Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
OsO4+PtCl4=PtO2+OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 = O33O2 = 2O3
O2=O33O2 = 2O3
O2=O33O2 = 2O3
O=O22O = O2
O2 + CS2 = CO2 + 2SO23O2 + CS2 = CO2 + 2SO2
Os+8 + P-3 = Os3P83Os+8 + 8P-3 = Os3P8
O2+CO=CO2O2 + 2CO = 2CO2
O2+Cl2=Cl2OO2 + 2Cl2 = 2Cl2O
O2+C8H18= CO2+H2O25O2 + 2C8H18 = 16CO2 + 18H2O
OF2 = O2 + F22OF2 = O2 + 2F2
OF2 = O2 + F2OF2 = O2 + 4F
O2 + C 10H 22 =CO2 + H2O 31O2 + 2C10H22 = 20CO2 + 22H2O
O2+2C6H14=CO2+H26O2 + C6H14 = 6CO2 + 7H2
O2+2C6H14=CO2+H26O2 + C6H14 = 6CO2 + 7H2
O2+2C6H14 =CO2 + H26O2 + C6H14 = 6CO2 + 7H2
O2+N2=NO22O2 + N2 = 2NO2
O2 + C2H8 =CO2 + H2O4O2 + C2H8 = 2CO2 + 4H2O
O2+C02+H20 =C6H12O615O2 + 15C02 + 3H20 = 5C6H12O6
OF2 = O + FOF2 = O + 2F
OF2 = O2 + F22OF2 = O2 + 2F2
O2+C=CO2O2 + C = CO2
OH + Pb= Pb(OH)22OH + Pb = Pb(OH)2
O2+C6H6=CO2+H2O15O2 + 2C6H6 = 12CO2 + 6H2O
OF2 = O2 + F22OF2 = O2 + 2F2
O3=O22O3 = 3O2
OF2+H2O=4O2+8HFOF2 + H2O = O2 + 2HF
OF2+H2O=4O2+8HFOF2 + H2O = O2 + 2HF
O2 + ZnS = ZnO + SO23O2 + 2ZnS = 2ZnO + 2SO2
O2 + CS2 =CO2 + SO23O2 + CS2 = CO2 + 2SO2
OH- + Mn+2 + BiO3- = Mn(OH)4 + Bi(OH)3 + H2O-1OH- - Mn+2 - BiO3- = -1Mn(OH)4 - Bi(OH)3 + 3H2O
OH- + Bi2O3 + OCl- = Cl- + BiO3- + H2O2OH- + Bi2O3 + 2OCl- = 2Cl- + 2BiO3- + H2O
O2 + Cl2 = Cl2OO2 + 2Cl2 = 2Cl2O
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O2 + N2 = NO22O2 + N2 = 2NO2
O2+NO=NO2O2 + 2NO = 2NO2
O2+H2=H2O2O2 + H2 = H2O2
O2+H2=H2O2O2 + H2 = H2O2
O2(g)+NO(g)= NO2(g)O2(g) + 2NO(g) = 2NO2(g)
O2 + 2 CaCl2= 2 Cl2 + 2 CaOO2 + 2CaCl2 = 2Cl2 + 2CaO
O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
O2 + Fe = FeOO2 + 2Fe = 2FeO
O2+H2=OHO2 + H2 = 2OH
O2+Fe3O4=Fe2O3O2 + 4Fe3O4 = 6Fe2O3
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
OH+AsH3=H3AsO4+H2O8OH + AsH3 = H3AsO4 + 4H2O
OH- + SO3 = SO4-- + H2O2OH- + SO3 = SO4-- + H2O
OH + Al2O3 = Al(OH)3 + O212OH + 2Al2O3 = 4Al(OH)3 + 3O2
OH + Al2O3 = Al(OH)3 + O212OH + 2Al2O3 = 4Al(OH)3 + 3O2
O3=2O22O3 = 3O2
O3=2O22O3 = 3O2
O2+P2+H2=POH3O2 + P2 + 3H2 = 2POH3
O2+C6H6=CO2+H2O15O2 + 2C6H6 = 12CO2 + 6H2O
O2+K=K2OO2 + 4K = 2K2O
O2+H2=2H2OO2 + 2H2 = 2H2O
O2+C5H12O2=CO2+H2O7O2 + C5H12O2 = 5CO2 + 6H2O
O2+C5H12O2=CO2+H2O7O2 + C5H12O2 = 5CO2 + 6H2O
O2+C5H12=CO2+H2O8O2 + C5H12 = 5CO2 + 6H2O
O2+H2=H2OO2 + 2H2 = 2H2O
O2 + CS2 = CO2 + 2SO23O2 + CS2 = CO2 + 2SO2
O2+N2=O2N2O2 + N2 = O2N2
O2 + As4S6= SO2 + As4O69O2 + As4S6 = 6SO2 + As4O6
O3(g)=O2(g)2O3(g) = 3O2(g)
O2(g) + C3H8 (g) = CO2 (l) + H2O(l)5O2(g) + C3H8(g) = 3CO2(l) + 4H2O(l)
O2 + C 4H 10 =CO2 + H2O 13O2 + 2C4H10 = 8CO2 + 10H2O
O2 + C5H12 = CO2 + H2O8O2 + C5H12 = 5CO2 + 6H2O
O2 + C2H5OH = CO2 + H2O3O2 + C2H5OH = 2CO2 + 3H2O
O2+HCl=H2O+Cl2O2 + 4HCl = 2H2O + 2Cl2
O(g)+C(s)=CO2(g)2O(g) + C(s) = CO2(g)
O2 + H2 = H2OO2 + 2H2 = 2H2O
