Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NO2(g) + H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH3+O2+2CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+2O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4NO3=N2+H2O+O22NH4NO3 = 2N2 + 4H2O + O2
NO2(g) + H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2- + Al + OH = NH3 + Al(OH)4- + H2O-1NO2- - Al + 3OH = -1NH3 - Al(OH)4- + 5H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2S2O3 + Cl2 + H2O = NaHSO4 + Cl20Na2S2O3 + Cl2 + 0H2O = 0NaHSO4 + Cl2
N2+O2=N2O32N2 + 3O2 = 2N2O3
NH3= N2 + H22NH3 = N2 + 3H2
Na2O+ H2O= NaOHNa2O + H2O = 2NaOH
N2(g) + 2 O2(g) = 2 NO2(g)N2(g) + 2O2(g) = 2NO2(g)
N+ H2O= H2+ N2O32N + 3H2O = 3H2 + N2O3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2(g) + H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3(g) = N2(g) + H2(g)2NH3(g) = N2(g) + 3H2(g)
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 + HCl=NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaHCO3 + HCl=NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaHCO3 + HCl=NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NH3+CO2 = CO(N2H4)+H2O2NH3 + CO2 = CO(N2H4) + H2O
NH3+CO2 = (NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NaOH + H2S = Na2S + 3H2O2NaOH + H2S = Na2S + 2H2O
Nb(OH)5 + H3PO4 = Nb3(PO4)5 + H2O3Nb(OH)5 + 5H3PO4 = Nb3(PO4)5 + 15H2O
NH4NO3 = N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 + 3Cl2 = 2 NCl3N2 + 3Cl2 = 2NCl3
NO2+Fe=NO3+Fe0NO2 + Fe = 0NO3 + Fe
NaNO3 +SO2 = Na2SO3 +NO2+O24NaNO3 + 2SO2 = 2Na2SO3 + 4NO2 + O2
N2O5(g)+H2O=HNO3(aq)N2O5(g) + H2O = 2HNO3(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Ni (CO) 4=Ni+CONi(CO)4 = Ni + 4CO
Na+KNO3=Na2O+K2O+N210Na + 2KNO3 = 5Na2O + K2O + N2
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+(NH4) 2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
NaIO3+SO2+H2O=Na2SO4+H2SO4+I22NaIO3 + 5SO2 + 4H2O = Na2SO4 + 4H2SO4 + I2
Ni(NO3)2(aq) + NaCl(aq) = NiCl2(s) +NaNO3Ni(NO3)2(aq) + 2NaCl(aq) = NiCl2(s) + 2NaNO3
Ni(NO3)2(aq) + NaCl(aq) = NiCl2 +NaNO3Ni(NO3)2(aq) + 2NaCl(aq) = NiCl2 + 2NaNO3
NH3(g)+O2(g)+CH4(g) = HCN(aq) + H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
N2 (g) + 3Cl2 (g)= 2NCl3 (g)N2(g) + 3Cl2(g) = 2NCl3(g)
NO3 + H2O = NH3 + OHNO3 + 6H2O = NH3 + 9OH
Na (s) + H2O (g) =NaOH (aq) + H2 (g)2Na(s) + 2H2O(g) = 2NaOH(aq) + H2(g)
N+CH3H2=CH3NH2N + CH3H2 = CH3NH2
N2+H2=2NH2N2 + 2H2 = 2NH2
NH4 + H2O = NH3 + OH-1NH4 + H2O = -1NH3 + OH
NaHCO3 + HCl = NaCl + CO2 + H2ONaHCO3 + HCl = NaCl + CO2 + H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO + O2 = NO22NO + O2 = 2NO2
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NO2 + H2SO4 = NO3 + SO4 + H0NO2 + H2SO4 = 0NO3 + SO4 + 2H
Na+O2=Na2O22Na + O2 = Na2O2
