Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
P4+O2=P2O5P4 + 5O2 = 2P2O5
PCl3 + H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
PCl3 +H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(CH3COO)2+H3P=Pb3P2+CH3COOH3Pb(CH3COO)2 + 2H3P = Pb3P2 + 6CH3COOH
Pb + H3PO4 = H2 + Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
PbO2 + NaCrO2 + NaOH = H2O + Na2CrO4 + NaPbO23PbO2 + NaCrO2 + 4NaOH = 2H2O + Na2CrO4 + 3NaPbO2
Pb + H3PO4 = H2 + Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(NO3)+HCl=PbCl+HNO3Pb(NO3) + HCl = PbCl + HNO3
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb(OH)2+NaOH=Na2PbO2+H2OPb(OH)2 + 2NaOH = Na2PbO2 + 2H2O
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(OH)2+HCl=H2O+PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4+Na=Na3PP4 + 12Na = 4Na3P
PCl5+P2O5=POCl33PCl5 + P2O5 = 5POCl3
PCl3+H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
P4O10+HCl=POCl3+HPO3P4O10 + 3HCl = POCl3 + 3HPO3
PbS2+Ca=CaS+PbPbS2 + 2Ca = 2CaS + Pb
Pb(NO3)2 (aq) +2 HBr(aq) = PbBr2(s) + 2HNO3(aq)Pb(NO3)2(aq) + 2HBr(aq) = PbBr2(s) + 2HNO3(aq)
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
PCl3 + 3H2O = H3PO3 + 3HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(NO3)2+NaI=PbI2+NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb(NO3)2+2KI=PbI2+2KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
Pb(NO3)2+2KI=PbI2+2KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PCl5+H2O=HCl+H3(PO4)PCl5 + 4H2O = 5HCl + H3(PO4)
PCl5+H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
PCl3+H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
PbS+ O2 = PbO+ SO22PbS + 3O2 = 2PbO + 2SO2
PBr3 + H2O = H3PO3 + HBr PBr3 + 3H2O = H3PO3 + 3HBr
Pb(NO3)2+FeBr3=Pb3(Br3)2+Fe2(NO3)63Pb(NO3)2 + 2FeBr3 = Pb3(Br3)2 + Fe2(NO3)6
P4(s)+Ca(s)=Ca3P2(s)P4(s) + 6Ca(s) = 2Ca3P2(s)
PbO2=PbO+O22PbO2 = 2PbO + O2
Pb(s) + AgNO3(aq)= Pb(NO3)2 + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2 + 2Ag(s)
PbSO4 = PbSO3 + O22PbSO4 = 2PbSO3 + O2
P4 + ClO + OH = H2PO4 + ClP4 + 8ClO + 8OH = 4H2PO4 + 8Cl
PbS + O2 = PbO + SO22PbS + 3O2 = 2PbO + 2SO2
Pb(NO3)2 = 2PbO + 4NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P + HNO3 + H2O= H3PO4 + NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
PbSO4 = PbSO3+O55PbSO4 = 5PbSO3 + O5
PbS + O2 = 2PbO + 2SO22PbS + 3O2 = 2PbO + 2SO2
P2S5(s) + PCl5(s) = PSCl3(g)P2S5(s) + 3PCl5(s) = 5PSCl3(g)
Pb2OH+CH3COO=Pb2CH3COO+OHCH3COOPb2OH + 2CH3COO = Pb2CH3COO + OHCH3COO
Pb2OH+CH3COO=Pb2CH3COO+OHCH3COOPb2OH + 2CH3COO = Pb2CH3COO + OHCH3COO
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
PbCO3 + KNO3 = Pb3O4 + KNO2 + CO23PbCO3 + KNO3 = Pb3O4 + KNO2 + 3CO2
PbS+O2 =PbO+SO22PbS + 3O2 = 2PbO + 2SO2
P4+O5=P2O5P4 + 2O5 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4 + S8 = P2S54P4 + 5S8 = 8P2S5
Pb + Na + C2H5Cl = Pb(C2H5)4 + NaClPb + 4Na + 4C2H5Cl = Pb(C2H5)4 + 4NaCl
Pb + Na + C2H5Cl = Pb(C2H5)4 + NaClPb + 4Na + 4C2H5Cl = Pb(C2H5)4 + 4NaCl
PtCl2 + 2HNO3 =Pt(NO3)2 + 2HClPtCl2 + 2HNO3 = Pt(NO3)2 + 2HCl
PbO2+HCl=PbCl2+Cl2+H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) +Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
Pt+2F=PtFPt + F = PtF
