Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Pb(NO3)2(aq)+K2CrO4=PbCrO4(s)+KNO3(aq)Pb(NO3)2(aq) + K2CrO4 = PbCrO4(s) + 2KNO3(aq)
PCl3+H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3(aq) Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3(aq)
Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3 Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3
Pb(NO3)2(aq)+KI(aq)=KNO3(aq)+PbI2(s)Pb(NO3)2(aq) + 2KI(aq) = 2KNO3(aq) + PbI2(s)
Pb(ClO2)4+Zn(SO4) =Pb(SO4)2+Zn(ClO2)2Pb(ClO2)4 + 2Zn(SO4) = Pb(SO4)2 + 2Zn(ClO2)2
P(s)+Br(l)=PBr3(g)P(s) + 3Br(l) = PBr3(g)
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2(aq) + NaCl(aq) =PbCl2 (s) + NaNO3(aq)Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
PbN6 + Cr(MnO4)2 = Cr2O3 + MnO2 + NO + Pb3O415PbN6 + 44Cr(MnO4)2 = 22Cr2O3 + 88MnO2 + 90NO + 5Pb3O4
P4 + H2 =PH3P4 + 6H2 = 4PH3
PCl5 +H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(N O 3 ) 2 (s)=PbO(s)+NO(g)+ O 2 (g)2Pb(NO3)2(s) = 2PbO(s) + 4NO(g) + 3O2(g)
Pb (NO3)2 + KL = PbL2+KNO3Pb(NO3)2 + 2KL = PbL2 + 2KNO3
P(s)+O2(g)=P2O3 (s)4P(s) + 3O2(g) = 2P2O3(s)
PbO+NH3 = Pb+N2+H2O3PbO + 2NH3 = 3Pb + N2 + 3H2O
PbSO4 (aq) + 2KI(aq) ==== PbI2 (s) + K2SO4(aq)PbSO4(aq) + 2KI(aq) = PbI2(s) + K2SO4(aq)
Pb +PbO2+2H2SO4 = 2PbSO4 +2H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
Pb +PbO2+2H2SO4 = 2PbSO4 +2H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
Pb +PbO2+2H2SO4=2PbSO4+2H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
Pb +PbO2+2H2SO4 = 2PbSO4 +2H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
Pb +PbO2+2H2SO4 = 2PbSO4 +2H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
P4+Cl2=PCl5P4 + 10Cl2 = 4PCl5
Pb(NO3)2+2Na=2NaNO3+PbPb(NO3)2 + 2Na = 2NaNO3 + Pb
Pb(NO3)2+2Na=2NaNO3+PbPb(NO3)2 + 2Na = 2NaNO3 + Pb
Pb(NO3)2+2Na=2NaNO3+PbPb(NO3)2 + 2Na = 2NaNO3 + Pb
PbCO3(s) + H2SO4(aq) = PbSO4(s) + CO2(g) + H2O(l) PbCO3(s) + H2SO4(aq) = PbSO4(s) + CO2(g) + H2O(l)
PbCO3(s) + H2SO4(aq) = PbSO4(s) + CO2(g) + H2O(l) PbCO3(s) + H2SO4(aq) = PbSO4(s) + CO2(g) + H2O(l)
PbCO3(s) + H2SO4(aq) = PbSO4(s) + CO2(g) + H2O(l) PbCO3(s) + H2SO4(aq) = PbSO4(s) + CO2(g) + H2O(l)
PCl3 + 3H2 = PH3 + 3HClPCl3 + 3H2 = PH3 + 3HCl
Pb+HNO3=Pb(NO3)2+NO2+H2OPb + 4HNO3 = Pb(NO3)2 + 2NO2 + 2H2O
PbO2 + HI = PbI2 + H2O + I2PbO2 + 4HI = PbI2 + 2H2O + I2
PCl5(g) + H2O(l) = HCl(aq) +H3PO4(aq)PCl5(g) + 4H2O(l) = 5HCl(aq) + H3PO4(aq)
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
PbCl2+K2CO3=PbCO3+KClPbCl2 + K2CO3 = PbCO3 + 2KCl
PbCl2+K2CO3=PbCO3+KClPbCl2 + K2CO3 = PbCO3 + 2KCl
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb+AgNO3=Pb(NO3)2+AgPb + 2AgNO3 = Pb(NO3)2 + 2Ag
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P + Br2 = 2PBr32P + 3Br2 = 2PBr3
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb (NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P 4 (s)+Cl 2 (g)=PCl 5 (g) P4(s) + 10Cl2(g) = 4PCl5(g)
P+O2=P4O104P + 5O2 = P4O10
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
Pb(NO3)2 + 2NaI = PbI2 + NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb(NO3)2 + 2NaI = PbI2 + NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
PbO2 + Sb + KOH = PbO + KSbO2 + H2O3PbO2 + 2Sb + 2KOH = 3PbO + 2KSbO2 + H2O
PbO2 + Sb + KOH = PbO + KSbO2 + H2O3PbO2 + 2Sb + 2KOH = 3PbO + 2KSbO2 + H2O
Pb(NO3)2+K2SO4=PbSO4+KNO3Pb(NO3)2 + K2SO4 = PbSO4 + 2KNO3
P2S5+O2=P4O10+SO22P2S5 + 15O2 = P4O10 + 10SO2
