Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S(s) + O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sn+Au(NO3)3=Au+Sn(NO3)23Sn + 2Au(NO3)3 = 2Au + 3Sn(NO3)2
Sn + Pb(C2H3O2)2 = Sn(C2H3O2)4 +PbSn + 2Pb(C2H3O2)2 = Sn(C2H3O2)4 + 2Pb
S8 + O2 = SO3 S8 + 12O2 = 8SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S8+O2=SO3S8 + 12O2 = 8SO3
S+NaNO3+NaOH=Na2SO4+NaNO2+H2OS + 3NaNO3 + 2NaOH = Na2SO4 + 3NaNO2 + H2O
SrCl2(aq) + H2SO4(aq) = SrSO4 + HClSrCl2(aq) + H2SO4(aq) = SrSO4 + 2HCl
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2 + Ca2MgSi2O7 = Mg2SiO4 + CaSiO3SiO2 + 2Ca2MgSi2O7 = Mg2SiO4 + 4CaSiO3
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SIF4+H2O=H4SIO4+H2SIF63SIF4 + 4H2O = H4SIO4 + 2H2SIF6
SrCO3 + H2CO3 = Sr(HCO3)2SrCO3 + H2CO3 = Sr(HCO3)2
Sb2S3+HNO3=Sb2O5+NO2+S+H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+CuCl2= SnCl2+CuSn + CuCl2 = SnCl2 + Cu
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
Sb+Cl2=SbCl2Sb + Cl2 = SbCl2
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SrH2 + H2O = Sr2+ + H2 +OH-4SrH2 + 2H2O = 2Sr2+ + 5H2 + 2OH-
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiO2(s) + 4 HI(aq) = SiI4(g) + 2 H2O(l)SiO2(s) + 4HI(aq) = SiI4(g) + 2H2O(l)
SiHCl3 = SiH4 + SiCl44SiHCl3 = SiH4 + 3SiCl4
SO2 + H2O + O = H2SO4SO2 + H2O + O = H2SO4
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiO2(s)+6C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sn(NO3)4(aq)+H2S(aq)=HNO3(aq)+SnS2(s)Sn(NO3)4(aq) + 2H2S(aq) = 4HNO3(aq) + SnS2(s)
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
S8(s) + O2(g) =SO2S8(s) + 8O2(g) = 8SO2
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si(s)+Cl2(g)=SiCl4(l)Si(s) + 2Cl2(g) = SiCl4(l)
SO2 + H2O + O2 = H2SO42SO2 + 2H2O + O2 = 2H2SO4
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S + O2 = SO32S + 3O2 = 2SO3
SO3 + 2H2O =2H2SO4SO3 + H2O = H2SO4
Sn(s) + HF(g) = SnF2 (s) + H2(g)Sn(s) + 2HF(g) = SnF2(s) + H2(g)
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + Li2Se = 2 SSe2 + Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SCl2+ NaF= S2Cl2+SF4+NaCl3SCl2 + 4NaF = S2Cl2 + SF4 + 4NaCl
SnCl4 (s) + F2 (g) = SnF4 (s) + Cl2 (g)SnCl4(s) + 2F2(g) = SnF4(s) + 2Cl2(g)
SO2+O2=SO2SO2 + 0O2 = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S(s)+O2(g)+H2O(l)=H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S+KOH=K2S2O3+K2S+H2O4S + 6KOH = K2S2O3 + 2K2S + 3H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl 4 + Mg = Si + MgCl 2 SiCl4 + 2Mg = Si + 2MgCl2
Sr(IO3)2 = SrI2 + O2Sr(IO3)2 = SrI2 + 3O2
SiO2 + Al = Si + Al2O33SiO2 + 4Al = 3Si + 2Al2O3
SnCl2 + KNO3 = Sn(NO3)2 + KClSnCl2 + 2KNO3 = Sn(NO3)2 + 2KCl
