Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NaBiO3 + H2SO4 = Bi2(SO4)3 + Na2SO4 + H2O + SO2-2NaBiO3 - 2H2SO4 = -1Bi2(SO4)3 - Na2SO4 - 2H2O + 2SO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaClO + Ca(OH)2 + H2O = CaCl + NaOH + H2O0NaClO + 0Ca(OH)2 + H2O = 0CaCl + 0NaOH + H2O
NO2 + H2O = HNO3 +NO3NO2 + H2O = 2HNO3 + NO
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
N + H2O = NH + O2N + H2O = 2NH + O
N + H2O = NO + HN + H2O = NO + 2H
NO2- + H+ = NO3- + NO + H2O3NO2- + 2H+ = NO3- + 2NO + H2O
Na2S + Na2SO3 + HCl = S + NaCl + H2O2Na2S + Na2SO3 + 6HCl = 3S + 6NaCl + 3H2O
NaCl+AgNO3 =AgCl+NaNO3 NaCl + AgNO3 = AgCl + NaNO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO 2 (g)+H 2 O(l)=HNO 3 (aq)+NO(g) 3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH3+O2 = N2+ H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4NO3 + NiCl2 = NiNO3 + Cl2NH4NH4NO3 + NiCl2 = NiNO3 + Cl2NH4
NaHCO3 + C6H8O7 = H2O + CO2 +Na3C6H5O73NaHCO3 + C6H8O7 = 3H2O + 3CO2 + Na3C6H5O7
Na2S2O3 + I2= NaI + S4O62Na2S2O3 + 2I2 = 4NaI + S4O6
Na2S2O3 + I2= NaI + S4O62Na2S2O3 + 2I2 = 4NaI + S4O6
Na2CrO4+AlBr3=NaBr+Al2(CrO4)33Na2CrO4 + 2AlBr3 = 6NaBr + Al2(CrO4)3
Na2CrO4+AlBr3=NaBr3+Al2CrO4Na2CrO4 + 2AlBr3 = 2NaBr3 + Al2CrO4
Na(OH) + HCl = NaCl + H2ONa(OH) + HCl = NaCl + H2O
Na(OH) + HCl = NaCl + H2ONa(OH) + HCl = NaCl + H2O
Na(OH) + HCl = NaCl + H2ONa(OH) + HCl = NaCl + H2O
Na(OH) + HCl = NaCl + H2ONa(OH) + HCl = NaCl + H2O
Na(OH) + HCl = NaCl + H2ONa(OH) + HCl = NaCl + H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH3 = H2 + N22NH3 = 3H2 + N2
N2 + O2 = NO2N2 + 2O2 = 2NO2
Na + O = Na2O2Na + O = Na2O
NaOH+(NH4)3PO4=Na3PO4+H2O+NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NH3+O2+CH4 = HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na2S2O3 + H2O = Na2SO4 + H2SO4 + H2O0Na2S2O3 + H2O = 0Na2SO4 + 0H2SO4 + H2O
NH3+H2O=NO2+H2O0NH3 + H2O = 0NO2 + H2O
NH3 + H2O = NO2 + H2O0NH3 + H2O = 0NO2 + H2O
N + H2O = NH3 + O2N + 3H2O = 2NH3 + 3O
Na2CrO4 + Pb(NO3)2 = PbCrO4 + NaNO3Na2CrO4 + Pb(NO3)2 = PbCrO4 + 2NaNO3
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaOH + Ba(CH3CO2)2 = Na(CH3CO2) + Ba(OH)22NaOH + Ba(CH3CO2)2 = 2Na(CH3CO2) + Ba(OH)2
NaOH + Ba(CH3CO2)2 = Na(CH3CO2) + Ba(OH)22NaOH + Ba(CH3CO2)2 = 2Na(CH3CO2) + Ba(OH)2
NaOH + Ba(CH3CO2)2 = Na(CH3CO2) + Ba(OH)22NaOH + Ba(CH3CO2)2 = 2Na(CH3CO2) + Ba(OH)2
Na+CO3=CO2+Na2O2Na + CO3 = CO2 + Na2O
NH4+H2O=NO2+H2O0NH4 + H2O = 0NO2 + H2O
NH4 + H2O = NO2 + H2O0NH4 + H2O = 0NO2 + H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaCl+ Pb(CH3COO)2=2Na(CH3COO)+ PbCl22NaCl + Pb(CH3COO)2 = 2Na(CH3COO) + PbCl2
N 2 H 4 =NH 3+N 2 3N2H4 = 4NH3 + N2
N2H4 + Fe(OH)2 = Fe + N2 + 4H2ON2H4 + 2Fe(OH)2 = 2Fe + N2 + 4H2O
N + H2O = NH2 + ON + H2O = NH2 + O
NiF 2 +Fe 2 (SO 4 ) 3 =NiSO 4+FeF 33NiF2 + Fe2(SO4)3 = 3NiSO4 + 2FeF3
NaN3=Na+N22NaN3 = 2Na + 3N2
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
