Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4ClO4=N2 + Cl2 +O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2
Na2CO3 + NH4Cl = NaCl + (NH4)2CO3Na2CO3 + 2NH4Cl = 2NaCl + (NH4)2CO3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na+H2=NaH2Na + H2 = 2NaH
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l) = NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaOH + NH4HCO3 = Na2CO3 + H2O + NH32NaOH + NH4HCO3 = Na2CO3 + 2H2O + NH3
NH + O2 = NO + H2O4NH + 3O2 = 4NO + 2H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaNO2+NaI+H2SO4=NO+I2+Na2SO4+H2O2NaNO2 + 2NaI + 2H2SO4 = 2NO + I2 + 2Na2SO4 + 2H2O
NaOH+K2SO4=NaSO4+K2OHNaOH + K2SO4 = NaSO4 + K2OH
NaCl+Ba(NO3)2=NaNO3+BaCl22NaCl + Ba(NO3)2 = 2NaNO3 + BaCl2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NiF2+Fe2(SO4)3=NiSO4+FeF33NiF2 + Fe2(SO4)3 = 3NiSO4 + 2FeF3
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NaCl+F2=NaF+Cl2NaCl + F2 = 2NaF + 2Cl
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
Na(s)+H2O(l)= NaOH(aq)+H22Na(s) + 2H2O(l) = 2NaOH(aq) + H2
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na(s)+H2O(l)= NaOH(aq)+H2(s)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(s)
Na(s)+H2O(l)= NaOH(aq)+H22Na(s) + 2H2O(l) = 2NaOH(aq) + H2
Na+H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
Na3PO4+Zn(NO3)2=+NaNO3+Zn3(PO4)22Na3PO4 + 3Zn(NO3)2 = 6NaNO3 + Zn3(PO4)2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O2+CO2=Na2CO3+O22Na2O2 + 2CO2 = 2Na2CO3 + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+H2O=NO+H2O0NH3 + H2O = 0NO + H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2O = HNO3 + N2O32N2 - 3H2O = -6HNO3 + 5N2O3
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaOH(aq) + H2SO4(aq)=Na2SO4(aq) + H2O(l)2NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l)
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
N+O=NON + O = NO
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3(s)=N2(g)+O2(g)+H20(g)10NH4NO3(s) = 10N2(g) + 15O2(g) + 2H20(g)
NO(g)+H2(g)=NH3(g)+H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NO + H = N + H2ONO + 2H = N + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Ni(NO3)2+ Na2S = NiS+ NaNO3Ni(NO3)2 + Na2S = NiS + 2NaNO3
Ni(NO3)2+ Na2S = NiS+ NaNO3Ni(NO3)2 + Na2S = NiS + 2NaNO3
NO + O2 = NO3NO + O2 = NO3
N2 + O2 = NON2 + O2 = 2NO
N2 + O2 = N2O2N2 + O2 = 2N2O
NaNo3+PbO=Pb(No3)2+Na2O2NaNo3 + PbO = Pb(No3)2 + Na2O
Nd2(SO4)3+3Cu = CuSO4+NdNd2(SO4)3 + 3Cu = 3CuSO4 + 2Nd
NH4OH+H2SO4=(NH4)2SO4+ H2O2NH4OH + H2SO4 = (NH4)2SO4 + 2H2O
NH4OH+H2SO4=NH4NO3+(NH4)2SO4+ H2O2NH4OH + H2SO4 = 0NH4NO3 + (NH4)2SO4 + 2H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH4SCN+Hg(NO3)2=Hg(SCN)2+NH4NO32NH4SCN + Hg(NO3)2 = Hg(SCN)2 + 2NH4NO3
NH4SCN+Hg(NO3)2=Hg(SCN)2+NH4NO32NH4SCN + Hg(NO3)2 = Hg(SCN)2 + 2NH4NO3
Na2SO4 + H2O = H2SO4 + NaOHNa2SO4 + 2H2O = H2SO4 + 2NaOH
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NH3+H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2+Cl2+O2+H2O = (NH4ClO4)N2 + Cl2 + 2O2 + 4H2O = 2(NH4ClO4)
N2H4=NH3+N23N2H4 = 4NH3 + N2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2+O2=NON2 + O2 = 2NO
