Enter Chemical Equation:

Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S8+F2=SF6S8 + 24F2 = 8SF6
Sn+HCl+NO = SnCl2+NH2OH3Sn + 6HCl + 2NO = 3SnCl2 + 2NH2OH
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SbCl3 + Na2S = Sb2S3 + NaCl2SbCl3 + 3Na2S = Sb2S3 + 6NaCl
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SB + Cl2 = SBCl32SB + 3Cl2 = 2SBCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + H2 = Sn+ H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3 + Fe = FeS + SbSb2S3 + 3Fe = 3FeS + 2Sb
S8 + CL2 = S2 CL2S8 + 4CL2 = 4S2CL2
Si+CO=SiC+OSi + CO = SiC + O
SiC+O2=CO2+SiO2SiC + 2O2 = CO2 + SiO2
SiC+O=CO2+SiO2SiC + 4O = CO2 + SiO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S(s)+H2SO4(aq)=SO2(g)+H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
SO2(g)+H2S(g)=S8(g)+H2O(g)8SO2(g) + 16H2S(g) = 3S8(g) + 16H2O(g)
SO3(g)+H2S(g)=S8(g)+H2O(g)2SO3(g) + 6H2S(g) = S8(g) + 6H2O(g)
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SR(OH)2 = SR +OHSR(OH)2 = SR + 2OH
SO2+H2O=SO4+H2O0SO2 + H2O = 0SO4 + H2O
Sn+ KOH= K2SnO2 + H2Sn + 2KOH = K2SnO2 + H2
SO2+O2= SO32SO2 + O2 = 2SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sb + H2SO4 = Sb2(SO4)3 + SO2 + H2O2Sb + 6H2SO4 = Sb2(SO4)3 + 3SO2 + 6H2O
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sb2O3 + H2O = Sb(OH)3Sb2O3 + 3H2O = 2Sb(OH)3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SiF4+H2O=H4SiO4+H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H1O+O2=SiO2+H2O4Si4H1O + 15O2 = 16SiO2 + 2H2O
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SnCl2 + H2O2 + HCl = SnCl4 + H2OSnCl2 + H2O2 + 2HCl = SnCl4 + 2H2O
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sr+Fe2(SO4)3=SrSO4+Fe3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
Si + C3H8O = SiO2 + C3H8Si + 2C3H8O = SiO2 + 2C3H8
Si + CH4O = SiO2 + 2CH4Si + 2CH4O = SiO2 + 2CH4
Si + C2H6O = SiO2 + 2C2H6Si + 2C2H6O = SiO2 + 2C2H6
Si + CH4O = SiO2 + 2CH4Si + 2CH4O = SiO2 + 2CH4
Si + C3H8O = SiO2 + C3H8Si + 2C3H8O = SiO2 + 2C3H8
SiO2 + 2H2SO4 = Si(SO4)2 + 2H2OSiO2 + 2H2SO4 = Si(SO4)2 + 2H2O
SiO2 + H2SO4 = Si(SO4)2 + 2H2OSiO2 + 2H2SO4 = Si(SO4)2 + 2H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
S + O2 = SO2S + O2 = SO2
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3(g) = O2(g) + SO2(g)2SO3(g) = O2(g) + 2SO2(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+ HNO3 = SO2+NO2+H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
S+ HNO3 = SO2+NO2+H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
S+ HNO3=SO2+NO2+H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
Si4H10(l) +O2(g) = SiO2(s) + H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sr + O2 = SrO2Sr + O2 = 2SrO
Sr + O = SrOSr + O = SrO
SiO2 + 4HF = SiF4 + 2H2OSiO2 + 4HF = SiF4 + 2H2O
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO3+MnO4=MnO2+SO42SO3 + MnO4 = MnO2 + 2SO4
Sn2 + O2 = SnO2Sn2 + 2O2 = 2SnO2
Sn + O2 = SnO2Sn + O2 = SnO2
SnO2 (s) + C(s) = Sn(l) +CO2 (g)SnO2(s) + C(s) = Sn(l) + CO2(g)
SnO2 (s) + C(s)= Sn(l) +CO2 (g)SnO2(s) + C(s) = Sn(l) + CO2(g)