Po+2 + Se-2 = PoSePo+2 + Se-2 = PoSe
Pt+4 + H-1 = PtH4Pt+4 + 4H-1 = PtH4
Pt+4 + H-1 = PtH4Pt+4 + 4H-1 = PtH4
Po+4 + N-3 = Po3 N43Po+4 + 4N-3 = Po3N4
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pt + H = PtHPt + H = PtH
Pt + H = PtH4Pt + 4H = PtH4
Pt+4 + H-1 = PtH4Pt+4 + 4H-1 = PtH4
Pt+2 + H-1 = PtH2Pt+2 + 2H-1 = PtH2
PCl5(l)+H2O(l)=H3PO4(aq)+HCl(g)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(g)
Pb(s) + AgNO3(aq)= Pb(NO3)2(aq) + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb + (OH) = Pb(OH)Pb + (OH) = Pb(OH)
P4 + KClO3 = KCl + P2O53P4 + 10KClO3 = 10KCl + 6P2O5
PbCO3 = PbO + CO2PbCO3 = PbO + CO2
PbO2 + HCl = PbCl2 + Cl2 + H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
P4O10 + H2O= H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2 + K2CO3= PbCO3 + KNO3Pb(NO3)2 + K2CO3 = PbCO3 + 2KNO3
Pb(s) + AgNO3(aq) = Pb(NO3)2(aq) + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2+LiBr=PbBr2+LiNO3Pb(NO3)2 + 2LiBr = PbBr2 + 2LiNO3
PbS + HNO3 = Pb(NO3)2 + NO + S +H2O3PbS + 8HNO3 = 3Pb(NO3)2 + 2NO + 3S + 4H2O
P4 + Ca = Ca3P2P4 + 6Ca = 2Ca3P2
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P+O2=P4O104P + 5O2 = P4O10
PCl5 + H2O = H3 PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
PbO2 +HCl=PbCl2 + Cl2 +H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
P4 + KClO3= KCl + P2O53P4 + 10KClO3 = 10KCl + 6P2O5
P 4 O 10 (s)+ H 2 O(l) = H 3 P O 4 (aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P 2 O 3 (g)+ O 2 (g) = P 2 O 5 (g)P2O3(g) + O2(g) = P2O5(g)
P + O2 =P4O104P + 5O2 = P4O10
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb (NO2)2+NaI=PbI2+NaNO2Pb(NO2)2 + 2NaI = PbI2 + 2NaNO2
Pb+HCl=PbCl2+H2Pb + 2HCl = PbCl2 + H2
P+Cl2=PCl52P + 5Cl2 = 2PCl5
Pb(NO3)2 + K2SO4=KNO3 + PbSO4Pb(NO3)2 + K2SO4 = 2KNO3 + PbSO4
PbS + HNO3 = Pb(NO3)2 + NO + S + H2O3PbS + 8HNO3 = 3Pb(NO3)2 + 2NO + 3S + 4H2O
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
P4 + Cl2 = PCl2P4 + 4Cl2 = 4PCl2
PF3+3H2O=3HF+H3PO3PF3 + 3H2O = 3HF + H3PO3
P4+O10=P2O5P4 + O10 = 2P2O5
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2(aq)+KCl(aq)=PbCl(aq)+K(NO3)2Pb(NO3)2(aq) + KCl(aq) = PbCl(aq) + K(NO3)2
PCl5+H2O= H3PO4+HClPCl5 + 4H2O = H3PO4 + 5HCl
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
P4+O2=P2O3P4 + 3O2 = 2P2O3
Pb(NO3)2 + NaI = PbI2 + 2NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb+H3PO4=H2+Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
P2O5 + BaO = Ba3(PO4)2P2O5 + 3BaO = Ba3(PO4)2
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2+KI=KNO3+PbI2Pb(NO3)2 + 2KI = 2KNO3 + PbI2
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P(s)+O2(g)=P2O5(s)4P(s) + 5O2(g) = 2P2O5(s)
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PCl5+H2O=HCl+H3PO4PCl5 + 4H2O = 5HCl + H3PO4
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
PbO2=PbO+O22PbO2 = 2PbO + O2
Pb(CH3COO)2+K2CrO4=PbCrO4+KCH3COOPb(CH3COO)2 + K2CrO4 = PbCrO4 + 2KCH3COO
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P+HNO3+H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
Pb(NO3)2 + (NH4)2CO3=PbCO3 + NO3NH4Pb(NO3)2 + (NH4)2CO3 = PbCO3 + 2NO3NH4