Ni(NO3)2+Na2S=NiS+NaNO3Ni(NO3)2 + Na2S = NiS + 2NaNO3
NaOH(aq)+NaNO2+Al(s)+H2O(l)=NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2 + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2O + H2ONH4NO3 = N2O + 2H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2+O2=NON2 + O2 = 2NO
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2H4(g)+N2O4(g)=N2(g)+14H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NaCl +H2O = HCl + Na2O2NaCl + H2O = 2HCl + Na2O
NaCl +H2O = HCl + Na2O2NaCl + H2O = 2HCl + Na2O
N 2 H 4 (l)=NH 3 (g)+N 2 (g) 3N2H4(l) = 4NH3(g) + N2(g)
Na + H2O = NaOH + O2-4Na - 2H2O = -4NaOH + O2
NH4NO3 (aq)=N2O(g) + H2O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)
N2H4(g)+N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NH3+O2 = NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NO+H= N2 + H2O2NO + 4H = N2 + 2H2O
Na2O2+H2O=NaOH+H2O2Na2O2 + 2H2O = 2NaOH + H2O2
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH4Cl(aq)+NaOH(aq)=H2O(l)+NH3(g)+NaCl(aq)NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq)
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaHCO3+HCl=H2O+NaCl+CO2NaHCO3 + HCl = H2O + NaCl + CO2
NaH2PO2+K2Cr2O7+H2SO4=H3PO4+Cr2(SO4)3+Na2SO4+K2SO4+H2O6NaH2PO2 + 4K2Cr2O7 + 19H2SO4 = 6H3PO4 + 4Cr2(SO4)3 + 3Na2SO4 + 4K2SO4 + 16H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2S3O6+KMnO4+HCl=Na2SO4+H2SO4+MnCl2+KCl+H2O5Na2S3O6 + 8KMnO4 + 24HCl = 5Na2SO4 + 10H2SO4 + 8MnCl2 + 8KCl + 2H2O
NaO2+H2O=NaOH+O24NaO2 + 2H2O = 4NaOH + 3O2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaHCO3+1H2O=Na+HCO3NaHCO3 + 0H2O = Na + HCO3
NaHCO3+1H2O=Na+HCO3NaHCO3 + 0H2O = Na + HCO3
NaHCO3+H2O=Na+HCO3NaHCO3 + 0H2O = Na + HCO3
NaOH + HClO4 = H2O + NaClO4NaOH + HClO4 = H2O + NaClO4
NaOH + HClO4 = H2O + NaClO4NaOH + HClO4 = H2O + NaClO4
NaCl + SO2 + H2O + O2 = Na2SO4 + HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
NaCl(s) + SO2(g) + H2O(l) + O2(g) = Na2SO4(s) + HCl(g)4NaCl(s) + 2SO2(g) + 2H2O(l) + O2(g) = 2Na2SO4(s) + 4HCl(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2O5=N2O4+O22N2O5 = 2N2O4 + O2
N2H4 = NH3+N23N2H4 = 4NH3 + N2
Na+Br=NaBrNa + Br = NaBr
N2O2 = NON2O2 = 2NO
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l) = NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NH3 + H2O = NH4OHNH3 + H2O = NH4OH
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaNO3 = NaNO4 + O-1NaNO3 = -1NaNO4 + O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na +NO3= NaNO2+O22Na + 2NO3 = 2NaNO2 + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S2O3 + H2O2 = Na2SO4 + H2SO4 + H2ONa2S2O3 + 4H2O2 = Na2SO4 + H2SO4 + 3H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NaHSO3+HCl+K2Cr2O7=NaHSO4+KCl+Cr2O3+H2O3NaHSO3 + 2HCl + K2Cr2O7 = 3NaHSO4 + 2KCl + Cr2O3 + H2O
Na2CO3 + H2SO4 = Na2SO4 + CO2 + H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na2CO3+C+N2=NaCN+CONa2CO3 + 4C + N2 = 2NaCN + 3CO
Na2CO3+C+N=NaCN+CONa2CO3 + 4C + 2N = 2NaCN + 3CO
NaNO3 + Sn + HBr = SnO2 + NO + NaBr + H2O4NaNO3 + 3Sn + 4HBr = 3SnO2 + 4NO + 4NaBr + 2H2O
