Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Pb2PO4+CaO = CaPO4+Pb2OPb2PO4 + CaO = CaPO4 + Pb2O
Pb2PO4+CaO = CaPO4+Pb2OPb2PO4 + CaO = CaPO4 + Pb2O
PCl3(l)+AgF(s)=PF3(g)+AgCl(s)PCl3(l) + 3AgF(s) = PF3(g) + 3AgCl(s)
Pb(s)+AgN O 3 (aq)=Pb (N O 3 ) 2 (aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4 (s)+Cl2 (g)=PCl5 (g)P4(s) + 10Cl2(g) = 4PCl5(g)
PCl3(l)+AgF(s)=PF3(g)+AgCl(s)PCl3(l) + 3AgF(s) = PF3(g) + 3AgCl(s)
Pb(NO3)2+K3PO4=Pb3(PO4)2+KNO33Pb(NO3)2 + 2K3PO4 = Pb3(PO4)2 + 6KNO3
PtCl4+Cl2=PtCl6PtCl4 + Cl2 = PtCl6
P+HNO3+H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
PC l 3 (l) + H 2 O(l) = H 3 P O 3 (aq) + HCl(aq) PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
P2O5 + H2O = H4P2O7P2O5 + 2H2O = H4P2O7
PCl5(s)+H2O(l)=POCl3(l)+HCl(aq)PCl5(s) + H2O(l) = POCl3(l) + 2HCl(aq)
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PbO + H2SO4 = Pb(SO4)2 + H2O + SO2PbO + 3H2SO4 = Pb(SO4)2 + 3H2O + SO2
Pb(NO3)2(aq) + NaCl(aq) = PbCl2 (s) + NaNO3(aq)Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
PCl5(s)+H2O(l)=POCl3(l)+HCl(aq)PCl5(s) + H2O(l) = POCl3(l) + 2HCl(aq)
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
P2O3+O2=P2O5P2O3 + O2 = P2O5
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
P 4 O 10 (s)+ H 2 O(l)= H 3 P O 4 (aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
PbO2+HCl=PbCl2+Cl2+H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
P 2 O 3 (g)+ O 2 (g)=P 2 O 5 (g)P2O3(g) + O2(g) = P2O5(g)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P+Cl2=PCl32P + 3Cl2 = 2PCl3
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
P2O3(g)+O2(g)=P2O5(g) P2O3(g) + O2(g) = P2O5(g)
P2O3(g) + O2(g) = P2O5(g) P2O3(g) + O2(g) = P2O5(g)
PbO(s)+2NH3(g)=Pb(s)+N2+H2O(l)3PbO(s) + 2NH3(g) = 3Pb(s) + N2 + 3H2O(l)
P2O3(g) +O2(g) = P2O5(g) P2O3(g) + O2(g) = P2O5(g)
P 2 O 3 (g)+ O 2 (g)= P 2 O 5 (g)P2O3(g) + O2(g) = P2O5(g)
PbO(s)+2NH3(g)=Pb(s)+N2+H2O(l)3PbO(s) + 2NH3(g) = 3Pb(s) + N2 + 3H2O(l)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
Pb(C2H3O2)2 + K2CO3 = PbCO3 + KC2H3O2Pb(C2H3O2)2 + K2CO3 = PbCO3 + 2KC2H3O2
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4(s)+NaOH(aq)+H2O=PH3(g)+Na2HPO3(aq)P4(s) + 4NaOH(aq) + 2H2O = 2PH3(g) + 2Na2HPO3(aq)
P 4 O 10 (s)+ H 2 O(l)= H 3 P O 4 (aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P 2 O 3 (g)+ O 2 (g)= P 2 O 5 (g)P2O3(g) + O2(g) = P2O5(g)
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
Pb(NO3)2 + Na2CrO4 = PbCrO4 + 2 NaNO3Pb(NO3)2 + Na2CrO4 = PbCrO4 + 2NaNO3
P+O2=P2O54P + 5O2 = 2P2O5
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
PCl3(l)+H2O(l)=H3PO3(aq)+HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
Pb(C2H3O2)2(aq) + H2O(l) + CO2(g) = PbCO3(s) + 2HC2H3O2(aq)Pb(C2H3O2)2(aq) + H2O(l) + CO2(g) = PbCO3(s) + 2HC2H3O2(aq)
PbO2=Pb3O4+O23PbO2 = Pb3O4 + O2
PbO2=Pb3O4+O23PbO2 = Pb3O4 + O2
Pb(NO3)2(aq)+Na2CO3(aq) = PbCO3+ (NaNO3)2Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3 + (NaNO3)2
P4O10 + 6H2O = 4H3PO4P4O10 + 6H2O = 4H3PO4
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
Pb(NO3)2 + BaI2 = PbI2 + Ba(NO3)2Pb(NO3)2 + BaI2 = PbI2 + Ba(NO3)2
P4+N2=P3N53P4 + 10N2 = 4P3N5
P4+H2=PH3P4 + 6H2 = 4PH3
PbO+C=CO2+Pb2PbO + C = CO2 + 2Pb
PbO+C=CO2+Pb44PbO + 2C = 2CO2 + Pb4
P4(s)+O2(g)=P4O10(s) P4(s) + 5O2(g) = P4O10(s)
PbO2=PbO+O22PbO2 = 2PbO + O2
PbCl2+K2SO4=PbSO4+2KClPbCl2 + K2SO4 = PbSO4 + 2KCl
P4+5O2=P2O5P4 + 5O2 = 2P2O5
Pb (NO3)2 + H2S = PbS + HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
