Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Na3PO4 + CaCl2 = Ca3 (PO4)2 + NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
NaOH + KCl = KOH + NaClNaOH + KCl = KOH + NaCl
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NH4OH + Fe(NO3)3 = Fe(OH)3 + NH4NO33NH4OH + Fe(NO3)3 = Fe(OH)3 + 3NH4NO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH8 = H2 + N22NH8 = 8H2 + N2
NH3(g) + O2(g) = NO(g) + H2O(g) 4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na2S + NaIO3 + H2SO4 = NaHSO4 + H2O + I25Na2S + 8NaIO3 + 13H2SO4 = 18NaHSO4 + 4H2O + 4I2
NaOH + H3PO4 =H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NaOH + H3PO4 =H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NaClO+H2S=NaCl + H2SO44NaClO + H2S = 4NaCl + H2SO4
N2O + N2O5 = NO3N2O + N2O5 = 8NO
Na2O2 = Na2O + O2 2Na2O2 = 2Na2O + O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2(g) +O2(g) = N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
NO + O2 = NO22NO + O2 = 2NO2
Na+ Cl = NaClNa + Cl = NaCl
NaCl + H2SO4 + MnO2 = NaHSO4 + MnSO4 + H2O + Cl22NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
N + H + S + O = (NH4)2SO42N + 8H + S + 4O = (NH4)2SO4
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaClO + NaI + HCl = NaCl + I2 + H2ONaClO + 2NaI + 2HCl = 3NaCl + I2 + H2O
Na2S2O3 + Cl2 + H2O = NaH(SO4) + HClNa2S2O3 + 4Cl2 + 5H2O = 2NaH(SO4) + 8HCl
Na2S2O3 + H2O2 = Na2SO4 + H2SO4 + H2ONa2S2O3 + 4H2O2 = Na2SO4 + H2SO4 + 3H2O
NaCl + MnO2 + H2SO4 = NaH(SO4) + MnSO4 + Cl2 + H2O2NaCl + MnO2 + 3H2SO4 = 2NaH(SO4) + MnSO4 + Cl2 + 2H2O
Na2CrO7 + HCl = NaCl + CrCl3 + H2O + Cl22Na2CrO7 + 28HCl = 4NaCl + 2CrCl3 + 14H2O + 9Cl2
NaOH+CuSO4=Cu(OH)2+Na2SO42NaOH + CuSO4 = Cu(OH)2 + Na2SO4
NaOH+CuSO4=Cu(OH)2+Na2SO42NaOH + CuSO4 = Cu(OH)2 + Na2SO4
NaOH+CuSO4=Cu(OH)2+Na2SO42NaOH + CuSO4 = Cu(OH)2 + Na2SO4
NaOH+CuSO4=Cu(OH)2+Na2SO42NaOH + CuSO4 = Cu(OH)2 + Na2SO4
NaHCO3 = CO2+H2O+Na2CO32NaHCO3 = CO2 + H2O + Na2CO3
Na + Cl + O = NaClONa + Cl + O = NaClO
Na + H + C + O = NaHCO3Na + H + C + 3O = NaHCO3
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaHCO3 + CH3OOH = CH3COONa + CO2 + H2ONaHCO3 + 2CH3OOH = CH3COONa + CO2 + 3H2O
NaOH + Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NiS + O2 = NiO + SO2 2NiS + 3O2 = 2NiO + 2SO2
NaOH + CuSO4 = Cu(OH)2 + Na2SO4 2NaOH + CuSO4 = Cu(OH)2 + Na2SO4
N2H4 + N2O4 = N2 + H2O2N2H4 + N2O4 = 3N2 + 4H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl=NaClNa + Cl = NaCl
NaCrO2+NaClO+H20=Na2CrO4+NaOH+Cl20NaCrO2 + 20NaClO + H20 = 0Na2CrO4 + 20NaOH + 10Cl2
NaClO + H2S = NaCl + H2SO44NaClO + H2S = 4NaCl + H2SO4
NaClO + H2S + H2O= NaCl + H2SO44NaClO + H2S + 0H2O = 4NaCl + H2SO4
NaClO + H2S= NaCl + H2SO44NaClO + H2S = 4NaCl + H2SO4
NaClO + H2S= NaCl + H2SO44NaClO + H2S = 4NaCl + H2SO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + MnO2 + H2SO4 = NaSO4 + MnSO4 + H2O + Cl22NaCl + 2MnO2 + 4H2SO4 = 2NaSO4 + 2MnSO4 + 4H2O + Cl2
