Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
S +H2SO4=SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S +H2SO4=SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S+HSO4=SO2+H2O3S + 4HSO4 = 7SO2 + 2H2O
S+HSO4=SO2 + H2O3S + 4HSO4 = 7SO2 + 2H2O
SIL4 + Mg = SI + MgL2SIL4 + 2Mg = SI + 2MgL2
SnCl4 + Fe = SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
SO2 + O2 = SO32SO2 + O2 = 2SO3
Si2H3 + O2= SiO2 + H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
SO3 + MnO4 + H+ = SO4 + Mn2+ + H2O15SO3 + 4MnO4 + 2H+ = 15SO4 + 2Mn2+ + H2O
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S + HNO3 = SO2+ NH4NO3+ H2O-2S - 2HNO3 = -2SO2 - NH4NO3 + H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SrCl2 + Li2SO4 = SrSO4 +LiClSrCl2 + Li2SO4 = SrSO4 + 2LiCl
SrCl2 + Li2SO4 = SrSO4 +LiClSrCl2 + Li2SO4 = SrSO4 + 2LiCl
SnO2+H2=Sn+H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + HNO3 +H2O = H2SO4 + NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
SO2 + HNO3 +H2O = H2SO4 + NO3SO2 + 2HNO3 + 2H2O = 3H2SO4 + 2NO
Sn + Ag+ =Sn2+ + Ag2Sn + Ag+ = Sn2+ + Ag
SO2+O2=SO32SO2 + O2 = 2SO3
Sb+H+NO3- =Sb4O6+NO+H2O-4Sb + 12H + 0NO3- = -1Sb4O6 + 0NO + 6H2O
SO4 = O2 + SO2SO4 = O2 + SO2
SeO3+F2=Se3+FO212SeO3 + 9F2 = 4Se3 + 18FO2
SnO2 + NO2 = Sn + NO20SnO2 + NO2 = 0Sn + NO2
SnO2 + NO = Sn + NO2SnO2 + 2NO = Sn + 2NO2
SnO2 + CO = Sn++++ + CO2 + e SnO2 + 2CO = Sn++++ + 2CO2 + 4e
SnO2 + CO = Sn++ + CO2 + e SnO2 + 2CO = Sn++ + 2CO2 + 2e
SnO2 + CO = Sn++ + CO2 + e SnO2 + 2CO = Sn++ + 2CO2 + 2e
SnO2 + CO = Sn + CO2 SnO2 + 2CO = Sn + 2CO2
SO(g)+O2(g)=SO2(g)2SO(g) + O2(g) = 2SO2(g)
SO(g)+O2(g)=SO2(g)2SO(g) + O2(g) = 2SO2(g)
Sn(NO2)2 + Hg2Se = SnSe + Hg2(NO2)2Sn(NO2)2 + Hg2Se = SnSe + Hg2(NO2)2
Sb + HNO3 = Sb2O5 + NO + H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Sn + Ag+ = Sn++ + AgSn + 2Ag+ = Sn++ + 2Ag
SiO2+ C=SiC+COSiO2 + 3C = SiC + 2CO
Sb+O2=SbO32Sb + 3O2 = 2SbO3
Sn + H3PO4 = H2 + Sn3(PO4)43Sn + 4H3PO4 = 6H2 + Sn3(PO4)4
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO+H2O2Si4H10 + 9O2 = 8SiO + 10H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
SnO2+2H2=Sn+2H2OSnO2 + 2H2 = Sn + 2H2O
SO2 + Br2 + 2H2O = HBr + H2SO4 SO2 + Br2 + 2H2O = 2HBr + H2SO4
S8(s) +HNO3(aq)=H2SO4(aq) +NO2(g) + H2O(l)S8(s) + 48HNO3(aq) = 8H2SO4(aq) + 48NO2(g) + 16H2O(l)
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Sc2O3 + SO3 = Sc2(SO4)3Sc2O3 + 3SO3 = Sc2(SO4)3
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S8+O2=SO3S8 + 12O2 = 8SO3
Si3N4(s)=Si(s)+N2(g)Si3N4(s) = 3Si(s) + 2N2(g)
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
So3(g)+H2O(l)=H2SoO(aq)So3(g) + 3H2O(l) = 3H2SoO(aq)
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SbO2 + O2 = Sb4O64SbO2 - O2 = Sb4O6
SbO2 + O2 = Sb4O64SbO2 - O2 = Sb4O6
SO2+O2=SO32SO2 + O2 = 2SO3
Sr(OH)2(aq)+(NH4)2S(aq)=SrS+2NH4OHSr(OH)2(aq) + (NH4)2S(aq) = SrS + 2NH4OH
SiO2+Mg=Si+MgOSiO2 + 2Mg = Si + 2MgO
SnS2O3 + Ca(MnO4)2 + HCl + CaCl2 = MnCl2 + CaSO4 + SnCl4 + H2OSnS2O3 + Ca(MnO4)2 + 6HCl + CaCl2 = 2MnCl2 + 2CaSO4 + SnCl4 + 3H2O