PbCl2(aq)+ Li3N(aq) = PbN +Cl2Li3PbCl2(aq) + Li3N(aq) = PbN + Cl2Li3
PCl3(l)+H2O(l)=H3PO3(aq)+HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
PbO2 + CH3COOH + H+ = Pb2+ + H2O + CO216PbO2 + 7CH3COOH + 8H+ = 8Pb2+ + 18H2O + 14CO2
P4O10(s)+H2O(l) = H3PO4 (aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4O10 + H2O = H3PO4 P4O10 + 6H2O = 4H3PO4
PbO2 + CH3COOH + H+ = Pb2+ + H2O + CO216PbO2 + 7CH3COOH + 8H+ = 8Pb2+ + 18H2O + 14CO2
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
Pb(NO3)2(aq)+NaCl(aq)=PbCl2(s)+NaNO3(aq)Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
P2H4 = PH3 + P46P2H4 = 8PH3 + P4
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
Pb(NO3)2(aq)+Na2CO3(aq) = PbCO3+ Na2(NO3)2Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3 + Na2(NO3)2
Pb(NO3)2(aq)+Na2CO3(aq) = PbCO3+ (NaNO3)2Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3 + (NaNO3)2
Pb(NO3)2(aq)+NaOH(aq) = PbOH+ Na(NO3)2Pb(NO3)2(aq) + NaOH(aq) = PbOH + Na(NO3)2
Pb(NO3)2(aq)+KI(aq) = PbI+ K(NO3)2Pb(NO3)2(aq) + KI(aq) = PbI + K(NO3)2
Pb(NO3)2(aq)+FeCl3(aq) = PbCl3+ Fe(NO3)2Pb(NO3)2(aq) + FeCl3(aq) = PbCl3 + Fe(NO3)2
P2O3+O2=P2O5P2O3 + O2 = P2O5
P + Cl2 = PCl32P + 3Cl2 = 2PCl3
P2+O3=P2O53P2 + 5O3 = 3P2O5
P + Cl2 = PCl32P + 3Cl2 = 2PCl3
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
PCl3(s)+Cl2(g)=PCl5(s)PCl3(s) + Cl2(g) = PCl5(s)
P4+O2=P2O3P4 + 3O2 = 2P2O3
P4+5O2=P4O10P4 + 5O2 = P4O10
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
Pb(C2H3O2)2+K2CrO4=PbCrO4+KC2H3O2Pb(C2H3O2)2 + K2CrO4 = PbCrO4 + 2KC2H3O2
Pb(C2H3O2)2+K2CrO4=PbCrO4+KC2H3O2Pb(C2H3O2)2 + K2CrO4 = PbCrO4 + 2KC2H3O2
PbCO3(s) + 2 HNO3(aq) = Pb(NO3)2(aq) + H2O(l) + CO2(g)PbCO3(s) + 2HNO3(aq) = Pb(NO3)2(aq) + H2O(l) + CO2(g)
P4O10(s)+H2O(l)=H3PO4(aq) P4O10(s) + 6H2O(l) = 4H3PO4(aq)
Pb+Cl2=PbCl2Pb + Cl2 = PbCl2
Pb+Cl2=PbCl4Pb + 2Cl2 = PbCl4
PCl5 + H2O = HCl + H3 PO4PCl5 + 4H2O = 5HCl + H3PO4
PCl5 + H2 O = HCl + H3 PO4PCl5 + 4H2O = 5HCl + H3PO4
P4+O2=P4O10P4 + 5O2 = P4O10
Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3(s) + NaNO3(aq)Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3(s) + 2NaNO3(aq)
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb(NO3)2(aq)+2KCl(aq)=PbCl+K(NO3)2Pb(NO3)2(aq) + KCl(aq) = PbCl + K(NO3)2
Pb+FeSO4=PbSO4+FePb + FeSO4 = PbSO4 + Fe
PF3+H2O=H3PO3+HFPF3 + 3H2O = H3PO3 + 3HF
P+O2=P2O54P + 5O2 = 2P2O5
P+O2=P2O54P + 5O2 = 2P2O5
Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3(s) + NaNO3(aq)Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3(s) + 2NaNO3(aq)
Pb(NO3)2(aq) + NaOH(aq) = Pb(OH)2(s) + NaNO3(aq)Pb(NO3)2(aq) + 2NaOH(aq) = Pb(OH)2(s) + 2NaNO3(aq)
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
Pb+O2+H2O = Pb(OH)22Pb + O2 + 2H2O = 2Pb(OH)2
Pb(NO3)2 + CH3COOH = Pb(CH3COO)2 + HNO3Pb(NO3)2 + 2CH3COOH = Pb(CH3COO)2 + 2HNO3
PC l 3 + H 2 O= H 3 P O 3 +HClPCl3 + 3H2O = H3PO3 + 3HCl
PCl3(s)+Cl2(g)=PCl5(s)PCl3(s) + Cl2(g) = PCl5(s)
PCl3(s)+Cl2(g)=PCl5(s)PCl3(s) + Cl2(g) = PCl5(s)
Pb(NO3)2(aq)+NaI(aq)=PbI2(s)+NaNO3(aq)Pb(NO3)2(aq) + 2NaI(aq) = PbI2(s) + 2NaNO3(aq)
PbCl2+AgNO3=Pb(NO3)2+AgClPbCl2 + 2AgNO3 = Pb(NO3)2 + 2AgCl
Pb(NO3)2(aq)+KCl(aq)=PbCl(s)+K(NO3)2Pb(NO3)2(aq) + KCl(aq) = PbCl(s) + K(NO3)2
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
PbO+C=CO2+Pb2PbO + C = CO2 + 2Pb
PBr3(l) + 3 H2O(l) = H3PO3(aq) + 3 HBr(g)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(g)
PbS+H2O2=PbSO4+H2OPbS + 4H2O2 = PbSO4 + 4H2O