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2+2C= SiC+ COSiO2 + 3C = SiC + 2CO
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
SrCl2 + H3PO4 = SrPO4 + H3Cl2SrCl2 + H3PO4 = SrPO4 + H3Cl2
SO2(g) + H2O(l) = H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
Sn + HNO3 + HCl = NO4 + SnCl4 + H2O 3Sn - 4HNO3 + 12HCl = -4NO4 + 3SnCl4 + 4H2O
SO2+O2 = SO32SO2 + O2 = 2SO3
Sc2O3 + 6HCl = 2ScCl3 + 3H2OSc2O3 + 6HCl = 2ScCl3 + 3H2O
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb(s) + O2(g)=Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb2S3 + HNO3 = HSbO3 + S + NO + H2O3Sb2S3 + 10HNO3 = 6HSbO3 + 9S + 10NO + 2H2O
Sr+O2=2SrO2Sr + O2 = 2SrO
Sr+O2=2SrO2Sr + O2 = 2SrO
Sr + Fe2 (SO4)3 = SrSO4 + Fe3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+O2=SO3SO3 + 0O2 = SO3
S + O2 = SO3 2S + 3O2 = 2SO3
S + O2 = SO2 S + O2 = SO2
S2Cl2 + NH3 = N4S4 + NH4Cl + S8=6S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
S2Cl2 + NH3 = N4S4 + NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SnO+C= Sn+CO22SnO + C = 2Sn + CO2
SnO+C= Sn+CO22SnO + C = 2Sn + CO2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnO2 + C = Sn + CO2SnO2 + C = Sn + CO2
Sb2O3+SbCl3 = Sb4O5Cl25Sb2O3 + 2SbCl3 = 3Sb4O5Cl2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SeCl6 + O2 =SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 =SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 =SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S+O2=SO2S + O2 = SO2
Sb(s)+O2(g)=Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si(s)+HF(aq)=SiF4(g)+H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
SO2Cl2 + HI = H2S + H2O + HCl + I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SO2 + HI = H2S + H2O + I2SO2 + 6HI = H2S + 2H2O + 3I2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sr(s)+H 2 O(l)=Sr(OH) 2 (aq)+H 2 (g) Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2Cl +HI = H2S +H2O +HCl + I22SO2Cl + 14HI = 2H2S + 4H2O + 2HCl + 7I2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn + O2 + HCl = SnCl2 + H2O2Sn + O2 + 4HCl = 2SnCl2 + 2H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + O2 + HCl =SnCl2 + H2O2Sn + O2 + 4HCl = 2SnCl2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO4SO2 + O2 = SO4
Sc2O3+6HCl=2ScCl3+3H2OSc2O3 + 6HCl = 2ScCl3 + 3H2O
Sn+O2+HCl=SnCl2+H2O2Sn + O2 + 4HCl = 2SnCl2 + 2H2O
Sn+O2+HCl=SnCl2+H2O2Sn + O2 + 4HCl = 2SnCl2 + 2H2O
SO2 + HNO3 = H2SO4 + NO2SO2 + 2HNO3 = H2SO4 + 2NO2
SnO+NF3=SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SO2 + O2 =SO3 2SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S + Na = SNa2S + 2Na = SNa2
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sn(OH)4 +HBr = H2O + SnBr4Sn(OH)4 + 4HBr = 4H2O + SnBr4
