Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaHCO3 + CH3CO2H =CH3CO2Na + H2CO3 NaHCO3 + CH3CO2H = CH3CO2Na + H2CO3
NaCl + H2SO4 = Na2SO4 + SO2 + HCl2NaCl + H2SO4 = Na2SO4 + 0SO2 + 2HCl
Ni(NH3)6 + (CH3)2C2(NOH)2 = NH4 + NH3 + NiC8H14N4O4Ni(NH3)6 + 2(CH3)2C2(NOH)2 = 2NH4 + 4NH3 + NiC8H14N4O4
NF3+Si=SiF4+N24NF3 + 3Si = 3SiF4 + 2N2
NH4Cl+AgNO3=NH4NO3+AgClNH4Cl + AgNO3 = NH4NO3 + AgCl
N2H4 = NH3+N23N2H4 = 4NH3 + N2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2 +H2 = NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+NO2=N2O+H2O6NH3 + 8NO2 = 7N2O + 9H2O
NH4NO3+BaCl2=NH4Cl+Ba(NO3)22NH4NO3 + BaCl2 = 2NH4Cl + Ba(NO3)2
NF3 + H2 = HF + N22NF3 + 3H2 = 6HF + N2
NF3 + H2 = HF + N22NF3 + 3H2 = 6HF + N2
NaOH+H2SO4=H2O+Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + I2 =NI3N2 + 3I2 = 2NI3
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
N2H4+2H2O2=N2+4H2ON2H4 + 2H2O2 = N2 + 4H2O
NiCO3 + HNO3 = NiNO3 + HCO3 NiCO3 + HNO3 = NiNO3 + HCO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + H2(SO4) = (NH4)2SO42NH3 + H2(SO4) = (NH4)2SO4
NH3+CH4=HCN+H2NH3 + CH4 = HCN + 3H2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + O2 = Na2O4Na + O2 = 2Na2O
Na+S = Na2S2Na + S = Na2S
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NH3 + Cl2 = N2 + HCl2NH3 + 3Cl2 = N2 + 6HCl
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na2CO3 + MgBr2 = MgCO3 + Na2Br2Na2CO3 + MgBr2 = MgCO3 + Na2Br2
Na3PO4 + ZnSO4 = Na2SO4 + Zn3(PO4)22Na3PO4 + 3ZnSO4 = 3Na2SO4 + Zn3(PO4)2
NaOH+NaNO2+Al+H2O=NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
NaHCO3(aq)+HCl(aq) = H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3+HCl = H2O+NaCl+CO2NaHCO3 + HCl = H2O + NaCl + CO2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl=Na+ClNaCl = Na + Cl
NO2+ H2O= HNO3 +NO3NO2 + H2O = 2HNO3 + NO
NO2+ H2O= HNO3 +NO3NO2 + H2O = 2HNO3 + NO
NH3 + Cl2 = N2 + HCl2NH3 + 3Cl2 = N2 + 6HCl
NH3 + Cl2 = N2 + 6HCl2NH3 + 3Cl2 = N2 + 6HCl
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + HCl = NH3Cl + HNH3 + HCl = NH3Cl + H
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2+H2=NH3N2 + 3H2 = 2NH3
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NaHCO3+HCl=NaCl+H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
N2H4+N2O4=3N2+4H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+I2=NaI2Na + I2 = 2NaI
NO2 + H2 = H2O + NH32NO2 + 7H2 = 4H2O + 2NH3
NO + H2 = N2 + H2O 2NO + 2H2 = N2 + 2H2O
NO + H2 = NH3 + H2O 2NO + 5H2 = 2NH3 + 2H2O
NaOH + Cl2+ NH3 = N2H4 + NaCl + H2O2NaOH + Cl2 + 2NH3 = N2H4 + 2NaCl + 2H2O
NaOH(aq) + (NH4)2SO4(aq) = 2 NH3(g) + H2O(l) + Na2SO4(aq)2NaOH(aq) + (NH4)2SO4(aq) = 2NH3(g) + 2H2O(l) + Na2SO4(aq)
N2H4 + O2 = N2 + H2ON2H4 + O2 = N2 + 2H2O
NaCl + H2SO4 = NaHSO4 + HClNaCl + H2SO4 = NaHSO4 + HCl
Na2SO3 + H2SO4 = Na2SO4 + H2O + SO2Na2SO3 + H2SO4 = Na2SO4 + H2O + SO2
