Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
S+O2=S2O42S + 2O2 = S2O4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S (s) + O2 (g) = SO32S(s) + 3O2(g) = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + NaClO + H2O = NaCl + H2SO4SO2 + NaClO + H2O = NaCl + H2SO4
SO4 + NaClO + H2O = NaCl + H2SO4SO4 - NaClO + H2O = -1NaCl + H2SO4
SO4 + NaClO + H2O = NaCl + H2SO4SO4 - NaClO + H2O = -1NaCl + H2SO4
Sn(s)+HNO 3 (aq)=SnO 2 (s)+NO 2 (g)+H 2 O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiO2(s)+9C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SH2+O2=H2SO4SH2 + 2O2 = H2SO4
Sr+Cl2+O2=Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
SO3 + H2O = SO4 + H2SO3 + H2O = SO4 + H2
S+O2=SO32S + 3O2 = 2SO3
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SF4+H2O = H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
SO4 + Ba(NO3)2 = BaSO4 + (NO3)SO4 + Ba(NO3)2 = BaSO4 + 2(NO3)
SO4 + Ba(NO3)2 = BaSO4 + (NO3)2SO4 + Ba(NO3)2 = BaSO4 + (NO3)2
Sr + O2 =2SrO2Sr + O2 = 2SrO
SiF4 + H2O = HF + SiO2SiF4 + 2H2O = 4HF + SiO2
SO2+O2=SO32SO2 + O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SiCl4=Si+Cl2SiCl4 = Si + 2Cl2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sb2S3 + O2 = Sb2O4 + SO2Sb2S3 + 5O2 = Sb2O4 + 3SO2
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Si + F2 = SiF4Si + 2F2 = SiF4
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SbH3 + H2O = Sb(OH)4 + H22SbH3 + 8H2O = 2Sb(OH)4 + 7H2
S8+O2=SO2S8 + 8O2 = 8SO2
SrCO3 + H2CO3 = Sr(HCO3)2SrCO3 + H2CO3 = Sr(HCO3)2
SO2Cl2 + H2O = H2SO4 + HClSO2Cl2 + 2H2O = H2SO4 + 2HCl
SO2 + O2= SO32SO2 + O2 = 2SO3
Si+H2SO4=SiSO4+H2Si + H2SO4 = SiSO4 + H2
SiI4(s)+Mg(s)=Si(s)+MgI2(s)SiI4(s) + 2Mg(s) = Si(s) + 2MgI2(s)
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3+3H2SO4=3H2S+Sb2(SO4)3Sb2S3 + 3H2SO4 = 3H2S + Sb2(SO4)3
Sn+O2=SnO2Sn + O2 = SnO2
Si2H3+ O = SiO2 + H2O2Si2H3 + 11O = 4SiO2 + 3H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sr(NO3)2 + CuSO4 = SrSO4 + Cu(NO3)2Sr(NO3)2 + CuSO4 = SrSO4 + Cu(NO3)2
SI+Pb(NO3) = SNO3+PbISI + Pb(NO3) = SNO3 + PbI
Sr(NO3)2 +K2SO4 = KNO3 + SrSO4Sr(NO3)2 + K2SO4 = 2KNO3 + SrSO4
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + F2= SF6S8 + 24F2 = 8SF6
Sb+ Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SrCl2(aq)+ZnSO4(aq)=SrSO4+ZnCl2SrCl2(aq) + ZnSO4(aq) = SrSO4 + ZnCl2
ScF3 +K =Sc +KFScF3 + 3K = Sc + 3KF
Sn+HNO3=SnO2+NO+H2O3Sn + 4HNO3 = 3SnO2 + 4NO + 2H2O
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Sc(NO3)3 + Na2S=Sc2S3+ NaNO32Sc(NO3)3 + 3Na2S = Sc2S3 + 6NaNO3
Sc(NO3)3 + Na2S=Sc2S3+ NaNO32Sc(NO3)3 + 3Na2S = Sc2S3 + 6NaNO3
S + F2 = SF6S + 3F2 = SF6
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S + O2 = SO2S + O2 = SO2
SiO2 + C = SiC + 18COSiO2 + 3C = SiC + 2CO
