Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na+O2 = Na2O22Na + O2 = Na2O2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+O2=Na2O4Na + O2 = 2Na2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+O2=Na2O22Na + O2 = Na2O2
Na+NaNO3 = Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na+NaNO3 = Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2O+F2O=2NaO+F2Na2O + F2O = 2NaO + F2
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
Na+H2SO4=Na2SO4+H22Na + H2SO4 = Na2SO4 + H2
NO+H2=NH3(g)+H2O(g)2NO + 5H2 = 2NH3(g) + 2H2O(g)
NH4Cl+Pb(C2H3O2)2 = C2H3O2NH4+PbCl22NH4Cl + Pb(C2H3O2)2 = 2C2H3O2NH4 + PbCl2
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
Na2CO3+H2O+CO2=NaHCO3 Na2CO3 + H2O + CO2 = 2NaHCO3
Na2CO3+H2O+CO2=NaHCO3 Na2CO3 + H2O + CO2 = 2NaHCO3
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2CO3 + Sr(C2H3O2)2=NaC2H3O2 + SrCO3Na2CO3 + Sr(C2H3O2)2 = 2NaC2H3O2 + SrCO3
Na2CO3 + C + N = NaCN + CONa2CO3 + 4C + 2N = 2NaCN + 3CO
N2 + I2 = NI3N2 + 3I2 = 2NI3
Na+Cu(NO3)=NaNO3+CuNa + Cu(NO3) = NaNO3 + Cu
Na+Cu(NO3)=NaNO3+CuNa + Cu(NO3) = NaNO3 + Cu
NO3 + Sn = NO + Sn0NO3 + Sn = 0NO + Sn
N2 + H = 2NH3N2 + 6H = 2NH3
Na+F=NaFNa + F = NaF
NO3- + C15H24O = H2O + N2 + CO2 + e82NO3- + 6C15H24O = 72H2O + 41N2 + 90CO2 + 82e
NH3(g)+Cl2(g)=N2H4(l)+NH4Cl(s)4NH3(g) + Cl2(g) = N2H4(l) + 2NH4Cl(s)
NH4Cl + NaOH = NH3 + NaCl + H2ONH4Cl + NaOH = NH3 + NaCl + H2O
NO3 + 10H = NH4 + 3H2ONO3 + 10H = NH4 + 3H2O
Na + Cl = NaClNa + Cl = NaCl
NO3- + Fe2+ + H+ = Fe3+ + NO + H2ONO3- - 9Fe2+ + 4H+ = -6Fe3+ + NO + 2H2O
NiCl2*6H2O + CH3COCH2COCH3 = Ni(H2O)2(CH3COCHCOCH3)2 + HCl + H2ONiCl2*6H2O + 2CH3COCH2COCH3 = Ni(H2O)2(CH3COCHCOCH3)2 + 2HCl + 4H2O
Na2CO3+ HCl+ Ca(OH)2 = CaCO3+NaCl+H2ONa2CO3 + 2HCl + Ca(OH)2 = CaCO3 + 2NaCl + 2H2O
NaCl + Pb(NO3)2 = PbCl2 + NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
Na2CO3 + 2 H2SO4 = Na2SO4 + 2 H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
Na(Cr2O7)+HBr=NaBr+CrBr3+Br2+H2O2Na(Cr2O7) + 28HBr = 2NaBr + 4CrBr3 + 7Br2 + 14H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaCl + BeF2 = NaF + BeCl22NaCl + BeF2 = 2NaF + BeCl2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na3PO4+Zn(NO3)2=NaNO3+Zn3(PO4)22Na3PO4 + 3Zn(NO3)2 = 6NaNO3 + Zn3(PO4)2
NaBH4 + CH3C6H4CHO=NaBH3 + (C6H5)2CHOH + H2020NaBH4 + 0CH3C6H4CHO = 20NaBH3 + 0(C6H5)2CHOH + H20
NH4NO3+Na3PO4=(NH4)3PO4+NaNO33NH4NO3 + Na3PO4 = (NH4)3PO4 + 3NaNO3
N2H4(l)=NH3(g)+N2(g) 3N2H4(l) = 4NH3(g) + N2(g)
NH4Cl+Ca(OH) =NH3+CaCl+H2ONH4Cl + Ca(OH) = NH3 + CaCl + H2O
NH3 + H2O = NH4+ + -OHNH3 + H2O = NH4+ + -OH
NaHSO4+KNO3+NH4OH=Na2SO4+KOH+NH4NO30NaHSO4 + KNO3 + NH4OH = 0Na2SO4 + KOH + NH4NO3
NaHSO4+KNO3+NH4OH=NaSO4+KOH+NH4NO30NaHSO4 + KNO3 + NH4OH = 0NaSO4 + KOH + NH4NO3
NaOH+FeBr3=NaBr3+FeOHNaOH + FeBr3 = NaBr3 + FeOH
Na+Cu(NO3)2 =NaNO3+ Cu2Na + Cu(NO3)2 = 2NaNO3 + Cu
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH2+O2=NO+H2ONH2 + O2 = NO + H2O