NH3+O2=N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
Na+H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NO+H=N2O+H2O2NO + 2H = N2O + H2O
NH3+CuO=N+Cu+H2O2NH3 + 3CuO = 2N + 3Cu + 3H2O
NH3+CuO=N2+Cu+H2O2NH3 + 3CuO = N2 + 3Cu + 3H2O
NaBr+H2O=NaOH+HBrNaBr + H2O = NaOH + HBr
NaBr+HOH=NaOH+HBrNaBr + HOH = NaOH + HBr
N+O=NON + O = NO
N+O=NON + O = NO
N2(g) + O2(g) = NO(g)N2(g) + O2(g) = 2NO(g)
NaHCO3+HCl=CO2+H2O+NaClNaHCO3 + HCl = CO2 + H2O + NaCl
NH4NO3 + LiOH = LiNO3 + NH3 + H2ONH4NO3 + LiOH = LiNO3 + NH3 + H2O
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NaIO3 + NaHSO3 = NaHSO4 + Na2SO4 + H2O + I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
Na2CO3=Na2O+CO2Na2CO3 = Na2O + CO2
NH3+NO=N2=H2O4NH3 + 6NO = 5N2 + 6H2O
NH4NO3(s) = N2(g)+O2(g)+H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2SO4+HNO3 = NaNO3 + H2SO4Na2SO4 + 2HNO3 = 2NaNO3 + H2SO4
N+H3=NH3N + H3 = NH3
NaH(CO3) = Na(CO3) = CO2 + H2020NaH(CO3) = 20Na(CO3) + 0CO2 + H20
NiO+H2=Ni+H2ONiO + H2 = Ni + H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + H3PO4 = Na3PO4+ H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2S +Pb(NO3)2 = 2NaNO3 +SPbNa2S + Pb(NO3)2 = 2NaNO3 + SPb
NaClO + H2S = NaCl + H2SO44NaClO + H2S = 4NaCl + H2SO4
Na2CO3 + HCl = NaCl + CO2 +H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NiCl2+O2=NiO+Cl2O5NiCl2 + 3O2 = NiO + Cl2O5
Na(s) + Cl2(g) = NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na2CO3+HNO3=CO2+NaNO3+H2ONa2CO3 + 2HNO3 = CO2 + 2NaNO3 + H2O
NO + O2 = NO22NO + O2 = 2NO2
NaNO3(s) = NaNO2(s) + O2(g) 2NaNO3(s) = 2NaNO2(s) + O2(g)
NaHCO3+HC2H3O2=NaC2H3O2+H2O+CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NaHCO3+HC2H3O2=NaC2H3O2+H2O+CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH2N2 + 2H2 = 2NH2
Na2CO3 +BaCl2 = NaCl + BaCO3Na2CO3 + BaCl2 = 2NaCl + BaCO3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2CO3+Ca(NO3)2=NaNO3+CaCO3Na2CO3 + Ca(NO3)2 = 2NaNO3 + CaCO3
Na2S+CaCl2=NaCl+CaSNa2S + CaCl2 = 2NaCl + CaS
NH4NO3 = N2 + O2 + H2010NH4NO3 = 10N2 + 15O2 + 2H20
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaN 3 =Na+N 2 2NaN3 = 2Na + 3N2
NiF 2 +Fe 2 (SO 4 ) 3 =NiSO 4 +FeF 3 3NiF2 + Fe2(SO4)3 = 3NiSO4 + 2FeF3
NCl3(aq) + H2O(l) = NH3(aq) + HOCl(aq)NCl3(aq) + 3H2O(l) = NH3(aq) + 3HOCl(aq)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + Cl2 + O2 + H2O = NH4ClO4N2 + Cl2 + 2O2 + 4H2O = 2NH4ClO4
NaCl + Fe3(PO4)2 = FeCl2 + Na3PO46NaCl + Fe3(PO4)2 = 3FeCl2 + 2Na3PO4
Na2CrO4+AgNO3=NaNO3+Ag2CrO4Na2CrO4 + 2AgNO3 = 2NaNO3 + Ag2CrO4
NaN3=Na+N22NaN3 = 2Na + 3N2
NH 4 NO 3 (aq)=N 2 O(g)+H 2 O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
N2+O2=N2O52N2 + 5O2 = 2N2O5
NH4+ + OH- = NH3 + H2ONH4+ + OH- = NH3 + H2O
NO2 + H2O = HNO2 + HNO32NO2 + H2O = HNO2 + HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O5=4NO2 + O22N2O5 = 4NO2 + O2