SiO2 + 9C = SiC + COSiO2 + 3C = SiC + 2CO
SO3+2H2O=H2SO4SO3 + H2O = H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(OH)2=Sr++ + OH-Sr(OH)2 = Sr++ + 2OH-
Si(OH)4+NaBr = SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SrCO3+SiO2+Eu2O3+Li2CO3 = SrSiO4EuLi+CO2+O22SrCO3 + 2SiO2 + Eu2O3 + Li2CO3 = 2SrSiO4EuLi + 3CO2 + O2
SrCO3+2SiO2+Eu2O3+Li2CO3 = SrSiO4EuLi+CO2+O22SrCO3 + 2SiO2 + Eu2O3 + Li2CO3 = 2SrSiO4EuLi + 3CO2 + O2
Sr2CO3+2SiO2+Eu2O3+Li2CO3 = SrSiO4EuLi+CO2+O22Sr2CO3 + 4SiO2 + 2Eu2O3 + 2Li2CO3 = 4SrSiO4EuLi + 4CO2 + O2
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S8(s) + O2(g) = SO3(g)S8(s) + 12O2(g) = 8SO3(g)
S8+MGO=MGS+O2S8 + 8MGO = 8MGS + 4O2
S8+MgO=MgS+O2S8 + 8MgO = 8MgS + 4O2
SrCO3 + H2CO3 = Sr(HCO3)2SrCO3 + H2CO3 = Sr(HCO3)2
SO2Cl2 + H2O = H2SO4 + HClSO2Cl2 + 2H2O = H2SO4 + 2HCl
S2Cl2 + NH3 = N4S4 + NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
S2Cl2 + NH3 = N4S4 + NH4Cl + S86S2Cl2 + 16NH3 = N4S4 + 12NH4Cl + S8
SrOH+HBr=H2O+SrBrSrOH + HBr = H2O + SrBr
SrOH+HBr=H2O+SrBrSrOH + HBr = H2O + SrBr
SiI4(s) + H2O(l) = HI(aq) + H2SiO3(s) SiI4(s) + 3H2O(l) = 4HI(aq) + H2SiO3(s)
SO2+CaCO3+O2=CaSO4+CO22SO2 + 2CaCO3 + O2 = 2CaSO4 + 2CO2
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Si + O2 = SiO4Si + 2O2 = SiO4
SO2 = O + SO3SO2 = -1O + SO3
SO2 = O + SO3SO2 = -1O + SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SF6+H2=H2S+HFSF6 + 4H2 = H2S + 6HF
S + O2 = SO2S + O2 = SO2
SF6 + H2 = H2S + HFSF6 + 4H2 = H2S + 6HF
Sn+O=SnOSn + O = SnO
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SrCl2(aq)+ZnSO4(aq)=SrSO4+ZnCl2SrCl2(aq) + ZnSO4(aq) = SrSO4 + ZnCl2
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8 + O2 =SO2S8 + 8O2 = 8SO2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8+O2=SO2S8 + 8O2 = 8SO2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SnCl4+(NH4)3PO4=Sn3(PO4)4+NH4Cl3SnCl4 + 4(NH4)3PO4 = Sn3(PO4)4 + 12NH4Cl
Sr(s)+Cl2(l) = SrCl2(s)Sr(s) + Cl2(l) = SrCl2(s)
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SN+HNO3=SNO2+NO2+H2OSN + 4HNO3 = SNO2 + 4NO2 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + O2 + H20 = H2SO410SO2 + 10O2 + H20 = 10H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S8+F2=SF6S8 + 24F2 = 8SF6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2O3 + MnO4- + OH- = MnO4-- + Sb(OH)6- + H2O-1Sb2O3 - 4MnO4- - 6OH- = -4MnO4-- - 2Sb(OH)6- + 3H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SO2(g)+O2(g)=SO3 2SO2(g) + O2(g) = 2SO3
SiO2+C=CO+SiCSiO2 + 3C = 2CO + SiC
SiO2+C=CO+SiCSiO2 + 3C = 2CO + SiC
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3(g)+H2O(l)=H2SO4SO3(g) + H2O(l) = H2SO4
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2 = SO32SO2 + O2 = 2SO3
