Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
Na2CO3+HCl=CO2+NaCl+H2ONa2CO3 + 2HCl = CO2 + 2NaCl + H2O
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
N2 + H2O = H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na3AsO4+NO+HNO3 = As2O3+NaNO3+H2O6Na3AsO4 + 4NO + 14HNO3 = 3As2O3 + 18NaNO3 + 7H2O
NaBr + Ca(OH)2 = CaBr2 + NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
N2O2+H2O=HNO3+NO2N2O2 - 2H2O = -4HNO3 + 6NO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NiC2O4*2H2O + O2 = NiO + H2O + CO22NiC2O4*2H2O + O2 = 2NiO + 4H2O + 4CO2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
N2(g) + H2(g) = NH3 (g)N2(g) + 3H2(g) = 2NH3(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH (aq) + Ba(NO3)2 (aq) = NaNO3 (aq) + Ba(OH)2 (s)2NaOH(aq) + Ba(NO3)2(aq) = 2NaNO3(aq) + Ba(OH)2(s)
NaHCO3(s) = Na2CO3 + CO2(g) + H2O(l)2NaHCO3(s) = Na2CO3 + CO2(g) + H2O(l)
Na + S= NaSNa + S = NaS
Na2CO3 + H2O + CO2 = NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
Na+Br2=2NaBr2Na + Br2 = 2NaBr
Na(s) + 2H2O(l)= Na(OH)2(aq) + H2(g)Na(s) + 2H2O(l) = Na(OH)2(aq) + H2(g)
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NH4NO3 + Ca(OH)2 = Ca(NO3)2 + 2NH3 + H2O2NH4NO3 + Ca(OH)2 = Ca(NO3)2 + 2NH3 + 2H2O
NO + NaOH = NaNO2 + H2O + N2O4NO + 2NaOH = 2NaNO2 + H2O + N2O
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NiS + O2 = NiO + SO22NiS + 3O2 = 2NiO + 2SO2
NH3 + O2 = HNO2 + H2O2NH3 + 3O2 = 2HNO2 + 2H2O
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NO+NH3 =N2+H2O6NO + 4NH3 = 5N2 + 6H2O
Na2S2 + O2 = Na2S2O32Na2S2 + 3O2 = 2Na2S2O3
Na2SnO3 + H2S = SnS2 + NaOH + H2ONa2SnO3 + 2H2S = SnS2 + 2NaOH + H2O
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3 N2 + 3H2 = 2NH3
NaCO3+Sr(NO2)2=Na(NO2)2+CO3SrNaCO3 + Sr(NO2)2 = Na(NO2)2 + CO3Sr
NaNO3 (s) + K2SO4 (s) = KNO3 (s) + Na2SO4 (s)2NaNO3(s) + K2SO4(s) = 2KNO3(s) + Na2SO4(s)
NaNO3 (s) + K2SO4 (s) = KNO3 (s) + Na2 SO4 (s)2NaNO3(s) + K2SO4(s) = 2KNO3(s) + Na2SO4(s)
Na2Zn(OH)4(aq)+H2(g)=NaOH(aq)+Zn(s)+H2O(l)Na2Zn(OH)4(aq) + H2(g) = 2NaOH(aq) + Zn(s) + 2H2O(l)
N2 + 1F2 = 2NF3N2 + 3F2 = 2NF3
N2 + 1H2 = 2NH3N2 + 3H2 = 2NH3
N2O5=NO2+O22N2O5 = 4NO2 + O2
N2 + 2H2 = 2NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2CO3+H2O2=H2O+CO2+NaCOHNa2CO3 - 4H2O2 = -5H2O - CO2 + 2NaCOH
Na2CO3+H2O2=H2O+CO2+NaOHNa2CO3 + 0H2O2 = -1H2O + CO2 + 2NaOH
Na2CO3+H2O2=H2O+CO2+NaCONa2CO3 - 3H2O2 = -3H2O - CO2 + 2NaCO
NaCl + HSO4 = Na2SO4 + Cl2 + SO2+ H2O6NaCl + 4HSO4 = 3Na2SO4 + 3Cl2 + SO2 + 2H2O