N2(Cl4)4 + C(H4)3 = C(Cl4)4 + 3N2 +6H2N2(Cl4)4 + C(H4)3 = C(Cl4)4 + N2 + 6H2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaHCO3 + HCl = H2O + NaCl + CO2NaHCO3 + HCl = H2O + NaCl + CO2
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
Na + O2 = Na2O4Na + O2 = 2Na2O
NiCl2 + NH4NO3 = NiNO3 + Cl2NH4NiCl2 + NH4NO3 = NiNO3 + Cl2NH4
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NiCl2 + NH4NO3 = Ni(NO3)2 + NH4ClNiCl2 + 2NH4NO3 = Ni(NO3)2 + 2NH4Cl
NiI2 + (NH4)2CO3 = NiCO3 + 2 NH4INiI2 + (NH4)2CO3 = NiCO3 + 2NH4I
NiI2(aq) + (NH4)2CO3(aq) = NiCO3(s) + 2 NH4I(aq)NiI2(aq) + (NH4)2CO3(aq) = NiCO3(s) + 2NH4I(aq)
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NiI2 + (NH4)2CO3 = NiCO3 + 2 NH4INiI2 + (NH4)2CO3 = NiCO3 + 2NH4I
NiI2 + (NH4)2CO3 = NiCO3 + 2 NH4INiI2 + (NH4)2CO3 = NiCO3 + 2NH4I
NiI2 + (NH4)2CO3 = NiCO3 + 2 NH4INiI2 + (NH4)2CO3 = NiCO3 + 2NH4I
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Ni(NO3)2+Na2CO3=NiCO3+NaNO3Ni(NO3)2 + Na2CO3 = NiCO3 + 2NaNO3
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2CO3 + AgNO3 = Ag2CO3 + NaNO3Na2CO3 + 2AgNO3 = Ag2CO3 + 2NaNO3
Na2CO3+Ca(HCO3)2=NaHCO3+ CaCO3Na2CO3 + Ca(HCO3)2 = 2NaHCO3 + CaCO3
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
N2O5 + H2O=HNO3N2O5 + H2O = 2HNO3
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
Ni(NO3)2 + Na2CO3= NiCO3 + NaNO3Ni(NO3)2 + Na2CO3 = NiCO3 + 2NaNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NCl3+H2O=HClO+NH3NCl3 + 3H2O = 3HClO + NH3
NiCl2 + (NH4)2S = NH4Cl + NiSNiCl2 + (NH4)2S = 2NH4Cl + NiS
N2H4=NH3+N23N2H4 = 4NH3 + N2
Ni(NO3)2+Na2CO3=NiCO3+NaNO3Ni(NO3)2 + Na2CO3 = NiCO3 + 2NaNO3
Na2S+O2+H2O=Na2S2O3+NaOH2Na2S + 2O2 + H2O = Na2S2O3 + 2NaOH
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na + HC1 = NaC1 + H22Na + 2HC1 = 2NaC1 + H2
N2 + O2 = NO2N2 + 2O2 = 2NO2
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NO3- + CH3OH = CO2 + N2 + H2O + OH-6NO3- + 5CH3OH = 5CO2 + 3N2 + 7H2O + 6OH-
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + H2SiO3 = NaSiO3 + H2OHNaOH + H2SiO3 = NaSiO3 + H2OH
Na2SO4 + Ca(NO3)2 = NaNO3 + CaSO4Na2SO4 + Ca(NO3)2 = 2NaNO3 + CaSO4
NaHCO3(aq) + C3H4OH(COOH)3 (aq) = C3H4OH(COONa)3 + H2O + CO23NaHCO3(aq) + C3H4OH(COOH)3(aq) = C3H4OH(COONa)3 + 3H2O + 3CO2
NaHCO3(aq) + C3H4OH(COOH)3 (aq) = C3H4OH(COONa)3 + H2O + CO23NaHCO3(aq) + C3H4OH(COOH)3(aq) = C3H4OH(COONa)3 + 3H2O + 3CO2
Na3PO4 + Li2SO4 = Na2SO4 + Li3PO42Na3PO4 + 3Li2SO4 = 3Na2SO4 + 2Li3PO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na3PO4 + AgClO4 = NaClO4 + Ag3PO4Na3PO4 + 3AgClO4 = 3NaClO4 + Ag3PO4
NaHSO3 + HNO3= H2SO3 + NaNO3NaHSO3 + HNO3 = H2SO3 + NaNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + Br =NaBrNa + Br = NaBr
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH+AlBr3=NaBr+Al(OH)33NaOH + AlBr3 = 3NaBr + Al(OH)3
NH4 NO3 = N2+ O2+ H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + AlBr3 = NaBr + Al(OH)33NaOH + AlBr3 = 3NaBr + Al(OH)3