P4+O2=P4O10P4 + 5O2 = P4O10
Pb(NO3)2+ HI= PbI+ H(NO3)2Pb(NO3)2 + HI = PbI + H(NO3)2
PCl5= P+ Cl22PCl5 = 2P + 5Cl2
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
P4O6 + L2= P2L4+ P4O105P4O6 + 8L2 = 4P2L4 + 3P4O10
P4O6 + L2= P2L4+ P2O105P4O6 + 14L2 = 7P2L4 + 3P2O10
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
Pb+Cu(NO3)2=Pb(NO3)4+CuPb + 2Cu(NO3)2 = Pb(NO3)4 + 2Cu
Pb+Ag(NO3)3=Pb(NO3)4+Ag3Pb + 4Ag(NO3)3 = 3Pb(NO3)4 + 4Ag
P4 + Cl2 = PCl5P4 + 10Cl2 = 4PCl5
Pb + PbO + H2SO4 = H2O + PbSO40Pb + PbO + H2SO4 = H2O + PbSO4
P + HNO3 + H2O = H3PO4 + NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
P + HNO3 = H3PO4 + NO2 + H2O P + 5HNO3 = H3PO4 + 5NO2 + H2O
P4+O2=P2O5P4 + 5O2 = 2P2O5
P + O2 = P2O54P + 5O2 = 2P2O5
Pb(NO3)2(aq)+KCl(aq)=PbCl(s)+K(NO3)2(aq)Pb(NO3)2(aq) + KCl(aq) = PbCl(s) + K(NO3)2(aq)
PbO2 + HMnO3 + HNO3 = Pb(NO3)2 + HMnO4 + H2OPbO2 + HMnO3 + 2HNO3 = Pb(NO3)2 + HMnO4 + H2O
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
Pb(NO3)2 + NaCl = PbCl2 + NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
Pb(s)+O2(g)=PbO(s)2Pb(s) + O2(g) = 2PbO(s)
Pb + N = Pb3N23Pb + 2N = Pb3N2
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb+K2CrO4=PbCrO4+K2Pb + K2CrO4 = PbCrO4 + K2
PbCl2(s)+H2O(l)=PbO+ HClPbCl2(s) + H2O(l) = PbO + 2HCl
Pb(NO3)2+HCl=PbCl2+HNO3Pb(NO3)2 + 2HCl = PbCl2 + 2HNO3
Pb(NO3)2+2LiCl=2LiNO3+PbCl2Pb(NO3)2 + 2LiCl = 2LiNO3 + PbCl2
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
PbO2 + H2SO4 = PbSO4 + H2O + O22PbO2 + 2H2SO4 = 2PbSO4 + 2H2O + O2
P4S6 + H+ + NO3- = NO + H3PO4 + SO2 + H2O3P4S6 + 44H+ + 44NO3- = 44NO + 12H3PO4 + 18SO2 + 4H2O
Pb(N3)2 + Co(MnO4)3 = CoO + MnO2 + Pb3O4 + NO15Pb(N3)2 + 22Co(MnO4)3 = 22CoO + 66MnO2 + 5Pb3O4 + 90NO
Pb(s)+O2(g)=PbO(s)2Pb(s) + O2(g) = 2PbO(s)
PbO+NaC=PbC2+Na2OPbO + 2NaC = PbC2 + Na2O
P4+O2=P2O5P4 + 5O2 = 2P2O5
P+O2=P2O54P + 5O2 = 2P2O5
Pb(NO3)2+(NH4)2SO4= PbSO4+2NH4NO3Pb(NO3)2 + (NH4)2SO4 = PbSO4 + 2NH4NO3
Pb2 (SO4)2 + Ca (MnO4)2 = Pb (MnO4)2 + Ca2 (SO4)2Pb2(SO4)2 + 2Ca(MnO4)2 = 2Pb(MnO4)2 + Ca2(SO4)2
Pb + H3PO4 = H2 +Pb3(PO4)2 3Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
PCl3(l) + H2O(l) = H3PO3(aq) + HCl(aq)PCl3(l) + 3H2O(l) = H3PO3(aq) + 3HCl(aq)
P4O10+6H2O=2H3PO4P4O10 + 6H2O = 4H3PO4
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2(aq)+LiCl(aq)=LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
Pb(NO3)2(aq)+2LiCl(aq)=2LiNO3(s)+PbCl2(aq)Pb(NO3)2(aq) + 2LiCl(aq) = 2LiNO3(s) + PbCl2(aq)
PbCO3(s) = PbO(s) + CO2(g)PbCO3(s) = PbO(s) + CO2(g)
PH3(g) + O2(g) =H2O(g) + P4O10(s)4PH3(g) + 8O2(g) = 6H2O(g) + P4O10(s)
PH3 + O2 = P4O10 + H2O 4PH3 + 8O2 = P4O10 + 6H2O
PBr3(l)+H2O(l)=H3PO3(aq)+HBr(aq)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(aq)
Pb (NO3) 2 + 2 KI = 2 KNO3 + PbI2 Pb(NO3)2 + 2KI = 2KNO3 + PbI2
P4S6 + H+ + NO3- = NO + H3PO4 + SO2 + H2O3P4S6 + 44H+ + 44NO3- = 44NO + 12H3PO4 + 18SO2 + 4H2O
Pb(N3)2 + Co(MnO4)3 = CoO + MnO2 + Pb3O4 + NO15Pb(N3)2 + 22Co(MnO4)3 = 22CoO + 66MnO2 + 5Pb3O4 + 90NO
PbS+O2=PbO+SO22PbS + 3O2 = 2PbO + 2SO2
PbS+O2=PbO+SO22PbS + 3O2 = 2PbO + 2SO2
PbCO3 = PbO + CO2PbCO3 = PbO + CO2
PbS(s) + O2(g) = PbO(s) + SO2(g) 2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
PbS(s) + O2(g) = PbO(s) + SO2(g) 2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
PCl3(l) + H2O(l) = H3PO3 + HClPCl3(l) + 3H2O(l) = H3PO3 + 3HCl
PCl3(l) + H2O(l) = H3PO3 + HClPCl3(l) + 3H2O(l) = H3PO3 + 3HCl
PCl5(l) + H2O(l) = H3PO4(aq) + HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
