Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4O7 = P + O22P4O7 = 8P + 7O2
P4O7 = P4 + O22P4O7 = 2P4 + 7O2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2 + Na2SO4 = PbSO4 + NaNO3Pb(NO3)2 + Na2SO4 = PbSO4 + 2NaNO3
PCl5+H2O=H3PO4+HClPCl5 + 4H2O = H3PO4 + 5HCl
PBr3 + H2O = H3PO3 + HBrPBr3 + 3H2O = H3PO3 + 3HBr
Pb(CH3COO)2+H2S=PbS+CH3COOHPb(CH3COO)2 + H2S = PbS + 2CH3COOH
Pb(NO3)2 + K2CrO4 = PbCrO4 + KNO3Pb(NO3)2 + K2CrO4 = PbCrO4 + 2KNO3
PbCl2+Zn(NO3)2=ZnCl2+Pb(NO3)2PbCl2 + Zn(NO3)2 = ZnCl2 + Pb(NO3)2
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb + H2O + O2 = Pb(OH)22Pb + 2H2O + O2 = 2Pb(OH)2
PCl5=PCl3+Cl2PCl5 = PCl3 + Cl2
Pb(NO3)2 (aq) + NaCl (aq) = PbCl2 (s) + NaNO3 (aq) Pb(NO3)2(aq) + 2NaCl(aq) = PbCl2(s) + 2NaNO3(aq)
PBr3 + H2O = H3PO3 + HBrPBr3 + 3H2O = H3PO3 + 3HBr
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4 + H2O +HNO3 = H3PO4 + NO3P4 + 8H2O + 20HNO3 = 12H3PO4 + 20NO
P+O2=P2O54P + 5O2 = 2P2O5
P5+O2 = P2O54P5 + 25O2 = 10P2O5
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PbCl2+Zn(NO3)2=ZnCl2+Pb(NO3)2PbCl2 + Zn(NO3)2 = ZnCl2 + Pb(NO3)2
P4(s)+NaOH(aq)+H2O(l) = PH3(g) + Na2HPO3(aq)P4(s) + 4NaOH(aq) + 2H2O(l) = 2PH3(g) + 2Na2HPO3(aq)
P4 + H2O +HNO3 = H3PO4 + NO3P4 + 8H2O + 20HNO3 = 12H3PO4 + 20NO
PCl5+H2O=H3PO4+HClPCl5 + 4H2O = H3PO4 + 5HCl
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb(s)+H2O(l)=PbO+H2Pb(s) + H2O(l) = PbO + H2
PbI4 + CrCl3 =PbCl4 +CrI33PbI4 + 4CrCl3 = 3PbCl4 + 4CrI3
Pb + HCl + HNO3=PbCl4 + NO + H2O3Pb + 12HCl + 4HNO3 = 3PbCl4 + 4NO + 8H2O
P4O10 + H2O= H3PO4P4O10 + 6H2O = 4H3PO4
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb + MnO4= Pb(MnO4)6Pb + 6MnO4 = Pb(MnO4)6
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(OH)2+HCl=H2O+PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(NO3)2+Na2SO4=PbSO4+NaNO3Pb(NO3)2 + Na2SO4 = PbSO4 + 2NaNO3
PCl5=P+Cl22PCl5 = 2P + 5Cl2
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4+Cl2=PCl5P4 + 10Cl2 = 4PCl5
P2O5+Si=P4+SiO22P2O5 + 5Si = P4 + 5SiO2
P2O5+Si=P2 +SiO22P2O5 + 5Si = 2P2 + 5SiO2
P2O5+Si=P +SiO22P2O5 + 5Si = 4P + 5SiO2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4(s)+O2(g)=P2O3(s)P4(s) + 3O2(g) = 2P2O3(s)
Pb(s)+H3PO4(aq)=H2(g)+Pb3(PO4)2(aq)3Pb(s) + 2H3PO4(aq) = 3H2(g) + Pb3(PO4)2(aq)
Pb(NO3)2+H3AsO4=PbHAsO4+HNO3Pb(NO3)2 + H3AsO4 = PbHAsO4 + 2HNO3
Pb(NO3)2 + NaI = PbI2 + NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb + Na + 4C2H5Cl=Pb(C2H5)4 + 4NaClPb + 4Na + 4C2H5Cl = Pb(C2H5)4 + 4NaCl
P+O2=P4O64P + 3O2 = P4O6
Pb(NO3)2= PbO+NO2+O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P4+O2=P2O3P4 + 3O2 = 2P2O3
P+O2=P4O104P + 5O2 = P4O10
Pb+H3PO4=H2+Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
PdCl2+HNO3=Pd(NO3)2+HClPdCl2 + 2HNO3 = Pd(NO3)2 + 2HCl
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb(NO3)2 + H2O = PbO + HNO3Pb(NO3)2 + H2O = PbO + 2HNO3
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
Pb(NO3)2(aq)+H3AsO4(aq)=PbHAsO4(s)+HNO3(aq)Pb(NO3)2(aq) + H3AsO4(aq) = PbHAsO4(s) + 2HNO3(aq)
PbS + O2 = PbO +SO22PbS + 3O2 = 2PbO + 2SO2
PbCl2+Li2SO4=LiCl+PbSO4PbCl2 + Li2SO4 = 2LiCl + PbSO4
PbS+O2=PbO+SO22PbS + 3O2 = 2PbO + 2SO2
