Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S + 6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr + P4= Sr3P26Sr + P4 = 2Sr3P2
S8 + O2 =SO2S8 + 8O2 = 8SO2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Si+O2=SiO2Si + O2 = SiO2
Sb2(CO3)4 + H2SO4 = Sb2(SO4)4 + CO2 + H2OSb2(CO3)4 + 4H2SO4 = Sb2(SO4)4 + 4CO2 + 4H2O
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO3 = SO2 + O22SO3 = 2SO2 + O2
S8 + HNO3 = H2SO4 + NO2+ H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2 O3 + NaOH = Na SbO2 + H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
S + O2 = SO32S + 3O2 = 2SO3
SO4+O2+HNO3=SNO2+H2O4SO4 - 9O2 + 4HNO3 = 4SNO2 + 2H2O
Sn + H3PO4 =H2 + Sn3(PO4)4 3Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2(aq)Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2(aq)
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sb2S5 + HCl = H2S + S + SbCl3Sb2S5 + 6HCl = 3H2S + 2S + 2SbCl3
Sn(NO3)2+2NaOH=Sn(OH)2+2NaNO3Sn(NO3)2 + 2NaOH = Sn(OH)2 + 2NaNO3
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sr3(PO4)2 + H2SO4 = SrSO4(aq) + Sr(H2PO4)2Sr3(PO4)2 + 2H2SO4 = 2SrSO4(aq) + Sr(H2PO4)2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S+6HNO3 = H2SO4 +NO2 +2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3+H2O =SO4+H2SO3 + H2O = SO4 + H2
SbCl3+Mg(BrO3)2+HCl=SbCl5+MgBr2+H2O6SbCl3 + Mg(BrO3)2 + 12HCl = 6SbCl5 + MgBr2 + 6H2O
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sn + 2HNO3=SnNO3 + HSn + HNO3 = SnNO3 + H
Sn + CuSo4 = SnSo4 + CuSn + CuSo4 = SnSo4 + Cu
SO2(g)+H2(g)=H2S(g)+H2O(g)SO2(g) + 3H2(g) = H2S(g) + 2H2O(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2S = 2S +H2OSO2 + 2H2S = 3S + 2H2O
SO2 +SbF5 = SbSO2 + 5FSO2 + SbF5 = SbSO2 + 5F
SO2 +SbF5 = SbSO2 + F5SO2 + SbF5 = SbSO2 + F5
S + O2 = SO2S + O2 = SO2
S + O2 = SO2S + O2 = SO2
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Si4H10 +O2 =SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sb2S3O12 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2S3O12 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
Sb2S3O12 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2S3O12 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
S+HNO3=H2SO4+N02+H2O-5S - 6HNO3 = -5H2SO4 - 3N02 + 2H2O
S2Cl2 +NH3 = N4S4 +NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S8+O2=SO2S8 + 8O2 = 8SO2
S8+HNO3=H2SO4+NO2+H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
S8+HNO3=H2SO4+NO2+H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
S8+NO3-+OH-=SO4-2+NO2-+H2OS8 + 24NO3- + 16OH- = 8SO4-2 + 24NO2- + 8H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SnCl4+Ca(NO3)2=CaCl2+Sn(NO3)4SnCl4 + 2Ca(NO3)2 = 2CaCl2 + Sn(NO3)4
S8+F2=SF6S8 + 24F2 = 8SF6
Sb2S3(s) + HCl(aq) = SbCl3(s) + H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr + Fe2(SO4)3 = SrSO4 + Fe3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
Si4H10 (l) + O2 (g) = SiO2 (s) + H2O (l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn + HCl = SnCl2 + H2Sn + 2HCl = SnCl2 + H2