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NaOH + CuCl2 = NaCl + Cu(OH)22NaOH + CuCl2 = 2NaCl + Cu(OH)2
NaL+Cl2 = NaCl+L22NaL + Cl2 = 2NaCl + L2
NaL+Cl2 = NaCl+L22NaL + Cl2 = 2NaCl + L2
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N+H=NH3N + 3H = NH3
NiSO4 + C2H5NS = NiS + C2H5NSO4NiSO4 + C2H5NS = NiS + C2H5NSO4
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl=NaClNa + Cl = NaCl
Na+H2O=NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4Cl+Ca(OH)2 = CaCl2+H2O+NH32NH4Cl + Ca(OH)2 = CaCl2 + 2H2O + 2NH3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na(s)+O2(g)=Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4NO3+H2SO4=(NH4)2SO4+H2O+NO27NH4NO3 + 3H2SO4 = 3(NH4)2SO4 + 5H2O + 8NO2
Na2S2O5=2Na+ + (S2O5)--Na2S2O5 = 2Na+ + (S2O5)--
Na2S2O5+Ca3(PO4)2 = Ca2SO4+Na3PO4+SO26Na2S2O5 + 2Ca3(PO4)2 = 3Ca2SO4 + 4Na3PO4 + 9SO2
Na2S2O5+Ca(OH)2 = Ca2SO4+NaOH+SO22Na2S2O5 + 2Ca(OH)2 = Ca2SO4 + 4NaOH + 3SO2
Na2S2O5+Ca(OH)2 = Ca2SO4+NaOH+SO22Na2S2O5 + 2Ca(OH)2 = Ca2SO4 + 4NaOH + 3SO2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na(NO3)+H2SO4=Na(SO4)+(NO3)H2Na(NO3) + H2SO4 = Na(SO4) + (NO3)H2
Na2Cr2O7 + SnI2 + HI = CrI3 + SnI4 + NaI + H2ONa2Cr2O7 + 3SnI2 + 14HI = 2CrI3 + 3SnI4 + 2NaI + 7H2O
NaCl=Na+Cl22NaCl = 2Na + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl= Na+ ClNaCl = Na + Cl
NO+O2=NO22NO + O2 = 2NO2
Na2O= Na+O22Na2O = 4Na + O2
NO+O2=NO22NO + O2 = 2NO2
NO+O=NO2NO + O = NO2
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaCO3 + NH4Cl = NaCl + NH4CO3NaCO3 + NH4Cl = NaCl + NH4CO3
NaPO4 + MgBr = NaBr + MgPO4NaPO4 + MgBr = NaBr + MgPO4
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + O2 = Na2O4Na + O2 = 2Na2O
N + O2 = N2O34N + 3O2 = 2N2O3
NH4 NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3+O2=N2O4+H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 +O2 +CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 +O2 +CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2+CH4=HNC+H2O2NH3 + 3O2 + 2CH4 = 2HNC + 6H2O
NH3+O2+CH4=HNC+H2O2NH3 + 3O2 + 2CH4 = 2HNC + 6H2O
NaCL = Na2 + CL2NaCL = Na2 + 2CL
NaCL = Na + CLNaCL = Na + CL
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na3PO4 + Li2SO4 = Na3SO4 + Li2PO4Na3PO4 + Li2SO4 = Na3SO4 + Li2PO4
Na3PO4 + Li2SO4 = Na3SO4 + Li2PO4Na3PO4 + Li2SO4 = Na3SO4 + Li2PO4
Na4SiO4 + Al2 (MnO4)3 = Al4 (SiO4)3 + Na2MnO43Na4SiO4 + 2Al2(MnO4)3 = Al4(SiO4)3 + 6Na2MnO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
NaClO3+HCl = ClO2 + H2O + NaCl5NaClO3 + 6HCl = 6ClO2 + 3H2O + 5NaCl
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na2S(aq)+CaCl2(aq)=NaCl(aq)+CaS(s)Na2S(aq) + CaCl2(aq) = 2NaCl(aq) + CaS(s)
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
Na2CO3+2HNO3=2NaNO3+H2O+CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