NaCl(aq) + Pb(ClO3)2(aq) = NaClO3(aq) + PbCl2(s)2NaCl(aq) + Pb(ClO3)2(aq) = 2NaClO3(aq) + PbCl2(s)
Na2CO3+AgNO3= AgCO3+Na2NO3Na2CO3 + AgNO3 = AgCO3 + Na2NO3
Na2CO3 + HCl = NaCl + H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
N2 +H2 = NH3N2 + 3H2 = 2NH3
NO2 + NO + H2O = H+ + NO3-3NO2 - NO + H2O = 2H+ + 2NO3-
NO2 + NO + H2O = H+ + NO3-3NO2 - NO + H2O = 2H+ + 2NO3-
NO2 + NO + H2O = HNO33NO2 - NO + H2O = 2HNO3
NaHCO3=Na2CO3 +H2O+ CO22NaHCO3 = Na2CO3 + H2O + CO2
NaS+FeCl=NaCl+FeSNaS + FeCl = NaCl + FeS
Na2S+FeCl2=NaCl+ FeSNa2S + FeCl2 = 2NaCl + FeS
NaOH +H3PO4 =Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaBiO3 + MnSO4 + HNO3 = HMnO4 + Bi(NO3)3 + NaNO3 + Na2SO4 + H2O5NaBiO3 + 2MnSO4 + 16HNO3 = 2HMnO4 + 5Bi(NO3)3 + NaNO3 + 2Na2SO4 + 7H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na2CO3+AgNO3=NaNO3+Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
Na2CO3+AgNO3=NaNO3+Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
N2+O2=NO2N2 + 2O2 = 2NO2
NaClO + NH3 = NCl3 + NaOH3NaClO + NH3 = NCl3 + 3NaOH
NO2+H2O=HNO2+HNO32NO2 + H2O = HNO2 + HNO3
NaOH+Ca(NO3)2=Ca(OH)2+NaNO32NaOH + Ca(NO3)2 = Ca(OH)2 + 2NaNO3
NaNO3+MgCl2=NaCl+Mg(NO3)22NaNO3 + MgCl2 = 2NaCl + Mg(NO3)2
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NH4Cl(s) + Ca(OH)2(s) = NH3(g) + CaCl2 + H2O(l) 2NH4Cl(s) + Ca(OH)2(s) = 2NH3(g) + CaCl2 + 2H2O(l)
NH4Cl(s) +NaOH(Ac) = NH3(g) + NaCl(Ac) + H2O(l) NH4Cl(s) + NaOH(Ac) = NH3(g) + NaCl(Ac) + H2O(l)
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2CO3 + C + N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaI+NaIO3+H2SO4=I2+NaSO4+H2O4NaI + 2NaIO3 + 6H2SO4 = 3I2 + 6NaSO4 + 6H2O
NO+Zn+HCl=N2O+H2O+ZnCl22NO + Zn + 2HCl = N2O + H2O + ZnCl2
NH4I + Cl2 = NH4Cl + I22NH4I + Cl2 = 2NH4Cl + I2
NH4I+Cl=NH4Cl+I22NH4I + 2Cl = 2NH4Cl + I2
N2(g)+3H2(g)=2NH3(g) N2(g) + 3H2(g) = 2NH3(g)
NH3 + Cl2 = N2H4 + NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
NH3 + Cl2 = N2H4 + NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
NH+H2=NH3NH + H2 = NH3
Na3PO4 +MgCl2 = Mg3(PO4)2 +NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
NH3 = N2 + H22NH3 = N2 + 3H2
Na2S2O3 + NO3- + H+ = SO4-- + N2 + Na+ + H2O-5Na2S2O3 - 8NO3- + 2H+ = -10SO4-- - 4N2 - 10Na+ + H2O
Na2S2O3 + NO3- + OH- = SO4-- + N2 + Na+ + H2O5Na2S2O3 + 8NO3- + 2OH- = 10SO4-- + 4N2 + 10Na+ + H2O
Na2S2O3 + NO3- + OH- = SO4-- + N2 + Na+ + H+5Na2S2O3 + 8NO3- + OH- = 10SO4-- + 4N2 + 10Na+ + H+
Na2S2O3 + NO3- + OH- = SO4-- + N2 + Na+ + H24Na2S2O3 + 6NO3- + 2OH- = 8SO4-- + 3N2 + 8Na+ + H2
Na2S2O3 + NO3- + OH- = SO4-- + N2 + Na+ + H2O5Na2S2O3 + 8NO3- + 2OH- = 10SO4-- + 4N2 + 10Na+ + H2O
Na2S2O3 + NO3- + OH- = SO4-- + N2 + Na+ + H2O5Na2S2O3 + 8NO3- + 2OH- = 10SO4-- + 4N2 + 10Na+ + H2O
Na2S2O3 + NO3- + H2O = SO4-- + N2 + Na+ + H+5Na2S2O3 + 8NO3- + H2O = 10SO4-- + 4N2 + 10Na+ + 2H+
Na2S2O3 + NO3- + H+ = SO4-- + N2 + Na+ + H2O-5Na2S2O3 - 8NO3- + 2H+ = -10SO4-- - 4N2 - 10Na+ + H2O