SnCl2 + FeCl3 = SnCl4 + FeCl2SnCl2 + 2FeCl3 = SnCl4 + 2FeCl2
SnCl2 + FeCl3 = SnCl4 + FeCl2SnCl2 + 2FeCl3 = SnCl4 + 2FeCl2
Sb+ O2= Sb4O64Sb + 3O2 = Sb4O6
Sb(OH)3+Pt3(PO4)4=SbPO4+Pt(OH)44Sb(OH)3 + Pt3(PO4)4 = 4SbPO4 + 3Pt(OH)4
Sn(OH)4 + 4 HBr = 4 H2O + SnBr4Sn(OH)4 + 4HBr = 4H2O + SnBr4
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4 + I2O5 = IF5 + SO25SF4 + 2I2O5 = 4IF5 + 5SO2
S8+O2=SO2S8 + 8O2 = 8SO2
S+O2=SO2S + O2 = SO2
Sn(OH)4 + 4HBr = SnBr4 + 4H2OSn(OH)4 + 4HBr = SnBr4 + 4H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2 + HNO3 + H20= H2SO4 + NO20SO2 + 20HNO3 + H20 = 20H2SO4 + 20NO
S(s)+O2(g)= SO2S(s) + O2(g) = SO2
Sn(OH)4+HBr=SnBr4+H2OSn(OH)4 + 4HBr = SnBr4 + 4H2O
Sn(OH)4 + HBr= SnBr4 +H2OSn(OH)4 + 4HBr = SnBr4 + 4H2O
SiO2 + HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
Sn(OH)4 + 4HBr = 4H2O+SnBr4Sn(OH)4 + 4HBr = 4H2O + SnBr4
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
S+NiCl3=Ni2S3+Cl23S + 2NiCl3 = Ni2S3 + 3Cl2
S+NiCl3=Ni2S3+Cl23S + 2NiCl3 = Ni2S3 + 3Cl2
S+NiCl3=Ni2S3+Cl23S + 2NiCl3 = Ni2S3 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO2S + O2 = SO2
Sn(s)+P(s)=Sn3P2(s) 3Sn(s) + 2P(s) = Sn3P2(s)
SO2 + HNO3 + H20 = H2SO4 + NO2SO2 + 2HNO3 + 0H20 = H2SO4 + 2NO2
S+O2=SO32S + 3O2 = 2SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO2SO2 + 0O2 = SO2
S(s) + O2(g) = SO2S(s) + O2(g) = SO2
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sr+H2O=Sr(OH)2+H2Sr + 2H2O = Sr(OH)2 + H2
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SnCl4+FeCl2=SnCl2+FeCl3SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
Sn(NO2)2+K3PO3=KNO2+Sn3(PO3)23Sn(NO2)2 + 2K3PO3 = 6KNO2 + Sn3(PO3)2
Sr(NO3)2 + Li2CO3 = Li(NO3) + SrCO3Sr(NO3)2 + Li2CO3 = 2Li(NO3) + SrCO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnCl4+FeCl2=SnCl2+FeCl3SnCl4 + 2FeCl2 = SnCl2 + 2FeCl3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4=NO2=H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnO + ClO2 = SnCl4 + O22SnO + 8ClO2 = 2SnCl4 + 9O2
SiO2+6C=SiC+COSiO2 + 3C = SiC + 2CO
SO2=S=O2SO2 = S + O2
SnO2 + HNO3 = Sn(NO3)4 + H2OSnO2 + 4HNO3 = Sn(NO3)4 + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SF4(g)+2F2(g)=SF6(g)SF4(g) + F2(g) = SF6(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Sb 2 S 3 + HNO 3 = Sb(NO 3 ) 3 + H 2 SSb2S3 + 6HNO3 = 2Sb(NO3)3 + 3H2S
Sn (OH)4 + HBr = H2O + Br4SnSn(OH)4 + 4HBr = 4H2O + Br4Sn
SiF4+H2O=HF+Si(OH)4SiF4 + 4H2O = 4HF + Si(OH)4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S8+6O2=4S2O3S8 + 6O2 = 4S2O3
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sn+KOH=K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
S8+O2=SO3S8 + 12O2 = 8SO3
Sb+H2O=Sb2O3+H22Sb + 3H2O = Sb2O3 + 3H2
