Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
NO = N2O +NO23NO = N2O + NO2
NO3- + H+ + e = N2 + H2O2NO3- + 12H+ + 10e = N2 + 6H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
No3-+I-=No2+I2-2No3- + 2I- = -3No2 + I2
No3-+I-=No2+I2-2No3- + 2I- = -3No2 + I2
NaBr + F2 == NaF + Br22NaBr + F2 = 2NaF + Br2
NH3 + Cl2 = N2 + HCl2NH3 + 3Cl2 = N2 + 6HCl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2CO3(aq) + Ca(OH)2(aq) = NaOH(aq) + CaCO3(s)Na2CO3(aq) + Ca(OH)2(aq) = 2NaOH(aq) + CaCO3(s)
NO3-+H2S = N2+ SO42- + H+ + H2O34NO3- + 2H2S = 17N2 + 2SO42- - 32H+ + 18H2O
NO3-+H2S = N2+ SO42-+ H++ H2O34NO3- + 2H2S = 17N2 + 2SO42- - 32H+ + 18H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NaHCO3+HCl=CO2+NaCl+H2ONaHCO3 + HCl = CO2 + NaCl + H2O
N2O4 + C2H6O = N2 + H2O + CO23N2O4 + 2C2H6O = 3N2 + 6H2O + 4CO2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl=NaClNa + Cl = NaCl
Na+Cl=NaClNa + Cl = NaCl
Na+Cl=NaClNa + Cl = NaCl
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na3PO4(aq)+Zn(NO3)2(aq)=NaNO3(aq)+Zn3(PO4)2(s)2Na3PO4(aq) + 3Zn(NO3)2(aq) = 6NaNO3(aq) + Zn3(PO4)2(s)
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
NaCN + H2SO4 = HCN + Na2SO42NaCN + H2SO4 = 2HCN + Na2SO4
NH3 + F2 = NH4F + F30NH3 + 3F2 = 0NH4F + 2F3
NaOH + H2SO4 =Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2SnO2 + Bi(OH)3 = Bi+ Na2SnO3 + H2O3Na2SnO2 + 2Bi(OH)3 = 2Bi + 3Na2SnO3 + 3H2O
NiO2+ 2H2O+Fe=Ni(OH2)+Fe(OH)2NiO2 + 3H2O + 2Fe = Ni(OH2) + 2Fe(OH)2
NO2+ 2H2O+Fe=N(OH2)+Fe(OH)2NO2 + 3H2O + 2Fe = N(OH2) + 2Fe(OH)2
NaCl + H2SO4 = HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
NO(g) + H2(g) = N2(g) + H2O(l)2NO(g) + 2H2(g) = N2(g) + 2H2O(l)
Na(s)+O2(g)=Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na(s)+O2(g)=Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na(s)+O2(g)=Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na(s)+O2(g)=Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na(s)+O2(g)=Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
NaHCO3+HC2H3O2=NaC2H3O2+CO2 +H2ONaHCO3 + HC2H3O2 = NaC2H3O2 + CO2 + H2O
NaHCO3+HC2H3O2=NaC2H3O2+CO2 +H2ONaHCO3 + HC2H3O2 = NaC2H3O2 + CO2 + H2O
Ni(NO3)2 + K3PO4= KNO3 + Ni3(PO4)23Ni(NO3)2 + 2K3PO4 = 6KNO3 + Ni3(PO4)2
NaBr + AgC2H3O2=NaC2H3O2 + AgBrNaBr + AgC2H3O2 = NaC2H3O2 + AgBr
NaCl + KI = KCl + NaINaCl + KI = KCl + NaI
NaCl + KI = KCl NaINaCl + KI = KClNaI
Na+HOH=NaOH+HNa + HOH = NaOH + H
Na2S +K2CrO4 + H2SO4 = Na2SO4 + K2SO4 + Cr2(SO4)3 +H2O3Na2S + 8K2CrO4 + 20H2SO4 = 3Na2SO4 + 8K2SO4 + 4Cr2(SO4)3 + 20H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaF(aq)+Al(NO3)3(aq)=AlF3(s)+NaNO3(aq)3NaF(aq) + Al(NO3)3(aq) = AlF3(s) + 3NaNO3(aq)
NaF(aq)+Al(NO3)3(aq)=AlF3(s)+NaNO3(aq)3NaF(aq) + Al(NO3)3(aq) = AlF3(s) + 3NaNO3(aq)