Na2S2O3 + NO3- + H+ = SO4-- + N2 + Na+ + H2O-5Na2S2O3 - 8NO3- + 2H+ = -10SO4-- - 4N2 - 10Na+ + H2O
Na2S + NO3- + H+ = SO4-- + N2 + Na+ + H2O5Na2S + 8NO3- + 8H+ = 5SO4-- + 4N2 + 10Na+ + 4H2O
Na2CO3 +Cu = Na2Cu + CO3Na2CO3 + Cu = Na2Cu + CO3
Na2CO3 +Cu = Na2Cu + CO3Na2CO3 + Cu = Na2Cu + CO3
Na2So4+BaCl2 =BaSo4+2NaClNa2So4 + BaCl2 = BaSo4 + 2NaCl
NH4Cl(s) + NaOH(Ac) = NH3(g) + NaCl(Ac) + H2O(l)NH4Cl(s) + NaOH(Ac) = NH3(g) + NaCl(Ac) + H2O(l)
Na+P4=Na3P12Na + P4 = 4Na3P
Na+P4=Na3P43Na + P4 = Na3P4
Na+P4=Na3P43Na + P4 = Na3P4
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2 =NO +O2 2NO2 = 2NO + O2
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2Cr2O7 + HCl=NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaN3 = Na + NNaN3 = Na + 3N
NaNO3(s) + H2SO4(aq) = Na2SO4(s) + HNO3(aq)2NaNO3(s) + H2SO4(aq) = Na2SO4(s) + 2HNO3(aq)
NaNO3(s) + H2SO4(aq) = Na2SO4(s) + HNO3(aq)2NaNO3(s) + H2SO4(aq) = Na2SO4(s) + 2HNO3(aq)
Na2CO3(aq) + AgNO3(aq) = Ag2CO3(s) + NaNO3(aq)Na2CO3(aq) + 2AgNO3(aq) = Ag2CO3(s) + 2NaNO3(aq)
Na2S(aq) + Fe(NO3)2(aq) = NaNO3(aq) + FeS(s)Na2S(aq) + Fe(NO3)2(aq) = 2NaNO3(aq) + FeS(s)
Na2CO3(aq) + BaCl2(aq) = BaCO3(s) + NaCl(aq)Na2CO3(aq) + BaCl2(aq) = BaCO3(s) + 2NaCl(aq)
Na2CrO2 + Br2 + NaOH = Na2CrO4 + NaBr + H2ONa2CrO2 + 2Br2 + 4NaOH = Na2CrO4 + 4NaBr + 2H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
N2+C2H3=C2H2+NH3N2 + 6C2H3 = 6C2H2 + 2NH3
N2O5(g)=NO2(g)+O2(g)2N2O5(g) = 4NO2(g) + O2(g)
NaNO2 + HCl= NaCl+ HNO2NaNO2 + HCl = NaCl + HNO2
N2H4 = NH3+ N23N2H4 = 4NH3 + N2
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaHCO3+HCl=NaCl+H2O=CO2NaHCO3 + HCl = NaCl + H2O + CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na+2H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na2CO3 (s) + HNO3 (aq) = NaNO3 (aq) + H2O (l) + CO2 (g)Na2CO3(s) + 2HNO3(aq) = 2NaNO3(aq) + H2O(l) + CO2(g)
NH4Cl+NaOH=NaCl+H2O+NH3NH4Cl + NaOH = NaCl + H2O + NH3
NaCHO3+HCl=NaCl+H2O+CO2NaCHO3 + HCl = NaCl + H2O + CO2
NH4NO3= N2O + H2ONH4NO3 = N2O + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni +HCl= NiCl2 +H2Ni + 2HCl = NiCl2 + H2
NH4NO3+NAOH=NANO3+H2O+NH3NH4NO3 + NAOH = NANO3 + H2O + NH3
NH4NO3+NAOH=NANO3+H2O+NH3NH4NO3 + NAOH = NANO3 + H2O + NH3
NO3- + Fe2+ + H+ = Fe3+ + NO + H2ONO3- - 9Fe2+ + 4H+ = -6Fe3+ + NO + 2H2O
NO3- + Fe2+ + H+ = Fe3+ + NO + H2ONO3- - 9Fe2+ + 4H+ = -6Fe3+ + NO + 2H2O
NaClO + CaCl2 + H2SO4 = Cl2 + CaSO4 + NaSO4 + H2O2NaClO + 0CaCl2 + 2H2SO4 = Cl2 + 0CaSO4 + 2NaSO4 + 2H2O
Na+O2=Na2O4Na + O2 = 2Na2O
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH3 3NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
Na2MnO4+H2O+NaI = MnO2+NaIO3+NaOH3Na2MnO4 + 3H2O + NaI = 3MnO2 + NaIO3 + 6NaOH
Na2CrO4+Na2SO4+H2O = Cr2(SO4)3+NaOH+H2O22Na2CrO4 + 3Na2SO4 + 8H2O = Cr2(SO4)3 + 10NaOH + 3H2O2
Na2O2 + H2SO4 = Na2SO4 + H2O2 Na2O2 + H2SO4 = Na2SO4 + H2O2