Na2CO3 + 2HCl = 2NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaIO3 + NaHSO3 = NaHSO4 + Na2SO4 + H2O + I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
NaIO3 + NaHSO3 = NaHSO4 + Na2SO4 + H2O + I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
Ni (CO) 4 = Ni + CONi(CO)4 = Ni + 4CO
Ni(CO)4=Ni+CONi(CO)4 = Ni + 4CO
Na+KNO3=Na2O+K2O+N210Na + 2KNO3 = 5Na2O + K2O + N2
NO2 (g) + O2 (g) + H2O (l) =HNO3 (aq)4NO2(g) + O2(g) + 2H2O(l) = 4HNO3(aq)
NO2 (g) + O2 (g) + H2O (l) =HNO3 (aq)4NO2(g) + O2(g) + 2H2O(l) = 4HNO3(aq)
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na2CO3 + HCl =NaCl + H2O +CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaHCO3 + HCl(aq) =CO2(g)+H2O(l)+NaCl(s)NaHCO3 + HCl(aq) = CO2(g) + H2O(l) + NaCl(s)
NaHCO3 + HCl(aq) =CO2(g)+H2O(l)+NaCl(s)NaHCO3 + HCl(aq) = CO2(g) + H2O(l) + NaCl(s)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na + H2O=NaOH + H22Na + 2H2O = 2NaOH + H2
NO2 + H2O= HNO3 + NO 3NO2 + H2O = 2HNO3 + NO
NH3+N2=NHNH3 + N2 = 3NH
NH3+N2=NHNH3 + N2 = 3NH
NO + NH4 = N2 + H2O4NO + 2NH4 = 3N2 + 4H2O
NO2+H2O +O2= HNO3 4NO2 + 2H2O + O2 = 4HNO3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaOH+Ca(OH)2+Cl2=Ca(ClO)2+NaCl+H2O2NaOH + Ca(OH)2 + 2Cl2 = Ca(ClO)2 + 2NaCl + 2H2O
NaIO3+Na2SO3+NaHSO3=I2+Na2SO4+H2O2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
NH4NO3(s) = N2(g)+ O2(g)+ H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s) = N2(g)+ O2(g)+ H20(g)10NH4NO3(s) = 10N2(g) + 15O2(g) + 2H20(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na3AsO3+HCl+Mg=AsH3+MgCl2+NaCl+H2ONa3AsO3 + 9HCl + 3Mg = AsH3 + 3MgCl2 + 3NaCl + 3H2O
Na2BO3 + BaCl2 = NaCl + BaBO3Na2BO3 + BaCl2 = 2NaCl + BaBO3
Na2S + BaCl2 = 2NaCl + BaSNa2S + BaCl2 = 2NaCl + BaS
NH4+ Cr2O42- H+ =H2O+Cr+NO83NH4 + 6Cr2O42-H+ = 169H2O + 12Cr + 83NO
NH4+ + Cr2O42- + H+ =H2O+Cr+NO83NH4+ + 5Cr2O42- - 78H+ = 127H2O + 10Cr + 83NO
NH4+ + Cr2O4 2- + H+=H2O+Cr3+ +NO247NH4+ + 15Cr2O42- - 222H+ = 383H2O + 10Cr3+ + 247NO
NH4+ + Cr2O42- + H+=H2O+Cr3+ +NO247NH4+ + 15Cr2O42- - 222H+ = 383H2O + 10Cr3+ + 247NO
NH4+ + Cr2O42- + H+=H2O+Cr3+ +NO247NH4+ + 15Cr2O42- - 222H+ = 383H2O + 10Cr3+ + 247NO
NH4+ + Cr2O42- + H+=H2O+Cr+NO83NH4+ + 5Cr2O42- - 78H+ = 127H2O + 10Cr + 83NO
NaC2H3O2 + BaCl2 = Ba (C2H3O2)2 + 2NaCl2NaC2H3O2 + BaCl2 = Ba(C2H3O2)2 + 2NaCl
NH4+ + Cr2O42- + H+=H2O+Cr+NO83NH4+ + 5Cr2O42- - 78H+ = 127H2O + 10Cr + 83NO
NaBr + BaCl2 = NaCl2 + BaBrNaBr + BaCl2 = NaCl2 + BaBr
NaCN + BaCl2 = NaCl2 + BaCNNaCN + BaCl2 = NaCl2 + BaCN
NaCN + BaCl2 = NaCl2 + BaCNNaCN + BaCl2 = NaCl2 + BaCN
NaIO3+NaHSO3=I2+NaHSO4+Na2SO4+H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaClO + Na2S2O5 + NaOH= Na2SO4 + NaCl + H2O2NaClO + Na2S2O5 + 2NaOH = 2Na2SO4 + 2NaCl + H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+O2=Na2O4Na + O2 = 2Na2O
N2 + O2 + H2O = NH4NO32N2 + O2 + 4H2O = 2NH4NO3
