Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH3 + Cl2 = N2 + Cl- + H+2NH3 + 3Cl2 = N2 + 6Cl- + 6H+
Na2SO3+HCl=SO2+NaCl+H2ONa2SO3 + 2HCl = SO2 + 2NaCl + H2O
NO2+HNO=H2O+NONO2 + 2HNO = H2O + 3NO
NH3+ H2O = (NH3)2O + H22NH3 + H2O = (NH3)2O + H2
Na2S+AgNO3=NaNO3+Ag2SNa2S + 2AgNO3 = 2NaNO3 + Ag2S
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na+H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
N2+O2 = NON2 + O2 = 2NO
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO2+H2O=NH3+O24NO2 + 6H2O = 4NH3 + 7O2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
N2+H2=NH3N2 + 3H2 = 2NH3
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
Na + O2 = Na2O22Na + O2 = Na2O2
Na + O2 = Na2O 4Na + O2 = 2Na2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
N2 + 3H2 =2NH3N2 + 3H2 = 2NH3
NH3(g) + O2(g)=H2O(l) + NO(g)4NH3(g) + 5O2(g) = 6H2O(l) + 4NO(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na3N + AgNO3 = NaNO3 +Ag3NNa3N + 3AgNO3 = 3NaNO3 + Ag3N
Na2S + Zn(NO3)2 = ZnS + 2NaNO3Na2S + Zn(NO3)2 = ZnS + 2NaNO3
Na2S + Zn(NO3)2 = ZnS + 1NaNO3Na2S + Zn(NO3)2 = ZnS + 2NaNO3
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2H4 + H2O2=N2 +H2ON2H4 + 2H2O2 = N2 + 4H2O
Na3PO4(aq) + Sr(OH)2(aq) = Na(OH) + Sr3(PO4)22Na3PO4(aq) + 3Sr(OH)2(aq) = 6Na(OH) + Sr3(PO4)2
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
NaOH + P4 + H2O = NaH2PO2 + PH33NaOH + P4 + 3H2O = 3NaH2PO2 + PH3
NaBH4 + BF3 = NaBF4 + B2H63NaBH4 + 4BF3 = 3NaBF4 + 2B2H6
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2+SO3+H2O=HNO3+H2SO40NO2 + SO3 + H2O = 0HNO3 + H2SO4
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + O2 = H2O + NO24NH3 + 7O2 = 6H2O + 4NO2
NaI+AgNO3=AgI+NaNO3NaI + AgNO3 = AgI + NaNO3
Na+HCl=H2+NaCl2Na + 2HCl = H2 + 2NaCl
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 +H2 = NH3N2 + 3H2 = 2NH3
NH3=N2+H22NH3 = N2 + 3H2
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NaHCO3+CH3COOH=CH3COONa+CO2+H2ONaHCO3 + CH3COOH = CH3COONa + CO2 + H2O
Na2SO4+Pb(NO3)2=NaNO3+PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaCL+LiI=NaI+LiCLNaCL + LiI = NaI + LiCL
Na2S+KI=NaI+K2SNa2S + 2KI = 2NaI + K2S
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2=NON2 + O2 = 2NO
Na2SO4(s) + C(s) = Na2S(s) + CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
Na2SO4(s) + C(s) = Na2S(s) + CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NH3 + O2 = HNO3 + H2010NH3 + 15O2 = 10HNO3 + H20
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2 + H2O = H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
N2 + F2= NF3N2 + 3F2 = 2NF3
Ni2(CO3)3 + Bi(ClO4)5 = Ni(ClO4)3 + Bi2(CO3)55Ni2(CO3)3 + 6Bi(ClO4)5 = 10Ni(ClO4)3 + 3Bi2(CO3)5
Na3PO4 + CaCl2= NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na2S+HCl=NaCl+H2SNa2S + 2HCl = 2NaCl + H2S
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
NA + I2 = NAI2NA + I2 = 2NAI