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SnCl2 + F2 = SnF2 + Cl2SnCl2 + F2 = SnF2 + Cl2
S + O2 = SO32S + 3O2 = 2SO3
S + 8Fe = 8 FeSS + Fe = FeS
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SO3(g)+H2O(l)=H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
SrCl2(aq) + K2SO4(aq) = SrSO4(s) + KCl(aq)SrCl2(aq) + K2SO4(aq) = SrSO4(s) + 2KCl(aq)
Sr + O2 = SrO2Sr + O2 = 2SrO
SiO2+C = SiC + CO2SiO2 + 2C = SiC + CO2
SO2 + PCl5 = SOCl2 + POCl3SO2 + PCl5 = SOCl2 + POCl3
S + O2 = SO2S + O2 = SO2
SO4 + LiOH = LiHSO5SO4 + LiOH = LiHSO5
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SnO2+2H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+C=Si+COSiO2 + 2C = Si + 2CO
SOCl2 = SO + Cl2SOCl2 = SO + Cl2
SO2 + O2= SO32SO2 + O2 = 2SO3
Sn + O2 = SnO2Sn + O2 = SnO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2 + Mg = Si + MgOSiO2 + 2Mg = Si + 2MgO
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2Cl2 + HI = H2S +H2O + HCl +I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SrBr2 + 2HClO = SrCl2 + 2HBr + O2SrBr2 + 2HClO = SrCl2 + 2HBr + O2
Si(OH)4 + NaBr = SiBr4 + NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SiO2+C = SiC + CO2SiO2 + 2C = SiC + CO2
SO2 + Cl2 = SO2Cl2SO2 + Cl2 = SO2Cl2
Si+Cl=SiCl4Si + 4Cl = SiCl4
Sn(NO2)4 + Pt3N4 = Sn3N4 + Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sr(NO3)2 + Li2CO3 = SrCO3 + 2LiNO3Sr(NO3)2 + Li2CO3 = SrCO3 + 2LiNO3
Sr(NO3)2 + Li2CO3 = SrCO3 + Li2(NO3)2Sr(NO3)2 + Li2CO3 = SrCO3 + Li2(NO3)2
Sr(NO3)2 + Li2CO3 = SrCO3 + Li2(NO3)2Sr(NO3)2 + Li2CO3 = SrCO3 + Li2(NO3)2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SCl2 + NaF = S2Cl2 + SF4 + NaCl3SCl2 + 4NaF = S2Cl2 + SF4 + 4NaCl
SCl2 + NaF = S2Cl2 + SF4 + NaCl3SCl2 + 4NaF = S2Cl2 + SF4 + 4NaCl
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
S2Fe + HNO3 = Fe2SO4 + H2SO4 + NO+ H2O6S2Fe + 26HNO3 = 3Fe2SO4 + 9H2SO4 + 26NO + 4H2O
S2Fe + HNO3 = Fe2SO4 + H2SO4 + NO+ H2O6S2Fe + 26HNO3 = 3Fe2SO4 + 9H2SO4 + 26NO + 4H2O
SO+NO2=NO=SO3SO + 2NO2 = 2NO + SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO+O2=SO3SO + O2 = SO3
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S(s) + O2(g) =SO3(aq)2S(s) + 3O2(g) = 2SO3(aq)
S(s) + O2(g) =SO3(aq)2S(s) + 3O2(g) = 2SO3(aq)
SO2+O2=SO32SO2 + O2 = 2SO3
SCl2+NaF = S2Cl2+SF4+NaCl3SCl2 + 4NaF = S2Cl2 + SF4 + 4NaCl
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si4H10(l)+O2(g)=SiO2+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2 + 10H2O(l)
Si + H2 = SiH4Si + 2H2 = SiH4
Si + HCl = SiCl + HSi + HCl = SiCl + H
SO2+ O2 = SO32SO2 + O2 = 2SO3
SnO2 + C = Sn + COSnO2 + 2C = Sn + 2CO
SO2+O2=SO32SO2 + O2 = 2SO3