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8 + H2 = H2SS8 + 8H2 = 8H2S
S8 + H2 = H2SS8 + 8H2 = 8H2S
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb2S3 + HNO3 = H3SbO4 + SO2 + NO + H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
Sb2S3 + HNO3 = H3SbO4 + SO2 + NO + H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
Sr(s) + HNO3 (aq) = Sr(NO3)2(aq) +H2 (g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
SO2 + H2O = H2SO3 SO2 + H2O = H2SO3
SO3 + HCl + BaCl2 = BaSO4 + HCl0SO3 + HCl + 0BaCl2 = 0BaSO4 + HCl
SO2 + Cl2 + H2O =SO3+2HClSO2 + Cl2 + H2O = SO3 + 2HCl
SO2 + Cl2 + H2O =SO4+2HClSO2 + 2Cl2 + 2H2O = SO4 + 4HCl
SO2 + Cl2 + H2O = H2SO4+2HClSO2 + Cl2 + 2H2O = H2SO4 + 2HCl
SO2 + Cl2 + H2O = SO5+ 2HClSO2 + 3Cl2 + 3H2O = SO5 + 6HCl
SO2 + Cl2 + H2O = SO + 2HCl-1SO2 + Cl2 + H2O = -1SO + 2HCl
SO2 + Cl2 + H2O = SO3 + 2HClSO2 + Cl2 + H2O = SO3 + 2HCl
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4= SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Sb4O6+6H2SO4= 2Sb2(SO4)3+6H2OSb4O6 + 6H2SO4 = 2Sb2(SO4)3 + 6H2O
Sr(C2H3O2)+K(CrO4)=Sr(CrO4)+K(C2H3O2)Sr(C2H3O2) + K(CrO4) = Sr(CrO4) + K(C2H3O2)
SO2 + 3O2 = 2SO32SO2 + O2 = 2SO3
SrCl2 + KNO3=Sr(NO3)2 + KClSrCl2 + 2KNO3 = Sr(NO3)2 + 2KCl
S8+O2= SO3S8 + 12O2 = 8SO3
SO2+3O3 =SO33SO2 + O3 = 3SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2=SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S8+MgO= MgS+O2S8 + 8MgO = 8MgS + 4O2
SnCl4 + (NH4)3 PO4 = Sn3(PO4)4 + NH4Cl3SnCl4 + 4(NH4)3PO4 = Sn3(PO4)4 + 12NH4Cl
S8 + F2=SF6S8 + 24F2 = 8SF6
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 (g) = O2 (g) + SO2 (g)2SO3(g) = O2(g) + 2SO2(g)
SCl4 + H2O = SO2 + HClSCl4 + 2H2O = SO2 + 4HCl
SbCl3 + Na2S = Sb2S3 + NaCl2SbCl3 + 3Na2S = Sb2S3 + 6NaCl
S +3H2SO4 = 4SO2 + 3H2OS + 2H2SO4 = 3SO2 + 2H2O
Si3H8(g)+O2(g)=SiO2(s)+H2O(l)Si3H8(g) + 5O2(g) = 3SiO2(s) + 4H2O(l)
SO2 + O = SO3SO2 + O = SO3
Sb2S3(s)+O2(g)=Sb2O3(s)+SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=3SO32SO2 + O2 = 2SO3
Sb2S3+HNO3=H3SbO4+SO2+NO+H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO-2SO2 - 2KMnO4 + H2O = -2MnSO4 - K2SO4 + H2SO
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SO3-2 + H2O = HSO3- + OH-SO3-2 + H2O = HSO3- + OH-
SO3-2 + H2O = HSO3- + OH-SO3-2 + H2O = HSO3- + OH-
SO3 2- +Cl2+ H+ = Cl- +H2O +SO22SO32- - 59Cl2 + 120H+ = -118Cl- + 60H2O + 2SO2
SO2(g) +O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8(s) + O2(g) = SO2(g)S8(s) + 8O2(g) = 8SO2(g)
Sr(NO2)2 + FeCl3 = SrCl2 + Fe(NO2)33Sr(NO2)2 + 2FeCl3 = 3SrCl2 + 2Fe(NO2)3
Sr + P4= Sr3P26Sr + P4 = 2Sr3P2
SO2+O2+4H2O=2H2SO4 2SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SO2 + O2 = SO4SO2 + O2 = SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 + H2 = H2SO4SO2 + O2 + H2 = H2SO4
SO2+O2+H2=H2SO4SO2 + O2 + H2 = H2SO4