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NaCI+H2SO4=Na2SO4+HCI2NaCI + H2SO4 = Na2SO4 + 2HCI
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + Cl2 = NaCl 2Na + Cl2 = 2NaCl
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaS+ZnSO4=NaSO4+ZnSNaS + ZnSO4 = NaSO4 + ZnS
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
Na3PO4+HCl=NaCl+H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=Na2O22Na + O2 = Na2O2
NH3+O2=H2O+NO24NH3 + 7O2 = 6H2O + 4NO2
NH4OH+Al(NO3)3=Al(OH)3+NH4NO33NH4OH + Al(NO3)3 = Al(OH)3 + 3NH4NO3
N2H4+O2=N2+H2ON2H4 + O2 = N2 + 2H2O
N2H4+O2=N2+H2ON2H4 + O2 = N2 + 2H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaCl + LiI = NaI + LiClNaCl + LiI = NaI + LiCl
Na2S + KI=NaI + K2SNa2S + 2KI = 2NaI + K2S
Na2SO4+Pb(NO3)2=NaNO3+PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2S+KI=NaI+K2SNa2S + 2KI = 2NaI + K2S
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3+Ca3(AsO3)2=NH4Ca3+NO3(AsO3)2NH4NO3 + Ca3(AsO3)2 = NH4Ca3 + NO3(AsO3)2
NH4NO3+Ca3(AsO3)2=NH4Ca3+NO3(AsO3)2NH4NO3 + Ca3(AsO3)2 = NH4Ca3 + NO3(AsO3)2
NH4NO3+Ca3(AsO3)2=NH4Ca3+NO3(AsO3)2NH4NO3 + Ca3(AsO3)2 = NH4Ca3 + NO3(AsO3)2
NH4NO3+Ca3(AsO3)2=NH4Ca3+NO3(AsO3)2NH4NO3 + Ca3(AsO3)2 = NH4Ca3 + NO3(AsO3)2
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2O5 = NO2+O22N2O5 = 4NO2 + O2
N2O5 = NO2+O22N2O5 = 4NO2 + O2
NaBH4+I2=B2H6+H2 + NaI 2NaBH4 + I2 = B2H6 + H2 + 2NaI
Na2CO3(aq) + C(s) + N2(g) = NaCN(aq) + CO(g)Na2CO3(aq) + 4C(s) + N2(g) = 2NaCN(aq) + 3CO(g)
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
Na3PO4 + 3KOH = 3NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NaOH+NaHCO3=Na2CO3+H2ONaOH + NaHCO3 = Na2CO3 + H2O
Na2O(aq)+ 2HF (aq) = 2NaF(aq) + H2ONa2O(aq) + 2HF(aq) = 2NaF(aq) + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NaOH+NaHCO3=Na2CO3+H2ONaOH + NaHCO3 = Na2CO3 + H2O
N2O5 + H2O = HNO3 N2O5 + H2O = 2HNO3
NH4NO2 = N2 + H2O NH4NO2 = N2 + 2H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na (s) + Cl2 (g) = NaCl (s) 2Na(s) + Cl2(g) = 2NaCl(s)
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
N2 (g) + O2 (g) = NO (g)N2(g) + O2(g) = 2NO(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl= Na+Cl22NaCl = 2Na + Cl2
Na2SO4+BaCl2= BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NaOH  +   H3PO4 = Na3PO4  + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaIO3 + Na2SO3 + NaHSO3 = Na2SO4 + H2O + I22NaIO3 + 3Na2SO3 + 2NaHSO3 = 5Na2SO4 + H2O + I2
NaBO3 + FeS + NaOH + H2O = Fe2(OH)3 + Na2SO4 + NaBO215NaBO3 + 4FeS + 8NaOH - H2O = 2Fe2(OH)3 + 4Na2SO4 + 15NaBO2
NO+H2SO4+NaNO2= HNO3+NaHSO4+H20-20NO + 40H2SO4 + 40NaNO2 = 20HNO3 + 40NaHSO4 + H20
NH4ClO3+Mg(OH)2=Mg(ClO3)2+NH4OH2NH4ClO3 + Mg(OH)2 = Mg(ClO3)2 + 2NH4OH
Na2SO4+Pb(NO3)2=NaNO3+PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaCl+LiI=NaI+LiClNaCl + LiI = NaI + LiCl
Na2S+KI=NaI+K2SNa2S + 2KI = 2NaI + K2S
Na2S+KI=NaI+K2SNa2S + 2KI = 2NaI + K2S