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2=SO32SO2 + O2 = 2SO3
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SeF6+H2O=HF+H6SeO6SeF6 + 6H2O = 6HF + H6SeO6
Sn3(PO4)2 + (NH4NO3) = (NH4)3PO4 + Sn(NO3)2Sn3(PO4)2 + 6(NH4NO3) = 2(NH4)3PO4 + 3Sn(NO3)2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sr(OH)2 * 8H2O + NH4SCN = Sr(SCN)2 + NH3 + H2OSr(OH)2*8H2O + 2NH4SCN = Sr(SCN)2 + 2NH3 + 10H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SiO2 + C = SiC + OCSiO2 + 3C = SiC + 2OC
SO2+O2=SO32SO2 + O2 = 2SO3
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2= SO32SO2 + O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S+O2=SO32S + 3O2 = 2SO3
Sb2S2 + HNO3 = Sb2O5 + NO2 + S + H2OSb2S2 + 10HNO3 = Sb2O5 + 10NO2 + 2S + 5H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sb2S3+HCl=H3SbCl6+H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SiO2 + 2C = SiC + CO2SiO2 + 2C = SiC + CO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SF6+H2=H2S+HFSF6 + 4H2 = H2S + 6HF
S8 + SrBr2 = Br2 + Sr8S8S8 + 8SrBr2 = 8Br2 + Sr8S8
S8 + SrBr2 = Br2 + SrS8S8 + SrBr2 = Br2 + SrS8
Sb2S3 + HNO3=H3SbO4+SO3+NO+H2O3Sb2S3 + 28HNO3 = 6H3SbO4 + 9SO3 + 28NO + 5H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
S+O2=SO2S + O2 = SO2
Sn + 4HNO3 = SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + H2O = 3H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SnCl2+K2Cr2O7+H2SO4=Sn(SO4)2+CrCl3+K2SO4+H2O3SnCl2 + K2Cr2O7 + 7H2SO4 = 3Sn(SO4)2 + 2CrCl3 + K2SO4 + 7H2O
Sn(s)+HNO 3 (aq) =SnO 2 (s)+NO 2 (g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn + HNO3 =SnO2 +NO2 =H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Si + NaOH + H2O = Na2SiO3 + H2Si + 2NaOH + H2O = Na2SiO3 + 2H2
Sr(HCO2)2 + MgSO4 = Mg(HCO2)2 + SrSO4Sr(HCO2)2 + MgSO4 = Mg(HCO2)2 + SrSO4
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=8SO2S8 + 8O2 = 8SO2
Sn(CO3)2 +H3PO4 =Sn3(PO4)4 +CO2 +H2O3Sn(CO3)2 + 4H3PO4 = Sn3(PO4)4 + 6CO2 + 6H2O
S8+O2=SO2S8 + 8O2 = 8SO2
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sb2S3 + HNO3 = HSbO3 + H2SO4 + NO + H2O3Sb2S3 + 28HNO3 = 6HSbO3 + 9H2SO4 + 28NO + 2H2O
Sb2S3 + HNO3 = HSbO3 + H2SO4 + NO + H2O3Sb2S3 + 28HNO3 = 6HSbO3 + 9H2SO4 + 28NO + 2H2O
SO2+O2= SO32SO2 + O2 = 2SO3
SbS3 + HNO3=H3SbO4+SO3+NO+H2O3SbS3 + 23HNO3 = 3H3SbO4 + 9SO3 + 23NO + 7H2O
SiO2 + Na2CO3 = Na2SiO3 + CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
SiO2 + Na2CO3 = Na2SiO3 + CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
SO2+H2S=S+H2OSO2 + 2H2S = 3S + 2H2O
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO3(g) + H2O(l)=H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Sn(s)+P(s)=Sn3P2(s)3Sn(s) + 2P(s) = Sn3P2(s)
SO2+Cl2+H2O=H2SO4 + HClSO2 + Cl2 + 2H2O = H2SO4 + 2HCl