Na + MgSO4= Mg + Na2SO42Na + MgSO4 = Mg + Na2SO4
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S+2HNO2=2NaNO2+H2SNa2S + 2HNO2 = 2NaNO2 + H2S
Na2S+2HNO2=2NaNO2+H2SNa2S + 2HNO2 = 2NaNO2 + H2S
Na2S+2HNO2=2NaNO2+H2SNa2S + 2HNO2 = 2NaNO2 + H2S
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
Na2SO3 + H2SO4 + K2Cr2O7 = K2SO4 + Cr2(SO4)3 + Na2SO4 + H2O3Na2SO3 + 4H2SO4 + K2Cr2O7 = K2SO4 + Cr2(SO4)3 + 3Na2SO4 + 4H2O
NO+H2O=HNO3+NONO + 0H2O = 0HNO3 + NO
NO+H2O=HNO3+NONO + 0H2O = 0HNO3 + NO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+H2O=HNO3+NO2NO2 + 0H2O = 0HNO3 + NO2
Ni(C2H3O2)2 +NH4NO3=Ni(NO3)+NH4(C2H3O2)2Ni(C2H3O2)2 + NH4NO3 = Ni(NO3) + NH4(C2H3O2)2
NH4NO3 + CaCl2 = NH4Cl + Ca(NO3)2 2NH4NO3 + CaCl2 = 2NH4Cl + Ca(NO3)2
Na+S=Na2S2Na + S = Na2S
Ni(NO3)2 + C2H3NaO2 = NiC2H3O2 + Na(NO3)2 Ni(NO3)2 + C2H3NaO2 = NiC2H3O2 + Na(NO3)2
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4Cl+NaOH=H2O+NH3+NaClNH4Cl + NaOH = H2O + NH3 + NaCl
NaCrO2 + NaClO + NaOH = Na2CrO4 + NaCl + H2O2NaCrO2 + 3NaClO + 2NaOH = 2Na2CrO4 + 3NaCl + H2O
N2+2H2=3NH3N2 + 3H2 = 2NH3
N2+F2=NF3N2 + 3F2 = 2NF3
NH3(g) + NO(g) = N2(g) + H2O(g)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(g)
Na2C2O4+KMnO4+H2SO4=CO2+Na2SO4+MnSO4+H2O+K2SO45Na2C2O4 + 2KMnO4 + 8H2SO4 = 10CO2 + 5Na2SO4 + 2MnSO4 + 8H2O + K2SO4
N2(g)+O2(g)+H2O(g)=H3NO3(aq) 2N2(g) + 3O2(g) + 6H2O(g) = 4H3NO3(aq)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+HI=NH4INH3 + HI = NH4I
NH3+HI= NH4I NH3 + HI = NH4I
NH3+HI= NH4I NH3 + HI = NH4I
NH3+HI=NH4INH3 + HI = NH4I
NH3+HI=NH4INH3 + HI = NH4I
NH3+HI= NH4I NH3 + HI = NH4I
NH3+HI=NH4INH3 + HI = NH4I
NH3+HI=NH4INH3 + HI = NH4I
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaNO2 + Br2 +NaOH=NaNO3+NaBr +H2ONaNO2 + Br2 + 2NaOH = NaNO3 + 2NaBr + H2O
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl=NaClNa + Cl = NaCl
N2+O2=NON2 + O2 = 2NO
Na(Al(OH)4) + H2SO4 = Na2SO4 + Al(OH)3 + H2O2Na(Al(OH)4) + H2SO4 = Na2SO4 + 2Al(OH)3 + 2H2O
N2H4+H2O2=NO2+H2ON2H4 + 6H2O2 = 2NO2 + 8H2O
Nb2(SO4)5 + K3PO4 = Nb3(PO4)5 + K2SO43Nb2(SO4)5 + 10K3PO4 = 2Nb3(PO4)5 + 15K2SO4
Nb2(SO4)5 + K3PO4 = Nb3(PO4)5 + K2SO43Nb2(SO4)5 + 10K3PO4 = 2Nb3(PO4)5 + 15K2SO4
Na2CrO2 + Br2+NaOH=Na2CrO4+NaBr+H2ONa2CrO2 + 2Br2 + 4NaOH = Na2CrO4 + 4NaBr + 2H2O
N2(g) + O2(g) + H2O(g)=HNO3(aq) 2N2(g) + 5O2(g) + 2H2O(g) = 4HNO3(aq)
N2(g) + O2(g) + H2O(g)= HNO2(aq) 2N2(g) + 3O2(g) + 2H2O(g) = 4HNO2(aq)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
N2 + 2H2 = 2NH3N2 + 3H2 = 2NH3
Na2CO3 + Ca (OH)2 = CaCO3 + NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
NO + H2 = N2 + H2O2NO + 2H2 = N2 + 2H2O
NH4ClO3=NH3+HCl+O22NH4ClO3 = 2NH3 + 2HCl + 3O2
NH4Cl(aq)+NaOH(aq)=H2O(l)+NH3(g)+NaCl(aq)NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq)
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2O5(g) + H2O(l) = 2 HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