P2S5+O2=P4O10+SO22P2S5 + 15O2 = P4O10 + 10SO2
Pb(NO3)2+MgSO4=PbSO4+Mg(NO3)2Pb(NO3)2 + MgSO4 = PbSO4 + Mg(NO3)2
PbCl2 + K2CO3 = PbCO3 + KCl PbCl2 + K2CO3 = PbCO3 + 2KCl
PbCl2 + K2CO3 = PbCO3 + KCl PbCl2 + K2CO3 = PbCO3 + 2KCl
P2 O5 +H2 O = H3P O4P2O5 + 3H2O = 2H3PO4
PBr3(l)+H2O(l)=H3PO3(aq)+HBr(aq)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(aq)
Pb +HNO3=Pb(NO3)4 +H2Pb + 4HNO3 = Pb(NO3)4 + 2H2
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
PbS+O2 =PbO+SO22PbS + 3O2 = 2PbO + 2SO2
PbO2(s)=PbO(s)+O2(g)2PbO2(s) = 2PbO(s) + O2(g)
P 4 (s)+C l 2 (g)=PC l 5 (g)P4(s) + 10Cl2(g) = 4PCl5(g)
Pb(NO3)2 + C2H4O2 = Pb(C2H3O2)2 + HNO3Pb(NO3)2 + 2C2H4O2 = Pb(C2H3O2)2 + 2HNO3
P4 + F2 = PF3P4 + 6F2 = 4PF3
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
PbCl2 + K2CO3 = PbCO3 + KClPbCl2 + K2CO3 = PbCO3 + 2KCl
PbCl2 + K2CO3 = PbCO3 + KClPbCl2 + K2CO3 = PbCO3 + 2KCl
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2+NaCl=PbCl2+NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
PbCO3 + C6H12O6 = Pb + CO2 + H2O12PbCO3 + C6H12O6 = 12Pb + 18CO2 + 6H2O
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
P2O3(s) + 3H2O(l) = H3PO3(aq)P2O3(s) + 3H2O(l) = 2H3PO3(aq)
Pb(NO3)2 (aq)+ AlCl3(aq) = PbCl2(s) + Al(NO3)3(aq)3Pb(NO3)2(aq) + 2AlCl3(aq) = 3PbCl2(s) + 2Al(NO3)3(aq)
PbSO4=PbSO3+O22PbSO4 = 2PbSO3 + O2
PBO +H2S=PBS +H2OPBO + H2S = PBS + H2O
PbO +H2S=PbS +H2OPbO + H2S = PbS + H2O
PBO +H2S=PBS +H2OPBO + H2S = PBS + H2O
PbCO3=PbO+CO2PbCO3 = PbO + CO2
PbO2(s)=Pb+O2PbO2(s) = Pb + O2
P +O2=P2O54P + 5O2 = 2P2O5
Pb(s) + H2 O(l) + O2 (g) = Pb(OH)2 (s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4+O2=P4O10P4 + 5O2 = P4O10
PtCl4=Pt+Cl2PtCl4 = Pt + 2Cl2
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
PbSO4+O2=PbSO4PbSO4 + 0O2 = PbSO4
PbSO3+O2=PbSO42PbSO3 + O2 = 2PbSO4
PbSO4+O2=PbSO4PbSO4 + 0O2 = PbSO4
PbO2=PbO+O22PbO2 = 2PbO + O2
PbO2=PbO+O22PbO2 = 2PbO + O2
Pb(OH)2=PbO+H2O(g)Pb(OH)2 = PbO + H2O(g)
Pb(OH)2=PbO+H2OPb(OH)2 = PbO + H2O
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PbS+H2O2 = PbSO4+H2OPbS + 4H2O2 = PbSO4 + 4H2O
P4+O=P4O10P4 + 10O = P4O10
P + O2 = P2O54P + 5O2 = 2P2O5
Pb(NO3)2 + FeCl3 = Fe(NO3)3 + PbCl23Pb(NO3)2 + 2FeCl3 = 2Fe(NO3)3 + 3PbCl2
PbO+CO=Pb+CO2PbO + CO = Pb + CO2
PbO+CO=Pb+CO2PbO + CO = Pb + CO2
PbO+CO=Pb+CO2PbO + CO = Pb + CO2
PbS + H2O2 = PbSO4 + H2OPbS + 4H2O2 = PbSO4 + 4H2O
P+O2=P2O54P + 5O2 = 2P2O5
Pb3O4 + H2SO4 = PbSO4 + H2O + O22Pb3O4 + 6H2SO4 = 6PbSO4 + 6H2O + O2
PbO2 + H2SO4 = PbSO4 + H2O + O22PbO2 + 2H2SO4 = 2PbSO4 + 2H2O + O2
Pb3O4 + HCl = PbCl2 + H2O + Cl2Pb3O4 + 8HCl = 3PbCl2 + 4H2O + Cl2
P + HNO3 = H3PO4 + NO2 + H2OP + 5HNO3 = H3PO4 + 5NO2 + H2O
P + HNO3 = H3PO4 + NO2 + H2OP + 5HNO3 = H3PO4 + 5NO2 + H2O
PbI2 + Na2SO4 = PbSO4 + 2NaIPbI2 + Na2SO4 = PbSO4 + 2NaI
Pb(NO3)2 + LiCl = PbCl2 + LiNO3Pb(NO3)2 + 2LiCl = PbCl2 + 2LiNO3
P4O10(s)+6H2O(l)=4H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P+O2 = P2O54P + 5O2 = 2P2O5
P+O2 = P2O54P + 5O2 = 2P2O5
Pb(NO3)2 + CuSO4 = PbSO4 + Cu(NO3)2 Pb(NO3)2 + CuSO4 = PbSO4 + Cu(NO3)2
Pb+PbO2+H2SO4=PbSO4+H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
P2H4(l) = PH3(g) + P4(s)6P2H4(l) = 8PH3(g) + P4(s)
P4(g)+Cl2(g)=PCl5(g)P4(g) + 10Cl2(g) = 4PCl5(g)
PbO2=PbO+O22PbO2 = 2PbO + O2
P4O10=P+O2P4O10 = 4P + 5O2
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
P4O10=P+O2P4O10 = 4P + 5O2