Na2CO3 + Mg(NO3)2 = MgCO3 + NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
Na2CO3+H2O=Na2O+H2CO3Na2CO3 + H2O = Na2O + H2CO3
NO2+O2=N2O54NO2 + O2 = 2N2O5
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCHO3 = Na2CO3 + CO2 + H2O2NaCHO3 = Na2CO3 + CO2 + H2O
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3 +O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaOH(aq)+CuCl2(aq) = NaCl(aq) + Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
NH4ClO4(s)=N2(g)+Cl2+O2(g)+H2O(g)2NH4ClO4(s) = N2(g) + Cl2 + 2O2(g) + 4H2O(g)
Na+ TiCl4 = Ti + NaCl4Na + TiCl4 = Ti + 4NaCl
NH4OH+HCI=NH4HCI+OHNH4OH + HCI = NH4HCI + OH
NaC2H3O2 + COSO4 = NaOSO4 + C(C2H3O2)NaC2H3O2 + COSO4 = NaOSO4 + C(C2H3O2)
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na2SiF6+Na=Si+NaFNa2SiF6 + 4Na = Si + 6NaF
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaHCO3 + LiCl = LiHCO3 + NaClNaHCO3 + LiCl = LiHCO3 + NaCl
Na(s)+H2O(l)=NaOH+H22Na(s) + 2H2O(l) = 2NaOH + H2
Ni(ClO4)2 + NaNO2 = NaClO4 + Ni(NO2)2Ni(ClO4)2 + 2NaNO2 = 2NaClO4 + Ni(NO2)2
NaSO4 + BaNO3 = NaNO3 + BaSO4NaSO4 + BaNO3 = NaNO3 + BaSO4
NaPO4+LiSO4= LiPO4+NaSO4NaPO4 + LiSO4 = LiPO4 + NaSO4
NaPO4+LiSO4= LiPO4+NaSO4NaPO4 + LiSO4 = LiPO4 + NaSO4
NaPO4+LiSO4= LiPO4+NaSO4NaPO4 + LiSO4 = LiPO4 + NaSO4
NaPO4+LiSO4= LiPO4+NaSO4NaPO4 + LiSO4 = LiPO4 + NaSO4
Na + FeBr3 = NaBr + Fe3Na + FeBr3 = 3NaBr + Fe
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaOH+H3PO4=H2O+Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NH4Cl+Na2CO3=(NH4)CO3+ClNa2NH4Cl + Na2CO3 = (NH4)CO3 + ClNa2
NO2+O2+H2O=HNO34NO2 + O2 + 2H2O = 4HNO3
N2+O2=N2O2N2 + O2 = 2N2O
NH3=N2+ H22NH3 = N2 + 3H2
NaO3+PbO=Pb(NaO3)2+Na2O-8NaO3 - 5PbO = -5Pb(NaO3)2 + Na2O
Na3PO4(aq)+AlCl3(aq)=NaCl + AlPO4Na3PO4(aq) + AlCl3(aq) = 3NaCl + AlPO4
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NaCl + H2O = NaOH + Cl2 + H2 2NaCl + 2H2O = 2NaOH + Cl2 + H2
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaNO = NaNO2 + O2-2NaNO = -2NaNO2 + O2
NaN3=Na+N22NaN3 = 2Na + 3N2
Na2SO3 + SnCl2 + HCl = NaCl + SnCl4 + SnS2 + H2O2Na2SO3 + 6SnCl2 + 12HCl = 4NaCl + 5SnCl4 + SnS2 + 6H2O
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NaC2H3O2 + CaSO4 = Na2SO4 + Ca(C2H3O2)22NaC2H3O2 + CaSO4 = Na2SO4 + Ca(C2H3O2)2
Na(OH)+AlBr3=NaBr+Al(OH)33Na(OH) + AlBr3 = 3NaBr + Al(OH)3
NH3+O2+CH4 = HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4NO3(aq) = N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na+O2=Na2O4Na + O2 = 2Na2O
NH4+OH=H2O+NH3NH4 + OH = H2O + NH3
Na2CO3 +NiCl2 = Na2Cl2 +NiCO3Na2CO3 + NiCl2 = Na2Cl2 + NiCO3
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na2S(aq)+Cu(NO3)2(aq) = NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2+3H2=2NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOCl(aq)+2NaI(aq)+2HC2H3O2(aq) = I2(s)+NaCl(aq)+2NaC2H3O2(aq)+H2O(l)NaOCl(aq) + 2NaI(aq) + 2HC2H3O2(aq) = I2(s) + NaCl(aq) + 2NaC2H3O2(aq) + H2O(l)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na + H2O = H + NaOHNa + H2O = H + NaOH