PCl3 + H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(NO3)2(aq) + K2CO3(aq) = PbCO3(s) + 2KNO3(aq)Pb(NO3)2(aq) + K2CO3(aq) = PbCO3(s) + 2KNO3(aq)
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
Pb(NO3)2 (aq) + ZnCl2 (aq) = PbCl2 (s) + Zn(NO3)2 (aq)Pb(NO3)2(aq) + ZnCl2(aq) = PbCl2(s) + Zn(NO3)2(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
Pb+PbO2+H2SO4=PbSO4+H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
PbO+O2=Pb3O46PbO + O2 = 2Pb3O4
Pb(NO3)2+Li2SO4=Pb(SO4)+LiNO3Pb(NO3)2 + Li2SO4 = Pb(SO4) + 2LiNO3
PCl5(l)+H2O(l)=H3PO4(aq)+HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
P 4 O 10 (s)+ H 2 O(l)= H 3 P O 4 (aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2I4+P4+H2O=PH4I+H3PO410P2I4 + 13P4 + 128H2O = 40PH4I + 32H3PO4
P(s) + Cl(g) = PCl5(s)P(s) + 5Cl(g) = PCl5(s)
P4+O2=P4O10P4 + 5O2 = P4O10
PbC O 3 (s)=PbO(s)+C O 2 (g)PbCO3(s) = PbO(s) + CO2(g)
PbCrO4 + HNO3 =Pb(NO3)2 +H2CrO4PbCrO4 + 2HNO3 = Pb(NO3)2 + H2CrO4
Pb(ClO4)2 + K2CO3 = PbCO3 +2KClO4Pb(ClO4)2 + K2CO3 = PbCO3 + 2KClO4
Pb(ClO4)2 + K2CO3 = PbCO3 +2KClO4Pb(ClO4)2 + K2CO3 = PbCO3 + 2KClO4
PbO2+MgCl2=MgO+ClO2+Pb5PbO2 + 2MgCl2 = 2MgO + 4ClO2 + 5Pb
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
PdCl2 + HNO3 = Pd(NO3)2 + HClPdCl2 + 2HNO3 = Pd(NO3)2 + 2HCl
PbCrO4 + HCl + FeSO4 = PbCl2 + Cr2(SO4)3 + FeCl3 + H2O + Fe2(SO4)32PbCrO4 + 16HCl + 6FeSO4 = 2PbCl2 + Cr2(SO4)3 + 4FeCl3 + 8H2O + Fe2(SO4)3
PbCrO4 + HCl + FeSO4 = PbCl2 + Cr2(SO4)3 + FeCl3 + H2O + Fe2(SO4)32PbCrO4 + 16HCl + 6FeSO4 = 2PbCl2 + Cr2(SO4)3 + 4FeCl3 + 8H2O + Fe2(SO4)3
PbO2 = PbO + O22PbO2 = 2PbO + O2
Pb (NO3)2 (aq)+NaOH (aq)= Pb (OH)2 (s)+NaNO3 (aq)Pb(NO3)2(aq) + 2NaOH(aq) = Pb(OH)2(s) + 2NaNO3(aq)
Pb (NO3)2 (aq)+NaOH (aq)= Pb (OH)2 (s)+NaNO3 (aq)Pb(NO3)2(aq) + 2NaOH(aq) = Pb(OH)2(s) + 2NaNO3(aq)
PbS + O2 = PbO + SO22PbS + 3O2 = 2PbO + 2SO2
P+O2=P2O54P + 5O2 = 2P2O5
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2=PbO+ NO2+O22Pb(NO3)2 = 2PbO + 4NO2 + O2
PCl5+4H2O=H3PO4+5HClPCl5 + 4H2O = H3PO4 + 5HCl
P4O10+6H2O=4H3PO4P4O10 + 6H2O = 4H3PO4
Pb (NO3)2 = PbO+ NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P+O2 = P2O54P + 5O2 = 2P2O5
PbO+NH3=Pb+N2+H2O3PbO + 2NH3 = 3Pb + N2 + 3H2O
Pb2(SO4)4 + Ag(NO3) = Pb(NO3)4 + Ag2(SO4)Pb2(SO4)4 + 8Ag(NO3) = 2Pb(NO3)4 + 4Ag2(SO4)
Pb(NO3)2+H2S=PbS+HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
PH3 + NO2 = PNO2 + HPH3 + NO2 = PNO2 + 3H
PH3 + NO2 = HNO2 + PPH3 + 3NO2 = 3HNO2 + P
PbS(s)+O2(g)=PbO(s)+SO2(g)2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
PbCl2 + Na2CrO4 = PbCrO4 + NaClPbCl2 + Na2CrO4 = PbCrO4 + 2NaCl
PH + N2O = P4O10 + H2O + N24PH + 12N2O = P4O10 + 2H2O + 12N2
PCl5 + H2O = POCl3 + HClPCl5 + H2O = POCl3 + 2HCl
P4 + Cl2 =PCl3P4 + 6Cl2 = 4PCl3
PBr3=P4 + Br24PBr3 = P4 + 6Br2
Pb(OH)2+CuNO3=Pb(NO3)2+CuOHPb(OH)2 + 2CuNO3 = Pb(NO3)2 + 2CuOH
PH + N2O = P4O10 + H2O + N24PH + 12N2O = P4O10 + 2H2O + 12N2
PbS+O2 =PbO+SO2 2PbS + 3O2 = 2PbO + 2SO2
Pb + PbO2 + H2SO4 = PbSO4 + H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
P2O3(g)+O2(g)=P2O5(g)P2O3(g) + O2(g) = P2O5(g)
PCl3(l) + AgF(s) = PF3(g) + AgCl(s)PCl3(l) + 3AgF(s) = PF3(g) + 3AgCl(s)
Pb(NO3)2(aq) + K2CrO4(aq) =PbCrO4(s) + KNO3(aq)Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(s) + 2KNO3(aq)
Pb(NO3)2(aq) + K2CrO4(aq) =PbCrO4(s) + KNO3(aq)Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(s) + 2KNO3(aq)
P4(s)+O2(g)+H2O(l)=H3PO4(aq)P4(s) + 5O2(g) + 6H2O(l) = 4H3PO4(aq)