N2O3 + K2CrO7 + H2SO4 = K2SO4 + Cr2(SO4)3 + HNO3 + H2O9N2O3 + 4K2CrO7 + 10H2SO4 = 4K2SO4 + 2Cr2(SO4)3 + 18HNO3 + H2O
N2O3 + Br2 + H2O = HNO3 + HBrN2O3 + 2Br2 + 3H2O = 2HNO3 + 4HBr
NaMnO4 + H2SO4 = Na2SO4 + Mn2O7 + H2O2NaMnO4 + H2SO4 = Na2SO4 + Mn2O7 + H2O
NH4OH + AlCl3 = Al(OH)3 +NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NO + O2 = NO22NO + O2 = 2NO2
NO + O2 = NO22NO + O2 = 2NO2
Na2O +H2O = NaOHNa2O + H2O = 2NaOH
Na2O +H2O = NaOHNa2O + H2O = 2NaOH
Na2(SO4)+Pb(NO3)2=Na(NO3)+Pb(SO4)Na2(SO4) + Pb(NO3)2 = 2Na(NO3) + Pb(SO4)
N2 + O2 + H2 = HNO3N2 + 3O2 + H2 = 2HNO3
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
N2+6H2=4NH3N2 + 3H2 = 2NH3
N2+6H2=2NH3N2 + 3H2 = 2NH3
NO2 + H2O = NO + HNO33NO2 + H2O = NO + 2HNO3
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2S2O3 + I2 = Na2S4O6 + NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
Na2(SO4)+Pb(NO3)2=Pb(SO4)+Na(NO3)Na2(SO4) + Pb(NO3)2 = Pb(SO4) + 2Na(NO3)
NH3 + O = NO2 + H2O2NH3 + 7O = 2NO2 + 3H2O
N2H4 + H2O2 = NO2 +H2ON2H4 + 6H2O2 = 2NO2 + 8H2O
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
N2+O2=NO2N2 + 2O2 = 2NO2
NaCl+Hg2=HgCl2+Na4NaCl + Hg2 = 2HgCl2 + 4Na
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2+O2=NO2N2 + 2O2 = 2NO2
NaCl+Ag(NO3)=Na(NO3)+AgClNaCl + Ag(NO3) = Na(NO3) + AgCl
Na(CO3)+Ag(NO3)=Na(NO3)+Ag(CO3)Na(CO3) + Ag(NO3) = Na(NO3) + Ag(CO3)
N2O(g) + H2(g) = NH3(g) + H2O(g)N2O(g) + 4H2(g) = 2NH3(g) + H2O(g)
Na2SO4 (aq) + AgNO3 (aq)= Ag2SO4 (s) + NaNO3 (aq)Na2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2NaNO3(aq)
N2O(g) + H2(g) = NH3(g) + H2O(g)N2O(g) + 4H2(g) = 2NH3(g) + H2O(g)
NH4NO3+KCI=KNO3+NH4CINH4NO3 + KCI = KNO3 + NH4CI
NH4OH + H2SO4 = (NH4)2SO4 + H2O2NH4OH + H2SO4 = (NH4)2SO4 + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NH4NO3+KCI=KNO3+NH4CINH4NO3 + KCI = KNO3 + NH4CI
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH3 + CO2 + H2O = (NH4)2CO32NH3 + CO2 + H2O = (NH4)2CO3
N2O5 = N2O4 + O22N2O5 = 2N2O4 + O2
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
N4 + H2 = H2N4N4 + H2 = H2N4
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NH4NO2 = N(g) + H2ONH4NO2 = 2N(g) + 2H2O
NH4NO2 = N + H2ONH4NO2 = 2N + 2H2O
Na+HCl=NaCl+H22Na + 2HCl = 2NaCl + H2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+O2=Na2O4Na + O2 = 2Na2O
Na+HCl=NaCl+H22Na + 2HCl = 2NaCl + H2
Na2HCO3 + H2O2 = NaOH + H2O + CO22Na2HCO3 + H2O2 = 4NaOH + 0H2O + 2CO2
NH4NO3(s) = N2O(g) + H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+H2O=Cl+H+NaOHNaCl + H2O = Cl + H + NaOH
Ni2 +2HgCl2 = 2NiCl2 + 2HgNi2 + 2HgCl2 = 2NiCl2 + 2Hg
Ni +HgCl2 = NiCl2 + HgNi + HgCl2 = NiCl2 + Hg
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO(g) + H2(g) = NH3(g) + H2O(g) 2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2SO4 + P4O10 = SO3 + Na3PO46Na2SO4 + P4O10 = 6SO3 + 4Na3PO4