PbCl2+Na2SO4=PbSO4+NaClPbCl2 + Na2SO4 = PbSO4 + 2NaCl
Pb(NO3)2 + NaI = PbI2 + NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
PbN2O6 = PbO + NO2 + O22PbN2O6 = 2PbO + 4NO2 + O2
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
Pb3O4 + HCl = PbCl2 + H2O + Cl2Pb3O4 + 8HCl = 3PbCl2 + 4H2O + Cl2
P+O=P4O104P + 10O = P4O10
Pb(NO3)2 + H2S =PbS + HNO3 Pb(NO3)2 + H2S = PbS + 2HNO3
PBr3+H2O=H3PO3+HBrPBr3 + 3H2O = H3PO3 + 3HBr
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
Pb(OH)2+HCl=H2O+PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
P4+O2= P2O5P4 + 5O2 = 2P2O5
P2O3(s)+O2(g)=P2O5(s)P2O3(s) + O2(g) = P2O5(s)
PCl5+H2O=HCl+H3PO4PCl5 + 4H2O = 5HCl + H3PO4
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4 + KOH +H2O = KH2PO2 + PH3P4 + 3KOH + 3H2O = 3KH2PO2 + PH3
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
P+O=P2O32P + 3O = P2O3
P+O=P2O32P + 3O = P2O3
Pb + HNO3 = Pb(NO3)2 + NO2 + H2OPb + 4HNO3 = Pb(NO3)2 + 2NO2 + 2H2O
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PbS+O2=PbO+SO22PbS + 3O2 = 2PbO + 2SO2
P + 3Cl2 = PCl32P + 3Cl2 = 2PCl3
P + O2 = P4O104P + 5O2 = P4O10
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
PCl5+H2O=H3PO4+HClPCl5 + 4H2O = H3PO4 + 5HCl
P+NO2=P4O10+NO4P + 10NO2 = P4O10 + 10NO
Pb(NO3)2(aq)+KI(aq)=PbI2+KNO3(aq)Pb(NO3)2(aq) + 2KI(aq) = PbI2 + 2KNO3(aq)
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
PbO2=PbO+O22PbO2 = 2PbO + O2
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4 + P2I4 + H2O = H3PO4 + PH4I13P4 + 10P2I4 + 128H2O = 32H3PO4 + 40PH4I
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
Pb + H2O + O2 = Pb(OH)22Pb + 2H2O + O2 = 2Pb(OH)2
PORN=PORNPORN = PORN
PCl5(s) + H2O(l) = H3PO4(aq) + HCl(aq)PCl5(s) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
P4O10 = P + O2P4O10 = 4P + 5O2
P4O10 = P + O2P4O10 = 4P + 5O2
PbCl2 + Na2SO4 = PbSO4 + NaClPbCl2 + Na2SO4 = PbSO4 + 2NaCl
PbCl2 + Na2SO4 = PbSO4 + NaClPbCl2 + Na2SO4 = PbSO4 + 2NaCl
Pb + H2O + O2 = Pb(OH)22Pb + 2H2O + O2 = 2Pb(OH)2
PbS+O2=SO2+PbO2PbS + 3O2 = 2SO2 + 2PbO
PbO+C =CO2+Pb2PbO + C = CO2 + 2Pb
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(C2H3O2)2(aq) + KI(aq)=PbI2(s) + KC2H3O2(aq)Pb(C2H3O2)2(aq) + 2KI(aq) = PbI2(s) + 2KC2H3O2(aq)
PCl3 + H2O = H3PO3 + HCl PCl3 + 3H2O = H3PO3 + 3HCl
P4(s) + O2(g) = P4O10(s)P4(s) + 5O2(g) = P4O10(s)
PdCl2(aq) + HNO3(aq) = Pd(NO3)2(s) + HCl(aq) PdCl2(aq) + 2HNO3(aq) = Pd(NO3)2(s) + 2HCl(aq)
PbS+O2=SO2+PbO2PbS + 3O2 = 2SO2 + 2PbO
P4O10(s) + H2O(l) = H3PO4(aq) P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb + H2O + O2 = Pb(OH)22Pb + 2H2O + O2 = 2Pb(OH)2
PbS+O2=SO2+PbO2PbS + 3O2 = 2SO2 + 2PbO
PbO + H2SO4 = PbOPbSO4 + H2O2PbO + H2SO4 = PbOPbSO4 + H2O
PbO + H2SO4 = PbOPbSO4 + H2O2PbO + H2SO4 = PbOPbSO4 + H2O
PbSo4+BaCl2=BaSo4+PbCl2PbSo4 + BaCl2 = BaSo4 + PbCl2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PbSO4(s) + H2O(l) = PbO2(s) + Pb(s) + H2SO4(aq)2PbSO4(s) + 2H2O(l) = PbO2(s) + Pb(s) + 2H2SO4(aq)
P4+O2+Cl=POCl3P4 + 2O2 + 12Cl = 4POCl3
Pb+2+Cl2=Pb+Cl--1Pb+2 + Cl2 = -1Pb + 2Cl-
Pb(NO3)2(aq) + K2S(aq) = PbS(s) + KNO3(aq)Pb(NO3)2(aq) + K2S(aq) = PbS(s) + 2KNO3(aq)
P2O5(s) + H2O(l) = H3PO4(aq)P2O5(s) + 3H2O(l) = 2H3PO4(aq)
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
Pb(C2H3O2)2(aq)+NaCl(aq)=NaC2H3O2(aq)+PbCl2(s)Pb(C2H3O2)2(aq) + 2NaCl(aq) = 2NaC2H3O2(aq) + PbCl2(s)
