Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaAlO2+H2O=Al(OH)3+NaOHNaAlO2 + 2H2O = Al(OH)3 + NaOH
NaBr (aq) + Pb(C2H3O2)2 (aq) = PbBr2(s) + NaC2H3O2(aq)2NaBr(aq) + Pb(C2H3O2)2(aq) = PbBr2(s) + 2NaC2H3O2(aq)
Na3PO4(aq) + Sr(ClO3)2 (aq) = Sr3(PO4)2 (s) + NaClO3(aq)2Na3PO4(aq) + 3Sr(ClO3)2(aq) = Sr3(PO4)2(s) + 6NaClO3(aq)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Ni+ C4H8N2O2= Ni(C4H8N2O2)2Ni + 2C4H8N2O2 = Ni(C4H8N2O2)2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaMnO4+K2SO3+KOH=K2MnO4+Na2SO4+H2O2NaMnO4 + K2SO3 + 2KOH = 2K2MnO4 + Na2SO4 + H2O
NaBr+H2SO4=Na2SO4+HBr2NaBr + H2SO4 = Na2SO4 + 2HBr
N2H4+HNO2=H2O+HN3N2H4 + HNO2 = 2H2O + HN3
NH4Cl+Cl2=HCl+NCl3NH4Cl + 3Cl2 = 4HCl + NCl3
NH3+O2=H2O+N24NH3 + 3O2 = 6H2O + 2N2
NO+H2O=NH3+O24NO + 6H2O = 4NH3 + 5O2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl+Sn(NO3)2=NaNO3+SnCl22NaCl + Sn(NO3)2 = 2NaNO3 + SnCl2
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
Na(NO3)+PbO=Pb(NO3)2+Na2O2Na(NO3) + PbO = Pb(NO3)2 + Na2O
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCN+CuCO3=Na2CO3+Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
NaOH + H2O = Na + OHNaOH + 0H2O = Na + OH
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaNO3 + Ba(NO3) + K3PO4 = Ba3(PO4)2 + KNO3 + Na3NaNO3 + 3Ba(NO3) + 2K3PO4 = Ba3(PO4)2 + 6KNO3 + 3Na
NaO2 + H2O = NaOH + O2 4NaO2 + 2H2O = 4NaOH + 3O2
Na2SO4+Ca3(PO4)2(aq) = Na3PO4(s)+CaSO43Na2SO4 + Ca3(PO4)2(aq) = 2Na3PO4(s) + 3CaSO4
Na2SO4+Ca3(PO4)2(aq) = Na3PO4(s)+ CaSO43Na2SO4 + Ca3(PO4)2(aq) = 2Na3PO4(s) + 3CaSO4
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na3(PO4)+CaCl2=Ca3(PO4)2+NaCl2Na3(PO4) + 3CaCl2 = Ca3(PO4)2 + 6NaCl
NaI + Cl2 = I2 + NaCl2NaI + Cl2 = I2 + 2NaCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na2S+HCl=NaCl+H2SNa2S + 2HCl = 2NaCl + H2S
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na(HCO3) + H(C2H3O2) = Na(C2H3O2) +H2CO3Na(HCO3) + H(C2H3O2) = Na(C2H3O2) + H2CO3
Na2CO3+Ca(OH)2=CO2+CaO+NaOHNa2CO3 + Ca(OH)2 = CO2 + CaO + 2NaOH
NaIO3+SO2+H2O=NaHSO4+H2SO4+I22NaIO3 + 5SO2 + 4H2O = 2NaHSO4 + 3H2SO4 + I2
Na2SO4(aq)+2CaCl2(aq)=CaSO4(s)+NaCl(aq)Na2SO4(aq) + CaCl2(aq) = CaSO4(s) + 2NaCl(aq)
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
Na2O+H2O = NaOHNa2O + H2O = 2NaOH
Na2O+H2O = NaOHNa2O + H2O = 2NaOH
Na2O+H2O = NaOHNa2O + H2O = 2NaOH
Na2SO3(aq)+HCl(aq)=NaCl (aq)+H2O(l)+SO2(g)Na2SO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + SO2(g)
Na2SO3(aq)+HCl(aq)=NaCl (aq)+H2O(l)+SO2(g)Na2SO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + SO2(g)
NaBr +AgCl=NaCl +AgBrNaBr + AgCl = NaCl + AgBr
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NAHCO 3+HCL=NACL+H2CO3NAHCO3 + HCL = NACL + H2CO3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na2CO3 +HCl = NaCl +CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na2HPO4+CuSO4=Na2SO4+CuHPO4Na2HPO4 + CuSO4 = Na2SO4 + CuHPO4