NO3- + CH3OH + H+ = N2 + HCO3 + H2O14NO3- + 10CH3OH + 14H+ = 7N2 + 10HCO3 + 22H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2C2O4 + H2SO4 = Na2SO4 + H2C2O4Na2C2O4 + H2SO4 = Na2SO4 + H2C2O4
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Ni(NO3)2 + Fe(NO3)3 + NH2CONH2 = NiFe2O4 + CO2 + H2O + N23Ni(NO3)2 + 6Fe(NO3)3 + 20NH2CONH2 = 3NiFe2O4 + 20CO2 + 40H2O + 32N2
Ni(NO3)2 + Zn(NO3)2 + Fe(NO3)3 + NH2CONH2 = NiZnFe2O4 + CO2 + H2O + N23Ni(NO3)2 + 3Zn(NO3)2 + 6Fe(NO3)3 + 26NH2CONH2 = 3NiZnFe2O4 + 26CO2 + 52H2O + 41N2
Ni(NO3)2 + Zn(NO3)2 + Fe(NO3)3 + NH2CONH2 = NiZnFe2O4 + CO2 + H2O + N23Ni(NO3)2 + 3Zn(NO3)2 + 6Fe(NO3)3 + 26NH2CONH2 = 3NiZnFe2O4 + 26CO2 + 52H2O + 41N2
Na2Cr2O7+HCl=NaCl+CrCl3+H2O+Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na2Cr2O7+FeCl2+HCl=CrCl3+FeCl3+NaCl+H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
N2+O2=NO2N2 + 2O2 = 2NO2
N2+O2=NO2N2 + 2O2 = 2NO2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+FeBr3=NaBr+Fe3Na + FeBr3 = 3NaBr + Fe
NaC2H3O2 + H2SO4=Na2SO4+ C2H4O22NaC2H3O2 + H2SO4 = Na2SO4 + 2C2H4O2
N2 + H2 =NH3N2 + 3H2 = 2NH3
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
Na2CO3+H3PO4=Na2HPO4+CO2+H2ONa2CO3 + H3PO4 = Na2HPO4 + CO2 + H2O
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na + H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
NH4 + O2 = N2 + H2O2NH4 + 2O2 = N2 + 4H2O
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na+H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
Na2 O + H2O = NaOHNa2O + H2O = 2NaOH
Na2 O + H2O = NaOHNa2O + H2O = 2NaOH
NiCO3 + 2H = Ni + H2O + CO2NiCO3 + 2H = Ni + H2O + CO2
Na2 S2 O3 + AgBr = Na3 Ag(S2 O3)2 + NaBr2Na2S2O3 + AgBr = Na3Ag(S2O3)2 + NaBr
N2O5+H2O=HNO2+HNO3N2O5 + H2O = 0HNO2 + 2HNO3
NH4ClO4 + Al = Al2O3 + N2 + HCl + H2O6NH4ClO4 + 10Al = 5Al2O3 + 3N2 + 6HCl + 9H2O
NH4ClO4 + Al = Al2O3 + N2 + HCl + H2O6NH4ClO4 + 10Al = 5Al2O3 + 3N2 + 6HCl + 9H2O
NaBH4(s)+H2SO4(aq) = B2H6(g)+H2(g)+Na2SO4(aq)2NaBH4(s) + H2SO4(aq) = B2H6(g) + 2H2(g) + Na2SO4(aq)
NaBH4(s)+HSO4(aq) = B2H6(g)+H2(g)+Na2SO4(aq)4NaBH4(s) + 2HSO4(aq) = 2B2H6(g) + 3H2(g) + 2Na2SO4(aq)
Na2CO3 +H2SO4=Na2SO4+CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na2CO3 +H2SO4=Na2SO4+CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na2CO3 +H2SO4=Na2SO4+CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na2O+HCL=NaCL+H2ONa2O + 2HCL = 2NaCL + H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2(g) + O2(g) + H2O = HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + Br2 = NaBr2Na + Br2 = 2NaBr
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + O2 = Na2O4Na + O2 = 2Na2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl+AgC2H3O2=NaC2H3O2+AgClNaCl + AgC2H3O2 = NaC2H3O2 + AgCl
Na+O2=Na2O4Na + O2 = 2Na2O
NO2=NO+O22NO2 = 2NO + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+CaCl2=CaCO3+NaClNa2CO3 + CaCl2 = CaCO3 + 2NaCl