Pb(NO3)2+FeCl3=Fe(NO3)3+PbCl23Pb(NO3)2 + 2FeCl3 = 2Fe(NO3)3 + 3PbCl2
Pb (NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
PbS+H2O2=PbSO4+H2OPbS + 4H2O2 = PbSO4 + 4H2O
Pb (s) + Mn(NO3)2 (aq) = Pb(NO3) +Mn2Pb(s) + Mn(NO3)2(aq) = 2Pb(NO3) + Mn
PBr3(l)+H2O(l)=H3PO3(aq)+HBr(aq)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(aq)
P4(s)+H2(g)=PH3(g)P4(s) + 6H2(g) = 4PH3(g)
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P2O3(g)+O2(g)=P2O5(g) P2O3(g) + O2(g) = P2O5(g)
Pb(NO3)2+H2S=PbS+HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
P2O3+O2=P2O5P2O3 + O2 = P2O5
P+HNO3=NO2+H2O +H3PO4P + 5HNO3 = 5NO2 + H2O + H3PO4
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
Pb(SO4)2 + Ca3(PO4)2 = Pb(PO4)2 + Ca3(SO4)2 Pb(SO4)2 + Ca3(PO4)2 = Pb(PO4)2 + Ca3(SO4)2
P+O2=P2O54P + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
PbO+O2=Pb3O46PbO + O2 = 2Pb3O4
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(s) + H2 O(l) + O2(g) =Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s) + O2(g) = P4 O10(s)P4(s) + 5O2(g) = P4O10(s)
PbNO3+Al=Al(NO3)+PbPbNO3 + Al = Al(NO3) + Pb
P4+SiH4=PH3+SiP4 + 3SiH4 = 4PH3 + 3Si
PH3+N2O=P4O10+H2O+N24PH3 + 16N2O = P4O10 + 6H2O + 16N2
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(s)+LiNO3(aq)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(s) + 2LiNO3(aq)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(s) + KNO3(aq)Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(s) + 2KNO3(aq)
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
P4O10+H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(s)+AgNO3(aq)=Pb(NO3)2(aq)+Ag(s) Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
Pb(NO3)2+KCl=K(NO3)2+PbClPb(NO3)2 + KCl = K(NO3)2 + PbCl
Pb(SO4)2+LiNO3=Pb(NO3)4+Li2SO4Pb(SO4)2 + 4LiNO3 = Pb(NO3)4 + 2Li2SO4
Pb(No3)2 + KOH = Pb(OH)2 + KNo3Pb(No3)2 + 2KOH = Pb(OH)2 + 2KNo3
P4O10(s)+H2O(l)=H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
Pb (NO3)2 + KCrO4 = PbCrO4 + K(NO3)2Pb(NO3)2 + KCrO4 = PbCrO4 + K(NO3)2
P2O5(s)+C(s)=P(s)+CO(g)P2O5(s) + 5C(s) = 2P(s) + 5CO(g)
P4O10+H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2 + NaI = PbI2 + Na(NO3) Pb(NO3)2 + 2NaI = PbI2 + 2Na(NO3)
Pb(NO3)2 + NaI = PbI2 + Na(NO3)Pb(NO3)2 + 2NaI = PbI2 + 2Na(NO3)
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
PCl5+H2O=H3PO4+HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(NO3)2+AlCl3= PbCl2+Al(NO3)33Pb(NO3)2 + 2AlCl3 = 3PbCl2 + 2Al(NO3)3
P 2 O 5 (s)+C(s)=P(s)+CO(g)P2O5(s) + 5C(s) = 2P(s) + 5CO(g)
Pb(N3)2 + Cr(MnO4)2=Pb3O4 + NO + Cr2O3+MnO215Pb(N3)2 + 44Cr(MnO4)2 = 5Pb3O4 + 90NO + 22Cr2O3 + 88MnO2
P4+5O2=2P4O10P4 + 5O2 = P4O10
P4+5O2=2P4O10P4 + 5O2 = P4O10
P4+5O2=2P4O10P4 + 5O2 = P4O10
P4 + NO = P4O6 + N2P4 + 6NO = P4O6 + 3N2
P + O2 = P4O104P + 5O2 = P4O10
P2O5 + H2O =H3PO4P2O5 + 3H2O = 2H3PO4
P4+O2=P2O5P4 + 5O2 = 2P2O5
PCl3 + H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
PCl3 + H2O = HCl + H3PO3PCl3 + 3H2O = 3HCl + H3PO3
PbO2+Cu+2HCl+2HNO3=PbCl2+Cu (NO3)2+2H2OPbO2 + Cu + 2HCl + 2HNO3 = PbCl2 + Cu(NO3)2 + 2H2O
P4+O2=P4O10P4 + 5O2 = P4O10
PBr3(l)+H2O(l)=H3PO3(aq)+HBr(aq)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(aq)
Pb(NO3)2 + KI = PbI + K(NO3)2Pb(NO3)2 + KI = PbI + K(NO3)2
Pb(NO3)2+Na2CO3= PbCO3+2NaNO3Pb(NO3)2 + Na2CO3 = PbCO3 + 2NaNO3
Pb(NO3)2+Na2CO3= PbCO3+2NaNO3Pb(NO3)2 + Na2CO3 = PbCO3 + 2NaNO3
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
PCl5(s) + H2O(l)= HCl(aq) + H3PO4(aq)PCl5(s) + 4H2O(l) = 5HCl(aq) + H3PO4(aq)