O2(g)+CS2(g)=CO2(g)+SO2(g)3O2(g) + CS2(g) = CO2(g) + 2SO2(g)
O2+ CCl4= COCl+ Cl2O2 + 2CCl4 = 2COCl + 3Cl2
O2+ S8= SO312O2 + S8 = 8SO3
O2+ C5H12 = CO2+H2O8O2 + C5H12 = 5CO2 + 6H2O
O3=O22O3 = 3O2
O2+ PCl3= POCl3O2 + 2PCl3 = 2POCl3
O2+C6H12O6= H2O + CO26O2 + C6H12O6 = 6H2O + 6CO2
O2 + HI = H2O + I2 O2 + 4HI = 2H2O + 2I2
O2 + 2H2O = 2H2O2O2 + 2H2O = 2H2O2
O2(g) + C6H5COOH(aq) = CO2(g) + H2O(g)15O2(g) + 2C6H5COOH(aq) = 14CO2(g) + 6H2O(g)
O2(g) + CH3OH(l) = CO2(g) + H2O(g)3O2(g) + 2CH3OH(l) = 2CO2(g) + 4H2O(g)
O2(g) + CH3CHO(l) = CO2(g) + H2O(g)5O2(g) + 2CH3CHO(l) = 4CO2(g) + 4H2O(g)
O2(g) + CH3OH(l) = CO2(g) + H2O(g)3O2(g) + 2CH3OH(l) = 2CO2(g) + 4H2O(g)
O2+C6H14=CO2+H2O19O2 + 2C6H14 = 12CO2 + 14H2O
O2(g) + CH3OH(l) = CO2(g) + H2O(g)3O2(g) + 2CH3OH(l) = 2CO2(g) + 4H2O(g)
O2(g) + CH3OH(l) = CO2(g) + H2O(g)3O2(g) + 2CH3OH(l) = 2CO2(g) + 4H2O(g)
O2(g) + CH3OH(l) = CO2(g) + H2O(g)3O2(g) + 2CH3OH(l) = 2CO2(g) + 4H2O(g)
O2(g) + C4H10(g) =CO2(g) + H2O(g)13O2(g) + 2C4H10(g) = 8CO2(g) + 10H2O(g)
O2+C7H6O2=CO2+H2O15O2 + 2C7H6O2 = 14CO2 + 6H2O
OH- + Fe(SCN)2+ = SCN- + Fe(OH)33OH- + Fe(SCN)2+ = 2SCN- + Fe(OH)3
O2(g) + CH3CHO(l) = CO2(g) + H2O(g)5O2(g) + 2CH3CHO(l) = 4CO2(g) + 4H2O(g)
O2 + HI = H2O + I2 O2 + 4HI = 2H2O + 2I2
O2+F2=F2OO2 + 2F2 = 2F2O
O2+C6H5COOH=CO2+H2O15O2 + 2C6H5COOH = 14CO2 + 6H2O
O2 + Sb2S3=Sb2O4 + SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2(g) + C6H5COOH(aq) = CO2(g) + H2O(g)15O2(g) + 2C6H5COOH(aq) = 14CO2(g) + 6H2O(g)
O2(g) + C6H5COOH(aq) = CO2(g) + H2O(g)15O2(g) + 2C6H5COOH(aq) = 14CO2(g) + 6H2O(g)
O2(g) + CH3CHO(l) = CO2(g) + H2O(g)5O2(g) + 2CH3CHO(l) = 4CO2(g) + 4H2O(g)
O2(g) + C4H10(g) = CO2(g) + H2O(g)13O2(g) + 2C4H10(g) = 8CO2(g) + 10H2O(g)
O2(g) + CH3CHO(l) = CO2(g) + H2O(g)5O2(g) + 2CH3CHO(l) = 4CO2(g) + 4H2O(g)
O2(g) + CH3CHO(l) = CO2(g) + H2O(g)5O2(g) + 2CH3CHO(l) = 4CO2(g) + 4H2O(g)
O2 + H2 = H2OO2 + 2H2 = 2H2O
O3=O22O3 = 3O2
O2 +C6 H14 = CO2 + H2O19O2 + 2C6H14 = 12CO2 + 14H2O
O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
O2+H2+Al=Al(OH)33O2 + 3H2 + 2Al = 2Al(OH)3
O2 + C6 H14 = CO2 + H2O19O2 + 2C6H14 = 12CO2 + 14H2O
O2+ 4Fe(OH)2 =2Fe2O3+ 4H2OO2 + 4Fe(OH)2 = 2Fe2O3 + 4H2O
O2 + CH2CHCl = H2O + CO2 + HCl 5O2 + 2CH2CHCl = 2H2O + 4CO2 + 2HCl
O2 + H = H2OO2 + 4H = 2H2O
O2 + C5H12 = CO2 + H2O 8O2 + C5H12 = 5CO2 + 6H2O
O2+NO=NO2O2 + 2NO = 2NO2
OF2 + Cl2 = OF2Cl2OF2 + Cl2 = 2OF2Cl
O2+Ca=CaOO2 + 2Ca = 2CaO
O2+Ca=CaOO2 + 2Ca = 2CaO
O2 + CH4 = CO2 + H2O2O2 + CH4 = CO2 + 2H2O
O2(g) + C7H16O2(l) =CO2(g) + H2O(g)10O2(g) + C7H16O2(l) = 7CO2(g) + 8H2O(g)
OH- + Cl2 = Cl- + ClO3- + H2O 6OH- + 3Cl2 = 5Cl- + ClO3- + 3H2O
O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
OH- + Cl2 = Cl- + ClO3- + H2O 6OH- + 3Cl2 = 5Cl- + ClO3- + 3H2O
O3 = O22O3 = 3O2
