Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaCl (aq) + AgC2H3O2 (aq) =NaC2H3O2 (aq) + AgCl (s)NaCl(aq) + AgC2H3O2(aq) = NaC2H3O2(aq) + AgCl(s)
NaCl (aq) + AgC2H3O2 (aq) =NaC2H3O2 (aq) + AgCl (s)NaCl(aq) + AgC2H3O2(aq) = NaC2H3O2(aq) + AgCl(s)
N2 + O2 = N2O2N2 + O2 = 2N2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Ni + HNO3 = Ni(NO3)2 + NO + H2O3Ni + 8HNO3 = 3Ni(NO3)2 + 2NO + 4H2O
Na + ZnI2 = NaI + NaZn49Na + 4ZnI2 = 8NaI + NaZn4
NH4Cl=NH3+HClNH4Cl = NH3 + HCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+HNO3=NaNO3+H2O+N2O8Na + 10HNO3 = 8NaNO3 + 5H2O + N2O
NaCl+H2O=Cl2+NaOH+H22NaCl + 2H2O = Cl2 + 2NaOH + H2
Na+HNO3=NaNO3+H2O+NH4NO38Na + 10HNO3 = 8NaNO3 + 3H2O + NH4NO3
Ni + AlCl3 = NiCl3 + AlNi + AlCl3 = NiCl3 + Al
Ni + AgNO3 = Ag + Ni(NO3)2Ni + 2AgNO3 = 2Ag + Ni(NO3)2
Ni + CuCl2 = NiCl2 + CuNi + CuCl2 = NiCl2 + Cu
NO3 - Al + H20 + OH = NH3 + Al(OH)4-10NO3-Al + 3H20 + 10OH = 10NH3 + 10Al(OH)4-
NO3 - Al + H20 + OH = Al(OH)4- + NH310NO3-Al + 3H20 + 10OH = 10Al(OH)4- + 10NH3
NO3 + OH + H20 - Al = Al(OH)4- + NH310NO3 - 18OH + 3H20-Al = 3Al(OH)4- + 10NH3
NO3 + OH - Al + H2O = Al(OH)4- + NH3NO3 + 3OH-Al + 6H2O = 3Al(OH)4- + NH3
NaHCO3 + NaOH = Na2CO3 + H2ONaHCO3 + NaOH = Na2CO3 + H2O
NaOH + Al + NaNO2 = NaAlO2 + NH3 + H2O-1NaOH - 2Al - NaNO2 = -2NaAlO2 - NH3 + H2O
NaHCO3= Na2O +H2O + CO22NaHCO3 = Na2O + H2O + 2CO2
NaHCO3= Na2C2O4 + H2O+ O24NaHCO3 = 2Na2C2O4 + 2H2O + O2
NaCl + H3PO4 + P2O5 = HCl + NaHPO4 + POCl30NaCl - H3PO4 + P2O5 = -3HCl + 0NaHPO4 + POCl3
NaCl + H3PO4 + P2O5 = HCl + NaHPO4 + HPO30NaCl + H3PO4 + P2O5 = 0HCl + 0NaHPO4 + 3HPO3
N2 +H2 = NH3N2 + 3H2 = 2NH3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH3(aq)+CO2(aq)+H2O=NH4HCO3(aq)NH3(aq) + CO2(aq) + H2O = NH4HCO3(aq)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + MnO2 + H2SO4 = MnSO4 + Na2SO4 + Cl2 + H2O2NaCl + MnO2 + 2H2SO4 = MnSO4 + Na2SO4 + Cl2 + 2H2O
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na+O2+H2O=NaOH4Na + O2 + 2H2O = 4NaOH
Na+O2+H2O=NaOH4Na + O2 + 2H2O = 4NaOH
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na+H2O=NaOH+H2 2Na + 2H2O = 2NaOH + H2
Na2CO3+HCL=NaCL+H2O+CO2Na2CO3 + 2HCL = 2NaCL + H2O + CO2
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaOH + HOAc = NaAc + HOHONaOH + HOAc = NaAc + HOHO
Na+O2=Na2O4Na + O2 = 2Na2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO2 + NaOH + Al + H2O = NaAlO2 + NH3NaNO2 + NaOH + 2Al + H2O = 2NaAlO2 + NH3
Na +O2=NaO4Na + 2O2 = NaO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H2(g)2Na + 2H2O = 2NaOH + H2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NaNO3+PbO=Pb (NO3) 2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NH3 + CO2 = (NH2)2CO + H2O2NH3 + CO2 = (NH2)2CO + H2O
NO2 + H2O + O2 = HNO34NO2 + 2H2O + O2 = 4HNO3