Sr3(PO4)2 + SiO2 + C = SrSiO3 + P4 + CO2Sr3(PO4)2 + 6SiO2 + 10C = 6SrSiO3 + P4 + 10CO
S+O2 = SO2S + O2 = SO2
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
Sr(OH)2 + HNO3 = Sr(NO3)2 + H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
Sr(OH)2 + HNO3 = Sr(NO3)2 + H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
S+O2=SO2S + O2 = SO2
SO2 + O2= SO3 2SO2 + O2 = 2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S + KMnO4 = K2SO4 + MnO2S + 2KMnO4 = K2SO4 + 2MnO2
S + KMnO4 = K2SO4 + MnO2S + 2KMnO4 = K2SO4 + 2MnO2
S + KMnO4 = K2SO4 + MnO2S + 2KMnO4 = K2SO4 + 2MnO2
Sn+P=Sn3P23Sn + 2P = Sn3P2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3(g)+Cu(g)=S4O6+Cu(g)0SO3(g) + Cu(g) = 0S4O6 + Cu(g)
SO3(g)+Cu(g)=S4O6+Cu(g)0SO3(g) + Cu(g) = 0S4O6 + Cu(g)
SO3(g)+Cu(g)=S4O6+Cu(g)0SO3(g) + Cu(g) = 0S4O6 + Cu(g)
Sn + HCl = SnCl + HSn + HCl = SnCl + H
SO4 + NH3 = SO3 + H2O + N23SO4 + 2NH3 = 3SO3 + 3H2O + N2
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO4-- +8e- +6H2O = 10OH- +H2SSO4-- + 4e- + 6H2O = 10OH- + H2S
SO3(g)+H2O(l)=H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
SCl2 + H3N = S4N4 + NH4Cl + S6SCl2 + 16H3N = S4N4 + 12NH4Cl + 2S
Sc2O3 + Cl2 + S2Cl2 = ScCl3 + SOCl22Sc2O3 + 9Cl2 + 3S2Cl2 = 4ScCl3 + 6SOCl2
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sc2O3 + H2O = Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
Sc2O3 + H2O = Sc(OH)3Sc2O3 + 3H2O = 2Sc(OH)3
S+HNO3=H2SO4+N2+H2O-5S - 6HNO3 = -5H2SO4 - 3N2 + 2H2O
S+HNO3=H2SO4+N2+H2O-5S - 6HNO3 = -5H2SO4 - 3N2 + 2H2O
Sn + NO3 = SnO2 + NO2Sn + 2NO3 = SnO2 + 2NO2
Sn + NO3 = SnO2 + NO2Sn + 2NO3 = SnO2 + 2NO2
SrCO3+H2SO4=SrSO4+CO2+H2OSrCO3 + H2SO4 = SrSO4 + CO2 + H2O
Sb2S3+HNO3=HSbO3+H2SO4+NO+H2O3Sb2S3 + 28HNO3 = 6HSbO3 + 9H2SO4 + 28NO + 2H2O
SiH3 + O2 = SiO2 + H2O 4SiH3 + 7O2 = 4SiO2 + 6H2O
SF4+H2O=H2SO3+HFSF4 + 3H2O = H2SO3 + 4HF
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S2Cl2+ NH3 = 12NH4Cl + S4N4 +S86S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + S8
SCl4 + H2O = H2SO3 +HClSCl4 + 3H2O = H2SO3 + 4HCl
S2Cl2+ NH3 = 12NH4Cl + S4N4 +S86S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + S8
SO2(g) + NaOH(s) = Na2SO3(s) + H2O(l)SO2(g) + 2NaOH(s) = Na2SO3(s) + H2O(l)
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
Si+O=SiO2Si + 2O = SiO2
Sn + KOH = K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
Sn+ KOH = K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
SnSO4+K2S=SnS+K2SO4SnSO4 + K2S = SnS + K2SO4
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2(g) + O2(g) = SO3(g) 2SO2(g) + O2(g) = 2SO3(g)
S (s) + O2(g) = SO3 (g)2S(s) + 3O2(g) = 2SO3(g)
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
Si+S8=Si2S44Si + S8 = 2Si2S4
S8+SrBr2=Br+Sr4SS8 + 32SrBr2 = 64Br + 8Sr4S