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na3PO4 + CaCl2 = NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaOH + Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NaOH+Cl2=NaCl+NaClO+H2O2NaOH + Cl2 = NaCl + NaClO + H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NH3 + NO = N2 +H2O4NH3 + 6NO = 5N2 + 6H2O
NH4+O2=NO+H2010NH4 + 5O2 = 10NO + 2H20
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4OH+HBr=H2O+NH4BrNH4OH + HBr = H2O + NH4Br
NH4OH+HBr=H2O+NH4BrNH4OH + HBr = H2O + NH4Br
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
NO2 = NO + O22NO2 = 2NO + O2
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaOH+Br2=NaBrO3+NaBr+H2O6NaOH + 3Br2 = NaBrO3 + 5NaBr + 3H2O
NaOH+Br2=NaBrO3+NaBr+H2O6NaOH + 3Br2 = NaBrO3 + 5NaBr + 3H2O
NaNO3 = Na+N2+O22NaNO3 = 2Na + N2 + 3O2
N2H4 = NH3 + N23N2H4 = 4NH3 + N2
NaNO3 = Na+N2+O22NaNO3 = 2Na + N2 + 3O2
Na2S + Cu(NO3)2 = NaNO3 + CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2(g) + O2(g )= N2O32N2(g) + 3O2(g) = 2N2O3
NaCl+Hg2(C2H3O2)= Na(C2H3O2)+Hg2ClNaCl + Hg2(C2H3O2) = Na(C2H3O2) + Hg2Cl
NH4OH(aq)+HClO3(aq)=H2O(l)+NH4ClO3(aq)NH4OH(aq) + HClO3(aq) = H2O(l) + NH4ClO3(aq)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2O+ (NH4)2SO4= Na2SO4 +H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
NaOH + NH4Cl = NH3 + H2O + NaClNaOH + NH4Cl = NH3 + H2O + NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NiCl2+KOH=NiK2+ClOHNiCl2 + 2KOH = NiK2 + 2ClOH
NiCl+KOH=NiK+ClOHNiCl + KOH = NiK + ClOH
NiS+HNO3= Ni(NO3)2 +NO +S+H2O3NiS + 8HNO3 = 3Ni(NO3)2 + 2NO + 3S + 4H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaNO3+ KCH3COO = KNO3 + NaCH3COONaNO3 + KCH3COO = KNO3 + NaCH3COO
NH3(aq) + O2(aq) = NO + H2O4NH3(aq) + 5O2(aq) = 4NO + 6H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+O2=NON2 + O2 = 2NO
Na3PO4 + Ca(NO3)2 = NaNO3 + Ca3(PO4)22Na3PO4 + 3Ca(NO3)2 = 6NaNO3 + Ca3(PO4)2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2S2O3 + I2= NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaNO2 + HSO3NH2= NaHSO4+H2O + N2NaNO2 + HSO3NH2 = NaHSO4 + H2O + N2
NaNO2 + HSO3NH2= NaHSO4+H2O + N2NaNO2 + HSO3NH2 = NaHSO4 + H2O + N2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4SCN + Hg(NO3)2 = Hg(SCN)2 + NH4NO32NH4SCN + Hg(NO3)2 = Hg(SCN)2 + 2NH4NO3
NaIO3 = NaI + O22NaIO3 = 2NaI + 3O2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
NH4OH + HNO3 = NH4NO3 + H2ONH4OH + HNO3 = NH4NO3 + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + I = NIN2 + 2I = 2NI
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 + Na = NaNH2 + H22NH3 + 2Na = 2NaNH2 + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO3+MgCl2=NaCl+Mg(NO3)22NaNO3 + MgCl2 = 2NaCl + Mg(NO3)2
NO + H2 = NH3 + H2O2NO + 5H2 = 2NH3 + 2H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