SO2+O2+H2=H2SO4SO2 + O2 + H2 = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Si4H10 +O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb2(SO4)3 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SiO2(s)+2C(s)=2CO(g)+Si(s)SiO2(s) + 2C(s) = 2CO(g) + Si(s)
SiO2+4C=2SiC+2COSiO2 + 3C = SiC + 2CO
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
S8 + O2=SO2S8 + 8O2 = 8SO2
S8 + F2 = SF6S8 + 24F2 = 8SF6
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sr(NO3)2 + K3PO4 = KNO3 + Sr3(PO4)23Sr(NO3)2 + 2K3PO4 = 6KNO3 + Sr3(PO4)2
Si + 2H2O = SiO2 + 2H2 Si + 2H2O = SiO2 + 2H2
SnO2+C=Sn+CO2SnO2 + C = Sn + CO2
SnO2+C=Sn+CO2SnO2 + C = Sn + CO2
SnO+C=Sn+CO22SnO + C = 2Sn + CO2
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SiO2 +H = H2O +SiSiO2 + 4H = 2H2O + Si
SiO2 +H2 = H2O +SiSiO2 + 2H2 = 2H2O + Si
SiO2 +H = H2O +SiSiO2 + 4H = 2H2O + Si
SiO2 +2H = 2H2O +SiSiO2 + 4H = 2H2O + Si
Sr(NO3)2 + K2SO4 = SrSO4 + K2(NO3)2Sr(NO3)2 + K2SO4 = SrSO4 + K2(NO3)2
Sr(NO3)2 + K2SO4 = SrSO4 + K2(NO3)2Sr(NO3)2 + K2SO4 = SrSO4 + K2(NO3)2
S + H2HgCl4 + NO + H2O = HgS + HNO3 + HCl3S + 3H2HgCl4 + 2NO + 4H2O = 3HgS + 2HNO3 + 12HCl
S8(s)+O2(g)=SO2(g)S8(s) + 8O2(g) = 8SO2(g)
S8(s)+O2(g)=SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2 + Ca3(PO4)2 = P2O5 + CaSiO33SiO2 + Ca3(PO4)2 = P2O5 + 3CaSiO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S+Hg=HgSS + Hg = HgS
S + 6HNO3 = H2SO4 + NO2 + H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S2O3 + Br2 = S2O6 + Br0S2O3 + Br2 = 0S2O6 + 2Br
S2O3 + Br2 = S2O6 + Br0S2O3 + Br2 = 0S2O6 + 2Br
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Si(s) + HF(aq) =SiF4(g) + H2(g) Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2(g)+O2(g) =SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
Si3N4(aq) = Si(aq)+ N2(aq)Si3N4(aq) = 3Si(aq) + 2N2(aq)
Sb(aq) + Cl2(aq) =SbCl3(aq)2Sb(aq) + 3Cl2(aq) = 2SbCl3(aq)
SF4 +H2O =H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S+O2=SO2S + O2 = SO2
S+O2=SO2S + O2 = SO2
Sn + P = Sn3P23Sn + 2P = Sn3P2
SCl2 = Cl2 + S22SCl2 = 2Cl2 + S2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S+3O2=2SO32S + 3O2 = 2SO3
Sb2S3(s)+HCl(Aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(Aq) = 2SbCl3(aq) + 3H2S(g)
Sr(s) + P4(s) =Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SF4(g)+2F2(g)=SF6(g)SF4(g) + F2(g) = SF6(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiF4(g) + H2O(l) = H2SiF6(aq) + H2SiO3(s)3SiF4(g) + 3H2O(l) = 2H2SiF6(aq) + H2SiO3(s)
Sr(s) + P4(s) =Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SN+HNO3+H2O=H2SNO3+NO3SN + 4HNO3 + H2O = 3H2SNO3 + 4NO
SiCl4 + O2 = SiO2 + Cl2SiCl4 + O2 = SiO2 + 2Cl2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + 2CO2SiO2 + C = Si + CO2
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SO3 + KOH = K2SO4 + H2OSO3 + 2KOH = K2SO4 + H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SF4 + 2F2 = SF6SF4 + F2 = SF6
Sn+HNO3+H2O=H2SnO3+NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
