCN + 3H2O + 7BrO3 = 7Br + 6SO4 + 6HCN
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SiF4(g) =Si(s) +2F2(g)SiF4(g) = Si(s) + 2F2(g)
S+6HNO3= H2SO4+NO2+ H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2S3 + HCl = SbCl3 + H2S Sb2S3 + 6HCl = 2SbCl3 + 3H2S
S8+O2=SO2S8 + 8O2 = 8SO2
SO3=SO2+O22SO3 = 2SO2 + O2
SiH4=Si+H2SiH4 = Si + 2H2
SiH4=Si+H2SiH4 = Si + 2H2
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S8+4O2=8SO2S8 + 8O2 = 8SO2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+ C= SiC+ COSiO2 + 3C = SiC + 2CO
Sn(s) + NaOH(aq) =Na2SnO2(s) + H2(g)Sn(s) + 2NaOH(aq) = Na2SnO2(s) + H2(g)
S+O2=SO32S + 3O2 = 2SO3
Sn(s)+P(s)=Sn3P2(s) 3Sn(s) + 2P(s) = Sn3P2(s)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g) Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2 + Br2 + H2O = SO42- + Br- + H+2SO2 + 79Br2 + 80H2O = 2SO42- + 158Br- + 160H+
SnF4+Cr=CrF3+Sn3SnF4 + 4Cr = 4CrF3 + 3Sn
S8 + NO3 = SO2 + NOS8 + 8NO3 = 8SO2 + 8NO
S8 + Br2 = SBr2S8 + 8Br2 = 8SBr2
S8 + NO2 = SO2 + NOS8 + 16NO2 = 8SO2 + 16NO
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
Sn(ClO3)2 = 3 O2 + SnCl2Sn(ClO3)2 = 3O2 + SnCl2
SO3 + 2HNO3 = 2NO + SO2+ H2O -3SO3 + 2HNO3 = 2NO - 3SO2 + H2O
SnSO4 (aq) + Fe (s) = Sn (s) + Fe(SO4)2 (aq) 2SnSO4(aq) + Fe(s) = 2Sn(s) + Fe(SO4)2(aq)
SnSO4 (aq) + Fe (s) = Sn (s) + FeSO4 (aq) SnSO4(aq) + Fe(s) = Sn(s) + FeSO4(aq)
SiC + CO2 = SiO2 + COSiC + 3CO2 = SiO2 + 4CO
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
S+O2=SO2S + O2 = SO2
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+2HNO3+H2O=H2SO4+2NO2SO2 + 2HNO3 + 0H2O = H2SO4 + 2NO2
SeCl6 + O2= SeO2 +Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SCl2 + NaF = SF4 + S2Cl2 + NaCl 3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2 +HNO3 +H20 = H2SO4+NO2SO2 + 2HNO3 + 0H20 = H2SO4 + 2NO2
SO2 +HNO3 = H2SO4 + NO2SO2 + 2HNO3 = H2SO4 + 2NO2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3+HClO3 +H2O = H2SO4 +HCl +H3SbO4 3Sb2S3 + 14HClO3 + 18H2O = 9H2SO4 + 14HCl + 6H3SbO4
SO2 + O2 = 6SO32SO2 + O2 = 2SO3
SO2 + O2 = 6SO32SO2 + O2 = 2SO3
SO2 + O2 = 6SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = 32SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2 =SO32SO2 + O2 = 2SO3
SiO2 + NaOH = Na2O3Si + H2OSiO2 + 2NaOH = Na2O3Si + H2O
SO4+NH3=SO3+H2O+N23SO4 + 2NH3 = 3SO3 + 3H2O + N2
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO2 + Br2 + 2H2O = H+ + SO42- + Br-2SO2 + 79Br2 + 80H2O = 160H+ + 2SO42- + 158Br-
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SnO3 + H2O = SnO2 + OHSnO3 + H2O = SnO2 + 2OH
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
