Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
S8+O2=SO3S8 + 12O2 = 8SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SbCl3 + H2S = Sb2S3 + HCl2SbCl3 + 3H2S = Sb2S3 + 6HCl
Sr+Cl2+O2=Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
Sr + Cl +O = Sr(ClO3)2Sr + 2Cl + 6O = Sr(ClO3)2
Sr+Cl2+O2=Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O3SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr+Cl2+O2=Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
Sr + Cl2 + O2 = Sr(ClO3)2Sr + Cl2 + 3O2 = Sr(ClO3)2
SH2+O2=H2SO4SH2 + 2O2 = H2SO4
SiO2 + C = SiC + COSiO2 + 3C = SiC + 2CO
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
Sb2O3 +H2O = H4Sb2O5Sb2O3 + 2H2O = H4Sb2O5
S+O2=SO2S + O2 = SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2+2H2O+2NH3=(NH4)2SO4+2HSO2 + 2H2O + 2NH3 = (NH4)2SO4 + 2H
SiCl4+ Mg= Si + MgCl2SiCl4 + 2Mg = Si + 2MgCl2
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + 2Li2Se = SSe2 + 2Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S+O2=SO32S + 3O2 = 2SO3
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 + H2O = H2SO4 SO3 + H2O = H2SO4
SO3 + H2O = H2SO4 SO3 + H2O = H2SO4
Sr+H2O=Sr(OH)=H22Sr + 2H2O = 2Sr(OH) + H2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
Sn+NaOH=Na2SnO2+H2Sn + 2NaOH = Na2SnO2 + H2
S+HNO3=H2SO4+NO2+H2S + 4HNO3 = H2SO4 + 4NO2 + H2
S+HNO3=H2SO4+NO2+H2S + 4HNO3 = H2SO4 + 4NO2 + H2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+HNO3=H2SO4+NO2+H2010S + 40HNO3 = 10H2SO4 + 40NO2 + H20
S+O2=SO2S + O2 = SO2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SnS+HNO3=Sn(NO3)4+Sn(SO4)2+NO+H2O6SnS + 32HNO3 = 3Sn(NO3)4 + 3Sn(SO4)2 + 20NO + 16H2O
SiO2 + Ca(OH)2 = CaSiO3 + H2OSiO2 + Ca(OH)2 = CaSiO3 + H2O
Sb + HNO3 = Sb2O5 + NO + H2016Sb + 20HNO3 = 8Sb2O5 + 20NO + H20
SO2+O2 =SO32SO2 + O2 = 2SO3
Sn + NO3- + H+ = SnO2 + H2O + NO2Sn + 4NO3- + 4H+ = SnO2 + 2H2O + 4NO2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+ O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO4+NO2=SO3+NO-1SO4 + NO2 = -1SO3 + NO
SO4+NO2=SO3+NO-1SO4 + NO2 = -1SO3 + NO
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si+O2=SiO2Si + O2 = SiO2
SnO + HCl = SnCl2 + H2O SnO + 2HCl = SnCl2 + H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Sr(OH)2+HBr=H2O+SrBr2Sr(OH)2 + 2HBr = 2H2O + SrBr2
SiO2 + H2O = H2SiO3SiO2 + H2O = H2SiO3
Si4H10 + O2 = SiO2 + H202Si4H10 + 8O2 = 8SiO2 + H20
Si4H10 + O2 = SiO2 + H202Si4H10 + 8O2 = 8SiO2 + H20
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S+HNO3 = H2SO4+NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sc+CuSO4=Sc2(SO4)3+Cu2Sc + 3CuSO4 = Sc2(SO4)3 + 3Cu
Sc+CuSO4=ScSO4+CuSc + CuSO4 = ScSO4 + Cu
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + C = SiO + COSiO2 + C = SiO + CO