NaOH+CuSO4=CuOH+NaSO4NaOH + CuSO4 = CuOH + NaSO4
NaCl+CuSO4=CuCl+NaSO4NaCl + CuSO4 = CuCl + NaSO4
Na + HOH = NaOH + H22Na + 2HOH = 2NaOH + H2
N2O+H2O=NH4NO3N2O + 2H2O = NH4NO3
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3+H2SO4=Na2SO4+CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
NH3 + N2O = N2 + H2O2NH3 + 3N2O = 4N2 + 3H2O
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
N2 + H = NH3N2 + 6H = 2NH3
NaC2O4+KMnO4+H2SO4=CO2+MnSO4+H2O+K2SO4+Na2SO410NaC2O4 + 2KMnO4 + 8H2SO4 = 20CO2 + 2MnSO4 + 8H2O + K2SO4 + 5Na2SO4
N + H = NH3N + 3H = NH3
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
N2+2H2 = 3NH3N2 + 3H2 = 2NH3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH4+NO3=N2+H2O6NH4 + 4NO3 = 5N2 + 12H2O
NaBr = Na + Br22NaBr = 2Na + Br2
N2+H2=2NH3N2 + 3H2 = 2NH3
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na3PO4 + AlCl3 = NaCl + AlPO4Na3PO4 + AlCl3 = 3NaCl + AlPO4
Na + O2 = Na2O4Na + O2 = 2Na2O
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaCl + F2 = 2NaF + Cl22NaCl + F2 = 2NaF + Cl2
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na + O2 = Na2O22Na + O2 = Na2O2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+3H2=NH3N2 + 3H2 = 2NH3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NaCIO3=NaCI+O22NaCIO3 = 2NaCI + 3O2
N2+H2=NH3N2 + 3H2 = 2NH3
Na+I2=NaI2Na + I2 = 2NaI
N2+H2=NH3N2 + 3H2 = 2NH3
Na+I2=NaI2Na + I2 = 2NaI
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H3 = NH3N2 + 2H3 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
N2H2+H2O2=N2+H2ON2H2 + H2O2 = N2 + 2H2O
Na3PO4 + FeCl3 = NaCl + FePO4Na3PO4 + FeCl3 = 3NaCl + FePO4
Na+P4=NaP4Na + P4 = NaP4
NaOH=Na2O+H2O2NaOH = Na2O + H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 = N2 +H22NH3 = N2 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2+I2=NaI2Na2 + 2I2 = 2NaI2
NH3+O2=2NO3+3H2O4NH3 + 9O2 = 4NO3 + 6H2O
NH3+O2=2NO3+3H2O4NH3 + 9O2 = 4NO3 + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na3(PO4)+CaF2=NaF+Ca3(PO4)22Na3(PO4) + 3CaF2 = 6NaF + Ca3(PO4)2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 + Ca(OH)2 = CaCO3 + NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
NH3+O2 = N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NBr3 = N2 + Br22NBr3 = N2 + 3Br2
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3=H2O+CO2+Na2CO32NaHCO3 = H2O + CO2 + Na2CO3
Na2S+Zn(NO3)2=ZnS+NaNO3Na2S + Zn(NO3)2 = ZnS + 2NaNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + H3PO4 = H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
Na2B4O7 +7C =B +Na +CONa2B4O7 + 7C = 4B + 2Na + 7CO
NaNO3 + Na=Na2NO2 +ONaNO3 + Na = Na2NO2 + O
NaNO3 + Na=Na2NO2 +ONaNO3 + Na = Na2NO2 + O