Sb 2 (SO 4 ) 3 + KMnO 4 + H 2 O = H 3 SbO 4 + K 2 SO 4 + MnSO 4 + H 2 SO 45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + HNO3 = NO2 + H2SO4 + H2OS + 6HNO3 = 6NO2 + H2SO4 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SCN- + (NO3)- + H3O+ = NO +SO42- + H2O +CO2SCN- + 30(NO3)- + 30H3O+ = 31NO + SO42- + 45H2O + CO2
Sb(s) + NO3 = (aq) Sb4O6(s) + NO(g)4Sb(s) + 3NO3 = (aq)Sb4O6(s) + 3NO(g)
Sb2S3+HCl= H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sb2S3+HCl= H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S + N2O = SO2 + NS + 2N2O = SO2 + 4N
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S + N2O = SO2 + N2S + 2N2O = SO2 + 2N2
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SiO2 + Na2CO3 = Na2SiO3 + CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
SF4(g)+O2(g)=OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SeO42- + Cl- + H+ = SeO32- + Cl2 + H2O SeO42- + 20Cl- + 20H+ = SeO32- + 10Cl2 + 10H2O
S8+F2 = SF6S8 + 24F2 = 8SF6
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + CL2 = S2CL2S8 + 4CL2 = 4S2CL2
SeO42- + Cl- + H+ = SeO32- + Cl2 + H2OSeO42- + 20Cl- + 20H+ = SeO32- + 10Cl2 + 10H2O
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sn(ClO3)2(aq)=SnCl2(aq)+O2(g)Sn(ClO3)2(aq) = SnCl2(aq) + 3O2(g)
Sr+O2=SrO2Sr + O2 = SrO2
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2(s) + 3 C(s) = SiC(s) + 2 CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO4+NH3=SO3+H2O+N23SO4 + 2NH3 = 3SO3 + 3H2O + N2
S2- + Cl2 = S + Cl-2S2- + Cl2 = 4S + 2Cl-
S2- + Cl2 = S + Cl-2S2- + Cl2 = 4S + 2Cl-
S 2- + Cl2 = S + Cl-2S2- + Cl2 = 4S + 2Cl-
Sn+AgNO3=Ag+SnNO3Sn + AgNO3 = Ag + SnNO3
Sn+NO3+OH=SnO2+NH33Sn + NO3 + 3OH = 3SnO2 + NH3
Sn+NO3+H2O=SnO2+NH39Sn + 4NO3 + 6H2O = 9SnO2 + 4NH3
Sr(NO3)2(aq) + Li2SO4(aq) = SrSO4(s) + 2 LiNO3(aq)Sr(NO3)2(aq) + Li2SO4(aq) = SrSO4(s) + 2LiNO3(aq)
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SiO2 (s) + C (s) = SiC (s) + CO (g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sn+HNO3=SnO2+NO2+H2010Sn + 20HNO3 = 10SnO2 + 20NO2 + H20
Sr + H2O = Sr(OH)2 + H2Sr + 2H2O = Sr(OH)2 + H2
Sn(s)+Cl2(g) = SnCl4(s)Sn(s) + 2Cl2(g) = SnCl4(s)
Sn(s)+Cl2(g) = SnCl4(s)Sn(s) + 2Cl2(g) = SnCl4(s)
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
Sb2S3 + HNO3 + H2O = H3SbO4 + H2SO4 + NO3Sb2S3 + 28HNO3 + 4H2O = 6H3SbO4 + 9H2SO4 + 28NO
SnCl4 + NaOH = Sn(OH)4 + NaClSnCl4 + 4NaOH = Sn(OH)4 + 4NaCl
S+KClO3=KClO3SS + KClO3 = KClO3S
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
Sn3(SO4)4+NH4OH=(NH4)3SO4+Sn(OH)4Sn3(SO4)4 + 12NH4OH = 4(NH4)3SO4 + 3Sn(OH)4
S(s)+O2(g)=SO2S(s) + O2(g) = 2SO