SiF4+H2O=HF+SiO2SiF4 + 2H2O = 4HF + SiO2
S+CO=SO2+CS + 2CO = SO2 + 2C
ScF3 + K = Sc + KFScF3 + 3K = Sc + 3KF
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
SiCl4 + Mg=MgCl2 + SiSiCl4 + 2Mg = 2MgCl2 + Si
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
SO3 + H2O=H2SO4SO3 + H2O = H2SO4
Si5H11S + S2 = SiS2 + H2S4Si5H11S + 29S2 = 20SiS2 + 22H2S
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
SO2+H2S=H2O+SSO2 + 2H2S = 2H2O + 3S
Sn + HNO3 + HCl = SnCl4 + NO + H2O3Sn + 4HNO3 + 12HCl = 3SnCl4 + 4NO + 8H2O
Sb2O3 + NaOH = NaSbO2 + H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
SCl4+H2O=H2SO3+HClSCl4 + 3H2O = H2SO3 + 4HCl
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
S+2Cl=S2Cl22S + 2Cl = S2Cl2
SnCl2 + I2 + HCl = SnCl4 + HISnCl2 + I2 + 2HCl = SnCl4 + 2HI
SnO2 + C = Sn + CO2SnO2 + C = Sn + CO2
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
Sr(s)+H2O(l)=Sr(OH)2(aq)+H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiO2 + Ca3(PO4)2 + C = CO + CaSiO3 + P46SiO2 + 2Ca3(PO4)2 + 10C = 10CO + 6CaSiO3 + P4
SiO +Ca3(PO4)2 +C =CO +CaSiO3 + P46SiO + 2Ca3(PO4)2 + 4C = 4CO + 6CaSiO3 + P4
SiO +Ca(PO4)2 +C =CO +CaSiO3 + P42SiO + 2Ca(PO4)2 + 12C = 12CO + 2CaSiO3 + P4
SO2+O2=SO32SO2 + O2 = 2SO3
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S8+O2=SOS8 + 4O2 = 8SO
S8+O2=SOS8 + 4O2 = 8SO
SnF2+Na3PO4=Sn3(PO4)2+NaF3SnF2 + 2Na3PO4 = Sn3(PO4)2 + 6NaF
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
S(s) + O2(g) = SO3 (g) 2S(s) + 3O2(g) = 2SO3(g)
S + HNO3 = SO2 + 4NO2 + H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
Sn+HCl=SnCl2+H2Sn + 2HCl = SnCl2 + H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si5H11S + S2 = SiS2 + H2S4Si5H11S + 29S2 = 20SiS2 + 22H2S
Sr(OH)2+HNO3 = Sr(NO3)2+H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
Sr(OH)2+HNO3 = Sr(NO3)2+H2OSr(OH)2 + 2HNO3 = Sr(NO3)2 + 2H2O
Si2Cl6 + H2O = SiO2 + HCl +H2Si2Cl6 + 4H2O = 2SiO2 + 6HCl + H2
SH + O2 = 3SO2 + 2H2O4SH + 5O2 = 4SO2 + 2H2O
SH + O2 = 3SO2 + 2H2O4SH + 5O2 = 4SO2 + 2H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S+CO = SO2+CS + 2CO = SO2 + 2C
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2(g) + O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8 + O2=SO2S8 + 8O2 = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl4 (l) + H2O (l) = SiO2 (s) + HCl (aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SiO2+C=Si+CO2SiO2 + C = Si + CO2
Si2Cl6 + H2O = SiO2 + HCl + HSi2Cl6 + 4H2O = 2SiO2 + 6HCl + 2H
Si2Cl6+H2O=SiO2+HCl+H2Si2Cl6 + 4H2O = 2SiO2 + 6HCl + H2
Sb2S3 + HCl = SbCl3 + H2S Sb2S3 + 6HCl = 2SbCl3 + 3H2S
SO3=SO2+O22SO3 = 2SO2 + O2
Sb2O3 + NaOH = NaSbO2 + H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