SbO2 + O2 = Sb4O64SbO2 - O2 = Sb4O6
SiO2+Na2CO3=Na2SiO3+CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
SiO2+Na2CO3=Na2SiO3+CO2SiO2 + Na2CO3 = Na2SiO3 + CO2
Sr+S8=SrS8Sr + S8 = 8SrS
Si+ CO2= SiC+ SiO22Si + CO2 = SiC + SiO2
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
S(s) + O2(g) =SO3(g)2S(s) + 3O2(g) = 2SO3(g)
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
S(s) + O2(g) = SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S8+HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sr + Sn(NO3)4 = Sn + SrNO34Sr + Sn(NO3)4 = Sn + 4SrNO3
SO2 + Br2 + H2O = HBr + H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
S8 + O2 = SO3S8 + 12O2 = 8SO3
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sr(s)+HNO3(aq)=Sr(NO3)2(aq)+H2(g)Sr(s) + 2HNO3(aq) = Sr(NO3)2(aq) + H2(g)
S8+Cl2=S2Cl3S8 + 6Cl2 = 4S2Cl3
S + OCl =SO3 + ClS + 3OCl = SO3 + 3Cl
SO2 + Ca(OH)2 = CaSO3 + H2OSO2 + Ca(OH)2 = CaSO3 + H2O
SO2 (g) + HNO2 (aq) = H2SO4 (aq) + NO (g) SO2(g) + 2HNO2(aq) = H2SO4(aq) + 2NO(g)
SnO2 + H3 = Sn + H2O3SnO2 + 4H3 = 3Sn + 6H2O
S2O3-- + I3- + H+ = I- + S406-- + H2O203S2O3-- - 407I3- + 1218H+ = -1221I- + S406-- + 609H2O
SiO2+CaF2+H2SO4=CaSO4+SiF4+H2OSiO2 + 2CaF2 + 2H2SO4 = 2CaSO4 + SiF4 + 2H2O
Sr (CLO2)2+HBr= SrBr2+HCLO2Sr(CLO2)2 + 2HBr = SrBr2 + 2HCLO2
S8+O2=SO3S8 + 12O2 = 8SO3
Sr(OH)2 + BaCl2 = SrCl2 + Ba(OH)2Sr(OH)2 + BaCl2 = SrCl2 + Ba(OH)2
S+6HNO3 = H2SO4+NO2+H2S + 4HNO3 = H2SO4 + 4NO2 + H2
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+O2 +H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SbO2 + O2 = Sb4O64SbO2 - O2 = Sb4O6
Sb + O2 = Sb4 O64Sb + 3O2 = Sb4O6
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SO3(g)=SO2(g)+O2(g)2SO3(g) = 2SO2(g) + O2(g)
SF6=S+F2SF6 = S + 3F2
S8 + HNO3 = H2SO4 + NO2 + H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
S(s) + H2SO4(aq) = SO2(g) + H2O(l)S(s) + 2H2SO4(aq) = 3SO2(g) + 2H2O(l)
SO2+O2=SO32SO2 + O2 = 2SO3
SrCl + NaOH = NaCl + Sr(OH)SrCl + NaOH = NaCl + Sr(OH)
Sb+O2=Sb4O64Sb + 3O2 = Sb4O6
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SiI4(s)+Mg(s)=Si(s)+MgI2(s)SiI4(s) + 2Mg(s) = Si(s) + 2MgI2(s)
S+O2=SO32S + 3O2 = 2SO3
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
Sn +Cl2 = SnCl4Sn + 2Cl2 = SnCl4
SO2+O2=SO32SO2 + O2 = 2SO3
Sn(s) + 2HClO3 (aq) = Sn(ClO3)2(aq) + H2 (g)Sn(s) + 2HClO3(aq) = Sn(ClO3)2(aq) + H2(g)
Sn(s) + 2HCl (aq) = SnCl2 (aq) + H2(g)Sn(s) + 2HCl(aq) = SnCl2(aq) + H2(g)
S+6HNO3=H2SO4+6NO2+2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2Cl2+HBr=H2S+HCl+Br2+H2OSO2Cl2 + 8HBr = H2S + 2HCl + 4Br2 + 2H2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO2 + O2 = SO4SO2 + O2 = SO4
SO2 + O2 = SO4SO2 + O2 = SO4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiH4(g)+NH3(g)=Si3N4(s)+H2(g)3SiH4(g) + 4NH3(g) = Si3N4(s) + 12H2(g)
SiO2(s)+C(s)=Si(l)+CO(g)SiO2(s) + 2C(s) = Si(l) + 2CO(g)
S8+O2=SO3S8 + 12O2 = 8SO3
Sr(OH)2 + AgNO3 = SrNO3 + Ag(OH)2Sr(OH)2 + AgNO3 = SrNO3 + Ag(OH)2
SO2(g) + O2(g) = SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