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SiI4(g)=Si(s)+I2(g)SiI4(g) = Si(s) + 2I2(g)
Sn + HNO3 = H2SnO3 + NO2+ H2OSn + 4HNO3 = H2SnO3 + 4NO2 + H2O
Sn + HNO3 = H2SnO3 + NO3+ H2O-1Sn + 4HNO3 = -1H2SnO3 + 4NO3 + 3H2O
S + 3Cl2 = SCl6S + 3Cl2 = SCl6
Sn + HNO3 = Sn(NO3)2 + NH4NO3+ H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
S + Fe3O4 = FeS2 + O26S + Fe3O4 = 3FeS2 + 2O2
S + O2 = SO32S + 3O2 = 2SO3
S8 + F2= SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2S= S +H2OSO2 + 2H2S = 3S + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SiC + KOH + H2O = K2SiO3 + K2CO3 + H2 SiC + 4KOH + 2H2O = K2SiO3 + K2CO3 + 4H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2= SO3S8 + 12O2 = 8SO3
SiO2 + Mg = Si + MgOSiO2 + 2Mg = Si + 2MgO
SiO2 + Mg = Si + MgOSiO2 + 2Mg = Si + 2MgO
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + Fe3O4 = FeS2 + O26S + Fe3O4 = 3FeS2 + 2O2
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2 + H2=Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2H2=Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2=Sn + H2OSnO2 + 2H2 = Sn + 2H2O
S+Hg=HgSS + Hg = HgS
Sn+O2=SnO2Sn + O2 = 2SnO
S+Cu=CuSS + Cu = CuS
S+Fe=FeSS + Fe = FeS
SO3+H=HSO3SO3 + H = HSO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + HNO3 = SO3 + H2O + NO2S + 6HNO3 = SO3 + 3H2O + 6NO2
S + HNO3 = SO3 + H2O + NO2S + 6HNO3 = SO3 + 3H2O + 6NO2
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SrO + 2Al = Sr + Al2O33SrO + 2Al = 3Sr + Al2O3
SO2+I2+H2O=H2SO4+HISO2 + I2 + 2H2O = H2SO4 + 2HI
SO2+I2+H2O=H2SO4+HISO2 + I2 + 2H2O = H2SO4 + 2HI
SiC + KOH + H2O = K2SiO3 + K2CO3 + H2 SiC + 4KOH + 2H2O = K2SiO3 + K2CO3 + 4H2
S8 + F2= SF6S8 + 24F2 = 8SF6
S + HNO3 = SO3 + H2O + NO2S + 6HNO3 = SO3 + 3H2O + 6NO2
S + 6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
S + Fe3O4 = FeS2 + O26S + Fe3O4 = 3FeS2 + 2O2
S8+O2=SO3S8 + 12O2 = 8SO3
S + Fe3O4 = FeS2 + O26S + Fe3O4 = 3FeS2 + 2O2
Sn(s) + NaOH(aq) = Na2SnO2(s) + H2(g)Sn(s) + 2NaOH(aq) = Na2SnO2(s) + H2(g)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S(s)+O2(g)=SO2S(s) + O2(g) = SO2
S(s)+O2(g)=SO2S(s) + O2(g) = 2SO
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2(g)+Br2(l)+H2O(l)=HBr(aq)+H2SO4(aq)SO2(g) + Br2(l) + 2H2O(l) = 2HBr(aq) + H2SO4(aq)
SO2(g)Br2(l)+H2O(l)=HBr(aq)+H2SO4(aq)SO2(g)Br2(l) + 2H2O(l) = 2HBr(aq) + H2SO4(aq)
SO3 + KOH = K2SO4 + H2OSO3 + 2KOH = K2SO4 + H2O
SnCl2 + O2 = SnO +ClO22SnCl2 + 5O2 = 2SnO + 4ClO2
Sn + HNO3 = Sn(NO3)2 + H2O + NH4NO34Sn + 10HNO3 = 4Sn(NO3)2 + 3H2O + NH4NO3
Sn + HNO3 = Sn(NO3)2 + H2O + NH4NO34Sn + 10HNO3 = 4Sn(NO3)2 + 3H2O + NH4NO3
S(s)+6HNO3(aq)=H2SO4(aq)+6NO2(g)+2H2O(l)S(s) + 6HNO3(aq) = H2SO4(aq) + 6NO2(g) + 2H2O(l)