Sn+O2=SnO2Sn + O2 = SnO2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2O3 + NaOH = NaSbO2 + H2OSb2O3 + 2NaOH = 2NaSbO2 + H2O
Sr + H2O = Sr(H2)OSr + H2O = Sr(H2)O
S+KMnO4=K2SO4+MnO2S + 2KMnO4 = K2SO4 + 2MnO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
SnO2 + 2 H2 = Sn + 2 H2OSnO2 + 2H2 = Sn + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S8 (g) + O2 (g) = SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O3SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O
SO3 (g) = O2 (g) + SO2 (g)2SO3(g) = O2(g) + 2SO2(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si5H11+Br2=Si+HBr2Si5H11 + 11Br2 = 10Si + 22HBr
S + F2 = F6SS + 3F2 = F6S
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
S8+O2=SO3S8 + 12O2 = 8SO3
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SCl2 + NaF = S4F4 + S2Cl2 + Na2Cl20SCl2 + 4NaF = S4F4 - 2S2Cl2 + 2Na2Cl2
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SCl2 + NaF = S4F4 + S2Cl2+ Na2Cl20SCl2 + 4NaF = S4F4 - 2S2Cl2 + 2Na2Cl2
SCl2 + NaF = S4F4 + S2Cl2+ Na2Cl20SCl2 + 4NaF = S4F4 - 2S2Cl2 + 2Na2Cl2
SO2Cl2 + H2O = H2SO4 + HClSO2Cl2 + 2H2O = H2SO4 + 2HCl
Sr(NO3)2+(NH4)2CO3=SrCO3+(NH4)2(NO3)2Sr(NO3)2 + (NH4)2CO3 = SrCO3 + (NH4)2(NO3)2
Sr(NO3)2+Pb(C2H3O2)=Sr(C2H3O2)+Pb(NO3)2Sr(NO3)2 + Pb(C2H3O2) = Sr(C2H3O2) + Pb(NO3)2
Sr(NO3)2+Fe(NO3)3=Sr(NO3)3+Fe(NO3)2Sr(NO3)2 + Fe(NO3)3 = Sr(NO3)3 + Fe(NO3)2
Sr(NO3)2+Pb(C2H3O2)=Sr(C2H3O2)+Pb(NO3)2Sr(NO3)2 + Pb(C2H3O2) = Sr(C2H3O2) + Pb(NO3)2
Si4H10 + O2 = SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g)2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
Sr + O2=2SrO2Sr + O2 = 2SrO
Sr + O2=2SrO2Sr + O2 = 2SrO
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + NaOH = Na2SO3 + H2OSO2 + 2NaOH = Na2SO3 + H2O
SbCl3+H2S=HCl+Sb2S32SbCl3 + 3H2S = 6HCl + Sb2S3
SO2 + O = SO3SO2 + O = SO3
SiO2(s)+3C(s)=SiC(s)+2CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
SrCO3+H2SO4=SrSO4+CO2+H2OSrCO3 + H2SO4 = SrSO4 + CO2 + H2O
SrCO3+H2SO4=SrSO4+CO2+H2OSrCO3 + H2SO4 = SrSO4 + CO2 + H2O
SCl2 + NaF = SF4 + S2Cl2 + NaCl3SCl2 + 4NaF = SF4 + S2Cl2 + 4NaCl
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SO4(g) + O2(g) + H2O(l) = H2SO4(aq)2SO4(g) - O2(g) + 2H2O(l) = 2H2SO4(aq)
Sb2S3+HNO=HSbO3+H2SO4+NO+H2O-1Sb2S3 + 28HNO = -2HSbO3 - 3H2SO4 + 28NO + 18H2O
SO3+NH3=NO+SO2+H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
SO2Cl2 + H2O = H2SO4 + HClSO2Cl2 + 2H2O = H2SO4 + 2HCl
S2Cl2 + NH3 = NH4Cl + S4N4 + S6S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + 8S
SiO2+Ca3(PO4)2+C=CaSiO3+P4+CO6SiO2 + 2Ca3(PO4)2 + 10C = 6CaSiO3 + P4 + 10CO
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
SbI3+Sb(IO3)3+H4SiO4=I2+Sb4(SiO4)3+H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO3+Cu = SO4 + Cu0SO3 + Cu = 0SO4 + Cu