Sb+Cl2= SbCl32Sb + 3Cl2 = 2SbCl3
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
Sb2S3 + HNO3 = HSbO3 + NO + H2SO4 + H2O3Sb2S3 + 28HNO3 = 6HSbO3 + 28NO + 9H2SO4 + 2H2O
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S8+O2=SO2S8 + 8O2 = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiO2(s)+C(s)=Si(l)+CO(g)SiO2(s) + 2C(s) = Si(l) + 2CO(g)
SnCl4+H2SO4=SnSO4+H2Cl4SnCl4 + H2SO4 = SnSO4 + H2Cl4
S+H2SO4=SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
Sn+4HNO3 = SnO2 + NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiCl4 + NH3 = Si3N4 + NH4Cl3SiCl4 + 16NH3 = Si3N4 + 12NH4Cl
S+HNO3 = H2SO4+H2O+NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SO2 + H2O = H2SO3 SO2 + H2O = H2SO3
SO2 = O2 = SO32SO2 = -1O2 + 2SO3
SbCl3 + (NH4)2S = Sb2S3 + NH4Cl 2SbCl3 + 3(NH4)2S = Sb2S3 + 6NH4Cl
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
SnCl2+LiOH=SnOH+LiCl2SnCl2 + LiOH = SnOH + LiCl2
S + HNO3 = H2SO4 + H2O + NO2S + 6HNO3 = H2SO4 + 2H2O + 6NO2
S8+HNO3=H2SO4+NO2+H2OS8 + 48HNO3 = 8H2SO4 + 48NO2 + 16H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2Cl2+HBr=H2S+HCl+Br2+H2OSO2Cl2 + 8HBr = H2S + 2HCl + 4Br2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S8+12O2=8SO3S8 + 12O2 = 8SO3
S8+12O2=8SO3S8 + 12O2 = 8SO3
S8+O2=SO2S8 + 8O2 = 8SO2
S + H2SO4 = 3SO2 + 2H2OS + 2H2SO4 = 3SO2 + 2H2O
SiO2 + NaOH = Na2SiO3 + H2OSiO2 + 2NaOH = Na2SiO3 + H2O
S + O2 = SO32S + 3O2 = 2SO3
S(s) + O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S+O2= SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
Si3N4 = Si + N2Si3N4 = 3Si + 2N2
SiO2 + 2HF = SiF4 + 2H2O SiO2 + 4HF = SiF4 + 2H2O
SiO2(s) + HF(aq) = SiF4(g) + H2O(l)SiO2(s) + 4HF(aq) = SiF4(g) + 2H2O(l)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2O + NO2 + SO2S + 4HNO3 = 2H2O + 4NO2 + SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
Si4H10+O2=SiO2+H202Si4H10 + 8O2 = 8SiO2 + H20
SiF4 + H2O = HF + SiO2SiF4 + 2H2O = 4HF + SiO2
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sr(NO3)2(aq) + (NH4)3PO4(aq) = Sr3(PO4)2(s) + NH4NO3(aq)3Sr(NO3)2(aq) + 2(NH4)3PO4(aq) = Sr3(PO4)2(s) + 6NH4NO3(aq)
SiO2(s)+C(s)=Si(l)+CO(g)SiO2(s) + 2C(s) = Si(l) + 2CO(g)
Sb2SO3 + O2 = Sb2O4 + SO22Sb2SO3 + 3O2 = 2Sb2O4 + 2SO2
Sb2O5 + H2O = Sb(OH)5Sb2O5 + 5H2O = 2Sb(OH)5
SF4 + H2O = H2SO3 + HFSF4 + 3H2O = H2SO3 + 4HF
S8 + O2 = SO3S8 + 12O2 = 8SO3
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
S + O2 = SO32S + 3O2 = 2SO3
SO2 + O2 + H2O = 4H2SO42SO2 + O2 + 2H2O = 2H2SO4
SnCl2+HgCl2=SnCl4+Hg2Cl2SnCl2 + 2HgCl2 = SnCl4 + Hg2Cl2
Se(s) + O2(g) = SeO3(g)2Se(s) + 3O2(g) = 2SeO3(g)
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sb(s)+Cl2(g)=SbCl3(s)2Sb(s) + 3Cl2(g) = 2SbCl3(s)
Sr(OH)2(aq) + FeCl3(aq) = SrCl2(aq) + Fe(OH)3(s)3Sr(OH)2(aq) + 2FeCl3(aq) = 3SrCl2(aq) + 2Fe(OH)3(s)
S2Cl2+H2O=SO2+HCl+S2S2Cl2 + 2H2O = SO2 + 4HCl + 3S
Sn(ClO3)2 = Sn O+ ClO 2+O22Sn(ClO3)2 = 2SnO + 4ClO2 + O2
Sn(ClO3)2 = SnO+ClO2+O22Sn(ClO3)2 = 2SnO + 4ClO2 + O2