Na2+2CuCl2=NaCl2+CuNa2 + 2CuCl2 = 2NaCl2 + 2Cu
Na + F2 = 2NaF2Na + F2 = 2NaF
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na202+H2O=NaOH+O2-2Na202 - 202H2O = -404NaOH + 101O2
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na2CO3 + Co(NO3)2 = NaNO3 + CoCO3Na2CO3 + Co(NO3)2 = 2NaNO3 + CoCO3
N2O5= NO2 +O22N2O5 = 4NO2 + O2
NaNO3 + CaCl2=Ca(NO3)2 +NaCl2NaNO3 + CaCl2 = Ca(NO3)2 + 2NaCl
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NiCO3 + HCl =NiCl2 + H2O +CO2NiCO3 + 2HCl = NiCl2 + H2O + CO2
NH4ClO4+P=H3PO4+N2+Cl2+H2O10NH4ClO4 + 8P = 8H3PO4 + 5N2 + 5Cl2 + 8H2O
Na2SO4 +FeCl3 = NaCl +Fe2(SO4)33Na2SO4 + 2FeCl3 = 6NaCl + Fe2(SO4)3
NH3=N2+H22NH3 = N2 + 3H2
NH3=N2+H22NH3 = N2 + 3H2
NH3=N2+H22NH3 = N2 + 3H2
NaCl O3+SO2+H2SO4=Cl O2+NaHSO42NaClO3 + SO2 + H2SO4 = 2ClO2 + 2NaHSO4
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaOH+(NH4)3PO4=Na3PO4+H2O+NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NH3(g) +O2(g) = NO(g)+ H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na2SO4(aq)+CaCl2(aq)=NaCl(aq)+CaSO4(s)Na2SO4(aq) + CaCl2(aq) = 2NaCl(aq) + CaSO4(s)
Na 2 CO 3 (aq)+CuCl 2 (aq)=CuCO 3 (s)+2NaCl(aq) Na2CO3(aq) + CuCl2(aq) = CuCO3(s) + 2NaCl(aq)
NH3(g)+Cl2(g)=NH4Cl(s)+NCl3(g)4NH3(g) + 3Cl2(g) = 3NH4Cl(s) + NCl3(g)
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2+O2=NON2 + O2 = 2NO
NiCl2*6(H2O) + C2H8N2 = Ni(C2H8N2)3Cl2 + H2ONiCl2*6(H2O) + 3C2H8N2 = Ni(C2H8N2)3Cl2 + 6H2O
N2 + H2 = NH2N2 + 2H2 = 2NH2
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + H2SO4 + O2 = Na2SO4 + H2O + Cl24NaCl + 2H2SO4 + O2 = 2Na2SO4 + 2H2O + 2Cl2
NaCl + H2SO4 + O2 = Na2SO4 + H2O + Cl4NaCl + 2H2SO4 + O2 = 2Na2SO4 + 2H2O + 4Cl
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO2+H2O=HNO3+HNO22NO2 + H2O = HNO3 + HNO2
N2O5 = NO2 + 5O22N2O5 = 4NO2 + O2
N2+H2=NH3N2 + 3H2 = 2NH3
N+O2=N2O34N + 3O2 = 2N2O3
N+O2=N2O34N + 3O2 = 2N2O3
NaOH+AlBr3=NaBr+Al(OH)33NaOH + AlBr3 = 3NaBr + Al(OH)3
NaClO + H2O = Na+ + OH- + Cl2 + O24NaClO + 2H2O = 4Na+ + 4OH- + 2Cl2 + O2
NaHSO3 + HCl + K2Cr2O7 = NaHSO4 +KCl + Cr2O3 + H2O3NaHSO3 + 2HCl + K2Cr2O7 = 3NaHSO4 + 2KCl + Cr2O3 + H2O
NaHSO3 + HCl + KMnO4 = NaHSO4 + KCl + MnCl2 + H2O5NaHSO3 + 6HCl + 2KMnO4 = 5NaHSO4 + 2KCl + 2MnCl2 + 3H2O
NaHSO3 + HCl + KMnO4 = NaHSO4 + KCl + MnCl2 + H2O5NaHSO3 + 6HCl + 2KMnO4 = 5NaHSO4 + 2KCl + 2MnCl2 + 3H2O
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaCO3(s)+HCl(aq)=NaCl(s)+HCO3NaCO3(s) + HCl(aq) = NaCl(s) + HCO3
NH3(g)+Fe(s)=FeN(s)+H2(g)2NH3(g) + 2Fe(s) = 2FeN(s) + 3H2(g)
Na2CO3 + NiCl2 = 2NaCl(aq) + NiCO3(s) Na2CO3 + NiCl2 = 2NaCl(aq) + NiCO3(s)
Na2CO3 + HCl = NaHCO3 + NaClNa2CO3 + HCl = NaHCO3 + NaCl
Na2CO3 + HCl = 2NaCl(s) + H2O(aq) + CO2(g)Na2CO3 + 2HCl = 2NaCl(s) + H2O(aq) + CO2(g)
Na2CO3 + AgNO3 = 2NaNO3(aq) + Ag2CO3(s)Na2CO3 + 2AgNO3 = 2NaNO3(aq) + Ag2CO3(s)
Na2CO3(aq) + CuSO4(aq) = Na2SO4(aq) + CuCO3(s)Na2CO3(aq) + CuSO4(aq) = Na2SO4(aq) + CuCO3(s)