N2(g)+H2(g)= NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaMnO4 + HBr = NaBr + MnBr2 +Br2 + H2O2NaMnO4 + 16HBr = 2NaBr + 2MnBr2 + 5Br2 + 8H2O
NaNO3+ HNO3=H30+NaNO3NaNO3 + 0HNO3 = 0H30 + NaNO3
NaNO3+ HNO3=H30+NaNO3NaNO3 + 0HNO3 = 0H30 + NaNO3
NaNO3 +PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Ni(ClO3)2=NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NaCl + F2 = NaF + Cl 2NaCl + F2 = 2NaF + 2Cl
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaI+K2Cr2O7+H2SO4=I2+Cr2(SO4)3+ K2SO4+NaSO4+H2O6NaI + 2K2Cr2O7 + 14H2SO4 = 3I2 + 2Cr2(SO4)3 + 2K2SO4 + 6NaSO4 + 14H2O
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NaClO3 = NaCl +O22NaClO3 = 2NaCl + 3O2
N2H2 + H2O = N2 + H2O0N2H2 + H2O = 0N2 + H2O
Na2O+H2O = NaOHNa2O + H2O = 2NaOH
NaHCO3+HCl=H2O+CO2+NaClNaHCO3 + HCl = H2O + CO2 + NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHCO3+N2H4+I2=N2+NaI+CO2+H2O4NaHCO3 + N2H4 + 2I2 = N2 + 4NaI + 4CO2 + 4H2O
NaHCO3+N2H4+I2=N2+NaI+CO2+H2O4NaHCO3 + N2H4 + 2I2 = N2 + 4NaI + 4CO2 + 4H2O
NaHCO3(s)=NaOH(s)+CO2(g) NaHCO3(s) = NaOH(s) + CO2(g)
NaHCO3(s)=NaOH(s)+CO2(g) NaHCO3(s) = NaOH(s) + CO2(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
Na2SO4 + Fe (OH) = Fe2(SO4) + NaOHNa2SO4 + 2Fe(OH) = Fe2(SO4) + 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3(g)+ O2(g)= NO(g)+ H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NaF + (Br)2 = NaBr + (F)22NaF + (Br)2 = 2NaBr + (F)2
NH4Cl + NaOH + H2O= NH4OH+NaClNH4Cl + NaOH + 0H2O = NH4OH + NaCl
NH4Cl+NaOH+H2O= NH4OH+NaClNH4Cl + NaOH + 0H2O = NH4OH + NaCl
NH4Cl+NaOH= NH4OH+NaClNH4Cl + NaOH = NH4OH + NaCl
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NaHCO3+HCl=CO2+NaCl+H2ONaHCO3 + HCl = CO2 + NaCl + H2O
NH3 = H2 + N22NH3 = 3H2 + N2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaNo3 + CaCl2 = Ca(No3)2 + NaCl2NaNo3 + CaCl2 = Ca(No3)2 + 2NaCl
Na + H2SO3 = NaSO3 + H2Na + H2SO3 = NaSO3 + H2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NH4SCN + H2SO4 + H2O = NH4HSO4 + COSNH4SCN + 2H2SO4 + H2O = 2NH4HSO4 + COS
NH3+O2+H2O=HNO3NH3 + 2O2 - H2O = HNO3
NH3 + HCl =NH4ClNH3 + HCl = NH4Cl
Na3PO4 + MgCl2=Mg3(PO4)2 +NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + Cl = NaClNa + Cl = NaCl
NH3 +HCl =NH4ClNH3 + HCl = NH4Cl
NH3 + HCl =NH4ClNH3 + HCl = NH4Cl
Na2SO4(aq)+CaI2(aq)=CaSO4(s)+2NaI(aq)Na2SO4(aq) + CaI2(aq) = CaSO4(s) + 2NaI(aq)
NH3 + HCl =NH4ClNH3 + HCl = NH4Cl
NaHCO3+H2CO3= NaH2+CO32NaHCO3 + H2CO3 = 2NaH2 + 3CO3
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaCl+Pb(NO3)2=Na(NO3)2 + PbClNaCl + Pb(NO3)2 = Na(NO3)2 + PbCl
Na2SO4+BaCl2=BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NaNO3+Zn=Zn (NO3)2+Na2NaNO3 + Zn = Zn(NO3)2 + 2Na
Na2SO4 + 2 HCl = 2 NaCl + H2O + SO3Na2SO4 + 2HCl = 2NaCl + H2O + SO3