S2+O3S=S2O5S2 + 2O3S = 6S2O
S2+O3=S2O3S2 + O3 = 3S2O
S2+O3S=S2O5S2 + 2O3S = 6S2O
S2+O3=S2O3S2 + O3 = 3S2O
S + HNO3 = H2SO4 + NO S + 2HNO3 = H2SO4 + 2NO
So2+Na2Cr2O7+H2O=Na2So4+Cr2(So4)3+H2O0So2 + 0Na2Cr2O7 + H2O = 0Na2So4 + 0Cr2(So4)3 + H2O
So2+Na2Cr2O7+H2O=Na2So4+Cr2(So4)3+H2O0So2 + 0Na2Cr2O7 + H2O = 0Na2So4 + 0Cr2(So4)3 + H2O
So2+Na2Cr2O7+H2O=Na2So4+Cr2(So4)3+H2O0So2 + 0Na2Cr2O7 + H2O = 0Na2So4 + 0Cr2(So4)3 + H2O
Sb+HNO3+H2O=HSb(OH)6+NO2Sb + 5HNO3 + H2O = HSb(OH)6 + 5NO2
Sr(OH)2+HI=SrI+H2O+O2Sr(OH)2 + 2HI = 2SrI + 3H2O + O
SO2+Na2CrO4+H2SO4= Na2SO4+ Cr2 (SO4)3+ H2O3SO2 + 2Na2CrO4 + 2H2SO4 = 2Na2SO4 + Cr2(SO4)3 + 2H2O
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn(OH)3- + Bi(OH)3 + OH- =Sn(OH)6-- + Bi3Sn(OH)3- + 2Bi(OH)3 + 3OH- = 3Sn(OH)6-- + 2Bi
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO2S + O2 = SO2
Si4H10 +O2 =SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SrBr2+(NH4)2CO3=SrCO3+NH4BrSrBr2 + (NH4)2CO3 = SrCO3 + 2NH4Br
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2(g)+C(s)=CS2(l)+CO(g)2SO2(g) + 5C(s) = CS2(l) + 4CO(g)
S8+ O2= SO3S8 + 12O2 = 8SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si + HNO3 = SiO2 + NO2 +H2OSi + 4HNO3 = SiO2 + 4NO2 + 2H2O
SO2 +H20=H2S+O210SO2 + H20 = 10H2S + 10O2
Sn+P4=Sn3P43Sn + P4 = Sn3P4
SO2(g)+H2S(g)=S8(l)+H2O(g)8SO2(g) + 16H2S(g) = 3S8(l) + 16H2O(g)
S(s)+H2SO4(aq)=SO2(g)+H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
SO4 + BaCl = Cl + BaSO4SO4 + BaCl = Cl + BaSO4
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Si(s) + HF(aq) = SiF4(g) + H2(g)Si(s) + 4HF(aq) = SiF4(g) + 2H2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO3S8 + 12O2 = 8SO3
S + HNO3 + H2O = H2SO4 + NO99-193S + 6HNO3 - 196H2O = -193H2SO4 + 6NO99
S + HNO3 + H2O = H2SO4 + NOS + 2HNO3 + 0H2O = H2SO4 + 2NO
Sn + 2NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sr(NO3)2 + NaF = NaNO3 + SrF2Sr(NO3)2 + 2NaF = 2NaNO3 + SrF2
Sb(OH)3 + Na2S = Na2(OH)3 + SbSSb(OH)3 + Na2S = Na2(OH)3 + SbS
SiCl4 + H2O = Si(OH)4 + HClSiCl4 + 4H2O = Si(OH)4 + 4HCl
Sn + H3PO4 = H2 + Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
S + O2 = SO32S + 3O2 = 2SO3
SiO2+ C = SiC + COSiO2 + 3C = SiC + 2CO
S+HNO3= H2SO4+NOS + 2HNO3 = H2SO4 + 2NO
SF4+H2O=SO2+HFSF4 + 2H2O = SO2 + 4HF
Sn+H2SO4=Sn(SO4)2+H2SO3+H2OSn + 4H2SO4 = Sn(SO4)2 + 2H2SO3 + 2H2O
Sn2(SO4)2+K2Cr2O7+H2SO4=Sn2(SO4)4+K2SO4+Cr(SO4)2+H2OSn2(SO4)2 + K2Cr2O7 + 7H2SO4 = Sn2(SO4)4 + K2SO4 + 2Cr(SO4)2 + 7H2O
Sn2(SO4)2+K2Cr2O7+H2SO4=Sn2(SO4)4+KSO4+Cr(SO4)2+H2OSn2(SO4)2 + 2K2Cr2O7 + 14H2SO4 = Sn2(SO4)4 + 4KSO4 + 4Cr(SO4)2 + 14H2O
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sn+H2SO4=Sn(SO4)2+H2SO3+H2OSn + 4H2SO4 = Sn(SO4)2 + 2H2SO3 + 2H2O
SO2Cl2+ HI = H2S + H2O + HCl + I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SnCl + NaOH= Sn(OH)+NaClSnCl + NaOH = Sn(OH) + NaCl
SnCl + HNO3=SnNO3+HClSnCl + HNO3 = SnNO3 + HCl
Sr(OH)2+FE(NO3)3=Sr(NO3)3+FE(OH)2Sr(OH)2 + FE(NO3)3 = Sr(NO3)3 + FE(OH)2
Sr(OH)2+FE(NO3)3=Sr(NO3)3+FE(OH)2Sr(OH)2 + FE(NO3)3 = Sr(NO3)3 + FE(OH)2