Pb( NO3)2 = PbO +NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P4 + O2 =P2O3P4 + 3O2 = 2P2O3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PCl3=Cl2+P44PCl3 = 6Cl2 + P4
Pb + SiO2 = PbSiO2Pb + SiO2 = PbSiO2
P2O5 + H2O=H3PO4P2O5 + 3H2O = 2H3PO4
P2O5 + H2O=H3PO4P2O5 + 3H2O = 2H3PO4
Pb(ClO4)4+BaSO4=Pb2(SO4)4+Ba(ClO4)22Pb(ClO4)4 + 4BaSO4 = Pb2(SO4)4 + 4Ba(ClO4)2
P4O10 + 6 PCl5 = 10Cl3POP4O10 + 6PCl5 = 10Cl3PO
P+O2=P4O104P + 5O2 = P4O10
PbS+O2=PbO+SO22PbS + 3O2 = 2PbO + 2SO2
Pb + Fe (NO3)3 = Fe + Pb(NO3)3Pb + Fe(NO3)3 = Fe + Pb(NO3)3
P4+Cl2= PCl3P4 + 6Cl2 = 4PCl3
PH3+O2=P4O10+H2O4PH3 + 8O2 = P4O10 + 6H2O
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2 + H2SO4 = PbSO4 + HNO3Pb(NO3)2 + H2SO4 = PbSO4 + 2HNO3
Pb(NO3)2+K2SO4=PbSO4+KNO3Pb(NO3)2 + K2SO4 = PbSO4 + 2KNO3
PO4 + CuCO3 = Cu3(PO4)2 +CO32PO4 + 3CuCO3 = Cu3(PO4)2 + 3CO3
Pb(NO3)2 + H2SO4 = PbSO4 + HNO3Pb(NO3)2 + H2SO4 = PbSO4 + 2HNO3
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P4+O2+H2O=H3PO4P4 + 5O2 + 6H2O = 4H3PO4
P4+S8 = P4S104P4 + 5S8 = 4P4S10
PCl3(l) + AgF(s) = PF3(g) + AgCl(s)PCl3(l) + 3AgF(s) = PF3(g) + 3AgCl(s)
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
PCl5(l)+4H2O(l) =P(OH)5(aq)+5HCl(g)PCl5(l) + 5H2O(l) = P(OH)5(aq) + 5HCl(g)
PCl5(l)+4H2O(l) =H3PO4(aq)+5HCl(g)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(g)
P4O6 + H2O = H3PO3P4O6 + 6H2O = 4H3PO3
PCl5+H2O=HCl+H3PO4PCl5 + 4H2O = 5HCl + H3PO4
P3+H2O2=H3PO4+H2O2P3 + 15H2O2 = 6H3PO4 + 6H2O
P4+H2O2=H3PO4+H2OP4 + 10H2O2 = 4H3PO4 + 4H2O
P4+H2O2=H3PO4+H2OP4 + 10H2O2 = 4H3PO4 + 4H2O
P4+H2O2=H3PO4+H2OP4 + 10H2O2 = 4H3PO4 + 4H2O
P4+H2O2=H3PO4+H2OP4 + 10H2O2 = 4H3PO4 + 4H2O
P4O10+3H2O=2H3PO4P4O10 + 6H2O = 4H3PO4
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
Pb(NO3)2 + H2O = PbO2 + HNO3 + H2Pb(NO3)2 + 2H2O = PbO2 + 2HNO3 + H2
Pb(NO3)2(l) + AlCl3(l) = PbCl2(s) + Al(NO3)3(aq)3Pb(NO3)2(l) + 2AlCl3(l) = 3PbCl2(s) + 2Al(NO3)3(aq)
P4 + O2 = P4O10P4 + 5O2 = P4O10
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4+O2=P2O5P4 + 5O2 = 2P2O5
PbO+Na3N=Pb3N2+Na2O3PbO + 2Na3N = Pb3N2 + 3Na2O
Pb(s) + AgNO3(aq) = Pb(NO3)2 + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2 + 2Ag(s)
PbO2 = PbO + O22PbO2 = 2PbO + O2
P4(s) + Ca(s) = Ca3P2(s)P4(s) + 6Ca(s) = 2Ca3P2(s)
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
PCl5(s)+H2O(l)=H3PO4(aq)+HCl(aq)PCl5(s) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
Pb(s) + H2 O(l) + O2 (g) =Pb(OH)2 (s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4 (s) + O2 (g) = P4 O10(s)P4(s) + 5O2(g) = P4O10(s)
P + H2SO4 = H3PO4 + H20 + SO220P + 40H2SO4 = 20H3PO4 + H20 + 40SO2
PtCl4 (s) = Pt(s) + Cl2 (g)PtCl4(s) = Pt(s) + 2Cl2(g)
Pb(s) + H2 O(l) + O2 (g) = Pb(OH)2 (s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4 (s) + O2 (g) = P4 O10(s)P4(s) + 5O2(g) = P4O10(s)
PCl5 (s) + H2 O(l) = POCl3 (l) + HCl(aq)PCl5(s) + H2O(l) = POCl3(l) + 2HCl(aq)
PtCl4 (s) = Pt(s) + Cl2 (g)PtCl4(s) = Pt(s) + 2Cl2(g)
P4 (s) + Cl2 (g) = PCl3 (l)P4(s) + 6Cl2(g) = 4PCl3(l)
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P(s) + O2(g) = P2O5(s)4P(s) + 5O2(g) = 2P2O5(s)
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P+2O2=PO2P + O2 = PO2
P4O10+H2O=H2PO4+H3OP4O10 + 10H2O = 4H2PO4 + 4H3O
P + Cl2 = PCl32P + 3Cl2 = 2PCl3