N2O5=4NO2+ O22N2O5 = 4NO2 + O2
Na2O2+H2O=O2+NaOH2Na2O2 + 2H2O = O2 + 4NaOH
NO + H2 = N2 + H2O 2NO + 2H2 = N2 + 2H2O
Na3PO4+Ba(NO3)2=Ba3(PO4)2+NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
Na2S+CuCl2=NaCl+CuSNa2S + CuCl2 = 2NaCl + CuS
NH4OH + Mg(NO3)2 = Mg(OH)2 + NH4NO32NH4OH + Mg(NO3)2 = Mg(OH)2 + 2NH4NO3
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NaHSO3 + KIO3 = I2 + Na2SO4 + H2SO4 + K2SO4 + H2O10NaHSO3 + 4KIO3 = 2I2 + 5Na2SO4 + 3H2SO4 + 2K2SO4 + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2O=NH3+NO5N2 + 6H2O = 4NH3 + 6NO
NaCl+ H2SO4= NaHSO4+ HClNaCl + H2SO4 = NaHSO4 + HCl
N2+H2= NH3N2 + 3H2 = 2NH3
Na2(CO3)+HCl=NaCl+H2O+CO2Na2(CO3) + 2HCl = 2NaCl + H2O + CO2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=N2O2N2 + O2 = 2N2O
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+H2O=Na(OH)+HNa + H2O = Na(OH) + H
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
Na3PO4 + CaCl2 = NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
N2 + F2 = NF3N2 + 3F2 = 2NF3
Ni(NH3)6 + (CH3)2C2(NOH)2 = NH4 + NH3 + NiC8H14N4O4Ni(NH3)6 + 2(CH3)2C2(NOH)2 = 2NH4 + 4NH3 + NiC8H14N4O4
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaHCO3+FeCl2=Fe(HCO3)2 + NaCl2NaHCO3 + FeCl2 = Fe(HCO3)2 + 2NaCl
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
N2O5 =NO2 + O22N2O5 = 4NO2 + O2
NaHCO3(aq)+HNO3(aq)=NaNO3+H2O(l)+CO2(g)NaHCO3(aq) + HNO3(aq) = NaNO3 + H2O(l) + CO2(g)
Na2CO3+Ba3(PO4)2=BaCO3+Na3PO43Na2CO3 + Ba3(PO4)2 = 3BaCO3 + 2Na3PO4
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na2CO3 + H+ = 2Na+ +HCO3- Na2CO3 + H+ = 2Na+ + HCO3-
NH4CO3+NaOH=NaCO3+NH3+H2ONH4CO3 + NaOH = NaCO3 + NH3 + H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaIO3+Na2SO3+NaHSO3=I2+Na2SO4+H2O2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
Na2Cr2O7+FeSO4+HCl=NaCl+CrCl3+Fe2(SO4)3+FeCl3+H2ONa2Cr2O7 + 6FeSO4 + 14HCl = 2NaCl + 2CrCl3 + 2Fe2(SO4)3 + 2FeCl3 + 7H2O
NO+O2=NO22NO + O2 = 2NO2
NaOH+S=Na2S2O3+Na2S+H2O6NaOH + 4S = Na2S2O3 + 2Na2S + 3H2O
NaOH+S=Na2S2O3+Na2S+H2O6NaOH + 4S = Na2S2O3 + 2Na2S + 3H2O
NaOH+S=Na2S2O3+Na2S+H2O6NaOH + 4S = Na2S2O3 + 2Na2S + 3H2O
Na2SO3+H2SO4=Na2SO4+SO2+H2ONa2SO3 + H2SO4 = Na2SO4 + SO2 + H2O
NaHCO3+HCl=NaCl+CO2+H2ONaHCO3 + HCl = NaCl + CO2 + H2O
NH4NO2(s)=N2(g)+H2O(l)NH4NO2(s) = N2(g) + 2H2O(l)
NaF+H2O=HF+NaOHNaF + H2O = HF + NaOH
NaF+H2O=HF+NaOHNaF + H2O = HF + NaOH
NaF+H2O=HF+NaOHNaF + H2O = HF + NaOH
NH4NO2=N2+2H2ONH4NO2 = N2 + 2H2O
NH4NO2=N2+2H2ONH4NO2 = N2 + 2H2O
NaHCO3 + HC2H3O2 = NaC2H3O2 = H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NO2+H2O=NO+HNO33NO2 + H2O = NO + 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O + (NH4)2SO4 = Na2SO4H2O + NH3Na2O + (NH4)2SO4 = Na2SO4H2O + 2NH3
Na2O + H2O + 2NH4Cl = 2NH4OH + 2NaClNa2O + H2O + 2NH4Cl = 2NH4OH + 2NaCl
NH4NO3(aq)=N2O(g)+H2O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4Cl + Ca(OH)2 = NH3 + H2O + CaCl22NH4Cl + Ca(OH)2 = 2NH3 + 2H2O + CaCl2