NH3+O2+CH4= HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO + Na2S2O5 + NaOH= Na2SO4 + NaCl + H2O2NaClO + Na2S2O5 + 2NaOH = 2Na2SO4 + 2NaCl + H2O
NaClO + Na2S2O3 + NaOH= Na2SO4 + NaCl + H2O4NaClO + Na2S2O3 + 2NaOH = 2Na2SO4 + 4NaCl + H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2SO4+Ca3(PO)2=CaSO4+Na3PO3Na2SO4 + Ca3(PO)2 = 3CaSO4 + 2Na3PO
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaI + Pb(SO4)2 = PbI4 + Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NO + H2O= NO3- + H+ + e-2NO + 4H2O = 2NO3- + 8H+ + 3e-
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2(OH)2 = NaOH Na2(OH)2 = 2NaOH
Na2S2O3 + I2 = Na2S4O6 + Na+ + I-2Na2S2O3 + I2 = Na2S4O6 + 2Na+ + 2I-
NaOH +H2 SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2SO4 + Ba(NO3)2 = BaSO4 + NaNO3Na2SO4 + Ba(NO3)2 = BaSO4 + 2NaNO3
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + CHCOOH = NH4 + CH3COO-1NH3 + CHCOOH = -1NH4 + CH3COO
NH3 + CHCOOH = NH4 + CH3COO-1NH3 + CHCOOH = -1NH4 + CH3COO
NH3+N2O=N2+H1O2NH3 + 6N2O = 7N2 + 6H1O
NH3+CO2+CaSO4+H2O=(NH4)2SO4+CaCO32NH3 + CO2 + CaSO4 + H2O = (NH4)2SO4 + CaCO3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H3=NH3N2 + 2H3 = 2NH3
NaBr +Co(NO3)2 = Na(NO3)2 + CoBrNaBr + Co(NO3)2 = Na(NO3)2 + CoBr
NaBr +Co(NO3)2 = Na(NO3)2 + CoBrNaBr + Co(NO3)2 = Na(NO3)2 + CoBr
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O5(g) + H2O(l) = HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH3 + H2O + ZnF3 = Zn2O3 + NH4F6NH3 + 3H2O + 2ZnF3 = Zn2O3 + 6NH4F
NH3 + H2O + ZnF3 = Zn2O3 + NH4F6NH3 + 3H2O + 2ZnF3 = Zn2O3 + 6NH4F
NH3 + H2O + ZnF3 = Zn2O3 + NH4F6NH3 + 3H2O + 2ZnF3 = Zn2O3 + 6NH4F
NH3 + H2O + ZnF3 = Zn2O3 + NH4F6NH3 + 3H2O + 2ZnF3 = Zn2O3 + 6NH4F
NH3 + H2O + ZnF3 = Zn2O3 + NH4F6NH3 + 3H2O + 2ZnF3 = Zn2O3 + 6NH4F
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
N2 + 2O2 = NO2N2 + 2O2 = 2NO2
N2 + 2NO2 = NO20N2 + NO2 = NO2
NH3+O2=4NO+8H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=4NO+8H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=4NO+8H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Na2CO3 + HCl = NaCl + H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
NaHCO3 + HCl = NaCl + H2CO3NaHCO3 + HCl = NaCl + H2CO3
Na(s) + 2H2O(l) =NaOH(aq) + 2H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH4NO3= N2O+H2ONH4NO3 = N2O + 2H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+Mg=Mg3N2+H22NH3 + 3Mg = Mg3N2 + 3H2
NAOH+PB+2NO3= PBOH +NANO3NAOH + PB + NO3 = PBOH + NANO3
NAOH+PBNO3= PBOH +NANO3NAOH + PBNO3 = PBOH + NANO3
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaIO3+NaHSO3=NaHSO4+Na2SO4+H2O+I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni O2 +H2O + Fe = Ni (OH)2 + Fe (OH) 2NiO2 + 2H2O + Fe = Ni(OH)2 + Fe(OH)2
NH4(OH)+H2CO3=NH4HCO3+2H2ONH4(OH) + H2CO3 = NH4HCO3 + H2O