S+6HNO3=H2SO4+6NO2+2H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2(g) + H2S(g) = S(s) + H2O(g)SO2(g) + 2H2S(g) = 3S(s) + 2H2O(g)
Sn(ClO3)2=SnO+ClO2+O22Sn(ClO3)2 = 2SnO + 4ClO2 + O2
Sn (s) + HBr (aq) = SnBr2 (aq) + H2 (g)Sn(s) + 2HBr(aq) = SnBr2(aq) + H2(g)
S8+O2=SO3S8 + 12O2 = 8SO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO3=SO2+O22SO3 = 2SO2 + O2
S+HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sb2S3+O2=Sb2O3+SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
Sr(CN)2+Na3PO4=Sr3(PO4)2+NaCN3Sr(CN)2 + 2Na3PO4 = Sr3(PO4)2 + 6NaCN
SiF4 (s) + 2H2O (l) = 4HF (aq) + SiO2 (s)SiF4(s) + 2H2O(l) = 4HF(aq) + SiO2(s)
SrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2OSrCO3 + 2HNO3 = Sr(NO3)2 + CO2 + H2O
SiCl4+H2O=SiO2+HClSiCl4 + 2H2O = SiO2 + 4HCl
SO3+Ba(OH)2=BaSO4+H2OSO3 + Ba(OH)2 = BaSO4 + H2O
S + HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SiO2+HF=SiF4+H2OSiO2 + 4HF = SiF4 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
Si2H3+O2=SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S + KNO3 + C = K2S +N2+CO2S + 2KNO3 + 3C = K2S + N2 + 3CO2
S+6HNO3=3H2SO4+N2+3H2O-5S - 6HNO3 = -5H2SO4 - 3N2 + 2H2O
S+6HNO3=3H2SO4+N2+3H2O-5S - 6HNO3 = -5H2SO4 - 3N2 + 2H2O
SO2+O2=SO32SO2 + O2 = 2SO3
S+6(HNO)3=3(H)2(SO)4+(NO)2+3(H2O)-4S + 2(HNO)3 = -1(H)2(SO)4 + 3(NO)2 + 4(H2O)
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
SiCl4(l) + H2O(l) = SiO2(s) + HCl(aq)SiCl4(l) + 2H2O(l) = SiO2(s) + 4HCl(aq)
Si2H3+O2= SiO2+H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S+6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
S02 + O2 = SO3S02 + 3O2 = 2SO3
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S8+O2=SO2S8 + 8O2 = 8SO2
Sn(ClO3)2=SnO+ClO+O22Sn(ClO3)2 = 2SnO + 4ClO + 3O2
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + O2 =SO32SO2 + O2 = 2SO3
SO3+HCl =SO2+H2O +ClSO3 + 2HCl = SO2 + H2O + 2Cl
SO2 + O2 = SO32SO2 + O2 = 2SO3
Sn+Br2=SnBr4Sn + 2Br2 = SnBr4
SO2 + O2 = SO32SO2 + O2 = 2SO3
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SiO2+3C=SiC+2COSiO2 + 3C = SiC + 2CO
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO2 + O2= SO32SO2 + O2 = 2SO3
SnCl2 + Ag2O= SnO + Cl2Ag2SnCl2 + Ag2O = SnO + Cl2Ag2
SnS + HNO3 + HCl = SnCl4 + H2SO4 + NO + H2O3SnS + 10HNO3 + 12HCl = 3SnCl4 + 3H2SO4 + 10NO + 8H2O
Sn + HNO3 = SnO2 + H2O + NO3Sn + 4HNO3 = 3SnO2 + 2H2O + 4NO
SO3(l)+ H2O(l) = H2SO4(aq)SO3(l) + H2O(l) = H2SO4(aq)
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
SiO2 + C = Si + COSiO2 + 2C = Si + 2CO
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SiO2 + C = SiC+ COSiO2 + 3C = SiC + 2CO
S8+ O2= SO2S8 + 8O2 = 8SO2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SnO2 + 2H2 = Sn + 2H2O SnO2 + 2H2 = Sn + 2H2O
SO2 + NaOH = Na2SO3 + H2OSO2 + 2NaOH = Na2SO3 + H2O
SiO2 + 3C = SiC + COSiO2 + 3C = SiC + 2CO
Sr + O2 = 2SrO2Sr + O2 = 2SrO
Sn + 4HNO3 = SnO2 + 4NO2 + 2H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Si+Br2=SiBr4Si + 2Br2 = SiBr4
S8+O2=SO3S8 + 12O2 = 8SO3
SF4+F2= SF6SF4 + F2 = SF6
SbI3+Sb(IO3)3+H2SiO4=Sb4(SiO4)3+I2+H2O11SbI3 + Sb(IO3)3 + 9H2SiO4 = 3Sb4(SiO4)3 + 18I2 + 9H2O