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaHCO3 + H2O = CO2 + NaHCO3 NaHCO3 + 0H2O = 0CO2 + NaHCO3
NH4Cl+NaOH=H2O+NH3+NaClNH4Cl + NaOH = H2O + NH3 + NaCl
NH4Cl+NaOH=H2O+NH3+NaClNH4Cl + NaOH = H2O + NH3 + NaCl
NH4Cl+NaOH=H2O+NH3+NaClNH4Cl + NaOH = H2O + NH3 + NaCl
NH4Cl+NaOH=H2O+NH3+NaClNH4Cl + NaOH = H2O + NH3 + NaCl
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaOH + NO2 + NO = NaNO3 + H2O2NaOH + 3NO2 - NO = 2NaNO3 + H2O
NaBH4+H2SO4=B2H6+H2+Na2SO42NaBH4 + H2SO4 = B2H6 + 2H2 + Na2SO4
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2O5(g) + H2O(l) = 2 HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na2CO3 + C2H5OH = CH3COONa + CO2 + H2O3Na2CO3 + 4C2H5OH = 6CH3COONa - CO2 + 3H2O
NaOH +HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaHCO3 +HCl = NaCl + H2CO3 NaHCO3 + HCl = NaCl + H2CO3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2+H2=NH3N2 + 3H2 = 2NH3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na2SiO3(s)+8HF(aq)=H2SiF6(aq)+2NaF(aq)+3H2O(l)Na2SiO3(s) + 8HF(aq) = H2SiF6(aq) + 2NaF(aq) + 3H2O(l)
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NH4ClO4 + Al = Al2O3 + N2 + Cl2 + H2O6NH4ClO4 + 8Al = 4Al2O3 + 3N2 + 3Cl2 + 12H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaH2 PO4+ Na OH= Na3 PO4+ H2ONaH2PO4 + 2NaOH = Na3PO4 + 2H2O
NaH2 PO4+NaOH=Na3 PO4+H2ONaH2PO4 + 2NaOH = Na3PO4 + 2H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2CO3+NiSO4=Na2SO4+NiCO3Na2CO3 + NiSO4 = Na2SO4 + NiCO3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na2CO3 +CaCl2 = CaCO3 + NaClNa2CO3 + CaCl2 = CaCO3 + 2NaCl
Na2CO3 +CaCl2 = CaCO3 + NaClNa2CO3 + CaCl2 = CaCO3 + 2NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
NH3NI3 = N2 + I2 +NH4I8NH3NI3 = 5N2 + 9I2 + 6NH4I
N2O5(g)+H2O(l)=HNO3(aq) N2O5(g) + H2O(l) = 2HNO3(aq)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O +HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3+O2=H2O+N24NH3 + 3O2 = 6H2O + 2N2
NiC2O4*2H2O + O2 = Ni2O3 + H2O + CO24NiC2O4*2H2O + 3O2 = 2Ni2O3 + 8H2O + 8CO2
NiC2O4*2H2O + O2 = NiO + H2O + CO22NiC2O4*2H2O + O2 = 2NiO + 4H2O + 4CO2
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O +HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO + O2 = NO22NO + O2 = 2NO2
Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NO2 + H + H2O = HNO3NO2 - H + H2O = HNO3
NO2 + H + H2O = HNO3NO2 - H + H2O = HNO3
NaCl (aq) + AgNO3 (aq) = AgCl (s) + NaNO3 (aq)NaCl(aq) + AgNO3(aq) = AgCl(s) + NaNO3(aq)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2+H2O=NH4NO2N2 + 2H2O = NH4NO2
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaClO + HClO3 = NaCl + HClO-2NaClO + HClO3 = -2NaCl + HClO
NaClO + HClO3 = NaCl + 3HClO-2NaClO + HClO3 = -2NaCl + HClO
NaHCO3+H2SO4=Na2SO4+CO2+H2O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NH3+O=NO+3H2O2NH3 + 5O = 2NO + 3H2O
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NiC2O4*2H2O=NiCO3+H2O+CONiC2O4*2H2O = NiCO3 + 2H2O + CO
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NiC2O4*2H2O+O2=Ni2O3+H2O+CO24NiC2O4*2H2O + 3O2 = 2Ni2O3 + 8H2O + 8CO2