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2+KI=PbI2+KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PBr3 + H2O = H3PO3 + HBr PBr3 + 3H2O = H3PO3 + 3HBr
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
Pb(NO3)2 = Pb + NO2 + O2Pb(NO3)2 = Pb + 2NO2 + O2
Pb+H2O=Pb3O4+H23Pb + 4H2O = Pb3O4 + 4H2
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P + 3I2 = PI32P + 3I2 = 2PI3
Pb(NO3)2(aq) + H3AsO4(aq) = PbHAsO4(s) + HNO3 (aq)Pb(NO3)2(aq) + H3AsO4(aq) = PbHAsO4(s) + 2HNO3(aq)
PbS + O2 = PbO + SO22PbS + 3O2 = 2PbO + 2SO2
Pb+O2=PbO2Pb + O2 = 2PbO
Pb(C2H3O2)2 + Na2SO4 = PbSO4 + NaC2H3O2Pb(C2H3O2)2 + Na2SO4 = PbSO4 + 2NaC2H3O2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
Pb + HClO3 = Pb(ClO3)2 = H2Pb + 2HClO3 = Pb(ClO3)2 + H2
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
PbCO3 = PbO + CO2PbCO3 = PbO + CO2
P4+H2=PH3P4 + 6H2 = 4PH3
Pb + Zn(C2H3O2)2 = Pb(C2H3O2)3 + Zn2Pb + 3Zn(C2H3O2)2 = 2Pb(C2H3O2)3 + 3Zn
PCl5+H2O(l)=H3PO4+HClPCl5 + 4H2O(l) = H3PO4 + 5HCl
Pb+O2=PbO2Pb + O2 = 2PbO
Pt(OH)4 + HIO3 = Pt(IO3)4 + H2OPt(OH)4 + 4HIO3 = Pt(IO3)4 + 4H2O
PbSO4= PbSO3+O22PbSO4 = 2PbSO3 + O2
Pb(NO3)2 = PbO + NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P + O2 = P2O54P + 5O2 = 2P2O5
PCl3 + H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
P4O10 + 6H2O = 4H3PO4P4O10 + 6H2O = 4H3PO4
P4O10(s) + 6H2O(l) = 4H3PO4(aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P + O2 = P4O104P + 5O2 = P4O10
Pb(OH)4 + (NH4)3PO4 = NH4OH +Pb3(PO4)43Pb(OH)4 + 4(NH4)3PO4 = 12NH4OH + Pb3(PO4)4
P4+O2=P2O5P4 + 5O2 = 2P2O5
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
PdCl2+HNO3=Pd(NO3)2+HClPdCl2 + 2HNO3 = Pd(NO3)2 + 2HCl
PbO+C=CO2+Pb2PbO + C = CO2 + 2Pb
Pb+NiCl2=PbCl+Ni2Pb + NiCl2 = 2PbCl + Ni
P4+C2H6=PH3+C3P47P4 + 6C2H6 = 12PH3 + 4C3P4
P4+H2=PH3P4 + 6H2 = 4PH3
P2O5+3H2O=2H3PO4P2O5 + 3H2O = 2H3PO4
P2O5+3H2O=2H3PO4P2O5 + 3H2O = 2H3PO4
P4+H2=PHP4 + 2H2 = 4PH
PbO+C=CO2+Pb2PbO + C = CO2 + 2Pb
Pb(NO3)2=PbO+NO2+O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P4 + F2 = PF3P4 + 6F2 = 4PF3
Pb(NO3)2 + K2S = PbS + KNO3Pb(NO3)2 + K2S = PbS + 2KNO3
PbO2 = PbO + O22PbO2 = 2PbO + O2
Pb(NO3)2 = Pb + NO2 + O2Pb(NO3)2 = Pb + 2NO2 + O2
POCl3 + H2O = P(OH)5 + HClPOCl3 + 4H2O = P(OH)5 + 3HCl
POCl3 + H2O = P(OH)5 + HClPOCl3 + 4H2O = P(OH)5 + 3HCl
P + O2 = P2O54P + 5O2 = 2P2O5
PCl5 + H2O = P(OH)5 + 5HClPCl5 + 5H2O = P(OH)5 + 5HCl
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb(NO3)2 + NiI2 = PbI2 + Ni(NO3)2 Pb(NO3)2 + NiI2 = PbI2 + Ni(NO3)2
Pb(NO3)2 (aq) + NiI2 (aq) = PbI2 (s) + Ni(NO3)2 (aq)Pb(NO3)2(aq) + NiI2(aq) = PbI2(s) + Ni(NO3)2(aq)
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2 = Pb + NO2 + O2Pb(NO3)2 = Pb + 2NO2 + O2
PCl3 + H2O = H3PO3 + 3HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(NO3)3+Na2O=Pb2O3+NaNO32Pb(NO3)3 + 3Na2O = Pb2O3 + 6NaNO3
PCl3 + 3H2O = H3PO3 + 3HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P4+O2=P4O10P4 + 5O2 = P4O10
P+O2=P4O104P + 5O2 = P4O10
Pb(NO3)2 + 2NH4+ + 2OH- = Pb(OH)2 + 2NH4NO3Pb(NO3)2 + 2NH4+ + 2OH- = Pb(OH)2 + 2NH4NO3
Pb(NO3)2 + 2NH3 + 2H2O = Pb(OH)2 + 2NH4NO3Pb(NO3)2 + 2NH3 + 2H2O = Pb(OH)2 + 2NH4NO3
P4+Na O H+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb + HCl + HNO3 = PbCl4 + H2O + NO3Pb + 12HCl + 4HNO3 = 3PbCl4 + 8H2O + 4NO