Na+H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3(g)+O2(g)=NO(g)+H2(g)2NH3(g) + O2(g) = 2NO(g) + 3H2(g)
Na+ZnI2=NaI+Zn2Na + ZnI2 = 2NaI + Zn
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Nb2(SO4)5 + K3PO4 = Nb3(PO4)5 + K2SO4 3Nb2(SO4)5 + 10K3PO4 = 2Nb3(PO4)5 + 15K2SO4
NaNO3 + FeCl3 = NaCl + Fe(NO3)33NaNO3 + FeCl3 = 3NaCl + Fe(NO3)3
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na3N = Na + N22Na3N = 6Na + N2
N2+I2= NI3N2 + 3I2 = 2NI3
NI3=4NI3NI3 = NI3
NI3=4NI3NI3 = NI3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaF+Br2=NaBr=F22NaF + Br2 = 2NaBr + F2
NH3 +Cl2 = N2 +NH4Cl8NH3 + 3Cl2 = N2 + 6NH4Cl
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaI+Cl2=NaCl+I22NaI + Cl2 = 2NaCl + I2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2+H2=NH3N2 + 3H2 = 2NH3
NO+O2=NO22NO + O2 = 2NO2
NH3 + Br2 = N2 + NH4Br8NH3 + 3Br2 = N2 + 6NH4Br
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NH4NO3 = N2O + H2O NH4NO3 = N2O + 2H2O
NaNO3+MnO=NaMn+NO4NaNO3 + MnO = NaMn + NO4
NaNO3+MnO=NaMn+NO4NaNO3 + MnO = NaMn + NO4
NH4Cl+NaNO2=4NaCl+2H2O+N2NH4Cl + NaNO2 = NaCl + 2H2O + N2
Na2CO3(aq)+SO2(g)+H2O(l)=NaHSO3(aq)+CO2(g)Na2CO3(aq) + 2SO2(g) + H2O(l) = 2NaHSO3(aq) + CO2(g)
Ni80Cr20+B4C=NiB+CrCNi80Cr20 + 20B4C = 80NiB + 20CrC
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaOH+(NH4)3PO4=Na3PO4+H2O+NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NaOH+(NH4)3PO4=Na3PO4+H2O+NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NaC2H3O2 + H2SO4 = Na2SO4 + C2H4O22NaC2H3O2 + H2SO4 = Na2SO4 + 2C2H4O2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2H4=NH3 +N23N2H4 = 4NH3 + N2
Na2S2O3 + HClO + H2O = NaHSO4 + HClNa2S2O3 + 4HClO + H2O = 2NaHSO4 + 4HCl
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + O2=N2O52N2 + 5O2 = 2N2O5
NaHCO3=CO2+H2O+Na2CO32NaHCO3 = CO2 + H2O + Na2CO3
NO (g) + 5H2 (g) = 2NH3 (g) + 2H2O (g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4L=NH3+HLNH4L = NH3 + HL
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2 + 3H2 =2NH3N2 + 3H2 = 2NH3
Na2O + I2 = NaOI + NaINa2O + I2 = NaOI + NaI
Na2O + I2 = NaOI + NaINa2O + I2 = NaOI + NaI
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2O + I2 = NaOI + NaINa2O + I2 = NaOI + NaI
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaClO3 =NaCl +O22NaClO3 = 2NaCl + 3O2
NaClO3 =NaCl +O22NaClO3 = 2NaCl + 3O2
N2 + 3 H2 =2 NH3N2 + 3H2 = 2NH3
NH4ClO4 + Al = Al2O3 + AlCl3 + NO + H2O3NH4ClO4 + 3Al = Al2O3 + AlCl3 + 3NO + 6H2O
N+Li=Li3NN + 3Li = Li3N
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H20 = HNO3 + NO40NO2 + H20 = 20HNO3 + 20NO
N2H4 + H2O2 = HNO3 + H2ON2H4 + 7H2O2 = 2HNO3 + 8H2O
N2H4 + H2O2 = HNO3 + NON2H4 - 5H2O2 = -6HNO3 + 8NO
NiCl2+FeSO4=NiSO4+FeCl2NiCl2 + FeSO4 = NiSO4 + FeCl2
NH4Cl + NaOCl + HCl = N2 + NaCl + H2O2NH4Cl + 3NaOCl - 2HCl = N2 + 3NaCl + 3H2O
NH3+Cl2=N2H4+2NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