NaHSO3+HCl+K2Cr2O7 = NaHSO4+KCl+Cr2O3+H2O3NaHSO3 + 2HCl + K2Cr2O7 = 3NaHSO4 + 2KCl + Cr2O3 + H2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH4NO2 = N2+H2ONH4NO2 = N2 + 2H2O
NH4NO2 = N2+ H2ONH4NO2 = N2 + 2H2O
NH3+ O2= NO+ H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHSO3+HCl+KMnO4=NaHSO4+KCl+MnCl2+H2O5NaHSO3 + 6HCl + 2KMnO4 = 5NaHSO4 + 2KCl + 2MnCl2 + 3H2O
Na+O++ =Na++O2Na + O++ = 2Na+ + O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2S + O2 + H2O = Na2S2O3 + NaOH2Na2S + 2O2 + H2O = Na2S2O3 + 2NaOH
NaClO3 + BaSO4 = Na2SO4 + Ba(ClO3)22NaClO3 + BaSO4 = Na2SO4 + Ba(ClO3)2
NH4Cl + Hg + HgNH2Cl=Hg2Cl2 + NH3NH4Cl + Hg + HgNH2Cl = Hg2Cl2 + 2NH3
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH4Cl + Ca(NO3)2 = CaCl + NH4(NO3)2NH4Cl + Ca(NO3)2 = CaCl + NH4(NO3)2
NaHCO 3 (aq)+HCl(aq)=H 2 O(l)+NaCl(aq)+CO 2 (g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaCl+Hg2(C2H3O2)2=Na2(C2H3O2)+HgCl24NaCl + Hg2(C2H3O2)2 = 2Na2(C2H3O2) + 2HgCl2
NaCl+Hg2(C2H3O2)2=Na2(C2H3O2)+HgCl24NaCl + Hg2(C2H3O2)2 = 2Na2(C2H3O2) + 2HgCl2
NH4Cl + Hg + HgNH2Cl=Hg2Cl2 + NH3NH4Cl + Hg + HgNH2Cl = Hg2Cl2 + 2NH3
NaClO3 + BaSO4 = Na2SO4 + Ba(ClO3)22NaClO3 + BaSO4 = Na2SO4 + Ba(ClO3)2
NH4OH+HCl=NH4Cl+H2ONH4OH + HCl = NH4Cl + H2O
NCl +CH = N + H + CClNCl + CH = N + H + CCl
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
Na2S2O3 + I2= NaI + S4O6 2Na2S2O3 + 2I2 = 4NaI + S4O6
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
N2O5 = N2O4 + O22N2O5 = 2N2O4 + O2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2+O=Na2ONa2 + O = Na2O
NaOCl(aq)+2NaI(aq)+2HC2H3O2(aq) = I2(s)+NaCl(aq)+2NaC2H3O2(aq)+H2O(l)NaOCl(aq) + 2NaI(aq) + 2HC2H3O2(aq) = I2(s) + NaCl(aq) + 2NaC2H3O2(aq) + H2O(l)
NH4NO=N2+O2+H2O2NH4NO = 2N2 - O2 + 4H2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na+O=Na2O2Na + O = Na2O
NaCl + Hg2(C2H3O2)2 = NaC2H3O2 +Hg2Cl22NaCl + Hg2(C2H3O2)2 = 2NaC2H3O2 + Hg2Cl2
N2+O2=NON2 + O2 = 2NO
NaCO3 + H2SO4 = NaSO4 + CO2 + H2ONaCO3 + H2SO4 = NaSO4 + CO2 + H2O
NaOH(aq)+HNO3(aq)=H2O(l)+NaNO3(aq)NaOH(aq) + HNO3(aq) = H2O(l) + NaNO3(aq)
Ni+HCl=NiCl2+H2Ni + 2HCl = NiCl2 + H2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl+Hg2(C2H3O2)2=Na(C2H3O2)2+Hg2ClNaCl + Hg2(C2H3O2)2 = Na(C2H3O2)2 + Hg2Cl
NO(g)+O2(g) = NO2(g)2NO(g) + O2(g) = 2NO2(g)
NH3+O=NO+H2O2NH3 + 5O = 2NO + 3H2O
NaHCO3 + H3PO4 = Na3PO4 +CO2 + H2O3NaHCO3 + H3PO4 = Na3PO4 + 3CO2 + 3H2O
Ni2O+H2SO4=Ni2(SO4)+H2ONi2O + H2SO4 = Ni2(SO4) + H2O
N2H4 + N2O4 = N2 + H2O 2N2H4 + N2O4 = 3N2 + 4H2O
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NaBH4 + PtCl2 = NaCl + BH + PtH + H2 4NaBH4 + 2PtCl2 = 4NaCl + 4BH + 2PtH + 5H2
NH3(g) + O2(g) =NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaBH4 + PtCl2 + H2O = NaCl + BHO + PtH + H2 4NaBH4 + 2PtCl2 + 4H2O = 4NaCl + 4BHO + 2PtH + 9H2
NaCl + Mg(C2H3O2)2 = Na(C2H3O2) + MgCl22NaCl + Mg(C2H3O2)2 = 2Na(C2H3O2) + MgCl2