Sn + 4 HNO3 = SnO2 + 4 NO2 + 2 H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn(s) + HNO3(aq) = SnO2H2O(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2H2O(s) + 4NO2(g) + H2O(l)
Sn(s) + HNO3(aq) = SnO2H2O(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2H2O(s) + 4NO2(g) + H2O(l)
Sn(OH)2+ 2H= Sn+ 2H2OSn(OH)2 + 2H = Sn + 2H2O
SbCl3 + Na2S = Sb2S3 + NaCl2SbCl3 + 3Na2S = Sb2S3 + 6NaCl
Sc2O3(s)+SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
Sn+HNO3+H2O=H2SnO3+NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
S+ 6HCl= H2+SCl2S + 2HCl = H2 + 2SCl
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr + O2=2SrO2Sr + O2 = 2SrO
SnCl3 + KCl + CrCl3 + H2O = SnCl2 + HCl + K2Cr2O76SnCl3 + 2KCl + 2CrCl3 + 7H2O = 6SnCl2 + 14HCl + K2Cr2O7
S8 + NO3- + H+ = S4O6-- + NO2 + H2OS8 + 20NO3- + 16H+ = 2S4O6-- + 20NO2 + 8H2O
S+HNO3=H2SO4+NO2+12H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 =2SrO2Sr + O2 = 2SrO
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Sr(OH)2 + Fe(NO3)3 = Fe(OH)3 + Sr(NO3)23Sr(OH)2 + 2Fe(NO3)3 = 2Fe(OH)3 + 3Sr(NO3)2
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S8(s) + 8O2(g) =8SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SrCl2+Li3(PO4)=Sr3(PO4)2+LiCl3SrCl2 + 2Li3(PO4) = Sr3(PO4)2 + 6LiCl
S8 + 12 O2 = 8 SO3S8 + 12O2 = 8SO3
S8 + 12 O2 = 8 SO3S8 + 12O2 = 8SO3
SnS+NF3=SnF2+N2S33SnS + 2NF3 = 3SnF2 + N2S3
S8+BaO=BaS+O2S8 + 8BaO = 8BaS + 4O2
SrCl2+Li3(PO4)=Sr3(PO4)2+LiCl3SrCl2 + 2Li3(PO4) = Sr3(PO4)2 + 6LiCl
SiCl4(s) + H2O(g) = SiO2(s) + HCl(g)SiCl4(s) + 2H2O(g) = SiO2(s) + 4HCl(g)
Sb2(SO4)3 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2(g)+O2(g)= SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8+O2= SO3S8 + 12O2 = 8SO3
Sb2(SO4)3 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
SO2 + 2Li2Se = SSe2 + 2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
SnCl2 +Co = SnCo +ClSnCl2 + Co = SnCo + 2Cl
Sn(s) + HNO3(aq) = SnO2(s) + NO2(g) + H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SrS (aq) + CuSO4 (aq) = SrSO4 (s) + CuS (s)SrS(aq) + CuSO4(aq) = SrSO4(s) + CuS(s)
SrS (s) + CuSO4 (aq) = SrSO4 (s) + CuS (s)SrS(s) + CuSO4(aq) = SrSO4(s) + CuS(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2= SO2S8 + 8O2 = 8SO2
S(s) + O2(g) + H2O(l) = H2SO4(aq)2S(s) + 3O2(g) + 2H2O(l) = 2H2SO4(aq)
S + SO3 = SO30S + SO3 = SO3
S + SO3 = SO30S + SO3 = SO3
S + O2 = SO2S + O2 = SO2
SO2 + O = SO3SO2 + O = SO3
SO2 + O = SO3SO2 + O = SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiO2(s)+HF(aq)=SiF4(g)+H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sn + HNO3 = SnO + NO2 + H2OSn + 2HNO3 = SnO + 2NO2 + H2O
SiCl4(l)+H2O(l)=SiO2(s)+HCl(aq) SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SiO2 + 4 HF = SiF4 + 2 H2OSiO2 + 4HF = SiF4 + 2H2O
S2Cl2 + NH3 = N4S4 + NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
SO2+Br2+H2O=HBr4+H2SO4SO2 + 4Br2 + 2H2O = 2HBr4 + H2SO4