S8+O2=SO2S8 + 8O2 = 8SO2
SO3+Ba+O2=BaSO42SO3 + 2Ba + O2 = 2BaSO4
S (s) + O2 (g) = SO2 (g)S(s) + O2(g) = SO2(g)
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+6HNO3=H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SO3S8 + 12O2 = 8SO3
Sb + HSO4- + H = Sb2O3 + SO2 + H2O-2Sb + 0HSO4- + 6H = -1Sb2O3 + 0SO2 + 3H2O
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S8+O2=SO2S8 + 8O2 = 8SO2
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO2S8 + 8O2 = 8SO2
S+KOH=K2SO3+K2S+H2O3S + 6KOH = K2SO3 + 2K2S + 3H2O
Si+S8=Si2S44Si + S8 = 2Si2S4
SO2 + O2 + H2O = H2SO4 2SO2 + O2 + 2H2O = 2H2SO4
SO2+C=SC+COSO2 + 3C = SC + 2CO
SiF4 + H2O=HF + Si(OH)4SiF4 + 4H2O = 4HF + Si(OH)4
SO2 + O2 + H2O = H2SO42SO2 + O2 + 2H2O = 2H2SO4
SiO2 + C = Si + COSiO2 + 2C = Si + 2CO
Sb + Cl2 = SbCl32Sb + 3Cl2 = 2SbCl3
Sn3(PO4)5+Na2(CO3) = Sn2(CO3)5+Na3PO42Sn3(PO4)5 + 15Na2(CO3) = 3Sn2(CO3)5 + 10Na3PO4
SO2+O2=SO32SO2 + O2 = 2SO3
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
Sb2S3 + O2 = Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
S8 + F2 = SF6S8 + 24F2 = 8SF6
Sb(OH)5+HCl=SbCl5+H2OSb(OH)5 + 5HCl = SbCl5 + 5H2O
S2Cl2+H2O=H2SO3+HCl+S2S2Cl2 + 3H2O = H2SO3 + 4HCl + 3S
S + H2O = SO4 + HS + 4H2O = SO4 + 8H
SnO2+C=Sn+CO2SnO2 + C = Sn + CO2
S2O32- + O2 = S0 + SO42-0S2O32- + 0O2 = -1S0 + SO42-
SiF4 + H2O = H4SiO4 + H2SiF63SiF4 + 4H2O = H4SiO4 + 2H2SiF6
Si2H3+O2=SiO2+H2O34Si2H3 + 17O2 = 8SiO2 + 6H2O3
S8+O2=SO3S8 + 12O2 = 8SO3
SO2 + O2 = SO32SO2 + O2 = 2SO3
S + O2 = SO32S + 3O2 = 2SO3
S8 + O2 + H2O = H2SO4S8 + 12O2 + 8H2O = 8H2SO4
S8 + O2 + H2O = H2SO4S8 + 12O2 + 8H2O = 8H2SO4
S2 + O2 = SO3S2 + 3O2 = 2SO3
SO2+H2O=H2SO3SO2 + H2O = H2SO3
SF4 (g) + H2O (l) = SO2 (g) + HF (g)SF4(g) + 2H2O(l) = SO2(g) + 4HF(g)
SO2 +O2 = SO32SO2 + O2 = 2SO3
Sn+H2S=SnS2+H2Sn + 2H2S = SnS2 + 2H2
SO2+O2=SO32SO2 + O2 = 2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
Si2H3 + O2 = SiO2 + H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sb2S3(s)+HCl(aq)=SbCl3(aq)+H2S(g)Sb2S3(s) + 6HCl(aq) = 2SbCl3(aq) + 3H2S(g)
SiCl4 + H2O = H4SiO4 + HClSiCl4 + 4H2O = H4SiO4 + 4HCl
SO2 + I2 + H2O = H2SO4 + HISO2 + I2 + 2H2O = H2SO4 + 2HI
SrCo3 + Al2S3 = Al2(Co3)3 + SrS 3SrCo3 + Al2S3 = Al2(Co3)3 + 3SrS
SO2 + O2 + CaCO3 = CaSO4 + CO2 2SO2 + O2 + 2CaCO3 = 2CaSO4 + 2CO2
S+H2O+O2=H2SO42S + 2H2O + 3O2 = 2H2SO4
S8+O2=SO3S8 + 12O2 = 8SO3
Sr(NO3)2+2NaF=SrF2+2NaNO3Sr(NO3)2 + 2NaF = SrF2 + 2NaNO3
Sr(NO3)2+2NaF=SrF2+2NaNO3Sr(NO3)2 + 2NaF = SrF2 + 2NaNO3
Sr(NO3)2+NaF=SrF2+NaNO3Sr(NO3)2 + 2NaF = SrF2 + 2NaNO3
Sn(CO3)2 + Pb(SO3)2 = Pb(CO3)2 + Sn(SO3)2Sn(CO3)2 + Pb(SO3)2 = Pb(CO3)2 + Sn(SO3)2
SO2 + I2 + H2O = HSO4- + I- + H+SO2 + I2 + 2H2O = HSO4- + 2I- + 3H+
SO2 + I2 + H2O = H2SO4- + I- + H+2SO2 + I2 + 4H2O = 2H2SO4- + 2I- + 4H+
S + 6HNO3 = H2SO4 + NO2 + H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + H2SO4 = SO2 + 2H2OS + 2H2SO4 = 3SO2 + 2H2O
SO4-- (l) + 7H+ + C2H5O2N = 3SO2 (g) + 4H2O (l) + 2CO2 + NH4+3SO4--(l) + 7H+ + C2H5O2N = 3SO2(g) + 4H2O(l) + 2CO2 + NH4+