NaNO3 + Na=Na2NO2 +ONaNO3 + Na = Na2NO2 + O
N2H4+O2=N2+H2ON2H4 + O2 = N2 + 2H2O
NaCl+H2O=NaOH+Cl2+H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCL+H2SO4=Na2SO4+HCL2NaCL + H2SO4 = Na2SO4 + 2HCL
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NO + O2 = NO22NO + O2 = 2NO2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2 + H2O = NaOH + O2-2Na2 - 2H2O = -4NaOH + O2
Na + Cl = NaClNa + Cl = NaCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NO + Fe = N2O +Fe20NO + 2Fe = 0N2O + Fe2
NO + Fe = N2O +Fe20NO + 2Fe = 0N2O + Fe2
Ni(NO3)2 + NaOH = Ni(OH)2 + NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NiCl2 + O2 = NiO + Cl2O5NiCl2 + 3O2 = NiO + Cl2O5
NdF3+Ca=Nd+CaF22NdF3 + 3Ca = 2Nd + 3CaF2
NH4OH + H2SO4 = (NH4)SO4 + H2(OH)NH4OH + H2SO4 = (NH4)SO4 + H2(OH)
NH4OH + CuSO4 = (NH4)2SO4 +Cu(OH)22NH4OH + CuSO4 = (NH4)2SO4 + Cu(OH)2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+F2=NF3N2 + 3F2 = 2NF3
Na3PO4+Ca(OH)2=NaOH+Ca3(PO4)22Na3PO4 + 3Ca(OH)2 = 6NaOH + Ca3(PO4)2
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaN3 = Na + N22NaN3 = 2Na + 3N2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
N2 + H2 = 2NH3N2 + 3H2 = 2NH3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaH2PO4 = NaPO3 + H2ONaH2PO4 = NaPO3 + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NCl3 = N2 + Cl22NCl3 = N2 + 3Cl2
NO2+O2+NaCO3=NaNO2+CO22NO2 - O2 + 2NaCO3 = 2NaNO2 + 2CO2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+FeSO4=Na2SO4+Fe(OH)22NaOH + FeSO4 = Na2SO4 + Fe(OH)2
N2+H=NH3N2 + 6H = 2NH3
N2+H=NH3N2 + 6H = 2NH3
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaOH+Zn(NO3)2= NaNO3+Zn(OH)22NaOH + Zn(NO3)2 = 2NaNO3 + Zn(OH)2
Na2CO3 + Ca(OH)2 = CaCO3 + NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
Na2CO3 + Ca(OH)2 = CaCO3 + NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=N2O2N2 + O2 = 2N2O
Na3PO4 + CaCl2 = Ca3(PO4)2 + NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
Na3PO4 + CaCl2 = Ca3(PO4)2 + NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
NH4NO3 (s) = N2O (g) + H2O (l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3 (s) = N2O (g) + H2O (l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaOH+Cu(NO3)2=Cu(OH)2+NaNO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
NaOH+Cu(NO3)2=Cu(OH)2+NaNO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2(SO4) +Pb(NO3)2 = Na(NO3) + Pb(SO4) Na2(SO4) + Pb(NO3)2 = 2Na(NO3) + Pb(SO4)
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NaCl + NH3 + CO2 + H2O = NaHCO3 + NH4ClNaCl + NH3 + CO2 + H2O = NaHCO3 + NH4Cl
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO+H2O=NH3+O24NO + 6H2O = 4NH3 + 5O2
NaOH + H3PO4 = H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
N2+Ca=CaN2N2 + Ca = CaN2