SO2+Br2+H2O=HBr4+H2SO4SO2 + 4Br2 + 2H2O = 2HBr4 + H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+KMnO4+H2O=MnSO4+K2SO4+H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SnCl2+HNO3+HCl=SnCl4+N2O+H2O4SnCl2 + 2HNO3 + 8HCl = 4SnCl4 + N2O + 5H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 + H2O = H2 + SO4SO3 + H2O = H2 + SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr + HNO3 = Sr(NO3)3 + NO2 + H2OSr + 6HNO3 = Sr(NO3)3 + 3NO2 + 3H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sn3P2 + NaF = SnF2 + Na3PSn3P2 + 6NaF = 3SnF2 + 2Na3P
Sb2S3 + (H)+ + (NO3)- = Sb2S5 + (HSO4)- + NO-1Sb2S3 + 2(H)+ + 4(NO3)- = -1Sb2S5 + 2(HSO4)- + 4NO
Sb2S3 + (H)+ + (NO3)- = Sb2S5 + (HSO4)- + NO-1Sb2S3 + 2(H)+ + 4(NO3)- = -1Sb2S5 + 2(HSO4)- + 4NO
Sr(OH)2+LiNO3=SrNO3+Li (OH)2Sr(OH)2 + LiNO3 = SrNO3 + Li(OH)2
S+O2=SO32S + 3O2 = 2SO3
SO2 + H2O = H2SO3 SO2 + H2O = H2SO3
Sb2S3 + H+ + NO3- = Sb2S2 + HSO4- + NOSb2S3 + H+ + 2NO3- = Sb2S2 + HSO4- + 2NO
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Si+S8=Si2S44Si + S8 = 2Si2S4
Sb2S3 + H+ + NO3- = Sb2S5 + HSO4- + NO-1Sb2S3 + 2H+ + 4NO3- = -1Sb2S5 + 2HSO4- + 4NO
Sb2S3 + H+ + NO3- = Sb2S5 + HSO4- + NO-1Sb2S3 + 2H+ + 4NO3- = -1Sb2S5 + 2HSO4- + 4NO
SO4+CH2O=H2S+CO2+H2O2SO4 + 5CH2O = 2H2S + 5CO2 + 3H2O
Sr(OH)2+HBr=SrBr2+H2OSr(OH)2 + 2HBr = SrBr2 + 2H2O
SH2+Br=S+BrHSH2 + 2Br = S + 2BrH
Sn + HNO3 =SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sb2S3 + HNO3 + H2O = H2SO4 + H3SbO4 + NO3Sb2S3 + 28HNO3 + 4H2O = 9H2SO4 + 6H3SbO4 + 28NO
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
S(s) + NaCl (aq) = Na2S (aq) + Cl2 (g)S(s) + 2NaCl(aq) = Na2S(aq) + Cl2(g)
SiF4 + H2O = H2SiF6 + H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6+O2=SeO2+3Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+3Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+3Cl2SeCl6 + O2 = SeO2 + 3Cl2
SiCl4 + H2O= H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2+O=SO3SO2 + O = SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr + Cl2 = SrCl2Sr + Cl2 = SrCl2
S8 + 8O2=8SOS8 + 4O2 = 8SO
Sn+2HBr=SnBr+H22Sn + 2HBr = 2SnBr + H2
Sn+2HBr=BrSn+H22Sn + 2HBr = 2BrSn + H2
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
SnO2+H2SO4=Sn(SO4)2+H2OSnO2 + 2H2SO4 = Sn(SO4)2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2+C=CO+SnSnO2 + 2C = 2CO + Sn
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SO4 + NaOH = NaSO4 + OHSO4 + NaOH = NaSO4 + OH
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S + O2 + H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
S + O2+ H2O = H2SO42S + 3O2 + 2H2O = 2H2SO4
SO2+O2+4H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + N2O = SO3 + N2SO2 + N2O = SO3 + N2
S8(s) + O2(g) = 8SO2S8(s) + 8O2(g) = 8SO2
S8(s) + O2(g) = 8SO2S8(s) + 8O2(g) = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2 + HNO3 = Sn(NO3)4 + H2O SnO2 + 4HNO3 = Sn(NO3)4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2 + C = SiC + CO SiO2 + 3C = SiC + 2CO
SO4 2- + NH3=SO3 2- +H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
SO42-+NH3=SO32-+H2O+N23SO42- + 20NH3 = 3SO32- + 30H2O + 10N2