NO2 + O2= N2O54NO2 + O2 = 2N2O5
NH3(g)+O2(g)=NO(g)+H2O(l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3 + Na2S + SO2 = CO2 + Na2S2O3Na2CO3 + 2Na2S + 4SO2 = CO2 + 3Na2S2O3
NH4CO3+O2=NH3+H2O+CO24NH4CO3 - O2 = 4NH3 + 2H2O + 4CO2
NI3 = N2 + I22NI3 = N2 + 3I2
Na +2 HOH = NaOH + H22Na + 2HOH = 2NaOH + H2
Na + HOH = NaOH + H22Na + 2HOH = 2NaOH + H2
Na + HOH = NaOH + HNa + HOH = NaOH + H
Na + HOH = NaOH + HNa + HOH = NaOH + H
Na + HOH = NaOH + HNa + HOH = NaOH + H
N2H4 + N2O4=N2 + H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NaAl(SO4)2 + 3NaHCO3 = 3CO2 + Al(OH)3 + 2Na2SO4NaAl(SO4)2 + 3NaHCO3 = 3CO2 + Al(OH)3 + 2Na2SO4
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NH3+O2 = HNO3+H2ONH3 + 2O2 = HNO3 + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(OH)3 = Ni2O3 +H2O2Ni(OH)3 = Ni2O3 + 3H2O
NH3+NO = N2+ H2O4NH3 + 6NO = 5N2 + 6H2O
Na3PO4(aq) + Zn(NO3)2(aq) = NaNO3(aq) + Zn3(PO4)2(s)2Na3PO4(aq) + 3Zn(NO3)2(aq) = 6NaNO3(aq) + Zn3(PO4)2(s)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 = N2 + H22NH3 = N2 + 3H2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na+2O=Na2O2Na + O = Na2O
N2 (g)+O2 (g)+H2O=HNO3 (aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
Na3PO4 + 3AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
N2 + H2= 2NH3N2 + 3H2 = 2NH3
N2(g)+O2(g)=N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
N2(g)+H2=NH3(g)N2(g) + 3H2 = 2NH3(g)
NaCiO+Fe=Fe2O3+NaCi3NaCiO + 2Fe = Fe2O3 + 3NaCi
NaHCO+CH3COOH=H2O+CH3COONa2NaHCO + CH3COOH = 0H2O + 2CH3COONa
N + O2 = N2 O54N + 5O2 = 2N2O5
N + O2 = N2 O34N + 3O2 = 2N2O3
Na + Cl = Cl NaNa + Cl = ClNa
N2+O2= NON2 + O2 = 2NO
NO+Ag=NO3+Ag0NO + Ag = 0NO3 + Ag
Na + Cl = ClNaNa + Cl = ClNa
Na + Cl = ClNaNa + Cl = ClNa
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaN3= Na + N22NaN3 = 2Na + 3N2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na3PO4(aq)+Ca(OH)2(aq)=Ca3(PO4)2(s)+NaOH(aq)2Na3PO4(aq) + 3Ca(OH)2(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
NH3+Mg=Mg3N2+H22NH3 + 3Mg = Mg3N2 + 3H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2SO3+KIO3+H=I2+K2SO4+NaI+H2ONa2SO3 + 2KIO3 + 10H = 0I2 + K2SO4 + 2NaI + 5H2O
NaBr +Cl = NaCl + BrNaBr + Cl = NaCl + Br
Na2SO3+KIO3+H=I2+K2SO4+NaI+H2ONa2SO3 + 2KIO3 + 10H = 0I2 + K2SO4 + 2NaI + 5H2O
NO2(g)+H2O(g)=HNO3(s)+NO(g)3NO2(g) + H2O(g) = 2HNO3(s) + NO(g)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
Na3PO4+3KOH=3NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
N2H4 = NH3 + N23N2H4 = 4NH3 + N2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni + NaOH = Ni(OH)2 + NaNi + 2NaOH = Ni(OH)2 + 2Na
Na2CO3 + Al(CO3)3 = Na2(Na3)3 + AlCO3-22Na2CO3 + 11Al(CO3)3 = -4Na2(Na3)3 + 11AlCO3