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NO2(g) + H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2(g) + H2O(l) + O2(g) = HNO3(aq)4NO2(g) + 2H2O(l) + O2(g) = 4HNO3(aq)
NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)2NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)
NH3(g) + CO2(g) = (NH2)2CO(s) + H2O(g)2NH3(g) + CO2(g) = (NH2)2CO(s) + H2O(g)
NH3(g) + O2(g) = NO(g) + H2O(l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
NH3(g) + O2(g) = NO(g) + H2O(l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)2NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)
NaH(s)+H2O(l) = NaOH(aq)+H2(g)NaH(s) + H2O(l) = NaOH(aq) + H2(g)
NaH(s) + H2O(l) = NaOH(aq) + H2(g)NaH(s) + H2O(l) = NaOH(aq) + H2(g)
Na2O+CO2=Na2CO3Na2O + CO2 = Na2CO3
Na2CO3+MG=MGCO3+NaNa2CO3 + MG = MGCO3 + 2Na
Ni(NO3)3 +PbBr4 = NiBr3 + Pb(NO3)44Ni(NO3)3 + 3PbBr4 = 4NiBr3 + 3Pb(NO3)4
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2S2O3+I2=NaI+Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaOH(aq)+H2S(g) =Na2S(aq) +H2O(l)2NaOH(aq) + H2S(g) = Na2S(aq) + 2H2O(l)
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2S+Fe(ClO3)2=NaClO3+SFeNa2S + Fe(ClO3)2 = 2NaClO3 + SFe
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NH4OH+Al=NAl+H3+H2ONH4OH + Al = NAl + H3 + H2O
NH4OH+Al=NAl+H3+H2ONH4OH + Al = NAl + H3 + H2O
Na2SO4(s)+C(s)=Na2S(s)+CO2Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2
Na2SO4(s)+C(s)=CO2(g)+Na2S(s)Na2SO4(s) + 2C(s) = 2CO2(g) + Na2S(s)
NaBO3 + FeS + NaOH + H2O = Fe2(OH)3 + Na2SO4 + NaBO215NaBO3 + 4FeS + 8NaOH - H2O = 2Fe2(OH)3 + 4Na2SO4 + 15NaBO2
NaIO3 + Na2SO3 + NaHSO3 =Na2SO4 + H2O + I22NaIO3 + 3Na2SO3 + 2NaHSO3 = 5Na2SO4 + H2O + I2
NO2 + SO2 + H2O = HNO3 + H2SO4-2NO2 + SO2 + 0H2O = -2HNO3 + H2SO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4Cl+Al2(SO4)3=(NH4)2SO4+AlCl36NH4Cl + Al2(SO4)3 = 3(NH4)2SO4 + 2AlCl3
NH4 + NO3 = N2 + 2H2O6NH4 + 4NO3 = 5N2 + 12H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2O + H2 = H2O + NH3N2O + 4H2 = H2O + 2NH3
Na2CO3+HNO3=NaNO3+CO2+H2ONa2CO3 + 2HNO3 = 2NaNO3 + CO2 + H2O
NH3 + H3BO3= H2O+(NH4)3BO33NH3 + H3BO3 = 0H2O + (NH4)3BO3
NH3 + H3BO3= H2O+(NH4)3BO33NH3 + H3BO3 = 0H2O + (NH4)3BO3
NH4OH + H3BO3= H2O+(NH4)3BO33NH4OH + H3BO3 = 3H2O + (NH4)3BO3
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2Cr2O7+FeCl2+HCl=CrCl3+FeCl3+NaCl+H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = NaCl2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2O = Na + O22Na2O = 4Na + O2
NaNO3 + Ag = AgNO3 + NaNaNO3 + Ag = AgNO3 + Na
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + C=Na + CONa2CO3 + 2C = 2Na + 3CO
Na + H2 O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + FeO = NaFe + ONa + FeO = NaFe + O
Na2CO3 + HCl = H2O + CO2 + NaClNa2CO3 + 2HCl = H2O + CO2 + 2NaCl
Na2CO3 + C +N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NaNO3+CaCl2=Ca(NO3)2+NaCl2NaNO3 + CaCl2 = Ca(NO3)2 + 2NaCl