Pb+CuSO4=PbSO4+CuPb + CuSO4 = PbSO4 + Cu
Pb(NO3)2+K2CrO4=PbCrO4+2KNO3Pb(NO3)2 + K2CrO4 = PbCrO4 + 2KNO3
PCl5(l) + H2O(l) = H3PO4(aq) + HCl(g)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(g)
P4+HNO3=P2O5+N2+H2OP4 + 4HNO3 = 2P2O5 + 2N2 + 2H2O
P4+HNO3=P2O5+N2+H2OP4 + 4HNO3 = 2P2O5 + 2N2 + 2H2O
P+HNO3+H2O=H3PO4+NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
Pb + PbO2 + H2SO4 = H20 + PbSO410Pb + 0PbO2 + 10H2SO4 = H20 + 10PbSO4
PbO2 + Pb + H2SO4 = H20 + PbSO40PbO2 + 10Pb + 10H2SO4 = H20 + 10PbSO4
Pb + H2SO4 = H20 + PbSO410Pb + 10H2SO4 = H20 + 10PbSO4
PbCrO4+HCl=PbCl2+CrCl3+Cl2+H2O2PbCrO4 + 16HCl = 2PbCl2 + 2CrCl3 + 3Cl2 + 8H2O
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P(s) + O2(g) = P2O5(s)4P(s) + 5O2(g) = 2P2O5(s)
P + Br2 = PBr32P + 3Br2 = 2PBr3
Pb + H3PO4 = H2 + Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
Pb + FeSO4 = PbSO4 + FePb + FeSO4 = PbSO4 + Fe
P4 + 1O2 = 2P2O3P4 + 3O2 = 2P2O3
P + O2 = P2O54P + 5O2 = 2P2O5
P + O2 = P2O54P + 5O2 = 2P2O5
Pb(NO3)2=Pb+NO2+O2Pb(NO3)2 = Pb + 2NO2 + O2
P+O2=P4O64P + 3O2 = P4O6
P+O2=P4O58P + 5O2 = 2P4O5
P+O2=P2O34P + 3O2 = 2P2O3
P+O2=P2O34P + 3O2 = 2P2O3
PbBr2+HCl=HBr+PbCl2PbBr2 + 2HCl = 2HBr + PbCl2
PbBr2+HCl=HBr+PbCl2PbBr2 + 2HCl = 2HBr + PbCl2
Pb (NO3)2+H2S=PbS+HNO3Pb(NO3)2 + H2S = PbS + 2HNO3
PI3 + H2O = H3PO3 + HIPI3 + 3H2O = H3PO3 + 3HI
Pb(CH3COO)2+KI=PbI2+CH3COOKPb(CH3COO)2 + 2KI = PbI2 + 2CH3COOK
Pb(CH3COO)2+KI=PbI2+CH3COOKPb(CH3COO)2 + 2KI = PbI2 + 2CH3COOK
P4+NaOH+H2O = PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
Pb + H3PO4 = H2 + Pb(PO4)2Pb + 2H3PO4 = 3H2 + Pb(PO4)2
Pb + Au(NO3)3 = Au + Pb(NO3)3Pb + Au(NO3)3 = Au + 3Pb(NO3)
PBr3+H2O=HBr+H3PO3PBr3 + 3H2O = 3HBr + H3PO3
P2I4 + P4 + H2O = PH4I + H3PO22P2I4 + 9P4 + 64H2O = 8PH4I + 32H3PO2
P+O2=P2O54P + 5O2 = 2P2O5
PCl5(l) + H2O(g) = H3PO4(aq) + HCl(g)PCl5(l) + 4H2O(g) = H3PO4(aq) + 5HCl(g)
P(s)+O2(g) = P4O10(s)4P(s) + 5O2(g) = P4O10(s)
Pb(NO3)2 (aq) + H3AsO4 (aq) = PbHAsO4 (s) + HNO3 (aq)Pb(NO3)2(aq) + H3AsO4(aq) = PbHAsO4(s) + 2HNO3(aq)
Pb(NO3)2 (aq) + H3AsO4 (aq) = PbHAsO4 (s) + HNO3 (aq)Pb(NO3)2(aq) + H3AsO4(aq) = PbHAsO4(s) + 2HNO3(aq)
Pb(NO3)2 + HF = HNO3 + PbF2Pb(NO3)2 + 2HF = 2HNO3 + PbF2
P2S2 = P4 + S84P2S2 = 2P4 + S8
Pb(C2H3O2)2 +K2CO3 = PbCO3 + KC2H3O2Pb(C2H3O2)2 + K2CO3 = PbCO3 + 2KC2H3O2
Pb(C2H3O2)2 + K2CO3 = PbCO3 +2KC2H3O2Pb(C2H3O2)2 + K2CO3 = PbCO3 + 2KC2H3O2
Pb(NO3)2 + H3AsO4 = PbHAsO4 + HNO3Pb(NO3)2 + H3AsO4 = PbHAsO4 + 2HNO3
PbCrO4+HCl=PbCl2+CrCl3+Cl2=+H2O2PbCrO4 + 16HCl = 2PbCl2 + 2CrCl3 + 3Cl2 + 8H2O
P4 + NaOH + H2O= PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
P4 + NaOH + H2O= PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PbO2 =PbO + O22PbO2 = 2PbO + O2
PCl5 + H2O = HCl + H3PO4PCl5 + 4H2O = 5HCl + H3PO4
PCl5 + 3H2O = 5HCl + H3 PO4PCl5 + 4H2O = 5HCl + H3PO4
PCl5 + H2O = HCl + H3 PO4PCl5 + 4H2O = 5HCl + H3PO4
P +O2= P2O54P + 5O2 = 2P2O5
PbCl2+KI=PbI2+KClPbCl2 + 2KI = PbI2 + 2KCl
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2 + NaCl = PbCl2 + NaNO3Pb(NO3)2 + 2NaCl = PbCl2 + 2NaNO3
P4(s) + Cl2(g) = PCl3(l) P4(s) + 6Cl2(g) = 4PCl3(l)
Pb(NO3)2(aq) + Li2SO4(aq) = PbSO4(s) + LiNO3(aq) Pb(NO3)2(aq) + Li2SO4(aq) = PbSO4(s) + 2LiNO3(aq)