Sr + O2= 2SrO2Sr + O2 = 2SrO
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S+O2= SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S+ HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2+2Mg=2MgO+SiSiO2 + 2Mg = 2MgO + Si
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+K2Cr2O7+H2O=SO2+Cr2O3+KOH3S + 2K2Cr2O7 + 2H2O = 3SO2 + 2Cr2O3 + 4KOH
SO2 + O = SO3SO2 + O = SO3
SO2 + O= SO3SO2 + O = SO3
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnO2+HNO3=Sn(NO3)4+H2OSnO2 + 4HNO3 = Sn(NO3)4 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn + HCl = SnCl2 +H2Sn + 2HCl = SnCl2 + H2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
S8 + 8O2 = 8SO2S8 + 8O2 = 8SO2
SiCl4 + H2O = H2SiO3 + HClSiCl4 + 3H2O = H2SiO3 + 4HCl
SiCl4+H2O=H2SiO3+HClSiCl4 + 3H2O = H2SiO3 + 4HCl
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiO2(s) + C(s) =Si(s) + CO(g)SiO2(s) + 2C(s) = Si(s) + 2CO(g)
Sn(NO3)2(Aq)+HCl(Aq)=SnCl2+HNO3Sn(NO3)2(Aq) + 2HCl(Aq) = SnCl2 + 2HNO3
S + HNO3 =NO2 + H2O + H2SO4 S + 6HNO3 = 6NO2 + 2H2O + H2SO4
S + HNO3 = NO2 + H2O + H2SO4 S + 6HNO3 = 6NO2 + 2H2O + H2SO4
Sr(OH)2(aq) + H3PO4(aq) = Sr3 (PO4)2 + H2O(l)3Sr(OH)2(aq) + 2H3PO4(aq) = Sr3(PO4)2 + 6H2O(l)
S+H2SO4=SO2+H2010S + 10H2SO4 = 20SO2 + H20
S(s)+ HNO3 (aq)= SO3 (g) + H20 (l) +NO220S(s) + 60HNO3(aq) = 20SO3(g) + 3H20(l) + 60NO2
SiO2 + F = SiF4 + O2SiO2 + 4F = SiF4 + O2
Sb+I2=SbI32Sb + 3I2 = 2SbI3
Sn + HNO3=SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 =SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 =SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SF4 + 3 H2O = H2SO3 + 4 HFSF4 + 3H2O = H2SO3 + 4HF
Se+NO3= SeO2+NOSe + NO3 = SeO2 + NO
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
Sn + HNO3 = SnO2 + NO2 + 3H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
SbS3+O2= Sb2O4+SO22SbS3 + 8O2 = Sb2O4 + 6SO2
S2O7 + H2O = H2SO4 + O22S2O7 + 4H2O = 4H2SO4 + O2
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
Si+NaOH+H2O=Na2SiO3+H2O0Si + 0NaOH + H2O = 0Na2SiO3 + H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2= SO32SO2 + O2 = 2SO3
Sc2O3(s) + SO3(l) = Sc2(SO4)3(s)Sc2O3(s) + 3SO3(l) = Sc2(SO4)3(s)
S8+O2 = SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SnCl2+O3+HCl=SnCl4+H2O3SnCl2 + O3 + 6HCl = 3SnCl4 + 3H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3=SO2+O22SO3 = 2SO2 + O2
Sn + KOH = K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + C = SiC + 2COSiO2 + 3C = SiC + 2CO
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+LiOH=Li2SO4+Li2S+H2O4S + 8LiOH = Li2SO4 + 3Li2S + 4H2O
S(s)+KClO3(s)=SO2(g)+KCl(s)3S(s) + 2KClO3(s) = 3SO2(g) + 2KCl(s)
SO2+O2=SO2SO2 + 0O2 = SO2
SO2 + Br2 + 2H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
S(s)+O2(g)=SO2(g)S(s) + O2(g) = SO2(g)
SnO2 + H2 =Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2H2 = Sn + 2H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + H2 =Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sb2S3+HNO3=H3SbO4+SO2+NO+H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