Sr +H2O = Sr(OH) + H22Sr + 2H2O = 2Sr(OH) + H2
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + NO3 = SN++ + SO---- + N-9S - NO3 = -6SN++ - 3SO---- + 5N
S + NO3 = SN++ + SO---- + N-9S - NO3 = -6SN++ - 3SO---- + 5N
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sn(NO3)2 + 2KOH = Sn(OH)2 + 2KNO3Sn(NO3)2 + 2KOH = Sn(OH)2 + 2KNO3
SFe + NO3 = NO + SO4 + FeSFe + 2NO3 = 2NO + SO4 + Fe
SnCl2(H2O)2 + 2NaOH = Sn(OH)2 + 2Na Cl + 2H2O SnCl2(H2O)2 + 2NaOH = Sn(OH)2 + 2NaCl + 2H2O
Sn+H3PO4=H2+Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
Sn + HNO3=Sn(NO3)4+NO+H2O3Sn + 16HNO3 = 3Sn(NO3)4 + 4NO + 8H2O
Sn + HNO3=Sn(NO3)4+NO+H2O3Sn + 16HNO3 = 3Sn(NO3)4 + 4NO + 8H2O
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SnCl + HNO3=SnNO3+HClSnCl + HNO3 = SnNO3 + HCl
SnCl + NaOH= Sn(OH)+NaClSnCl + NaOH = Sn(OH) + NaCl
SO3 + H2O =H2SO4SO3 + H2O = H2SO4
SnCl2+H2SO4+HCl=SnCl4+H2S+H2O4SnCl2 + H2SO4 + 8HCl = 4SnCl4 + H2S + 4H2O
S2-+2NO-2= S+NO-2S2- + NO-2 = -4S + NO
S2-+2NO-2=S+NO-2S2- + NO-2 = -4S + NO
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
SrCl2+K3PO4=Sr3(PO4)2+KCl3SrCl2 + 2K3PO4 = Sr3(PO4)2 + 6KCl
SrCl2+Na2CO3=NaCl+Sr2(CO3)22SrCl2 + 2Na2CO3 = 4NaCl + Sr2(CO3)2
SrCl2+Mg(NO3)2=Sr(NO3)2+MgCl2SrCl2 + Mg(NO3)2 = Sr(NO3)2 + MgCl2
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sn + HNO3 = H2SnO3 + H2O + NO2Sn + 4HNO3 = H2SnO3 + H2O + 4NO2
SeO2 + (CH3)2CNOH = Se + (CH3)2NOH + NH3 +N23SeO2 + 12(CH3)2CNOH = 3Se + 18(CH3)2NOH - 14NH3 + 4N2
SeO2 + (CH3)2CNOH = Se + (CH3)2NOH + NH3 +NO211SeO2 + 12(CH3)2CNOH = 11Se + 18(CH3)2NOH - 14NH3 + 8NO2
SeO2 + (CH3)2CNOH = Se + (CH3)2NOH + NH3+ H2OSeO2 - 4(CH3)2CNOH = Se - 6(CH3)2NOH + 2NH3 + 4H2O
SeO2 + (CH3)2CNOH = Se + CH3CH3NOH + NH3+ H2OSeO2 - 4(CH3)2CNOH = Se - 6CH3CH3NOH + 2NH3 + 4H2O
SeO2 + (CH3)2CNOH = HSe + CH3CH3NOH + NH3+ H2O2SeO2 - 10(CH3)2CNOH = 2HSe - 15CH3CH3NOH + 5NH3 + 9H2O
SeO2+(CH3)2CNOH = SeO3 + CH3CH3NOH + NH3 +HSe13SeO2 - 2(CH3)2CNOH = 9SeO3 - 3CH3CH3NOH + NH3 + 4HSe
SeO2+(CH3)2CNOH = Se + CH3CH3NOH + NH3 +HSe-1SeO2 - 4(CH3)2CNOH = -9Se - 6CH3CH3NOH + 2NH3 + 8HSe
SeO2+(CH3)2CNOH = Se + CH3CH3NOH + NH3 +HSeO311SeO2 - 4(CH3)2CNOH = 3Se - 6CH3CH3NOH + 2NH3 + 8HSeO3
SeO2+(CH3)2CNOH = Se + CH3CH3NOH + NH3 +HCNSeO2 + 8(CH3)2CNOH = Se + 10CH3CH3NOH - 6NH3 + 4HCN
SeO2+(CH3)2CNOH = Se + CH3CH3NOH + NH3 +H-1SeO2 - 4(CH3)2CNOH = -1Se - 6CH3CH3NOH + 2NH3 + 8H
SeO2+(CH3)2CNOH = Se + CH3CH3NOH + NH3 +OH3SeO2 - 4(CH3)2CNOH = 3Se - 6CH3CH3NOH + 2NH3 + 8OH
SeO2+(CH3)2CNOH = Se + CH3CH3NOH + NH3 +H2OSeO2 - 4(CH3)2CNOH = Se - 6CH3CH3NOH + 2NH3 + 4H2O
SnO2+C=Sn+CO2SnO2 + C = Sn + CO2
Sb2O3+SbCl3=Sb4O5Cl25Sb2O3 + 2SbCl3 = 3Sb4O5Cl2
SeO2+(CH3)2CNOH=Se+CH3CH3NH+(CH3)2CNOH0SeO2 + (CH3)2CNOH = 0Se + 0CH3CH3NH + (CH3)2CNOH
SeO2+N2H4+CH3CH2OH=Se+C6H5CH2CONHNH2+H2O3SeO2 + N2H4 + 4CH3CH2OH = 3Se + C6H5CH2CONHNH2 + 9H2O
SeO2+N2H4+H2O+CH3CH2OH=Se+C6H5CH2CONHNH23SeO2 + N2H4 - 9H2O + 4CH3CH2OH = 3Se + C6H5CH2CONHNH2
SeO2+C2H10N2O6=Se+NO2+C2H10O4SeO2 + C2H10N2O6 = Se + 2NO2 + C2H10O4
SeO2+C2H10N2O6=Se+NO2+C2H10O62SeO2 + C2H10N2O6 = 2Se + 2NO2 + C2H10O6