Na2C2O4=Na+ C2O4Na2C2O4 = 2Na + C2O4
NaC2O4=Na+ C2O4NaC2O4 = Na + C2O4
NaC2O4=Na+ C2O4NaC2O4 = Na + C2O4
NaI+ H2SO4 = Na2 SO4 + H2S + I2 + H2O8NaI + 5H2SO4 = 4Na2SO4 + H2S + 4I2 + 4H2O
NH3 + O2 = H2O + NO4NH3 + 5O2 = 6H2O + 4NO
N2 + O2 = N2O32N2 + 3O2 = 2N2O3
NH3 + ClF3= HF + N2 +Cl22NH3 + 2ClF3 = 6HF + N2 + Cl2
NH3 +O2 = NO+ H2O4NH3 + 5O2 = 4NO + 6H2O
NaIO3+ H2O+ SO2= Na2SO4+ H2SO4+I22NaIO3 + 4H2O + 5SO2 = Na2SO4 + 4H2SO4 + I2
Na2B4O7(aq)+ HCl = NaCl+ H2O+ H3BO3Na2B4O7(aq) + 2HCl = 2NaCl - 5H2O + 4H3BO3
Na2B4O7+ HCl = NaCl+ H2O+ H3BO3Na2B4O7 + 2HCl = 2NaCl - 5H2O + 4H3BO3
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
NaOH + HCl = NaCl +H2ONaOH + HCl = NaCl + H2O
N2+H=2NH3N2 + 6H = 2NH3
NaHCO3+H3PO4=Na2HPO4+H2O+CO22NaHCO3 + H3PO4 = Na2HPO4 + 2H2O + 2CO2
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaHCO3+H3PO4=Na2HPO4+H2O+CO22NaHCO3 + H3PO4 = Na2HPO4 + 2H2O + 2CO2
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na(s) + H2O(l) = H2(g) + NaOH(aq)2Na(s) + 2H2O(l) = H2(g) + 2NaOH(aq)
Na(s) + H2O(l) = H2(g) + NaOH(aq)2Na(s) + 2H2O(l) = H2(g) + 2NaOH(aq)
Ni(NO3)2+ Na2SO4 = NiSO4 (s)+ 2 NaNO3 Ni(NO3)2 + Na2SO4 = NiSO4(s) + 2NaNO3
Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3 + KCl = KNO3 + NH4ClNH4NO3 + KCl = KNO3 + NH4Cl
N2O5+H2O=HNO2+HNO3N2O5 + H2O = 0HNO2 + 2HNO3
N2O5+H2O=HNO2+HNO3N2O5 + H2O = 0HNO2 + 2HNO3
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NaHCO3 + H3O + Cl = NaCl + H2O +CO2NaHCO3 + H3O + Cl = NaCl + 2H2O + CO2
NH4 + NaOH = NH3 +H2O +NaNH4 + NaOH = NH3 + H2O + Na
NaOH + H2SO4 = H2O + Na2SO4 2NaOH + H2SO4 = 2H2O + Na2SO4
Na+ H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O4+N2H4=N2+H2ON2O4 + 2N2H4 = 3N2 + 4H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + HNO2 = H2O + Na + N-3NaOH + HNO2 = -1H2O - 3Na + N
Na(s) + Br2(l) = NaBr(s)2Na(s) + Br2(l) = 2NaBr(s)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaN3=Na+N22NaN3 = 2Na + 3N2
N2 H4 + N2 O4 = H2 O + N22N2H4 + N2O4 = 4H2O + 3N2
N H4 N O3 = N2 + O2 + H2 O2NH4NO3 = 2N2 + O2 + 4H2O
NaClO+H2O2=NaClO2 +H2ONaClO + H2O2 = NaClO2 + H2O
NaClO+H2O2=NaClO2 +H1O0NaClO + H2O2 = 0NaClO2 + 2H1O
NaClO+H2O2=NaClO2 +H2O20NaClO + H2O2 = 0NaClO2 + H2O2
NaClO+H2O2=NaClO2 +H2ONaClO + H2O2 = NaClO2 + H2O
NaClO+H2O2=NaClO2 +H2O20NaClO + H2O2 = 0NaClO2 + H2O2
NaClO+H2O2=NaClO2 +H2O20NaClO + H2O2 = 0NaClO2 + H2O2
NaClO+H2O2=NaClO2 +H+ +O-1NaClO + 0H2O2 = -1NaClO2 + 0H+ + O
NaClO+H2O2=NaClO+ +H+ +O-2NaClO + H2O2 = -2NaClO+ + 2H+ + 2O
NaClO+H2O2=NaClO++++H+++O-4NaClO + 3H2O2 = -4NaClO+++ + 6H++ + 6O
NaClO+H2O2=NaClO2+H2ONaClO + H2O2 = NaClO2 + H2O
NaClO+H2O2=NaClO2+H2ONaClO + H2O2 = NaClO2 + H2O
NH3+02 = N0+H200NH3+02 = -1N0 + H20
NiS+O2=SO2+NiO(s)2NiS + 3O2 = 2SO2 + 2NiO(s)
NiS+O2=SO2+Ni(s)NiS + O2 = SO2 + Ni(s)
NaSO4 + Fe3+ = Fe + SO4 + Na NaSO4 + 0Fe3+ = 0Fe + SO4 + Na
NaSO4 + Fe3+ = Fe + SO4 + Na NaSO4 + 0Fe3+ = 0Fe + SO4 + Na