O3 = O22O3 = 3O2
O2 + C 6H 14 = CO2 +H2O 19O2 + 2C6H14 = 12CO2 + 14H2O
O3=O22O3 = 3O2
O2+ N2=N2O42O2 + N2 = N2O4
O2(g)+FeO(s)=Fe2O3(s)O2(g) + 4FeO(s) = 2Fe2O3(s)
O2+H2O+CO2=C6H12O6-6O2 + 6H2O + 6CO2 = C6H12O6
O2 + CS2 =CO2 + SO23O2 + CS2 = CO2 + 2SO2
OCl- + S2O32- + OH = 2SO4 + Cl2 + H2O2OCl- - 2S2O32- + 92OH = -4SO4 + Cl2 + 46H2O
O2 + CH2CHCl = H2O + CO2 + HCl5O2 + 2CH2CHCl = 2H2O + 4CO2 + 2HCl
O2 + Co = Co2O33O2 + 4Co = 2Co2O3
O2 +C8H18 =CO2 + H2O25O2 + 2C8H18 = 16CO2 + 18H2O
O+H= H2OO + 2H = H2O
O2 +OH = H2O2 0O2 + 2OH = H2O2
O2 + OH- = H2O2 + H20-10O2 + 0OH- = -10H2O2 + H20
O + H = H2O O + 2H = H2O
O+C=CO22O + C = CO2
O2 = O33O2 = 2O3
O10P4 + H2O = H3PO4O10P4 + 6H2O = 4H3PO4
O2+PCL3=POCL3O2 + 2PCL3 = 2POCL3
OCl- + S2O3-- + OH- = SO4-- + Cl- + H2O4OCl- + S2O3-- + 2OH- = 2SO4-- + 4Cl- + H2O
O2+NH3 =NO+H2O5O2 + 4NH3 = 4NO + 6H2O
O2 + As4S6 = 3SO2 + As4O69O2 + As4S6 = 6SO2 + As4O6
O2+Fe3(PO4)2= Fe2O3+PO49O2 + 4Fe3(PO4)2 = 6Fe2O3 + 8PO4
OCl- + S2O3- + OH- = SO4- + Cl- + H2O9OCl- + 2S2O3- + 2OH- = 4SO4- + 9Cl- + H2O
OCl- + S2O3- + OH- = SO42- + Cl- + H2O161OCl- + 2S2O3- + 2OH- = 4SO42- + 161Cl- + H2O
OCl- + S2O32- + OH- = SO42- + Cl- + H2O103OCl- + 2S2O32- + 2OH- = 4SO42- + 103Cl- + H2O
OCl- + S2O332- + OH- = SO42- + Cl- + H2O-497OCl- + 2S2O332- + 2OH- = 4SO42- - 497Cl- + H2O
O(g) + N(g) = NO(g)O(g) + N(g) = NO(g)
OH- = H2O + O2 + e-4OH- = 2H2O + O2 + 2e-
OCl- + S2O3 -- + OH- = SO4 -- + Cl- + H2O4OCl- + S2O3-- + 2OH- = 2SO4-- + 4Cl- + H2O
OCl- + S2O3 -- + OH- = SO4 -- + Cl- + H2O4OCl- + S2O3-- + 2OH- = 2SO4-- + 4Cl- + H2O
OH = O2 + H2OH = O2 + 2H
OC10H169+O2=OCH+O20OC10H169 + O2 = 0OCH + O2
OC10H169+O2=OCH+O20OC10H169 + O2 = 0OCH + O2
O2=O33O2 = 2O3
OH- + CrO2- + ClO- = CrO4+2 +Cl- +H2O6OH- - 2CrO2- - 7ClO- = -2CrO4+2 - 7Cl- + 3H2O
OH- + Mn+2 + ClO- = MnO4- +Cl- +H2O6OH- + 2Mn+2 + 5ClO- = 2MnO4- + 5Cl- + 3H2O
OH- + Mn+2 + Br2 = MnO2 + Br- +H2O4OH- + Mn+2 + Br2 = MnO2 + 2Br- + 2H2O
O2+H20+Pb=Pb(OH)210O2 + H20 + 10Pb = 10Pb(OH)2
O3=O22O3 = 3O2
O3=O22O3 = 3O2
O3 = O2 2O3 = 3O2
O2+C6H14=CO2+H2O19O2 + 2C6H14 = 12CO2 + 14H2O
O2+C6H14 = CO2+H2O19O2 + 2C6H14 = 12CO2 + 14H2O
O2+C6H14 = CO2+H2O19O2 + 2C6H14 = 12CO2 + 14H2O
O2+H2=H2OO2 + 2H2 = 2H2O
O2(g) + Mg(s) = MgOO2(g) + 2Mg(s) = 2MgO
O2 + Mg = MgOO2 + 2Mg = 2MgO
OCH4 + O2 = CO2 + H2O2OCH4 + 3O2 = 2CO2 + 4H2O
O2 + KCL = KCLO33O2 + 2KCL = 2KCLO3
O2 + NO = NO2 O2 + 2NO = 2NO2
O2 + H2O + Pb = Pb(OH)2O2 + 2H2O + 2Pb = 2Pb(OH)2
O2 + As4S6 = SO2 + As4O69O2 + As4S6 = 6SO2 + As4O6
O2+CH4=CO2+H205O2 + 5CH4 = 5CO2 + H20
OH- + NH4Cl = N2 + Cl2 + H2O + e8OH- + 2NH4Cl = N2 + Cl2 + 8H2O + 8e
O2=O33O2 = 2O3
O2+H+e=H2OO2 + 4H + 0e = 2H2O
O2+C2H2=H2O+CO25O2 + 2C2H2 = 2H2O + 4CO2
O2(g) + H2(g) = H2OO2(g) + 2H2(g) = 2H2O
O2(g) + H2(g) = H2OO2(g) + 2H2(g) = 2H2O