S + HNO3 = SO2 + NO2 + H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
S + HNO3 = SO2 + NO2 + H2OS + 4HNO3 = SO2 + 4NO2 + 2H2O
S+O2=SO2S + O2 = SO2
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiH10+O2=SiO2+H2O2SiH10 + 7O2 = 2SiO2 + 10H2O
S+6HNO3 = H2SO4+NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S+O2=SO2S + O2 = SO2
S+O=SO2S + 2O = SO2
S8+O2=SO2S8 + 8O2 = 8SO2
SO3 + O2 = SO42SO3 + O2 = 2SO4
SrCo3 + Al2S3 = Al2(Co3)3 + SrS 3SrCo3 + Al2S3 = Al2(Co3)3 + 3SrS
S + O2 = SO32S + 3O2 = 2SO3
S + O2 = SO2S + O2 = 2SO
Sr(OH)2+FeCl3=SrCl2+Fe(OH)33Sr(OH)2 + 2FeCl3 = 3SrCl2 + 2Fe(OH)3
Se(s)+O2(g)=SeO3(g)2Se(s) + 3O2(g) = 2SeO3(g)
Sb + I2 = SbI32Sb + 3I2 = 2SbI3
SO2 + O2 = SO32SO2 + O2 = 2SO3
SF4 + H2O = SO2 + HFSF4 + 2H2O = SO2 + 4HF
S8+NO3=SO2+NOS8 + 8NO3 = 8SO2 + 8NO
SiCl4   +     H2O  = H4SiO4   +     HClSiCl4 + 4H2O = H4SiO4 + 4HCl
S+HNO3=NO2+SO2+H2010S + 20HNO3 = 20NO2 + 10SO2 + H20
Sr(s)+S(s)=SrSSr(s) + S(s) = SrS
Sn+AgBr=Ag+SnBrSn + AgBr = Ag + SnBr
Sb2 S3 + H Cl = H3 Sb Cl6 + H2 SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sb2 S3 + H Cl = H3 Sb Cl6 + H2 SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sb + O2 = Sb4O64Sb + 3O2 = Sb4O6
SiO2   +     HF  =  SiF4    +      H2OSiO2 + 4HF = SiF4 + 2H2O
S + HNO3= NO2 + H2O + H2SO4S + 6HNO3 = 6NO2 + 2H2O + H2SO4
SO 2 (g)+O 2 (g)+H 2 O(l)=H 2 SO 4 (aq) 2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Si2H3   +   O2  =     SiO2   +   H2O4Si2H3 + 11O2 = 8SiO2 + 6H2O
Sn+KOH=K2SnO2+H2Sn + 2KOH = K2SnO2 + H2
SN+KOH=K2SNO2+H2SN + 2KOH = K2SNO2 + H2
S(s)+O2(g)=SO3(g)2S(s) + 3O2(g) = 2SO3(g)
Sb+H2O=Sb(OH)5+H22Sb + 10H2O = 2Sb(OH)5 + 5H2
Sb+H2O=Sb(OH)+H22Sb + 2H2O = 2Sb(OH) + H2
SeO2 + H2Se = Se + H2OSeO2 + 2H2Se = 3Se + 2H2O
S+O2=1SO32S + 3O2 = 2SO3
S+O2=SO32S + 3O2 = 2SO3
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
Si O2 + C=Si +COSiO2 + 2C = Si + 2CO
Sn(NO2)4+Pt3N4=Sn3N4+Pt(NO2)43Sn(NO2)4 + Pt3N4 = Sn3N4 + 3Pt(NO2)4
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
SO3+ H2SO4 = SO2+H2SO3-1SO3 + H2SO4 = -1SO2 + H2SO3
Si(CH3)4 + 12CO2 = SiO2 + 16 CO + 6 H2OSi(CH3)4 + 12CO2 = SiO2 + 16CO + 6H2O
Si(CH3)4+ 12CO2 = SiO2+ 16 CO+ 6 H2OSi(CH3)4 + 12CO2 = SiO2 + 16CO + 6H2O
Si(CH3)4+ 12CO2 = SiO2+ 16 CO+ 6 H2OSi(CH3)4 + 12CO2 = SiO2 + 16CO + 6H2O
Si+Cl2=SiCl2Si + Cl2 = SiCl2
Si+Cl2=SiCl32Si + 3Cl2 = 2SiCl3
SO2 + O2 + H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SrBr(aq)+NH4CO3(aq)=SrCO3(s)+NH4Br(aq)SrBr(aq) + NH4CO3(aq) = SrCO3(s) + NH4Br(aq)
SO3 + H2O = H2SO4SO3 + H2O = H2SO4
SO2 + CO2 = SO3 + COSO2 + CO2 = SO3 + CO
S8+O2=SO2S8 + 8O2 = 8SO2
S8 + O2 = SO3S8 + 12O2 = 8SO3
SO2+O2=SO32SO2 + O2 = 2SO3
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SO2+O2 = SO32SO2 + O2 = 2SO3
SO2+O2=SO32SO2 + O2 = 2SO3
Si + O= SiOSi + O = SiO
SO2 + O = SO3SO2 + O = SO3
SO2 + O = SO3SO2 + O = SO3
Sn + 4HCl = SnCl4 = 2H2Sn + 4HCl = SnCl4 + 2H2
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
SO3+O2=SO22SO3 - O2 = 2SO2
S+H2O=SO42-+H2S+H-1S + 0H2O = 0SO42- - H2S + 2H