Na3PO4+MgCl2=Mg3(PO4)2+NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3 + HCl= NH4ClNH3 + HCl = NH4Cl
Na2CO3+2HCL=2NaCL+H2O+CO2Na2CO3 + 2HCL = 2NaCL + H2O + CO2
Na+O2=NaO2Na + O2 = NaO2
Na+O2=NaO2Na + O2 = NaO2
NaCl03 + SnSO4 + H2SO4 = Na2SO4 + H2SO3 + SnCl2 + H2O-2NaCl03 - 3SnSO4 + 4H2SO4 = -1Na2SO4 + 2H2SO3 - 3SnCl2 + 2H2O
Na2 + CoSO4 = Na2SO4 + CoNa2 + CoSO4 = Na2SO4 + Co
NaCl03 + SnSO4 + H2SO4 = Na2SO4 + Sn(SO)4 + HCl + H2O-18NaCl03 + 2SnSO4 - 3H2SO4 = -9Na2SO4 + 2Sn(SO)4 - 54HCl + 24H2O
N2 + 3 H2 = 2 NH3N2 + 3H2 = 2NH3
NaCl(aq) + Ba(NO3)2(aq) = Na(NO3)2 + BaClNaCl(aq) + Ba(NO3)2(aq) = Na(NO3)2 + BaCl
NaOH + H3PO4 = H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NaCl + CaO = NaO + CaClNaCl + CaO = NaO + CaCl
NO2(g)+H2O(l)=2HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2S(aq) + Mg(NO3)2(aq) = Na(NO3) + MgSNa2S(aq) + Mg(NO3)2(aq) = 2Na(NO3) + MgS
NaSO4 + HCl = HSO4 + NaClNaSO4 + HCl = HSO4 + NaCl
N2+3H2=2NH3N2 + 3H2 = 2NH3
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
NO2+O2+H2O=HNO34NO2 + O2 + 2H2O = 4HNO3
NH3=H2+N22NH3 = 3H2 + N2
Na2SO4(aq) + Sr(NO3)2(aq) = SrSO4(s) + NaNO3(aq)Na2SO4(aq) + Sr(NO3)2(aq) = SrSO4(s) + 2NaNO3(aq)
NO + O2 = NO2 2NO + O2 = 2NO2
N2 + HNO3 =N2O4 + H2ON2 + 8HNO3 = 5N2O4 + 4H2O
NH4NO3=N2+H2O+O22NH4NO3 = 2N2 + 4H2O + O2
NH4NO3=N2+H2O+O22NH4NO3 = 2N2 + 4H2O + O2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
N2+O2=N2O32N2 + 3O2 = 2N2O3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl=Na+Cl22NaCl = 2Na + Cl2
N2 (g) + 3Cl2 (g) = 2NCl3 (g)N2(g) + 3Cl2(g) = 2NCl3(g)
NO + O = NO2NO + O = NO2
NO + O = NO2NO + O = NO2
NaF(aq)+HBr(aq)=NaBr(aq)+HF(aq)NaF(aq) + HBr(aq) = NaBr(aq) + HF(aq)
Na2CO3+AgNO3 = Ag2CO3+NaNO3Na2CO3 + 2AgNO3 = Ag2CO3 + 2NaNO3
Na2CO3(s)+ AgNO3(s) = Ag2CO3(s) + NaNO3(s)Na2CO3(s) + 2AgNO3(s) = Ag2CO3(s) + 2NaNO3(s)
Na2CO3 + AgNO3 = Ag2CO3 + NaNO3Na2CO3 + 2AgNO3 = Ag2CO3 + 2NaNO3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + I2 = NI3N2 + 3I2 = 2NI3
Ni2(So3)3 + NaClO = Na2(So3) + Ni(ClO)3Ni2(So3)3 + 6NaClO = 3Na2(So3) + 2Ni(ClO)3
N2Cl4 + CH4 = CCl4 + 2H2 + N2N2Cl4 + CH4 = CCl4 + 2H2 + N2
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
NaCIO3(s)=NaCI(s)+O2(g)2NaCIO3(s) = 2NaCI(s) + 3O2(g)
Na2SO4 (aq) + AgNO3 (aq) = Ag2SO4 (s) + NaNO3 (aq)Na2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2NaNO3(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na2Cr2O9+S+H2O=SO2+Cr2O3+NaOH2Na2Cr2O9 + 5S + 2H2O = 5SO2 + 2Cr2O3 + 4NaOH
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2SO4 + BaCl2= BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NO2+ H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2 CO3 + H2O + CO2 = Na H CO3Na2CO3 + H2O + CO2 = 2NaHCO3
N2O5+H2O = HNO3N2O5 + H2O = 2HNO3
NH3+Mg=N2Mg3+H22NH3 + 3Mg = N2Mg3 + 3H2
Na2CrO4(aq) + Ba(NO3)2(aq) = Na2(NO3)2 + BaCrO4Na2CrO4(aq) + Ba(NO3)2(aq) = Na2(NO3)2 + BaCrO4