SO2 + O2 + 2H2O = 4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sn + H2S = SnS + HSn + H2S = SnS + 2H
Sn + H2S = SnS2 + HSn + 2H2S = SnS2 + 4H
Sb + H2S = Sb2S3 + H2Sb + 3H2S = Sb2S3 + 6H
Sn+HNO3 = SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
S2O3 + OCl = Cl + S4O62S2O3 + 0OCl = 0Cl + S4O6
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + KOH = K2SO3 + H2OSO2 + 2KOH = K2SO3 + H2O
SrCO3 = SrO + CO2SrCO3 = SrO + CO2
S + O2 = SO32S + 3O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
SrCO3 = SrO + CO2SrCO3 = SrO + CO2
SrCO3=SrO+CO2SrCO3 = SrO + CO2
SrCO3=SrO+CO2SrCO3 = SrO + CO2
S + O2 = SO2S + O2 = SO2
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2 + C = Si + CO2SiO2 + C = Si + CO2
SiO2+C=Si+CO2SiO2 + C = Si + CO2
SiO2+C=Si+CO2SiO2 + C = Si + CO2
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
S+O2=SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SnCl2 + HCl + H2O = SnCl4 + H2O 0SnCl2 + 0HCl + H2O = 0SnCl4 + H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SbCl3+H2S=HCl+Sb2S32SbCl3 + 3H2S = 6HCl + Sb2S3
SRCO3 = SRO+ CO2SRCO3 = SRO + CO2
SRCO3 = SRO+ CO2SRCO3 = SRO + CO2
S8(s)+O2=SO3S8(s) + 12O2 = 8SO3
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2+O2=SO32SO2 + O2 = 2SO3
S8+O2=SO2S8 + 8O2 = 8SO2
S(s)+O2(G)=SO2(G)S(s) + O2(G) = SO2(G)
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3+KClO3=Sb4O6+SO2+KCl2Sb2S3 + 6KClO3 = Sb4O6 + 6SO2 + 6KCl
Sb2S3+KClO3=Sb4O6+SO2+KCl2Sb2S3 + 6KClO3 = Sb4O6 + 6SO2 + 6KCl
Sb2S3+KClO3=Sb4O6+SO2+KCl2Sb2S3 + 6KClO3 = Sb4O6 + 6SO2 + 6KCl
SO2 + HNO3 + H2O = H2SO4+NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
SO2+ O2 = SO2SO2 + 0O2 = SO2
SO = S + OSO = S + O
SO = S + O22SO = 2S + O2
SO2 = S + O2SO2 = S + O2
SO2(g)+HNO2(aq)=H2SO4(aq)+NO(g)SO2(g) + 2HNO2(aq) = H2SO4(aq) + 2NO(g)
Si2H3 + O2 = SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO3 +2H2O= H2SO3+OHSO3 + 2H2O = H2SO3 + 2OH
SO3 +2H2O= H2SO3+H2O0SO3 + H2O = 0H2SO3 + H2O
SO3 +2H2O= HSO3+H2O0SO3 + H2O = 0HSO3 + H2O
SO3 +H2O= H2SO3+H2O0SO3 + H2O = 0H2SO3 + H2O
SO2 +O2 = SO32SO2 + O2 = 2SO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
Sn(NO3)2 + Au2C2O4 = SnC2O4 + AuNO3Sn(NO3)2 + Au2C2O4 = SnC2O4 + 2AuNO3
S + O2 = SO2S + O2 = 2SO
S8+O2=SO3S8 + 12O2 = 8SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
S + O2 = SO2S + O2 = 2SO
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = S2O34SO2 - O2 = 2S2O3
Si2O5 + F2 = SiOF2 + O22Si2O5 + 4F2 = 4SiOF2 + 3O2
SiO2 + F2 = Si2O3F2 + O24SiO2 + 2F2 = 2Si2O3F2 + O2
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si + HF = SiF4 +H2Si + 4HF = SiF4 + 2H2
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
S+O2=S2O62S + 3O2 = S2O6
Sr+Fe2(SO4)3 = SrSO4+Fe3Sr + Fe2(SO4)3 = 3SrSO4 + 2Fe