NaCl + HSO4 = NaSO4 + Cl2 + SO2+ H2O6NaCl + 8HSO4 = 6NaSO4 + 3Cl2 + 2SO2 + 4H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na+O2 = Na2O4Na + O2 = 2Na2O
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
N2+O2 = N2O52N2 + 5O2 = 2N2O5
Na+O2=Na2O4Na + O2 = 2Na2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3 + HBr = NaBr + H2O + CO2Na2CO3 + 2HBr = 2NaBr + H2O + CO2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaNO3+PbO= Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na+O2=Na2O4Na + O2 = 2Na2O
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaOH+H2SO4=H2O+Na2(SO4)2NaOH + H2SO4 = 2H2O + Na2(SO4)
NH4Br + Al2O3 =AlBr3 + (NH4)2O6NH4Br + Al2O3 = 2AlBr3 + 3(NH4)2O
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
NaHCO3 (aq) + H2O(l) = Na(s) + OH(g) H2O(l) + CO2(g)NaHCO3(aq) + H2O(l) = Na(s) + OH(g)H2O(l) + CO2(g)
NaC2H3O2 + NaOH = CH4 + Na2CO3NaC2H3O2 + NaOH = CH4 + Na2CO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaIO3 + Na2S4O6 + HCl + NaCl = NaICl2 + Na2SO4 + H2O7NaIO3 + 2Na2S4O6 + 2HCl + 12NaCl = 7NaICl2 + 8Na2SO4 + H2O
NH4NO3 =N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na3PO4+CaCl2=Ca3(PO4)2+NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
NaHCO3+HCl=NaCl=H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2SO4+HCl=NaCl+H2O+SO3Na2SO4 + 2HCl = 2NaCl + H2O + SO3
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NiC2O4*2H2O (s) = NiCO3 (s) + H2O (g) + CO (g)NiC2O4*2H2O(s) = NiCO3(s) + 2H2O(g) + CO(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NiC2O4*2H2O (s) + O2 (g) = NiO (s) + H2O (g) + CO2 (g)2NiC2O4*2H2O(s) + O2(g) = 2NiO(s) + 4H2O(g) + 4CO2(g)
NiC2O4*2H2O (s) + O2 (g) = Ni2O3 (s) + H2O (g) + CO2 (g)4NiC2O4*2H2O(s) + 3O2(g) = 2Ni2O3(s) + 8H2O(g) + 8CO2(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l) = NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
NaClO+Na2S2O+NaOH=Na2SO4+NaCl+H2O6NaClO + Na2S2O + 2NaOH = 2Na2SO4 + 6NaCl + H2O
NaClO+Na2S2O+NaOH=Na2SO4+NaCl+H2O6NaClO + Na2S2O + 2NaOH = 2Na2SO4 + 6NaCl + H2O
NaClO+Na2S2O+NaOH=Na2SO4+NaCl+H2O6NaClO + Na2S2O + 2NaOH = 2Na2SO4 + 6NaCl + H2O
NiCO3+H2SO4=NiSO4+CO2+H2ONiCO3 + H2SO4 = NiSO4 + CO2 + H2O
NH3(g) + HCl(g) = NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na + I2 = NaI2Na + I2 = 2NaI
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaCl+Pb(NO3)2=NaNO3+PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
Na3PO4(aq) + CoCl2(aq) = Co3(PO4)2(s) + NaCl(aq)2Na3PO4(aq) + 3CoCl2(aq) = Co3(PO4)2(s) + 6NaCl(aq)
NO +O2 = NO22NO + O2 = 2NO2
NaOH + KHC8H4O4 = NaKC8H4O4 + H2ONaOH + KHC8H4O4 = NaKC8H4O4 + H2O