NaOH + HClO4 = NaClO4 + H2ONaOH + HClO4 = NaClO4 + H2O
NaOH + HClO4 = NaClO4 + H2ONaOH + HClO4 = NaClO4 + H2O
NO+H2=NH3+H2O2NO + 5H2 = 2NH3 + 2H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NH4NO3 = N2 + O2 + H2010NH4NO3 = 10N2 + 15O2 + 2H20
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
NO+O2=NO22NO + O2 = 2NO2
N2H4(g) + N2O4(g) = N2(g) + H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaCl(l)+AgNO3(aq)=NaNO3(aq)+AgCl(s)NaCl(l) + AgNO3(aq) = NaNO3(aq) + AgCl(s)
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
NaHCO3=Na2O+H2O+CO22NaHCO3 = Na2O + H2O + 2CO2
N2+H2= N H3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
Ni+HBr=NiBr3+H22Ni + 6HBr = 2NiBr3 + 3H2
Ni+HBrO4=Ni(BrO4)3+H22Ni + 6HBrO4 = 2Ni(BrO4)3 + 3H2
NaCO3 + HNO3 = NaNO3 +HCO3NaCO3 + HNO3 = NaNO3 + HCO3
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
Na2S2O3 + H2O2 = Na2SO4 + H2SO4 + H2O Na2S2O3 + 4H2O2 = Na2SO4 + H2SO4 + 3H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3+H2O=(NH2)3+(OH3)26NH3 + 6H2O = 2(NH2)3 + 3(OH3)2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NaN3 = Na + N22NaN3 = 2Na + 3N2
NaCl + H2O = Cl2 + H2 + NaOH2NaCl + 2H2O = Cl2 + H2 + 2NaOH
NH4NO3 + Ca(OH)2 = Ca(NO3)2 + NH3 + H2O2NH4NO3 + Ca(OH)2 = Ca(NO3)2 + 2NH3 + 2H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na+O2=Na2O4Na + O2 = 2Na2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaNO3+CH3COOH+Zn =Zn(CH3COO)2+H2O+NaNO2NaNO3 + 2CH3COOH + Zn = Zn(CH3COO)2 + H2O + NaNO2
NO + K2Cr2O7 + H2SO4 = KNO3 + Cr2(SO4)3 + K2SO4 + H2O2NO + K2Cr2O7 + 3H2SO4 = 2KNO3 + Cr2(SO4)3 + 0K2SO4 + 3H2O
Na + H2O=Na OH + H22Na + 2H2O = 2NaOH + H2
N2+2H2=3NH3N2 + 3H2 = 2NH3
Na2SO4+CaCl2=2CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NaCO3 + HCl = NaCl + CO3 + H22NaCO3 + 2HCl = 2NaCl + 2CO3 + H2
NaOH + Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NaOH + Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NaOH + Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
Na + H2O = NaOH+ H22Na + 2H2O = 2NaOH + H2
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaOCl + 2KI + 3H2SO4 =2I2 + 2H2O +2HCl +Na2SO4 +2K2SO42NaOCl + 4KI + 3H2SO4 = 2I2 + 2H2O + 2HCl + Na2SO4 + 2K2SO4
NiCl2 + Li2S = LiCl + NiSNiCl2 + Li2S = 2LiCl + NiS
NO 2 (g)+H 2 O(l)=HNO 3 (aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2HPO4(aq)+H2CO3(Aq)=NaH2PO4(aq)+NaHCO3(aq)Na2HPO4(aq) + H2CO3(Aq) = NaH2PO4(aq) + NaHCO3(aq)
NaBr + AgNO3 = AgBr + NaNO3NaBr + AgNO3 = AgBr + NaNO3
NaBr + AgNO3 = AgBr + NaNO3NaBr + AgNO3 = AgBr + NaNO3
Na2CO3+C2H4O2=NaC2H3O2+CO2+H2ONa2CO3 + 2C2H4O2 = 2NaC2H3O2 + CO2 + H2O
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NH4SCN + Zn(NO3)2 = Zn(SCN)2 + NH4(NO3)2NH4SCN + Zn(NO3)2 = Zn(SCN)2 + 2NH4(NO3)
Na+O2=Na2O4Na + O2 = 2Na2O