NaSO4 + Al3+ = Al + SO4 + NaNaSO4 + 0Al3+ = 0Al + SO4 + Na
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na+O2=Na2O4Na + O2 = 2Na2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + O = NaONa + O = NaO
NaCO3 + Ca(OH) = NaOH + CaCO3NaCO3 + Ca(OH) = NaOH + CaCO3
NaBr + Ca3(PO4)2 = CaBr2 + Na3PO46NaBr + Ca3(PO4)2 = 3CaBr2 + 2Na3PO4
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaH+B2H6=NaBH42NaH + B2H6 = 2NaBH4
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na(OH)+I2=NaI+NaIO3+H2O6Na(OH) + 3I2 = 5NaI + NaIO3 + 3H2O
NH4VO3 + HNO3 = VO3NO3 + NO2 + H2ONH4VO3 + 10HNO3 = VO3NO3 + 10NO2 + 7H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+CO2=Na2CO3+CO2Na + 2CO2 = Na2CO3 + CO
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + O2 = Na2O22Na + O2 = Na2O2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 + CuSO4 = Na2SO4 + CuCO3Na2CO3 + CuSO4 = Na2SO4 + CuCO3
Na2CO3 + CuSO4 = Na2SO4 + CuCO3Na2CO3 + CuSO4 = Na2SO4 + CuCO3
Na2SO3 + KMnO4+NaHSO4=Na2SO4+MnSO4+K2SO4+H2O5Na2SO3 + 2KMnO4 + 6NaHSO4 = 8Na2SO4 + 2MnSO4 + K2SO4 + 3H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaO2 +2H2O=4NaOH +3O24NaO2 + 2H2O = 4NaOH + 3O2
NaO2 +2H2O=4NaOH +3O24NaO2 + 2H2O = 4NaOH + 3O2
NaO2 +2H2O=4NaOH +3O24NaO2 + 2H2O = 4NaOH + 3O2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaL+Br2=NaBr+L22NaL + Br2 = 2NaBr + L2
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3 + Br + NaOH = N + NaBr + H2ONH3 + 3Br + 3NaOH = N + 3NaBr + 3H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NH4NO3 (aq) = N2 (g) + O2 (g) + 2 H2O (l)2NH4NO3(aq) = 2N2(g) + O2(g) + 4H2O(l)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(NO3)3 + PbBr4 = NiBr3 + Pb(NO3)44Ni(NO3)3 + 3PbBr4 = 4NiBr3 + 3Pb(NO3)4
NH4VO3 + HNO3 = VO3NO3 + NO2 + H2ONH4VO3 + 10HNO3 = VO3NO3 + 10NO2 + 7H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
N2+O2=NO2N2 + 2O2 = 2NO2
N2+O2=N2O2N2 + O2 = N2O2
N2+O2=2NON2 + O2 = 2NO
Na (s) + MgF2 =2NaF (s) + Mg (s)2Na(s) + MgF2 = 2NaF(s) + Mg(s)
Na (s) + O2 (g) = Na2O4Na(s) + O2(g) = 2Na2O
Na3PO4 + Ca(OH)2 = NaOH + (PO4)2Ca32Na3PO4 + 3Ca(OH)2 = 6NaOH + (PO4)2Ca3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g) = N2(g) + H2(g)2NH3(g) = N2(g) + 3H2(g)
Na + 2H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + FeCr2O4 + O2 = Fe2O3 + Na2CrO4 + CO38Na2CO3 + 4FeCr2O4 + 11O2 = 2Fe2O3 + 8Na2CrO4 + 8CO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
NH4NO3 = N2O + 2H2ONH4NO3 = N2O + 2H2O
NaOH+CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
NH3+O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH3+O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Ni(NO6)2 +NaOH = Ni(OH)2 +NaNO6Ni(NO6)2 + 2NaOH = Ni(OH)2 + 2NaNO6
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NH3 + O2 =NO+ H2O4NH3 + 5O2 = 4NO + 6H2O
NO + O2 =NO22NO + O2 = 2NO2
NiS+O2 = NiO + SO22NiS + 3O2 = 2NiO + 2SO2