NaNo3+CaCl2=CaNo6+NaCl2NaNo3 + CaCl2 = CaNo6 + 2NaCl
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2O2+ H2O=NaOH+ O22Na2O2 + 2H2O = 4NaOH + O2
N+H=NH3N + 3H = NH3
N2 + 4H2 = NH3N2 + 3H2 = 2NH3
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na+H2O= Na(OH)+H22Na + 2H2O = 2Na(OH) + H2
Na2CO3 (aq) + H2O(l) + CO2(g) = 2NaHCO3 (s)Na2CO3(aq) + H2O(l) + CO2(g) = 2NaHCO3(s)
Na2CO3 (aq) + H2O(l) + CO2(g) = 2NaHCO3 (s)Na2CO3(aq) + H2O(l) + CO2(g) = 2NaHCO3(s)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + O2=Na2O4Na + O2 = 2Na2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+2H2ONaOH + HCl = NaCl + H2O
NaOH+Cl2=NaCl+NaClO+H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NaOH+Cl2=NaCl+NaClO+H2020NaOH + 10Cl2 = 0NaCl + 20NaClO + H20
N2H4 +SeO4-- + H3O+ = N2 + Se + H2O3N2H4 + 2SeO4-- + 4H3O+ = 3N2 + 2Se + 12H2O
NH4OH + FeCl3 = Fe(OH)3 + NH4Cl3NH4OH + FeCl3 = Fe(OH)3 + 3NH4Cl
NH4OH + FeCl3 = Fe(OH)3 + NH4Cl3NH4OH + FeCl3 = Fe(OH)3 + 3NH4Cl
NAHCO3 + CH3COOH= NAC2H3O2+ H2CO3NAHCO3 + CH3COOH = NAC2H3O2 + H2CO3
NAHCO3 + CH3COOH= NAC2H3O2+ H2CO3NAHCO3 + CH3COOH = NAC2H3O2 + H2CO3
NaHCO3 + CH3COOH = NaC2H3O2 + H2CO3NaHCO3 + CH3COOH = NaC2H3O2 + H2CO3
NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)2NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)
NO2(g) + H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH3 + H2SO4 = (NH4)2 SO42NH3 + H2SO4 = (NH4)2SO4
N2O3 + H2 = NH3 + 3H2O N2O3 + 6H2 = 2NH3 + 3H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2 + CO = N2O + CO22NO2 + 3CO = N2O + 3CO2
Na + S + O2 = Na2SO42Na + S + 2O2 = Na2SO4
Na + S + O2 = Na SO4Na + S + 2O2 = NaSO4
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO3NO + O2 = NO3
N2H 4+ H2O2 = HNO3 + H2ON2H4 + 7H2O2 = 2HNO3 + 8H2O
N2H + H2O2 = HNO3 + H2O2N2H + 11H2O2 = 4HNO3 + 10H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g)+O2(g)=N2(g)+H2O(l)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(l)
Na2SO4(aq)+Sr(NO3)2(aq)=SrSO4(s)+NaNO3(aq)Na2SO4(aq) + Sr(NO3)2(aq) = SrSO4(s) + 2NaNO3(aq)
N2O5(g) + 5H2(g) = 5H2O(g) + N2(g)N2O5(g) + 5H2(g) = 5H2O(g) + N2(g)
N2O5(g) + 5H2(g) = 5H2O(g) + N2(g)N2O5(g) + 5H2(g) = 5H2O(g) + N2(g)
NH3(l)+H2SO4(aq)=(NH4)2SO4(aq)2NH3(l) + H2SO4(aq) = (NH4)2SO4(aq)
NaBr(aq)+Ca(OH)2(aq)=CaBr2(aq)+NaOH(aq)2NaBr(aq) + Ca(OH)2(aq) = CaBr2(aq) + 2NaOH(aq)
NH3 + H2O = 2NH4OHNH3 + H2O = NH4OH
NH3 + O2 = N2O3 + H24NH3 + 3O2 = 2N2O3 + 6H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaHCO3+C6H8O7=CO2+H2O+Na3C6H5O73NaHCO3 + C6H8O7 = 3CO2 + 3H2O + Na3C6H5O7
NaBH4+I2=B2H6+H2+NaI2NaBH4 + I2 = B2H6 + H2 + 2NaI
NaCl (Aq)+ F2 (g) = Na F (Aq) + Cl2 (g) 2NaCl(Aq) + F2(g) = 2NaF(Aq) + Cl2(g)
NaHCO3=Na2CO3 +CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2CO3+HNO3=CO2+H2O+NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
Na2CO3+HNO3=CO2+H2O+NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaBH4+I2=B2H6+H2+NaI2NaBH4 + I2 = B2H6 + H2 + 2NaI