OsO4 + PtCl4 = PtO2 + OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 + NO2 = NO-1O2 + 2NO2 = 2NO
O2=O33O2 = 2O3
O2+H2=H2OO2 + 2H2 = 2H2O
O2+H2=H2OO2 + 2H2 = 2H2O
O2 + NaHCO3 = CO2 + NaOH0O2 + NaHCO3 = CO2 + NaOH
O3 + NaI + H2O = I2 +NaOHO3 + 6NaI + 3H2O = 3I2 + 6NaOH
O2+3e=2O3-3O2 + 2e = 2O3-
O2=3O2-+6e-1O2 = -1O2- + e
O2+4e=2O2-O2 + e = O2-
O2+3e=3O2O2 + 0e = O2
O2+H2=H2OO2 + 2H2 = 2H2O
O2 C5H10 (l) + O2 (g) =CO2 (g) + H2O (g)2O2C5H10(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
OF2 + H2O = O2 + 2HFOF2 + H2O = O2 + 2HF
O2 + C7H8 = CO2 + H2O9O2 + C7H8 = 7CO2 + 4H2O
O3=O22O3 = 3O2
O2(g) PbS(s) + O2(g) = PbO(s) + SO2(g) 2O2(g)PbS(s) + O2(g) = 2PbO(s) + 2SO2(g)
Os + O2 = OsO4Os + 2O2 = OsO4
OH- + H2O + Si = SiO3 2- + H22OH- + 62H2O + 2Si = 2SiO32- + 63H2
O2 = O33O2 = 2O3
O2+HCl=Cl2+H2OO2 + 4HCl = 2Cl2 + 2H2O
O2+S2=2SO22O2 + S2 = 2SO2
O3 = O22O3 = 3O2
OF2 + H2O = O2 + HFOF2 + H2O = O2 + 2HF
O+H=H2OO + 2H = H2O
O+H=HOO + H = HO
O+H=HOO + H = HO
O2+H=H2OO2 + 4H = 2H2O
O2+H=H2OO2 + 4H = 2H2O
O2+H2=H2OO2 + 2H2 = 2H2O
O2 + CH4 = CO2 + H2O2O2 + CH4 = CO2 + 2H2O
O2+FeSO4*7H2O+MgO= Fe2O3+MgSO4+H2OO2 + 4FeSO4*7H2O + 4MgO = 2Fe2O3 + 4MgSO4 + 28H2O
OH-(Aq)+ClO3-(Aq) + Fe(OH)3(s) =FeO42-(Aq) + Cl-(aq)+H2O(l)3OH-(Aq) + 40ClO3-(Aq) + 3Fe(OH)3(s) = 3FeO42-(Aq) + 40Cl-(aq) + 6H2O(l)
OF2+H2O=O2+HFOF2 + H2O = O2 + 2HF
O2 + Sb2S3 = Sb2O4 + SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2+SO2=SO3O2 + 2SO2 = 2SO3
O2-+H2O=OH-+O24O2- + 2H2O = 4OH- + 3O2
OH - + CrO4 2- + C2H4O2 = Cr 3- + CO2 + H2O -8OH- + 12CrO42- + 125C2H4O2 = 4Cr3- + 250CO2 + 246H2O
OH - + CrO4 2- + C2H4O2 = Cr 3- + CO2 + H2O -8OH- + 12CrO42- + 125C2H4O2 = 4Cr3- + 250CO2 + 246H2O
O2+CH4=CO2+H2O2O2 + CH4 = CO2 + 2H2O
O2+ H2SO4= H2O+ SO4O2 + 2H2SO4 = 2H2O + 2SO4
O2+C4H10=CO2+H2O13O2 + 2C4H10 = 8CO2 + 10H2O
O2+PCl3=POCl3O2 + 2PCl3 = 2POCl3
OH- + Br2 + VO2+ =VO3+ + Br- + H2O2OH- + Br2 + VO2+ = VO3+ + 2Br- + H2O
O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
O2+Mg=MgOO2 + 2Mg = 2MgO
O2 + H2O + e- = OH-O2 + 2H2O + 2e- = 4OH-
O2+H2= H2O O2 + 2H2 = 2H2O
O2+H2= H2O O2 + 2H2 = 2H2O
O3=2O22O3 = 3O2
O2+FeO=Fe3O4O2 + 6FeO = 2Fe3O4
O2+Zn=ZnOO2 + 2Zn = 2ZnO
O3=2O22O3 = 3O2
O3 = 2O22O3 = 3O2
OsO4+PtCl4=PtO2+OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 = 2(O2)O2 = (O2)
O2+C3H6=CO2+H2O9O2 + 2C3H6 = 6CO2 + 6H2O
O2+2H2=2H2OO2 + 2H2 = 2H2O
O2+C3H8= H2O+CO25O2 + C3H8 = 4H2O + 3CO2
O2(g)=O2(aq)O2(g) = O2(aq)
O2 + 2C6H14 = CO2 + H26O2 + C6H14 = 6CO2 + 7H2
O2 + N2O4 = NO20O2 + N2O4 = 2NO2
O2 + N2O4 = NO20O2 + N2O4 = 2NO2
O2 + Ni S =SO2+ Ni2O3 7O2 + 4NiS = 4SO2 + 2Ni2O3
O2(s)+ P2(s) +H2(g)= H2PO4(l)4O2(s) + P2(s) + 2H2(g) = 2H2PO4(l)
O2+H2+P2=H2PO44O2 + 2H2 + P2 = 2H2PO4
O2+P2+H2=H2PO44O2 + P2 + 2H2 = 2H2PO4