Na2O+P4O10=Na3PO46Na2O + P4O10 = 4Na3PO4
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2CO3+ 2HNO3 = 2NaNO3 + H2O +CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH4Cl + MgO = (NH4)2O + MgCl22NH4Cl + MgO = (NH4)2O + MgCl2
NH4Cl + MgO = (NH4)2O + MgCl22NH4Cl + MgO = (NH4)2O + MgCl2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O3=NO+H2O6NH3 + 5O3 = 6NO + 9H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2O2=H2O+ Na2O22NaOH + H2O2 = 2H2O + Na2O2
NaOH+H2O2=H2O+ NaO2NaOH + H2O2 = 2H2O + 2NaO
NaOH+H2O2=H2O+ Na2O2NaOH + 0H2O2 = H2O + Na2O
NaOH+H2O2=H2O+ Na2O22NaOH + H2O2 = 2H2O + Na2O2
NH4I + Cl2 = NH4Cl + I22NH4I + Cl2 = 2NH4Cl + I2
NH3 + Cl2 +H2O = NH4Cl + H2O0NH3 + 0Cl2 + H2O = 0NH4Cl + H2O
NaH+B2H6=NaBH42NaH + B2H6 = 2NaBH4
NaH+B2H6=NaBH42NaH + B2H6 = 2NaBH4
Na2SO3+S8=Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
NO +Cl2=NOCl2NO + Cl2 = 2NOCl
N2O5 + H2O = 5HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = 1HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = 2 HNO3N2O5 + H2O = 2HNO3
NaOH+H2O2= Na2O2+H2O2NaOH + H2O2 = Na2O2 + 2H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3 = N2+ H22NH3 = N2 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NiCn + LiC2H3O2 = NiC2H3O2 + LiCnNiCn + LiC2H3O2 = NiC2H3O2 + LiCn
Na + Br2 = NaBr2Na + Br2 = 2NaBr
Na + Br2 = NaBr2Na + Br2 = 2NaBr
Na + Br2 = NaBr2Na + Br2 = 2NaBr
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na3PO4(aq) + MgCl2(aq) = Mg3(PO4)2 + NaCl2Na3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2 + 6NaCl
Na3PO4 + MgCl2 = Mg3(PO4)2 + NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
NaOH+HNO3=H2O+NaNO3NaOH + HNO3 = H2O + NaNO3
NO2 + H2O = H3NO3 + NO-1NO2 - 3H2O = -2H3NO3 + NO
Na + Cl2 = 2 NaCl2Na + Cl2 = 2NaCl
Ni2O3 + CO = Ni + CO2Ni2O3 + 3CO = 2Ni + 3CO2
Ni2O3 + CO = Ni + CO2Ni2O3 + 3CO = 2Ni + 3CO2
Na + H2O = NaOH + H2O0Na + H2O = 0NaOH + H2O
NHO3+S=NO2+H2O+H2SO46NHO3 + S = 6NO2 + 2H2O + H2SO4
NH3+Cl2=NH4Cl+N28NH3 + 3Cl2 = 6NH4Cl + N2
NH3+O2=NO2+H2020NH3 + 20O2 = 20NO2 + 3H20
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH +CO2 = Na2CO3 + H2O 2NaOH + CO2 = Na2CO3 + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4Cl + Ca(OH)2 = NH3 + HOH + CaCl22NH4Cl + Ca(OH)2 = 2NH3 + 2HOH + CaCl2
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2 + H2=NH3N2 + 3H2 = 2NH3
Na2CO3+NO+O2=NaNO2+CO22Na2CO3 + 4NO + O2 = 4NaNO2 + 2CO2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO + O2 = NO22NO + O2 = 2NO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Ni + 2Ag+ = Ni2+ + 2Ag2Ni + Ag+ = Ni2+ + Ag
Ni + 2Ag+ = Ni2+ + 2Ag2Ni + Ag+ = Ni2+ + Ag
NO2(g)+H2O(l)=NO(g)+HNO3(aq)3NO2(g) + H2O(l) = NO(g) + 2HNO3(aq)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+Cl2=NH4Cl+N28NH3 + 3Cl2 = 6NH4Cl + N2
Na2NH+H2O=NH3+NaOHNa2NH + 2H2O = NH3 + 2NaOH
N2(g)+O2(g)=NO2(g)N2(g) + 2O2(g) = 2NO2(g)