N2+Ca=CaN2N2 + Ca = CaN2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na+O2=Na2O22Na + O2 = Na2O2
NO(g)+O2(g)=NO2(g)2NO(g) + O2(g) = 2NO2(g)
NH3 + MgCl2 + NaH2PO4 + 6H2O = NH4MgPO4 * 6H2O + HCl + NaClNH3 + MgCl2 + NaH2PO4 + 6H2O = NH4MgPO4*6H2O + HCl + NaCl
Na(s)+Br2(g)=NaBr(s)2Na(s) + Br2(g) = 2NaBr(s)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na3PO4+Ca(NO3)2=Ca3(PO4)2+NaNO32Na3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6NaNO3
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl=NaClNa + Cl = NaCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaHSO4 + S2 + NaOH = NaHSO34NaHSO4 + S2 + 2NaOH = 6NaHSO3
N2 + O2 = N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na3Po4 + CuCl2 = NaCl + Cu3(Po4)22Na3Po4 + 3CuCl2 = 6NaCl + Cu3(Po4)2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3 = H2O + O2 + N22NH4NO3 = 4H2O + O2 + 2N2
Na2CO3 (aq) + HCl (aq) = NaHCO3 (aq) + NaCl (aq) Na2CO3(aq) + HCl(aq) = NaHCO3(aq) + NaCl(aq)
Na2S2O3 + 4 H2O2 = Na2SO4 + H2SO4 + 3H2ONa2S2O3 + 4H2O2 = Na2SO4 + H2SO4 + 3H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO(g)+H2(g)=NH3(g)=H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NH3+O2+H2O=HNO3NH3 + 2O2 - H2O = HNO3
NH3+O2+H2O=NHO3NH3 + 2O2 - H2O = NHO3
N2 + O2 = NO2N2 + 2O2 = 2NO2
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na+NaNO3=Na2O+N5Na + NaNO3 = 3Na2O + N
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4Cl + Hg2(C2H3O2)2 = NH4C2H3O2 + Hg2Cl22NH4Cl + Hg2(C2H3O2)2 = 2NH4C2H3O2 + Hg2Cl2
NH4Cl + Hg2(C2H3O2)2 = NH4C2H3O2 + Hg2Cl22NH4Cl + Hg2(C2H3O2)2 = 2NH4C2H3O2 + Hg2Cl2
NH3+HBr=NH4BrNH3 + HBr = NH4Br
Na2CO3+H2SO4=Na2SO4=CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
NH4OH + H3PO4 = (NH4)3PO4 +H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na2SO3+HCl=NaCl+H2O+SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NH4Cl+Hg2(C2H3O2)2=NH4C2H3O2+Hg2Cl22NH4Cl + Hg2(C2H3O2)2 = 2NH4C2H3O2 + Hg2Cl2
N2 + H2 + O2 = HNO3N2 + H2 + 3O2 = 2HNO3
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaOH+HBr=NaBr+H2ONaOH + HBr = NaBr + H2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2+O2=N2O4N2 + 2O2 = N2O4
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na+B2O3=Na2O+B6Na + B2O3 = 3Na2O + 2B
NaCN+CuCO3=Na2CO3+Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
Ni(MnO4)2+(NH4)3PO4=Ni3(PO4)2+NH4MnO43Ni(MnO4)2 + 2(NH4)3PO4 = Ni3(PO4)2 + 6NH4MnO4
Na2SO4 + HCl + BaCl2 = NaCl + H2 + BaSO4 Na2SO4 + 0HCl + BaCl2 = 2NaCl + 0H2 + BaSO4
NaSO4 + HCl + BaCl2 = NaCl + H2 + BaSO4 2NaSO4 - 2HCl + 2BaCl2 = 2NaCl - H2 + 2BaSO4
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
NaNO2+O2=NaNO32NaNO2 + O2 = 2NaNO3
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NH4Cl+Ca(OH)2=CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3 + HCl =NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2SO4 * 2H2O + SO3 = Na2SO4 +H2SO4Na2SO4*2H2O + 2SO3 = Na2SO4 + 2H2SO4