NH4OH+H2CO3=NH4HCO3+2H2ONH4OH + H2CO3 = NH4HCO3 + H2O
Na2CO3+HNO3=NaNO3+CO2+H2ONa2CO3 + 2HNO3 = 2NaNO3 + CO2 + H2O
NO+H2=NH3+H2O2NO + 5H2 = 2NH3 + 2H2O
NH3+O2+H2O=HNO3NH3 + 2O2 - H2O = HNO3
N2+6H2= NH3N2 + 3H2 = 2NH3
NH4Cl + KOH = NH4OH + KClNH4Cl + KOH = NH4OH + KCl
NaOH + H3PO4 = H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
Na2C2O4 + Ca(NO3)2 = CaC2O4 + 2NaNO3Na2C2O4 + Ca(NO3)2 = CaC2O4 + 2NaNO3
N2+ H2O=NH3+NO5N2 + 6H2O = 4NH3 + 6NO
NH3+O2=NO2+ H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2+O2=N2O2N2 + O2 = 2N2O
NO2= NO+O22NO2 = 2NO + O2
NaHCO3+HCl=NaCl+H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaHCO3+HCl=NaCl+H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3+O2=N2O4+H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NaOH + HCl= NaCl + H2ONaOH + HCl = NaCl + H2O
Na2Cr2O7+FeCl2+HCl=CrCl3+FeCl3+NaCl+H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
NH4 + S = NH4SNH4 + S = NH4S
NH4 + CO32 = NH4CO32NH4 + CO32 = NH4CO32
NH4 + NO3 = NH4NO3NH4 + NO3 = NH4NO3
NH4 + OH = NH4OHNH4 + OH = NH4OH
NH4 + Br = NH4BrNH4 + Br = NH4Br
NH4 + Cl = NH4ClNH4 + Cl = NH4Cl
Na2S+Na2SO4+SiO2=Na2SiO3+SO30Na2S + Na2SO4 + SiO2 = Na2SiO3 + SO3
NaCl + H2O = Cl2 + H2 + NaOH2NaCl + 2H2O = Cl2 + H2 + 2NaOH
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaIO3+Na2SO3+NaHSO3=I2+Na2SO4+H2O2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
NaNO3+C2+Ca(OH)2 = NaNO2+CaCO3+H2O4NaNO3 + C2 + 2Ca(OH)2 = 4NaNO2 + 2CaCO3 + 2H2O
NH4NO3+Ca(OH)2=NH3+CaNO3+H2O7NH4NO3 + 8Ca(OH)2 = 6NH3 + 8CaNO3 + 13H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 = N2 + H22NH3 = N2 + 3H2
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Ni + O2 = Ni2O34Ni + 3O2 = 2Ni2O3
Ni + O2 = Ni2O22Ni + O2 = Ni2O2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na2 CO3 + H Br = Na Br + H2 CO3Na2CO3 + 2HBr = 2NaBr + H2CO3
NH4 + OH = NH3 + H2ONH4 + OH = NH3 + H2O
NO + CO = N2 +CO22NO + 2CO = N2 + 2CO2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NO + CO = N2 + CO22NO + 2CO = N2 + 2CO2
Na2S+NiSO4=Na2SO4+NiSNa2S + NiSO4 = Na2SO4 + NiS
NH4+O2=NO+H2O2NH4 + 3O2 = 2NO + 4H2O
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na+I2=NaI2Na + I2 = 2NaI
N2 + F2 = NF3N2 + 3F2 = 2NF3
Na3PO4 + KOH = NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NO + O2 = NO22NO + O2 = 2NO2
NaI+Ni(NO3)2= Na(NO3)2 +NiINaI + Ni(NO3)2 = Na(NO3)2 + NiI
NaI+Ni(NO3)2= Na(NO3)2 +NiINaI + Ni(NO3)2 = Na(NO3)2 + NiI
NH3 = H + NNH3 = 3H + N
NH3 + O2 = NO + 2H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl + H20 = Na20 + HCl20NaCl + H20 = Na20 + 20HCl
NH4NO3(s) = N2(g) + O2(g) +H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NiSO4 + O2 = NiO + SO22NiSO4 - O2 = 2NiO + 2SO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaNO3 + Ba3(PO4)2 = Na3PO4 + Ba(NO3)26NaNO3 + Ba3(PO4)2 = 2Na3PO4 + 3Ba(NO3)2