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SnCl2+H2S=SnS+H2Cl2SnCl2 + H2S = SnS + H2Cl2
Sn + Cl2 = SnCl4Sn + 2Cl2 = SnCl4
S8+O2=SO3S8 + 12O2 = 8SO3
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
SO2+O2+2H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+2H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+2H2O=4H2SO42SO2 + O2 + 2H2O = 2H2SO4
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SiO2 + Mg = Si + MgOSiO2 + 2Mg = Si + 2MgO
Sr(NO3)2 + KI = SrI2 + KNO3Sr(NO3)2 + 2KI = SrI2 + 2KNO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SnCl2 + FeCl3 =SnCl4 + FeCl2SnCl2 + 2FeCl3 = SnCl4 + 2FeCl2
Sn(OH)4 + HBr= SnBr4 + H2OSn(OH)4 + 4HBr = SnBr4 + 4H2O
SrCl2(aq) + H2SO4(aq)= HCl(aq) + SrSO4(s)SrCl2(aq) + H2SO4(aq) = 2HCl(aq) + SrSO4(s)
Sn(OH)4 + HBr = SnBr + H(OH)4Sn(OH)4 + HBr = SnBr + H(OH)4
SeO2+ZnO=ZnSeO3SeO2 + ZnO = ZnSeO3
SeO2+Al(OH)3=Al2(SeO3)3+H2O3SeO2 + 2Al(OH)3 = Al2(SeO3)3 + 3H2O
SeO2+CaO=CaSeO3SeO2 + CaO = CaSeO3
SeO2+Ba(OH)2=BaSeO3+H2OSeO2 + Ba(OH)2 = BaSeO3 + H2O
SbO4 + SO2 = SbO2 + SO4220SbO4 + SO2 = 20SbO2 + SO42
Sr(OH)2+HNO3 = Sr(NO3)2 +H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g) Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
S(s)+O2(g)=SO32S(s) + 3O2(g) = 2SO3
S(s)+O2(g)=SO32S(s) + 3O2(g) = 2SO3
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb + HNO3= Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Si + Fe2O3 = SiO2 + Fe 3Si + 2Fe2O3 = 3SiO2 + 4Fe
SO2 + O2 +4H2O=2H2SOSO2 - O2 + H2O = H2SO
S + H2 = SH2S + H2 = SH2
Sr(s) + I2(g)=SrI2Sr(s) + I2(g) = SrI2
S + O2= SO2S + O2 = 2SO
Sr(s) + H2O(l) = Sr(OH)2(aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sr(s) + H2O(l) = Sr(OH)2(aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SiCl4+Mg=Si+MgCl2SiCl4 + 2Mg = Si + 2MgCl2
S8(g) + O2(g) = S8O2S8(g) + O2(g) = S8O2
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3 + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sn + Cu(NO3)2 = Sn(NO3)2 + CuSn + Cu(NO3)2 = Sn(NO3)2 + Cu
Sn + Cu(NO3)2 = Sn(NO3)2 + CuSn + Cu(NO3)2 = Sn(NO3)2 + Cu
SnCl2 + HNO3 + HCl = SnCl4 + N2O + H2O4SnCl2 + 2HNO3 + 8HCl = 4SnCl4 + N2O + 5H2O
SnCl4 + K3PO4 = KCl +Sn3(PO4)43SnCl4 + 4K3PO4 = 12KCl + Sn3(PO4)4
Sb2S3 + O2 = Sb4O6 + SO22Sb2S3 + 9O2 = Sb4O6 + 6SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4 + I2O5 = IF5 + SO25SF4 + 2I2O5 = 4IF5 + 5SO2
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SbCl3+HCl+NaBrO3=SbCl5+NaBr+H2O3SbCl3 + 6HCl + NaBrO3 = 3SbCl5 + NaBr + 3H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2= SO2SO2 + 0O2 = SO2
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S2O8+CaO2=CaS2O10S2O8 + CaO2 = CaS2O10
S2O8+CAO2=CAS2O10S2O8 + CAO2 = CAS2O10