Na2SO4 * 2H2O + SO3 = Na2SO4 +H2SO4Na2SO4*2H2O + 2SO3 = Na2SO4 + 2H2SO4
Na2SO4 * 2H2O + SO3 = Na2SO4 +H2SO4Na2SO4*2H2O + 2SO3 = Na2SO4 + 2H2SO4
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=N2O2N2 + O2 = 2N2O
Na+L2=NaL2Na + L2 = 2NaL
NaOH + H2SO4=Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaHCO3(s)=Na2CO3(s)+H2O(g)+CO2(g)2NaHCO3(s) = Na2CO3(s) + H2O(g) + CO2(g)
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2(CO3) + H2SO4 = Na2 (SO4) + CO2 +H2ONa2(CO3) + H2SO4 = Na2(SO4) + CO2 + H2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
N2O3+H2O=HNO2N2O3 + H2O = 2HNO2
N2+O2=N2O52N2 + 5O2 = 2N2O5
N2+O2=N2O2N2 + O2 = 2N2O
N2+O2=N2O2N2 + O2 = 2N2O
NaOH+Fe(NO3)3=Fe(OH)3+NaNO33NaOH + Fe(NO3)3 = Fe(OH)3 + 3NaNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3(g) + O3(g) = N2(g) + H2O(g)2NH3(g) + O3(g) = N2(g) + 3H2O(g)
N2H4+N2O5=N2+H2O5N2H4 + 2N2O5 = 7N2 + 10H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHCO3 + CaCl2 = CaCO3 + NaCl + CO2 + H2O2NaHCO3 + CaCl2 = CaCO3 + 2NaCl + CO2 + H2O
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3 + HNO3 = NaNO3 + H2O + CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
Na3PO4+Ba(NO3)2= NaNO3+PO4+Ba2Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + 2PO4 + 3Ba
NO2+O2+H2O=HNO34NO2 + O2 + 2H2O = 4HNO3
Na+H2O=NaO+H2Na + H2O = NaO + H2
NaBr+Ca(OH)2 = CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NaHCO3 + H3PO4 = Na3PO4 + CO2 + H2O3NaHCO3 + H3PO4 = Na3PO4 + 3CO2 + 3H2O
NaClO + H2SO4 = NaSO4 + Cl2 + H2O2NaClO + 2H2SO4 = 2NaSO4 + Cl2 + 2H2O
Na2So3+HCl=NaCl+H20+So210Na2So3 + 20HCl = 20NaCl + H20 + 15So2
Na2Cr2O7 + AlPO4 = Na3PO4 + Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
Na2So3+HCl=+NaCl+H 2 0+So210Na2So3 + 20HCl = 20NaCl + H20 + 15So2
Na2So3+HCl=+NaCl+H 2 0+So210Na2So3 + 20HCl = 20NaCl + H20 + 15So2
Na2So3+HCl=+NaCl+H20+So210Na2So3 + 20HCl = 20NaCl + H20 + 15So2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + HNO32NH3 + 7O2 = -4NO + 6HNO3
NH3+H3PO4=(NH4)2 HPO42NH3 + H3PO4 = (NH4)2HPO4
NH3+H3PO4=(NH4)2HPO42NH3 + H3PO4 = (NH4)2HPO4
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH4F+AlCl3=NH4Cl+AlF33NH4F + AlCl3 = 3NH4Cl + AlF3
Ni + H2SO4 = H2 + Ni2(SO4)3 2Ni + 3H2SO4 = 3H2 + Ni2(SO4)3
Ni + H2SO4 = H2 + Ni2(SO4)3 2Ni + 3H2SO4 = 3H2 + Ni2(SO4)3
NaL+Cl2=NaCl+L22NaL + Cl2 = 2NaCl + L2
Na2S2O3 + HCl = S + SO2 + H2O + NaClNa2S2O3 + 2HCl = S + SO2 + H2O + 2NaCl
NaPO4+MgCl=MgPO4+NaClNaPO4 + MgCl = MgPO4 + NaCl
Na+CuCl2= Cu + NaCl2Na + CuCl2 = Cu + 2NaCl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2C2O4+KMnO4+H2SO4=CO2+MnSO4+H2O+K2SO4+Na2SO45Na2C2O4 + 2KMnO4 + 8H2SO4 = 10CO2 + 2MnSO4 + 8H2O + K2SO4 + 5Na2SO4