P+O2=P2O54P + 5O2 = 2P2O5
PH3+NO3=H3PO3+N22PH3 + 2NO3 = 2H3PO3 + N2
PbO +O2 = 3PbO22PbO + O2 = 2PbO2
P4+Cl2 = PCl5P4 + 10Cl2 = 4PCl5
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
Pb(C2H3O2)2(aq)+ HCl(aq) = PbCl2(s) + HC2H3O2(aq)Pb(C2H3O2)2(aq) + 2HCl(aq) = PbCl2(s) + 2HC2H3O2(aq)
Pb(NO3)2(aq)+ H2SO4(aq) = PbSO4(s) + HNO3(aq)Pb(NO3)2(aq) + H2SO4(aq) = PbSO4(s) + 2HNO3(aq)
PbS + O2 =PbO + SO2 2PbS + 3O2 = 2PbO + 2SO2
Pb(NO3)2+H3AsO4=PbHAsO4+HNO3Pb(NO3)2 + H3AsO4 = PbHAsO4 + 2HNO3
PbBr4 +CuSO4=PbSO4+CuBr4PbBr4 + CuSO4 = PbSO4 + CuBr4
PbBr4 +CuSO4=PbSO4+CuBr4PbBr4 + CuSO4 = PbSO4 + CuBr4
Pb+PbO2+H2SO4=PbSO4+H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
Pb(CH3COO)2+H2S=PbS+CH3COOHPb(CH3COO)2 + H2S = PbS + 2CH3COOH
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb(C2H3O2)2 + H2SO4 = PbSO4 + HC2H3O2Pb(C2H3O2)2 + H2SO4 = PbSO4 + 2HC2H3O2
P4 + Cl2 = PCl5 P4 + 10Cl2 = 4PCl5
P4 + Cl2 = PCl5 P4 + 10Cl2 = 4PCl5
Pb(NO3)2(aq)+2HCl(aq)=PbCl2(s)+2HNO3(aq)Pb(NO3)2(aq) + 2HCl(aq) = PbCl2(s) + 2HNO3(aq)
PbO=PbO2+O2-2PbO = -2PbO2 + O2
PbO=PbO2+O2-2PbO = -2PbO2 + O2
Pb(NO3)2 + K2CO3 = PbCO3 + 2KNO3Pb(NO3)2 + K2CO3 = PbCO3 + 2KNO3
Pb2O=PbO+O2-2Pb2O = -4PbO + O2
Pb(NO3)2(aq)+H2SO4(aq)=PbSO4(s)+HNO3(aq)Pb(NO3)2(aq) + H2SO4(aq) = PbSO4(s) + 2HNO3(aq)
PbO2+HCl=PbCl2+H2O+Cl2PbO2 + 4HCl = PbCl2 + 2H2O + Cl2
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb(s) + H2O(l) + O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
Pb(s) + H2O(l) + O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4O10+10H2O=PH3+H2O0P4O10 + H2O = 0PH3 + H2O
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb(s)+AgNO3(aq)=Pb(NO3)2+Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2 + 2Ag(s)
PbO2 = Pb + OPbO2 = Pb + 2O
P + O2 = P2O34P + 3O2 = 2P2O3
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4(s)+H2(g)=PH3(g)P4(s) + 6H2(g) = 4PH3(g)
PbS + H2O2 = PbSO4 + H2OPbS + 4H2O2 = PbSO4 + 4H2O
P4O10+H2O = 2H3PO4P4O10 + 6H2O = 4H3PO4
P4 +5O2 = 2P2O5P4 + 5O2 = 2P2O5
PCl5(l)+H2O(l)=H3PO4(aq)+HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
Pb(NO3)2 + HNO3 = Pb + NO+ H2O-3Pb(NO3)2 + 8HNO3 = -3Pb + 2NO + 4H2O
PCl5 = PCl3 +Cl2 PCl5 = PCl3 + Cl2
P + O2 = P2O34P + 3O2 = 2P2O3
PbS + H2O2 = PbSO4 + H2OPbS + 4H2O2 = PbSO4 + 4H2O
Pb(C2H3O2)2(aq) + HCl(aq) = PbCl2(s) + HC2H3O2(aq)Pb(C2H3O2)2(aq) + 2HCl(aq) = PbCl2(s) + 2HC2H3O2(aq)
Pb(OH)2 + HCl = PbCl2 + 2H2OPb(OH)2 + 2HCl = PbCl2 + 2H2O
Pb(NO3)2(aq) + H2SO4(aq) = PbSO4(s) + HNO3(aq)Pb(NO3)2(aq) + H2SO4(aq) = PbSO4(s) + 2HNO3(aq)
PbS + Zn= PbZn+SPbS + Zn = PbZn + S
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
PCl5(l)+H2O(l)=H3PO4(aq)+HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
PCl5 + H2O =HCl + H3PO4PCl5 + 4H2O = 5HCl + H3PO4
Pb(Cl)2(s)+2HF=PbF2(s)+2H+2ClPb(Cl)2(s) + 2HF = PbF2(s) + 2H + 2Cl
Pb(NO3)2(aq) + Na3PO4(aq)=Pb3(PO4)2(s) + NaNO3(g)3Pb(NO3)2(aq) + 2Na3PO4(aq) = Pb3(PO4)2(s) + 6NaNO3(g)
P4(s)+NaOH(aq)+H2O(l)=PH3(g)+Na2HPO3(aq)P4(s) + 4NaOH(aq) + 2H2O(l) = 2PH3(g) + 2Na2HPO3(aq)
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
PO4 + Sr = Sr3(PO4)22PO4 + 3Sr = Sr3(PO4)2
P4+O2= P2O5P4 + 5O2 = 2P2O5
Pb(NO3)2+K2SO4=PbSO4+2KNO3Pb(NO3)2 + K2SO4 = PbSO4 + 2KNO3
P4O10+NaOH=Na3PO4+H2OP4O10 + 12NaOH = 4Na3PO4 + 6H2O
Pb(s) + H2O(l) + O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4O10  +  H2O  =  H3PO4P4O10 + 6H2O = 4H3PO4
PCl5  +  H2O = HCl  +  H3PO4PCl5 + 4H2O = 5HCl + H3PO4
Pb(ClO3)2+ 2KBr= PbBr2 +2 KClO3Pb(ClO3)2 + 2KBr = PbBr2 + 2KClO3