NH4Br+Al2O3 = AlBr3 + (NH4)2O6NH4Br + Al2O3 = 2AlBr3 + 3(NH4)2O
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NO (g) + O2 (g) = NO2 (g)2NO(g) + O2(g) = 2NO2(g)
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NiCO3 = NiO + CO2NiCO3 = NiO + CO2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na2SO4 + CaCl2*2H2O = CaSO4*2H2O + 2NaClNa2SO4 + CaCl2*2H2O = CaSO4*2H2O + 2NaCl
NaNO2+H2SO4=NO+ NaNO3+Na2SO4+H2O3NaNO2 + H2SO4 = 2NO + NaNO3 + Na2SO4 + H2O
N2 + H2 =NH3N2 + 3H2 = 2NH3
NH3(g) + O2(g) = NO2(g) + H2O(l)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(l)
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH4NO2=H2O+N2NH4NO2 = 2H2O + N2
N2+H2 = NH3N2 + 3H2 = 2NH3
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NH4Br+Ba(C2H3O2)2=NH4C2H3O2+BaBr22NH4Br + Ba(C2H3O2)2 = 2NH4C2H3O2 + BaBr2
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NaOH + CO2 = Na2CO3 + 3H2O2NaOH + CO2 = Na2CO3 + H2O
Na+ Ni(SO4) = Na2(SO4) + Ni2Na + Ni(SO4) = Na2(SO4) + Ni
Na2SO4+MnO2+NaOH = Na2SO3+NaMnO4+H2O3Na2SO4 + 2MnO2 + 2NaOH = 3Na2SO3 + 2NaMnO4 + H2O
Na+HNO3=NaNO3+H22Na + 2HNO3 = 2NaNO3 + H2
Na+O2=NaO32Na + 3O2 = 2NaO3
Na+O2=NaO2Na + O2 = NaO2
Na3AsO4+NO+HNO3 = As2O3+NaNO3+H4Na3AsO4 + 5NO + 7HNO3 = 2As2O3 + 12NaNO3 + 7H
Na3AsO4+NO+HNO3 = As2O3+NaNO3+H2O6Na3AsO4 + 4NO + 14HNO3 = 3As2O3 + 18NaNO3 + 7H2O
NaCl + H2CO3 = Na2CO3 + HCl2NaCl + H2CO3 = Na2CO3 + 2HCl
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na+H2O=NaOH2Na + H2O = NaOH2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2(g) + O2(g)= NO(g)N2(g) + O2(g) = 2NO(g)
N2(g) + O2(g)= NO(g)N2(g) + O2(g) = 2NO(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaClO3+C12H22O11=NaCl+CO2+H2O8NaClO3 + C12H22O11 = 8NaCl + 12CO2 + 11H2O
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
NCl3+H2O=N(OH)3+HClNCl3 + 3H2O = N(OH)3 + 3HCl
NCl3+H2O=N(OH)3+HClNCl3 + 3H2O = N(OH)3 + 3HCl
NaClO3 + C12H22O11 = NaCl +CO2 + H20130NaClO3 + 30C12H22O11 = 130NaCl + 360CO2 + 33H20
NaClO3 + C12H22O11 = NaCl +CO2 + H2O8NaClO3 + C12H22O11 = 8NaCl + 12CO2 + 11H2O
NaClO3 + C12H22O11 = NaCl +CO2 + H20130NaClO3 + 30C12H22O11 = 130NaCl + 360CO2 + 33H20
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH + H2 SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2SO4 + CaCO3 + C2 = NaCO3 + CaSO3 + CO2-1Na2SO4 - CaCO3 + 0C2 = -2NaCO3 - CaSO3 + CO2
Na2SO4 + CaCO3 + C2 = NaCO3 + CaSO3 + CO2-1Na2SO4 - CaCO3 + 0C2 = -2NaCO3 - CaSO3 + CO2
Na2SO4+CaI2=CaSO4+NaINa2SO4 + CaI2 = CaSO4 + 2NaI
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2S+AlCl3+H2O=Al(OH)3+NaCl+H2S3Na2S + 2AlCl3 + 6H2O = 2Al(OH)3 + 6NaCl + 3H2S