SO2 +O2 = SO32SO2 + O2 = 2SO3
SiO2 + C = SiC +COSiO2 + 3C = SiC + 2CO
Si+NO3=NO2+SiO3Si + 3NO3 = 3NO2 + SiO3
SrBr2 + F2 = SrF2 +Br2SrBr2 + F2 = SrF2 + Br2
SO3 + H2O= H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Si + NaOH + H20 = Na2SiO3 + H20Si + 0NaOH + H20 = 0Na2SiO3 + 10H2
Sb2S3 + NO3- = Sb+ NO + SSb2S3 + 0NO3- = 2Sb + 0NO + 3S
Sb2S3 + NO3- = Sb + NO + SSb2S3 + 0NO3- = 2Sb + 0NO + 3S
Sr(NO3)2(aq) + (NH4)3PO4(aq) = Sr3(PO4)2(s) + NH4NO3(aq)3Sr(NO3)2(aq) + 2(NH4)3PO4(aq) = Sr3(PO4)2(s) + 6NH4NO3(aq)
Si2H3+ O2= SiO2+ H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2= SO3S8 + 12O2 = 8SO3
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
Sn+HNO3 +H2O=H2SnO3 +NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
Sr+Cu(No3)2=Sr(No3)2+Cu22Sr + 2Cu(No3)2 = 2Sr(No3)2 + Cu2
Sr+Cu(No3)2=SrNo3+Cu24Sr + 2Cu(No3)2 = 4SrNo3 + Cu2
SrC O3(s)+ H2CO3(aq) = Sr (HCO3)2(aq) SrCO3(s) + H2CO3(aq) = Sr(HCO3)2(aq)
S8 + F2 = SF6S8 + 24F2 = 8SF6
S8 + 12 O2 + H2O = 8H2SO4S8 + 12O2 + 8H2O = 8H2SO4
SnO2 + CO = Sn + CO2SnO2 + 2CO = Sn + 2CO2
SnO2 +CO=Sn +CO2SnO2 + 2CO = Sn + 2CO2
SO2+H2S= S +H2OSO2 + 2H2S = 3S + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SbCl5+H2O=SbOCl3+HClSbCl5 + H2O = SbOCl3 + 2HCl
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr3(PO4)2+H2SO4=SrSO4+H3PO4Sr3(PO4)2 + 3H2SO4 = 3SrSO4 + 2H3PO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S(s)+4HNO3(aq)=3H2SO3(aq)+4N2O(g)+6H2O(l)-2S(s) - 2HNO3(aq) = -2H2SO3(aq) - N2O(g) + H2O(l)
Sn+HF=SnF2+HSn + 2HF = SnF2 + 2H
SnO2+CO=Sn+2CO2SnO2 + 2CO = Sn + 2CO2
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s)+Cl2(g)=SnCl4Sn(s) + 2Cl2(g) = SnCl4
SiO2 + 4 HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + 4 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
Si+S8=Si2S44Si + S8 = 2Si2S4
SiO2 + 4 HF= SiF4 + 2 H2O SiO2 + 4HF = SiF4 + 2H2O
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO3+H2O=SO4H2SO3 + H2O = SO4H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2+H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2= SO32SO2 + O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SF4(g) + O2(g) = OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO2S + O2 = SO2
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO2 + OH = SnO3 +H2OSnO2 + 2OH = SnO3 + H2O
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SO2(g)+O2(g)=SO32SO2(g) + O2(g) = 2SO3
Si + 3 H2O + 3 MnO2 = 3 Mn(OH)2 + SiO3Si + 3H2O + 3MnO2 = 3Mn(OH)2 + SiO3
SnSO4+K2Cr2O7+H2SO4 = Sn2(SO4)4 +K2SO4 +Cr2(SO4)3+ H2O6SnSO4 + 2K2Cr2O7 + 14H2SO4 = 3Sn2(SO4)4 + 2K2SO4 + 2Cr2(SO4)3 + 14H2O