NH3+O2+CH4= HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2O+H2=NH3+H2ON2O + 4H2 = 2NH3 + H2O
Na2S+Mg(NO3)2=MgS+2Na(NO3)Na2S + Mg(NO3)2 = MgS + 2Na(NO3)
NO + O2 = NO22NO + O2 = 2NO2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2+H2=NH3N2 + 3H2 = 2NH3
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
Na+O=Na2O2Na + O = Na2O
Na + HCI = NaCI+ H22Na + 2HCI = 2NaCI + H2
NiF2+Fe2(SO4)3= NiSO4+FeF33NiF2 + Fe2(SO4)3 = 3NiSO4 + 2FeF3
Na2S(aq) +O2(g) +H2O(l) =Na2S2O3(aq) +NaOH(aq)2Na2S(aq) + 2O2(g) + H2O(l) = Na2S2O3(aq) + 2NaOH(aq)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
N2H4= NH3+N23N2H4 = 4NH3 + N2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S + ZnSO4 = Na2SO4 + SZnNa2S + ZnSO4 = Na2SO4 + SZn
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3(aq)+HNO3(aq)=CO2(g)+H2O(g)+NaNO3(aq)Na2CO3(aq) + 2HNO3(aq) = CO2(g) + H2O(g) + 2NaNO3(aq)
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4Cl(aq)+FeN(aq)=(NH4)3N(aq)+FeCl3(aq)3NH4Cl(aq) + FeN(aq) = (NH4)3N(aq) + FeCl3(aq)
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
Na2S + 2 NH4Cl = (NH4)2S + 2 NaClNa2S + 2NH4Cl = (NH4)2S + 2NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NA + NANO=NA2O + N2NA + NANO = NA2O + N2
NaS+ArNO3=ArS+NaNO3NaS + ArNO3 = ArS + NaNO3
NaS+ArNO3=ArS+NaNO3NaS + ArNO3 = ArS + NaNO3
N2O5 = NO2 + 5O22N2O5 = 4NO2 + O2
NaNO3+PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3+O2= CO2+H2O+Na2CO32NaHCO3 + 0O2 = CO2 + H2O + Na2CO3
N2H4 = NH3 + N23N2H4 = 4NH3 + N2
NiS + O2 = NiO + SO22NiS + 3O2 = 2NiO + 2SO2
Na2S + Cu(NO3)2 = NaNO3 + CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na+H2O=Na(OH)+H22Na + 2H2O = 2Na(OH) + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2O5=NO2+O2 2N2O5 = 4NO2 + O2
NO2 + H2O = NH4 + OHNO2 + 6H2O = NH4 + 8OH
Na+ H2O= NaOH+ H22Na + 2H2O = 2NaOH + H2
NaClO + Na2S2O3 + NaOH = NaCl + Na2SO4 + H2O4NaClO + Na2S2O3 + 2NaOH = 4NaCl + 2Na2SO4 + H2O
N2O4=NO2N2O4 = 2NO2
Na+HCl= H2+NaCl2Na + 2HCl = H2 + 2NaCl
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na+ + Cl- = NaClNa+ + Cl- = NaCl
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na+O2=Na2O4Na + O2 = 2Na2O
NaHCO3 = Na2CO3 + H2O + 2CO22NaHCO3 = Na2CO3 + H2O + CO2
NaCl=Na+Cl22NaCl = 2Na + Cl2
Na2So4(aq)+Ba(No3)2=BaSo4(s)+NaNo3(aq)Na2So4(aq) + Ba(No3)2 = BaSo4(s) + 2NaNo3(aq)
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
NH4OH + CU(OH)2=(NH4)2CU(NH2)4 + H2O6NH4OH + CU(OH)2 = (NH4)2CU(NH2)4 + 8H2O
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
N2O+ H2 = NH3 + H2ON2O + 4H2 = 2NH3 + H2O
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
NH4NO3=N2O+2H2ONH4NO3 = N2O + 2H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
NaMnO4 + FeCl2 = NaCl + Fe(MnO4)22NaMnO4 + FeCl2 = 2NaCl + Fe(MnO4)2
NH3+O2=NO=H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO=H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaClO+NaOH+I2=NaIO3+NaCl+H24NaClO + 2NaOH + I2 = 2NaIO3 + 4NaCl + H2