Na +Cl2=NaCl2Na + Cl2 = 2NaCl
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaOH+K3PO3=Na3PO3+KOH3NaOH + K3PO3 = Na3PO3 + 3KOH
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH4OH+AgNO3=NH4NO3+Ag2O+H2O2NH4OH + 2AgNO3 = 2NH4NO3 + Ag2O + H2O
NH3 + O2= NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2H4+O2=N2+H2ON2H4 + O2 = N2 + 2H2O
NiC2O4*2H2O (s) + O2 (g) = NiO (s) + H2O (g) + CO2 (g)2NiC2O4*2H2O(s) + O2(g) = 2NiO(s) + 4H2O(g) + 4CO2(g)
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NH4OH+HCl=H2O+NH4ClNH4OH + HCl = H2O + NH4Cl
NH4+Cl+NaB4O7=NaCl+BN+HCl+H2O4NH4 + 3Cl + NaB4O7 = NaCl + 4BN + 2HCl + 7H2O
N2+ H2 = NH2N2 + 2H2 = 2NH2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4NO3 + H2O = HNO3 + 2(NH4)2O2NH4NO3 + H2O = 2HNO3 + (NH4)2O
Na+Cl2= NaCl2Na + Cl2 = 2NaCl
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaBr + Ba= NaBa +BrNaBr + Ba = NaBa + Br
NaBr + Ba= NaBa +BrNaBr + Ba = NaBa + Br
Na3PO4 = Na + PO4Na3PO4 = 3Na + PO4
NaOH + FeCl3 = NaCl + Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NH3+O2=N+H2O4NH3 + 3O2 = 4N + 6H2O
NaOH(aq)+Cu(s)=Na + CuOHNaOH(aq) + Cu(s) = Na + CuOH
Na+NaNO=Na2O+N22Na + 2NaNO = 2Na2O + N2
NaCl+H2SO4+MnO2=Na2SO4+MnSO4+H2O+Cl22NaCl + 2H2SO4 + MnO2 = Na2SO4 + MnSO4 + 2H2O + Cl2
NaOH+(NH4)3PO4 = Na3PO4+H2O+NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NaOH+Al=Na3AlO3+H26NaOH + 2Al = 2Na3AlO3 + 3H2
Na2CO3 + HCl = NaCl +H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na + H2O= NaOH + H22Na + 2H2O = 2NaOH + H2
NaHCO3+CH3COOH=H2CO3+NaCH3COONaHCO3 + CH3COOH = H2CO3 + NaCH3COO
N2O4 + N2H4 = N2 + H2ON2O4 + 2N2H4 = 3N2 + 4H2O
NaNO3+HCl=HNO3+NaClNaNO3 + HCl = HNO3 + NaCl
N2(g) + H2(g) = NH3 N2(g) + 3H2(g) = 2NH3
Na3PO4 + Cu(NO3)2 = Cu3(PO4)2 + NaNO32Na3PO4 + 3Cu(NO3)2 = Cu3(PO4)2 + 6NaNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2C2O4+Pb(NO3)2=PbC2O4+NaNO3Na2C2O4 + Pb(NO3)2 = PbC2O4 + 2NaNO3
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaCl+KNO3=NaNO3+KClNaCl + KNO3 = NaNO3 + KCl
NaCl + H2O = NaOH + HClNaCl + H2O = NaOH + HCl
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaO+H20=NaOH20NaO + H20 = 20NaOH
N2+O2=NON2 + O2 = 2NO
Na2CO3+H2O=NaOH+H2CO3Na2CO3 + 2H2O = 2NaOH + H2CO3
NH3 +CuO=Cu+N2 +H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na2S + MgBr2 = MgS + 2NaBrNa2S + MgBr2 = MgS + 2NaBr
NaIO3+NaHSO3=Na2SO4+NaHSO4+I2+H2O2NaIO3 + 5NaHSO3 = 2Na2SO4 + 3NaHSO4 + I2 + H2O