NiCO3=CO2+NiONiCO3 = CO2 + NiO
NaHCO3 + NiCl2 = NaCl2 + NiHCO3NaHCO3 + NiCl2 = NaCl2 + NiHCO3
NH4Cl + Ca(OH)2 = NH4OH + CaCl22NH4Cl + Ca(OH)2 = 2NH4OH + CaCl2
Na + H2O =NaOH + H2 2Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NaCl(aq)+Hg2(C2H3O2)2(aq)=Na(C2H3O2)2+Hg2ClNaCl(aq) + Hg2(C2H3O2)2(aq) = Na(C2H3O2)2 + Hg2Cl
Na+I2=NaI2Na + I2 = 2NaI
Na+I2=2NaI2Na + I2 = 2NaI
Ni(CO3)2(s) + 2HNO3(aq) = Ni(NO3)2(aq) + HCO3(aq)Ni(CO3)2(s) + 2HNO3(aq) = Ni(NO3)2(aq) + 2HCO3(aq)
Na+I2=NaI2Na + I2 = 2NaI
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2CrO4 + KNO3 =Na2K +CrO4NO3Na2CrO4 + KNO3 = Na2K + CrO4NO3
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaN3=Na+N22NaN3 = 2Na + 3N2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaI+H2SO4=I2+H2S+H2O+Na2SO48NaI + 5H2SO4 = 4I2 + H2S + 4H2O + 4Na2SO4
N2H4 + O2 = H2O + NO2N2H4 + 3O2 = 2H2O + 2NO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2S + Cu(NO3)2 = NaNO3 + CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH4NO3+Mn(PO4)2=NH4PO4 +Mn(NO3)22NH4NO3 + Mn(PO4)2 = 2NH4PO4 + Mn(NO3)2
NH3+O2= N2O + H2O2NH3 + 2O2 = N2O + 3H2O
NO+H2 = N2 + H2O2NO + 2H2 = N2 + 2H2O
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na3PO4 + CaCl2 =NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NH3 + I2 =N2I6 + H22NH3 + 3I2 = N2I6 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHSO3 + HCl = SO2 + H2O + NaClNaHSO3 + HCl = SO2 + H2O + NaCl
NaHSO3 + HCl = SO2 + H2O + NaClNaHSO3 + HCl = SO2 + H2O + NaCl
NiSO4 + Li3PO4 = Ni3(PO4)2 + 6Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
Na(OH)+Zn(NO3)=Zn(OH)+ Na(NO3)Na(OH) + Zn(NO3) = Zn(OH) + Na(NO3)
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaN3=2Na+N22NaN3 = 2Na + 3N2
N2H4+H2O2= N2+4H2ON2H4 + 2H2O2 = N2 + 4H2O
N2H4+H2O2= N2+4H2ON2H4 + 2H2O2 = N2 + 4H2O
NaOH+NH4NO3=NH3+H2O+NaNO3NaOH + NH4NO3 = NH3 + H2O + NaNO3
NH4Cl + NaNO3 = NH4NO3 + NaClNH4Cl + NaNO3 = NH4NO3 + NaCl
NH4+OH=NH3+H2ONH4 + OH = NH3 + H2O
Ni3(PO4)2 + 3H2SO4 = NiSO4 + H3PO4Ni3(PO4)2 + 3H2SO4 = 3NiSO4 + 2H3PO4
NaCl+Pb(CIO3)2=Na(CIO3)2+PbClNaCl + Pb(CIO3)2 = Na(CIO3)2 + PbCl
NaCl+Pb(CIO3)2=Na(CIO3)2+PbClNaCl + Pb(CIO3)2 = Na(CIO3)2 + PbCl
Na2CO3 + H3C6H5O7 = NaCHO + H2O + CO29Na2CO3 + 4H3C6H5O7 = 18NaCHO + 7H2O + 15CO2
Na2CO3 + H3C6H5O7 = NaCHO + H2O + CO29Na2CO3 + 4H3C6H5O7 = 18NaCHO + 7H2O + 15CO2
Na2CO3 + H3C6H5O7=Na2CHO2 + 3H2O + 2CO26Na2CO3 + H3C6H5O7 = 6Na2CHO2 + H2O + 6CO2
NO3- + OH- + Al----- = NH3 + Al(OH)4 + H2O-9NO3- + 49OH- - 8Al----- = -9NH3 - 8Al(OH)4 + 54H2O
NO3- + OH- + Al = NH3 + Al(OH)4 + H2O-1NO3- + OH- - 2Al = -1NH3 - 2Al(OH)4 + 6H2O
N+H=NH3N + 3H = NH3
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na2SO3 + KMnO4 + H2SO4 = MnSO4 + Na2SO4 + K2SO4 + H2O5Na2SO3 + 2KMnO4 + 3H2SO4 = 2MnSO4 + 5Na2SO4 + K2SO4 + 3H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na+SF6=Na2S+NaF8Na + SF6 = Na2S + 6NaF