NaBH4 (s) + I2 = B2H6 + H2 + NaI 2NaBH4(s) + I2 = B2H6 + H2 + 2NaI
N2H4 + N2O4 = N2 + 4H2O2N2H4 + N2O4 = 3N2 + 4H2O
Na2CO3+2HCl=2NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Ni+4CO=Ni(CO)4Ni + 4CO = Ni(CO)4
NaHCO3+C6H8O7 = CO2+H2O+Na3C6H5O73NaHCO3 + C6H8O7 = 3CO2 + 3H2O + Na3C6H5O7
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2CO3 + HNO3 = CO2 + H2O + NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
Na2CO3+HNO3=CO2+H2O+NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
NaBH4 +I2 =B2H6+H2+NaI2NaBH4 + I2 = B2H6 + H2 + 2NaI
Na2CO3 (aq) +HNO3 (aq)=CO2 (g) + H2O (l) + NaNO3 (aq)Na2CO3(aq) + 2HNO3(aq) = CO2(g) + H2O(l) + 2NaNO3(aq)
NaBH4+I2=B2H6+H2+NaI 2NaBH4 + I2 = B2H6 + H2 + 2NaI
NaBH4+I2 =B2H6+H2+NaI 2NaBH4 + I2 = B2H6 + H2 + 2NaI
N2+O2=N2O52N2 + 5O2 = 2N2O5
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na2CO3+HCl=NaCl+H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
NaBH4 (s) + I2 (s) = B2H6 (g) + H2 (g) + NaI (s)2NaBH4(s) + I2(s) = B2H6(g) + H2(g) + 2NaI(s)
NaHCO3 +C6H8O7= CO2 +H2O +Na3C6H5O73NaHCO3 + C6H8O7 = 3CO2 + 3H2O + Na3C6H5O7
NaBr + KClO3 = NaClO3 + KBrNaBr + KClO3 = NaClO3 + KBr
NaBr + KClO = NaClO + KBrNaBr + KClO = NaClO + KBr
NaBr + KClO = NaClO + KBrNaBr + KClO = NaClO + KBr
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
Na2SO4 + HCl = NaCl + H2O + SO3Na2SO4 + 2HCl = 2NaCl + H2O + SO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2CO3+HI = NaI + CO2 + H2ONa2CO3 + 2HI = 2NaI + CO2 + H2O
Na2CO3+HI = NaI + CO2 + H2ONa2CO3 + 2HI = 2NaI + CO2 + H2O
NO2+NaOH+B=NaNO2+Na3BO3+H2O3NO2 + 6NaOH + B = 3NaNO2 + Na3BO3 + 3H2O
N2+F2=NF3N2 + 3F2 = 2NF3
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na+MgO=Mg+Na2O2Na + MgO = Mg + Na2O
Na+O2=Na2O22Na + O2 = Na2O2
Na2CO3 + HNO3 = H2O + CO2 + NaNO3Na2CO3 + 2HNO3 = H2O + CO2 + 2NaNO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na(SO4) + KCl = K2(SO4) + NaCl2Na(SO4) + 2KCl = K2(SO4) + NaCl2
Na(SO4) + KCl = K(SO4) + NaClNa(SO4) + KCl = K(SO4) + NaCl
Na(SO4) + KCl = K(SO4) + NaClNa(SO4) + KCl = K(SO4) + NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH4OH=H2O+NH3NH4OH = H2O + NH3
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaBH4(s) + I2(s) = B2H6(g) + H2(g) + NaI(s)2NaBH4(s) + I2(s) = B2H6(g) + H2(g) + 2NaI(s)
Na2CO3+HNO3=CO2+H2O+NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
NaBH4 (s)+I2 (s)=B2H6(g)+H2(g)+NaI(s)2NaBH4(s) + I2(s) = B2H6(g) + H2(g) + 2NaI(s)
NaBH4+I2=B2H6+H2+NaI2NaBH4 + I2 = B2H6 + H2 + 2NaI
N2+3H2= NH3N2 + 3H2 = 2NH3
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NaBH4 + I2 = B2H6 + H2 + NaI2NaBH4 + I2 = B2H6 + H2 + 2NaI
NaOH + AgNO3 = NaNO3 + AgOHNaOH + AgNO3 = NaNO3 + AgOH
NaOH + CuSO4 = NaSO4 + CuOHNaOH + CuSO4 = NaSO4 + CuOH
NaOH + AgNO3 = NaNO3 + AgOHNaOH + AgNO3 = NaNO3 + AgOH
NaOH + AgNO3 = NaNO3 + AgOHNaOH + AgNO3 = NaNO3 + AgOH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + HCl =H2 + NaCl2Na + 2HCl = H2 + 2NaCl