O2(s)+P2(s)+H2(g)=POH3(l)O2(s) + P2(s) + 3H2(g) = 2POH3(l)
O2 + CO = CO2O2 + 2CO = 2CO2
O2+CH4=2CO2+2H2O2 + CH4 = CO2 + 2H2
O2+CH4=2CO2+2H2O2 + CH4 = CO2 + 2H2
O2+Fe=Fe2O33O2 + 4Fe = 2Fe2O3
Os5(IO6)8+Re4(SiO4)7=Os(SiO4)2+Re5(IO6)77Os5(IO6)8 + 10Re4(SiO4)7 = 35Os(SiO4)2 + 8Re5(IO6)7
O2+Hg=HgOO2 + 2Hg = 2HgO
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
OCN- + OCl- + OH- = CO3-- + N2 + Cl- + H2O2OCN- + 3OCl- + 2OH- = 2CO3-- + N2 + 3Cl- + H2O
OH+3H=H2OOH + H = H2O
O+H=H2OO + 2H = H2O
O2 = O33O2 = 2O3
O2 + N2H4 = H2O2 + N22O2 + N2H4 = 2H2O2 + N2
OH- + V2+ + V(OH)4+ = 2VO2- + H20140OH- + 40V2+ + 10V(OH)4+ = 90VO2- + 9H20
O2+PH3= P2O5 + H25O2 + 4PH3 = 2P2O5 + 6H2
OH- + V++ + V(OH)4+ = VO++ + H2O-2OH- + V++ + 2V(OH)4+ = 3VO++ + 3H2O
O2+P4=P4O105O2 + P4 = P4O10
O2+P4=P4O105O2 + P4 = P4O10
O2+H=H2OO2 + 4H = 2H2O
O2+C4H10=CO2+H2O13O2 + 2C4H10 = 8CO2 + 10H2O
OsO4 + PtCl4 = PtO2 + OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 + C8H18 = CO2 + H2O25O2 + 2C8H18 = 16CO2 + 18H2O
O2+ CS2= CO2+ SO23O2 + CS2 = CO2 + 2SO2
OH-+H3O+=H2OOH- + H3O+ = 2H2O
O2 = O33O2 = 2O3
OsO4 + PtCl4 =PtO2 +OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
OsO4 + PtCl4 =PtO2 +OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 (g) + 2H2S (g) = SO2 (g) + 2 H2O (g) 3O2(g) + 2H2S(g) = 2SO2(g) + 2H2O(g)
O2+AlCl3=Al2O3+Cl23O2 + 4AlCl3 = 2Al2O3 + 6Cl2
O2(g) + H2O(l) + Mg(s) = Mg(OH)2(s)O2(g) + 2H2O(l) + 2Mg(s) = 2Mg(OH)2(s)
OH(aq) = O2(g) +H2OH(aq) = O2(g) + 2H
O2+2Cl2=2Cl2OO2 + 2Cl2 = 2Cl2O
O2 + H2SO3 = H2O2 + SO43O2 + 2H2SO3 = 2H2O2 + 2SO4
O2+NO=NO2O2 + 2NO = 2NO2
O2+NO=NO2O2 + 2NO = 2NO2
O2+Sb2S3=Sb2O4+SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2 + C 6H 14 = CO2 + H2O19O2 + 2C6H14 = 12CO2 + 14H2O
O2 + C5H12 = CO2 + H2O8O2 + C5H12 = 5CO2 + 6H2O
O2 + CH4 = CO2 + H2O2O2 + CH4 = CO2 + 2H2O
O2 + Sb2S2= Sb2O4 + SO24O2 + Sb2S2 = Sb2O4 + 2SO2
O2 + H2O + Fe = Fe(OH) 33O2 + 6H2O + 4Fe = 4Fe(OH)3
O2 = O33O2 = 2O3
O2 + S = SO33O2 + 2S = 2SO3
O2 + H2 = H2OO2 + 2H2 = 2H2O
O2+KCl=KClO33O2 + 2KCl = 2KClO3
O2+Fe3=Fe2O39O2 + 4Fe3 = 6Fe2O3
O2+N2=N2O55O2 + 2N2 = 2N2O5
O2+Fe=Fe2O33O2 + 4Fe = 2Fe2O3
O2 + Mn2+ + OH- + H2O = Mn(OH)35O2 + 4Mn2+ + 4OH- + 10H2O = 8Mn(OH)3
O2+C5H12O2= CO2+H2O7O2 + C5H12O2 = 5CO2 + 6H2O
O2 + C5H12 = CO2 + H2O 8O2 + C5H12 = 5CO2 + 6H2O
O2 + CH4 = CO2 + H2O 2O2 + CH4 = CO2 + 2H2O
O2 + CH4 = COH2 + H2O O2 + CH4 = COH2 + H2O
O2+H2S=H2O+SO23O2 + 2H2S = 2H2O + 2SO2
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O3=O22O3 = 3O2
O2 + C6H12O6 = H2O +CO26O2 + C6H12O6 = 6H2O + 6CO2
O+2H=2OHO + H = OH
O+H=2OHO + H = OH
O2 + C 2H 6 = CO2 + H2O7O2 + 2C2H6 = 4CO2 + 6H2O
O2+Sb2S3=Sb2SO4+SO3O2 + Sb2S3 = Sb2SO4 + 2SO
OF2(g) = O2 + F2(g)2OF2(g) = O2 + 2F2(g)
OF2(g) = O2 + F2(g)2OF2(g) = O2 + 2F2(g)