NO+Cu(NO2)3+H2O=Cu+HNO3-1NO + Cu(NO2)3 + H2O = Cu + 2HNO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3 +HCl = NH4ClNH3 + HCl = NH4Cl
NH3 +HCl = NH4ClNH3 + HCl = NH4Cl
N2 + O2 = NON2 + O2 = 2NO
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2S2O3 + HCl = NaCl + H2O + SO2 + SNa2S2O3 + 2HCl = 2NaCl + H2O + SO2 + S
NaOH + Cl2 = NaCl + NaClO3 + H2O6NaOH + 3Cl2 = 5NaCl + NaClO3 + 3H2O
NaOH + Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NH3 + Cl2 = NH4Cl + N28NH3 + 3Cl2 = 6NH4Cl + N2
NO + O2 = 3NO22NO + O2 = 2NO2
NaIO3+BaCl2+CH3COOH=NaCl+BaIO3+CH3COOH0NaIO3 + 0BaCl2 + CH3COOH = 0NaCl + 0BaIO3 + CH3COOH
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO + O2 = NO22NO + O2 = 2NO2
Na + O2 = Na2O 4Na + O2 = 2Na2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NA(s) + H2O(l) = NAOH(aq) + H2(g)2NA(s) + 2H2O(l) = 2NAOH(aq) + H2(g)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaAsO2+Cl2+NaOH=Na3AsO4+NaCl+H2NaAsO2 + 0Cl2 + 2NaOH = Na3AsO4 + 0NaCl + H2
NH3+H2SO4=S+HNO3+H2O3NH3 + 4H2SO4 = 4S + 3HNO3 + 7H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO3 + H2O=HNO3 + NO2-1NO3 - H2O = -2HNO3 + NO2
NO3 + H2O=HNO3 + NO-3NO3 - 2H2O = -4HNO3 + NO
Ni(NO3)2+Na2S=NiS+NaNO3Ni(NO3)2 + Na2S = NiS + 2NaNO3
NH3+Cl2=HCl+NCl3NH3 + 3Cl2 = 3HCl + NCl3
NO2 + KOH + KMnO4 = KNO3 + MnO2 + H2O3NO2 + 2KOH + KMnO4 = 3KNO3 + MnO2 + H2O
NO3 + H2O = HNO3 + HNO2-2NO3 - H2O = -3HNO3 + HNO2
NaOH + Ca Br2 =2Ca (OH)2 + 2 Na Br2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NO(g) +H2(g) = NH3(g) +H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Ni(NO3)2+Na2CO3=NiCO3+NaNO3Ni(NO3)2 + Na2CO3 = NiCO3 + 2NaNO3
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaCO3 + AgNO3= NaNO3 + AgCO3NaCO3 + AgNO3 = NaNO3 + AgCO3
NaCO3 + AgNO3 = NaNO3 + AgCO3NaCO3 + AgNO3 = NaNO3 + AgCO3
NaCO3(aq) + AgNO3(aq) = NaNO3(aq) + AgCO3(s)NaCO3(aq) + AgNO3(aq) = NaNO3(aq) + AgCO3(s)
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
N2O5 = NO2+O22N2O5 = 4NO2 + O2
NO+ O2 =NO22NO + O2 = 2NO2
NH4SCN+Pb(NO3)2= Pb(SCN)2+NH4NO32NH4SCN + Pb(NO3)2 = Pb(SCN)2 + 2NH4NO3
NH4SCN+Mg(NO3)2= Mg(SCN)2+NH4NO32NH4SCN + Mg(NO3)2 = Mg(SCN)2 + 2NH4NO3
NH4SCN+Ba(NO3)2= Ba(SCN)2+NH4NO32NH4SCN + Ba(NO3)2 = Ba(SCN)2 + 2NH4NO3
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l)=NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaCl+Ba=Na+BaClNaCl + Ba = Na + BaCl
NH4OH+AlCl3 = NH4Cl + Al(OH)33NH4OH + AlCl3 = 3NH4Cl + Al(OH)3
Na2SO4+C=Na2S+CONa2SO4 + 4C = Na2S + 4CO
Na2SO4+C=Na2S+CONa2SO4 + 4C = Na2S + 4CO
NH3=N2+H22NH3 = N2 + 3H2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl=Cl2+Na2NaCl = Cl2 + 2Na
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3=N2+H22NH3 = N2 + 3H2
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaHSO3 + H2SO4 = SO2 + H2O + Na2SO4 2NaHSO3 + H2SO4 = 2SO2 + 2H2O + Na2SO4
NO2 +Na2SO3 = N2 + Na2SO42NO2 + 4Na2SO3 = N2 + 4Na2SO4