NaCl + NaHSO4 = Na2SO4 + HCl NaCl + NaHSO4 = Na2SO4 + HCl
NaCl + H2SO4 = HCl + NaHSO4NaCl + H2SO4 = HCl + NaHSO4
Na2SSO3 + Br3+ H2O = S+ Na2SO4 + HBr3Na2SSO3 + 2Br3 + 3H2O = 3S + 3Na2SO4 + 6HBr
Na2SSO3 + Cl2 + H2O = H2SO4 + Na2SO4 + HClNa2SSO3 + 4Cl2 + 5H2O = H2SO4 + Na2SO4 + 8HCl
NaBrO + NaH2PO3 = NaBr + NaH2PO4NaBrO + NaH2PO3 = NaBr + NaH2PO4
NaBrO + Na2SSO3 + H2O = NaBr + Na2SO4 + H2SO44NaBrO + Na2SSO3 + H2O = 4NaBr + Na2SO4 + H2SO4
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaHCO3+CH3COOH=CH3COONa+H2O+CO2NaHCO3 + CH3COOH = CH3COONa + H2O + CO2
NH4I + NaOH = NH4OH + NaINH4I + NaOH = NH4OH + NaI
N2O5=NO2+O22N2O5 = 4NO2 + O2
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Ni + O2= Ni2O34Ni + 3O2 = 2Ni2O3
N2H4=NH3+N23N2H4 = 4NH3 + N2
NH 4 NO 3 (aq)=N 2 O(g)+H 2 O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)
Na 2 S(aq)+Cu(NO 3 ) 2 (aq)=NaNO 3 (aq)+CuS(s) Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO2 (g) + H2 (g) = NH3 (g) + H2O (l) 2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(l)
NH3+O2=HNO3+H2ONH3 + 2O2 = HNO3 + H2O
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
Na2CrO4+AgNO3=NaNO3+Ag2CrO4Na2CrO4 + 2AgNO3 = 2NaNO3 + Ag2CrO4
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NaNO2 + HCl + H2O = HNO2 + H3O + NaClNaNO2 + HCl + 0H2O = HNO2 + 0H3O + NaCl
Ni + O2=Ni2O34Ni + 3O2 = 2Ni2O3
Na2O+(NH4)2SO4=Na2SO4H2O+NH3Na2O + (NH4)2SO4 = Na2SO4H2O + 2NH3
NH3 + CuO =Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH + Cl2 = NaClO3 + NaCl + H2O6NaOH + 3Cl2 = NaClO3 + 5NaCl + 3H2O
NaOH + Cl2 = NaClO3 + NaCl + H2O6NaOH + 3Cl2 = NaClO3 + 5NaCl + 3H2O
NaOH+ Mg =MgO2 + Na + H22NaOH + Mg = MgO2 + 2Na + H2
NaOH (aq) + Mg (s)=MgO2 + Na + H2(g)2NaOH(aq) + Mg(s) = MgO2 + 2Na + H2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2H4+O2=H2O+N2N2H4 + O2 = 2H2O + N2
N2(g)+H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2+H2O=N2H4+NO23N2 + 4H2O = 2N2H4 + 2NO2
NaVO3 + HCl + Zn = NaCl + VCl2 + ZnCl2 + H2O2NaVO3 + 12HCl + 3Zn = 2NaCl + 2VCl2 + 3ZnCl2 + 6H2O
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4Cl + Hg(O2CCH3)2 = NH4C2H3O2 + HgCl22NH4Cl + Hg(O2CCH3)2 = 2NH4C2H3O2 + HgCl2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NO2 (g) + H2 (g) = NH3 (g) + H2O (l) 2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(l)
NaNO2 + CH3COOH = NO- + NO2 + H3O+ + NaCH3COO3NaNO2 + 3CH3COOH = NO- + 2NO2 + H3O+ + 3NaCH3COO
NaNO2 + CH3COO- + H+ = NO- + NO2 + H2O + NaCH3COO-NaNO2 + CH3COO- + 0H+ = 0NO- + NO2 + 0H2O + NaCH3COO-
NaNO2 + CH3COOH = NO + NO2 + H2O + NaCH3COO2NaNO2 + 2CH3COOH = NO + NO2 + H2O + 2NaCH3COO
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaI(aq) + AgNO3(aq)=NaINO3 + 3AgNaI(aq) + AgNO3(aq) = NaINO3 + Ag