Pb(NO3)2 (aq) + K2CrO4 (aq)=PbCrO4 (s) + 2KNO3 (aq)Pb(NO3)2(aq) + K2CrO4(aq) = PbCrO4(s) + 2KNO3(aq)
Pb(NO3)2 (aq)+ Na2CO3 (aq)=PbCO3 (s) + NaNO3 (aq)Pb(NO3)2(aq) + Na2CO3(aq) = PbCO3(s) + 2NaNO3(aq)
Pb(NO3)2 (aq) + CuSO4 (aq)=PbSO4 (s) + Cu(NO3)2 (aq)Pb(NO3)2(aq) + CuSO4(aq) = PbSO4(s) + Cu(NO3)2(aq)
Pb(NO3)2 + AlCl3= PbCl2 + Al(NO3)33Pb(NO3)2 + 2AlCl3 = 3PbCl2 + 2Al(NO3)3
Pb(C2H3O2)2 + K2CO3 = PbCO3 + KC2H3O2Pb(C2H3O2)2 + K2CO3 = PbCO3 + 2KC2H3O2
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
PbO2 + ZnSO4 = Pb(SO4)2 + ZnOPbO2 + 2ZnSO4 = Pb(SO4)2 + 2ZnO
PCl3+H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
PbO2 + ZnSO4 = Pb(SO4)2 + ZnOPbO2 + 2ZnSO4 = Pb(SO4)2 + 2ZnO
PbO2 + ZnSO4 = Pb(SO4)2 + ZnOPbO2 + 2ZnSO4 = Pb(SO4)2 + 2ZnO
PbO2 + ZnSO4 = Pb(SO4)2 + ZnOPbO2 + 2ZnSO4 = Pb(SO4)2 + 2ZnO
P4 + O3 = P2O53P4 + 10O3 = 6P2O5
P2O5(s) + H2O(l) = H3PO4(aq)P2O5(s) + 3H2O(l) = 2H3PO4(aq)
PCl5(l) + H2O(l) =H3PO4(aq) + HCl(aq)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(aq)
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
P2O5 (g) + 3H2O(l) = 2H3PO4(aq)P2O5(g) + 3H2O(l) = 2H3PO4(aq)
P4+O2=P2O3P4 + 3O2 = 2P2O3
P(s) + O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
P4+S8=P2S54P4 + 5S8 = 8P2S5
P4+S8=P2S54P4 + 5S8 = 8P2S5
P(s) + O2(g) = P4O10(s)4P(s) + 5O2(g) = P4O10(s)
PbCO3 = PbO+CO2PbCO3 = PbO + CO2
Pb(CH3COO)2+H2S=PbS+CH3COOHPb(CH3COO)2 + H2S = PbS + 2CH3COOH
P4 + NaOH + H2O = Na2HPO3 + PH3P4 + 4NaOH + 2H2O = 2Na2HPO3 + 2PH3
PBr3 + H2O = HBr + H3PO3PBr3 + 3H2O = 3HBr + H3PO3
PbCl4+ZnO=PbO2+ZnCl2PbCl4 + 2ZnO = PbO2 + 2ZnCl2
P4+O2=P2O3P4 + 3O2 = 2P2O3
Pb(NO3)3 (aq)+Na2O=Pb2O3+NaNO32Pb(NO3)3(aq) + 3Na2O = Pb2O3 + 6NaNO3
PbSO4 + KCl = PbCl2 + K2SO4PbSO4 + 2KCl = PbCl2 + K2SO4
P4+O2=P2O3P4 + 3O2 = 2P2O3
P4 + 5Cl2=4PCl3P4 + 6Cl2 = 4PCl3
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4(s) + Cl2(g) =PCl3(l)P4(s) + 6Cl2(g) = 4PCl3(l)
Pb(NO3)2(aq) + Li2SO4(aq)= PbSO4(s) + LiNO3(aq)Pb(NO3)2(aq) + Li2SO4(aq) = PbSO4(s) + 2LiNO3(aq)
P+O2=P2O34P + 3O2 = 2P2O3
Pb(NO3)2 +FeCl3 =Fe(NO3)3 + PbCl23Pb(NO3)2 + 2FeCl3 = 2Fe(NO3)3 + 3PbCl2
P4 +O5 =P2O5P4 + 2O5 = 2P2O5
P4 + O5 =P2O5P4 + 2O5 = 2P2O5
P2I4(s) +P4(s) +H2O(l) =PH4I(s) +H3PO4(aq)10P2I4(s) + 13P4(s) + 128H2O(l) = 40PH4I(s) + 32H3PO4(aq)
P2I4(s) +P4(s) +H2O(l) =PH4I(s) +H3PO4(aq)10P2I4(s) + 13P4(s) + 128H2O(l) = 40PH4I(s) + 32H3PO4(aq)
P + Cl2 = PCl52P + 5Cl2 = 2PCl5
P2O5+H2O=H4P2O7P2O5 + 2H2O = H4P2O7
P2+O2=P2O52P2 + 5O2 = 2P2O5
Pb+O2=PbO2Pb + O2 = 2PbO
Pb+O2=PbO2Pb + O2 = PbO2
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2 + K2CrO4 = PbCrO4 + KNO3Pb(NO3)2 + K2CrO4 = PbCrO4 + 2KNO3
P2+O2=P2O52P2 + 5O2 = 2P2O5
P4 +H2SO4 = H3PO4 + SO2 + H2OP4 + 10H2SO4 = 4H3PO4 + 10SO2 + 4H2O
P4 +H2SO4 = H3PO4 + SO2 + H2OP4 + 10H2SO4 = 4H3PO4 + 10SO2 + 4H2O
P4 +H2SO4 = H3PO4 + SO2 + H2OP4 + 10H2SO4 = 4H3PO4 + 10SO2 + 4H2O
PB+PBO2+2H2SO4=2PBSO4+2H2OPB + PBO2 + 2H2SO4 = 2PBSO4 + 2H2O
P4+O2 =P2O3P4 + 3O2 = 2P2O3
PbSO3 + O2 = PbSO42PbSO3 + O2 = 2PbSO4
PbL4+CrCl3=PbCl4+CrL33PbL4 + 4CrCl3 = 3PbCl4 + 4CrL3
P+O2=P4O58P + 5O2 = 2P4O5
P+O2=P4O58P + 5O2 = 2P4O5
Pb(NO3)2 + 2HCl = PbCl2 + 2HNO3Pb(NO3)2 + 2HCl = PbCl2 + 2HNO3
P+O2=P2O54P + 5O2 = 2P2O5
Pb(NO3)2+HCl=PbCl2+HNO3Pb(NO3)2 + 2HCl = PbCl2 + 2HNO3