SeO2+C2H10N2O6=Se+NO2+C2H10O4SeO2 + C2H10N2O6 = Se + 2NO2 + C2H10O4
SeO2+CH3CH2OOH+H2O=Se+(CH3CO2)2CHCH3SeO2 + 3CH3CH2OOH - 4H2O = Se + (CH3CO2)2CHCH3
SeO2+CH3CH2OOH+H2O=Se+(CH3CO2)2CHCH3SeO2 + 3CH3CH2OOH - 4H2O = Se + (CH3CO2)2CHCH3
SeO2+CH3CH2OOH+OH=Se+(CH3CO2)2CHCH33SeO2 + 3CH3CH2OOH - 8OH = 3Se + (CH3CO2)2CHCH3
SeO2+CH3CH2OOH+H2O=Se+(CH3CO2)2CHCH3SeO2 + 3CH3CH2OOH - 4H2O = Se + (CH3CO2)2CHCH3
SeO2+CH3CH2OOH+OH=Se+(CH3CO2)2CHCH33SeO2 + 3CH3CH2OOH - 8OH = 3Se + (CH3CO2)2CHCH3
SeO2+CH3CH2OOH+H2O=Se+(CH3CO2)2CHCH3SeO2 + 3CH3CH2OOH - 4H2O = Se + (CH3CO2)2CHCH3
SO2(g)+H2O(l)=H2SO3(aq)SO2(g) + H2O(l) = H2SO3(aq)
SnO2(s) + 2 H2(g)= Sn(s) + 2 H2O(g)SnO2(s) + 2H2(g) = Sn(s) + 2H2O(g)
Se+Bi(NO3)3+H2O=Bi2Se3+NO2+OH3Se + 2Bi(NO3)3 + 6H2O = Bi2Se3 + 6NO2 + 12OH
Se+Bi(NO3)3+H2O=Bi2Se3+NO2+OH3Se + 2Bi(NO3)3 + 6H2O = Bi2Se3 + 6NO2 + 12OH
Se+Bi(NO3)3+H2O=Bi2Se3+NO2+H2O0Se + 0Bi(NO3)3 + H2O = 0Bi2Se3 + 0NO2 + H2O
Se+Bi(NO3)3+H2O=Bi2Se3+NO2+H20-15Se - 10Bi(NO3)3 + 30H2O = -5Bi2Se3 - 30NO2 + 3H20
SeO2+C2H4(NH2)2+HNO3=Se+C2H4(NO2)2+NH3-1SeO2 + C2H4(NH2)2 + 2HNO3 = -1Se + C2H4(NO2)2 + 2NH3
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn++ + Br2 = Sn++++ + Br-Sn++ + Br2 = Sn++++ + 2Br-
Sn++ + Br2 = Sn+++++ + Br-2Sn++ + 3Br2 = 2Sn+++++ + 6Br-
Sn++ + Br2 = Sn++++ + Br-Sn++ + Br2 = Sn++++ + 2Br-
Sn++ + Br2 = Sn+ + Br--2Sn++ + Br2 = -2Sn+ + 2Br-
Sn++ + Br2 = Sn+++ + Br-2Sn++ + Br2 = 2Sn+++ + 2Br-
Sn+HNO3=SnO2 + H2O + NO2Sn + 4HNO3 = SnO2 + 2H2O + 4NO2
SiO2(s)+C(s)=Si+CO2(g)SiO2(s) + C(s) = Si + CO2(g)
S + 3Fe2(SO4)3 + 4H2O = 6FeSO4 + 4H2SO4S + 3Fe2(SO4)3 + 4H2O = 6FeSO4 + 4H2SO4
S + 3Fe2(SO4)3 + 4H2O = 6FeSO4 + 4H2SO4S + 3Fe2(SO4)3 + 4H2O = 6FeSO4 + 4H2SO4
SeO2+CH3OH=Se+CH3COOH+H20SeO2 + 2CH3OH = 0Se + CH3COOH + 2H2
SeO2+(CH3)2CNOH=Se+CH3COOH+CH3CN+H0SeO2 + 2(CH3)2CNOH = 0Se + CH3COOH + 2CH3CN + 4H
SeO2+(CH3)2CNOH=Se+CH3COOH+CH3CN+H2OSeO2 + 2(CH3)2CNOH = Se + CH3COOH + 2CH3CN + 2H2O
SeO2+H2O+(CH3)2CNOH=Se+CH3COOH+CH3CNSeO2 - 2H2O + 2(CH3)2CNOH = Se + CH3COOH + 2CH3CN
SeO2+H2O+(CH3)2CNOH=Se+CH3COOH+CH3CNSeO2 - 2H2O + 2(CH3)2CNOH = Se + CH3COOH + 2CH3CN
Si + 4 F2 = SiF4Si + 2F2 = SiF4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sb + HNO3 = Sb2O5 + NO +H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sn + H2SO4 = SnSO4 + SO2 + H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
S + HCl = SH + ClS + HCl = SH + Cl
S + HCl = SH + ClS + HCl = SH + Cl
S + HNO3 = H2SO4 + NO S + 2HNO3 = H2SO4 + 2NO
S + HNO3 = H2SO4 + NO S + 2HNO3 = H2SO4 + 2NO
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2(g)+H2S(g)=S8(l)+H2O(g)8SO2(g) + 16H2S(g) = 3S8(l) + 16H2O(g)
SO3(g) = SO2(g) + O2(g)2SO3(g) = 2SO2(g) + O2(g)
Sb(s) + O2(g) = Sb2O5(s)4Sb(s) + 5O2(g) = 2Sb2O5(s)
Sn(NO2)4 + K3PO4 = KNO2 + Sn3(PO4)43Sn(NO2)4 + 4K3PO4 = 12KNO2 + Sn3(PO4)4
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + NaOH = Na2SO4 + Na2S + H2O4S + 8NaOH = Na2SO4 + 3Na2S + 4H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S + KOH = K2SO4 + K2S + H2O4S + 8KOH = K2SO4 + 3K2S + 4H2O