S+H2O=SO42-+H2S+H-1S + 0H2O = 0SO42- - H2S + 2H
Sn(s)+HF(g)=SnF2(s)+H2(g)Sn(s) + 2HF(g) = SnF2(s) + H2(g)
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SiO2(s)+C(s)=SiC(s)+CO(g)SiO2(s) + 3C(s) = SiC(s) + 2CO(g)
Si4H10 + O2 = SiO2 + H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO(s) + H2(g) = Sn(s) + H2O(l)SnO(s) + H2(g) = Sn(s) + H2O(l)
Sn(s)+HBr(aq)=SnBr2(aq)+H2(g)Sn(s) + 2HBr(aq) = SnBr2(aq) + H2(g)
SrS+Ba(NO3)2=BaS2+SrNO32SrS + Ba(NO3)2 = BaS2 + 2SrNO3
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO2S8 + 8O2 = 8SO2
SiO2+C=SiC+COSiO2 + 3C = SiC + 2CO
SnCl2+K2Cr2O7=SnCr2O7+2KClSnCl2 + K2Cr2O7 = SnCr2O7 + 2KCl
SnCl2+K2Cr2O7=SnCr2O7+2KClSnCl2 + K2Cr2O7 = SnCr2O7 + 2KCl
SO2+O2 =SO32SO2 + O2 = 2SO3
SiO2 + Ca3(PO4)2 = P2O5 + CaSiO33SiO2 + Ca3(PO4)2 = P2O5 + 3CaSiO3
S8+ O2= SO3S8 + 12O2 = 8SO3
SiO2 + HF = SiF4 +H2OSiO2 + 4HF = SiF4 + 2H2O
SiCl4 + H2O = SiO2 + HClSiCl4 + 2H2O = SiO2 + 4HCl
SO2Cl2+H2O=H2SO4+HClSO2Cl2 + 2H2O = H2SO4 + 2HCl
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
S8+O2=SO3S8 + 12O2 = 8SO3
S8+O2=SO2S8 + 8O2 = 8SO2
Si + Cl2 = SiCl4Si + 2Cl2 = SiCl4
S + O2 = SO32S + 3O2 = 2SO3
SiO2 + HF = SiF4 + H2OSiO2 + 4HF = SiF4 + 2H2O
SO2(g)+O2(g) =SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnCl4 +F2 = Cl + SnF2SnCl4 + F2 = 8Cl + 2SnF
Sn(s)+NaOH(aq)=Na2SnO2(aq)+H2(g)Sn(s) + 2NaOH(aq) = Na2SnO2(aq) + H2(g)
SO2+O2=SO32SO2 + O2 = 2SO3
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
Sb+Cl2=SbCl32Sb + 3Cl2 = 2SbCl3
Sb3(PO3)5 + Cr2C3 = Sb4C5 + Cr3(PO3)612Sb3(PO3)5 + 15Cr2C3 = 9Sb4C5 + 10Cr3(PO3)6
Sn(NO2)4 + CaS = SnS2 + Ca(NO2)2Sn(NO2)4 + 2CaS = SnS2 + 2Ca(NO2)2
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
S8 + O2 = SO2S8 + 8O2 = 8SO2
Sb + H2O = Sb2O3 + H22Sb + 3H2O = Sb2O3 + 3H2
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
Sb + HCl = SbCl3 + H22Sb + 6HCl = 2SbCl3 + 3H2
Sb+HNO3= Sb2O5+NO+H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Sb2S3+HNO3= Sb2O5+NO2+S+H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
Sb2S3 +HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sb2S3 +HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
Sn +HNO3 = Sn(NO3)2 + H2Sn + 2HNO3 = Sn(NO3)2 + H2
Sb+HNO3= Sb2O5+NO+H2O6Sb + 10HNO3 = 3Sb2O5 + 10NO + 5H2O
Sb2S3+HNO3= Sb2O5+NO2+S+H2OSb2S3 + 10HNO3 = Sb2O5 + 10NO2 + 3S + 5H2O
S8+O2=SO3S8 + 12O2 = 8SO3
SO2(g)+O2(g)+H2O(l)=H2SO4(aq)2SO2(g) + O2(g) + 2H2O(l) = 2H2SO4(aq)
SrBr2 + H2SO4=SrSO4 + HBrSrBr2 + H2SO4 = SrSO4 + 2HBr
Sb2S3 +HCl = H3SbCl6 + H2SSb2S3 + 12HCl = 2H3SbCl6 + 3H2S
SO2+Li2Se=SSe2+Li2OSO2 + 2Li2Se = SSe2 + 2Li2O
S + O2=SO2S + O2 = SO2
S+ O2 = SO2S + O2 = SO2
SnO2+2 C = Sn+2COSnO2 + 2C = Sn + 2CO
Sr(NO3)2(aq) + CuSO4*5H2O(aq) = SrSO4(s) + Cu(NO3)2(aq) + 5 H2O(l)Sr(NO3)2(aq) + CuSO4*5H2O(aq) = SrSO4(s) + Cu(NO3)2(aq) + 5H2O(l)
Si4H10+O2 = SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SiCl4+H2O=H4SiO4+HClSiCl4 + 4H2O = H4SiO4 + 4HCl
Sr(SO4) + Pb(NO3)2 = Pb(SO4) + Sr(NO3)2Sr(SO4) + Pb(NO3)2 = Pb(SO4) + Sr(NO3)2
Sr(SO4) + Pb(NO3)2 = Pb(SO4) + Sr(NO3)2Sr(SO4) + Pb(NO3)2 = Pb(SO4) + Sr(NO3)2