Na2SO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+SO2(g)Na2SO3(aq) + 2HCl(aq) = H2O(l) + 2NaCl(aq) + SO2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+H2O+Al=NaAl(OH)4+H22NaOH + 6H2O + 2Al = 2NaAl(OH)4 + 3H2
N2O5+K2O2=KNO3+O22N2O5 + 2K2O2 = 4KNO3 + O2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2O=N2+O22N2O = 2N2 + O2
N2+H2=NH3N2 + 3H2 = 2NH3
Na(IO3) + H2SO3 + HCl = Na2(SO4) + H2O + I2 + NaCl-2Na(IO3) - 5H2SO3 + 8HCl = -5Na2(SO4) - H2O - I2 + 8NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2 + H2O = NH3 + H2O0NO2 + H2O = 0NH3 + H2O
Na2CO3+Mg(NO3)2=MgCO3+NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
Na3PO4+AgNO3=NaNO3+Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
Na2CO3=Na2O+CO2Na2CO3 = Na2O + CO2
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3 + O = NO + H2020NH3 + 20O = 20NO + 3H20
Na + O2 = Na2O22Na + O2 = Na2O2
NaHCO3 + H2SO4 = CO2 + Na2SO4 + H2O2NaHCO3 + H2SO4 = 2CO2 + Na2SO4 + 2H2O
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+Mg=Mg3N2+H22NH3 + 3Mg = Mg3N2 + 3H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl=Na+Cl22NaCl = 2Na + Cl2
NaCl=Na+ClNaCl = Na + Cl
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3 + H2SO4=Na2SO4 + H2O = CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
Na2SO4+BaCl2=NaCl+BaSO4Na2SO4 + BaCl2 = 2NaCl + BaSO4
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
N2O+Cu=N2 +CuON2O + Cu = N2 + CuO
NH3= N + HNH3 = N + 3H
Na2 + S= NaSNa2 + 2S = 2NaS
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 =2 NON2 + O2 = 2NO
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na2SO4 + CaCl2 = CaSO4 + NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na2C2O4 + Ba(NO3)2 = BaC2O4 + Na2(NO3)2Na2C2O4 + Ba(NO3)2 = BaC2O4 + Na2(NO3)2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
NaHCO3 + CH3COOH = NaH2CCOOH + H2O + CO2NaHCO3 + CH3COOH = NaH2CCOOH + H2O + CO2
NaHCO3 + CH3COOH = NaH2CCOOH + H2O + CO2NaHCO3 + CH3COOH = NaH2CCOOH + H2O + CO2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na3PO4+KOH = NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
Na + O2= Na2O4Na + O2 = 2Na2O
NaOH + Cl2 = NaCl + NaClO2 + H2O4NaOH + 2Cl2 = 3NaCl + NaClO2 + 2H2O
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
N2H4=NH3(g)+N2(g)3N2H4 = 4NH3(g) + N2(g)
NH3+O2=NO2+H2020NH3 + 20O2 = 20NO2 + 3H20
Na3PO4(aq)+Zn(NO3)2(aq)=NaNO3(aq)+Zn3(PO4)2(s)2Na3PO4(aq) + 3Zn(NO3)2(aq) = 6NaNO3(aq) + Zn3(PO4)2(s)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NO + 2 H2O + 3 Fe3 = NO3- + 4 H+ + 3 Fe2 0NO + 0H2O + 2Fe3 = 0NO3- + 0H+ + 3Fe2
Na2SO4 + C= CO 2 + Na2SNa2SO4 + 2C = 2CO2 + Na2S
NO3- + H+ + e- = N2 + H2O2NO3- + 12H+ + 5e- = N2 + 6H2O
NO3- + H+ + e- = N2 + H2O2NO3- + 12H+ + 5e- = N2 + 6H2O
NaI3+SnSO4=NaSO4+SnI3NaI3 + SnSO4 = NaSO4 + SnI3
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+Mg=Mg3N2+H22NH3 + 3Mg = Mg3N2 + 3H2