S + KOH = K2SO4 + K2S + H2O4S + 8KOH = K2SO4 + 3K2S + 4H2O
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SbCl5 + KI = 2KCl + I2 + SbCl3SbCl5 + 2KI = 2KCl + I2 + SbCl3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8 + O2 = SO2S8 + 8O2 = 8SO2
S8+HNO3=H2SO4+NO2+H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
Sn + NH4F= (NH4)2SnF6 + NH3 + H2Sn + 6NH4F = (NH4)2SnF6 + 4NH3 + 2H2
Sn + NH4F= (NH4)2SnF6 + NH3 + H2Sn + 6NH4F = (NH4)2SnF6 + 4NH3 + 2H2
Sn+ S= SnSSn + S = SnS
Sn+HF=SnF2+H2Sn + 2HF = SnF2 + H2
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
Sr(NO3)2 + H2SO4 = 2HNO3 + SrSO4 Sr(NO3)2 + H2SO4 = 2HNO3 + SrSO4
Sn + H2SO4 = SnSO4 + SO2 + H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
Sb2S3 + HCl = SbCl3 + H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S2Cl2+NH3=S4N4+S8+NH4Cl6S2Cl2 + 16NH3 = S4N4 + S8 + 12NH4Cl
Si(s) + HF(aq) = SiF4(g) + H2Si(s) + 4HF(aq) = SiF4(g) + 2H2
SO3 + H2O =H2SO4SO3 + H2O = H2SO4
Sn + H3PO4 = H2 + Sn3(PO4)4 3Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+O2+H2O=H2SO42S + 3O2 + 2H2O = 2H2SO4
S8+ F2= SF6S8 + 24F2 = 8SF6
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S + NO3- + H = SO2 + NO + H2O-1S + 0NO3- + 4H = -1SO2 + 0NO + 2H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sc2O3(s) + H2O(l) = Sc(OH)3(s)Sc2O3(s) + 3H2O(l) = 2Sc(OH)3(s)
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr(NO3)2 + Li2SO4 = LiNO3 + SrSO4Sr(NO3)2 + Li2SO4 = 2LiNO3 + SrSO4
SO2+O2=SO32SO2 + O2 = 2SO3
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+P=Sn3P43Sn + 4P = Sn3P4
Sb2S3 + Na2CO3 + C = Sb + Na2S + COSb2S3 + 3Na2CO3 + 6C = 2Sb + 3Na2S + 9CO
Sr + P4 = Sr3P26Sr + P4 = 2Sr3P2
Sb + SO3 = Sb4O6 + S816Sb + 8SO3 = 4Sb4O6 + S8
S03 + Cl2O = S2O6 + Cl2S03 + 18Cl2O = 3S2O6 + 36Cl
Sr +P4=Sr3P26Sr + P4 = 2Sr3P2
Sb + SO3 = Sb4O6 + S816Sb + 8SO3 = 4Sb4O6 + S8
Si2H3 + O2=SiO2 + H2O 4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Si2Cl6(aq)+H2O(l)=HCl(g)+SiO2(s)+H2(g)Si2Cl6(aq) + 4H2O(l) = 6HCl(g) + 2SiO2(s) + H2(g)
S2Cl2(l) + NH3(g) =S4N4(s) + S8(s) + NH4Cl(s)6S2Cl2(l) + 16NH3(g) = S4N4(s) + S8(s) + 12NH4Cl(s)
Sc2O3(s) + H2O(l) = Sc(OH)3(s)Sc2O3(s) + 3H2O(l) = 2Sc(OH)3(s)
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sr +P4=Sr3P26Sr + P4 = 2Sr3P2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2Cl2 +HI = H2S +H2O+HCl+I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SO2Cl3 +HI = H2S +H2O+HCl+I22SO2Cl3 + 18HI = 2H2S + 4H2O + 6HCl + 9I2
S8(s) + 8 H2(g) = 8 H2S(g)S8(s) + 8H2(g) = 8H2S(g)
SnCl4 + O2 =Sn(ClO3)4SnCl4 + 6O2 = Sn(ClO3)4
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Si O2 + C = Si C + CO SiO2 + 3C = SiC + 2CO
Sn+2HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+O2=SO3S8 + 12O2 = 8SO3
Sb2S3(s) + HCl(aq) = SbCl3(s) + H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SbCl3+C3H6O=Sb+CH3Cl+CH3COCl2SbCl3 + 3C3H6O = 2Sb + 3CH3Cl + 3CH3COCl
SbCl3+C3H6O=Sb+CH3Cl+CH3COSbCl3 + 3C3H6O = Sb + 3CH3Cl + 3CH3CO
SbCl3+C3H6O=Sb+HCl+OH+CO211SbCl3 + 3C3H6O = 11Sb + 33HCl - 15OH + 9CO2