NO2 + MnO4- + H2O = NO3- + Mn++ + H+5NO2 + MnO4- + H2O = 5NO3- + Mn++ + 2H+
Na+O=Na2O2Na + O = Na2O
NaHCO3+HCl=NaCl+HCO3HNaHCO3 + HCl = NaCl + HCO3H
NaHCO3+CaCl2=NaCl2+HCO3CaNaHCO3 + CaCl2 = NaCl2 + HCO3Ca
Ni (ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
Na+Pb(NO3)2=NaNO3+Pb2Na + Pb(NO3)2 = 2NaNO3 + Pb
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CrO2 + H2O2 = Na2CrO4 + H2ONa2CrO2 + 2H2O2 = Na2CrO4 + 2H2O
Na2CrO2 + H2O2 = Na2CrO6 + H2ONa2CrO2 + 4H2O2 = Na2CrO6 + 4H2O
N+O2=N2O54N + 5O2 = 2N2O5
NO2+NaOH=NaNO3+NaNO2+H2O2NO2 + 2NaOH = NaNO3 + NaNO2 + H2O
NH4NO2 = N2 +H2ONH4NO2 = N2 + 2H2O
NH4NO2 = N2 +H2ONH4NO2 = N2 + 2H2O
NH4NO2 = N2 +H2ONH4NO2 = N2 + 2H2O
NH4NO3 = N2 +O2 +H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2 + H2O = NaOH + H2Na2 + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2S + Na2CO3 + SO4 = Na2S2O3 + CO2-6Na2S + Na2CO3 - 4SO4 = -5Na2S2O3 + CO2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NO2+NO3=N2O5NO2 + NO3 = N2O5
NO2+N2O3=N2O54NO2 - N2O3 = N2O5
NaOH=Na2O+H2O2NaOH = Na2O + H2O
N2O3+NO2=N2O5-1N2O3 + 4NO2 = N2O5
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO = N2O + NO23NO = N2O + NO2
Na2SO3 + S8 = Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NO + O2=NO22NO + O2 = 2NO2
NH3 + F2 = NH4F + NF34NH3 + 3F2 = 3NH4F + NF3
Na+I2=NaI 2Na + I2 = 2NaI
NaHCO3 + HC2H3O2 = C2H3NaO2 + CO2 + H2ONaHCO3 + HC2H3O2 = C2H3NaO2 + CO2 + H2O
NaHCO3 + C6H8O7 =3 CO2 + 3 H2O + Na3C6H5O7 3NaHCO3 + C6H8O7 = 3CO2 + 3H2O + Na3C6H5O7
NaHCO3 + C6H8O7 =3 CO2 + 3 H2O + Na3C6H5O7 3NaHCO3 + C6H8O7 = 3CO2 + 3H2O + Na3C6H5O7
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCO3+Mg(NO3)=MgCO3+NaNO3NaCO3 + Mg(NO3) = MgCO3 + NaNO3
NaCl + Ca = CaCl + NaNaCl + Ca = CaCl + Na
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+O2=Na2O22Na + O2 = Na2O2
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NaCl + H2O = NaOH + H2 + Cl22NaCl + 2H2O = 2NaOH + H2 + Cl2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2CO3 + H3PO4= Na3PO4 + CO2 + H2O3Na2CO3 + 2H3PO4 = 2Na3PO4 + 3CO2 + 3H2O
Na2SO4 + C= Na2S + CONa2SO4 + 4C = Na2S + 4CO
NaOH+HBr=NaBr+H2ONaOH + HBr = NaBr + H2O
NaCl + H2SO4 = HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
NaCl+MnO2+H2SO4=Na2SO4+MnSO4+H2O+Cl22NaCl + MnO2 + 2H2SO4 = Na2SO4 + MnSO4 + 2H2O + Cl2
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
NH3+Cl2=N2+HCl2NH3 + 3Cl2 = N2 + 6HCl
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2SO3 + S8 = Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaIO3 + SO2+ H2O = Na2SO4 + I2+ H2SO42NaIO3 + 5SO2 + 4H2O = Na2SO4 + I2 + 4H2SO4
NaOH(aq)+Al(NO3)3=Al(OH)3(s)+NaNO3(aq)3NaOH(aq) + Al(NO3)3 = Al(OH)3(s) + 3NaNO3(aq)
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O = Na2O2Na + O = Na2O