Pb+HCl+HNO3=PbCl4+NO+H2O3Pb + 12HCl + 4HNO3 = 3PbCl4 + 4NO + 8H2O
Pb+HNO3=Pb(NO3)4+NO2+H2OPb + 8HNO3 = Pb(NO3)4 + 4NO2 + 4H2O
Pb+HNO3=Pb(NO3)4+NO+H2O3Pb + 16HNO3 = 3Pb(NO3)4 + 4NO + 8H2O
Pb+HNO3=Pb(NO3)4+NO2+H2OPb + 8HNO3 = Pb(NO3)4 + 4NO2 + 4H2O
Pb+H2SO4=Pb(SO4)2+SO2+H2OPb + 4H2SO4 = Pb(SO4)2 + 2SO2 + 4H2O
Pb+H2SO4=Pb(SO4)2+SO2+H2OPb + 4H2SO4 = Pb(SO4)2 + 2SO2 + 4H2O
P4O10+H2O= H3PO4P4O10 + 6H2O = 4H3PO4
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
Pb(CH3)4+O2=PbO+CO2+H2O2Pb(CH3)4 + 15O2 = 2PbO + 8CO2 + 12H2O
Pb(CH3)4+O2=PbO+CO2+H2O2Pb(CH3)4 + 15O2 = 2PbO + 8CO2 + 12H2O
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
PbCO3=PbO+CO2PbCO3 = PbO + CO2
PCl3(l) + AgF(s) =PF3(g) + AgCl(s)PCl3(l) + 3AgF(s) = PF3(g) + 3AgCl(s)
Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(s) + KNO3(aq)Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(s) + 2KNO3(aq)
Pb(CO3) = CO2 + PbOPb(CO3) = CO2 + PbO
P4+HNO3 + H2O=NO2+H3PO4P4 + 20HNO3 - 4H2O = 20NO2 + 4H3PO4
P4+HNO3+H2O=NO2+H3PO4P4 + 20HNO3 - 4H2O = 20NO2 + 4H3PO4
PCl3+NaNH2=P3N5+NaCl+HCl+H23PCl3 + 5NaNH2 = P3N5 + 5NaCl + 4HCl + 3H2
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
Pb ++ + I - = PbI2Pb++ + 2I- = PbI2
Pb ++ + I - = PbI2Pb++ + 2I- = PbI2
P+HNO3+H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
PbS (s) + 2 O2 (g) = PbO2 (s) + SO2 (g)PbS(s) + 2O2(g) = PbO2(s) + SO2(g)
PCl3(l)+3H2(g)=PH3(g)+3HCl(g)PCl3(l) + 3H2(g) = PH3(g) + 3HCl(g)
P4+5O2=2P2O5P4 + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P2O5+Ba(OH)2=Ba3(PO4)2+H2OP2O5 + 3Ba(OH)2 = Ba3(PO4)2 + 3H2O
PCl5(s)+H2O(l)=H3PO4(aq)+HCl(aq) PCl5(s) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
Pb(NO3)2=PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
Pb(NO3)2=PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb + Cu(NO3)2 = Pb(NO3)2 + CuPb + Cu(NO3)2 = Pb(NO3)2 + Cu
Pb + Cu(NO3)2 = Pb(NO3)2 + CuPb + Cu(NO3)2 = Pb(NO3)2 + Cu
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
PbCl2 + AgNO3 = Pb(NO3)2 + AgCl PbCl2 + 2AgNO3 = Pb(NO3)2 + 2AgCl
Pb(NO3)2 + K2CrO4 = PbCrO4 + KNO3Pb(NO3)2 + K2CrO4 = PbCrO4 + 2KNO3
Pb(NO3)2+AlCl3=Al(NO3)3+PbCl23Pb(NO3)2 + 2AlCl3 = 2Al(NO3)3 + 3PbCl2
Pb(CH3)4+O2=PbO+CO2+H2O2Pb(CH3)4 + 15O2 = 2PbO + 8CO2 + 12H2O
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
Pb + H3PO4 = H2 + Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
PCl5 = PCl3 +Cl2PCl5 = PCl3 + Cl2
P2O3+Ca(OH)2=H2PHO3+CaOP2O3 + 3Ca(OH)2 = 2H2PHO3 + 3CaO
Pb(ClO4)2+Na2S=PbS+2NaClO4Pb(ClO4)2 + Na2S = PbS + 2NaClO4
Pb(ClO4)2+Na2S=PbS+2NaClO4Pb(ClO4)2 + Na2S = PbS + 2NaClO4
P4(s)+NaOH(aq)+H2O(l)=PH3(g)+Na2HPO3(aq) P4(s) + 4NaOH(aq) + 2H2O(l) = 2PH3(g) + 2Na2HPO3(aq)
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
PCl5+H2O=H3PO4+HClPCl5 + 4H2O = H3PO4 + 5HCl
P4 + Cl2 = PCl5P4 + 10Cl2 = 4PCl5
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P+O2=P2O54P + 5O2 = 2P2O5
P4(s) + 5 O2(g) = 2 P2O5(s)P4(s) + 5O2(g) = 2P2O5(s)
Pb(NO3)2(aq)+NaI(aq)=NaNO3(aq)+PbI2(s)Pb(NO3)2(aq) + 2NaI(aq) = 2NaNO3(aq) + PbI2(s)
Pb(NO3)2 (aq) + CuSO4(aq) = PbSO4 (s) + Cu(NO3)2 (aq)Pb(NO3)2(aq) + CuSO4(aq) = PbSO4(s) + Cu(NO3)2(aq)
PbCO3(s)=PbO(s)+CO2(g)PbCO3(s) = PbO(s) + CO2(g)
Pb(s) + H2O(l) + O2(g) =Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
Pb(s) + H2O(l) + O2(g) =Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
Pb(NO3)2+K2CrO4=PbCrO4+KNO3Pb(NO3)2 + K2CrO4 = PbCrO4 + 2KNO3
Pb + (NO3)2 + NaBr = PbBr2 + Na(NO3)Pb + (NO3)2 + 2NaBr = PbBr2 + 2Na(NO3)