NaOH+Cl2=NaClO3+H20+NaCl60NaOH + 30Cl2 = 20NaClO3 + 3H20 + 40NaCl
NaOH + H3PO4 = NaH2PO4 + H2ONaOH + H3PO4 = NaH2PO4 + H2O
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2CO3 + CO2 + H2O = NaHCO3Na2CO3 + CO2 + H2O = 2NaHCO3
NaOH=Na2O + H2O2NaOH = Na2O + H2O
Na2CO3 + CuSO4 = Na2SO4 + CuCO3Na2CO3 + CuSO4 = Na2SO4 + CuCO3
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NO2 + NO3 = N2O5NO2 + NO3 = N2O5
NO2 + NO3 = N2O5NO2 + NO3 = N2O5
NaCl = Cl2 + Na2NaCl = Cl2 + 2Na
N2 + O2 = N1O1N2 + O2 = 2N1O1
NO = N2 + O22NO = N2 + O2
NaOH = Na2O + H2O2NaOH = Na2O + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2Cr2O7+AlPO4=Na3PO4+Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
Ni(NO3)3+PbBr4=NiBr3+Pb(NO3)44Ni(NO3)3 + 3PbBr4 = 4NiBr3 + 3Pb(NO3)4
NaHCO3+NaH2PO4=Na2H2P2O7+CO2+H2O0NaHCO3 + 2NaH2PO4 = Na2H2P2O7 + 0CO2 + H2O
NaHCO3+NaH2PO4=Na2HPO4+CO2+H2ONaHCO3 + NaH2PO4 = Na2HPO4 + CO2 + H2O
Na2CrO4+Pb(NO3)2=NaNO3+PbCrO4Na2CrO4 + Pb(NO3)2 = 2NaNO3 + PbCrO4
NaI + Cr(NO3)3 = NaNO3 + CrI33NaI + Cr(NO3)3 = 3NaNO3 + CrI3
Na2CrO4 + AgNO3 = NaNO3 + Ag2CrO4Na2CrO4 + 2AgNO3 = 2NaNO3 + Ag2CrO4
NaI + Pb(NO3)2 = NaNO3 + PbI22NaI + Pb(NO3)2 = 2NaNO3 + PbI2
NaI + Cr(NO3)3 = NaNO3 + CrI33NaI + Cr(NO3)3 = 3NaNO3 + CrI3
NaI + AgNO3 = NaNO3 + AgINaI + AgNO3 = NaNO3 + AgI
Na3PO4 + Pb(NO3)2 = NaNO3 + Pb3 (PO4)22Na3PO4 + 3Pb(NO3)2 = 6NaNO3 + Pb3(PO4)2
Na3PO4 + Cr(NO3)3 = NaNO3 + CrPO4Na3PO4 + Cr(NO3)3 = 3NaNO3 + CrPO4
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NaI + AgNO3 = NaNO3 + AgINaI + AgNO3 = NaNO3 + AgI
Na3PO4(aq) + NiCl2 (aq)= Na3Cl2 + Ni (PO4)Na3PO4(aq) + NiCl2(aq) = Na3Cl2 + Ni(PO4)
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 =NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N H3 + O2 = N2 + H2 O4NH3 + 3O2 = 2N2 + 6H2O
Na + O2 = Na2 O4Na + O2 = 2Na2O
Na + O2 = Na2 O4Na + O2 = 2Na2O
NAIO3 + NA2SO3 = NAI + NA2SO4NAIO3 + 3NA2SO3 = NAI + 3NA2SO4
NO2 +FeCl3 = FeNO2 +Cl3NO2 + FeCl3 = FeNO2 + Cl3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Ni + Ag (NO3) = Ni (NO3) + AgNi + Ag(NO3) = Ni(NO3) + Ag
Ni + Fe Cl3 = Ni Cl3 + FeNi + FeCl3 = NiCl3 + Fe
Ni2 + Fe Cl3 = Ni2 Cl3 + FeNi2 + FeCl3 = Ni2Cl3 + Fe
Ni + K4 Fe (CN) = Ni Fe (CN) + K4Ni + K4Fe(CN) = NiFe(CN) + K4
Ni + 2Na (OH) = Ni(OH)2 + 2NaNi + 2Na(OH) = Ni(OH)2 + 2Na
Ni + 2NH4 (SCN) = Ni(SCN)2 + 2NH4Ni + 2NH4(SCN) = Ni(SCN)2 + 2NH4
Ni2 + 2NH4 (SCN) = Ni(SCN)2 + 2NH4Ni2 + 4NH4(SCN) = 2Ni(SCN)2 + 4NH4
Ni + Na2 (CO3) = Ni CO3 + 2NaNi + Na2(CO3) = NiCO3 + 2Na
Ni + Hg Cl2 = Ni Cl2 + HgNi + HgCl2 = NiCl2 + Hg
Ni2 + Hg Cl2 = Ni Cl2 + HgNi2 + 2HgCl2 = 2NiCl2 + 2Hg
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2 CO3 + NaOH = Na2 OH+NaCO3 Na2CO3 + NaOH = Na2OH + NaCO3
N H3 + F2 = N2 F4 + H F2NH3 + 5F2 = N2F4 + 6HF
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=NON2 + O2 = 2NO
Na+Br2=NaBr2Na + Br2 = 2NaBr
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