Na + O = Na2O2Na + O = Na2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na+O2=Na2O4Na + O2 = 2Na2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3+NaOH=NaNO3+NH3+H2ONH4NO3 + NaOH = NaNO3 + NH3 + H2O
N2+O2=2NO2N2 + 2O2 = 2NO2
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na + I2 = NaI2Na + I2 = 2NaI
Na2CO3+BaCl2=BaCO3+NaClNa2CO3 + BaCl2 = BaCO3 + 2NaCl
NaCl = Na + Cl22NaCl = 2Na + Cl2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
Na3PO4 + AgNO3 = Na3NO3 + AgPO4Na3PO4 + AgNO3 = Na3NO3 + AgPO4
NaOH+Cl2=NaCl+NaClO+H2O2NaOH + Cl2 = NaCl + NaClO + H2O
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaOH + AgNO3 = NaNO3 + AgOHNaOH + AgNO3 = NaNO3 + AgOH
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl=Na+Cl22NaCl = 2Na + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
Na + MgCl2= NaCl+ Mg2Na + MgCl2 = 2NaCl + Mg
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
N2+H2=2NH3N2 + 3H2 = 2NH3
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NO + O2 = NO22NO + O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
N2+O2=N2O52N2 + 5O2 = 2N2O5
NI3(s)=N2(g)+I2(g)2NI3(s) = N2(g) + 3I2(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+HCl=NaCl+H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
Na3PO4+MgCl2=Mg3(PO4)2+NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2+H2=NH2N2 + 2H2 = 2NH2
N2H4 + 2H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
NH4NO3 = N2 + 4H2O + O22NH4NO3 = 2N2 + 4H2O + O2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaCl + H2SO4 = HCl + NaHSO4NaCl + H2SO4 = HCl + NaHSO4
NH4Cl+BaO2H2=BaCl2+NH3+H2O2NH4Cl + BaO2H2 = BaCl2 + 2NH3 + 2H2O
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH = Na2O + H2O2NaOH = Na2O + H2O
NH4NO2+H2O=NH4OH+HNO2NH4NO2 + H2O = NH4OH + HNO2
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
Na2(O)2 +H2O=NaOH+ONa2(O)2 + H2O = 2NaOH + O
NaBr+HNO3=Br2+NO+NaNO3+H2O6NaBr + 8HNO3 = 3Br2 + 2NO + 6NaNO3 + 4H2O
N2O3 + H2O = HNO2N2O3 + H2O = 2HNO2
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
N2H4 = NH3 + N23N2H4 = 4NH3 + N2
NaOH+Cl2=NaCl+NaClO3+H2O6NaOH + 3Cl2 = 5NaCl + NaClO3 + 3H2O
NaCl + Al2(SO4)3=AlCl3+Na2SO46NaCl + Al2(SO4)3 = 2AlCl3 + 3Na2SO4
NaOH+H2(SO4)=Na2(SO4)+H2O2NaOH + H2(SO4) = Na2(SO4) + 2H2O
NaOH+S=Na2S+Na2S2O3+H2O6NaOH + 4S = 2Na2S + Na2S2O3 + 3H2O
NaHCO3+HCl=NaCl+CO2+H2ONaHCO3 + HCl = NaCl + CO2 + H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+Al(NO3)3=NaNO3+Al(OH)33NaOH + Al(NO3)3 = 3NaNO3 + Al(OH)3
Na3PO4+AgNO3=NaNO3+Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
Na + O2 = NaO2Na + O2 = 2NaO
Na+O2=Na2O4Na + O2 = 2Na2O
Ni(ClO3)3=NiCl3+O22Ni(ClO3)3 = 2NiCl3 + 9O2
NH3+O2=HNO3+H22NH3 + 3O2 = 2HNO3 + 2H2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NH4OH+HC2H3O2=NH4C2H3O2+H2ONH4OH + HC2H3O2 = NH4C2H3O2 + H2O