Pb3O4 + HCl = PbO2 + Cl2 + H2O-1Pb3O4 + 4HCl = -3PbO2 + 2Cl2 + 2H2O
Pb3O4 + 2HCl = PbO2 + Cl2 + H2O-1Pb3O4 + 4HCl = -3PbO2 + 2Cl2 + 2H2O
Pb3O4 + HCl = PbO2 + Cl2 + H2O-1Pb3O4 + 4HCl = -3PbO2 + 2Cl2 + 2H2O
PbO2=PbO+O22PbO2 = 2PbO + O2
Pb(OH)4 + Cu2O= PbO2+CuOHPb(OH)4 + 2Cu2O = PbO2 + 4CuOH
P+O2=P2O54P + 5O2 = 2P2O5
P4 (s) + 3 O2 (g) =2 P2O3 (s)P4(s) + 3O2(g) = 2P2O3(s)
Pb(NO3)2+HCl = PbCl2+HNO3Pb(NO3)2 + 2HCl = PbCl2 + 2HNO3
PbCl4+Al2(SO4)3=Pb(SO4)2 + AlCl33PbCl4 + 2Al2(SO4)3 = 3Pb(SO4)2 + 4AlCl3
P4+OH+H2O=H2PO2-+H3PP4 - 12OH + 12H2O = 0H2PO2- + 4H3P
Pb+AgNO3=Pb(NO3)4+AgPb + 4AgNO3 = Pb(NO3)4 + 4Ag
PbF2+PCl3=PF3+PbCl23PbF2 + 2PCl3 = 2PF3 + 3PbCl2
Pb+PbO2+H2SO4=PbSO4+H2OPb + PbO2 + 2H2SO4 = 2PbSO4 + 2H2O
PCl3+Cl2=PCl5PCl3 + Cl2 = PCl5
PCl5=PCl3+Cl2PCl5 = PCl3 + Cl2
P2O9H4 + Au(OH)3 = P2AuH7O12P2O9H4 + Au(OH)3 = P2AuH7O12
P4+3O2=2P2O3P4 + 3O2 = 2P2O3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
PbBr2+HCl=HBr+PbCl2PbBr2 + 2HCl = 2HBr + PbCl2
P4+Br2=PBr3P4 + 6Br2 = 4PBr3
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4+O2=P2O3P4 + 3O2 = 2P2O3
P4+O2=P2O3P4 + 3O2 = 2P2O3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(s) + H2 O(l) + O2(g) = Pb(OH)2(s) 2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P+O2=2P2O4P + O2 = 2P2O
Pb(s) + H2 O(l) + O2(g) = Pb(OH)2(s) 2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
PBr3 = P4 + Br24PBr3 = P4 + 6Br2
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb(CH3COO)2 + H2S = PbS + CH3COOHPb(CH3COO)2 + H2S = PbS + 2CH3COOH
Pb(CH3COO)2 + H2S = PbS + CH3COOHPb(CH3COO)2 + H2S = PbS + 2CH3COOH
PbS2 + Al=Pb + Al2S33PbS2 + 4Al = 3Pb + 2Al2S3
PCl5=PCl3+Cl2PCl5 = PCl3 + Cl2
Pb(SO4)2 + 4 LiNO3 = Pb(NO3)4 + 2 Li2SO4Pb(SO4)2 + 4LiNO3 = Pb(NO3)4 + 2Li2SO4
Pb(SO4)2 + 4 LiNO3 = Pb(NO3)4 + 2 Li2SO4Pb(SO4)2 + 4LiNO3 = Pb(NO3)4 + 2Li2SO4
P4(s) + NaOH(aq) + H2O(l) = PH3(g) + Na2HPO3(aq)P4(s) + 4NaOH(aq) + 2H2O(l) = 2PH3(g) + 2Na2HPO3(aq)
P4O10 + H2O= H3PO4P4O10 + 6H2O = 4H3PO4
PbO2 = PbO + O22PbO2 = 2PbO + O2
PbS+HNO3=Pb(NO3)2+NO+S+H2O3PbS + 8HNO3 = 3Pb(NO3)2 + 2NO + 3S + 4H2O
P4 + 6Cl2 = 4PCl3P4 + 6Cl2 = 4PCl3
P4 + 5Cl2 = 4PCl3P4 + 6Cl2 = 4PCl3
P4 + 5Cl2 = 4PCl3P4 + 6Cl2 = 4PCl3
P4 + 5Cl2 = 4PCl3P4 + 6Cl2 = 4PCl3
PbO2 = PbO + O22PbO2 = 2PbO + O2
PbS + O2 = PbO + SO22PbS + 3O2 = 2PbO + 2SO2
Pb(SiO3)2 + Na2(SO4) = Pb(SO4)2 + Na2(SiO3)Pb(SiO3)2 + 2Na2(SO4) = Pb(SO4)2 + 2Na2(SiO3)
Pb(N3)2 + Cr(MnO4)2 = Cr2O3 + MnO2 + Pb3O4 + NO15Pb(N3)2 + 44Cr(MnO4)2 = 22Cr2O3 + 88MnO2 + 5Pb3O4 + 90NO
Pb(OH)2+HCl=H2O+PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(N3)2+Cr(MnO4)2=Cr2O3+MnO2+Pb3O4+NO15Pb(N3)2 + 44Cr(MnO4)2 = 22Cr2O3 + 88MnO2 + 5Pb3O4 + 90NO
P + O2 = P2O54P + 5O2 = 2P2O5
Pb(C2H3O2)2 + (NH4)3PO4 = NH4C2H3O2 + Pb3(PO4)23Pb(C2H3O2)2 + 2(NH4)3PO4 = 6NH4C2H3O2 + Pb3(PO4)2
P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
Pb H2SO4 = PbSO4 + H2PbH2SO4 = PbSO4 + H2
PCl5 = PCl3+Cl2PCl5 = PCl3 + Cl2
Pb(C2H3O2)2 + K2SO4 = PbSO4 + KC2H3O2Pb(C2H3O2)2 + K2SO4 = PbSO4 + 2KC2H3O2
P + O2 = P2O54P + 5O2 = 2P2O5
P2S5 + PCl5 = PSCl3P2S5 + 3PCl5 = 5PSCl3
Pb + Na2CO3 = 2Na + PbCO3Pb + Na2CO3 = 2Na + PbCO3
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P+O2=P4O104P + 5O2 = P4O10
P5 + O2 = P2O54P5 + 25O2 = 10P2O5