NaI(aq) + AgNO3(aq)=NaINO3 + 3AgNaI(aq) + AgNO3(aq) = NaINO3 + Ag
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
N2+Cl2=NCl3N2 + 3Cl2 = 2NCl3
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
NO2=NO+O22NO2 = 2NO + O2
NH3+L2=N2L6+H22NH3 + 3L2 = N2L6 + 3H2
NO2+H2O=NHO2+HNO32NO2 + H2O = NHO2 + HNO3
NO2=NO+O22NO2 = 2NO + O2
NaOH+Ba(C2H3O2)2=Ba(OH)2+Na(C2H3O2)2NaOH + Ba(C2H3O2)2 = Ba(OH)2 + 2Na(C2H3O2)
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NH4OH + HNO3 = NH4NO3 + H2ONH4OH + HNO3 = NH4NO3 + H2O
NH4OH + HNO3 = NH4NO3 + H2ONH4OH + HNO3 = NH4NO3 + H2O
NaOH+H3PO4=H2O+Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
N 2 (g)+H 2 (g)=NH 3 (g) N2(g) + 3H2(g) = 2NH3(g)
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NH 4 NO 3 (s)=N 2 O(g)+H 2 O(l) NH4NO3(s) = N2O(g) + 2H2O(l)
N2+Cl2=NClN2 + Cl2 = 2NCl
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
N2+F2=NF3N2 + 3F2 = 2NF3
Ni2O3 + N2 = NO2 + Ni4Ni2O3 + 3N2 = 6NO2 + 8Ni
Na + Cl2= NaCl2Na + Cl2 = 2NaCl
Na+Fe2O3=Na2O+Fe6Na + Fe2O3 = 3Na2O + 2Fe
NaOH(aq)+ FeCl3(aq) = NaCl(aq)+ Fe(OH)3(s)3NaOH(aq) + FeCl3(aq) = 3NaCl(aq) + Fe(OH)3(s)
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + 2?O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NaHCO3 + HC2H3O2 = H2CO3 + NaC2H3O2NaHCO3 + HC2H3O2 = H2CO3 + NaC2H3O2
N2 + 2O2 = 2NO2N2 + 2O2 = 2NO2
N2 + 2O2 = 2NO2N2 + 2O2 = 2NO2
N2H4 =NH3+N23N2H4 = 4NH3 + N2
N2 + 2O2 = 2NO2N2 + 2O2 = 2NO2
NaOH + Cl2 = H2O + NaO3Cl + NaCl6NaOH + 3Cl2 = 3H2O + NaO3Cl + 5NaCl
NaNO3 + SO2 = Na2SO4 + NO22NaNO3 + SO2 = Na2SO4 + 2NO2
NaOH + Cl2 = H2O + NaOCl + NaCl2NaOH + Cl2 = H2O + NaOCl + NaCl
NaF + MgCl2 =NaCl + MgF22NaF + MgCl2 = 2NaCl + MgF2
Na4Fe(CN)6 + 6H2O = 4NaOH + Fe(OH)2 + 6HCNNa4Fe(CN)6 + 6H2O = 4NaOH + Fe(OH)2 + 6HCN
Na4Fe(CN)6 + 6H2O = 4NaOH + Fe(OH)2 + 6HCNNa4Fe(CN)6 + 6H2O = 4NaOH + Fe(OH)2 + 6HCN
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Ni(OH)2 + NH3 = Ni(NH3)6(OH)2Ni(OH)2 + 6NH3 = Ni(NH3)6(OH)2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+H2O+H2SO4=(NH4)2SO42NH3 + 0H2O + H2SO4 = (NH4)2SO4
Na3PO4+CrCl3=CrPO4+NaClNa3PO4 + CrCl3 = CrPO4 + 3NaCl
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaCl + O2 = NaClO2NaCl + O2 = NaClO2
NaCl + O2 = NaClO2NaCl + O2 = NaClO2
NH4OH(aq)+AgNO3(aq)=NH4NO3(aq)+Ag2O(s)+H2O2NH4OH(aq) + 2AgNO3(aq) = 2NH4NO3(aq) + Ag2O(s) + H2O
NaOH(aq) + NH4Cl(s) = NaCl(aq) + NH3(g) + H2ONaOH(aq) + NH4Cl(s) = NaCl(aq) + NH3(g) + H2O
NH3 + O = NO + H2O2NH3 + 5O = 2NO + 3H2O
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2SO4(aq) + PbCl2(aq) = PbSO4(s) + NaCl(aq)Na2SO4(aq) + PbCl2(aq) = PbSO4(s) + 2NaCl(aq)
NaSo + Ca(NO) = Na(NO) + CaSoNaSo + Ca(NO) = Na(NO) + CaSo
Na3PO4 + CaF2= NaF + Ca3(PO4)22Na3PO4 + 3CaF2 = 6NaF + Ca3(PO4)2
Na + H2O= NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + Cl2 = NCl3N2 + 3Cl2 = 2NCl3