N2H4(l) =NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na3PO4 + Ba(NO3)2 = BaPO4 + Na3(NO3)2Na3PO4 + Ba(NO3)2 = BaPO4 + Na3(NO3)2
NaOH+AlCl3=NaCl+Al(OH)33NaOH + AlCl3 = 3NaCl + Al(OH)3
NiF2(aq) + Fe2(SO4)3(aq) = NiSO4(aq) + FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NA+H2O=NAOH+H22NA + 2H2O = 2NAOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
N2+H2=NH2N2 + 2H2 = 2NH2
NH3(g) + O2(g) = N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH3(g) + HCl(g) = NH4Cl(g)NH3(g) + HCl(g) = NH4Cl(g)
N2(g) + O2(g) = N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
Na2SO3+S8= Na2S2O38Na2SO3 + S8 = 8Na2S2O3
N2 + H2O = (NH4)(NO2)N2 + 2H2O = (NH4)(NO2)
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO + O2 = NO22NO + O2 = 2NO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
Na+ MgF2=NaF+ Mg2Na + MgF2 = 2NaF + Mg
Na+H3PO4=Na3PO4+H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NH4OH + HC2H3O2 = NH4C2H3O2 + H2ONH4OH + HC2H3O2 = NH4C2H3O2 + H2O
NaIO2 + H2O + SO2 = Na2SO4 + H2SO4 + I22NaIO2 + 2H2O + 3SO2 = Na2SO4 + 2H2SO4 + I2
Na + NaNO3 = Na2O + N2 10Na + 2NaNO3 = 6Na2O + N2
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NO+ClO=Cl+NO3NO + 2ClO = 2Cl + NO3
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NaCr2O7+HCl = NaCl+CrCl3+H2O+Cl22NaCr2O7 + 28HCl = 2NaCl + 4CrCl3 + 14H2O + 7Cl2
NaCr2O7+HCl = NaCl+CrCl3+H2O+Cl22NaCr2O7 + 28HCl = 2NaCl + 4CrCl3 + 14H2O + 7Cl2
Na+H2O=NaOH+HNa + H2O = NaOH + H
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2Cr2O7+HCl = NaCl+CrCl3+H2O+Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
NaCIO3+H2SO4+SO2=NaHSO4+CIO22NaCIO3 + H2SO4 + SO2 = 2NaHSO4 + 2CIO2
Na+I2=NaI2Na + I2 = 2NaI
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+O2=N2O4N2 + 2O2 = N2O4
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
N2O5=NO2+O22N2O5 = 4NO2 + O2
Na2CO3+HCl= HCO3+Na2ClNa2CO3 + HCl = HCO3 + Na2Cl
N2O4=NO2N2O4 = 2NO2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH4Cl(s)=NH3(g)+HCl(g)NH4Cl(s) = NH3(g) + HCl(g)
N2(g)+Mg(s)=Mg3N2(s)N2(g) + 3Mg(s) = Mg3N2(s)
N2(g)+CaC2(s)=C(s)+CaNCN(s)N2(g) + CaC2(s) = C(s) + CaNCN(s)
NH3 + Cl2 = NH4Cl + N28NH3 + 3Cl2 = 6NH4Cl + N2
NO2(g)=NO(g)+O2(g)2NO2(g) = 2NO(g) + O2(g)
NO3- + Al + OH- + H2O = NH3 + Al(OH)4NO3- + 2Al - OH- + 6H2O = NH3 + 2Al(OH)4
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO + O2= NO22NO + O2 = 2NO2
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NO2+H20=NO3+OH-20NO2 + H20 = -20NO3 + 20OH
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH3+CO=CH4+N2+O28NH3 + 6CO = 6CH4 + 4N2 + 3O2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NiCl2*6H2O+6NH4OH=Ni(NH3)4Cl2+12H2ONiCl2*6H2O + 4NH4OH = Ni(NH3)4Cl2 + 10H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na + S = NaSNa + S = NaS