NH3+Mg=Mg3N2+H22NH3 + 3Mg = Mg3N2 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NaI(aq)+Pb(C2H3O2)2(aq)=PbI2(s)+NaC2H3O2(aq)2NaI(aq) + Pb(C2H3O2)2(aq) = PbI2(s) + 2NaC2H3O2(aq)
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2CO3+C+N2=NaCN+CONa2CO3 + 4C + N2 = 2NaCN + 3CO
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NaClO 3 + 2Al = Al 2 O 3 + NaCl NaClO3 + 2Al = Al2O3 + NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + H2SO4 + MnO2 = Na2SO4 + MnSO4 + H2O + Cl22NaCl + 2H2SO4 + MnO2 = Na2SO4 + MnSO4 + 2H2O + Cl2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na(s)+ZnSO4(aq)=NaSO4+ZnNa(s) + ZnSO4(aq) = NaSO4 + Zn
NaCl(aq)+AgNO3(aq)=AgCl+NaNO3(aq)NaCl(aq) + AgNO3(aq) = AgCl + NaNO3(aq)
NaCl(aq)+AgNO3(aq)=AgCl+NaNO3(aq)NaCl(aq) + AgNO3(aq) = AgCl + NaNO3(aq)
Na(s) + O(g)=Na2O2Na(s) + O(g) = Na2O
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
NaCl + Ca(NO3)2=CaCl2+ 2NaNO3 2NaCl + Ca(NO3)2 = CaCl2 + 2NaNO3
NaCl + Ca(NO3)2=CaCl2+ 2NaNO3 2NaCl + Ca(NO3)2 = CaCl2 + 2NaNO3
Na2CO3+Ca (OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3= N2O + H2ONH4NO3 = N2O + 2H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O=N2+O22N2O = 2N2 + O2
Na(s)+O2(g)=Na2O(s)4Na(s) + O2(g) = 2Na2O(s)
N2O= N2+O22N2O = 2N2 + O2
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
Na2SO4 + AgNO3 = Ag2SO4 + NaNO3 Na2SO4 + 2AgNO3 = Ag2SO4 + 2NaNO3
Na3P+MgBr2=NaBr+Mg3P22Na3P + 3MgBr2 = 6NaBr + Mg3P2
NH3 + O2 = H2O+ HNO3NH3 + 2O2 = H2O + HNO3
NaI + H3PO4 = HI + Na3PO43NaI + H3PO4 = 3HI + Na3PO4
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NaHSO4+Al+NaOH=Na2S+Al2O3+H2O3NaHSO4 + 8Al + 3NaOH = 3Na2S + 4Al2O3 + 3H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S+AgNO3 = Ag2S + NaNO3Na2S + 2AgNO3 = Ag2S + 2NaNO3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4 + HNO3 = HSO4 + Na2NO3Na2SO4 + HNO3 = HSO4 + Na2NO3
Na2SO4 + AgNO3 = AgSO4 + Na2NO3Na2SO4 + AgNO3 = AgSO4 + Na2NO3
NO3+H2=N+H2ONO3 + 3H2 = N + 3H2O
NO2(g) +H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2H4(l)=NH3(g) +N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4OH+Cu(NO3)2=NH4NO3+Cu(OH)22NH4OH + Cu(NO3)2 = 2NH4NO3 + Cu(OH)2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na3PO4+CoSO4=Co3(PO4)2+Na2SO42Na3PO4 + 3CoSO4 = Co3(PO4)2 + 3Na2SO4
NaOH(aq) + H3PO4(aq) = Na3PO4(aq) + H2O(l)3NaOH(aq) + H3PO4(aq) = Na3PO4(aq) + 3H2O(l)
NaCl(aq) + Ba(s) = BaCl2(aq) + Na(s)2NaCl(aq) + Ba(s) = BaCl2(aq) + 2Na(s)
NaCl+H2SO4=Cl2+Na2SO4+H2O+H2S8NaCl + 5H2SO4 = 4Cl2 + 4Na2SO4 + 4H2O + H2S
NH4ClO4 (s) + Al (s) = Al2O3 (g) + HCl (g) + N2 (g) + H2O (g) 6NH4ClO4(s) + 10Al(s) = 5Al2O3(g) + 6HCl(g) + 3N2(g) + 9H2O(g)
NaHCO3 + HCl = NaCl + CO2 + H2ONaHCO3 + HCl = NaCl + CO2 + H2O