SO2+Na2Cr2O7+H2SO4=Na2SO4+Cr(SO4)3+H2O0SO2 + Na2Cr2O7 + 7H2SO4 = Na2SO4 + 2Cr(SO4)3 + 7H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2= SO32SO2 + O2 = 2SO3
SO3+H2O=H2SO4SO3 + H2O = H2SO4
S2O3 + OH = SO3 + H2OS2O3 + 6OH = 2SO3 + 3H2O
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnCl4+NH3=SnCl3+HCl+N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO2+O2=SO32SO2 + O2 = 2SO3
SO4 + Ca(ClO)2 = CaSO4 + ClOSO4 + Ca(ClO)2 = CaSO4 + 2ClO
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + HNO3 + H20 = H2SnO3 + NO40Sn + 60HNO3 + H20 = 40H2SnO3 + 60NO
Sb2S3 + HNO3 = Sb2O5 + H2SO4 + NO2 + H2020Sb2S3 + 340HNO3 = 20Sb2O5 + 60H2SO4 + 340NO2 + 11H20
Sb2S3 + HNO3 = Sb2 + H2SO4 + NO2 + H2010Sb2S3 + 120HNO3 = 10Sb2 + 30H2SO4 + 120NO2 + 3H20
SFe + NO3 = NO + SO4+FeSFe + 2NO3 = 2NO + SO4 + Fe
SnO2 + H2 = Sn + H2O SnO2 + 2H2 = Sn + 2H2O
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Si(OC2H5)4 + CH3CH2OH = Si(OH)4 + CH3CH2OH0Si(OC2H5)4 + CH3CH2OH = 0Si(OH)4 + CH3CH2OH
Si(OC2H5)4 + 2CH3CH2OH = Si(OH)4 + 2CH3CH2OH0Si(OC2H5)4 + CH3CH2OH = 0Si(OH)4 + CH3CH2OH
S2 + O2 = SO3S2 + 3O2 = 2SO3
SnO2 + 2H2O = Sn(OH)4SnO2 + 2H2O = Sn(OH)4
SiO2 + 2H2O = H4SiO4SiO2 + 2H2O = H4SiO4
SiO2 + 2H2O = H4SiO4SiO2 + 2H2O = H4SiO4
Sb2O3 + HCN = Sb +HCONSb2O3 + 3HCN = 2Sb + 3HCON
Si4H10 + O2 = SiO2 +H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO2 + O2+ 4H2O = 2H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2+ 4H2O = 2H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Sb + H2SO4 = Sb2(SO4)3 + H2O + SO30Sb + H2SO4 = 0Sb2(SO4)3 + H2O + SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + O2 = SO2S8 + 8O2 = 8SO2
S + CO = SO + CS + CO = SO + C
SnS + H20 + HNO3 = H2SnO3 + H2SO6 + NO24SnS - H20 + 36HNO3 = 4H2SnO3 + 4H2SO6 + 36NO2
SnS + H20 + HNO3 = H2SnO3 + H2SO4 + NO220SnS - 3H20 + 140HNO3 = 20H2SnO3 + 20H2SO4 + 140NO2
SnS + H20 + HNO3 = H2SnO3 + H2SO4 + NO40SnS + H20 + 140HNO3 = 40H2SnO3 + 40H2SO4 + 140NO
SO2+CaO=CaSO3SO2 + CaO = CaSO3
SO2+CaO=CaSO3SO2 + CaO = CaSO3
Sb(NO3)2 +Na2S = SbS + NaNO3Sb(NO3)2 + Na2S = SbS + 2NaNO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
S + Hg= HgSS + Hg = HgS
Sb(s) +Cl2 (g) = SbCl32Sb(s) + 3Cl2(g) = 2SbCl3
SrC + CO2 = SrO2 + CSrC + CO2 = SrO2 + 2C
Sn+HNO3=Sn(NO3)2+NH4NO3+H2O4Sn + 10HNO3 = 4Sn(NO3)2 + NH4NO3 + 3H2O
Sb2O3+H2O=H4Sb2O5Sb2O3 + 2H2O = H4Sb2O5
SnO2 + C = Sn + CO2 SnO2 + C = Sn + CO2
SO3=SO2+O22SO3 = 2SO2 + O2
SiO2(s)+C(s)=CO2+SiSiO2(s) + C(s) = CO2 + Si
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 +O2 = SO32SO2 + O2 = 2SO3
S(s)+C(s)=CS2(g)2S(s) + C(s) = CS2(g)
Sn+ Fe(NO3)2= Sn(NO3)+ Fe2Sn + Fe(NO3)2 = 2Sn(NO3) + Fe
Sn+ Fe(NO3)3= Sn(NO3)+ Fe3Sn + Fe(NO3)3 = 3Sn(NO3) + Fe
Sn+ Ca(NO3)3= Sn(NO3)+ Ca3Sn + Ca(NO3)3 = 3Sn(NO3) + Ca