Pb(NO3)2 + NaCl = NaNO3 + PbCl2  Pb(NO3)2 + 2NaCl = 2NaNO3 + PbCl2
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
Pb(NO3)2+H3AsO4=PbHAsO4+HNO3Pb(NO3)2 + H3AsO4 = PbHAsO4 + 2HNO3
Pb(NO3)2+H3AsO4=PbHAsO4+HNO3Pb(NO3)2 + H3AsO4 = PbHAsO4 + 2HNO3
P+HClO3+H2O=HCl+H3PO46P + 5HClO3 + 9H2O = 5HCl + 6H3PO4
PbS + HNO3 = S+ Pb(NO3)2 + NO + H2O3PbS + 8HNO3 = 3S + 3Pb(NO3)2 + 2NO + 4H2O
Pb + FeSO4 = PbSO4+ FePb + FeSO4 = PbSO4 + Fe
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
PbSO4 = PbSO3 + O22PbSO4 = 2PbSO3 + O2
PCl5 + 4 H2O =H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
P(s) + O2 (g) = P4 O10 (s) 4P(s) + 5O2(g) = P4O10(s)
Pb(No3)2+KI=PbI2+KNo3Pb(No3)2 + 2KI = PbI2 + 2KNo3
PCl3 +AgF = PF3 + AgClPCl3 + 3AgF = PF3 + 3AgCl
PI3(l) + H2O(l) = H3PO3(aq) + HI(aq) PI3(l) + 3H2O(l) = H3PO3(aq) + 3HI(aq)
Pb(No2)4+Pt3N4=Pb3N4+Pt(No2)43Pb(No2)4 + Pt3N4 = Pb3N4 + 3Pt(No2)4
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
P4(s)+Cl2(g)=PCl5(g)P4(s) + 10Cl2(g) = 4PCl5(g)
Pb(NO3)2(aq) + Na2SO4(aq) = PbSO4(s) + NaNO3(aq)Pb(NO3)2(aq) + Na2SO4(aq) = PbSO4(s) + 2NaNO3(aq)
PCl5=PCl3+Cl2PCl5 = PCl3 + Cl2
PCl5=PCl3+Cl2PCl5 = PCl3 + Cl2
P4(s)+NaOH+H2O(l)= PH3(g)+Na2HPO3(aq)P4(s) + 4NaOH + 2H2O(l) = 2PH3(g) + 2Na2HPO3(aq)
P(s)+O2(g)=P4O10(s)4P(s) + 5O2(g) = P4O10(s)
Pb(ClO4)2(aq)+Na2S(aq)=PbS(s)+2NaClO4(aq)Pb(ClO4)2(aq) + Na2S(aq) = PbS(s) + 2NaClO4(aq)
PBr3+ 3H2O= H3PO3+ 3HBrPBr3 + 3H2O = H3PO3 + 3HBr
P + KCLO3=KCL + P2O56P + 5KCLO3 = 5KCL + 3P2O5
P + KCLO3=KCL + P2O56P + 5KCLO3 = 5KCL + 3P2O5
P + KCLO3=KCL + P2O56P + 5KCLO3 = 5KCL + 3P2O5
P + O4=PO4P + O4 = PO4
PCl5+4H2O=H3PO4+5HClPCl5 + 4H2O = H3PO4 + 5HCl
P + 5O2 = P2O54P + 5O2 = 2P2O5
Pb(NO3)2(aq)+LiCl(aq)=PbCl2(aq)+LiNO3(s)Pb(NO3)2(aq) + 2LiCl(aq) = PbCl2(aq) + 2LiNO3(s)
Pb+Cl=PbCl2Pb + 2Cl = PbCl2
P+O2=P2O54P + 5O2 = 2P2O5
Pb(s) + H2O(l) + O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
Pb(s) + H2O(l) + O2(g) = Pb(OH)2(s) =2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
Pb(NO3)4+Ca(ClO3)2=Ca(NO3)2+Pb(ClO3)4Pb(NO3)4 + 2Ca(ClO3)2 = 2Ca(NO3)2 + Pb(ClO3)4
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
PtCl4 +Cl2= PtCl2PtCl4 - 3Cl2 = 2PtCl
Pb(NO3)2 + Na2CO3 = PbCO3 + NaNO3Pb(NO3)2 + Na2CO3 = PbCO3 + 2NaNO3
PbO2 = PbO+O22PbO2 = 2PbO + O2
PBr3+H2O=HBr+H3PO3PBr3 + 3H2O = 3HBr + H3PO3
P4O10+6H2O=H3O+H2PO4P4O10 + 10H2O = 4H3O + 4H2PO4
P4O10+6H2O=H3O+H2PO4P4O10 + 10H2O = 4H3O + 4H2PO4
P2O5 = P + O22P2O5 = 4P + 5O2
P2O5 + H2O = H3PO4P2O5 + 3H2O = 2H3PO4
P+O2=P2O54P + 5O2 = 2P2O5
Pb(NO3)2 + NaCl = NaNO3 + PbCl2Pb(NO3)2 + 2NaCl = 2NaNO3 + PbCl2
P4O10 + H2O = H3PO4 P4O10 + 6H2O = 4H3PO4
Pb(NO3)2+K2CrO4=PbCrO4+KNO3Pb(NO3)2 + K2CrO4 = PbCrO4 + 2KNO3
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
PCl5(g) + H2O(l) = HCl(aq) + H3PO4(aq)PCl5(g) + 4H2O(l) = 5HCl(aq) + H3PO4(aq)
Pb(s) + H2O(l) +O2(g) = Pb(OH)2(s)2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
PH3 + O2 = P4O10 + H2O4PH3 + 8O2 = P4O10 + 6H2O
Pb(NO3)2 + Ag2S = PbS + 2AgNO3Pb(NO3)2 + Ag2S = PbS + 2AgNO3
Pb(s) + H2 O(l) + O2(g)= Pb(OH)2(s) 2Pb(s) + 2H2O(l) + O2(g) = 2Pb(OH)2(s)
P4(s) + O2(g) = P4 O10(s) P4(s) + 5O2(g) = P4O10(s)
PCl3(g)+Cl2(g)=PCl5(s)PCl3(g) + Cl2(g) = PCl5(s)