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
NH4+H2O=H3O+NH3NH4 + H2O = H3O + NH3
NaOH=Na+OHNaOH = Na + OH
NH3+H2O=NH4+OHNH3 + H2O = NH4 + OH
Na(OH) + H2(CO3) = Na2(CO3) + H(OH)2Na(OH) + H2(CO3) = Na2(CO3) + 2H(OH)
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
Na + O2 = Na2O4Na + O2 = 2Na2O
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NaHCO3 +HC2H3O2 = NaC2H3O2 + H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NO3- + Al + OH- + H2O = NH3 + Al(OH)4-3NO3- + 8Al + 5OH- + 18H2O = 3NH3 + 8Al(OH)4-
Na2CO3 + CaCl2 = NaCl + CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
NO3- + Al + OH- + H2O = NH3 + Al(OH)-4-3NO3- + 8Al + 35OH- - 18H2O = -3NH3 + 8Al(OH)-4
Na2S+Cl2=NaCl+S66Na2S + 6Cl2 = 12NaCl + S6
NaHCO3+HC2H3O2=NaC2H3O2+H2O+CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NaHCO3+HC2H3O2=NaC2H3O2+H2O+O22NaHCO3 + HC2H3O2 = 2NaC2H3O2 + 0H2O + 2O2
NaHCO3+HC2H3O2=NaC2H3O2+H2O+O22NaHCO3 + HC2H3O2 = 2NaC2H3O2 + 0H2O + 2O2
Na2CO3+CaCl2=NaCl+CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2+O2+H2O=4HNO32N2 + 5O2 + 2H2O = 4HNO3
NO3- + Al + OH- + H2O = NH3 + Al(OH-)40NO3- + Al + 4OH- + 0H2O = 0NH3 + Al(OH-)4
N2 + O2 +H2O = 4HNO3 2N2 + 5O2 + 2H2O = 4HNO3
NO3- + Al + OH- + H2O = NH3 + Al(OH)-4-3NO3- + 8Al + 35OH- - 18H2O = -3NH3 + 8Al(OH)-4
NO3- + Al + OH- + H2O = NH3 + Al(OH)4-3NO3- + 8Al + 5OH- + 18H2O = 3NH3 + 8Al(OH)4-
NaHCO3=Na2O+CO2+H2O2NaHCO3 = Na2O + 2CO2 + H2O
Na2S = Na + SNa2S = 2Na + S
NaHS = NaH + SNaHS = NaH + S
NaOH + NiSO4 = NaSO4 + Ni(OH)NaOH + NiSO4 = NaSO4 + Ni(OH)
NaOH + NiSO4 = NaSO4 + NiOHNaOH + NiSO4 = NaSO4 + NiOH
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4Cl = NH3 + HClNH4Cl = NH3 + HCl
Na+Br2= NaBr2Na + Br2 = 2NaBr
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH = Na2O + H2O2NaOH = Na2O + H2O
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
Na +HCl=NaCl +H22Na + 2HCl = 2NaCl + H2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2S(aq)+CuSO4(aq)=Na2SO4+CuSNa2S(aq) + CuSO4(aq) = Na2SO4 + CuS
Na+O2=Na2O NaO26Na + 3O2 = 2Na2ONaO2
Na+O2=Na2O NaO26Na + 3O2 = 2Na2ONaO2
Na+O2=Na2O4Na + O2 = 2Na2O
Na+O2=Na2O4Na + O2 = 2Na2O
Na+O2=Na2O4Na + O2 = 2Na2O
Na O+HCI=NaOHHCI+NaCI2+H20-20NaO - 20HCI = -20NaOHHCI + 0NaCI2 + H20
N2Cl4 + CH4 = CCl4 + N2 + H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O4(g)=2NO2(g)N2O4(g) = 2NO2(g)
NH3(g)+Cl2(g)=NH4Cl(s)+NCl3(g)4NH3(g) + 3Cl2(g) = 3NH4Cl(s) + NCl3(g)
NaBr+Ag2SO4=Na2SO4+AgBr2NaBr + Ag2SO4 = Na2SO4 + 2AgBr
NO2 + H2O + O2 = HNO34NO2 + 2H2O + O2 = 4HNO3
NO2 +H2O + O2 = HNO34NO2 + 2H2O + O2 = 4HNO3
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na2CO3 + 6HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