P4O10 + Na2O = Na3(PO4)P4O10 + 6Na2O = 4Na3(PO4)
P+O2=P2O54P + 5O2 = 2P2O5
PbO2+MnSO4+H3PO4=Pb3(PO4)2+HMnO4+PbSO4+H2O5PbO2 + 2MnSO4 + 2H3PO4 = Pb3(PO4)2 + 2HMnO4 + 2PbSO4 + 2H2O
PbO2+MnSO4+H3PO4=Pb2(PO4)2+HMnO4+PbSO4+H2O8PbO2 + 2MnSO4 + 6H3PO4 = 3Pb2(PO4)2 + 2HMnO4 + 2PbSO4 + 8H2O
P4+H2=PH3P4 + 6H2 = 4PH3
PH3 + O2 = P4O10 + H2O4PH3 + 8O2 = P4O10 + 6H2O
Pb + PbO2 + 2SO= 2PbSO4-1Pb + 3PbO2 + 2SO = 2PbSO4
Pb(C2H3O2)2(aq) + H2O(l) + CO2(g) = PbCO3(s) + HC2H3O2(aq)Pb(C2H3O2)2(aq) + H2O(l) + CO2(g) = PbCO3(s) + 2HC2H3O2(aq)
Pb(C2H3O2)2(aq) + H2O(l) + CO2(g) = PbCO3(s) + 2HC2H3O2(aq)Pb(C2H3O2)2(aq) + H2O(l) + CO2(g) = PbCO3(s) + 2HC2H3O2(aq)
P4O10+H2O= H3PO4P4O10 + 6H2O = 4H3PO4
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P2S5(s) + PCl5(s) =PSCl3(g)P2S5(s) + 3PCl5(s) = 5PSCl3(g)
Pb(SO4) + Ag(NO3) = Pb(NO3) + Ag(SO4)Pb(SO4) + Ag(NO3) = Pb(NO3) + Ag(SO4)
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P + Cl2 = PCl32P + 3Cl2 = 2PCl3
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb3P4 = Pb + P4Pb3P4 = 3Pb + P4
P + O2 = P4O104P + 5O2 = P4O10
Pb(OH)4--+ ClO- = PbO2+ Cl- + OH- + H2OPb(OH)4-- + ClO- = PbO2 + Cl- + 2OH- + H2O
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4 + 6Cl2 = 5PCl3P4 + 6Cl2 = 4PCl3
PbO4 (s)=Pb (s) + O2 (g)PbO4(s) = Pb(s) + 2O2(g)
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
PbO2 (s) + CO (g) = Pb (s) + CO2 (g)PbO2(s) + 2CO(g) = Pb(s) + 2CO2(g)
PbO2 (s) + CO (g) = Pb (s) +CO2 (g)PbO2(s) + 2CO(g) = Pb(s) + 2CO2(g)
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
PCl5 =PCl3 + Cl2PCl5 = PCl3 + Cl2
Pb+PbO2+H2SO4 = PbSO4+H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
Pb+PbO2+H2SO = PbSO4+H2O-1Pb + 2PbO2 + H2SO = PbSO4 + H2O
Pb+PbO2+H2SO1 = PbSO4+H2O-1Pb + 2PbO2 + H2SO1 = PbSO4 + H2O
Pb(s) + AgNO3(aq) = Pb(NO3)2(aq) + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4(s) + Ca(s) = Ca3P2(s)P4(s) + 6Ca(s) = 2Ca3P2(s)
Pb(NO3)2(aq) +2KCl(aq) = PbCl2(s) +2KNO3(aq) Pb(NO3)2(aq) + 2KCl(aq) = PbCl2(s) + 2KNO3(aq)
P4 + 3 H2 = PH3P4 + 6H2 = 4PH3
P4 + 6 H2 = 4 PH3P4 + 6H2 = 4PH3
PH3 + O2 = P4O10 + H2O4PH3 + 8O2 = P4O10 + 6H2O
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
PBr3(l)+H2O(l)=H3PO3(aq)+HBr(aq)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(aq)
Pb(NO3)2 + KL = PbL2 + KNO3Pb(NO3)2 + 2KL = PbL2 + 2KNO3
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
Pb + 2AgNO3 = 2Ag + Pb(NO3)2Pb + 2AgNO3 = 2Ag + Pb(NO3)2
Pb + H3PO4 = PbPO4 + H22Pb + 2H3PO4 = 2PbPO4 + 3H2
Pb + H3PO4 = PbPO4 + HPb + H3PO4 = PbPO4 + 3H
P + Cl2 = PCl32P + 3Cl2 = 2PCl3
Pb2O4 = 2Pb + O2Pb2O4 = 2Pb + 2O2
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
Pb(s)+H2O(l)+O2(g)=Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P4O10 + H2O = H2PO4 + H3OP4O10 + 10H2O = 4H2PO4 + 4H3O
PbS+O2=PbO+SO22PbS + 3O2 = 2PbO + 2SO2
P + O2 = P2O22P + O2 = P2O2
Pb + H2SO4= H2+ PbSO4Pb + H2SO4 = H2 + PbSO4
PbO2 = PbO + O22PbO2 = 2PbO + O2
P4(s)+2NaOH(aq)+H2O(l)=PH3(g)+Na2HPO3(aq)P4(s) + 4NaOH(aq) + 2H2O(l) = 2PH3(g) + 2Na2HPO3(aq)
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PCl5(l) + H2O(l) = H3PO4(aq) + HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