Sb2S3+HNO3=H3SbO4+SO2+NO+H2O3Sb2S3 + 22HNO3 = 6H3SbO4 + 9SO2 + 22NO + 2H2O
SbS3+HNO3=H3SbO4+SO2+NO+H2O3SbS3 + 17HNO3 = 3H3SbO4 + 9SO2 + 17NO + 4H2O
SO3=SO2+O22SO3 = 2SO2 + O2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO3 2SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + H2SO4 = SO2 +H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
SiF4 +2NH3 + 2HF=(NH4)2SiF6SiF4 + 2NH3 + 2HF = (NH4)2SiF6
Sr+O2=2SrO2Sr + O2 = 2SrO
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO3+2NaOH=NaSO3 +2OHSO3 + NaOH = NaSO3 + OH
SO3+2NaOH=2NaSO3 +2OHSO3 + NaOH = NaSO3 + OH
SO3+2NaOH=2NaSO3 +OHSO3 + NaOH = NaSO3 + OH
SO2 + NO3- + H2O = SO4-- + N2O + H+4SO2 + 2NO3- + 3H2O = 4SO4-- + N2O + 6H+
SO2 + NO3 + H2O = SO4-- + N2O + H+5SO2 + 2NO3 + 5H2O = 5SO4-- + N2O + 10H+
SO2 + NO3 + H2O = SO4-- + N2O + H+5SO2 + 2NO3 + 5H2O = 5SO4-- + N2O + 10H+
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SrCl2 + KMnO + H3PO4 = Cl2 + Mn3(PO4)2 + Sr(PO4)2 + K3PO4 + H2O-1SrCl2 + 6KMnO + 4H3PO4 = -1Cl2 + 2Mn3(PO4)2 - Sr(PO4)2 + 2K3PO4 + 6H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S8 +F2=SF4S8 + 16F2 = 8SF4
SO2+O2=SO32SO2 + O2 = 2SO3
SiH4+NH3=Si3N4+H23SiH4 + 4NH3 = Si3N4 + 12H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S=S88S = S8
SO2 + O2 = SO32SO2 + O2 = 2SO3
S+H2+O=H2SO4S + H2 + 4O = H2SO4
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
SO2 + Fe3(Aq)= Fe S + O23SO2 + Fe3(Aq) = 3FeS + 3O2
Sb2O5=Sb5+O210Sb2O5 = 4Sb5 + 25O2
SO2 + Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+O2=O8S2S8 + 16O2 = 4O8S2
S8+O2=O8S2S8 + 16O2 = 4O8S2
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
Sr(NO3)2 (aq) + K2SO4 (aq) = SrSO4 (aq) + K2(NO3)2 (aq)Sr(NO3)2(aq) + K2SO4(aq) = SrSO4(aq) + K2(NO3)2(aq)
SO2+O2 = SO32SO2 + O2 = 2SO3
Sn(s) + 2 AgClO4(aq) = 2 Ag(s) + 2 Sn(ClO4)2(aq) Sn(s) + 2AgClO4(aq) = 2Ag(s) + Sn(ClO4)2(aq)
Sn(s) + 2 NaOH(aq) = Na2SnO2(aq) + 4 H2(g) Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
SF 4 (s) + 2H 2 O(l) = SO 2 (g) + 4HF(aq)SF4(s) + 2H2O(l) = SO2(g) + 4HF(aq)
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
SO3 + 2H2O = H2SO4SO3 + H2O = H2SO4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+MnO4=SO4+MnO22SO3 + MnO4 = 2SO4 + MnO2
SO3+MnO4=SO4+MnO22SO3 + MnO4 = 2SO4 + MnO2
S+6HNO3=H2SO4+6NO2+3H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn +2HBr = SnBr2 +H2Sn + 2HBr = SnBr2 + H2
SiO2 (l) + Al (l) = Al2O3 (s) + Si (l)3SiO2(l) + 4Al(l) = 2Al2O3(s) + 3Si(l)
SCl2 +NaF = SF4 + S2Cl2 +Na-1SCl2 + 4NaF = SF4 - S2Cl2 + 4Na
SCl2 +NaF = SF4 + S2Cl2=Na-1SCl2 + 4NaF = SF4 - S2Cl2 + 4Na
SO2+H2=H2S+H2OSO2 + 3H2 = H2S + 2H2O
Sn(ClO3)2 + Na2CrO4 = SnCrO4 + Na(ClO3)Sn(ClO3)2 + Na2CrO4 = SnCrO4 + 2Na(ClO3)
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8 + Na2SO3 + H2O = Na2S2O3*5H2OS8 + 8Na2SO3 + 40H2O = 8Na2S2O3*5H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.