SiO2 + 3C = SiC + COSiO2 + 3C = SiC + 2CO
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SnSO4+K2Cr2O7+H2SO4=Sn2(SO4)3+Cr2(SO4)3+K2SO4+H2O6SnSO4 + K2Cr2O7 + 7H2SO4 = 3Sn2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
SnSO4+K2Cr2O7+H2SO4=Sn2(SO4)3+Cr2(SO4)3+K2SO4+H2O6SnSO4 + K2Cr2O7 + 7H2SO4 = 3Sn2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
SbCl3+C3H6O=Sb+HCl+CO2+H2O-16SbCl3 - 3C3H6O = -16Sb - 48HCl - 9CO2 + 15H2O
S8 + AsF5 = S16 (AsF6)2 + AsF32S8 + 3AsF5 = S16(AsF6)2 + AsF3
Si4 H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
S(s)+O2(g)=SO2S(s) + O2(g) = SO2
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+H2O+O2=H2SO42SO2 + 2H2O + O2 = 2H2SO4
SO2 + KMnO4 + H2O = MnSO4 + K2SO4 + H2SO45SO2 + 2KMnO4 + 2H2O = 2MnSO4 + K2SO4 + 2H2SO4
SO2 + NaOH = Na2SO3 + H2OSO2 + 2NaOH = Na2SO3 + H2O
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn + HCl =SnCl3 + H22Sn + 6HCl = 2SnCl3 + 3H2
SO3 +H2O = H2SO4SO3 + H2O = H2SO4
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
Sn (s) + P (s) = Sn3P2 (s) 3Sn(s) + 2P(s) = Sn3P2(s)
Si + F = SiF4Si + 4F = SiF4
SO2CI2 + HI =H2S + H2O + HCI + I2SO2CI2 + 7HI = H2S + 2H2O + HCI + 4I2
Sr(NO3)2 = SrO + NO2 + O22Sr(NO3)2 = 2SrO + 4NO2 + O2
Sr(NO3)2 + C2H5NO3 = SrO + NO2 + H2O +CO2 11Sr(NO3)2 + 2C2H5NO3 = 11SrO + 24NO2 + 5H2O + 4CO2
Sr(NO3)2 + C2H5NO3 = SrO + NO2 + H2O +CO2 11Sr(NO3)2 + 2C2H5NO3 = 11SrO + 24NO2 + 5H2O + 4CO2
Sr(NO3)2 + C2H5NO3 = SrO + NO2 + H2O +CO211Sr(NO3)2 + 2C2H5NO3 = 11SrO + 24NO2 + 5H2O + 4CO2
SO3+H2O=H2SO4SO3 + H2O = H2SO4
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
SO2+O2+4H2O=2H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SiO2+C+Cl2=CO+SiCl4SiO2 + 2C + 2Cl2 = 2CO + SiCl4
SiO2+C+Cl2=CO+SiCl4SiO2 + 2C + 2Cl2 = 2CO + SiCl4
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S + HNO3 = H2O + H2SO4 + NOS + 2HNO3 = 0H2O + H2SO4 + 2NO
S8(s) + O2(g) = SO2(g)S8(s) + 8O2(g) = 8SO2(g)
Sr+HNO3=Sr(NO3)2+H2Sr + 2HNO3 = Sr(NO3)2 + H2
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
S8(s) + O2(g) = SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SiC+Cl2=SiCl4+CSiC + 2Cl2 = SiCl4 + C
SiC+Cl=SiCl4+CSiC + 4Cl = SiCl4 + C
S8+F2=SF6S8 + 24F2 = 8SF6
S8(s) + O2(g) =SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SnO+NF3= SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
S+6HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sn(s)+HNO3(aq)=SnO2(s)+NO2(g)+H2O(l)Sn(s) + 4HNO3(aq) = SnO2(s) + 4NO2(g) + 2H2O(l)
SO2Cl2+HI=H2S+H2O+HCl+I2SO2Cl2 + 8HI = H2S + 2H2O + 2HCl + 4I2
SnS2 + NaOH = Sn (OH)6 + Na + SSnS2 + 6NaOH = Sn(OH)6 + 6Na + 2S
Sn + NaS = SnS2 + NaSn + 2NaS = SnS2 + 2Na
Sb2S3 + NaOH= Sb(OH)4 + Na + SSb2S3 + 8NaOH = 2Sb(OH)4 + 8Na + 3S
Sb + Na2S = Sb2S3 + Na2Sb + 3Na2S = Sb2S3 + 6Na
SO2 + H2S = H2O + SSO2 + 2H2S = 2H2O + 3S
SO2=S8+O28SO2 = S8 + 8O2
S +O2 = SO2S + O2 = SO2
S +O = SO2S + 2O = SO2
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(C2H3O2) + MgSO4 = SrSO4 + MgC2H3O2Sr(C2H3O2) + MgSO4 = SrSO4 + MgC2H3O2