P4+O2=P2O5P4 + 5O2 = 2P2O5
P 4 (s)+C l 2 (g)=PC l 5 (g)P4(s) + 10Cl2(g) = 4PCl5(g)
Pb(CH3COO)2+Ba(OH)2=Pb(OH)2+Ba(CH3COO)2Pb(CH3COO)2 + Ba(OH)2 = Pb(OH)2 + Ba(CH3COO)2
PbO2 (s) = PbO(s) + O2(g)2PbO2(s) = 2PbO(s) + O2(g)
Pb(NO3)2(aq)+NaI(aq)=PbI2(s)+NaNO3(aq)Pb(NO3)2(aq) + 2NaI(aq) = PbI2(s) + 2NaNO3(aq)
PB + PBO2 + H2SO4 = PBSO4 + H2OPB + PBO2 + 2H2SO4 = 2PBSO4 + 2H2O
Pb(C2 H3 O2)2 + Na OH = Pb(OH)2 + C2 H3 Na O2 Pb(C2H3O2)2 + 2NaOH = Pb(OH)2 + 2C2H3NaO2
Pb (NO3)3+Na2CO3 = Pb2 (CO3)3+NaNO32Pb(NO3)3 + 3Na2CO3 = Pb2(CO3)3 + 6NaNO3
P4(g)+N2O(g)=P4O6(g)+N2(g)P4(g) + 6N2O(g) = P4O6(g) + 6N2(g)
PbS(s) + O2(g) = 2PbO(s) + 2SO2(g)2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
P4(s) +F2(g)=PF5(g)P4(s) + 10F2(g) = 4PF5(g)
Pb(NO3)2(aq)+NaCl(aq)=PbCl2(s)+NaNO3(aq)Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
PbS + O2= Pb + SO2PbS + O2 = Pb + SO2
PbS + O2= Pb + SO2PbS + O2 = Pb + SO2
P4 + NaOH + H2O = PH3 +Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb3N2+N2=PbN4Pb3N2 + 5N2 = 3PbN4
PCl5+H2O=HCl+ H3PO4PCl5 + 4H2O = 5HCl + H3PO4
PCl3 +H2O=H3PO3 +HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
Pb(s)+O2(g)=PbO(s)2Pb(s) + O2(g) = 2PbO(s)
Pb + O2 = PbO2Pb + O2 = 2PbO
Pb(NO3)2 + LiCl = PbCl2 + LiNO3Pb(NO3)2 + 2LiCl = PbCl2 + 2LiNO3
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb(s)+O2=PbO(s)2Pb(s) + O2 = 2PbO(s)
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
Pb(s) + O2(g) = PbO(s)2Pb(s) + O2(g) = 2PbO(s)
Pb(s) + O2(g) = PbO(s)2Pb(s) + O2(g) = 2PbO(s)
Pb(s) + O2(g) = PbO(s)2Pb(s) + O2(g) = 2PbO(s)
Pb(s) + O2(g) = PbO(s)2Pb(s) + O2(g) = 2PbO(s)
Pb(s) + O2(g) = PbO(s)2Pb(s) + O2(g) = 2PbO(s)
Pb(NO3)2(aq) + LiCl(aq) = PbCl2(s) +LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
P + O2 = P2O54P + 5O2 = 2P2O5
P + O2 = P2O54P + 5O2 = 2P2O5
P + O2 = P2O54P + 5O2 = 2P2O5
PbS(s)+O2(g)=2PbO(s)+2SO2(g)2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
Pt(NO3)2+K= K(NO3) + PtPt(NO3)2 + 2K = 2K(NO3) + Pt
P + O2 = P4O104P + 5O2 = P4O10
Pb(OH)2+HCl=H2O+PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
PbS + H2O = PbSO4 + H2PbS + 4H2O = PbSO4 + 4H2
PbS + H2O = PbO + SO2 + H2PbS + 3H2O = PbO + SO2 + 3H2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
Pb(NO3)2 + HC2H3O2 = H(NO3)2 + Pb(C2H3O2)Pb(NO3)2 + HC2H3O2 = H(NO3)2 + Pb(C2H3O2)
Pb(NO3)2+NaCl=5PbCl2+2NaNO3 Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb(NO3)2+NaCl=PbCl2+2NaNO3 Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb+H2O2=PbO+H2OPb + H2O2 = PbO + H2O
Pb(s) + AgNO3(aq) = Pb(NO3)2 + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2 + 2Ag(s)
PbO2 + KI + CHCl3 = I2 + PbCl2 + KCl + H2O + CO25PbO2 + 2KI + 4CHCl3 = I2 + 5PbCl2 + 2KCl + 2H2O + 4CO2
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
PbS+O2 =PbO+SO22PbS + 3O2 = 2PbO + 2SO2
Pb+O2 = PbO2Pb + O2 = 2PbO
PbCrO4 + HCl= Cr2O7 + PbCl + H2O2PbCrO4 + 2HCl = Cr2O7 + 2PbCl + H2O
PCl3(l) + Cl2(g) + P4O10(s) = POCl3(l)6PCl3(l) + 6Cl2(g) + P4O10(s) = 10POCl3(l)
Pb+O2 = PbO2Pb + O2 = 2PbO
Pb(CH3COO)2+K2CrO4=PbCrO4+KCH3COOPb(CH3COO)2 + K2CrO4 = PbCrO4 + 2KCH3COO
PdCl2+HNO3=Pd(NO3)2+HClPdCl2 + 2HNO3 = Pd(NO3)2 + 2HCl
PdCl2+HNO3=Pd(NO3)2+HClPdCl2 + 2HNO3 = Pd(NO3)2 + 2HCl
PaI5=Pa+I22PaI5 = 2Pa + 5I2
PbS+H2O2=PbSO4+H2OPbS + 4H2O2 = PbSO4 + 4H2O
Pb S+H2 O2=Pb S O4+ H2 OPbS + 4H2O2 = PbSO4 + 4H2O
PbF2 + PCl3 = PF3 + PbCl23PbF2 + 2PCl3 = 2PF3 + 3PbCl2