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na+ H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO3(aq)+Ni(s)=NO(g)+Ni2(aq)0NO3(aq) + 2Ni(s) = 0NO(g) + Ni2(aq)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaC2H3O2+Ca(NO3)2=CaC2H3O2+Na(NO3)2NaC2H3O2 + Ca(NO3)2 = CaC2H3O2 + Na(NO3)2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2CO3 + FeCl3 = NaCl + Fe2(CO3)33Na2CO3 + 2FeCl3 = 6NaCl + Fe2(CO3)3
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaOH(aq) + NaNO2(aq) + Al(s) + H2O(l) = NH3(aq) + NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaOH(aq) + NaNO2(aq) + Al(s) + H2O(l) = NH3(aq) + NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaOH(aq) + NaNO2(aq) + Al(s) + H2O(l) = NH3(aq) + NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaOH(aq) + NaNO2(aq) + Al(s) + H2O(l) = NH3(aq) + NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaNO2 = NaNO3 + O-1NaNO2 = -1NaNO3 + O
NaOH +H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3 NI3 =N2 + I2 + NH4I8NH3NI3 = 5N2 + 9I2 + 6NH4I
NH3 NI3 =N2 + I2 + NH4I8NH3NI3 = 5N2 + 9I2 + 6NH4I
NH3 NI3 =N2 + I2 + NH4I8NH3NI3 = 5N2 + 9I2 + 6NH4I
NaOH + Pb(NO3)2 = Pb(OH) + Na(NO3)2NaOH + Pb(NO3)2 = Pb(OH) + Na(NO3)2
N2H2+N2O4=N2+H2O4N2H2 + N2O4 = 5N2 + 4H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NaCl+H2SO4+MnO2=Na2SO4+MnSO4+H2O+Cl22NaCl + 2H2SO4 + MnO2 = Na2SO4 + MnSO4 + 2H2O + Cl2
NH3 + CO2 + H2O = (NH4)2CO32NH3 + CO2 + H2O = (NH4)2CO3
NH3 + CO2 = (NH2)2CO + H2O2NH3 + CO2 = (NH2)2CO + H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na2CO3+C+N2=NaCN+CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NaCH3COO(aq)+HCl(aq)=CH3COOH(aq)+NaCl(aq)NaCH3COO(aq) + HCl(aq) = CH3COOH(aq) + NaCl(aq)
NH3+O3=N2+H2O2NH3 + O3 = N2 + 3H2O
NaClO + NH3 = N2H4 + NaCl + H2ONaClO + 2NH3 = N2H4 + NaCl + H2O
NaBr (aq) + Cl2 (g) = NaCl (aq) + Br2 (g)2NaBr(aq) + Cl2(g) = 2NaCl(aq) + Br2(g)
Na (s) + H2O (l) = NaOH (aq) + H2 (g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3+O2=N2O+H2020NH3 + 5O2 = 10N2O + 3H20
N2+H2 = NH3N2 + 3H2 = 2NH3
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s) = N2(g) +O(g) + H2O(g)NH4NO3(s) = N2(g) + O(g) + 2H2O(g)
NH4NO(s)= N2(g) +O2 + H2O(g)2NH4NO(s) = 2N2(g) - O2 + 4H2O(g)
NaOH + NaNO2 + Al + H20 = NH3 + NaAlO20NaOH + 20NaNO2 + 20Al + 3H20 = 20NH3 + 20NaAlO2
Na + H2 = NaH2Na + H2 = 2NaH
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na3P+H2O=NaOH+PH3Na3P + 3H2O = 3NaOH + PH3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na2S(aq) + CaCl2(g) = CaS + NaCl (aq)Na2S(aq) + CaCl2(g) = CaS + 2NaCl(aq)
N2(g) + 3H2(g) = 2NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2+H2=NH3N2 + 3H2 = 2NH3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaHCO3 + C6H8O7 +H2O = Na3C6H5O7 + C02-6NaHCO3 + 2C6H8O7 - 10H2O = -2Na3C6H5O7 + 9C02
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NiC2O4*2H2O + O2 = Ni2O3 + H2O + CO24NiC2O4*2H2O + 3O2 = 2Ni2O3 + 8H2O + 8CO2
Na3P+H2O = PH3+NaOHNa3P + 3H2O = PH3 + 3NaOH
Ni(NO3)2*6H2O + H2C2O4 =NiC2O4*2H2O + H2O + HNO3 Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NaOCl + NH3 = NaONH3 + Cl22NaOCl + 2NH3 = 2NaONH3 + Cl2