NH4Cl + Ca(OH)2 = CaCl2 + H2O + NH32NH4Cl + Ca(OH)2 = CaCl2 + 2H2O + 2NH3
NaHCO3 + H3C6H5O7 = H20 + CO2 + Na3C6H5O7150NaHCO3 + 80H3C6H5O7 = 27H20 + 330CO2 + 50Na3C6H5O7
NaHCO3 + H2SO4 = CO2 + Na2SO4 + H2O2NaHCO3 + H2SO4 = 2CO2 + Na2SO4 + 2H2O
NaHCO3 + H2SO4 = 3CO2 + Na2SO4 + 4H2O2NaHCO3 + H2SO4 = 2CO2 + Na2SO4 + 2H2O
NO2 + O2 + H2O = HNO34NO2 + O2 + 2H2O = 4HNO3
NaNO3 (aq) + PbO (s)=Pb(NO3)2 (aq) + Na2O (s)2NaNO3(aq) + PbO(s) = Pb(NO3)2(aq) + Na2O(s)
NO + O2 = NO22NO + O2 = 2NO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O +2HCl = 2NaCl + H2ONa2O + 2HCl = 2NaCl + H2O
Na2S + Pb(C2H3O2)2 = PbS + NaC2H3O2Na2S + Pb(C2H3O2)2 = PbS + 2NaC2H3O2
Ni2+ + Nh4Cl + Nh3 = Ni(Nh3)6 + Nh4Cl0Ni2+ + Nh4Cl + 0Nh3 = 0Ni(Nh3)6 + Nh4Cl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + SO2 = NO + S + H2O4NH3 + 5SO2 = 4NO + 5S + 6H2O
Ni2+ + Nh4Cl + Nh3 = Ni(Nh3)6 + Cl0Ni2+ + 3Nh4Cl - 4Nh3 = 0Ni(Nh3)6 + 3Cl
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2SO4+Pb(NO3)2=NaNO3+PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Ni + NaHDMG = Ni(DMG)2 + NaHNi + 2NaHDMG = Ni(DMG)2 + 2NaH
Ni + NaHDMG = Ni(DMG) + NaHNi + NaHDMG = Ni(DMG) + NaH
Ni + NH3 +H2O = Ni(OH)2 + NH4Ni + 2NH3 + 2H2O = Ni(OH)2 + 2NH4
NaClO+NaOH+I2=NaIO3+NaCl+H24NaClO + 2NaOH + I2 = 2NaIO3 + 4NaCl + H2
NACLO +AGNO3 = NANO3+AGCLO3+AGCL3NACLO + 3AGNO3 = 3NANO3 + AGCLO3 + 2AGCL
NH4Cl+Ca(OH)2= CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NaOH+H2S=Na2S+H2O2NaOH + H2S = Na2S + 2H2O
Na2OH+H2S=Na2S+H3ONa2OH + H2S = Na2S + H3O
Na2OH+H2S=Na2S=H3ONa2OH + H2S = Na2S + H3O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na2HPO4=Na4P2O7+H2O2Na2HPO4 = Na4P2O7 + H2O
Na3Po4 + KOH = NaOH + K3Po4Na3Po4 + 3KOH = 3NaOH + K3Po4
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na++Cl-=NaClNa+ + Cl- = NaCl
NH4NO3 = N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2O + H2 = NH3 + H2ON2O + 4H2 = 2NH3 + H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2O5=N2O4+O22N2O5 = 2N2O4 + O2
NH3+ClF3=N2+HF+Cl22NH3 + 2ClF3 = N2 + 6HF + Cl2
Na3PO4 + CaCl2 = Ca3(PO4)2 + NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
Na2S + AgNO3 = Ag2S + NaNO3Na2S + 2AgNO3 = Ag2S + 2NaNO3
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH3(g)+O2(g)= NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NAOH+HCL=NACL+H2ONAOH + HCL = NACL + H2O
Na2 + CO + HNO = CO2 + H2O + NaNONa2 - CO + 2HNO = -1CO2 + H2O + 2NaNO
NaHCO3(s)= Na2CO3(s)+CO2(g)+H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
NaClO + Na2S2O3 + NaOH=NaCl + Na2SO4 + H2O4NaClO + Na2S2O3 + 2NaOH = 4NaCl + 2Na2SO4 + H2O
NaNH2 + NaNO3 = NaN3 + NaOH + NH33NaNH2 + NaNO3 = NaN3 + 3NaOH + NH3
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NaOH + KIO3 = NaIO3 + KOHNaOH + KIO3 = NaIO3 + KOH

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.