NH4 + Fe2O3 + H+ = N2 + Fe + H2O 6NH4 + 4Fe2O3 + 0H+ = 3N2 + 8Fe + 12H2O
N2 + H2 =NH3N2 + 3H2 = 2NH3
NH4 + Fe2O3 + H+ = N2 + Fe + H2O6NH4 + 4Fe2O3 + 0H+ = 3N2 + 8Fe + 12H2O
NH4 + Fe2O3 = N2 + Fe + H2O 6NH4 + 4Fe2O3 = 3N2 + 8Fe + 12H2O
NO3+ H2S = NO + S + H2ONO3 + 2H2S = NO + 2S + 2H2O
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=NH3N2 + 3H2 = 2NH3
N+H=NH3N + 3H = NH3
N2+H2=NHN2 + H2 = 2NH
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
NaF(aq)+ HNO3(aq)=NaNO3(aq)+HF(aq)NaF(aq) + HNO3(aq) = NaNO3(aq) + HF(aq)
NaF(aq)+ HNO3(aq)=NaNO3(aq)+HF(aq)NaF(aq) + HNO3(aq) = NaNO3(aq) + HF(aq)
NaF(aq)+ HNO3(aq)=NaNO3(aq)+HF(aq)NaF(aq) + HNO3(aq) = NaNO3(aq) + HF(aq)
N2+6H2O=2HNO3+7H2N2 + 6H2O = 2HNO3 + 5H2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na+H2SO4 = Na2SO4+H22Na + H2SO4 = Na2SO4 + H2
Na+H2SO4 = NaSO4+H2Na + H2SO4 = NaSO4 + H2
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+Mg=Mg3N2+H22NH3 + 3Mg = Mg3N2 + 3H2
NH3+Mg=Mg3N2+H32NH3 + 3Mg = Mg3N2 + 2H3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+HCl=NaCl+H2ONa2O + 2HCl = 2NaCl + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaCl=Na+Cl22NaCl = 2Na + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
NaCi=Na+Ci22NaCi = 2Na + Ci2
NaNO2(aq) + HBr(aq)= NaBr(aq) + HNO2(aq)NaNO2(aq) + HBr(aq) = NaBr(aq) + HNO2(aq)
NaHCO3 + Ca(H2PO4)2 = Na2HPO4 + CaHPO4 + CO2 + H2O2NaHCO3 + Ca(H2PO4)2 = Na2HPO4 + CaHPO4 + 2CO2 + 2H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2+O2=NON2 + O2 = 2NO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + H2 SO4 = Na2 SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3(s) = N2(g) + H2O(g) + O2(g) 2NH4NO3(s) = 2N2(g) + 4H2O(g) + O2(g)
NH4NO3(s) = N2(g) + H2O(g) + O2(g) 2NH4NO3(s) = 2N2(g) + 4H2O(g) + O2(g)
NH4NO3(s) = N2(g) + 2H2O(g) + O2(g) 2NH4NO3(s) = 2N2(g) + 4H2O(g) + O2(g)
Na + S = Na2S2Na + S = Na2S
Na2Cr2O7 + H2SO4 + H2O = 2 H2CrO4 + 2 NaHSO4 Na2Cr2O7 + 2H2SO4 + H2O = 2H2CrO4 + 2NaHSO4
Na2O+ Na2O2+NiO = Na2NiO2Na2O + 0Na2O2 + NiO = Na2NiO2
NaOH + CoCl2= CoOH + NaCl2NaOH + CoCl2 = CoOH + NaCl2
NH4 + NO3 = N2O + H2ONH4 + NO3 = N2O + 2H2O
NaNO3=NaNO2+ONaNO3 = NaNO2 + O
NH4NO3 = N2O+H2ONH4NO3 = N2O + 2H2O
NaOH(aq) + HCl(aq) = H2O(l) + NaCl(aq)NaOH(aq) + HCl(aq) = H2O(l) + NaCl(aq)
Na2CO3+Cr(NO3)3=Cr2(CO3)3+NaNO33Na2CO3 + 2Cr(NO3)3 = Cr2(CO3)3 + 6NaNO3
NH3+H3PO4=(NH4)2HPO42NH3 + H3PO4 = (NH4)2HPO4
N2+H2=NH3N2 + 3H2 = 2NH3
NaHSO3 = Na2SO3 + SO2 + H2O2NaHSO3 = Na2SO3 + SO2 + H2O
N2 + H2 =NH3N2 + 3H2 = 2NH3
NaCI+H2O=2NaOH+HCINaCI + H2O = NaOH + HCI
NaCI+H2O=2NaOH+HCINaCI + H2O = NaOH + HCI
NaCI+H2O=2NaOH+HCINaCI + H2O = NaOH + HCI
NaCI+H2O=NaOH+HCINaCI + H2O = NaOH + HCI
NaCI+H2O=NaOH+HCINaCI + H2O = NaOH + HCI
NaCI+H2O=NaOH+HCINaCI + H2O = NaOH + HCI