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO3(g) + H2O(l)= H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Sb2S3 + O2 = Sb + SO2Sb2S3 + 3O2 = 2Sb + 3SO2
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SO3=SO4+S832SO3 = 24SO4 + S8
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SrO(s) + H2O(l) = Sr(OH)2(aq) SrO(s) + H2O(l) = Sr(OH)2(aq)
SnS2 + O2 =SnO2 + SO2SnS2 + 3O2 = SnO2 + 2SO2
SnS2 + O2 =SnO2 + SO2SnS2 + 3O2 = SnO2 + 2SO2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SrCl2 +Na2CO3 = NaCl + Sr(CO3)SrCl2 + Na2CO3 = 2NaCl + Sr(CO3)
SF6 = S + F2SF6 = S + 3F2
Sb2O5+KI +HCl = SbCl3 +KCl +I2 +H2OSb2O5 + 4KI + 10HCl = 2SbCl3 + 4KCl + 2I2 + 5H2O
S+HNO3= NO+H2SO4S + 2HNO3 = 2NO + H2SO4
S+HNO3= NO+H2SO4S + 2HNO3 = 2NO + H2SO4
Sr(s)+HCl(aq)=SrCl2(aq)+H2(g)Sr(s) + 2HCl(aq) = SrCl2(aq) + H2(g)
Sr(s)+HCl(aq)=SrCl(aq)+H2(g)2Sr(s) + 2HCl(aq) = 2SrCl(aq) + H2(g)
SO2+O2=2SO4SO2 + O2 = SO4
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sb2S3+HNO3=H2SO4+H3SbO4+N2O+H2O-2Sb2S3 - 14HNO3 = -6H2SO4 - 4H3SbO4 - 7N2O + 5H2O
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
S+O2=SO32S + 3O2 = 2SO3
S(s) + O2(g) = SO3(aq)2S(s) + 3O2(g) = 2SO3(aq)
S8+O2=SO2S8 + 8O2 = 8SO2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sn + HNO3 = Sn(NO3)2 + H2O + NO3Sn + 8HNO3 = 3Sn(NO3)2 + 4H2O + 2NO
SbS3 + O2 = Sb + SO2 SbS3 + 3O2 = Sb + 3SO2
SO2 + O3 = SO33SO2 + O3 = 3SO3
Sn(OH)4 + HBr=SnBr4+H2OSn(OH)4 + 4HBr = SnBr4 + 4H2O
Sb2S3 + HNO3 = Sb2O3 + NO2 + S + H2OSb2S3 + 6HNO3 = Sb2O3 + 6NO2 + 3S + 3H2O
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + HSb2S3 + 5HNO3 = Sb2O5 + 5NO2 + 3S + 5H
S8+ O2=8SO2S8 + 8O2 = 8SO2
Sb2S3 + HNO3 = Sb2O3 + NO2 + S + H2020Sb2S3 + 60HNO3 = 20Sb2O3 + 60NO2 + 60S + 3H20
Sn+KOH=K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sr(NO3)2+AlCl3 = SrCl2+ Al(NO3)33Sr(NO3)2 + 2AlCl3 = 3SrCl2 + 2Al(NO3)3
S8+O2=SO3S8 + 12O2 = 8SO3
S(s) + HNO3(aq) = H2SO4(aq) + H2O(l) + NO2(g) S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
S8+16O2=4SO2S8 + 8O2 = 8SO2
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2O3+NaOH=NaSbO2+H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
SO2(aq)+H2O(l)=HSO3+H2O(aq)0SO2(aq) + H2O(l) = 0HSO3 + H2O(aq)
SO2+O2=SO32SO2 + O2 = 2SO3
SnCl4+NH3= SnCl2+HCl+N23SnCl4 + 2NH3 = 3SnCl2 + 6HCl + N2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO4SO2 + O2 = SO4
SO2+O2=SO4SO2 + O2 = SO4
SrCO3 + Al(NO3)3*9H2O + (NH2)2CO = SrAl2O4 + H2O + CO2 + N2SrCO3 + 2Al(NO3)3*9H2O + 5(NH2)2CO = SrAl2O4 + 28H2O + 6CO2 + 8N2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SrCO3 + Al(NO3)3*9H2O + (NH2)2CO = SrAl2O4 + H2O + CO2 + N2SrCO3 + 2Al(NO3)3*9H2O + 5(NH2)2CO = SrAl2O4 + 28H2O + 6CO2 + 8N2
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