Na(s) + CuCl2(aq) = NaCl(aq) + Cu(s)2Na(s) + CuCl2(aq) = 2NaCl(aq) + Cu(s)
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
NO2 + CH4 = CO +H2O + N26NO2 + 4CH4 = 4CO + 8H2O + 3N2
NO + CH4 = CO +H2O + N26NO + 2CH4 = 2CO + 4H2O + 3N2
NH3(g) +O2(g) =N2(g) +H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH3(g) +HCl(g) =NH4Cl(g)NH3(g) + HCl(g) = NH4Cl(g)
N2(g) +O2(g) = N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3 = N2O +H2ONH4NO3 = N2O + 2H2O
NH4NO3 = N2O +H2ONH4NO3 = N2O + 2H2O
NO2+CO2=CO+NONO2 - CO2 = -1CO + NO
Na2S + 2H= 2 Na + H2SNa2S + 2H = 2Na + H2S
NaClO3(s)+KI(s)+HCl(aq)=NaCl(aq)+I2(aq)+KCl(aq)+H2O(l)NaClO3(s) + 6KI(s) + 6HCl(aq) = NaCl(aq) + 3I2(aq) + 6KCl(aq) + 3H2O(l)
NaCl + H2O = H2 + Cl2 + NaOH2NaCl + 2H2O = H2 + Cl2 + 2NaOH
N+Cl=NCl3N + 3Cl = NCl3
Na2S+(NH4)3PO4 = Na2PO4 + (NH4)3SNa2S + (NH4)3PO4 = Na2PO4 + (NH4)3S
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl=NaClNa + Cl = NaCl
Na+Cl=NaClNa + Cl = NaCl
Na2HASO3 + NaBrO3 + HCl = NaCl + NaBr + H3ASO43Na2HASO3 + NaBrO3 + 6HCl = 6NaCl + NaBr + 3H3ASO4
Na2HASO3 + NaBrO3 + HCl = NaCl + NaBr + H3ASO43Na2HASO3 + NaBrO3 + 6HCl = 6NaCl + NaBr + 3H3ASO4
Na2Cr2O7+H2O+S=SO2+NaOH+Cr2O32Na2Cr2O7 + 2H2O + 3S = 3SO2 + 4NaOH + 2Cr2O3
Na2Cr2O7+H2O+S=SO2+NaOH+Cr2O32Na2Cr2O7 + 2H2O + 3S = 3SO2 + 4NaOH + 2Cr2O3
NH4+ + H2O= H3O+ + NH3NH4+ + H2O = H3O+ + NH3
NH3 + H2O = NH4 + 3OHNH3 + H2O = NH4 + OH
NH3 + H2O = NH4 + 3OHNH3 + H2O = NH4 + OH
NaOH + H3PO4 = Na3PO4 +H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaHCO3=NaOH+H2O+CO2NaHCO3 = NaOH + 0H2O + CO2
Na3PO4 +Ba(NO3)2 = NaNO3 + Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
NO + CO = N2 + CO22NO + 2CO = N2 + 2CO2
NO2 + CO = N2 + CO22NO2 + 4CO = N2 + 4CO2
NO2 + CO2 = N2 + CO20NO2 + CO2 = 0N2 + CO2
NO + CO2 = N2 + CO20NO + CO2 = 0N2 + CO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NiSO4 + KOH = NiOH + KSO4NiSO4 + KOH = NiOH + KSO4
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO2- + Al + OH = NH3 + Al(OH)4- + H2O-1NO2- - Al + 3OH = -1NH3 - Al(OH)4- + 5H2O
NO2- + Al + H2O = NH3 + Al(OH)4- + OHNO2- + Al + 5H2O = NH3 + Al(OH)4- + 3OH
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaCl+ HBr = NaBr + HClNaCl + HBr = NaBr + HCl
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na2SO3 = Na2SO4 +Na2S4Na2SO3 = 3Na2SO4 + Na2S
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2+Cl=NaClNa2 + 2Cl = 2NaCl
Na3PO4 + 3 NH4HCO3 = 3 NaHCO3 + (NH4)3PO4 Na3PO4 + 3NH4HCO3 = 3NaHCO3 + (NH4)3PO4
NH4Cl + NaHCO3 = NaCl + NH4HCO3NH4Cl + NaHCO3 = NaCl + NH4HCO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+H2O+O2= HNO34NO2 + 2H2O + O2 = 4HNO3
NH3+O2+CH4=HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2O(g) + H2(g) = NH3(g) + H2O(g)N2O(g) + 4H2(g) = 2NH3(g) + H2O(g)