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO(g)+H2(g)=NH(g)+H2O(g)2NO(g) + 3H2(g) = 2NH(g) + 2H2O(g)
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NH3=H2+N22NH3 = 3H2 + N2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH4Br+Pb(C2H3O2)2=NH4(C2H3O2)+PbBr22NH4Br + Pb(C2H3O2)2 = 2NH4(C2H3O2) + PbBr2
NH4Br+Pb(C2H3O2)2=NH4(C2H3O2)+PbBr22NH4Br + Pb(C2H3O2)2 = 2NH4(C2H3O2) + PbBr2
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NaHSO3(s) =Na2SO3(s) + SO2(g) + H2O(l) 2NaHSO3(s) = Na2SO3(s) + SO2(g) + H2O(l)
Na + H2O =H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NH3+Na2CrO4+H2O+NaCl=NaNO3+CrCl3+NaOH3NH3 + 8Na2CrO4 + 14H2O + 24NaCl = 3NaNO3 + 8CrCl3 + 37NaOH
Na2S + 2 HNO3 = 2 NaNO3 + H2SNa2S + 2HNO3 = 2NaNO3 + H2S
NO2+H20=HNO3+NO40NO2 + H20 = 20HNO3 + 20NO
NaOH + Cu = Cu(OH)2 + Na2NaOH + Cu = Cu(OH)2 + 2Na
NH4NO3=2N2+O2+4H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3=2N2+O2+4H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaHCO3 + HNO3 = NaNO3(aq) + CO2(g) + H2O(l) NaHCO3 + HNO3 = NaNO3(aq) + CO2(g) + H2O(l)
NaN3 = Na3N+N23NaN3 = Na3N + 4N2
NaCl (aq) + AgC 2 H 3 O 2 (aq) = NaC 2 H 3 O 2 (aq) + AgCl (s)NaCl(aq) + AgC2H3O2(aq) = NaC2H3O2(aq) + AgCl(s)
Ni(NO3 ) 2 (aq) + NaOH (aq) = Ni(OH) 2 (s) + NaNO 3 (aq)Ni(NO3)2(aq) + 2NaOH(aq) = Ni(OH)2(s) + 2NaNO3(aq)
Ni(ClO3)2+K3ASO4=KClO3+Ni3(ASO4)2 3Ni(ClO3)2 + 2K3ASO4 = 6KClO3 + Ni3(ASO4)2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH3+Cl2=N2H4+NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
NH3 + O2= NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=NaO2Na + O2 = 2NaO
Na+O2=NaO2Na + O2 = 2NaO
NH4NO3 + Pb(ClO4)2 = Pb(NO3)2 + NH4ClO42NH4NO3 + Pb(ClO4)2 = Pb(NO3)2 + 2NH4ClO4
Na2S + Pb(C2H3O2)2 = PbS +NaC2H3O2Na2S + Pb(C2H3O2)2 = PbS + 2NaC2H3O2
Na3PO4 + Ba(NO3)2 = NaNO3 + Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
N2O (g)+O2 (g) = NO2 (g)2N2O(g) + 3O2(g) = 4NO2(g)
NO3- + 4H+ + Ag = Ag+ + NO + 2H2ONO3- + 4H+ + 3Ag = 3Ag+ + NO + 2H2O
Na2CO3+CaCl2=CaCO3+NaClNa2CO3 + CaCl2 = CaCO3 + 2NaCl
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
N2+O2=NO2N2 + 2O2 = 2NO2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2+O2=NO2N2 + 2O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 +H2 =NH3N2 + 3H2 = 2NH3
NO +O2 = NO22NO + O2 = 2NO2
N2 +H2 =NH3N2 + 3H2 = 2NH3
N2O (g)+ O2(g) = NO2(g)2N2O(g) + 3O2(g) = 4NO2(g)
Na2SO4(aq)+4C(s) = Na2S(aq)+4CO(g)Na2SO4(aq) + 4C(s) = Na2S(aq) + 4CO(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
Na2O + (NH4)2SO4 = Na2SO4 + H2O + NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na2SO4 + 2S = Na2S + 2SO2Na2SO4 + 2S = Na2S + 2SO2
NH4Cl + Ba(OH)2 = NH4OH + BaCl22NH4Cl + Ba(OH)2 = 2NH4OH + BaCl2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S + H2SO4 = Na2SO4 + SO3 +H2O0Na2S + H2SO4 = 0Na2SO4 + SO3 + H2O