Na +H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NaSO4+Al2(SO4)3+BaCl2=BaSO4+ NaCl+AlCl-4NaSO4 + Al2(SO4)3 - BaCl2 = -1BaSO4 - 4NaCl + 2AlCl
Na3PO4 + Mg(CH3COO)2 = Na + Mg3(PO4) + (CH3COO)2Na3PO4 + 3Mg(CH3COO)2 = 3Na + Mg3(PO4) + 3(CH3COO)2
Na2CO3+CoCl2=CoCO3+NaClNa2CO3 + CoCl2 = CoCO3 + 2NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+ HNa + H2O = NaOH + H
Na3PO4+AgNO3=Na3NO3+AgPO4Na3PO4 + AgNO3 = Na3NO3 + AgPO4
Na3PO4+AgNO3=Na3NO3+AgPO4Na3PO4 + AgNO3 = Na3NO3 + AgPO4
Na3PO4(aq)+AgNO3(aq)=Na3NO3(aq)+AgPO4(s)Na3PO4(aq) + AgNO3(aq) = Na3NO3(aq) + AgPO4(s)
NaOH+P4+H2O= NaH2PO3+PH32NaOH + P4 + 4H2O = 2NaH2PO3 + 2PH3
NH4NO3 + CaO = NH3 + H2O + Ca(NO3)22NH4NO3 + CaO = 2NH3 + H2O + Ca(NO3)2
NO+O2=NO22NO + O2 = 2NO2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na2O2+2H2O=2NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na2O2+2H2O=2NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NaOH + KCl= NaCl + KOHNaOH + KCl = NaCl + KOH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na+HCI=H2+NaCI2Na + 2HCI = H2 + 2NaCI
N2+H2=NH3N2 + 3H2 = 2NH3
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
Na+ +Cl- =NaClNa+ + Cl- = NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaHCO3 + Cu(NO3)2 = CuCO3 + NaNO3 + H2O + CO22NaHCO3 + Cu(NO3)2 = CuCO3 + 2NaNO3 + H2O + CO2
NaCl + H2SO4 = H2S + Cl + NaSO4 +H2O4NaCl + 5H2SO4 = H2S + 4Cl + 4NaSO4 + 4H2O
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2(g)+O2(g)+H20=HNO3(aq)10N2(g) + 30O2(g) + H20 = 20HNO3(aq)
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH4N2 + 4H2 = 2NH4
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+Mg=Mg3N2+H22NH3 + 3Mg = Mg3N2 + 3H2
N2+H2=N3H53N2 + 5H2 = 2N3H5
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+O2= NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + Al = Na3AlO3 + H26NaOH + 2Al = 2Na3AlO3 + 3H2
NaHCO3= Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
Na3PO4+AgNO3=Ag3PO4+NaNO3Na3PO4 + 3AgNO3 = Ag3PO4 + 3NaNO3
Na3PO4+Pb(NO3)2=Pb3(PO4)2+NaNO32Na3PO4 + 3Pb(NO3)2 = Pb3(PO4)2 + 6NaNO3
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NA+H2O=NAOH+H22NA + 2H2O = 2NAOH + H2
NH4+ NO3=2NO+H2O2NH4 + 3NO3 = 5NO + 4H2O
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH4+ NO3=2NO+H2O2NH4 + 3NO3 = 5NO + 4H2O
N2O+H2=NH3+H2ON2O + 4H2 = 2NH3 + H2O
NH4+ NO3=2NO+H2O2NH4 + 3NO3 = 5NO + 4H2O
NO2+O2=N2O42NO2 + 0O2 = N2O4
NaOH + FeCl3 = NaCl + Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NH3 + HClO3 = NH4ClO3NH3 + HClO3 = NH4ClO3
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2S(aq) + AgC2H3O2(aq) = NaC2H3O2(aq) + Ag2S(s)Na2S(aq) + 2AgC2H3O2(aq) = 2NaC2H3O2(aq) + Ag2S(s)