S +6HNO3 = H2SO4 +NO2 +H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Sb2S3(s)+HCl(aq)=SbCl3(s)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(s) + 3H2S(g)
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
SO2 + H2S = S + H2OSO2 + 2H2S = 3S + 2H2O
SO2 + MgO = MgSO3SO2 + MgO = MgSO3
S + OH- = S- + S2O3 -- + H2O6S + 6OH- = 4S- + S2O3-- + 3H2O
S + OH- = S- + S4O6 - + H2O15S + 12OH- = 11S- + S4O6- + 6H2O
S + OH- = S- + S2O3 2- + H2O65S + 64OH- = 63S- + S2O32- + 32H2O
S + OH- = S- + (S2O3)2- + H2O15S + 12OH- = 11S- + (S2O3)2- + 6H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sr + Se = SrSeSr + Se = SrSe
Sr + Se = SrSeSr + Se = SrSe
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SeCl6 + O2 = SeO2 + Cl2 SeCl6 + O2 = SeO2 + 3Cl2
SO2+O2=SO32SO2 + O2 = 2SO3
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnCl4+H2O=SnO2+HClSnCl4 + 2H2O = SnO2 + 4HCl
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO3 + Ca(OH)2 = CaSO4 + H2OSO3 + Ca(OH)2 = CaSO4 + H2O
SO2 + Ca(OH)2 = CaSO3 + H2OSO2 + Ca(OH)2 = CaSO3 + H2O
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Sb+O2=Sb2O54Sb + 5O2 = 2Sb2O5
S8(s)+O2(g)= SO2(g)S8(s) + 8O2(g) = 8SO2(g)
SrSO4 = Sr + SO4SrSO4 = Sr + SO4
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+KOH=K2SO3+K2S+H2O3S + 6KOH = K2SO3 + 2K2S + 3H2O
SrCO3 + HClO4 = Sr(ClO4)2 + CO2 + H2OSrCO3 + 2HClO4 = Sr(ClO4)2 + CO2 + H2O
S8+HNO3=H2SO4+NO2+H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO2 + CaCO3 + O2 + 2H2O = CaSO4*2H2O + CO2 2SO2 + 2CaCO3 + O2 + 4H2O = 2CaSO4*2H2O + 2CO2
SO2+O2=SO32SO2 + O2 = 2SO3
S + O2 = SO2S + O2 = SO2
Sn + HBr = SnBr2 + H2 Sn + 2HBr = SnBr2 + H2
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SO2Ci2+ HI= H2S+H2O+HCi+I2SO2Ci2 + 8HI = H2S + 2H2O + 2HCi + 4I2
S+CO=SO2+CS + 2CO = SO2 + 2C
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+HNO3=NO+H2SO4+H2O-3SO2 - 2HNO3 = -2NO - 3H2SO4 + 2H2O
SO2 + O2 =SO32SO2 + O2 = 2SO3
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S(s)+O2(g)=2SO2S(s) + O2(g) = SO2
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
S(s)+O2(g)=SO2S(s) + O2(g) = SO2
Sn+P=Sn3P23Sn + 2P = Sn3P2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnO+NF3=SnF2+N2O33SnO + 2NF3 = 3SnF2 + N2O3
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
SiF4+H2O=HF+SiO2SiF4 + 2H2O = 4HF + SiO2
Se+O2=SeO32Se + 3O2 = 2SeO3
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sr(CH3COO)2 + (NH4)3PO4 = NH4CH3COO + Sr3(PO4)23Sr(CH3COO)2 + 2(NH4)3PO4 = 6NH4CH3COO + Sr3(PO4)2
SrO = Sr + O22SrO = 2Sr + O2
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sr+AgBr=Ag+SrBr2Sr + 2AgBr = 2Ag + SrBr2
S8 + O2 = SO2S8 + 8O2 = 8SO2
ScCl3+Na2CO3+H2O=Sc(OH)3+CO2+NaCl2ScCl3 + 3Na2CO3 + 3H2O = 2Sc(OH)3 + 3CO2 + 6NaCl
S+O2=SO2S + O2 = SO2
S+O2=SO2S + O2 = SO2
S8+O2=SO3S8 + 12O2 = 8SO3
SF4 + 3 H2O = H2SO3 + 4HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + 3 H2O = H2SO3 + 4HFSF4 + 3H2O = H2SO3 + 4HF
SF4 + 3 H2O = H2SO3 = 4HFSF4 + 3H2O = H2SO3 + 4HF
Sc(NO3)2(aq) + Ba(OH)2(aq) = Sc(OH)2(s) + Ba(NO3)2(aq)Sc(NO3)2(aq) + Ba(OH)2(aq) = Sc(OH)2(s) + Ba(NO3)2(aq)