N2O5=N2O4+O22N2O5 = 2N2O4 + O2
Na + Pb(NO3)4 = NaNO3 + Pb4Na + Pb(NO3)4 = 4NaNO3 + Pb
NO2 = NO + O22NO2 = 2NO + O2
NO2 = NO + O22NO2 = 2NO + O2
NO2 = NO + O22NO2 = 2NO + O2
Na2CO3 + H2O = H2CO3 + NaOHNa2CO3 + 2H2O = H2CO3 + 2NaOH
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NO2 + H2O = HNO3 + NO 3NO2 + H2O = 2HNO3 + NO
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
N2O(g) + H2(g) = NH3(g) + H2O(g)N2O(g) + 4H2(g) = 2NH3(g) + H2O(g)
NaHCO3 + C6H8O7 = CO2 + H2O + Na3C6H5O73NaHCO3 + C6H8O7 = 3CO2 + 3H2O + Na3C6H5O7
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH4ClO4=N2+O2+H2O+HCl4NH4ClO4 = 2N2 + 5O2 + 6H2O + 4HCl
NH4ClO4=N2+O2+H2O+H2Cl2NH4ClO4 = N2 + 3O2 + 2H2O + 2H2Cl
Na+HCl=NaCl+H22Na + 2HCl = 2NaCl + H2
Na+F2=NaF2Na + F2 = 2NaF
N2+O2=N2O52N2 + 5O2 = 2N2O5
N2 + H2=NH3N2 + 3H2 = 2NH3
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
NI3 = N2 + I22NI3 = N2 + 3I2
Na2SO3+HCl=NaCl+H2O+SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NO2 + O2 + H2O = HNO34NO2 + O2 + 2H2O = 4HNO3
NaOH + 2H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2H2 + NO2 = N2 + H2O4N2H2 + 2NO2 = 5N2 + 4H2O
NaCl + O2 = NaClO32NaCl + 3O2 = 2NaClO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2
NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2
NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2
NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2NaHCO3 + CH3COOH = NaCH3COO + H2O + CO2
Ni(OH)2+H2(SO4)=Ni(SO4)+H2ONi(OH)2 + H2(SO4) = Ni(SO4) + 2H2O
NaBr + H3PO4 = Na3PO4 + HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
Na+S=Na2S2Na + S = Na2S
N2+O2=NO2N2 + 2O2 = 2NO2
NaCl = Na + Cl22NaCl = 2Na + Cl2
NO + H = N + H2ONO + 2H = N + H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O = Na2O2Na + O = Na2O
Na2SO3 + KMnO4 + NaHSO4 = Na2SO4 + MnSO4 + K2SO4 + H2O5Na2SO3 + 2KMnO4 + 6NaHSO4 = 8Na2SO4 + 2MnSO4 + K2SO4 + 3H2O
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2CO3 + Ca (OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NH3+O2=N2O4+H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NaOH + Cl2 = NaClO + NaCl + H2O2NaOH + Cl2 = NaClO + NaCl + H2O
Na2SO3+KMnO4+H2O=Na2SO4+MnO2+KOH3Na2SO3 + 2KMnO4 + H2O = 3Na2SO4 + 2MnO2 + 2KOH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+N2=N2H44NH3 + N2 = 3N2H4
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH4Cl+ClO-+OH-=N2+Cl-+H2O2NH4Cl + 3ClO- + 2OH- = N2 + 5Cl- + 5H2O
NaNO2+Cl2+NaOH=NaNO3+NaCl+H2ONaNO2 + Cl2 + 2NaOH = NaNO3 + 2NaCl + H2O
NH3(g) + O2(g) = N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH3(g) + HCl(g) = NH4Cl(g)NH3(g) + HCl(g) = NH4Cl(g)
N2(g) + O2(g) = N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaCl+Pb(NO3)2= PbCl2+2NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3 + CO2 = (NH2)2 CO + H2O2NH3 + CO2 = (NH2)2CO + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=Na2O4Na + O2 = 2Na2O