NI3=N2+I22NI3 = N2 + 3I2
Na3PO4(aq) + CaCl2(aq)= Ca3(PO4)2(s)+ NaCl(aq)2Na3PO4(aq) + 3CaCl2(aq) = Ca3(PO4)2(s) + 6NaCl(aq)
Na(s)+MgF2=2NaF(s)+Mg(s)2Na(s) + MgF2 = 2NaF(s) + Mg(s)
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH +Y2(SO4)3 = Na2SO4 + Y(OH)36NaOH + Y2(SO4)3 = 3Na2SO4 + 2Y(OH)3
Na+O2=Na2O4Na + O2 = 2Na2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+Mg3(PO4)2=Na3PO4+Mg(OH)26NaOH + Mg3(PO4)2 = 2Na3PO4 + 3Mg(OH)2
NiCl2 + Na2SO4 = NiSO4 + NaClNiCl2 + Na2SO4 = NiSO4 + 2NaCl
NiCl2 + Na2SO4 = NiSO4 + NaClNiCl2 + Na2SO4 = NiSO4 + 2NaCl
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = N2 + 3H2O4NH3 + 3O2 = 2N2 + 6H2O
N2(g) + H2(g) =NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2O2 + H2SO4 = Na2SO4 + H2O2 Na2O2 + H2SO4 = Na2SO4 + H2O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3+NaCl=NH4Cl+NaNO3NH4NO3 + NaCl = NH4Cl + NaNO3
NH4NO2 =N2+H2ONH4NO2 = N2 + 2H2O
Na2SO3 + BaCl2 +H2O = 2NaCl + BaSO4 + H2Na2SO3 + BaCl2 + H2O = 2NaCl + BaSO4 + H2
NaOH(s)+Al(s)+H2O(l) = NaAl(OH)4(Al)+H2(g)2NaOH(s) + 4Al(s) + 6H2O(l) = 2NaAl(OH)4(Al) + 3H2(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH + Pb(NO3)2 = NaNO3 +Pb(OH)22NaOH + Pb(NO3)2 = 2NaNO3 + Pb(OH)2
N2+Br2=NBr3N2 + 3Br2 = 2NBr3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NH3+ NO= N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na2S + H3PO4 = H2S + Na3PO43Na2S + 2H3PO4 = 3H2S + 2Na3PO4
NO = N2 + O22NO = N2 + O2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Ni(OH2)62 + 2NH3 = Ni(OH)2 + 4H2O +2NH4 Ni(OH2)62 + 2NH3 = Ni(OH)2 + 60H2O + 2NH4
NH3OH++Cl2=N2H5++H2O+HClO2+H+6NH3OH+ + Cl2 = 3N2H5+ + 2H2O + 2HClO2 + 3H+
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
NaN3 = N2 + Na3N3NaN3 = 4N2 + Na3N
NaNH2 + NaNO3 = NaN3 +NaOH + NH33NaNH2 + NaNO3 = NaN3 + 3NaOH + NH3
NaNH2 + NaNO3 = NaN3 +NaOH + NH33NaNH2 + NaNO3 = NaN3 + 3NaOH + NH3
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
Na+ + CI- = NaCINa+ + CI- = NaCI
Na+ + CI- = NaCINa+ + CI- = NaCI
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaL + CaCl2 = NaCl2 + CaLNaL + CaCl2 = NaCl2 + CaL
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaOH + NaNO2 + Al + H2O = NH3 + NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na+H2O=H+NaOHNa + H2O = H + NaOH
Na+H2O=H+NaOHNa + H2O = H + NaOH
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
N2O5(g) + H2O(l) =HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH4NO3(s) = N2O(g) + H2O(g)NH4NO3(s) = N2O(g) + 2H2O(g)