PbF2 + PCl3 = PF3 + PbCl23PbF2 + 2PCl3 = 2PF3 + 3PbCl2
Pb(C2H3O2)4 + Al2(CO3)3= Pb(CO3)2 + Al(C2H3O2)33Pb(C2H3O2)4 + 2Al2(CO3)3 = 3Pb(CO3)2 + 4Al(C2H3O2)3
PbS+H2O2=PbSO4+H2OPbS + 4H2O2 = PbSO4 + 4H2O
P + H2 =PH32P + 3H2 = 2PH3
P + H2 =PH32P + 3H2 = 2PH3
P + KOH + H2 = KH2PO2 + PH32P + 0KOH + 3H2 = 0KH2PO2 + 2PH3
Pb(NO3)2+HCl=PbCl2+HNO3Pb(NO3)2 + 2HCl = PbCl2 + 2HNO3
Pb(NO3) 4 = PbO + NO4 + O2-2Pb(NO3)4 = -2PbO - 8NO4 + 5O2
PbSO4=PbSO3+O22PbSO4 = 2PbSO3 + O2
P2O5 + 3H2O = 2H3PO4P2O5 + 3H2O = 2H3PO4
PbCl2 + 2NaI = PbI2 + 2NaClPbCl2 + 2NaI = PbI2 + 2NaCl
Pb(C2H5)4 + O2 =PbO +CO2 + H2O2Pb(C2H5)4 + 27O2 = 2PbO + 16CO2 + 20H2O
P4O10 +CaO =Ca3(PO4)2P4O10 + 6CaO = 2Ca3(PO4)2
P4O10 +CuO =Cu3(PO4)2P4O10 + 6CuO = 2Cu3(PO4)2
PCl3(l)+H2O(l)=H3PO3(aq)+HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
PCl3(l)+H2O(l)=H3PO3(aq)+HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
PCl3(l)+H2O(l)=H3PO3(aq)+HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
P2S5+NaIO3+H2O=H3PO4+H2SO4+NaI3P2S5 + 20NaIO3 + 24H2O = 6H3PO4 + 15H2SO4 + 20NaI
P2S5+NaIO3+H2O=H3PO4+H2SO4+NaI3P2S5 + 20NaIO3 + 24H2O = 6H3PO4 + 15H2SO4 + 20NaI
PbCl2+K2SO4=PbSO4+KClPbCl2 + K2SO4 = PbSO4 + 2KCl
PI3+H2O=H3PO3+HIPI3 + 3H2O = H3PO3 + 3HI
P+Br=PBrP + Br = PBr
P2O5+H2O=H3PO4P2O5 + 3H2O = 2H3PO4
P2O5+H2O=H3PO4P2O5 + 3H2O = 2H3PO4
P2O5+H2O=H3PO4P2O5 + 3H2O = 2H3PO4
PbO(s)+2NH3(g)=Pb(s)+N2(g)+H2O(l)3PbO(s) + 2NH3(g) = 3Pb(s) + N2(g) + 3H2O(l)
P 4 (s)+C l 2 (g)=PC l 5 (g)P4(s) + 10Cl2(g) = 4PCl5(g)
Pb(NO3)2(aq)+Na2CO3(aq)= Pb2CO3(s)+ 2NO3(aq) +Na2(aq)2Pb(NO3)2(aq) + Na2CO3(aq) = Pb2CO3(s) + 4NO3(aq) + Na2(aq)
Pb(NO3)2(aq)+Na2CO3(aq)= Pb2CO3+ 2NO3 +Na22Pb(NO3)2(aq) + Na2CO3(aq) = Pb2CO3 + 4NO3 + Na2
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4(s)+O2(g)=P4O10P4(s) + 5O2(g) = P4O10
Pb(s) + S(s) = PbSPb(s) + S(s) = PbS
Pb + S = PbSPb + S = PbS
Pb(s) + S(s) = PbSPb(s) + S(s) = PbS
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
PCl5+ H2O = HCl + H3PO4PCl5 + 4H2O = 5HCl + H3PO4
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4+O2=P2O5P4 + 5O2 = 2P2O5
PCl3+H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(ClO3)2 + K2CrO4 = PbCrO4 + 2KClO3Pb(ClO3)2 + K2CrO4 = PbCrO4 + 2KClO3
P+O2=P2O54P + 5O2 = 2P2O5
Pb(NO3)2(aq)+H2SO4(aq)=PbSO4(s)+HNO3(aq)Pb(NO3)2(aq) + H2SO4(aq) = PbSO4(s) + 2HNO3(aq)
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
PbS + H2O = PbSO4 + H2O0PbS + H2O = 0PbSO4 + H2O
PbS+ H2O = PbSO4 + H2PbS + 4H2O = PbSO4 + 4H2
Pb(No3)2 + NaI = PbI2 + NaNo3Pb(No3)2 + 2NaI = PbI2 + 2NaNo3
Pb(NO3)2+2KI=PbI2+2KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
PCl5(g)=PCl3(g)+Cl2(g)PCl5(g) = PCl3(g) + Cl2(g)
PbCl2 + LiOH = Pb(OH)2 + LiClPbCl2 + 2LiOH = Pb(OH)2 + 2LiCl
PCl3(l)+Cl2(g)+P4O10(s)=POCl3(l)6PCl3(l) + 6Cl2(g) + P4O10(s) = 10POCl3(l)
P4+H2=PH3P4 + 6H2 = 4PH3
P4+H2=PH2P4 + 4H2 = 4PH2
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
PO4+Fe=FePO4PO4 + Fe = FePO4
Pb(NO3)2(aq)+2KCl(aq)=Cl2Pb(s) + 2K(NO3)Pb(NO3)2(aq) + 2KCl(aq) = Cl2Pb(s) + 2K(NO3)
PCl5 = PCl3 + PCl2-1PCl5 = -3PCl3 + 2PCl2
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P + O2 = P4O104P + 5O2 = P4O10
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
PH3 = P4 +H24PH3 = P4 + 6H2
P(s)02(g)=P205(s)205P(s)02(g) = 2P205(s)
Pb(s) + AgNO3(aq)=Pb(NO3)2 + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2 + 2Ag(s)