Si4H10 + O2= SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sn+ H2O = SnOH+ H22Sn + 2H2O = 2SnOH + H2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SbI3+Sb(IO3)3+H4SiO4=I2+Sb4(SiO4)3+H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
Sb2S3 + KNO3 + HCl=Sb2O5 + NO2 + K2SO4 + KCl + H2OSb2S3 + 28KNO3 + 22HCl = Sb2O5 + 28NO2 + 3K2SO4 + 22KCl + 11H2O
Sb+Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SIH4 +O2= SIO2 +H205SIH4 + 5O2 = 5SIO2 + H20
SO3 (g) + H2O (l) = H2SO4 (aq) SO3(g) + H2O(l) = H2SO4(aq)
SO2+O2=SO2SO2 - O2 = 2SO
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO3 + NH3 = NO + SO2 + H2O5SO3 + 2NH3 = 2NO + 5SO2 + 3H2O
S+Cl2=S2Cl22S + Cl2 = S2Cl2
SiH4 +N2O = SiO2 + H2 + N2SiH4 + 2N2O = SiO2 + 2H2 + 2N2
SiH4 + NH3 = SiN +H22SiH4 + 2NH3 = 2SiN + 7H2
SF6 + SiO2 = SiF + O2 + SSF6 + 6SiO2 = 6SiF + 6O2 + S
SF6 + SiO2 = SiF + O + SSF6 + 6SiO2 = 6SiF + 12O + S
SF6 + SiN = SiF + S + N2SF6 + 6SiN = 6SiF + S + 3N2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l) Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
S8+SrBr2=Sr+S8Br2S8 + SrBr2 = Sr + S8Br2
Sn(NO3)4 + K2SO3 = KNO3 + Sn(SO3)2Sn(NO3)4 + 2K2SO3 = 4KNO3 + Sn(SO3)2
SCl4+H2O=H2SO3+HClSCl4 + 3H2O = H2SO3 + 4HCl
SO2+O2=SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SO2 + NO2 + H2O = H2SO4 + NOSO2 + NO2 + H2O = H2SO4 + NO
SO2 + KMnO4 + KOH = K2SO4 + MnO2 + H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
SO + H2S = H2O + SSO + H2S = H2O + 2S
SnCl4 + NaOH = NaCl+ Sn(OH)4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S + O2 = SO2S + O2 = SO2
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SO2 + KMnO4 + KOH = K2SO4 + MnO2 +H2O3SO2 + 2KMnO4 + 4KOH = 3K2SO4 + 2MnO2 + 2H2O
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SnCl4 + NaOH = NaCl + Sn ( OH) 4SnCl4 + 4NaOH = 4NaCl + Sn(OH)4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Se+HNO3=SeO2+NO+H2O3Se + 4HNO3 = 3SeO2 + 4NO + 2H2O
SO4-2 + H+ = HSO4-SO4-2 + H+ = HSO4-
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2(SO3)5+Al=Al2(SO3)3+Sb 3Sb2(SO3)5 + 10Al = 5Al2(SO3)3 + 6Sb
Sr(NO3)2 + Na2SO4 = SrSO4 + NaNO3Sr(NO3)2 + Na2SO4 = SrSO4 + 2NaNO3
SO2+O2 = SO32SO2 + O2 = 2SO3
S2Cl2+NH3=S4N4+S8+NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S2Cl2+NH3=NH4Cl+S4N4+S86S2Cl2 + 16NH3 = 12NH4Cl + S4N4 + S8
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+SrBr2=S8Br2+Sr22S8 + 2SrBr2 = 2S8Br2 + Sr2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SnOF2 + H2SiF6 = SnSiF6 + HF + O22SnOF2 + 2H2SiF6 = 2SnSiF6 + 4HF + O2
SnOF2 + H2SiF6 = SnSiF6 + HF + O22SnOF2 + 2H2SiF6 = 2SnSiF6 + 4HF + O2
Sn3O2(OH)2 + H2SiF6 = SnSiF6 + H2OSn3O2(OH)2 + 3H2SiF6 = 3SnSiF6 + 4H2O
SiF4+H2O= H2SiF6+H2SiO33SiF4 + 3H2O = 2H2SiF6 + H2SiO3