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2SO4 +Ca(NO3)2 = NaNO3 + CaSO4Na2SO4 + Ca(NO3)2 = 2NaNO3 + CaSO4
N2O5 +H2O = HNO3 N2O5 + H2O = 2HNO3
Na2O +H2O = NaOHNa2O + H2O = 2NaOH
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH4NO3(s)=N2(g)+O2(g)+H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2 +H2 = NH3N2 + 3H2 = 2NH3
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3
NaCl = Na + Cl22NaCl = 2Na + Cl2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHCO3 + H3C6H5O7 = Na3C6H5O7 + H2 O + CO23NaHCO3 + H3C6H5O7 = Na3C6H5O7 + 3H2O + 3CO2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na +N2O =0NaNO2 + N22Na + 4N2O = 2NaNO2 + 3N2
NaF + Mg(NO3)2 = MgF2 + NaNO32NaF + Mg(NO3)2 = MgF2 + 2NaNO3
NaF + Mg(NO3)2 = MgF2 + NaNO32NaF + Mg(NO3)2 = MgF2 + 2NaNO3
NaOH + H2CO3 = H2O + Na2CO32NaOH + H2CO3 = 2H2O + Na2CO3
Na2S(aq) + Cu(NO3)2= 2NaNO3 + CuSNa2S(aq) + Cu(NO3)2 = 2NaNO3 + CuS
NH3+O2=N+H2O4NH3 + 3O2 = 4N + 6H2O
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NH3=N2+H22NH3 = N2 + 3H2
NH3=N2+H22NH3 = N2 + 3H2
NH3=N2+H22NH3 = N2 + 3H2
NH3=N2+H22NH3 = N2 + 3H2
NH3=N2+H22NH3 = N2 + 3H2
N2O5+H2O=2HNO3N2O5 + H2O = 2HNO3
NH3 = N2 + H22NH3 = N2 + 3H2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 = N2 + H22NH3 = N2 + 3H2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 = N2 + H22NH3 = N2 + 3H2
NH3 = N2 + H22NH3 = N2 + 3H2
Na2S + CaCl2 = CaS + NaClNa2S + CaCl2 = CaS + 2NaCl
Na2O + CO2 = Na2CO3Na2O + CO2 = Na2CO3
Na3PO4 + CaCl2= NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
N2 + H2 = NH3 N2 + 3H2 = 2NH3
Ni(NO3)2+Na2C2O4=C2NiO4+NaNO3Ni(NO3)2 + Na2C2O4 = C2NiO4 + 2NaNO3
NaCl+Ba(NO3)2 = NaNO3 + BaCl22NaCl + Ba(NO3)2 = 2NaNO3 + BaCl2
NaCl+Ba(NO3)2 = NaNO3 + BaCl22NaCl + Ba(NO3)2 = 2NaNO3 + BaCl2
Ni(NO3)2+Na2C2O4=NiC2O4+NaNO3Ni(NO3)2 + Na2C2O4 = NiC2O4 + 2NaNO3
Na2SO4 + Al(OH)3 = Al2(SO4)3 + NaOH3Na2SO4 + 2Al(OH)3 = Al2(SO4)3 + 6NaOH
Na2B4O7 + H2SO4 + H2O = H3BO3 + Na2SO4 Na2B4O7 + H2SO4 + 5H2O = 4H3BO3 + Na2SO4
NH3+O2=H2O+NO24NH3 + 7O2 = 6H2O + 4NO2
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NH4CLO3 = NH3 + 2HCL +3O22NH4CLO3 = 2NH3 + 2HCL + 3O2
NaClO3 + FeCO3 = Na2CO3 + Fe(ClO3)22NaClO3 + FeCO3 = Na2CO3 + Fe(ClO3)2
NO2+H2O=HNO+NONO2 - H2O = -2HNO + 3NO
N2H2= NH3+N23N2H2 = 2NH3 + 2N2
Na2O(s)+HCl(aq)= NaCl(aq)+H2O(l)Na2O(s) + 2HCl(aq) = 2NaCl(aq) + H2O(l)
Na2SO3 + K2Cr2O7 + H2SO4 = Na2SO4 + Cr(SO4)3 + H2O + K2SO40Na2SO3 + K2Cr2O7 + 7H2SO4 = 0Na2SO4 + 2Cr(SO4)3 + 7H2O + K2SO4
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N14+H1=NH3N14 + 42H1 = 14NH3
N2+H2=NH3N2 + 3H2 = 2NH3
Ni(NO3)2+Na2C2O4=NiC2O4+2NaNO3Ni(NO3)2 + Na2C2O4 = NiC2O4 + 2NaNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NiSO4 + NaCOOCH3 + NaSO4 = Ni(OH)2 + CO2 + NaCO3 + H2SO4 -1NiSO4 + 0NaCOOCH3 + 2NaSO4 = -1Ni(OH)2 - 2CO2 + 2NaCO3 + H2SO4
Na+Cl2=NaCl2Na + Cl2 = NaCl2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.