NaOH(aq)+HI(aq) = NaI(aq)+H2O(l)NaOH(aq) + HI(aq) = NaI(aq) + H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
N2O3 + H2O = HNO2N2O3 + H2O = 2HNO2
NH4OH(aq)+HNO3(aq) = NH4NO3+H2O(l)NH4OH(aq) + HNO3(aq) = NH4NO3 + H2O(l)
NaClO4=NaCl+O2NaClO4 = NaCl + 2O2
NaI + Br = NaBr + INaI + Br = NaBr + I
NaHCO3 + C6H8O7 + H2O = Na3C6H5O7 + C02-6NaHCO3 + 2C6H8O7 - 10H2O = -2Na3C6H5O7 + 9C02
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3+O2=N2O3+H2O2NH3 + 3O2 = N2O3 + 3H2O
NiC2O4*2H2O=NiCO3+H2O+CONiC2O4*2H2O = NiCO3 + 2H2O + CO
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaI + AgNO3 = NaNO3 + AgINaI + AgNO3 = NaNO3 + AgI
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NO2 + H2O = HNO2 + NO-1NO2 - H2O = -2HNO2 + NO
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
Ni(NO3)2 + KOH = Ni(OH)2 + KNO3Ni(NO3)2 + 2KOH = Ni(OH)2 + 2KNO3
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O +HNO3 Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NCl3 + CH4 = CCl4 + N2 +H24NCl3 + 3CH4 = 3CCl4 + 2N2 + 6H2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NCl3 + CH4 = CCl4 + N2 +H24NCl3 + 3CH4 = 3CCl4 + 2N2 + 6H2
NH3+CuO=N2+Cu+H2O2NH3 + 3CuO = N2 + 3Cu + 3H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+ O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na3P+H2O=NaOH+PH3Na3P + 3H2O = 3NaOH + PH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + N2O   =   N2 + H2O2NH3 + 3N2O = 4N2 + 3H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 +O2=NO +H2O4NH3 + 5O2 = 4NO + 6H2O
Na+CL =NaCLNa + CL = NaCL
NH4NO= N2+O2+H2O2NH4NO = 2N2 - O2 + 4H2O
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NaOH + H2S = Na2S + H2O2NaOH + H2S = Na2S + 2H2O
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NH4ClO4 + Al = Al2O3 + N2 + Cl2 + H2O6NH4ClO4 + 8Al = 4Al2O3 + 3N2 + 3Cl2 + 12H2O
NaNH2 + NaNO3 = NaN3 +NaOH + NH33NaNH2 + NaNO3 = NaN3 + 3NaOH + NH3
Na + O2 = Na2O 4Na + O2 = 2Na2O
NiC2O4*2H2O + O2 = Ni2O3 + H2O + CO2 4NiC2O4*2H2O + 3O2 = 2Ni2O3 + 8H2O + 8CO2
NiC2O4*2H2O + O2 = Ni2O3 + H2O + CO2 4NiC2O4*2H2O + 3O2 = 2Ni2O3 + 8H2O + 8CO2
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH4F+NaOH+Al(OH)3=Na3AlF6+H3N+H2O6NH4F + 3NaOH + Al(OH)3 = Na3AlF6 + 6H3N + 6H2O
N2+H2 = NH3N2 + 3H2 = 2NH3
Na(s) + Br2(l) = NaBr(s) 2Na(s) + Br2(l) = 2NaBr(s)
NH4NO3(s) = N2(g) + O2(g) + H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4+ +OH- =NH3 + H2ONH4+ + OH- = NH3 + H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaO2 + H2O = NaOH O2 +H2O2-2NaO2 + 0H2O = -2NaOHO2 + H2O2
NaAl(CO3)(OH)2+HCl=NaCl+AlCl3+CO2+H2ONaAl(CO3)(OH)2 + 4HCl = NaCl + AlCl3 + CO2 + 3H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaCLO3=NaCL+O22NaCLO3 = 2NaCL + 3O2
Na2CO3 + Mg(NO3)2 = MgCO3 + NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
Na+HCl=H2+NaCl2Na + 2HCl = H2 + 2NaCl
Na2CO3 + Mg(NO3)2 = MgCO3 + NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq)=NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq)=NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