SO2 + O2+ H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn + I2 =SnI2Sn + I2 = SnI2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sb + O = Sb3O3Sb + O = Sb3O
S + O2= SO32S + 3O2 = 2SO3
SO2+NO2+H20=H2SO4+HNO3-1SO2 + 2NO2 + 0H20 = -1H2SO4 + 2HNO3
SO2 + NaHCO3 + H20 = Na2SO3 + CO2 + 2H2OSO2 + 2NaHCO3 + 0H20 = Na2SO3 + 2CO2 + H2O
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Sn + Cl2 = SnCl2Sn + Cl2 = SnCl2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2+CaCO3+O2=CaSO4+CO22SO2 + 2CaCO3 + O2 = 2CaSO4 + 2CO2
S+O2=SO32S + 3O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+N2O=SO3+N2SO2 + N2O = SO3 + N2
S8 +O2 = SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
SrCl+NaOH= SrOH+NaClSrCl + NaOH = SrOH + NaCl
SrCl2+NaOH= SrOH+NaCl2SrCl2 + NaOH = SrOH + NaCl2
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrCO3 + Al(NO3)3*9H2O + (NH2)CO = SrAl2O4 + H2O + CO2 + N24SrCO3 + 8Al(NO3)3*9H2O + 30(NH2)CO = 4SrAl2O4 + 102H2O + 34CO2 + 27N2
SrCO3 + Al(NO3)39H2O + (NH2)CO = SrAl2O4 + H2O + CO2 + N24SrCO3 + 8Al(NO3)39H2O + 462(NH2)CO = 4SrAl2O4 + 470H2O + 466CO2 + 387N2
SrCO3 + Al(NO3)3*9H2O + (NH2)CO = SrAl2O4 + H2O + CO2 + N24SrCO3 + 8Al(NO3)3*9H2O + 30(NH2)CO = 4SrAl2O4 + 102H2O + 34CO2 + 27N2
SrCO3 + Al(NO3)3*9H2O + (NH2)CO = SrAl2O4 + H2O + CO2 + N24SrCO3 + 8Al(NO3)3*9H2O + 30(NH2)CO = 4SrAl2O4 + 102H2O + 34CO2 + 27N2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O3 =SO33SO2 + O3 = 3SO3
SrCO3 + Al(NO3)39H2O + (NH2)CO = SrAl2O4 + H2O + CO2 + N24SrCO3 + 8Al(NO3)39H2O + 462(NH2)CO = 4SrAl2O4 + 470H2O + 466CO2 + 387N2
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2+H2O=H2SO4S8 + 12O2 + 8H2O = 8H2SO4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S + O = SO2S + 2O = SO2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn + 2KOH = K2SnO2 + 2H2Sn + 2KOH = K2SnO2 + H2
S8+F2=SF6S8 + 24F2 = 8SF6
S3As2+HNO3+H2O=H2SO4+H3AsO4+NO3S3As2 + 28HNO3 + 4H2O = 9H2SO4 + 6H3AsO4 + 28NO
S2Fe+HNO3=Fe2(SO4)3+H2SO4+NO+H2O2S2Fe + 10HNO3 = Fe2(SO4)3 + H2SO4 + 10NO + 4H2O
S2Fe+HNO3=Fe2(SO4)3+H2SO4+NO+H2O2S2Fe + 10HNO3 = Fe2(SO4)3 + H2SO4 + 10NO + 4H2O
S2Fe+HNO3=Fe2(SO4)3+H2SO4+NO+H2O2S2Fe + 10HNO3 = Fe2(SO4)3 + H2SO4 + 10NO + 4H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+HNO3+H2O=H2SO4+NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
SrCl2+2NaHCO3=2NaCl+Sr(HCO3)2SrCl2 + 2NaHCO3 = 2NaCl + Sr(HCO3)2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S+O2=SO2S + O2 = SO2
S+O2=SO2S + O2 = SO2
SrBr2 + (NH4)2CO3 = SrCO3 + NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiC + Cl2 = SiCl4 =CSiC + 2Cl2 = SiCl4 + C
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