OF2(g) = O2 + F2(g)2OF2(g) = O2 + 2F2(g)
O2+ SO2+H2O=H2SO4O2 + 2SO2 + 2H2O = 2H2SO4
OPCl3+H2O = PCl3 +H3O-1OPCl3 + 3H2O = -1PCl3 + 2H3O
OH + HS = S + H2OOH + HS = S + H2O
O2 + 4Mn2- + 8OH- + 2H2O = 4Mn(OH)37O2 + 4Mn2- - 4OH- + 14H2O = 8Mn(OH)3
O2 +Fe = Fe2 O33O2 + 4Fe = 2Fe2O3
O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
O2+C6H14=CO2+H2O19O2 + 2C6H14 = 12CO2 + 14H2O
OsO4 + PtCl4 = PtO2 + OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
OsO4 + PtCl4 = PtO2 + OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2S2 + 2H2 = H2S + H2O2O2S2 + 3H2 = 2H2S + H2O2
O2 + Li2CO3 + MnCO3 = LiMn2O4 +CO23O2 + 2Li2CO3 + 8MnCO3 = 4LiMn2O4 + 10CO2
O2+ Li2CO3+ MnCO3 = LiMn24+CO2-49O2 + 2Li2CO3 + 96MnCO3 = 4LiMn24 + 98CO2
OsO4 + 8H+ = Os + 4H2O + 8e--1OsO4 - 8H+ = -1Os - 4H2O + 4e-
Os(s) + 2O2(g)= OsO4(g)Os(s) + 2O2(g) = OsO4(g)
O2+ Sb2S3 =Sb2O4+ SO48O2 + Sb2S3 = Sb2O4 + 3SO4
O2 + Sb2S3 = Sb2O4 + SO25O2 + Sb2S3 = Sb2O4 + 3SO2
OF2 + H2O = O2 + HFOF2 + H2O = O2 + 2HF
OF2 + H20 = O2 + HF10OF2 + H20 = 5O2 + 20HF
O2+ H2O + SO2 =H4SO40O2 + 2H2O + SO2 = H4SO4
O2+C4H10=CO2+H2O13O2 + 2C4H10 = 8CO2 + 10H2O
O2 + C 2H 6 = CO2 + H2O7O2 + 2C2H6 = 4CO2 + 6H2O
O2(g)+CS2(s)= CO2(g)+SO2(g)3O2(g) + CS2(s) = CO2(g) + 2SO2(g)
OH- + NO2 + Co2+ = NO3- + Co + H2O2OH- + NO2 + Co2+ = NO3- + 2Co + H2O
O2=O2O2 = O2
OH-+Mg+VO42-=Mg2++V2+H2O168OH- - 332Mg - 2VO42- = -166Mg2+ - V2 + 84H2O
O2 +H2O+Pb=Pb(OH)2O2 + 2H2O + 2Pb = 2Pb(OH)2
O2 +H2O+Pb=Pb(OH)2O2 + 2H2O + 2Pb = 2Pb(OH)2
O2 + C6H12O6 = H2O =CO26O2 + C6H12O6 = 6H2O + 6CO2
O2 + CO = CO2O2 + 2CO = 2CO2
O2 + CO = CO2O2 + 2CO = 2CO2
O2 + 4H+ + 2Br- = 2H2O + Br2 O2 + 4H+ + 4Br- = 2H2O + 2Br2
O2 + 4H+ + 2Br- = 2H2O + Br2 + 3O2 + 12H+ + 8Br- = 6H2O + 4Br2+
O2 + 4H+ + Cu+ = Cu2+ + 2H2OO2 + 4H+ - 8Cu+ = -4Cu2+ + 2H2O
O10P4 +H2O=H3PO4O10P4 + 6H2O = 4H3PO4
O2+S=SO33O2 + 2S = 2SO3
OH + H2O = H3O-1OH + 2H2O = H3O
OH + H2O = H3O-1OH + 2H2O = H3O
O2+S=SO33O2 + 2S = 2SO3
O2+Fe=Fe2O33O2 + 4Fe = 2Fe2O3
O2+F2=F2O33O2 + 2F2 = 2F2O3
O2+CH4 = CO2+H2O2O2 + CH4 = CO2 + 2H2O
O2+N2=NO22O2 + N2 = 2NO2
O2 = O33O2 = 2O3
O2 + e- = O77O2 + 0e- = 2O7
O+CH4=OH+CH3O + CH4 = OH + CH3
O2+NO=NO2O2 + 2NO = 2NO2
O2+S=SO33O2 + 2S = 2SO3
O2+HClO + Mg(OH)2 = Mg(ClO4)2 + H2O3O2 + 2HClO + Mg(OH)2 = Mg(ClO4)2 + 2H2O
O2+PCl3=POCl3O2 + 2PCl3 = 2POCl3
O2+4H++2Zn=2H2O+2Zn2+O2 + 4H+ + 8Zn = 2H2O + 4Zn2+
OH+Ag=AgOHOH + Ag = AgOH
O2 +Sb2S3 = Sb2O4 + SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2 + 2 H2 = 2 H2OO2 + 2H2 = 2H2O
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
OF2 + H2O = O2 + HFOF2 + H2O = O2 + 2HF
O5646=O345335345335O5646 = 5646O345335
O2+C2H5OH=CO2+H2O3O2 + C2H5OH = 2CO2 + 3H2O
O2+NO=NO2O2 + 2NO = 2NO2
O2+NO=NO2O2 + 2NO = 2NO2
O2 + C5H12 = CO2 + H2O8O2 + C5H12 = 5CO2 + 6H2O