SO2 + O2 = SO32SO2 + O2 = 2SO3
SrCl2 (aq) + Fe2(SO4)3 (aq) = SrSO4 (s )+ FeCl3 (aq)3SrCl2(aq) + Fe2(SO4)3(aq) = 3SrSO4(s) + 2FeCl3(aq)
Sn+HNO3=SnO2+NO2+H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
Sn+HNO3+H2O=H2SnO3+NO3Sn + 4HNO3 + H2O = 3H2SnO3 + 4NO
Si4H10+O2=SiO2+H2O2Si4H10 + 13O2 = 8SiO2 + 10H2O
SO3 = SO2+O22SO3 = 2SO2 + O2
S8 + O2 = SO2S8 + 8O2 = 8SO2
SO2+O2+H2O=H2SO42SO2 + O2 + 2H2O = 2H2SO4
SO2+Br+H2O=HBr+H2SO4SO2 + 2Br + 2H2O = 2HBr + H2SO4
SO2+Br+H2O=HBr+H2SO4SO2 + 2Br + 2H2O = 2HBr + H2SO4
SO2+Br2+H2O=HBr+H2SO4SO2 + Br2 + 2H2O = 2HBr + H2SO4
SO2+Br+H2O=HBr+H2SO4SO2 + 2Br + 2H2O = 2HBr + H2SO4
Sn + 2AgNO3 = Sn(NO3)2+2AgSn + 2AgNO3 = Sn(NO3)2 + 2Ag
SO2(g)+O2(g)=SO3(g)2SO2(g) + O2(g) = 2SO3(g)
SnCl4 + Fe =SnCl2 + FeCl33SnCl4 + 2Fe = 3SnCl2 + 2FeCl3
SO2 + H2O = H2SO3SO2 + H2O = H2SO3
SnS2 + HCl = H2SnCl6 + H2SSnS2 + 6HCl = H2SnCl6 + 2H2S
SnS2 + HCl = H2SnCl6 + H2SSnS2 + 6HCl = H2SnCl6 + 2H2S
SO4Cr+BrOH+SO4H2=SO4Cr2+Br3Cr+H2O-8SO4Cr + 6BrOH + 3SO4H2 = -5SO4Cr2 + 2Br3Cr + 6H2O
S8+ O2 = SO2S8 + 8O2 = 8SO2
Sr3(PO4)2+ Na2SO4= Na3PO4+ SrSO4Sr3(PO4)2 + 3Na2SO4 = 2Na3PO4 + 3SrSO4
SO3 (s)+H2O(l)=H2SO4 (aq)SO3(s) + H2O(l) = H2SO4(aq)
SO3 (s)+H2O(l)=H2SO4 (aq)SO3(s) + H2O(l) = H2SO4(aq)
SO3 (s)+H2O(l)=H2SO4 (aq)SO3(s) + H2O(l) = H2SO4(aq)
Si4H10(l)+O2(g)=SiO2(s)+H2O(l)2Si4H10(l) + 13O2(g) = 8SiO2(s) + 10H2O(l)
SeCl6 + O2 = SeO2 + Cl2SeCl6 + O2 = SeO2 + 3Cl2
SnO2 + H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
Sb2S3+HCl=SbCl3+H2SSb2S3 + 6HCl = 2SbCl3 + 3H2S
SnS2+O2=SnO2+SO2SnS2 + 3O2 = SnO2 + 2SO2
S8(s) + Cu(s) = Cu2S(s)S8(s) + 16Cu(s) = 8Cu2S(s)
Sb2S3 + 3Fe = FeS + 2SbSb2S3 + 3Fe = 3FeS + 2Sb
S + H2SO4 = SO2 + H2OS + 2H2SO4 = 3SO2 + 2H2O
S8 + O2 = SO2S8 + 8O2 = 8SO2
SiO2+Cl2=SiCl4+O2Cl2SiO2 + 3Cl2 = SiCl4 + O2Cl2
Sn + HNO3 = SnO2 + NO2 + H2OSn + 4HNO3 = SnO2 + 4NO2 + 2H2O
S + HNO3 = H2SO4+ NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
S + HNO3 = H2SO4+ NO2+H2OS + 6HNO3 = H2SO4 + 6NO2 + 2H2O
Sn3(PO4)4+Na2(CO3)=Sn2(CO3)4+Na3(PO4)2Sn3(PO4)4 + 12Na2(CO3) = 3Sn2(CO3)4 + 8Na3(PO4)
Sn(SO4)2+K3PO4=Sn3(PO4)4+K2SO43Sn(SO4)2 + 4K3PO4 = Sn3(PO4)4 + 6K2SO4
S+H2SO4 = SO2+H2OS + 2H2SO4 = 3SO2 + 2H2O
S8 + O2 + H2 = H2SO4S8 + 16O2 + 8H2 = 8H2SO4
SeCl6(s) + O2(g) = SeO2 + Cl2(g)SeCl6(s) + O2(g) = SeO2 + 3Cl2(g)
SiH4+Ni(OH)2=SiO2+NiO+H2SiH4 + 2Ni(OH)2 = SiO2 + 2NiO + 4H2
SiH2Cl2+Ni(OH)2=SiO2+NiCl2+H2SiH2Cl2 + Ni(OH)2 = SiO2 + NiCl2 + 2H2
SiH2Cl2+Ni(OH)2=SiO2+NiCl2+H2O+H2SiH2Cl2 + Ni(OH)2 = SiO2 + NiCl2 + 0H2O + 2H2
SiH2Cl2+Ni(OH)2+KOH=SiO2+KCl+NiO+H2O0SiH2Cl2 + Ni(OH)2 + 0KOH = 0SiO2 + 0KCl + NiO + H2O
SrCO3 + 2HCl = SrCl2 + CO2 + H2OSrCO3 + 2HCl = SrCl2 + CO2 + H2O
SiCl4+Ni(OH)2=NiCl2+SiO2+H2OSiCl4 + 2Ni(OH)2 = 2NiCl2 + SiO2 + 2H2O
SiCl4+Ni(OH)2=NiCl+SiO2+H2O+O2SiCl4 + 4Ni(OH)2 = 4NiCl + SiO2 + 4H2O + O2
SiCl4+Ni(OH)2=NiCl+SiO2+H2O+O2SiCl4 + 4Ni(OH)2 = 4NiCl + SiO2 + 4H2O + O2
SiCl4+Ni(OH)2=NiCl3+SiO2+H2O+O2-3SiCl4 - 4Ni(OH)2 = -4NiCl3 - 3SiO2 - 4H2O + O2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.