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SF4(g)+O2(g)=OSF4(g)2SF4(g) + O2(g) = 2OSF4(g)
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
S(s)+O2(g)= SO(aq)2S(s) + O2(g) = 2SO(aq)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S+ H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
S8 +O2=SO2S8 + 8O2 = 8SO2
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
Sn +Cl2 =SnCl4Sn + 2Cl2 = SnCl4
Sr(s) + H2O(l) = Sr(OH)2 (aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S + O2 = SO32S + 3O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
S8+H2=H2SS8 + 8H2 = 8H2S
Sn + H3PO4 = H2 + Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
S+Cu = CuSS + Cu = CuS
SO3 + 2H2O = H2SO4 SO3 + H2O = H2SO4
SO3 + H2O = H2SO4 SO3 + H2O = H2SO4
S8(s) + F2(g) = SF6(g)S8(s) + 24F2(g) = 8SF6(g)
SiC(s) + Cl2(g) = SiCl4(l) + C(s)SiC(s) + 2Cl2(g) = SiCl4(l) + C(s)
SrF2(aq)+K2SO4 (aq) = SrSO4 (s) + KF (aq)SrF2(aq) + K2SO4(aq) = SrSO4(s) + 2KF(aq)
SrI2 + LiOH = Sr(OH)2 + LiISrI2 + 2LiOH = Sr(OH)2 + 2LiI
S8+O2=SO2S8 + 8O2 = 8SO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S(s)+ H2O4(aq)=SO2(g)+H2O(l)3S(s) + 2H2O4(aq) = 3SO2(g) + 2H2O(l)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S + HNO3 = 2SO4 + NO2 + H2OS + 8HNO3 = SO4 + 8NO2 + 4H2O
Sr(OH)2 +HC2H3O2 = SrC2H3O2 + H(OH)2Sr(OH)2 + HC2H3O2 = SrC2H3O2 + H(OH)2
Sn + P = Sn3P23Sn + 2P = Sn3P2
SnCl2 + S(NH4) = SnS + NH4Cl2SnCl2 + S(NH4) = SnS + NH4Cl2
SnCl2 + (NH4)S = SnS + NH4Cl2SnCl2 + (NH4)S = SnS + NH4Cl2
S6+O2=SO2S6 + 6O2 = 6SO2
Sc2 O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SrF2(aq)+K2SO4 (aq) = SrSO4 (s) + KF (aq)SrF2(aq) + K2SO4(aq) = SrSO4(s) + 2KF(aq)
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si + NaOH = Na4SiO4 + H2Si + 4NaOH = Na4SiO4 + 2H2
S + 6HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SO2+HIO3+H2O=HI+H2SO43SO2 + HIO3 + 3H2O = HI + 3H2SO4
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
S8+ O2= SO2S8 + 8O2 = 8SO2
SO3+ H2O= H2SO4SO3 + H2O = H2SO4
SbCl5+KI=KCl+I2+SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
SiO2 + HF =SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 + H2O =H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2 + 4 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
S(HCO3)+ H(C2H3O2)= CO2+ H2O+ S(C2H3O2)S(HCO3) + H(C2H3O2) = CO2 + H2O + S(C2H3O2)
SO2+ Mg2=SO42- + Mg0SO2 + Mg2 = 0SO42- + 2Mg
S+N2=SN2S + N2 = 2SN
S+N=SNS + N = SN
SiCl4(l) + K(s)= KCl(s) + Si(s)SiCl4(l) + 4K(s) = 4KCl(s) + Si(s)
Sn + O2 = SnO2Sn + O2 = SnO2
SrF2(aq)+K2SO4 (aq) = SrSO4 (s) + KF (aq)SrF2(aq) + K2SO4(aq) = SrSO4(s) + 2KF(aq)
SrF2(aq)+K2SO4 (aq) = SrSO4 (s) + KF (aq)SrF2(aq) + K2SO4(aq) = SrSO4(s) + 2KF(aq)