N2+O2=NO2N2 + 2O2 = 2NO2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2 + H2O =HNO3 + NO 3NO2 + H2O = 2HNO3 + NO
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+F2=NF3N2 + 3F2 = 2NF3
N2+F2=NF2N2 + 2F2 = 2NF2
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
N+H=NH3N + 3H = NH3
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NO+O2=NO22NO + O2 = 2NO2
NH3=N2+H22NH3 = N2 + 3H2
NaOH+MgBr2=Mg(OH)2+NaBr2NaOH + MgBr2 = Mg(OH)2 + 2NaBr
Na2Cr2O7+AlPO4=Na3PO4+Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
NaCl+MnO2+H2SO4=NaHSO4+MnSO4+H2O+Cl22NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NaN3=Na+N22NaN3 = 2Na + 3N2
NH4I + Cl2 =NH4Cl + I2 2NH4I + Cl2 = 2NH4Cl + I2
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NaCl=Na2+Cl22NaCl = Na2 + Cl2
Na2B4O7+H2SO4+H2O=H3BO3+Na2SO4Na2B4O7 + H2SO4 + 5H2O = 4H3BO3 + Na2SO4
NaOH+KNO3=NaNO3+KOHNaOH + KNO3 = NaNO3 + KOH
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
NCl3=N2+Cl22NCl3 = N2 + 3Cl2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2 + O2 = N2O2N2 + O2 = N2O2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3=N2+H22NH3 = N2 + 3H2
Na2CO3+Ga(NO2)3=Ga2(CO3)3+NaNO23Na2CO3 + 2Ga(NO2)3 = Ga2(CO3)3 + 6NaNO2
Na + S = NaSNa + S = NaS
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na+Mg(NO3)2=Mg+NaNO32Na + Mg(NO3)2 = Mg + 2NaNO3
Na+O2=Na2O4Na + O2 = 2Na2O
NH4Cl + NaOH = NH4OH + NaClNH4Cl + NaOH = NH4OH + NaCl
N2 + O2 = N2O2N2 + O2 = 2N2O
Na +Br2 = NaBr2Na + Br2 = 2NaBr
N2 + H2O = H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
N2O = N2+O22N2O = 2N2 + O2
N2+O2 =N2O2N2 + O2 = 2N2O
NaOH + CO2 = H2CO3 + Na2O2NaOH + CO2 = H2CO3 + Na2O
NaOH + CO2 = H2CO3 + Na2O2NaOH + CO2 = H2CO3 + Na2O
NH3 + HNO2 = N2 + H2ONH3 + HNO2 = N2 + 2H2O
NH4VO3 + HNO3 = VO2NO3 + NO2 + H2ONH4VO3 + 8HNO3 = VO2NO3 + 8NO2 + 6H2O
NH4VO3 + HNO3 = VO3NO3 + NO2 + H2ONH4VO3 + 10HNO3 = VO3NO3 + 10NO2 + 7H2O
NH4VO3 + HNO3 = VO4NO3 + NO2 + H2ONH4VO3 + 12HNO3 = VO4NO3 + 12NO2 + 8H2O
N2O5(g)=NO2(g)+O2(g)2N2O5(g) = 4NO2(g) + O2(g)
N2O5(g)=NO2(g)+O2(g)2N2O5(g) = 4NO2(g) + O2(g)
NH4NO3 = N2 + O2 +H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 +H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 +H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2CrO4(aq)+Pb(NO3)2(aq)=PbCrO4(s)+NaNO3(aq)Na2CrO4(aq) + Pb(NO3)2(aq) = PbCrO4(s) + 2NaNO3(aq)
NH4OH + H2C2O4 = NH4C2O4 + H2OHNH4OH + H2C2O4 = NH4C2O4 + H2OH
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH4OH + KAl(SO4)2 * 12H2O = Al(OH)3 + (NH4)2SO4 + KOH + H2O4NH4OH + KAl(SO4)2*12H2O = Al(OH)3 + 2(NH4)2SO4 + KOH + 12H2O
NH4OH + KAl(SO4)2 * 12H2O = Al(OH)3 + (NH4)2SO4 + KOH + H2O4NH4OH + KAl(SO4)2*12H2O = Al(OH)3 + 2(NH4)2SO4 + KOH + 12H2O
Na2CO3 + NaClO + Cr(OH)3 = Na2CrO4 + NaCl + CO2 + H2O2Na2CO3 + 3NaClO + 2Cr(OH)3 = 2Na2CrO4 + 3NaCl + 2CO2 + 3H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.