Na + H2O = NaOH + HNa + H2O = NaOH + H
Na + H2O = NaOH + HNa + H2O = NaOH + H
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2+O2+H2= HNO3N2 + 3O2 + H2 = 2HNO3
Na2B4O7+H2SO4+H2O=H3BO3+Na2SO4Na2B4O7 + H2SO4 + 5H2O = 4H3BO3 + Na2SO4
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na2 CO3 + H2 CO3 = Na HCO3Na2CO3 + H2CO3 = 2NaHCO3
NH3 + CuO =Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + O2+ H2O = HNO34NO2 + O2 + 2H2O = 4HNO3
NaCl + AgNO3=AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na3PO4 + AlCl3 =AlPO4+ NaClNa3PO4 + AlCl3 = AlPO4 + 3NaCl
N2H4 + O2 = NO + H2ON2H4 + 2O2 = 2NO + 2H2O
N2H4 + O2 = NO + H2ON2H4 + 2O2 = 2NO + 2H2O
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NH3 (g) + O2 (g)= NO (g) + H2O (g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH3 (g) + O2 (g)= NO2 (g) + H2O (g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH4Cl+Ca(OH)2=CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na2S + Cu3N2 = Na3N + CuS3Na2S + Cu3N2 = 2Na3N + 3CuS
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NaCIO3(g)=NaCI(s) + O2 (g)2NaCIO3(g) = 2NaCI(s) + 3O2(g)
NaCIO3(g)=NaCI(s) + O2 (g)2NaCIO3(g) = 2NaCI(s) + 3O2(g)
NaOH + FeBr3 = NaBr3 + FeOHNaOH + FeBr3 = NaBr3 + FeOH
NaOH+FeBr3=NaBr3+FeOHNaOH + FeBr3 = NaBr3 + FeOH
NaOH+FeBr3=NaBr3+FeOHNaOH + FeBr3 = NaBr3 + FeOH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO3 + BaCO3 = Na2CO3 +BaSO3Na2SO3 + BaCO3 = Na2CO3 + BaSO3
NH4 + OH = NH3 + H2ONH4 + OH = NH3 + H2O
Ni + OH = Ni(OH)2Ni + 2OH = Ni(OH)2
Na2 + HBrO3 = NaBr + NaOH + O2Na2 + HBrO3 = NaBr + NaOH + O2
NAHCO3 + HCl = NACl + CO2 + H2ONAHCO3 + HCl = NACl + CO2 + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2+H2O=HN3+NO7NO2 - H2O = -2HN3 + 13NO
NaOH+HCl=Na2O+HCl0NaOH + HCl = 0Na2O + HCl
NaOH+HCl=Na2O+HCl0NaOH + HCl = 0Na2O + HCl
NaOH+FeBr3=NaBr3+FeOHNaOH + FeBr3 = NaBr3 + FeOH
Ni(NH3)4 + HDMG = Ni(DMG)2 + NH4 + NH3Ni(NH3)4 + 2HDMG = Ni(DMG)2 + 2NH4 + 2NH3
Ni2 + NH3 = Ni(NH3)4Ni2 + 8NH3 = 2Ni(NH3)4
Ni(OH)2 + H2SO4 = Ni2 + SO4 + H2O2Ni(OH)2 + 2H2SO4 = Ni2 + 2SO4 + 4H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH3 + Cl2 = NH4Cl + NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
Na+Co2=Na2Co34Na + 3Co2 = 2Na2Co3
Na + O2 = Na2O4Na + O2 = 2Na2O
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2O + H2O=NaOHNa2O + H2O = 2NaOH
NaOH+ 3HNO3 = NaNO3 + 2H2O NaOH + HNO3 = NaNO3 + H2O
NaOH+3HNO3=NaNO3+2H2ONaOH + HNO3 = NaNO3 + H2O
NaIO3+NaSO3+HCl=Na2SO4+H2O+I2+NaCl-2NaIO3 - 10NaSO3 + 8HCl = -10Na2SO4 + 4H2O - I2 + 8NaCl
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na + H2S = NaS + 2HNa + H2S = NaS + 2H
Na+O2=NaO2Na + O2 = NaO2
Na3PO4 +3AgNO3=NaNO3+Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
Na2O + H2SO4 = Na2SO4 + H2ONa2O + H2SO4 = Na2SO4 + H2O