N2(g) + H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na + H2O = NaOH +H2 2Na + 2H2O = 2NaOH + H2
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2(g)+O2(g)+H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N+Li=Li3NN + 3Li = Li3N
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na2Co3+CaCl2=NaCl=CaCo3Na2Co3 + CaCl2 = 2NaCl + CaCo3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na +Cl = NaClNa + Cl = NaCl
NH3(g) + O2 (g) = NO2 (g) + H2O (l)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(l)
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na + O2 = Na2O4Na + O2 = 2Na2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2+O2=NON2 + O2 = 2NO
Na3PO4*3H2O=Na3PO4+ H2ONa3PO4*3H2O = Na3PO4 + 3H2O
NaI2+Cl2=NaCl2+I2NaI2 + Cl2 = NaCl2 + I2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2O5 + H2O = 2HNO3N2O5 + H2O = 2HNO3
NH3 + HNO3(aq) = NH4NO3NH3 + HNO3(aq) = NH4NO3
Na + Cl2 = Na Cl2Na + Cl2 = 2NaCl
NaI+H2O2=H2O+NaIO3NaI + 3H2O2 = 3H2O + NaIO3
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3
Na + HBr = NaBr + H22Na + 2HBr = 2NaBr + H2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3(aq)+NiCl2(s)=NiCO3(s)+2NaClNa2CO3(aq) + NiCl2(s) = NiCO3(s) + 2NaCl
NH4Br(aq) + Pb(C2H3O2)2(aq) = PbBr2(s) + 2NH4(C2H3O2)(aq)2NH4Br(aq) + Pb(C2H3O2)2(aq) = PbBr2(s) + 2NH4(C2H3O2)(aq)
NH4Br(aq) + Pb(C2H3O2)2(aq) = PbBr2(s) + NH4(C2H3O2)(aq)2NH4Br(aq) + Pb(C2H3O2)2(aq) = PbBr2(s) + 2NH4(C2H3O2)(aq)
NH4Br(aq) + Pb(C2H3O2)2 = PbBr2(s) + NH4(C2H3O2)(aq)2NH4Br(aq) + Pb(C2H3O2)2 = PbBr2(s) + 2NH4(C2H3O2)(aq)
Na2OH(aq) H2S(g) = Na2S(aq) H3O(l)Na2OH(aq)H2S(g) = Na2S(aq)H3O(l)
Na2CO3 + HNO3 = CO2 + H2O + NaNO3 Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NiCl2 + O2 = NiO + Cl2O5NiCl2 + 3O2 = NiO + Cl2O5
NH3 + O2 = NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4Cl + NaOH = NH3 + NaCl + H2ONH4Cl + NaOH = NH3 + NaCl + H2O
Na3P + H2O = PH3 + NaOHNa3P + 3H2O = PH3 + 3NaOH
N2 + H2 = NH2N2 + 2H2 = 2NH2
NH4Cl + CaO = NH3 + CaCl2 + H2O2NH4Cl + CaO = 2NH3 + CaCl2 + H2O
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2SO3 + H2SO4 = SO4 +H2O + Na2SO4Na2SO3 - H2SO4 = -1SO4 - H2O + Na2SO4
NaBr+H2SO4=Na2SO4+HBr2NaBr + H2SO4 = Na2SO4 + 2HBr
NaBr+H2SO4=Na2SO4+HBr2NaBr + H2SO4 = Na2SO4 + 2HBr
NaCl + H2O = NaOH + H2 + Cl22NaCl + 2H2O = 2NaOH + H2 + Cl2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
N2 O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaCl(aq) + KNO3(aq) = KCl(aq) + NaNO3(aq)NaCl(aq) + KNO3(aq) = KCl(aq) + NaNO3(aq)