PbCO3 + KNO3 = Pb3O4 + KNO2 + CO23PbCO3 + KNO3 = Pb3O4 + KNO2 + 3CO2
PbCO3 + KNO3 = Pb3O4 + KNO2 + CO23PbCO3 + KNO3 = Pb3O4 + KNO2 + 3CO2
P4 (s)+Cl2 (g)=PCl5 (g)P4(s) + 10Cl2(g) = 4PCl5(g)
Pb + N2= Pb2N34Pb + 3N2 = 2Pb2N3
P2O3 (g) + O2 = P2O5 (g)P2O3(g) + O2 = P2O5(g)
P4 + S8 =P4S104P4 + 5S8 = 4P4S10
P2O5+H2O=H3PO4P2O5 + 3H2O = 2H3PO4
P2O5+BaO=Ba3(PO4)2P2O5 + 3BaO = Ba3(PO4)2
PbO2+HCl=PbCl2+H2O+Cl2PbO2 + 4HCl = PbCl2 + 2H2O + Cl2
PB(NO3)2+KI = KNO3+PBI2PB(NO3)2 + 2KI = 2KNO3 + PBI2
P + HNO3 = H3PO4 + H2O +NO2P + 5HNO3 = H3PO4 + H2O + 5NO2
P + HNO3 = H3PO4 + H2O +NO2P + 5HNO3 = H3PO4 + H2O + 5NO2
P + HNO3 = H3PO4 + H2O +NO2P + 5HNO3 = H3PO4 + H2O + 5NO2
P + Cl2 = PCl32P + 3Cl2 = 2PCl3
PH3 + N2O = P4O10 + H2O + N24PH3 + 16N2O = P4O10 + 6H2O + 16N2
P2O5(s) + H2O(l)= H3PO4(aq)P2O5(s) + 3H2O(l) = 2H3PO4(aq)
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
Pb+HP=H+Pb3P3Pb + HP = H + Pb3P
PbCrO4+HCl+FeSO4=PbCl2+Cr2(SO4)3+FeCl3+H2O+Fe2(SO4)32PbCrO4 + 16HCl + 6FeSO4 = 2PbCl2 + Cr2(SO4)3 + 4FeCl3 + 8H2O + Fe2(SO4)3
PCl5(l)+H2O(l)=H3PO4(aq)+HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb+H3PO4=H2+Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4 + HNO3 + H2O = H3PO4 + NO3P4 + 20HNO3 + 8H2O = 12H3PO4 + 20NO
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P+O2=P2O54P + 5O2 = 2P2O5
PbO=Pb+O22PbO = 2Pb + O2
PbS + H2O2 = PbSO4 + H2OPbS + 4H2O2 = PbSO4 + 4H2O
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
Pb(NO3)2 + 2H2SO4 = Pb(HSO4)2 + 2HNO3Pb(NO3)2 + 2H2SO4 = Pb(HSO4)2 + 2HNO3
Pb+HP=H+Pb3P3Pb + HP = H + Pb3P
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2 + 2 NH4Cl = PbCl2 + 2 NH4 NO3Pb(NO3)2 + 2NH4Cl = PbCl2 + 2NH4NO3
P4 + O2 = P4O6P4 + 3O2 = P4O6
P4 + O2 = P4O6P4 + 3O2 = P4O6
Pb + N2 = Pb2N34Pb + 3N2 = 2Pb2N3
Pt + CoSo4 = Co2 + Pt2So44Pt + 2CoSo4 = Co2 + 2Pt2So4
Pt + CoSo4 = Co + PtSo4Pt + CoSo4 = Co + PtSo4
Pb(NO3)2(aq) + Li2SO4(aq) = PbSO4(s) + 2LiNO3(aq)Pb(NO3)2(aq) + Li2SO4(aq) = PbSO4(s) + 2LiNO3(aq)
P2O5 (s) + H2O (l) = H3PO4 (aq)P2O5(s) + 3H2O(l) = 2H3PO4(aq)
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
Pb( C2 H3 O2)+ NH4SO4= PbSO4 + NH4( C2 H3 O2)Pb(C2H3O2) + NH4SO4 = PbSO4 + NH4(C2H3O2)
Pb(ClO4)2+Na2S=PbS+2NaClO4Pb(ClO4)2 + Na2S = PbS + 2NaClO4
Pb(ClO4)2(aq)+Na2S(aq)=PbS(s)+2NaClO4(aq)Pb(ClO4)2(aq) + Na2S(aq) = PbS(s) + 2NaClO4(aq)
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
PCl3+Cl2 = PCl5PCl3 + Cl2 = PCl5
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
Pb(NO3)2 + Na3PO4 = Pb3(PO4)2 + Na NO33Pb(NO3)2 + 2Na3PO4 = Pb3(PO4)2 + 6NaNO3
Pb(NO3)2 = PbO + NO + O22Pb(NO3)2 = 2PbO + 4NO + 3O2
P2S5 + PCl5 = PSCl3P2S5 + 3PCl5 = 5PSCl3
P2O5(s) + H2O(l)=H3PO4(aq)P2O5(s) + 3H2O(l) = 2H3PO4(aq)
P4(s) + Ca(s)= Ca3P2(s)P4(s) + 6Ca(s) = 2Ca3P2(s)
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P(s)+O2(g)=P2O5(s)4P(s) + 5O2(g) = 2P2O5(s)
P4+Cl2= PCl5P4 + 10Cl2 = 4PCl5
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P + Cl2 = PCl52P + 5Cl2 = 2PCl5
P4 + O2 = P2O3P4 + 3O2 = 2P2O3
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4 + KOH+ H2O = KH2PO2 + PH3P4 + 3KOH + 3H2O = 3KH2PO2 + PH3
Pb(NO3)2 + H2S = PbS + 2 HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