NaC2O4+KMnO4+H2SO4=CO2+MnSO4+H2O+K2SO4+Na2SO410NaC2O4 + 2KMnO4 + 8H2SO4 = 20CO2 + 2MnSO4 + 8H2O + K2SO4 + 5Na2SO4
Na+O2=Na2O4Na + O2 = 2Na2O
Na3P + H2O = NaOH + PH3Na3P + 3H2O = 3NaOH + PH3
Na3P + H2O = NaOH + PH3Na3P + 3H2O = 3NaOH + PH3
NaHSO4 + H2SO4 = SO2+ H2O+ Na2SO42NaHSO4 - H2SO4 = 0SO2 + 0H2O + Na2SO4
NaHSO4+ H2SO4 = SO2+ H2O+ Na2SO42NaHSO4 - H2SO4 = 0SO2 + 0H2O + Na2SO4
N2+H2=NH3N2 + 3H2 = 2NH3
Na(CIO3)= NaCI+ O22Na(CIO3) = 2NaCI + 3O2
Na2CO3+3MgSO4=2MgCO3+Na2SO4Na2CO3 + MgSO4 = MgCO3 + Na2SO4
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + F2 =NaF2Na + F2 = 2NaF
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaN3 = Na + N22NaN3 = 2Na + 3N2
N2O5+H2O = HNO3N2O5 + H2O = 2HNO3
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na + H2O = NaOH = H22Na + 2H2O = 2NaOH + H2
Na +Cl2 = NaCl2Na + Cl2 = 2NaCl
NaClO + CO2 = NaCl + CO3NaClO + CO2 = NaCl + CO3
NaClO + C = NaCl + CO22NaClO + C = 2NaCl + CO2
N2 + O2 = N2O32N2 + 3O2 = 2N2O3
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3+C2H4O2 = NaC2H3O2+CO2+H2ONa2CO3 + 2C2H4O2 = 2NaC2H3O2 + CO2 + H2O
NO(g) + H2(g) = NH3(g) + H2O(g) 2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na2CO3+C2H4O2=NaC2H3O2+CO2+H2O Na2CO3 + 2C2H4O2 = 2NaC2H3O2 + CO2 + H2O
Na + Cl2=NaCl2Na + Cl2 = 2NaCl
Ni(NO3)2 + Na2CO3= NiCO3 + NaNO3Ni(NO3)2 + Na2CO3 = NiCO3 + 2NaNO3
N2H2+O2=N2+H2O2N2H2 + O2 = 2N2 + 2H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3=N2+H22NH3 = N2 + 3H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NO(g)+CO(g)=N(g)+CO2(g) NO(g) + CO(g) = N(g) + CO2(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2 + H2O = H3NO + NO3NO2 - 3H2O = -2H3NO + 5NO
NH4NO3 + CA(OH)2 = NH4 +CA(NO3)2 + H2O9NH4NO3 + 5CA(OH)2 = 8NH4 + 5CA(NO3)2 + 7H2O
NH3 + O2= NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2= NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + HCl= NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH3 + O2= NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + Ca(OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O3+H2O=HNO2N2O3 + H2O = 2HNO2
NaMnO4+K2SO3+KOH=K2MnO4+Na2SO4+H2O2NaMnO4 + K2SO3 + 2KOH = 2K2MnO4 + Na2SO4 + H2O
NaOH + Cl2 = NaCl + NaClO+ H2O2NaOH + Cl2 = NaCl + NaClO + H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na+OH=NaOHNa + OH = NaOH
Na+OH=NaOHNa + OH = NaOH
NaCl(s) + H2SO4(l) = Na2SO4(s) + HCl(g)2NaCl(s) + H2SO4(l) = Na2SO4(s) + 2HCl(g)
Na2SO4(s) + C(s) = Na2S(s) + CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
N2+H2=2NH3N2 + 3H2 = 2NH3
N02+H2=HN00N02 + H2 = 2HN0
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaCO3=NaO+CO2NaCO3 = NaO + CO2
NaCO3=NaO+CO2NaCO3 = NaO + CO2
Na2SO4(s)+C(s)=Na2S(s)+CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