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Ni(NO3)2(s) = NiO(s)+ NO2 +O22Ni(NO3)2(s) = 2NiO(s) + 4NO2 + O2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2+F2=NF3N2 + 3F2 = 2NF3
NaOH + H2C2O4 = Na2C2O4 + H2O2NaOH + H2C2O4 = Na2C2O4 + 2H2O
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N + O = NO2N + 2O = NO2
N2 + O2 = NO2N2 + 2O2 = 2NO2
N + O = NO2N + 2O = NO2
N2 + O2 = NO2N2 + 2O2 = 2NO2
NaCl(aq)+Hg2(C2H3O2)2(aq)=Na(C2H3O2)+HgCl2NaCl(aq) + Hg2(C2H3O2)2(aq) = 2Na(C2H3O2) + 2HgCl
Na(s) + H2O(l) = NaOH(aq) + H(g)Na(s) + H2O(l) = NaOH(aq) + H(g)
Na2SO3(aq) + HCl(aq) = NaCl(aq) + H2O + SO2(g)Na2SO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O + SO2(g)
Na2O(s) + H2O(l) = 2NaOH(aq)Na2O(s) + H2O(l) = 2NaOH(aq)
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na2O + H2O = 2NaOHNa2O + H2O = 2NaOH
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na(s) + H2O(l) = NaOH(aq) +H(g)Na(s) + H2O(l) = NaOH(aq) + H(g)
N2+H2 = NH3N2 + 3H2 = 2NH3
NH4Cr2O7= NH3 + H2O + Cr2O3 + O24NH4Cr2O7 = 4NH3 + 2H2O + 4Cr2O3 + 7O2
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaNO3 + H2SO4 = NaHSO4 + HNO3NaNO3 + H2SO4 = NaHSO4 + HNO3
NH3+Na=H2+NaNH22NH3 + 2Na = H2 + 2NaNH2
Na2O(s)+HCl(aq)=NaCl(aq)+H2O(l)Na2O(s) + 2HCl(aq) = 2NaCl(aq) + H2O(l)
Na2O + H2O = 2NaOHNa2O + H2O = 2NaOH
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NiSO4 + K2O = NiO + K2SO4NiSO4 + K2O = NiO + K2SO4
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2H4 +O2 = N2 + H2ON2H4 + O2 = N2 + 2H2O
N2H4 +O2 = N2 + H2ON2H4 + O2 = N2 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO + O2 = NO22NO + O2 = 2NO2
N2 + O2 = NON2 + O2 = 2NO
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaNO2+NaI+H2SO4=NO+I2+Na2SO4+H2O2NaNO2 + 2NaI + 2H2SO4 = 2NO + I2 + 2Na2SO4 + 2H2O
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N+ F= NF3N + 3F = NF3
NaCl+ AgNO3= NaNO3+ AgClNaCl + AgNO3 = NaNO3 + AgCl
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NaOH+H2SO4=NaHSO4+H2ONaOH + H2SO4 = NaHSO4 + H2O
Na+H3PO4=Na3PO4+H26Na + 2H3PO4 = 2Na3PO4 + 3H2
Na2S2O3+H2O2=Na2SO4+H2SO4+H2O20Na2S2O3 + H2O2 = 0Na2SO4 + 0H2SO4 + H2O2
Na2S2O3+H2O2=Na2SO4+H2SO4+H2ONa2S2O3 + 4H2O2 = Na2SO4 + H2SO4 + 3H2O
Ni + AgNO3 = Ag + Ni(NO3)2Ni + 2AgNO3 = 2Ag + Ni(NO3)2
Ni + AgNO3 = Ag + Ni(NO3)2Ni + 2AgNO3 = 2Ag + Ni(NO3)2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaBrO3 + XeF2 + H2O = NaBrO4 + HF +XeNaBrO3 + XeF2 + H2O = NaBrO4 + 2HF + Xe
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2+H2O=HNO2+NO-1NO2 - H2O = -2HNO2 + NO
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.