O2+C6H14=C2H4+H2OO2 + 2C6H14 = 6C2H4 + 2H2O
O2+C6H14=C2H4+H2OO2 + 2C6H14 = 6C2H4 + 2H2O
O2+CH4=CO2+H2O2O2 + CH4 = CO2 + 2H2O
O2+Al=Al2O33O2 + 4Al = 2Al2O3
OF2+H2O=O2+HFOF2 + H2O = O2 + 2HF
OF2+H2O=O2+HFOF2 + H2O = O2 + 2HF
O2- + H2O = OH- + H3O+0O2- + 2H2O = OH- + H3O+
O2- + H2O = OH- + H3O+0O2- + 2H2O = OH- + H3O+
O2- + H2O = OH- + H3O+0O2- + 2H2O = OH- + H3O+
O2- + H2O = 3OH- + H3O+0O2- + 2H2O = OH- + H3O+
O2+KCI=KCIO33O2 + 2KCI = 2KCIO3
O2+H2S=H2O+SO23O2 + 2H2S = 2H2O + 2SO2
ONaClO + NaI + H2SO4= I2 + NaCl+Na2SO4 + H2OONaClO + 4NaI + 2H2SO4 = 2I2 + NaCl + 2Na2SO4 + 2H2O
O2+N2=NOO2 + N2 = 2NO
OH+ CO2+ H2O = HCO3OH + CO2 + 0H2O = HCO3
O2+F2=OF2O2 + 2F2 = 2OF2
OH+Zn+NO3=ZnO2+NH33OH + 3Zn + NO3 = 3ZnO2 + NH3
OH+Zn+NO3=ZnO2+NH33OH + 3Zn + NO3 = 3ZnO2 + NH3
O2 + C3H8 = H2O + CO25O2 + C3H8 = 4H2O + 3CO2
O2+C6H14=CO2+H2060O2 + 10C6H14 = 60CO2 + 7H20
OF2 +SO2 = SO3 + F2OF2 + SO2 = SO3 + F2
OH- + H2 + Br2 = H2O + Br-2OH- + H2 + Br2 = 2H2O + 2Br-
OsO4+PtCl4=PtO2+OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 + S8 = SO312O2 + S8 = 8SO3
O2 = O33O2 = 2O3
O2 + CS = CO + SO23O2 + 2CS = 2CO + 2SO2
O2 + C 10H 22 = CO2 + H2O31O2 + 2C10H22 = 20CO2 + 22H2O
O + H = H2OO + 2H = H2O
O + H = H2OO + 2H = H2O
OsO4 + PtCl4 = PtO2 + OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 + CS2 = CO2 +SO23O2 + CS2 = CO2 + 2SO2
O2 + CO = CO2O2 + 2CO = 2CO2
O2 + Fe = Fe2O33O2 + 4Fe = 2Fe2O3
O2+H2=H2OO2 + 2H2 = 2H2O
OCl- + S2O3- - + OH- = SO4- - + Cl- + H2O4OCl- + S2O3-- + 2OH- = 2SO4-- + 4Cl- + H2O
O2+H2=H2OO2 + 2H2 = 2H2O
O2=O33O2 = 2O3
O2+ Sb2S3=Sb2O4+ SO25O2 + Sb2S3 = Sb2O4 + 3SO2
OH- + Co++ + O2 = Co(OH)3 + H2O-8OH- - 4Co++ - O2 = -4Co(OH)3 + 2H2O
O2+CH4=CO2+H2O2O2 + CH4 = CO2 + 2H2O
O2 + C5H12O2 = CO2 + H2O7O2 + C5H12O2 = 5CO2 + 6H2O
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O + H2 = H2OO + H2 = H2O
O2 + H = H2OO2 + 4H = 2H2O
O2+C5H12=CO2+H2O8O2 + C5H12 = 5CO2 + 6H2O
O2(g) + C5H12(g) = CO2(g) + H2O(g)8O2(g) + C5H12(g) = 5CO2(g) + 6H2O(g)
O2 + C5H12 = CO2 + H2O8O2 + C5H12 = 5CO2 + 6H2O
O2 P4+O2+H2O=H3PO4O2P4 + 4O2 + 6H2O = 4H3PO4
O2+2Fe2++OH-=2FeO(OH)+H2O-5O2 - 4Fe2+ - 4OH- = -8FeO(OH) + 2H2O
O+Au=Au2O33O + 2Au = Au2O3
O2(g) + C5H12(g) = CO2(g) + H2O(g)8O2(g) + C5H12(g) = 5CO2(g) + 6H2O(g)
O2(g) + C5H12(g) = CO2(g) + H2O(g)8O2(g) + C5H12(g) = 5CO2(g) + 6H2O(g)
O2+NO=4NO0O2 + NO = NO
O2+NO=NO0O2 + NO = NO
O2+8NO=NO2O2 + 2NO = 2NO2
O2 =O33O2 = 2O3
O2 + N2 + H2 + C2 =H2NCH2COOH2O2 + N2 + 5H2 + 2C2 = 2H2NCH2COOH
O2 + Cl2 = Cl2OO2 + 2Cl2 = 2Cl2O
O2 + Cl2 = Cl2OO2 + 2Cl2 = 2Cl2O
O2+C6H12O6=H2O+CO26O2 + C6H12O6 = 6H2O + 6CO2
O2+C5H12O2=H2O+CO27O2 + C5H12O2 = 6H2O + 5CO2
O2=6O2O2 = O2
O2 + H2 = H2OO2 + 2H2 = 2H2O
O2+CS2=CO+SO25O2 + 2CS2 = 2CO + 4SO2