Pb+HNO3=Pb(NO3)2+H2O+NO3Pb + 8HNO3 = 3Pb(NO3)2 + 4H2O + 2NO
P(s) + O2(g) = P4O10(s)4P(s) + 5O2(g) = P4O10(s)
P4+Cl2=PCl5P4 + 10Cl2 = 4PCl5
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb(NO3)2=Pb+NO2+O2Pb(NO3)2 = Pb + 2NO2 + O2
PCl5 + HOH = H3PO4 + HClPCl5 + 4HOH = H3PO4 + 5HCl
Pb(NO3)2+H2S=PbS+HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
PbS+H2O2=PbSO4+H2OPbS + 4H2O2 = PbSO4 + 4H2O
P4 + O2 = P4O6P4 + 3O2 = P4O6
Pb(CIO2)4 + Zn(SO4) = Pb(SO4)2 + Zn(CIO2)2Pb(CIO2)4 + 2Zn(SO4) = Pb(SO4)2 + 2Zn(CIO2)2
PCl5(l) + H2O(l) = H3PO4(aq) + HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
P(s) +O2(g) = P4O10(s)4P(s) + 5O2(g) = P4O10(s)
PbO+C=Pb+CO22PbO + C = 2Pb + CO2
P2O5+H2O=H3PO4P2O5 + 3H2O = 2H3PO4
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
P4(s) + Ca(s) = Ca3P2(s) P4(s) + 6Ca(s) = 2Ca3P2(s)
PbCl2 + Na2SO4 = PbSO4 + NaClPbCl2 + Na2SO4 = PbSO4 + 2NaCl
P2S5 + PCl5 = PSCl3P2S5 + 3PCl5 = 5PSCl3
Pb(NO3)2 + Zn = Pb + Zn(NO3)2Pb(NO3)2 + Zn = Pb + Zn(NO3)2
Pb + Na + C2H5Cl = Pb(C2H5)4 + NaClPb + 4Na + 4C2H5Cl = Pb(C2H5)4 + 4NaCl
PbS + O2 = PbO + SO22PbS + 3O2 = 2PbO + 2SO2
Pb(NO3)2 = PbO + 2NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
Pb(ClO3)2+NaI = Na(ClO3)+PbI2Pb(ClO3)2 + 2NaI = 2Na(ClO3) + PbI2
Pb(CLO2)4 + Zn(SO4)= Pb(SO4)2 + Zn(CLO2)2Pb(CLO2)4 + 2Zn(SO4) = Pb(SO4)2 + 2Zn(CLO2)2
PCl5(l) + H2O(l) = H3PO4(aq) + HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
P4 + O2 = P4O10P4 + 5O2 = P4O10
Pb(NO3)2 + H2SO4 = PbSO4 + HNO3Pb(NO3)2 + H2SO4 = PbSO4 + 2HNO3
P4O10+6H2O=4H3PO4P4O10 + 6H2O = 4H3PO4
Pb + PbO2 + H2SO4 = PbSO4 + H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
P2O3 = P + O22P2O3 = 4P + 3O2
P5+S8=P2S44P5 + 5S8 = 10P2S4
PbSO4 = PbSO3 + O22PbSO4 = 2PbSO3 + O2
Pb(ClO4)4 + Ca(C2O4) = Pb2(C2O4)4 + Ca(ClO4)22Pb(ClO4)4 + 4Ca(C2O4) = Pb2(C2O4)4 + 4Ca(ClO4)2
P+O=2PO5P + 5O = PO5
Pb+O2=PbO2Pb + O2 = PbO2
PbO2 + SeO3 = PbO + SeO4PbO2 + SeO3 = PbO + SeO4
Pb(NO3)2=PbO+NO2+O22Pb(NO3)2 = 2PbO + 4NO2 + O2
PCl5 + H2O(l) = POCl3(l) + HCl(aq)PCl5 + H2O(l) = POCl3(l) + 2HCl(aq)
PbCl4(aq)+K3PO4(aq)=KCl(aq)+Pb3(PO4)4(s)3PbCl4(aq) + 4K3PO4(aq) = 12KCl(aq) + Pb3(PO4)4(s)
PCl3=P4+Cl24PCl3 = P4 + 6Cl2
PCl3=P4+Cl34PCl3 = P4 + 4Cl3
Pt(NO3)4 + Mg = Mg(NO3) + PtPt(NO3)4 + 4Mg = 4Mg(NO3) + Pt
P(s) + O2(g) = P4O10(s)4P(s) + 5O2(g) = P4O10(s)
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P + Cl2 = PCl32P + 3Cl2 = 2PCl3
P4 + 6O2 = P4O2P4 + O2 = P4O2
Pb(NO3)2+ MnCl2= PbCl2 + Mn(NO3)2Pb(NO3)2 + MnCl2 = PbCl2 + Mn(NO3)2
PBr3(l)+H2O(l)=H3PO3(aq)+HBr(aq)PBr3(l) + 3H2O(l) = H3PO3(aq) + 3HBr(aq)
PCl3+H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
PCl3+H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
PbSO4 = PbSO3+O22PbSO4 = 2PbSO3 + O2
PbSO4 = PbSO3+O22PbSO4 = 2PbSO3 + O2
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4O10+H2O= H3PO4P4O10 + 6H2O = 4H3PO4
P+O2=P4O104P + 5O2 = P4O10
Pb(NO3)2(aq)+H2SO4(aq)=PbSO4(s)+HNO3(aq)Pb(NO3)2(aq) + H2SO4(aq) = PbSO4(s) + 2HNO3(aq)
Pb(NO3)2(aq)+H2SO4(aq)=PbSO4(s)+HNO3(aq)Pb(NO3)2(aq) + H2SO4(aq) = PbSO4(s) + 2HNO3(aq)
PbCrO4 + HCl + FeSO4 = PbCl2 + Cr2(SO4)3 + FeCl3 + H2O + Fe2(SO4)-2PbCrO4 - 16HCl - 2FeSO4 = -2PbCl2 - Cr2(SO4)3 - 4FeCl3 - 8H2O + Fe2(SO4)
Pb(NO3)2(aq)+2NaI(aq)=PbI2(s)+2NaNO3(aq)Pb(NO3)2(aq) + 2NaI(aq) = PbI2(s) + 2NaNO3(aq)
PBr3+H2O=H3PO3+HBrPBr3 + 3H2O = H3PO3 + 3HBr
PBr3+H2O=H3PO3+HBrPBr3 + 3H2O = H3PO3 + 3HBr

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.