Na2SO4(s)+C(s)=Na2S(s)+CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
Na2SO4(s)+C(s)=Na2S(s)+CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4 Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na+Al(OH)3=NaOH+Al3Na + Al(OH)3 = 3NaOH + Al
Na+Al(OH)3=NaOH+Al3Na + Al(OH)3 = 3NaOH + Al
NaCl+SO2+H2O+O2 = Na2SO4+HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
NiCl2+ O2= NiO + Cl2O5NiCl2 + 3O2 = NiO + Cl2O5
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na+F2=NaF2Na + F2 = 2NaF
NH3 + O2 = N2 +H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2CO3 + HCl =NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaHCO3 = CO2 + H2O + Na2CO32NaHCO3 = CO2 + H2O + Na2CO3
NH3+HCL =NH4CLNH3 + HCL = NH4CL
NH3(aq)+CoCl2(aq)=CoH2+NCl32NH3(aq) + 3CoCl2(aq) = 3CoH2 + 2NCl3
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na2S2O3 + Cl2 + H2O = NaHSO4 + HCl Na2S2O3 + 4Cl2 + 5H2O = 2NaHSO4 + 8HCl
Na2CO3 + NH4OH = (NH4)2CO3 + NaOHNa2CO3 + 2NH4OH = (NH4)2CO3 + 2NaOH
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na2CO3 + HCl= NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
N2 + H2 =NH3N2 + 3H2 = 2NH3
Na2CO3 + HCl = NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaOH + AlPO4 = Al(OH)3 + Na3PO43NaOH + AlPO4 = Al(OH)3 + Na3PO4
NH4Cl + Ba(OH)2= BaCl2 + NH3 + H2O 2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
NaOH + 2KNO3 = NaNO3 + 2KOHNaOH + KNO3 = NaNO3 + KOH
NaH2PO4 = NaPO3 + H2ONaH2PO4 = NaPO3 + H2O
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
NaOH + H2SO4=Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na3PO4+H2SO4=H3PO4+Na2SO42Na3PO4 + 3H2SO4 = 2H3PO4 + 3Na2SO4
Na2CO3 + HCl = NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na 2 SO 4 (aq)+CaI 2 (aq)=CaSO 4 (s)+2NaI(aq)Na2SO4(aq) + CaI2(aq) = CaSO4(s) + 2NaI(aq)
NiS(s) + O2(g) = NiO(s) + SO2(g) 2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
NaCl(s) + H2SO4(l) = Na2SO4(s) + HCl(g)2NaCl(s) + H2SO4(l) = Na2SO4(s) + 2HCl(g)
Na2SO4(s) + C(s) = Na2S(s) + CO2(g) Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NiCl2 + O2 + H2O = HCl + NiONiCl2 + 0O2 + H2O = 2HCl + NiO
Na2O2(s) + H2O(g) + CO2(g) = NaHCO 3(s) + O2(g)2Na2O2(s) + 2H2O(g) + 4CO2(g) = 4NaHCO3(s) + O2(g)
NaCl(s) + H2SO4(l) = HCl(g) + Na2SO4 (s) 2NaCl(s) + H2SO4(l) = 2HCl(g) + Na2SO4(s)
Na2B4O7(s) + H2SO4(aq) + H2O(l) = H3BO3(s) + Na2SO4(aq) Na2B4O7(s) + H2SO4(aq) + 5H2O(l) = 4H3BO3(s) + Na2SO4(aq)
Na2S2O3(aq) + I2(aq) = Na2S4O6(aq) + NaI(aq)2Na2S2O3(aq) + I2(aq) = Na2S4O6(aq) + 2NaI(aq)
Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)
NiS(s) + O2(g) = NiO(s) + SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NaMnO4 + K2SO3 + KOH=K2MnO4 + Na2SO4 + H2O2NaMnO4 + K2SO3 + 2KOH = 2K2MnO4 + Na2SO4 + H2O
NaMnO4+K2SO3+KOH=K2MnO4+Na2SO4+H2O2NaMnO4 + K2SO3 + 2KOH = 2K2MnO4 + Na2SO4 + H2O