O2+ CS2= CO2 + SO23O2 + CS2 = CO2 + 2SO2
O2 + CH4 = CO2 + H2O 2O2 + CH4 = CO2 + 2H2O
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O2+ CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O2 + Ag + H2S = Ag2S + H2OO2 + 4Ag + 2H2S = 2Ag2S + 2H2O
O2 + CS2 = CO2 + SO2 3O2 + CS2 = CO2 + 2SO2
O2 + F2 = OF2O2 + 2F2 = 2OF2
OsO4+PtCl4=PtO2+OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O+C=CO22O + C = CO2
O2+H2+S8=H2SO416O2 + 8H2 + S8 = 8H2SO4
O2+H2= 2H2OO2 + 2H2 = 2H2O
O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
O2+NH3=NO+H2O5O2 + 4NH3 = 4NO + 6H2O
O2+NO= NO2O2 + 2NO = 2NO2
O2 + PCl3 = POCl3O2 + 2PCl3 = 2POCl3
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O2 + Zn + H = Zn2+ + H2OO2 + 0Zn + 4H = 0Zn2+ + 2H2O
O2+C6H2=CO2+H2O13O2 + 2C6H2 = 12CO2 + 2H2O
OsO4+KNH2=KOsO3N+H2OOsO4 + KNH2 = KOsO3N + H2O
O2+C3H8=CO2+H2O5O2 + C3H8 = 3CO2 + 4H2O
O2 + SO2 = SO3O2 + 2SO2 = 2SO3
O2(g)+ SO2(g)=SO3(g)O2(g) + 2SO2(g) = 2SO3(g)
OsO4 + PtCl4 = PtO2 + OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O+C2H6=CO2+H2O7O + C2H6 = 2CO2 + 3H2O
O2+C8H18=CO+H2O17O2 + 2C8H18 = 16CO + 18H2O
O2+C8H12=CO+H2O7O2 + C8H12 = 8CO + 6H2O
OC7H16+O2=CO2+H2O2OC7H16 + 21O2 = 14CO2 + 16H2O
O2+ClO2=Cl2O5O2 + 4ClO2 = 2Cl2O5
OH(aq) + H(aq) = 2H2O(l)OH(aq) + H(aq) = H2O(l)
OH(aq) + H(aq) = H2O(l)OH(aq) + H(aq) = H2O(l)
O2+2H2=2H4OO2 + 4H2 = 2H4O
O2 + H2O = H2O2O2 + 2H2O = 2H2O2
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O2+CS2=CO2+SO23O2 + CS2 = CO2 + 2SO2
O2 + Cl2 = Cl2OO2 + 2Cl2 = 2Cl2O
OsO4+PtCl4=PtO2+OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
OF2 = O + FOF2 = O + 2F
O3=O22O3 = 3O2
O2+H2=H2OO2 + 2H2 = 2H2O
O2 + H2 = H2OO2 + 2H2 = 2H2O
O2+N2=NO22O2 + N2 = 2NO2
OH-+Sn4++Cr2O72-=CrO4-+Sn2++H2O128OH- - 129Sn4+ - Cr2O72- = -2CrO4- - 258Sn2+ + 64H2O
O2 +CH4 = CO2 + H2O2O2 + CH4 = CO2 + 2H2O
O2 +CH = CO2 + H2O5O2 + 4CH = 4CO2 + 2H2O
O2 +C2H6 = CO2 + H2O7O2 + 2C2H6 = 4CO2 + 6H2O
O2+H2=H2OO2 + 2H2 = 2H2O
OsO4 + PtCl4 = PtO2 + OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 + Cl2 = Cl2OO2 + 2Cl2 = 2Cl2O
O2+ Sb2S3 = Sb2O4 + SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2 = O33O2 = 2O3
O2 + Sb2S3 = Sb2O4 +SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2+N2=N2O42O2 + N2 = N2O4
O2+Sb2S3=Sb2O4+SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O3 = O22O3 = 3O2
O2 + Sb2S3 = Sb2O4 + SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2=O2O2 = O2
O2 + C4H9NH2 = CO2+H2O+N227O2 + 4C4H9NH2 = 16CO2 + 22H2O + 2N2
OsO4+PtCl4=PtO2+OsCl8OsO4 + 2PtCl4 = 2PtO2 + OsCl8
O2 + Sb2S3 = Sb2O4 + SO25O2 + Sb2S3 = Sb2O4 + 3SO2
O2 + NO = NO2O2 + 2NO = 2NO2
O+I2=IO2O + I2 = 2IO
O3 = O22O3 = 3O2
O2 = O2O2 = O2
O3+C2H2=CHOCHOOO3 + C2H2 = CHOCHOO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.