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H3PO4=Na2HPO4+H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
Na+O2=Na2O22Na + O2 = Na2O2
Na+O2=NaO2Na + O2 = NaO2
NH3 + HCl = NCl + H4NH3 + HCl = NCl + H4
Na2CO3(s) + HCl(g) = H2O + CO2(g) + NaCl(s) Na2CO3(s) + 2HCl(g) = H2O + CO2(g) + 2NaCl(s)
Na2CO3(s) + HCl(g) = H2O + NaCl(s) + CO2(g)Na2CO3(s) + 2HCl(g) = H2O + 2NaCl(s) + CO2(g)
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaCl (aq)+ AgC2H3O2 (aq) = NaC2H3O2 (aq)+ AgCl (s)NaCl(aq) + AgC2H3O2(aq) = NaC2H3O2(aq) + AgCl(s)
N2 (g)+ H2 (g) = NH3 (g)N2(g) + 3H2(g) = 2NH3(g)
NH4OH +H3PO4=(NH4)3PO4 +H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaCO3 + Mg(NO3) = MgCO3 + NaNO3NaCO3 + Mg(NO3) = MgCO3 + NaNO3
NaHCO3(aq)+C6H8O7(aq)=CO2(g)+H2O(l)+Na3C6H5O7(aq)3NaHCO3(aq) + C6H8O7(aq) = 3CO2(g) + 3H2O(l) + Na3C6H5O7(aq)
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaHCO3(s)=Na2CO3(s)+CO2(g)+H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NO2+H2O=HNO2+HNO32NO2 + H2O = HNO2 + HNO3
NH3+CUO=N2+CU+H2O2NH3 + 3CUO = N2 + 3CU + 3H2O
NH3+CUO=N2+CU+H2O2NH3 + 3CUO = N2 + 3CU + 3H2O
NH3+CUO=N2+CU+H2O2NH3 + 3CUO = N2 + 3CU + 3H2O
Na2SO3+ HCl=NaCl + S + SO2 +H2ONa2SO3 + 2HCl = 2NaCl + 0S + SO2 + H2O
Na2SO3+ HCl=NaCl + S + SO2 +H2ONa2SO3 + 2HCl = 2NaCl + 0S + SO2 + H2O
Na2SO3+ HCl=NaCl + S + SO2 +H2ONa2SO3 + 2HCl = 2NaCl + 0S + SO2 + H2O
Na2CO3 + KI = Na2I + KCO3Na2CO3 + KI = Na2I + KCO3
Na2SO3 + NH3 = Na2H3 + NSO3Na2SO3 + NH3 = Na2H3 + NSO3
NaOH + NH3 = NaH3 + NOHNaOH + NH3 = NaH3 + NOH
Na2CO3 + NH3 = Na2H3 + NCO3Na2CO3 + NH3 = Na2H3 + NCO3
Na2SO3 + FeCl3 = NaCl +Fe2(SO3)33Na2SO3 + 2FeCl3 = 6NaCl + Fe2(SO3)3
NaNO3 + 4H2O = NaOH + HNO3NaNO3 + H2O = NaOH + HNO3
NaNO3 + 4H2O = NaOH + HNO3NaNO3 + H2O = NaOH + HNO3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3 (g) +H2O (g) = (NH3)2O (g) +H2 (g)2NH3(g) + H2O(g) = (NH3)2O(g) + H2(g)
NH3 (g) +H2O (g) = (NH3)2O (g) +H2 (g)2NH3(g) + H2O(g) = (NH3)2O(g) + H2(g)
NH3 (g) +H2O (g) = (NH3)2O (g) +H2 (g)2NH3(g) + H2O(g) = (NH3)2O(g) + H2(g)
N2O5 +H2O = HNO3N2O5 + H2O = 2HNO3
Na2CO3 + C2H4O2= C2H3O2Na + H2O + CO2Na2CO3 + 2C2H4O2 = 2C2H3O2Na + H2O + CO2
Na2CO3 + C2H4O2= C2H3O2Na + H2O + O22Na2CO3 + 3C2H4O2 = 4C2H3O2Na + 0H2O + 2O2
Na2CO3(s) = Na2O(s) + CO2(g)Na2CO3(s) = Na2O(s) + CO2(g)
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2S(aq) + Cu(NO3)2(aq) = NaNO3(aq) + CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3(g) + CO2(g) = (NH2)2CO(s) + H2O(g)2NH3(g) + CO2(g) = (NH2)2CO(s) + H2O(g)
NaH(s) + H2O(l) = NaOH(aq) + H2NaH(s) + H2O(l) = NaOH(aq) + H2
NH3+ O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+ O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NaS+ZnNO3=NaNO3+ZnSNaS + ZnNO3 = NaNO3 + ZnS
NaOH=Na2O+H2O2NaOH = Na2O + H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2CO3+HNO3=CO2+H2O+NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