Sc(NO3)2(aq)+Ba(OH)2(aq)=Sc(OH)2(s)+Ba(NO3)2(aq)Sc(NO3)2(aq) + Ba(OH)2(aq) = Sc(OH)2(s) + Ba(NO3)2(aq)
SiF4+Al= Si +AlF33SiF4 + 4Al = 3Si + 4AlF3
SiO2(s)+4HF(aq)=SiF4(g)+2H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
Sr+AgBr=Ag+SrBr2Sr + 2AgBr = 2Ag + SrBr2
S8+O2=SO2S8 + 8O2 = 8SO2
S8 (g) + O2 (g) =SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
S8 (g) + O2 (g) =SO2 (g)S8(g) + 8O2(g) = 8SO2(g)
Sr(NO3)2 (aq) + H2SO4 (aq) = SrSO4 (s) + 2HNO3 (aq)Sr(NO3)2(aq) + H2SO4(aq) = SrSO4(s) + 2HNO3(aq)
SnO2 + C = Sn + CO SnO2 + 2C = Sn + 2CO
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S (s)+HNO3 (aq)=H2SO4 (aq)+H2O (l)+NO2 (g)=S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Si(OH)4+NaBr=SiBr4+NaOHSi(OH)4 + 4NaBr = SiBr4 + 4NaOH
SO2 + NaClO + H2O = H2SO4 + NaCl SO2 + NaClO + H2O = H2SO4 + NaCl
SO2 + HI = I2 + S + H2O SO2 + 4HI = 2I2 + S + 2H2O
S8 + O2+ H2O= H2SO4S8 + 12O2 + 8H2O = 8H2SO4
Sb2S3 + HNO3 = Sb2O5 + NO2 + S + H2O Sb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SrCl2*6H2O + FeCl3 + NaOH = SrFe12O19 + Cl2 + NaCl + H2OSrCl2*6H2O + 12FeCl3 + 38NaOH = SrFe12O19 + 0Cl2 + 38NaCl + 25H2O
SnS2+HCl=H2SnCl6+H2SSnS2 + 6HCl = H2SnCl6 + 2H2S
S6+O2=SO2S6 + 6O2 = 6SO2
Sn + HNO3 = SnO2 + N2O + H2O2Sn + 2HNO3 = 2SnO2 + N2O + H2O
S8+O2+H2O = H2SO4S8 + 12O2 + 8H2O = 8H2SO4
SiCl4 + Mg = Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
SO2(g)+HNO3(aq)+H2O(l)=H2SO4(aq)+NO(g)3SO2(g) + 2HNO3(aq) + 2H2O(l) = 3H2SO4(aq) + 2NO(g)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
Sr(s) + O2(g) =SrO(s)2Sr(s) + O2(g) = 2SrO(s)
Sr(s) + Br2(l) = SrBr2(s)Sr(s) + Br2(l) = SrBr2(s)
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S(s)+HNO3(aq)=H2SO4(aq)+H2O(l)+NO2(g)S(s) + 6HNO3(aq) = H2SO4(aq) + 2H2O(l) + 6NO2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + C= SiC + CO SiO2 + 3C = SiC + 2CO
SiO2 + C= SiC + CO SiO2 + 3C = SiC + 2CO
SO-2+S=SO-2SO-2 + 0S = SO-2
S0-2+S=S0-2S0-2 + 0S = S0-2
Sb2O3+C4H6O6=Sb2(C4H4O6)3+H2OSb2O3 + 3C4H6O6 = Sb2(C4H4O6)3 + 3H2O
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
Sr(s) + O2(g) = SrO(s)2Sr(s) + O2(g) = 2SrO(s)
SO3 + Ba(OH)2 = BaSO4 + H2OSO3 + Ba(OH)2 = BaSO4 + H2O
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sr(s) + P4(s) = Sr3P2(s)6Sr(s) + P4(s) = 2Sr3P2(s)
S(s) + O2(g) = SO2(g)S(s) + O2(g) = SO2(g)
SiO2(s)+ 6 C(s) = SiC(s)+ CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SnO2 + CO= Sn + CO2SnO2 + 2CO = Sn + 2CO2
SnO2 + CO= Sn + CO2SnO2 + 2CO = Sn + 2CO2
Sb2S3 + HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
Sb2S3 + HNO3 = Sb(NO3)3 + H2SSb2S3 + 6HNO3 = 2Sb(NO3)3 + 3H2S
Sb2S3 + HNO3 = Sb(NO3)3 + H2SSb2S3 + 6HNO3 = 2Sb(NO3)3 + 3H2S
Sb2S3 + O2 = Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
Sb2S3(s) + O2(g) = Sb2O3(s) + SO2(g) 2Sb2S3(s) + 9O2(g) = 2Sb2O3(s) + 6SO2(g)
SO2+ O2=SO32SO2 + O2 = 2SO3

This program was created with a lot of help from:

Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer

Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.