NaMnO+Na2SO3+NaOH=Na2MnO4+Na2SO4+H2O2NaMnO - 5Na2SO3 + 2NaOH = 2Na2MnO4 - 5Na2SO4 + H2O
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NaOH + HNO3 = NaNO3 + H2ONaOH + HNO3 = NaNO3 + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na + O2=Na2O4Na + O2 = 2Na2O
Na + HCI =H2+ NaCI2Na + 2HCI = H2 + 2NaCI
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH+Cl2=NaCl+NaClO+H2O2NaOH + Cl2 = NaCl + NaClO + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2+2H2=NHN2 + H2 = 2NH
N2+2H2=NHN2 + H2 = 2NH
N2+2H2=NHN2 + H2 = 2NH
N2+2H2=NHN2 + H2 = 2NH
N2+2H2=NHN2 + H2 = 2NH
Na2SO4 + Pb(NO3)2 = PbSO4 + NaNO3Na2SO4 + Pb(NO3)2 = PbSO4 + 2NaNO3
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NaCl + H2O = NaOH + Cl2 H22NaCl + 2H2O = 2NaOH + Cl2H2
NH3 + NO = N2+H2O 4NH3 + 6NO = 5N2 + 6H2O
NaBr + Cl2=NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
Na3PO4 + HCl = NaCl + H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
Na+O2=NaO2Na + O2 = NaO2
Na + O2 = NaO2Na + O2 = NaO2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaI+H2O+NaMnO4=NaIO3+MnO2+NaOHNaI + H2O + 2NaMnO4 = NaIO3 + 2MnO2 + 2NaOH
Na2Cr2O7 + KBr = NaBr + K2Cr2O7Na2Cr2O7 + 2KBr = 2NaBr + K2Cr2O7
NH4OH + FeCl3 = Fe(OH)3 + NH4Cl3NH4OH + FeCl3 = Fe(OH)3 + 3NH4Cl
NH4OH+FeCl3=Fe(OH)3+NH4Cl3NH4OH + FeCl3 = Fe(OH)3 + 3NH4Cl
NH3 +O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH +Al2(SO3)3=Na2SO3 +Al(OH)36NaOH + Al2(SO3)3 = 3Na2SO3 + 2Al(OH)3
NH4NO3 = N2 + H2O + O22NH4NO3 = 2N2 + 4H2O + O2
NaCl + MnO2+ H2SO4 =NaHSO4+ MnSO4+Cl2+ H2O 2NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + Cl2 + 2H2O
Na 2 S(aq)+Cu(NO 3 ) 2 (aq)=NaNO 3 (aq)+CuS(s) Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaCl + MnO2+ H2SO4 =NaHSO4+ MnSO4+Cl2+ H2O 2NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + Cl2 + 2H2O
NH4Cl+Mg(OH)2=NH3+H2O+MgCl22NH4Cl + Mg(OH)2 = 2NH3 + 2H2O + MgCl2
NaCl+H2O=NaOH+Cl2+H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Na2SO4+Pb(NO3)2=PbSO4+NaNO3Na2SO4 + Pb(NO3)2 = PbSO4 + 2NaNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NH3 + NO = N2+H2O 4NH3 + 6NO = 5N2 + 6H2O
Na2S2O3+Br2+NaOH=Na2SO4+NaBr+H2ONa2S2O3 + 4Br2 + 10NaOH = 2Na2SO4 + 8NaBr + 5H2O
NH4NO3=N2+H2O+O22NH4NO3 = 2N2 + 4H2O + O2
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
NH3+ H2SO4 =(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaCl = Na + Cl22NaCl = 2Na + Cl2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + HCl =H2 + NaCl2Na + 2HCl = H2 + 2NaCl
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NaCl+H2O=Cl2+H2+NaOH2NaCl + 2H2O = Cl2 + H2 + 2NaOH
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na2CO3 + O2 = NaO + CO22Na2CO3 + O2 = 4NaO + 2CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.