NO2 + H2O = HNO3 +H22NO2 + 2H2O = 2HNO3 + H2
NO2 + H2O = HNO3 +H22NO2 + 2H2O = 2HNO3 + H2
Na + O2 = Na2O4Na + O2 = 2Na2O
NO3- + 2Cu + 4H+ = 2NO2 + 2Cu2+ + 2H2ONO3- + 2Cu + 2H+ = NO2 + Cu2+ + H2O
NaOH+CH4+N2O = NaCO3+NH2+H2O-2NaOH - 2CH4 - 3N2O = -2NaCO3 - 6NH2 + H2O
NaCi+H2SO4=NaHSO4+HCiNaCi + H2SO4 = NaHSO4 + HCi
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaCI+H2SO4=NaHSO4+HCINaCI + H2SO4 = NaHSO4 + HCI
Na2SO4 + MgCl2 = MgSO4 + Na2Cl2Na2SO4 + MgCl2 = MgSO4 + Na2Cl2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na+2Cl=4NaClNa + Cl = NaCl
NH4Cl (aq) + NaOH (aq) = H2O (l) + NH3 (g) + NaCl (aq)NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq)
Na3PO4 + Ca(NO3)2 = Ca3(PO4)2 + NaNO32Na3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6NaNO3
NS2=S8+N24NS2 = S8 + 2N2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na2O2 + H2SO4 = Na2SO4 + H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na +H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
Na + O2 = Na2O22Na + O2 = Na2O2
Na2O+CO2=Na2CO3Na2O + CO2 = Na2CO3
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NH4OH= NH3+H2ONH4OH = NH3 + H2O
NaNO3= NaNO2+ O22NaNO3 = 2NaNO2 + O2
NaHCO3 + HCl = NaCl + H2O +CO2NaHCO3 + HCl = NaCl + H2O + CO2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na+Br2=NaBr2Na + Br2 = 2NaBr
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH+CuCl2=NaCl+Cu(OH)22NaOH + CuCl2 = 2NaCl + Cu(OH)2
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+F2=NF3N2 + 3F2 = 2NF3
NaHCO3 + HNO3 = NaNO3 + H2O + CO2NaHCO3 + HNO3 = NaNO3 + H2O + CO2
N + H = NH3N + 3H = NH3
Ni(NO3)2+NaOH=Ni(OH)2+NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NH4Cl + NaOH = NH3 + NaCl + H2ONH4Cl + NaOH = NH3 + NaCl + H2O
NaOH+CO2 =Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaPO4 + BaCl2 = 2NaCl + Ba(PO4)22NaPO4 + BaCl2 = 2NaCl + Ba(PO4)2
NaC2H3O2 + AgNO3 = NaNO3 + AgC2H3O2NaC2H3O2 + AgNO3 = NaNO3 + AgC2H3O2
Ni(NO3)2(aq)+NaOH(aq)=Ni(OH)2(aq)+NaNO3(aq)Ni(NO3)2(aq) + 2NaOH(aq) = Ni(OH)2(aq) + 2NaNO3(aq)
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaClO2+Cl2=ClO2+NaCl2NaClO2 + Cl2 = 2ClO2 + 2NaCl
NaClO2+Cl2=ClO2+NaCl2NaClO2 + Cl2 = 2ClO2 + 2NaCl
NaOH+Cl2=NaCl+NaClO+H2O2NaOH + Cl2 = NaCl + NaClO + H2O
Na2S + ZnSO4 = ZnS + Na2SO4Na2S + ZnSO4 = ZnS + Na2SO4
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NO + H2O = NH3 + O24NO + 6H2O = 4NH3 + 5O2
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH(aq) + Al(s)+HOH(l)=NaAlO2(aq) + H2 (g)2NaOH(aq) + 2Al(s) + 2HOH(l) = 2NaAlO2(aq) + 3H2(g)
Na3PO4(aq) + BaCl2(aq) = NaCl(aq) + Ba3(PO4)2(s)2Na3PO4(aq) + 3BaCl2(aq) = 6NaCl(aq) + Ba3(PO4)2(s)
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NO+O2=NO22NO + O2 = 2NO2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na+Cl=NaClNa + Cl = NaCl
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH4N2 + 4H2 = 2NH4