NH 3+ O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl + H3PO4=Na3PO4 + HCl 3NaCl + H3PO4 = Na3PO4 + 3HCl
Na2SO3 + HCl =NaCl+SO2+H2ONa2SO3 + 2HCl = 2NaCl + SO2 + H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+I2=NaI2Na + I2 = 2NaI
N2+O2=N2O2N2 + O2 = 2N2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2O=N2+O22N2O = 2N2 + O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4Cl+Ca(OH)2=CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NaOH+Cl2=NaCl+NaClO+H2O2NaOH + Cl2 = NaCl + NaClO + H2O
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4Cl + Ba(OH)2 = NH3 + BaCl2 + H2O2NH4Cl + Ba(OH)2 = 2NH3 + BaCl2 + 2H2O
NaCl + KNO3 = KCl + NaNO3NaCl + KNO3 = KCl + NaNO3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2SiF6+Na = Si + NaFNa2SiF6 + 4Na = Si + 6NaF
NH4+CuO = N2+Cu+H2O2NH4 + 4CuO = N2 + 4Cu + 4H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Ni(ClO3)2 = NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
Na3PO4 + KOH = NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na + SO4=Na2SO42Na + SO4 = Na2SO4
NH3+H2SO4= (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+H2O = H2O2+N2H4N2 + 4H2O = 2H2O2 + N2H4
N2H4+H2O2 = N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
Nb+5O2 = Nb2O54Nb + 5O2 = 2Nb2O5
N2+H2=NH3N2 + 3H2 = 2NH3
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NANO2+O2=NANO32NANO2 + O2 = 2NANO3
Na2CO3(aq) + HCl(aq) = NaCl (aq)+ CO2(g) + H2O(l)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + CO2(g) + H2O(l)
Na2CO3(s) = Na2O(s) + CO2(g)Na2CO3(s) = Na2O(s) + CO2(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH + FeSO4= Na2SO4+ Fe(OH)22NaOH + FeSO4 = Na2SO4 + Fe(OH)2
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Nh4So4 + CaNo3=Nh4No3 + CaSo4Nh4So4 + CaNo3 = Nh4No3 + CaSo4
NO = N2O + NO23NO = N2O + NO2
Na2CO3 + HNO3 = H2O + CO2 + NaNO3Na2CO3 + 2HNO3 = H2O + CO2 + 2NaNO3
NaCl + H2SO4 = HCl + NaHSO4NaCl + H2SO4 = HCl + NaHSO4
NaCl + H2SO4 = HCl + NaHSO4NaCl + H2SO4 = HCl + NaHSO4
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na2CO3+Ca(NO3)2=CaCO3+2NaNO3Na2CO3 + Ca(NO3)2 = CaCO3 + 2NaNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+2Cl=2NaCl2Na + 2Cl = NaCl2
Na+Cl2=2NaCl2Na + Cl2 = 2NaCl
Na + Br2 = NaBr2Na + Br2 = 2NaBr
NH4SO4 + CaNO3 = NH4NO3 + CaSO4NH4SO4 + CaNO3 = NH4NO3 + CaSO4
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2 + H2 = 2NHN2 + H2 = 2NH
NaHCO3 = CO2 + NaOHNaHCO3 = CO2 + NaOH
NaHCO3 = H2O + CO2 + Na2O2NaHCO3 = H2O + 2CO2 + Na2O
NaHCO3 = H2O + CO2 + Na2CO32NaHCO3 = H2O + CO2 + Na2CO3
NaN3(s)=Na(s)+N2(g) 2NaN3(s) = 2Na(s) + 3N2(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.