NaBH4 +I2 =B2H6+H2+NaI2NaBH4 + I2 = B2H6 + H2 + 2NaI
NaNO3 = NaNO2 + O2 2NaNO3 = 2NaNO2 + O2
N2+O2=N2O2N2 + O2 = N2O2
NaHCO3 + HC2H3O2=NaC2H3O2 + CO2 + H22NaHCO3 + 3HC2H3O2 = 2NaC2H3O2 + 4CO2 + 4H2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2S+Zn(NO3)2=ZnS+Na(NO3)Na2S + Zn(NO3)2 = ZnS + 2Na(NO3)
Na3PO4(aq)+FeCl3(aq)=NaCl(aq)+FePO4(s)Na3PO4(aq) + FeCl3(aq) = 3NaCl(aq) + FePO4(s)
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O5(g) = NO2 + O22N2O5(g) = 4NO2 + O2
N2O5=NO2+O22N2O5 = 4NO2 + O2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na3PO4 + BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NaHCO3 = Na2CO3+CO2 +H2O 2NaHCO3 = Na2CO3 + CO2 + H2O
NH3 + CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH4NO3 + Ca(OH)2 =Ca(NO3)2 + NH3 + H2O2NH4NO3 + Ca(OH)2 = Ca(NO3)2 + 2NH3 + 2H2O
Nb + Cl = NbCl5Nb + 5Cl = NbCl5
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHCO3(aq) + C6H8O7(aq) = CO2(g) + H2O (l) + Na3C6H5O7(aq)3NaHCO3(aq) + C6H8O7(aq) = 3CO2(g) + 3H2O(l) + Na3C6H5O7(aq)
NH4NO3 + Ca(OH)2 = Ca(NO3)2 + NH3 + H2O2NH4NO3 + Ca(OH)2 = Ca(NO3)2 + 2NH3 + 2H2O
NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O (g) 2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
Na3PO4 + BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
Na2CO3(aq) + HNO3 (aq) = CO2(g) + H2O (l) + NaNO3(aq)Na2CO3(aq) + 2HNO3(aq) = CO2(g) + H2O(l) + 2NaNO3(aq)
Ni (OH)3 + H2S = Ni2 S3 + H2 O2Ni(OH)3 + 3H2S = Ni2S3 + 6H2O
Ni (OH)3 + H2S = Ni2 S3 + H2 O2Ni(OH)3 + 3H2S = Ni2S3 + 6H2O
Na2CO3(aq) +HNO3(aq)=CO2(g) +H2O(l) +NaNO3(aq)Na2CO3(aq) + 2HNO3(aq) = CO2(g) + H2O(l) + 2NaNO3(aq)
NaBH4 (s) + I2 (s) = B2H6 (g) + H2 (g) + NaI (s)2NaBH4(s) + I2(s) = B2H6(g) + H2(g) + 2NaI(s)
NaBH4 (s) +I2 (s)=B2H(g)+H2(g)+NaI (s)4NaBH4(s) + 2I2(s) = 2B2H(g) + 7H2(g) + 4NaI(s)
NaBH4 (s) +I2 (s)=B2H(g)+H2(g)+NaI (s)4NaBH4(s) + 2I2(s) = 2B2H(g) + 7H2(g) + 4NaI(s)
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na2CO3 (aq) + HNO3(aq) = CO2 (g) + H2O (l) + NaNO3 (aq)Na2CO3(aq) + 2HNO3(aq) = CO2(g) + H2O(l) + 2NaNO3(aq)
NaBH4 (s) + I2 (s) = B2H6(g) + H2(g) + NaI(s)2NaBH4(s) + I2(s) = B2H6(g) + H2(g) + 2NaI(s)
NH3 = N2 + H22NH3 = N2 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = N2O4 + H2O 4NH3 + 7O2 = 2N2O4 + 6H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na + H2O= NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4Cl + NaOH = NH3 + H2O + NaClNH4Cl + NaOH = NH3 + H2O + NaCl
NH4+ + H2O = H3O+ + NH3NH4+ + H2O = H3O+ + NH3
Na +H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NaCl+SO2+H2O+O2 = Na2SO4+HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
NaOH + Al = Na3AlO3 + H26NaOH + 2Al = 2Na3AlO3 + 3H2
N(NO2)3 + CH3OH = N2 + CO2 + H2ON(NO2)3 + 2CH3OH = 2N2 + 2CO2 + 4H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + HCl = H2 + NaCl2Na + 2HCl = H2 + 2NaCl