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2H4+2N2O4=3N2+4H2O2N2H4 + N2O4 = 3N2 + 4H2O
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
N2+O2+H2+C=C8H11ON22N2 + O2 + 11H2 + 16C = 2C8H11ON2
NaOH+(NH4)3PO4=Na3PO4+H2O+NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NaCo3 + FeCI = FeCo3 + NaCINaCo3 + FeCI = FeCo3 + NaCI
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NaCl + BeF2 = NaF + BeCl22NaCl + BeF2 = 2NaF + BeCl2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3 + N2O = N2 + H2O2NH3 + 3N2O = 4N2 + 3H2O
NiCl2+NaOH=NiOH+NaCl2NiCl2 + NaOH = NiOH + NaCl2
N2H4(l)=NH3(g)+N2(g) 3N2H4(l) = 4NH3(g) + N2(g)
NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + H2O(l) 2NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4(NO)3+NaCl=NH4Cl+Na(NO)3NH4(NO)3 + NaCl = NH4Cl + Na(NO)3
Na3PO4 + PbCl4 = NaCl + Pb3(PO4)44Na3PO4 + 3PbCl4 = 12NaCl + Pb3(PO4)4
NO(g) +O2 (g)+ H2O(l) =HNO3(g)4NO(g) + 3O2(g) + 2H2O(l) = 4HNO3(g)
Na1 + O2 = Na2O4Na1 + O2 = 2Na2O
Na1 + O2 = Na2O4Na1 + O2 = 2Na2O
Na1 + O2 = Na2O4Na1 + O2 = 2Na2O
NaBr +Cl2 = NaCl +Br22NaBr + Cl2 = 2NaCl + Br2
Na3PO4 + HCl = NaCl + H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NH3 + O2 = 2NO + 3H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 + HCl = NaCl + CO2 + H2ONaHCO3 + HCl = NaCl + CO2 + H2O
N2H4 + N2O4 = N2 + H2O2N2H4 + N2O4 = 3N2 + 4H2O
NS2=S8+N2 4NS2 = S8 + 2N2
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2H4O3=N2+O2+H2O2N2H4O3 = 2N2 + O2 + 4H2O
NO2 = NO + O22NO2 = 2NO + O2
NaHCO3+C2H4O2 = CO2 +H2O +Na8NaHCO3 + C2H4O2 = 10CO2 + 6H2O + 8Na
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Ni+O2=NiO2Ni + O2 = 2NiO
Ni(NO3)2+NaOH=Ni(OH)2+NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NaCO3=NaO2+CONaCO3 = NaO2 + CO
Na2CO3 + Pb3P2 = Na2P2 + Pb3CO3Na2CO3 + Pb3P2 = Na2P2 + Pb3CO3
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaBr(aq) + AgNO3(aq) = NaNO3(aq) + AgBr(s) NaBr(aq) + AgNO3(aq) = NaNO3(aq) + AgBr(s)
NaI(aq) + AgNO3(aq) = NaNO3(aq) + AgI(s) NaI(aq) + AgNO3(aq) = NaNO3(aq) + AgI(s)
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl=NaClNa + Cl = NaCl
Na2O2 + H2O = 2NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
Na3PO4(aq)+Ba(NO3)2(aq)=Ba3(PO4)2(s)+NaNO3(aq)2Na3PO4(aq) + 3Ba(NO3)2(aq) = Ba3(PO4)2(s) + 6NaNO3(aq)
NO2 + H2O = HNO3 +NO3NO2 + H2O = 2HNO3 + NO
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na + HCl =NaCl + H22Na + 2HCl = 2NaCl + H2
N6I3+I2=N6I5N6I3 + I2 = N6I5
NaI3+I2=NaI62NaI3 + 3I2 = 2NaI6
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaBr + H3PO4 = Na3PO4 + HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O+H2O = NaOHNa2O + H2O = 2NaOH
Na + I2 = NaI2Na + I2 = 2NaI
N2 + 2Al = 2AlNN2 + 2Al = 2AlN
N2(g) + 3H2(g) = 2NH3(g)N2(g) + 3H2(g) = 2NH3(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.