P4+O2 = P2O5P4 + 5O2 = 2P2O5
Pb(s)+H2O(l)+O2(g)=Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P4 + O2 = P4O10P4 + 5O2 = P4O10
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
PbO+NaCl+H2O+CO2=Pb2Cl2CO3+NaOH2PbO + 2NaCl + H2O + CO2 = Pb2Cl2CO3 + 2NaOH
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
PBr3 + H2O = H3PO3 + HBrPBr3 + 3H2O = H3PO3 + 3HBr
P4 +F2 =PF3P4 + 6F2 = 4PF3
P4+N2O=P4O6+N2P4 + 6N2O = P4O6 + 6N2
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P + O2 = P2O34P + 3O2 = 2P2O3
P + Br2 = 2PBr32P + 3Br2 = 2PBr3
PCl3 + 3H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
P+HNO3+H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
P4+F2=PF3P4 + 6F2 = 4PF3
P+HNO3+H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
P+HNO3+H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
Pt + HCl + HNO3 = PtCl4 + N2O + H2O2Pt + 8HCl + 2HNO3 = 2PtCl4 + N2O + 5H2O
P + KOH + H2O = KH2PO2 + PH34P + 3KOH + 3H2O = 3KH2PO2 + PH3
PbCO3=PbO + CO2 PbCO3 = PbO + CO2
P2O5(s) + H2O(l) = H3PO4(aq)P2O5(s) + 3H2O(l) = 2H3PO4(aq)
Pb(OH)2 = PbO + H2OPb(OH)2 = PbO + H2O
P2O5+H2O=H3PO4P2O5 + 3H2O = 2H3PO4
PCl5 + AsF3 = PF5 + AsCl3 3PCl5 + 5AsF3 = 3PF5 + 5AsCl3
P4O10 + Ca(OH)2 = Ca3(PO4)2 + H2O P4O10 + 6Ca(OH)2 = 2Ca3(PO4)2 + 6H2O
P2O5 + 2H2O = 2H3PO4P2O5 + 3H2O = 2H3PO4
Pb3O4 + H2O = Pb + (OH)Pb3O4 + 4H2O = 3Pb + 8(OH)
PCl3 + Cl2 = PCl5PCl3 + Cl2 = PCl5
PbO2 + HCl = PbCl2 + Cl2 + H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb + O2 = PbO32Pb + 3O2 = 2PbO3
Pb(NO3)2 + 2NaClO3 = Pb(ClO3)2 + 2NaNO3Pb(NO3)2 + 2NaClO3 = Pb(ClO3)2 + 2NaNO3
P + O2 = PO2P + O2 = 2PO
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
Pb(NO3)2+BaI2=PbI2+Ba(NO3)2Pb(NO3)2 + BaI2 = PbI2 + Ba(NO3)2
P4+O2=P2O3P4 + 3O2 = 2P2O3
Pb(NO3)2(aq) + Li2SO4(aq) = PbSO4(s) + LiNO3(aq) Pb(NO3)2(aq) + Li2SO4(aq) = PbSO4(s) + 2LiNO3(aq)
PbN2O6+NaI=NaNO3+PbI2PbN2O6 + 2NaI = 2NaNO3 + PbI2
Pt + HCl = PtCl + H22Pt + 2HCl = 2PtCl + H2
Pb2 + H2SO4 = SO4Pb + H2Pb2 + 2H2SO4 = 2SO4Pb + 2H2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4 + O2 = P2O3P4 + 3O2 = 2P2O3
P4O10+H2O=H3O4PP4O10 + 6H2O = 4H3O4P
Pb(NO3)2 + K2CO3 = PbCO3 + KNO3Pb(NO3)2 + K2CO3 = PbCO3 + 2KNO3
P4O10+H2O=H3PO3+O2P4O10 + 6H2O = 4H3PO3 + 2O2
P4O10+H2O=H3PO3+O2P4O10 + 6H2O = 4H3PO3 + 2O2
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
Pb(NO3)2+NaI=PbI+Na(NO3)2Pb(NO3)2 + NaI = PbI + Na(NO3)2
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2 + HCl = PbCl2 + HNO3Pb(NO3)2 + 2HCl = PbCl2 + 2HNO3
P(s) + O2(g) = P2O5(g)4P(s) + 5O2(g) = 2P2O5(g)
Pb (NO3)2 + NaCl= PbCl2 + NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
PbO+NaOH=Na2PbO+H2O2PbO + 2NaOH = Na2PbO + H2O2
Pb(NO3)2 + Na2CO3 = PbCO3 + 2NaNO3Pb(NO3)2 + Na2CO3 = PbCO3 + 2NaNO3
PbO2 + H2 =Pb +H2OPbO2 + 2H2 = Pb + 2H2O
Pb(s)+H2O=PbO+H2Pb(s) + H2O = PbO + H2
P+HNO3+H2O=NO+H3PO43P + 5HNO3 + 2H2O = 5NO + 3H3PO4
PH3 + O2 = P4O10 + H2O4PH3 + 8O2 = P4O10 + 6H2O
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
Pb(NO3)2+K2SO4=KNO3+PbSO4Pb(NO3)2 + K2SO4 = 2KNO3 + PbSO4
PbS( s) + O2 (g) =PbO (s) + SO2 (g)2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
PCl3 + H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