N2 (g) + H2 (g) = NH3 (g) N2(g) + 3H2(g) = 2NH3(g)
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+ClF3=N2+Cl2+HF2NH3 + 2ClF3 = N2 + Cl2 + 6HF
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + HNO3 = NaNO3 + H2ONaOH + HNO3 = NaNO3 + H2O
NaCl + H2SO4 = NaHSO4 + HClNaCl + H2SO4 = NaHSO4 + HCl
NaI(aq)+Pb(C2H3O2)2(aq)=PbI2(s)+NaC2H3O2(aq)2NaI(aq) + Pb(C2H3O2)2(aq) = PbI2(s) + 2NaC2H3O2(aq)
NaI+Cl2=NaCl+I22NaI + Cl2 = 2NaCl + I2
NH3 + 2NO3 = N2 + H2O4NH3 + 2NO3 = 3N2 + 6H2O
Na+O2=NaO2Na + O2 = 2NaO
Na2CO3+CaSO4=Na2SO4+CaCO3Na2CO3 + CaSO4 = Na2SO4 + CaCO3
NaCl+Pb(NO3)2=NaNO3+PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
NaSO4+BaCl2=BaSO4+NaCl2NaSO4 + BaCl2 = BaSO4 + NaCl2
NO3- + H2SO4 + Fe2+ = Fe3+ + NO + SO42- + H2O39NO3- + 2H2SO4 + 111Fe2+ = 74Fe3+ + 39NO + 2SO42- + 2H2O
NH4VO3 = V2O5 + 2H2O + 2NH32NH4VO3 = V2O5 + H2O + 2NH3
NH4VO3 = V2O5 + NH3 +H2O2NH4VO3 = V2O5 + 2NH3 + H2O
NH4V3O7 = NH4VO3 +H2O +VO2NH4V3O7 = NH4VO3 + 0H2O + 2VO2
NH4V3O7 = VO2 + NH4VO3 NH4V3O7 = 2VO2 + NH4VO3
NH4V3O7 + VOC2O4 = V2O5 + NH3 + CO +H2O2NH4V3O7 + 4VOC2O4 = 5V2O5 + 2NH3 + 8CO + H2O
Ni(OH)2(s) +2 HCl(aq) = NiCl2(s) +2 H2O(l)Ni(OH)2(s) + 2HCl(aq) = NiCl2(s) + 2H2O(l)
NaOH+HCl = NaCl+H2ONaOH + HCl = NaCl + H2O
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
N2O3=N2O4+O2-2N2O3 = -2N2O4 + O2
N2O3=N2O4+O2-2N2O3 = -2N2O4 + O2
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3(g)+O2(g)=NO(g)+H2O(g) 4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NaBr+K3PO4=KBr+Na3PO43NaBr + K3PO4 = 3KBr + Na3PO4
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NO+H2O+Sb2O5=SbO+HNO32NO + H2O + Sb2O5 = 2SbO + 2HNO3
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaF= Na +FNaF = Na + F
Na3P + CaF2 = NaF +Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
Na + ZnI2 = NaI + NaZn49Na + 4ZnI2 = 8NaI + NaZn4
NO(g)+CO(g)=N2(g)+CO2(g)2NO(g) + 2CO(g) = N2(g) + 2CO2(g)
NaOH+Fe(NO3)3 = Fe(OH)3+NaNO33NaOH + Fe(NO3)3 = Fe(OH)3 + 3NaNO3
Na2S + O2 + H2O = Na2S2O3 + NaOH2Na2S + 2O2 + H2O = Na2S2O3 + 2NaOH
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
N2H4+O2=N2+H2ON2H4 + O2 = N2 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO + O2=NO22NO + O2 = 2NO2
NH4NO2 (s) = N2 (g)+H2O (l)NH4NO2(s) = N2(g) + 2H2O(l)
Na+H2O=NaOH+HNa + H2O = NaOH + H
NO3-+4H++Fe2+=NO+2H2O+Fe3+-1NO3- - 4H+ + 9Fe2+ = -1NO - 2H2O + 6Fe3+
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaCN + Cl2 +NaOH = N2 + Na2CO3 + NaCl + H2O2NaCN + 5Cl2 + 12NaOH = N2 + 2Na2CO3 + 10NaCl + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2O=N2+O22N2O = 2N2 + O2
N2O=N2+O22N2O = 2N2 + O2
Na2S(aq)+Pb(NO3)2(aq)=NaNO3(aq)+PbS(s)Na2S(aq) + Pb(NO3)2(aq) = 2NaNO3(aq) + PbS(s)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.