SrCO3 + 2HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
SrCO3 + 2HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
S +NaOH=Na2S+ Na2SO3+ H2O3S + 6NaOH = 2Na2S + Na2SO3 + 3H2O
S + O2 = SO2S + O2 = SO2
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=H2O+SiF4SiO2 + 4HF = 2H2O + SiF4
Sc2O3 + H2O = Sc(OH)3 Sc2O3 + 3H2O = 2Sc(OH)3
SO2 + O2 = SO3 2SO2 + O2 = 2SO3
S + HNO3 = SO2 + NO + H2O3S + 4HNO3 = 3SO2 + 4NO + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sc2O3+H2O=Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(NO3)2+Na2S=SrS+NaNO3Sr(NO3)2 + Na2S = SrS + 2NaNO3
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 + H2O = H+ + SO42-S8 + 166O2 + 4H2O = 8H+ + 8SO42-
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
S2+3O2+2H2O=2H2SO4S2 + 3O2 + 2H2O = 2H2SO4
SO2Cl2+HI=H2S+H2O+HCl+I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
Sr+KNO3=SrKNO3Sr + KNO3 = SrKNO3
S8 + 12O2 = 8SO3S8 + 12O2 = 8SO3
SnSO4+K2Cr2O7+H2SO4 = Sn2(SO4)4 +K2SO4 +Cr2(SO4)3+ H2O6SnSO4 + 2K2Cr2O7 + 14H2SO4 = 3Sn2(SO4)4 + 2K2SO4 + 2Cr2(SO4)3 + 14H2O
SO 2+O2=SO32SO2 + O2 = 2SO3
Sn(SO4)2+2Mn=2MnSO4+SnSn(SO4)2 + 2Mn = 2MnSO4 + Sn
Sn + OH- + H2O = SnO3 + H2Sn + 0OH- + 3H2O = SnO3 + 3H2
SiO2 + 4 HF=SiF4+2H2OSiO2 + 4HF = SiF4 + 2H2O
S8 + HNO3 = H2SO4 +NO2 +H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
Sr+KCl=SrCl2+KSr + 2KCl = SrCl2 + 2K
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
Sb2S3 + HNO3 = Sb2O5 + H2SO4 + NO2 + H2OSb2S3 + 28HNO3 = Sb2O5 + 3H2SO4 + 28NO2 + 11H2O
Sb2S3 + HNO3 = Sb2O5 + H2SO4 + NO2 + H2OSb2S3 + 28HNO3 = Sb2O5 + 3H2SO4 + 28NO2 + 11H2O
Sn3(PO4)4 + Na2CO3 = Sn(CO3)2 + Na3PO4Sn3(PO4)4 + 6Na2CO3 = 3Sn(CO3)2 + 4Na3PO4
SO2 + Br2 + H3O = H2SO3 + HBr2SO2 + Br2 + 2H3O = 2H2SO3 + 2HBr
SnO+NF3=SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
SrSO4(s) = SrO2 + SO2SrSO4(s) = SrO2 + SO2
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
S(s)+H2SO4(aq)=SO2(g)+H2OS(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O
S(s)+H2SO4(aq)=SO2(g)+H2OS(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O
S(s)+H2SO4(aq)=SO2(g)+H2OS(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si4H10 + O2= SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8 + O2 + H2O = H+ + SO42-S8 + 166O2 + 4H2O = 8H+ + 8SO42-
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn(CO3)2 + H2SO4 = CO2 + H2O + Sn(SO4)2Sn(CO3)2 + 2H2SO4 = 2CO2 + 2H2O + Sn(SO4)2
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn+ HNO3= SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S(s)+O2(g)=SO(s)2S(s) + O2(g) = 2SO(s)
S8 + H2 = H2SS8 + 8H2 = 8H2S