Sn+ ZnCl2 = SnCl + Zn2Sn + ZnCl2 = 2SnCl + Zn
Sn + FeSO4= SnSO4+ FeSn + FeSO4 = SnSO4 + Fe
Sn + Fe(SO4) = SnSO4+ FeSn + Fe(SO4) = SnSO4 + Fe
SO2+O2=SO32SO2 + O2 = 2SO3
S + O = SO2S + 2O = SO2
S+HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S2+HNO3=H2SO4+NO2+H2OS2 + 12HNO3 = 2H2SO4 + 12NO2 + 4H2O
SiO2 + HF = SiF4 + H2O SiO2 + 4HF = SiF4 + 2H2O
SO2 + Al (OH) 3 = Al2 (SO3) 3 + H2O3SO2 + 2Al(OH)3 = Al2(SO3)3 + 3H2O
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn + NaOH = Na2SnO2 + H2Sn + 2NaOH = Na2SnO2 + H2
Sb2(SO4)3 + KMnO4 + H2O = H3SbO4 + K2SO4 + MnSO4 + H2SO45Sb2(SO4)3 + 4KMnO4 + 24H2O = 10H3SbO4 + 2K2SO4 + 4MnSO4 + 9H2SO4
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O3SO2 + Na2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
SbCl3+(NH4)2S=Sb2S3+NH4Cl2SbCl3 + 3(NH4)2S = Sb2S3 + 6NH4Cl
Si + HF = SiF4 + H2Si + 4HF = SiF4 + 2H2
Si + HF = SiF4 + H2323Si + 92HF = 23SiF4 + 4H23
SiO2(s)+C(s)=Si(s)+CO2(g)SiO2(s) + C(s) = Si(s) + CO2(g)
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
SO2+Al(OH)3=Al2(SO3)3+H2O3SO2 + 2Al(OH)3 = Al2(SO3)3 + 3H2O
SO2+Al(OH)3=Al2(SO3)3+H2O3SO2 + 2Al(OH)3 = Al2(SO3)3 + 3H2O
SO2+H2O=H2SO3SO2 + H2O = H2SO3
S+O2=SO2S + O2 = SO2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
SiO2+C=Si+COSiO2 + 2C = Si + 2CO
SiO+C=Si+COSiO + C = Si + CO
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6+O2=SeO2+Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SO3+SCl2=SOCl2+SO2SO3 + SCl2 = SOCl2 + SO2
SO2 + NO2 = SO3 + NOSO2 + NO2 = SO3 + NO
SO2 + NO2= SO3 + NOSO2 + NO2 = SO3 + NO
SO2 + NO2= SO3+NOSO2 + NO2 = SO3 + NO
SO2 + NO2= SO3+NOSO2 + NO2 = SO3 + NO
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Sb + O2 = Sb2O54Sb + 5O2 = 2Sb2O5
S8+O2=SO2S8 + 8O2 = 8SO2
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO3 + Co(OH)2 = Co + SO4+ H2OSO3 + Co(OH)2 = Co + SO4 + H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
Si+HF=SiF4+H2Si + 4HF = SiF4 + 2H2
Sb+O2=Sb2O54Sb + 5O2 = 2Sb2O5
SnCl4 + NH3 = SnCl3 + HCl + N26SnCl4 + 2NH3 = 6SnCl3 + 6HCl + N2
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2+NaOH=Na2SO3+H2OSO2 + 2NaOH = Na2SO3 + H2O
SO2+HMnO2+H2O=H2SO4+Mn(OH)2SO2 + 2HMnO2 + 2H2O = H2SO4 + 2Mn(OH)2
Sr + O2 = 2SrO2Sr + O2 = 2SrO
SO3(g) + H2O(l) = H2SO4(aq)SO3(g) + H2O(l) = H2SO4(aq)
Si4H10(l)+ O2 (g) = SiO2 (s) +H2O (l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
Sr(s) + H2O(l) = Sr(OH)2(aq) + H2(g)Sr(s) + 2H2O(l) = Sr(OH)2(aq) + H2(g)
Sn + HNO3 = Sn(NO3)2 + NO +H2O3Sn + 8HNO3 = 3Sn(NO3)2 + 2NO + 4H2O
Sn + HNO3 = Sn(NO3)2 + NO +H2O3Sn + 8HNO3 = 3Sn(NO3)2 + 2NO + 4H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO3 + NaOH = Na2SO4 + H2OSO3 + 2NaOH = Na2SO4 + H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.