Na + O2 = Na2O4Na + O2 = 2Na2O
NaCl = Na + Cl22NaCl = 2Na + Cl2
NH4+NO3=H2O+N2ONH4 + NO3 = 2H2O + N2O
NiSO4 + NaCl = NiCl2 + Na2SO4NiSO4 + 2NaCl = NiCl2 + Na2SO4
NH4+NO3=H2O+N2ONH4 + NO3 = 2H2O + N2O
NaBr + Cu(No3)2 = CuBr2 + (NaNo3)22NaBr + Cu(No3)2 = CuBr2 + (NaNo3)2
Na+FeCl2=Fe+NaCl2Na + FeCl2 = Fe + 2NaCl
Ni(OH)3 +H2S = Ni2S3 + H2O2Ni(OH)3 + 3H2S = Ni2S3 + 6H2O
NaCl+ SO2+ H2O+ O2= Na2SO4+ HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
Ni(OH)3 + HIO2 = Ni(IO2)3 + H2ONi(OH)3 + 3HIO2 = Ni(IO2)3 + 3H2O
NaHCO3=CO2+NaOHNaHCO3 = CO2 + NaOH
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2O4 + N2H8 = N4 +H2ON2O4 + N2H8 = N4 + 4H2O
NaBr+Sn(NO3)4=NaNO3+SnBr44NaBr + Sn(NO3)4 = 4NaNO3 + SnBr4
N2+O2=NO2N2 + 2O2 = 2NO2
NO2 + H2O + O2 = HNO34NO2 + 2H2O + O2 = 4HNO3
NO2 + H2O + O2 = HNO34NO2 + 2H2O + O2 = 4HNO3
NO2(g) + H2O(l) + O2(g) = HNO3(aq)4NO2(g) + 2H2O(l) + O2(g) = 4HNO3(aq)
NH3 + O2=NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Ni + 3CO = Ni(CO)4Ni + 4CO = Ni(CO)4
N2+H2=NH3N2 + 3H2 = 2NH3
NH4Cl + NaOH = NH4OH + NaClNH4Cl + NaOH = NH4OH + NaCl
Na3 (PO4) + H2O = Na(OH) + H3(PO4)Na3(PO4) + 3H2O = 3Na(OH) + H3(PO4)
NaHCO3 + CH3COOH = C2H3NaO2 + H2CO3NaHCO3 + CH3COOH = C2H3NaO2 + H2CO3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH3 + O2 =NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 HCl = NaCl H2O CO2NaHCO3HCl = NaClH2OCO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4NO3 (aq) + Ca(OH)2 (aq) = Ca(NO3)2 (aq) + H2O (aq) + NH3 (g)2NH4NO3(aq) + Ca(OH)2(aq) = Ca(NO3)2(aq) + 2H2O(aq) + 2NH3(g)
Na2SO4(H2O) = Na2SO4 + H2ONa2SO4(H2O) = Na2SO4 + H2O
Na+H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaNO3 + KCl = NaCl+KNO3NaNO3 + KCl = NaCl + KNO3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2 + 3H2= 2NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
Na + H2O = NaHO + H22Na + 2H2O = 2NaHO + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3 + HCl= NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NH4OH + BaHCO3 = NH4HCO3 + BaOHNH4OH + BaHCO3 = NH4HCO3 + BaOH
NaHCO3= Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaOH + H2SO4 =Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3(g) + O2(g) = NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Ni + C4H8N2O2 = Ni(C4H8N2O2)2Ni + 2C4H8N2O2 = Ni(C4H8N2O2)2
NH4OH + MgSO3 = Mg(OH)2 + (NH4)2SO32NH4OH + MgSO3 = Mg(OH)2 + (NH4)2SO3
Ni + I2 = NiI2 Ni + I2 = NiI2
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N3H7O + NO2 = N2O + H2O 6N3H7O + 16NO2 = 17N2O + 21H2O
N3H7O + NO2 = N2O + H2O 6N3H7O + 16NO2 = 17N2O + 21H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+2HCl=2NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na2SO4+Pb(NO3)2=NaNO3+PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2S+2HCl=2NaCl+H2SNa2S + 2HCl = 2NaCl + H2S
N2+H2O=NH3+NO5N2 + 6H2O = 4NH3 + 6NO
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.