Sn6O4(OH)4 + H2SiF6 = SnSiF6 + H2OSn6O4(OH)4 + 6H2SiF6 = 6SnSiF6 + 8H2O
SnOF2 + H2SO4 = SnF2 + SO4 + H2OSnOF2 + H2SO4 = SnF2 + SO4 + H2O
SnOF2 + H2SO4 = SnSO4 + HF + O22SnOF2 + 2H2SO4 = 2SnSO4 + 4HF + O2
SnOF2 + H2SO4 = SnSO4 + HF + OSnOF2 + H2SO4 = SnSO4 + 2HF + O
SnOF2 + H2SO4 = SnSO4 + HF + O22SnOF2 + 2H2SO4 = 2SnSO4 + 4HF + O2
Sn3O2(OH)2 + H2SO4 = SnSO4 + H2OSn3O2(OH)2 + 3H2SO4 = 3SnSO4 + 4H2O
Sn6O4(OH)4 + H2SO4 = SnSO4 + H2OSn6O4(OH)4 + 6H2SO4 = 6SnSO4 + 8H2O
Sn6O4(OH)4 + H2SO4 = SnSO4 + H + OSn6O4(OH)4 + 6H2SO4 = 6SnSO4 + 16H + 8O
Sn6O4(OH)4 + H2SO4 = SnSO4 + 2H2OSn6O4(OH)4 + 6H2SO4 = 6SnSO4 + 8H2O
SiCl4+NH3=Si3N4+NH4Cl3SiCl4 + 16NH3 = Si3N4 + 12NH4Cl
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
S + HNO3 = H2SO4 + NO2 +H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
SnOF2 + e = Sn++ + O-- + F-SnOF2 + 2e = Sn++ + O-- + 2F-
SnOF2 + e = Sn++ + O-- + FSnOF2 + 0e = Sn++ + O-- + 2F
SnOF2 = Sn + O + FSnOF2 = Sn + O + 2F
Sn6H4(OH)4 + H2SO4 + e = Sn++ + HSO4- + O2Sn6H4(OH)4 - 8H2SO4 - 20e = 6Sn++ - 8HSO4- + 2O2
Sn6H4(OH)4 + H2SO4 = Sn + HSO4 + O2Sn6H4(OH)4 - 8H2SO4 = 6Sn - 8HSO4 + 2O2
Sn6H4(OH)4 + H2SO4 = Sn + SO4 + H2OSn6H4(OH)4 + 0H2SO4 = 6Sn + 0SO4 + 4H2O
Sn6H4(OH)4 + e = Sn++++ + H2OSn6H4(OH)4 - 24e = 6Sn++++ + 4H2O
Sn6H4(OH)4 + e = Sn++ + H2OSn6H4(OH)4 - 12e = 6Sn++ + 4H2O
Sn6H4(OH)4 = Sn + H2OSn6H4(OH)4 = 6Sn + 4H2O
SiCl4 + NH3 = NH4Cl + Si3N43SiCl4 + 16NH3 = 12NH4Cl + Si3N4
SiCl4+Mg=MgCl2+SiSiCl4 + 2Mg = 2MgCl2 + Si
SCl2 + NH3 = S4N4 + NH4Cl + S6SCl2 + 16NH3 = S4N4 + 12NH4Cl + 2S
SO2+O2=SO32SO2 + O2 = 2SO3
SO4+O2=SO32SO4 - O2 = 2SO3
SrCO3 + HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
Sb + O2 = Sb2O34Sb + 3O2 = 2Sb2O3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S8 + O2 =SO2 S8 + 8O2 = 8SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(NO3)2 + Na2SO4 = NaNO3 + SrSO4Sr(NO3)2 + Na2SO4 = 2NaNO3 + SrSO4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn + H2SO4 = SnSO4 + SO2 + H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
SbI3 + Sb(IO3)3 + H4SiO4 = I2 + Sb4(SiO4)3 + H2O10SbI3 + 2Sb(IO3)3 + 9H4SiO4 = 18I2 + 3Sb4(SiO4)3 + 18H2O
S+HNO3 =SO2+NO2+H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(NO3)2 + Na3PO4 = Sr3 (PO4)2 + NaNO33Sr(NO3)2 + 2Na3PO4 = Sr3(PO4)2 + 6NaNO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
S+O2=SO32S + 3O2 = 2SO3
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S + O2 = SO2S + O2 = SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr(OH)2 + HI = SrI2 + H2OSr(OH)2 + 2HI = SrI2 + 2H2O
SnSiF6 + H2SiF6 = Sn + H2SiF60SnSiF6 + H2SiF6 = 0Sn + H2SiF6
SnSiF6 + H2SiF6 = Sn + HSiF6SnSiF6 + H2SiF6 = Sn + 2HSiF6
Sn++ + H2SO4 = Sn + SO4-- + H+0Sn++ + H2SO4 = 0Sn + SO4-- + 2H+

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.