Na2O + H2SO4 = Na2SO4 + H2ONa2O + H2SO4 = Na2SO4 + H2O
Na2CO3 + HCl = CO2 + H2O + NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NiCl3 + F2 = Cl + F3Ni24NiCl3 + 3F2 = 12Cl + 2F3Ni2
NaCl + Pb(NO3)2 = NaNO3 + PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
NH3+Cl2=NH4Cl+N28NH3 + 3Cl2 = 6NH4Cl + N2
NaHSO3+KMnO4+HCl=H2O+KCl+MnCl2+NaHSO45NaHSO3 + 2KMnO4 + 6HCl = 3H2O + 2KCl + 2MnCl2 + 5NaHSO4
NaHSO3+KMnO4+HCl=H2O+KCl+MnCl2+NaHSO45NaHSO3 + 2KMnO4 + 6HCl = 3H2O + 2KCl + 2MnCl2 + 5NaHSO4
NaHSO3+KMnO4+HCl=H2O+KCl+MnCl2+NaHSO45NaHSO3 + 2KMnO4 + 6HCl = 3H2O + 2KCl + 2MnCl2 + 5NaHSO4
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Ni(NO3)2 + NH3 = Ni(NH3)6 +NO3Ni(NO3)2 + 6NH3 = Ni(NH3)6 + 2NO3
NH4NO2 + NaOH= NH4+ H2O + NaNO27NH4NO2 + 8NaOH = 6NH4 + 6H2O + 8NaNO2
Ni+O2=Ni2O34Ni + 3O2 = 2Ni2O3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3 + 2CuSO4 = 2NaSO4 + Cu2CO3Na2CO3 + 2CuSO4 = 2NaSO4 + Cu2CO3
Na2CO3+MnCl2=MnCO3+2NaClNa2CO3 + MnCl2 = MnCO3 + 2NaCl
Na2CO3+MnCl2=MnCO3+2NaClNa2CO3 + MnCl2 = MnCO3 + 2NaCl
N2 (g)+3H(g)= 2NH2(g)N2(g) + 4H(g) = 2NH2(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl + SO2 + H2O + O2 = Na2SO4 + HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH + HCl = NaCl +H2ONaOH + HCl = NaCl + H2O
Na2S+Sb=SbS+NaNa2S + Sb = SbS + 2Na
Na2CO3+Ag=AgCO3+Na2Na2CO3 + Ag = AgCO3 + Na2
NaOH+Ca(NO3)2=Na(NO3)2+CaOHNaOH + Ca(NO3)2 = Na(NO3)2 + CaOH
NA2CO3+PB(NO3)=NA2(NO3)+PBCO3NA2CO3 + PB(NO3) = NA2(NO3) + PBCO3
NA2CO3+PB+(NO3)=NA2(NO3)+PBCO3NA2CO3 + PB + (NO3) = NA2(NO3) + PBCO3
Na+O2=NaO2Na + O2 = NaO2
Na+O2=NaO2Na + O2 = NaO2
Na2S+AgNO3=Na2NO3+AgSNa2S + AgNO3 = Na2NO3 + AgS
Na2CO3+AgNO3=Na2NO3+AgCO3Na2CO3 + AgNO3 = Na2NO3 + AgCO3
Ni + CO = Ni(CO)4Ni + 4CO = Ni(CO)4
NaOH + Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NH4Cl + Ca(OH)2 = CaCl2 + H2O + NH32NH4Cl + Ca(OH)2 = CaCl2 + 2H2O + 2NH3
NH4Cl + Ca(OH)2 = CaCl2 + H2O + NH32NH4Cl + Ca(OH)2 = CaCl2 + 2H2O + 2NH3
Na2CO3 + HCl = NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na2S2O3 + Cl2 + H2O = Na2SO4 + HCl + NaCl -1Na2S2O3 - 4Cl2 - 5H2O = -2Na2SO4 - 10HCl + 2NaCl
Na2SO4 + CaCl2 = CaSO4 + NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = O2 + HNO34NO2 + 2H2O = -1O2 + 4HNO3
NaOH + HClO4 = NaClO4 + H2ONaOH + HClO4 = NaClO4 + H2O
NO(g)+CO(g)=N2(g)+CO2(g)2NO(g) + 2CO(g) = N2(g) + 2CO2(g)
Na+Cl= NaClNa + Cl = NaCl
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3 + O2= NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3 = NaCl+ O22NaClO3 = 2NaCl + 3O2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+O2+CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+O2+H2 =HNO3N2 + 3O2 + H2 = 2HNO3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na + HF = NaF + H22Na + 2HF = 2NaF + H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.