PBr3(g) + H2O(l)=H3PO3(aq) + HBr(aq)PBr3(g) + 3H2O(l) = H3PO3(aq) + 3HBr(aq)
Pb ( C2 H3 O2) + CuCl2= PbCl2 + Cu ( C2 H3 O2)Pb(C2H3O2) + CuCl2 = PbCl2 + Cu(C2H3O2)
PbO2 + Sn + H+ = Pb2+ + Sn2+ +H2O2PbO2 + 14Sn + 8H+ = Pb2+ + 7Sn2+ + 4H2O
Pb(OH)2 + Hg2S = PbS + Hg(OH)Pb(OH)2 + Hg2S = PbS + 2Hg(OH)
Pb(NO3)2+NaCl=PbCl2+NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
PbCl2= Pb +ClPbCl2 = Pb + 2Cl
P+Cl=PClP + Cl = PCl
PbO + NaCl + H2O + CO2 = Pb2Cl2CO3 + NaOH2PbO + 2NaCl + H2O + CO2 = Pb2Cl2CO3 + 2NaOH
PbS + H2SO4 = PbSO4 + H2SPbS + H2SO4 = PbSO4 + H2S
Pb(NO3)2 (aq) + 2KI (aq) = PbI2 (s) + 2KNO3 (aq)Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3(aq)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(CH3COO)2 + KSCN = PbSCN + K(CH3COO)2Pb(CH3COO)2 + KSCN = PbSCN + K(CH3COO)2
Pb(NO3)2+AlCl3=PbCl2+Al(NO3)33Pb(NO3)2 + 2AlCl3 = 3PbCl2 + 2Al(NO3)3
Pb(NO3)4 + 2CaCl2 = PbCl4 + 2Ca(NO3)2Pb(NO3)4 + 2CaCl2 = PbCl4 + 2Ca(NO3)2
Pb(NO3)4 + 2CaCl2 = PbCl4 + 2Ca(NO3)2Pb(NO3)4 + 2CaCl2 = PbCl4 + 2Ca(NO3)2
PbN6 + CrMn2O8 = Cr2O3 + MnO2 + Pb3O4 + NO15PbN6 + 44CrMn2O8 = 22Cr2O3 + 88MnO2 + 5Pb3O4 + 90NO
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
PCH3 + KMnO4 + H2S O4 = PCOOH + K2S O4 + MnS O4 + H2O5PCH3 + 6KMnO4 + 9H2SO4 = 5PCOOH + 3K2SO4 + 6MnSO4 + 14H2O
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4 + H2 =PH3P4 + 6H2 = 4PH3
PbS + H2O2 = PbSO4 + H2OPbS + 4H2O2 = PbSO4 + 4H2O
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P4+Cl2=PCl5P4 + 10Cl2 = 4PCl5
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(l)+H2O=PbOH+H22Pb(l) + 2H2O = 2PbOH + H2
PCl5(l) + H2O(l) = H3PO4(aq) + HCl(g)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(g)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
PbO+C=Pb+CO22PbO + C = 2Pb + CO2
Pb(NO3)2+K2CrO4=KNO3+PbCrO4Pb(NO3)2 + K2CrO4 = 2KNO3 + PbCrO4
PbSO4+AgNO3=Pb(NO3)+AgSO4PbSO4 + AgNO3 = Pb(NO3) + AgSO4
Pb(NO3)2 + Na3HPO4 = Pb3(PO4)2 + NaNO3 + H23Pb(NO3)2 + 2Na3HPO4 = Pb3(PO4)2 + 6NaNO3 + H2
Pb(NO2)2 + NaCl = NaNO2 = PbCl2Pb(NO2)2 + 2NaCl = 2NaNO2 + PbCl2
Pb(ClO4)2 + NiSO4 = PbSO4 + Ni(ClO4)2Pb(ClO4)2 + NiSO4 = PbSO4 + Ni(ClO4)2
Pb(CH3COO)2 + KI = PbI2 + KCH3COOPb(CH3COO)2 + 2KI = PbI2 + 2KCH3COO
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
PbO2 = PbO+O22PbO2 = 2PbO + O2
PCl3(l)+H2O(l)=H3PO3(aq)+HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4+O2=P2O3P4 + 3O2 = 2P2O3
Pb(NO3)2(aq) + KI(s) = PbI2(s) + KNO3(aq)Pb(NO3)2(aq) + 2KI(s) = PbI2(s) + 2KNO3(aq)
P2O4 = P2 + 2O2P2O4 = P2 + 2O2
P4O10+ H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4O10+ H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2(aq)+K2S(aq)=PbS+KNO3Pb(NO3)2(aq) + K2S(aq) = PbS + 2KNO3
PbO(s)+2NH3(g)=Pb(s)+N2(g)+H2O(l)3PbO(s) + 2NH3(g) = 3Pb(s) + N2(g) + 3H2O(l)
PbNO2(aq) + NaCl(aq) = PbCl(s) + NaNO2(aq)PbNO2(aq) + NaCl(aq) = PbCl(s) + NaNO2(aq)
PbO(s)+2NH3(g)=Pb(s)+N2(g)+H2O(l)3PbO(s) + 2NH3(g) = 3Pb(s) + N2(g) + 3H2O(l)
PbO+NH4Cl=Pb+PbCl2+N2+H2O4PbO + 2NH4Cl = 3Pb + PbCl2 + N2 + 4H2O
PCl5+H2O=H3PO4+HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(s) + H2O(l) +O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4 + NaOH +H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P(s)+O2(g)+Cl2(g)=POCl3(l)2P(s) + O2(g) + 3Cl2(g) = 2POCl3(l)