SO4-- + NH3 = SO3-- + H2O + N23SO4-- + 2NH3 = 3SO3-- + 3H2O + N2
Sn2+ + NO3- + H+ = Sn4+ + NO + H2O-6Sn2+ + NO3- + 4H+ = -3Sn4+ + NO + 2H2O
SO4--+NH3=SO3--+H2O+N23SO4-- + 2NH3 = 3SO3-- + 3H2O + N2
S2 (s) + H (g) = HS (g)S2(s) + 2H(g) = 2HS(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S+6 HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SNa2 (aq) + H2Sr (aq) = SrS (s) + NaH (aq)SNa2(aq) + H2Sr(aq) = SrS(s) + 2NaH(aq)
SO3(g) = SO2(g) + O2(g)2SO3(g) = 2SO2(g) + O2(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiCl4(l) + H2O = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O = SiO2(s) + 4HCl(aq)
Sr(OH)2 + N2 = Sr3N2 + H2O + O26Sr(OH)2 + 2N2 = 2Sr3N2 + 6H2O + 3O2
SO2 + O2 = 2SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+ 6HNO3=H2SO+NO2+H2O-1S + 0HNO3 = -1H2SO + 0NO2 + H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
Si(OH)4 +NaBr=SiBr4 +NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
S+F2=SF6S + 3F2 = SF6
Sc2 O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
SnO2(s)+2H2(g) = Sn(s)+2H2O(g)SnO2(s) + 2H2(g) = Sn(s) + 2H2O(g)
SnO2(s)+2H2(g) = Sn(s)+2H2O(g)SnO2(s) + 2H2(g) = Sn(s) + 2H2O(g)
Sn(NO3)2 + 2RbOH = Sn(OH)2 + 2RbNO3Sn(NO3)2 + 2RbOH = Sn(OH)2 + 2RbNO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S8+ Cu= Cu2SS8 + 16Cu = 8Cu2S
Sb2S3+O2 = Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+NO2=NO+SO3SO2 + NO2 = NO + SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S+ O2= SO32S + 3O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrBr2 + KClO3 = KBr2 + SrClO3SrBr2 + KClO3 = KBr2 + SrClO3
S+H2SO4=SO2+H2010S + 10H2SO4 = 20SO2 + H20
Sn2O+HCl=SnCl+H2OSn2O + 2HCl = 2SnCl + H2O
SnO+HCl=SnCl2+H2OSnO + 2HCl = SnCl2 + H2O
SnCl2(aq) + Fe2(SO4)3(aq) = SnSO4 + FeCl33SnCl2(aq) + Fe2(SO4)3(aq) = 3SnSO4 + 2FeCl3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S8 + Cu = Cu2SS8 + 16Cu = 8Cu2S
SnO2+2H2=Sn+2H2OSnO2 + 2H2 = Sn + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SnSO4 + K2Cr2O7 + H2SO4 = Sn2(SO4)4 + K2SO4 + Cr2(SO4)3 + H2O6SnSO4 + 2K2Cr2O7 + 14H2SO4 = 3Sn2(SO4)4 + 2K2SO4 + 2Cr2(SO4)3 + 14H2O
SrCl2 + HCl = Cl + H2SrSrCl2 + 2HCl = 4Cl + H2Sr
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sc + HCl = ScCl3 + H22Sc + 6HCl = 2ScCl3 + 3H2
SrCl2(aq) + K2SO4(aq) = SrSO4(s) + KCl(aq)SrCl2(aq) + K2SO4(aq) = SrSO4(s) + 2KCl(aq)
S8 + O2 = S O3S8 + 12O2 = 8SO3
SiL+2Mg=Si+2MgL22SiL + Mg = 2Si + MgL2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g) 2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SrI2+K2S=SrS+2KISrI2 + K2S = SrS + 2KI
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.