Pb(NO3)2+NaI=PbI2+NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb(NO3)2+NaI=PbI2+NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb+ H2SO4=PbO2+2H+PbS049Pb + 4H2SO4 = 8PbO2 + 8H + PbS04
Pb+ H2SO4=PbO2+2H+PbS49Pb + 4H2SO4 = 8PbO2 + 8H + PbS4
Pb(CLO4)2+K2CrO4=PbCrO4+KCLO4Pb(CLO4)2 + K2CrO4 = PbCrO4 + 2KCLO4
P2O3 +O2 = P2O5P2O3 + O2 = P2O5
P + O2 = P2O54P + 5O2 = 2P2O5
PCl5+4H2O=H3PO4+5HClPCl5 + 4H2O = H3PO4 + 5HCl
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb+AgNO3=Ag+Pb(NO3)2Pb + 2AgNO3 = 2Ag + Pb(NO3)2
Pb(NO3)2(aq)+2LiBr(aq)=PbBr2(s)+2LiNO3(aq)Pb(NO3)2(aq) + 2LiBr(aq) = PbBr2(s) + 2LiNO3(aq)
Pb + H2O + O2 = Pb(OH)22Pb + 2H2O + O2 = 2Pb(OH)2
Pb(C2H3O2)2(aq)+   Na2SO4(aq)=   PbSO4(s) +   NaC2H3O2(aq)Pb(C2H3O2)2(aq) + Na2SO4(aq) = PbSO4(s) + 2NaC2H3O2(aq)
Pb + H2O + O2 = Pb(OH)22Pb + 2H2O + O2 = 2Pb(OH)2
PBr3(l)+3H2O(l) = H3PO3(aq)+3HBr(g)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(g)
PBr3 + H2O = H3PO3 + HBrPBr3 + 3H2O = H3PO3 + 3HBr
Pb(ClO3)2+ K2CrO4 = PbCrO4 + KClO3Pb(ClO3)2 + K2CrO4 = PbCrO4 + 2KClO3
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P+O2=P2O34P + 3O2 = 2P2O3
Pb(CH3)4+O2=PbO+CO2+H2O2Pb(CH3)4 + 15O2 = 2PbO + 8CO2 + 12H2O
P4+O2=P4O10P4 + 5O2 = P4O10
P + O2 = P2O54P + 5O2 = 2P2O5
PCl3(l)+Cl2(g)=PCl5(s)PCl3(l) + Cl2(g) = PCl5(s)
P+O2=P2O54P + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
PbO2 = PbO + O22PbO2 = 2PbO + O2
Pb(OH)4+HNO3=Pb(NO3)4+H2OPb(OH)4 + 4HNO3 = Pb(NO3)4 + 4H2O
PbCl2+HI= PbI2 + HClPbCl2 + 2HI = PbI2 + 2HCl
PCl3 + O2 = POCl32PCl3 + O2 = 2POCl3
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
P4+O2=P4O10P4 + 5O2 = P4O10
P4(s)+6F2(g) = 4 PF3(g)P4(s) + 6F2(g) = 4PF3(g)
Pb S+H2O=Pb+Pb O2+H2SO42PbS + 2H2O = 5Pb - 3PbO2 + 2H2SO4
Pb S+H2O=Pb+Pb O2+H2SO42PbS + 2H2O = 5Pb - 3PbO2 + 2H2SO4
Pb S+H2O=Pb+Pb O2+H2SO42PbS + 2H2O = 5Pb - 3PbO2 + 2H2SO4
Pb S+H2O=Pb+Pb O2+H2SO42PbS + 2H2O = 5Pb - 3PbO2 + 2H2SO4
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
Pb(N O 3 ) 2 +NaCl= PbC l 2 +NaN O 3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb(ClO4)2+HCl = HClO4 +PbCl2Pb(ClO4)2 + 2HCl = 2HClO4 + PbCl2
Pb(NO3)2=PbO+NO+O22Pb(NO3)2 = 2PbO + 4NO + 3O2
Pb (NO3)2+NaCl=PbCl2+NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb (NO3)2+NaCl=PbCl2+2NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PCl3(l) + AgF(s)=PF3(g)+ AgCl(s)PCl3(l) + 3AgF(s) = PF3(g) + 3AgCl(s)
Pb + PbO2 + H2SO4 = PbSO4 + H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
PCl3+Cl=PCl5PCl3 + 2Cl = PCl5
PCl3(l)+H2O(l)=H3PO3(aq)+HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
Pb(OH)2+HCl=H2O+PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4(s) + 6 F2(g) = 4 PF3(g)P4(s) + 6F2(g) = 4PF3(g)
P4(s) + 6 F2(g) = 4 PF3(g)P4(s) + 6F2(g) = 4PF3(g)
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
PCl3 + HF = PF3 +HClPCl3 + 3HF = PF3 + 3HCl
PCl3(g) + HF(g) = PF3(g) +HCl(g)PCl3(g) + 3HF(g) = PF3(g) + 3HCl(g)
P4+3O2=2P2O3P4 + 3O2 = 2P2O3
PH3 +O2 =P4O10 + H2O4PH3 + 8O2 = P4O10 + 6H2O
PH3 +5O2 =P4O10 + 6H2O4PH3 + 8O2 = P4O10 + 6H2O
P4 + O2 = 2P2 O5P4 + 5O2 = 2P2O5
Pb(NO3)2 + NaI = PbI2 + NaNO3 Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
PBr3 + H2O = H3PO3 + HBrPBr3 + 3H2O = H3PO3 + 3HBr
P4 + Cl2 = PCl5P4 + 10Cl2 = 4PCl5
P4 + Cl2 = PCl5P4 + 10Cl2 = 4PCl5
P4(s) + H2(g) = PH3(g)P4(s) + 6H2(g) = 4PH3(g)