Ni(NO3)2*6H2O (aq) + H2C2O4 (aq) = NiC2O4*2H2O (s) + H2O (l) + HNO3 (aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3 = N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NiC2O4*2H2O = NiCO3 + H2O + CONiC2O4*2H2O = NiCO3 + 2H2O + CO
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Ni(NO3)2+Na2S=NiS+NaNO3Ni(NO3)2 + Na2S = NiS + 2NaNO3
Na2CO3+AgNO3=NaNO3+Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2O5+NH3=N2+H2O3N2O5 + 10NH3 = 8N2 + 15H2O
Na+C12=NaC112Na + C12 = 12NaC1
NH3(g)+O2(g)=NO2(g)+H2O4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+AlBr3= NaBr+Al(OH)33NaOH + AlBr3 = 3NaBr + Al(OH)3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NBr3+NaOH=N2+NaBr+HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2 = NH3N2 + 3H2 = 2NH3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 + Na = NaNH2 + H22NH3 + 2Na = 2NaNH2 + H2
NaI+Cl2=I2+NaCl2NaI + Cl2 = I2 + 2NaCl
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH3+F2=N2F4+HF2NH3 + 5F2 = N2F4 + 6HF
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl+H2SO4=HCl+Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
Na+Cl=NaClNa + Cl = NaCl
Na+Cl=NaClNa + Cl = NaCl
Na+Cl=NaCl2Na + 2Cl = NaCl2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+O2=Na2O4Na + O2 = 2Na2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2O5+ H2O= HNO3N2O5 + H2O = 2HNO3
Na2NH+ H2O= NH3 + NaOHNa2NH + 2H2O = NH3 + 2NaOH
NaI+KMnO4+H2SO4=I+K2SO4+MnSO4+Na2SO4+H2O10NaI + 2KMnO4 + 8H2SO4 = 10I + K2SO4 + 2MnSO4 + 5Na2SO4 + 8H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaHCO3 + H3PO4 = CO2 + H2O + Na3PO43NaHCO3 + H3PO4 = 3CO2 + 3H2O + Na3PO4
NaHCO3 + H3PO4 = CO2 + H2O + Na2HPO42NaHCO3 + H3PO4 = 2CO2 + 2H2O + Na2HPO4
NaOH +H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+NaNO2+Al+H2O=NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
N2H4=NH3 +N23N2H4 = 4NH3 + N2
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NaOH+HCl=H2O+NaClNaOH + HCl = H2O + NaCl
NaOH(aq) + HNO3(aq)= NaNO3(aq) +H2O(l)NaOH(aq) + HNO3(aq) = NaNO3(aq) + H2O(l)
NaOH+HCl=H2O+NaClNaOH + HCl = H2O + NaCl
NH4NO3(s)=N2(g)+O2(g)+H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaHCO 3 (aq)+HCl(aq)=H 2 O(l)+NaCl(aq)+CO 2 (g) NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO 3 (aq)+HCl(aq)=H 2 O(l)+NaCl(aq)+CO 2 (g) NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2+H2=NH3N2 + 3H2 = 2NH3
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na2O+H2O=Na(OH)2+H2O0Na2O + H2O = 0Na(OH)2 + H2O
NH3 + O2 =NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+ H2O= HNO3 + NO 3NO2 + H2O = 2HNO3 + NO
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
Na + F2 = NaF2Na + F2 = 2NaF
NaCIO3=NaCI+O22NaCIO3 = 2NaCI + 3O2
Na3P + H2O = PH3 + NaOHNa3P + 3H2O = PH3 + 3NaOH
NH4Cl = NH3 + HClNH4Cl = NH3 + HCl
NH3+S2Cl2=NH4Cl+S4N4+S816NH3 + 6S2Cl2 = 12NH4Cl + S4N4 + S8
Na2HPO4+AgNO3=Na2NO3+AgHPO4Na2HPO4 + AgNO3 = Na2NO3 + AgHPO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na + H2 = NaH2Na + H2 = 2NaH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+Ba(NO3)2=Na(NO3)2+BaClNaCl + Ba(NO3)2 = Na(NO3)2 + BaCl
NH 4 NO 3 (aq)=N 2 O(g)+H 2 O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.