Pb(s) +HNO3(aq) =Pb(NO3)4(aq) +H2(g)Pb(s) + 4HNO3(aq) = Pb(NO3)4(aq) + 2H2(g)
Pb(NO3)2 + Na2(SO4) = PbSO4 + NaNO3Pb(NO3)2 + Na2(SO4) = PbSO4 + 2NaNO3
P4(s)+NaOH(aq)+H2O=PH3(g)+NaHPO3(aq)7P4(s) + 12NaOH(aq) + 24H2O = 16PH3(g) + 12NaHPO3(aq)
P4 + S8 = P4S3 8P4 + 3S8 = 8P4S3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4+HNO3+H2O=H3PO4+NO3P4 + 20HNO3 + 8H2O = 12H3PO4 + 20NO
Pb+NiCl = PbCl4 + NiPb + 4NiCl = PbCl4 + 4Ni
Pb+NiCl = PbCl4 + NiPb + 4NiCl = PbCl4 + 4Ni
PCl3 + 3H2O = H3PO3 + 3HClPCl3 + 3H2O = H3PO3 + 3HCl
P2O5 + H2O = 2H3PO4P2O5 + 3H2O = 2H3PO4
PCl3 + Cl2 = PCl5PCl3 + Cl2 = PCl5
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb(s) + HNO3(aq) = Pb(NO3)4(aq) + H2(g)Pb(s) + 4HNO3(aq) = Pb(NO3)4(aq) + 2H2(g)
Pb(s) + HNO3(aq) = Pb(NO3)4(aq) + H2(g)Pb(s) + 4HNO3(aq) = Pb(NO3)4(aq) + 2H2(g)
Pb(s) + H2O(l) +O2(g) = Pb(OH)2(s) 2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4 + O2 = P2O3P4 + 3O2 = 2P2O3
PbCl2 + Na2CrO4 = PbCrO4 + NaClPbCl2 + Na2CrO4 = PbCrO4 + 2NaCl
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4+O2=P2O5P4 + 5O2 = 2P2O5
PI3(s) + H2O(l) = H3PO3(aq) + HI(g)PI3(s) + 3H2O(l) = H3PO3(aq) + 3HI(g)
P4(s)+ O2(g)= P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P + Cl = PCl3P + 3Cl = PCl3
PH3+AgNO3+H2O=Ag+H3PO4+HNO3PH3 + 8AgNO3 + 4H2O = 8Ag + H3PO4 + 8HNO3
Pb(NO3)2+NaI=PbI2+NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
P + H2O + H2 = H3PO32P + 6H2O - 3H2 = 2H3PO3
P4+O2=P2 O5P4 + 5O2 = 2P2O5
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P Cl3+H2 O=H Cl+H3 PO3PCl3 + 3H2O = 3HCl + H3PO3
P Cl3+H2 O=H Cl+H3 P O3PCl3 + 3H2O = 3HCl + H3PO3
Pb(NO3)2+KI=KNO3+PbI2Pb(NO3)2 + 2KI = 2KNO3 + PbI2
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PbCl4+K3PO4=KCl+Pb3(PO4)43PbCl4 + 4K3PO4 = 12KCl + Pb3(PO4)4
Pb3O4 = PbO + O22Pb3O4 = 6PbO + O2
Pb3O4 = PbO + O22Pb3O4 = 6PbO + O2
P2O5 = P + O22P2O5 = 4P + 5O2
Pb+Zn(NO3)2=Pb(NO3)2+ZnPb + Zn(NO3)2 = Pb(NO3)2 + Zn
Pb+Cu(NO3)2=Pb(NO3)2+CuPb + Cu(NO3)2 = Pb(NO3)2 + Cu
Pb+Mg(NO3)2=Pb(NO3)2+MgPb + Mg(NO3)2 = Pb(NO3)2 + Mg
Pd(NO3)3+Ca(OH)2=Pd(OH)3+Ca(NO3)22Pd(NO3)3 + 3Ca(OH)2 = 2Pd(OH)3 + 3Ca(NO3)2
Pb(NO3)2 + 2 KCl = PbCl2 + KNO3Pb(NO3)2 + 2KCl = PbCl2 + 2KNO3
Pb + H2PO4 = H2 + Pb3(PO4)23Pb + 2H2PO4 = 2H2 + Pb3(PO4)2
Pb + 4HNO3 = Pb(NO3)2 + 2NO2 + 2H2OPb + 4HNO3 = Pb(NO3)2 + 2NO2 + 2H2O
P4+O2 = P2O5P4 + 5O2 = 2P2O5
P4+O2 = P2O5P4 + 5O2 = 2P2O5
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
PbO + C =CO2 + Pb2PbO + C = CO2 + 2Pb
P+O2=P2O54P + 5O2 = 2P2O5
P+O2=P2O54P + 5O2 = 2P2O5
Pb(OH)2 + 2HNO3 = Pb(NO3)2 + 2H2OPb(OH)2 + 2HNO3 = Pb(NO3)2 + 2H2O
PbO2=PbO+O22PbO2 = 2PbO + O2
Pb(NO3)2(aq)+NaCl(aq)=PbCl2(s)+NaNO3(aq)Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
P2+O2=PO3P2 + 3O2 = 2PO3
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PdCl2 + HNO3 = Pd(NO3)2 +2HClPdCl2 + 2HNO3 = Pd(NO3)2 + 2HCl
Pb(NO3)2 = Pb+NO2+O2Pb(NO3)2 = Pb + 2NO2 + O2
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P4 + O2=P4 O10P4 + 5O2 = P4O10
P4 +O2 = P2O5P4 + 5O2 = 2P2O5

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.