SO2 (g) + O2 (g)=SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SrI2+Ag(SO4)=AgI2+Sr(SO4)SrI2 + Ag(SO4) = AgI2 + Sr(SO4)
Sr(OH)2 + HNO3 = Sr(NO3)2 +H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
SrCO3 + Al(NO3)39H2O + (NH2)CO = SrAlO4 + H2O + CO2 + N2SrCO3 + Al(NO3)39H2O + 57(NH2)CO = SrAlO4 + 58H2O + 58CO2 + 48N2
SrCO3 + Al(NO3)39H2O + 5(NH2)CO = SrAlO4 + H2O + CO2 + N2SrCO3 + Al(NO3)39H2O + 57(NH2)CO = SrAlO4 + 58H2O + 58CO2 + 48N2
SrCO3 + Al(NO3)39H2O + 5(NH2)CO = SrAlO4 + H2O + CO2 + N2SrCO3 + Al(NO3)39H2O + 57(NH2)CO = SrAlO4 + 58H2O + 58CO2 + 48N2
SrCO3 + Al(NO3)39H2O + (NH2)CO = SrAlO4 + H2O + CO2 + N2SrCO3 + Al(NO3)39H2O + 57(NH2)CO = SrAlO4 + 58H2O + 58CO2 + 48N2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+C=CS2+CO2SO2 + 5C = CS2 + 4CO
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr(OH)2+FeCl3=SrCl2+Fe(OH)33Sr(OH)2 + 2FeCl3 = 3SrCl2 + 2Fe(OH)3
SnF4+Na=NaF+SnSnF4 + 4Na = 4NaF + Sn
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4 +H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SnSO4 +Na2S = SnS + Na2SO4SnSO4 + Na2S = SnS + Na2SO4
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sb2S3 + O2 = Sb203 + SO2203Sb2S3 + 609O2 = 2Sb203 + 609SO2
SO2 + PCl5 = SOCl2 + POCl3SO2 + PCl5 = SOCl2 + POCl3
SO2 + NaOH =Na2SO3 + H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2 + NaOH =Na2SO3 + H2OSO2 + 2NaOH = Na2SO3 + H2O
Sb+ S = Sb2S52Sb + 5S = Sb2S5
Sn + O2 = SnO2Sn + O2 = 2SnO
Sn + Cl2= SnCl4Sn + 2Cl2 = SnCl4
SO3 + O2 = SO22SO3 - O2 = 2SO2
S8+O2=SO3S8 + 12O2 = 8SO3
Si2H6 + H2O = Si(OH)4 + H2Si2H6 + 8H2O = 2Si(OH)4 + 7H2
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
Sb + I2 = SbI32Sb + 3I2 = 2SbI3
SO2+H2S=S8+H2O8SO2 + 16H2S = 3S8 + 16H2O
Sb + I2 = SbI32Sb + 3I2 = 2SbI3
SO2 + 2 NaOH = H2O + Na2SO3SO2 + 2NaOH = H2O + Na2SO3
SO2 + 2 NaOH = H2O + Na2SO3SO2 + 2NaOH = H2O + Na2SO3
S + O2 = SO32S + 3O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiF4+H2O=H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sn + AgNO3 = Sn(NO3)2 + AgSn + 2AgNO3 = Sn(NO3)2 + 2Ag
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Si2H3+O2=Si02+H2O4Si2H3 + 3O2 = 4Si02 + 6H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO2S8 + 8O2 = 8SO2
S02H=S+H2020S02H = 40S + H20
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S+O2=SO2S + O2 = SO2
SeCl6 + O2= SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Si2H3+O2=SiO2 +H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SF6+H2O=SO3+HFSF6 + 3H2O = SO3 + 6HF
SF6+H2O=SO3+HFSF6 + 3H2O = SO3 + 6HF
SF6+H2O=SO3+HFSF6 + 3H2O = SO3 + 6HF
SF6+3H2O=SO3+6HFSF6 + 3H2O = SO3 + 6HF
S4+O2=SO3S4 + 6O2 = 4SO3
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.