PH3(g) + O2(g) = P2O5(s) + H2O(g)2PH3(g) + 4O2(g) = P2O5(s) + 3H2O(g)
P(s) + KClO3(s) = KCl(s) + P2O5(s)6P(s) + 5KClO3(s) = 5KCl(s) + 3P2O5(s)
P+3O2=2P2O34P + 3O2 = 2P2O3
Pb+PbO2+H2SO4=PbS+H2O5Pb - 3PbO2 + 2H2SO4 = 2PbS + 2H2O
Pb(NO3)2(aq)+2KI(aq)=PbI2(s)+2KNO3(aq)Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3(aq)
Pb(NO3)2(aq)+2KI(aq)=PbI2(s)+2KNO3(aq)Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3(aq)
PbO (s) + NaCl (aq) + H2O (l) + CO2 (g) = Pb2Cl2CO3 (s) + NaOH (aq)2PbO(s) + 2NaCl(aq) + H2O(l) + CO2(g) = Pb2Cl2CO3(s) + 2NaOH(aq)
Pb+NO3-+H+=NO+H2O+PbPb + 0NO3- + 0H+ = 0NO + 0H2O + Pb
Pb(s) + H2 O(l) + O2(g)=Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s) + O2(g) = P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P4(s) + O2(g) = P4 O10(s)P4(s) + 5O2(g) = P4O10(s)
P4(s) + O2(g)=P4 O10(s)P4(s) + 5O2(g) = P4O10(s)
P4+HNO3=P2O5+N2+H2OP4 + 4HNO3 = 2P2O5 + 2N2 + 2H2O
P4 + 4 HNO3 = 2 P2O5 + 2 N2 + 2 H2OP4 + 4HNO3 = 2P2O5 + 2N2 + 2H2O
Pb(NO3)2 + SnCl4 = PbCl4 + Sn(NO3)2Pb(NO3)2 + SnCl4 = PbCl4 + Sn(NO3)2
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
P4 + Br2 =PBr3P4 + 6Br2 = 4PBr3
Pb(N3)2 + Cr(MnO4)2 = Pb3O4 + NO + Cr2O3 + MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
Pb(s) +O2(g)=PbO2 (s)Pb(s) + O2(g) = PbO2(s)
PBr 4 (l)=P 4 (s) + Br 2 (l)4PBr4(l) = P4(s) + 8Br2(l)
Pb + 4H2O = Pb3O4 + 4H23Pb + 4H2O = Pb3O4 + 4H2
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PbO2+HCl = PbCl2 + Cl2 + H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P4 + NaOH = PH3 + Na2H2PO2P4 + 8NaOH = 0PH3 + 4Na2H2PO2
Pb(NO3)2(aq)+KCl(aq)=PbCl2(s)+KNO3(aq)Pb(NO3)2(aq) + 2KCl(aq) = PbCl2(s) + 2KNO3(aq)
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb(NO3)2 = PbO = NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
PbO2=Pb+O2PbO2 = Pb + O2
PbO + HCl + HNO3 = Pb(NO3)2 + PbClO + H2OPbO + 0HCl + 2HNO3 = Pb(NO3)2 + 0PbClO + H2O
PbO2 +2H+ + 2HCl = Cl + Pb + H2OPbO2 + 0H+ + 4HCl = 4Cl + Pb + 2H2O
Pb(NO3)2(aq) + KI(aq) = PbI2(s) + KNO3(aq)Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3(aq)
Pb(NO3)2+NaCl=PbCl2+2NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb(NO3)2+NaCl=PbCl2+2NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb(NO3)2+NaCl=PbCl2+NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
PbS( s) + O2 (g) = PbO (s) + SO2 (g)2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
P(s)+O2(g)=P2O5(s)4P(s) + 5O2(g) = 2P2O5(s)
PbS( s) + O2 (g) = PbO (s) + SO2 (g)2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
P4+HNO3=P2O5+H2O+N2P4 + 4HNO3 = 2P2O5 + 2H2O + 2N2
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
Pb(NO3)2 + K2Cr2O7 = KNO3 + PbCr2O7Pb(NO3)2 + K2Cr2O7 = 2KNO3 + PbCr2O7
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2(aq) + KI(aq) =PbI2(s) + KNO3(aq)Pb(NO3)2(aq) + 2KI(aq) = PbI2(s) + 2KNO3(aq)
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
Pb(ClO4)2(aq)+K2S(aq) = PbS(s)+2KClO4(aq)Pb(ClO4)2(aq) + K2S(aq) = PbS(s) + 2KClO4(aq)
Pb(NO3)2 (aq)+2NH4Cl (aq) = PbCl2 (s)+2NH4NO3 (aq)Pb(NO3)2(aq) + 2NH4Cl(aq) = PbCl2(s) + 2NH4NO3(aq)
P(s)+O2(g)=P2O5(s)4P(s) + 5O2(g) = 2P2O5(s)
P4+KOH+H2O=KH2PO2 + PH3P4 + 3KOH + 3H2O = 3KH2PO2 + PH3
P4O10 + H2O = PH3 + O2P4O10 + 6H2O = 4PH3 + 8O2
Pb(NO3)2(aq)+K2CrO4(aq)=PbCrO4(aq)+KNO3(aq)Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(aq) + 2KNO3(aq)
Pb(s)+HCl(aq)=PbCl2+H2Pb(s) + 2HCl(aq) = PbCl2 + H2