Pb(OH)2 + HCl = H2O +PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(OH)3 + ClO = Cl- + PbO2 + OH- + H2O3Pb(OH)3 + ClO = Cl- + 3PbO2 - OH- + 5H2O
PbO +PH3 =P4 +H2O + Pb6PbO + 4PH3 = P4 + 6H2O + 6Pb
Pb(C2H3O2)+Na(PO4)=Pb(PO4)+Na(C2H3O2)Pb(C2H3O2) + Na(PO4) = Pb(PO4) + Na(C2H3O2)
Pb(C2H3O2)+Na(PO4)=Pb(PO4)+Na(C2H3O2)Pb(C2H3O2) + Na(PO4) = Pb(PO4) + Na(C2H3O2)
P (s)+O2 (g)=P4O10 (s)4P(s) + 5O2(g) = P4O10(s)
P4(s) + F2(g) = PF3(s)P4(s) + 6F2(g) = 4PF3(s)
PbO2 + 2H2 = Pb + 2H2OPbO2 + 2H2 = Pb + 2H2O
Pb(NO3)2(aq) + NaOH(aq)= Pb(OH)2(s) + NaNO3(aq)Pb(NO3)2(aq) + 2NaOH(aq) = Pb(OH)2(s) + 2NaNO3(aq)
PbCl4 + K2SO4 = PbSO4 + K2Cl4PbCl4 + K2SO4 = PbSO4 + K2Cl4
Pb+H3PO4=Pb3(PO4)2+H23Pb + 2H3PO4 = Pb3(PO4)2 + 3H2
Pb(NO3)2 + KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PbCl2+Li2SO4=PbSO4+LiClPbCl2 + Li2SO4 = PbSO4 + 2LiCl
P + O2 = P2O54P + 5O2 = 2P2O5
PbO2 = PbO + O22PbO2 = 2PbO + O2
P4O10+ Mg(OH)2 = Mg3(PO4)2 + H2OP4O10 + 6Mg(OH)2 = 2Mg3(PO4)2 + 6H2O
P4+O2=P4O10P4 + 5O2 = P4O10
P2O5+H2O=H3PO4P2O5 + 3H2O = 2H3PO4
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
PbCl2 + K2SO4 = PbSO4 + 2KClPbCl2 + K2SO4 = PbSO4 + 2KCl
Pb(NO3)2+NH4Cl=PbCl2+NH4NO3Pb(NO3)2 + 2NH4Cl = PbCl2 + 2NH4NO3
PbO = Pb + O22PbO = 2Pb + O2
PbS+O2 = PbO+S22PbS + O2 = 2PbO + S2
Pb(OH)2 + 2HBr = PbBr2 + 2H2OPb(OH)2 + 2HBr = PbBr2 + 2H2O
Pb(OH)2 + 2HBr = PbBr2 + 2H2OPb(OH)2 + 2HBr = PbBr2 + 2H2O
Pb (NO3)2 +KI = PbI2 + KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2 + Na2SO4 + NaC2H3O2 = PbC2H3O2 + NaSO4 + 2 NaNO3Pb(NO3)2 + Na2SO4 + NaC2H3O2 = PbC2H3O2 + NaSO4 + 2NaNO3
PbO2 = PbO + O22PbO2 = 2PbO + O2
P4 + Cl2 = PCl3P4 + 6Cl2 = 4PCl3
Pb(CN)2+Ni = Pb + Ni(CN)2Pb(CN)2 + Ni = Pb + Ni(CN)2
P4(s) + Ca(s) = Ca3P2(s)P4(s) + 6Ca(s) = 2Ca3P2(s)
PCl5 +H2O=H3PO4+ HClPCl5 + 4H2O = H3PO4 + 5HCl
P4+O2=P2O5P4 + 5O2 = 2P2O5
PCl3 + H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
PCl3 +H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(CH3COO)2+H3P=Pb3P2+CH3COOH3Pb(CH3COO)2 + 2H3P = Pb3P2 + 6CH3COOH
Pb + H3PO4 = H2 + Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
P4+Cl2=PCl3P4 + 6Cl2 = 4PCl3
PbO2 + NaCrO2 + NaOH = H2O + Na2CrO4 + NaPbO23PbO2 + NaCrO2 + 4NaOH = 2H2O + Na2CrO4 + 3NaPbO2
Pb + H3PO4 = H2 + Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(NO3)+HCl=PbCl+HNO3Pb(NO3) + HCl = PbCl + HNO3
P4+O2=P2O5P4 + 5O2 = 2P2O5
Pb(OH)2+NaOH=Na2PbO2+H2OPb(OH)2 + 2NaOH = Na2PbO2 + 2H2O
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(OH)2+HCl=H2O+PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
P4+Na=Na3PP4 + 12Na = 4Na3P
PCl5+P2O5=POCl33PCl5 + P2O5 = 5POCl3
PCl3+H2O=H3PO3+HClPCl3 + 3H2O = H3PO3 + 3HCl
P4O10+HCl=POCl3+HPO3P4O10 + 3HCl = POCl3 + 3HPO3
PbS2+Ca=CaS+PbPbS2 + 2Ca = 2CaS + Pb
Pb(NO3)2 (aq) +2 HBr(aq) = PbBr2(s) + 2HNO3(aq)Pb(NO3)2(aq) + 2HBr(aq) = PbBr2(s) + 2HNO3(aq)
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
PCl3 + 3H2O = H3PO3 + 3HClPCl3 + 3H2O = H3PO3 + 3HCl
Pb(NO3)2+NaI=PbI2+NaNO3Pb(NO3)2 + 2NaI = PbI2 + 2NaNO3
Pb(NO3)2+2KI=PbI2+2KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
Pb(NO3)2+2KI=PbI2+2KNO3Pb(NO3)2 + 2KI = PbI2 + 2KNO3
PCl5+H2O=HCl+H3(PO4)PCl5 + 4H2O = 5HCl + H3(PO4)
PCl5+H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
PCl3+H2O = H3PO3 + HClPCl3 + 3H2O = H3PO3 + 3HCl