PbCl2 + NaOH + H2O2 = Pb(OH)2 + NaClPbCl2 + 2NaOH + 0H2O2 = Pb(OH)2 + 2NaCl
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
PH3 + O2=PO + H2O4PH3 + 5O2 = 4PO + 6H2O
Pb(NO3)2(aq)+2KCl(aq)=PbCl2(s)+2KNO3(aq)Pb(NO3)2(aq) + 2KCl(aq) = PbCl2(s) + 2KNO3(aq)
Pb(NO3)2(aq)+2KCl(aq)=PbCl2(s)+2KNO3(aq)Pb(NO3)2(aq) + 2KCl(aq) = PbCl2(s) + 2KNO3(aq)
PbSO4+Na2CrO4=PbCrO4+Na2SO4PbSO4 + Na2CrO4 = PbCrO4 + Na2SO4
Pb(NO3)2(aq) + HSO4(aq) = H(NO3)2(aq) + PbSO4(s)Pb(NO3)2(aq) + HSO4(aq) = H(NO3)2(aq) + PbSO4(s)
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P4+HNO3=P2O5+H2O+N2P4 + 4HNO3 = 2P2O5 + 2H2O + 2N2
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
Pb(NO3)2(aq)+NaCl(aq)=PbCl2(s)+NaNO3(aq)Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
Pb(NO3)2(aq)+NaCl(aq)=PbCl2(s)+NaNO3(aq)Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
PbSO3+O2=PbSO42PbSO3 + O2 = 2PbSO4
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(NO3)2 + KI = KNO3 + PbI2Pb(NO3)2 + 2KI = 2KNO3 + PbI2
Pb(NO3)2 + K2CrO4 = KNO3 + PbCrO4Pb(NO3)2 + K2CrO4 = 2KNO3 + PbCrO4
Pb(NO3)2 + NaCl = PbCl2 + NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
P4 (s)+Cl2 (g)=PCl5 (g)P4(s) + 10Cl2(g) = 4PCl5(g)
P4 + O3 = P2O3P4 + 2O3 = 2P2O3
Pb +O2=PbO2Pb + O2 = PbO2
PBr3+H2O=H3PO3+HBrPBr3 + 3H2O = H3PO3 + 3HBr
Pb(NO3)2+NaI=PbI2+NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb+O2=PbO2Pb + O2 = PbO2
PH4Cl+KOH=KCl+PH3+H2OPH4Cl + KOH = KCl + PH3 + H2O
P2O5 + C = P + CO22P2O5 + 5C = 4P + 5CO2
P(s)+O2(g)=P2O5(s)4P(s) + 5O2(g) = 2P2O5(s)
P2O3 + O2 = P2O5P2O3 + O2 = P2O5
P2S5+HNO3=H3PO4+S+NO2+H2OP2S5 + 10HNO3 = 2H3PO4 + 5S + 10NO2 + 2H2O
P2S5+HNO3=H3PO4+S+NH3+H2O-4P2S5 - 5HNO3 = -8H3PO4 - 20S - 5NH3 + 17H2O
P4O6 = 4P + 3O2P4O6 = 4P + 3O2
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
P4+KClO2+KOH=K3PO4+KCl+H2OP4 + 5KClO2 + 12KOH = 4K3PO4 + 5KCl + 6H2O
P+HNO3+ H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
Pb(s) +O2(g)=PbO2 (s)Pb(s) + O2(g) = PbO2(s)
Pb(s) +O2(g) =PbO2 (s)Pb(s) + O2(g) = PbO2(s)
Pb(s) +O2(g) =PbO2 (s)Pb(s) + O2(g) = PbO2(s)
Pb(s) + O2(g) = PbO2 (s)Pb(s) + O2(g) = PbO2(s)
Pb(s) + O2(g) = PbO2 (s)Pb(s) + O2(g) = PbO2(s)
Pb(NO3)2 + H2S = PbS + HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
Pb(NO3)2 + H2S = PbS + HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
P4+Br2=PBr3P4 + 6Br2 = 4PBr3
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(OH)2 + CuNO3 = Pb(NO3)2 + CuOHPb(OH)2 + 2CuNO3 = Pb(NO3)2 + 2CuOH
PBSO4+NA2CO3+C=PB+NA2SO4+CO22PBSO4 + 2NA2CO3 + C = 2PB + 2NA2SO4 + 3CO2
Pb(NO3)2+2LiCl = 2LiNO3+PbCl2Pb(NO3)2 + 2LiCl = 2LiNO3 + PbCl2
Pb(s) + H2 O(l) + O2(g) = Pb(OH)2(s) 2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s) + O2(g) = P4 O10(s) P4(s) + 5O2(g) = P4O10(s)
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(s) + H2 O(l) + O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s) + O2(g) =P4 O10(s) P4(s) + 5O2(g) = P4O10(s)
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
PbO2+HMnO3+HNO3=Pb(NO3)2+HMnO4+H2OPbO2 + HMnO3 + 2HNO3 = Pb(NO3)2 + HMnO4 + H2O
P4+O2=P2O3P4 + 3O2 = 2P2O3
Pb(s) + H2 O(l) + O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s) + O2(g) = P4 O10(s)P4(s) + 5O2(g) = P4O10(s)
PbCO3 + S +O2 = PbS+ COPbCO3 + S - O2 = PbS + CO
PbCO3 + S +O2 = PbSO3 + CO2PbCO3 + 2S + O2 = 2PbSO3 + 2CO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.