PbS+ O2 = PbO+ SO22PbS + 3O2 = 2PbO + 2SO2
PBr3 + H2O = H3PO3 + HBr PBr3 + 3H2O = H3PO3 + 3HBr
Pb(NO3)2+FeBr3=Pb3(Br3)2+Fe2(NO3)63Pb(NO3)2 + 2FeBr3 = Pb3(Br3)2 + Fe2(NO3)6
P4(s)+Ca(s)=Ca3P2(s)P4(s) + 6Ca(s) = 2Ca3P2(s)
PbO2=PbO+O22PbO2 = 2PbO + O2
Pb(s) + AgNO3(aq)= Pb(NO3)2 + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2 + 2Ag(s)
PbSO4 = PbSO3 + O22PbSO4 = 2PbSO3 + O2
P4 + ClO + OH = H2PO4 + ClP4 + 8ClO + 8OH = 4H2PO4 + 8Cl
PbS + O2 = PbO + SO22PbS + 3O2 = 2PbO + 2SO2
Pb(NO3)2 = 2PbO + 4NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
P + HNO3 + H2O= H3PO4 + NO3P + 5HNO3 + 2H2O = 3H3PO4 + 5NO
PbSO4 = PbSO3+O55PbSO4 = 5PbSO3 + O5
PbS + O2 = 2PbO + 2SO22PbS + 3O2 = 2PbO + 2SO2
P2S5(s) + PCl5(s) = PSCl3(g)P2S5(s) + 3PCl5(s) = 5PSCl3(g)
Pb2OH+CH3COO=Pb2CH3COO+OHCH3COOPb2OH + 2CH3COO = Pb2CH3COO + OHCH3COO
Pb2OH+CH3COO=Pb2CH3COO+OHCH3COOPb2OH + 2CH3COO = Pb2CH3COO + OHCH3COO
P4 + O2 = P2O5P4 + 5O2 = 2P2O5
PbCO3 + KNO3 = Pb3O4 + KNO2 + CO23PbCO3 + KNO3 = Pb3O4 + KNO2 + 3CO2
PbS+O2 =PbO+SO22PbS + 3O2 = 2PbO + 2SO2
P4+O5=P2O5P4 + 2O5 = 2P2O5
P4+O2=P2O5P4 + 5O2 = 2P2O5
P4 + S8 = P2S54P4 + 5S8 = 8P2S5
Pb + Na + C2H5Cl = Pb(C2H5)4 + NaClPb + 4Na + 4C2H5Cl = Pb(C2H5)4 + 4NaCl
Pb + Na + C2H5Cl = Pb(C2H5)4 + NaClPb + 4Na + 4C2H5Cl = Pb(C2H5)4 + 4NaCl
PtCl2 + 2HNO3 =Pt(NO3)2 + 2HClPtCl2 + 2HNO3 = Pt(NO3)2 + 2HCl
PbO2+HCl=PbCl2+Cl2+H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) +Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
Pt+2F=PtFPt + F = PtF
Po+2 + Se-2 = PoSePo+2 + Se-2 = PoSe
Pt+4 + H-1 = PtH4Pt+4 + 4H-1 = PtH4
Pt+4 + H-1 = PtH4Pt+4 + 4H-1 = PtH4
Po+4 + N-3 = Po3 N43Po+4 + 4N-3 = Po3N4
P4+NaOH+H2O=PH3+Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pt + H = PtHPt + H = PtH
Pt + H = PtH4Pt + 4H = PtH4
Pt+4 + H-1 = PtH4Pt+4 + 4H-1 = PtH4
Pt+2 + H-1 = PtH2Pt+2 + 2H-1 = PtH2
PCl5(l)+H2O(l)=H3PO4(aq)+HCl(g)PCl5(l) + 4H2O(l) = H3PO4(aq) + 5HCl(g)
Pb(s) + AgNO3(aq)= Pb(NO3)2(aq) + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4O10 + H2O = H3PO4P4O10 + 6H2O = 4H3PO4
Pb + (OH) = Pb(OH)Pb + (OH) = Pb(OH)
P4 + KClO3 = KCl + P2O53P4 + 10KClO3 = 10KCl + 6P2O5
PbCO3 = PbO + CO2PbCO3 = PbO + CO2
PbO2 + HCl = PbCl2 + Cl2 + H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
P4O10 + H2O= H3PO4P4O10 + 6H2O = 4H3PO4
Pb(NO3)2 + K2CO3= PbCO3 + KNO3Pb(NO3)2 + K2CO3 = PbCO3 + 2KNO3
Pb(s) + AgNO3(aq) = Pb(NO3)2(aq) + Ag(s)Pb(s) + 2AgNO3(aq) = Pb(NO3)2(aq) + 2Ag(s)
P4 + NaOH + H2O = PH3 + Na2HPO3P4 + 4NaOH + 2H2O = 2PH3 + 2Na2HPO3
Pb(NO3)2+LiBr=PbBr2+LiNO3Pb(NO3)2 + 2LiBr = PbBr2 + 2LiNO3
PbS + HNO3 = Pb(NO3)2 + NO + S +H2O3PbS + 8HNO3 = 3Pb(NO3)2 + 2NO + 3S + 4H2O
P4 + Ca = Ca3P2P4 + 6Ca = 2Ca3P2
PCl5 + H2O = H3PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
P4(s)+O2(g)=P4O10(s)P4(s) + 5O2(g) = P4O10(s)
P+O2=P4O104P + 5O2 = P4O10
PCl5 + H2O = H3 PO4 + HClPCl5 + 4H2O = H3PO4 + 5HCl
PbO2 +HCl=PbCl2 + Cl2 +H2OPbO2 + 4HCl = PbCl2 + Cl2 + 2H2O
P4 + KClO3= KCl + P2O53P4 + 10KClO3 = 10KCl + 6P2O5
P 4 O 10 (s)+ H 2 O(l) = H 3 P O 4 (aq)P4O10(s) + 6H2O(l) = 4H3PO4(aq)
P 2 O 3 (g)+ O 2 (g) = P 2 O 5 (g)P2O3(g) + O2(g) = P2O5(g)
P + O2 =P4O104P + 5O2 = P4O10

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.