Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
N2(g) + O2(g) = NO(g)N2(g) + O2(g) = 2NO(g)
Na3N=Na(s) + N2(g)2Na3N = 6Na(s) + N2(g)
Na3N=Na(s) + N2(g)2Na3N = 6Na(s) + N2(g)
N2 (g) + O2 (g) = N2O3 2N2(g) + 3O2(g) = 2N2O3
Na2CO3 + 2 HNO3 = H2CO3 + 2 NaNO3Na2CO3 + 2HNO3 = H2CO3 + 2NaNO3
Na2CO3 + 2 HNO3 = H2CO3 + 2 NaNO3Na2CO3 + 2HNO3 = H2CO3 + 2NaNO3
Na+Pb= NaPbNa + Pb = NaPb
NaCl+BeF2=NaF+BeCl22NaCl + BeF2 = 2NaF + BeCl2
N2+H2(aq)=NH3(l)N2 + 3H2(aq) = 2NH3(l)
N2+H2=NH3(l)N2 + 3H2 = 2NH3(l)
NaOH + CaBr2 = Ca(OH) 2 + NaBr2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NO+O2=NO22NO + O2 = 2NO2
N2 (g) + O2 (g) = NO (g)N2(g) + O2(g) = 2NO(g)
NaOH + CuCl2 = Cu(OH)2 + NaCl2NaOH + CuCl2 = Cu(OH)2 + 2NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2Cr2O7 + HCl = NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
NH3(aq) +HClO4(aq) =NClO4+H3HNH3(aq) + HClO4(aq) = NClO4 + H3H
N2+H2=N2H4N2 + 2H2 = N2H4
NaClO3=NaCl +O22NaClO3 = 2NaCl + 3O2
NH4Cl(s)= NH3(g) + HClNH4Cl(s) = NH3(g) + HCl
NaOH(aq) + HNO3(aq) = NaNO3(aq) + H2O(l)NaOH(aq) + HNO3(aq) = NaNO3(aq) + H2O(l)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl + BeF2 = NaF + BeCl22NaCl + BeF2 = 2NaF + BeCl2
NO2 + H2O=HNO3 +NO3NO2 + H2O = 2HNO3 + NO
Na + H2SO4 = Na2SO4 + H22Na + H2SO4 = Na2SO4 + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NAC2H3O2 + AGNO3 = NANO3 + AGC2H3O2NAC2H3O2 + AGNO3 = NANO3 + AGC2H3O2
Na+O2=Na2O4Na + O2 = 2Na2O
Na3PO4 + 3KOH = 3NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na3PO4 + 3KOH = 3NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NH3+ NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NaCl(aq)+AgNO3(aq)=AgCl(s)+NaNO3(aq)NaCl(aq) + AgNO3(aq) = AgCl(s) + NaNO3(aq)
NaF + H2SO4 = Na2SO4 + HF2NaF + H2SO4 = Na2SO4 + 2HF
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3+O2=H2O+NO4NH3 + 5O2 = 6H2O + 4NO
NH4NO3(s) = N2(g) + O2(g) + H2O(l)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(l)
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NH3+Cl2=HCl+N22NH3 + 3Cl2 = 6HCl + N2
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NCl3 + H2O = HClO + NH3 NCl3 + 3H2O = 3HClO + NH3
NO2=NO+O22NO2 = 2NO + O2
NO2=NO+O22NO2 = 2NO + O2
NO2=NO+O22NO2 = 2NO + O2
Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
NaHCO3=CO2+H2O+Na2CO32NaHCO3 = CO2 + H2O + Na2CO3
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
N2H4 + N2O4 = N2 + H2O2N2H4 + N2O4 = 3N2 + 4H2O
NaHCO3 + 2HCl = CO2 + H2O + NaClNaHCO3 + HCl = CO2 + H2O + NaCl
NaHCO3 + 2HCl = CO2 + H2O + NaClNaHCO3 + HCl = CO2 + H2O + NaCl
N2H4(l)+O2(g) = NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na2SO4 + HBr = NaBr+ H2SO4Na2SO4 + 2HBr = 2NaBr + H2SO4
Na + NiSO3 = NaSO3 + NiNa + NiSO3 = NaSO3 + Ni
NaF + CaBr2 = NaBr + CaF22NaF + CaBr2 = 2NaBr + CaF2
NH3(g)+O2(g)=N2(g)+H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2O5=NO2+O22N2O5 = 4NO2 + O2
N4 + 3 H2 = 2 NH3N4 + 6H2 = 4NH3
N2 + 3 H2 = 2 NH3N2 + 3H2 = 2NH3
N2 + 3 H2 = 2 NH3N2 + 3H2 = 2NH3
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
NaOH(aq)+ HNO 3 (aq)=H 2 O(l)+ NaNO 3 (aq)NaOH(aq) + HNO3(aq) = H2O(l) + NaNO3(aq)
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na + H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH+Br2=NaBrO3+NaBr+H2O6NaOH + 3Br2 = NaBrO3 + 5NaBr + 3H2O
NaOH(aq)+(NH4)2SO4(aq)=(NH4)2OH(aq)+NaSO4(s)NaOH(aq) + (NH4)2SO4(aq) = (NH4)2OH(aq) + NaSO4(s)
Na2SO3 + Fe2(Cr2O7)3 = Na2Cr2O7 + Fe2(SO3)3 3Na2SO3 + Fe2(Cr2O7)3 = 3Na2Cr2O7 + Fe2(SO3)3
Na3PO4(aq)+CoCl2(aq)=Co3(PO4)2(s)+NaCl(aq)2Na3PO4(aq) + 3CoCl2(aq) = Co3(PO4)2(s) + 6NaCl(aq)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
N a 2 S(aq)+ Cu(N O 3 ) 2 (aq)=NaN O 3 (aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaOH + 3LiOH = NaLi + 4OHNaOH + LiOH = NaLi + 2OH
NaOH + 3LiOH = NaLi + OHNaOH + LiOH = NaLi + 2OH
NaHCO3 = Na2CO3 +H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(C2H3O2)2(aq) + Na2S(aq) = NiS(s) + NaC2H3O2(aq)Ni(C2H3O2)2(aq) + Na2S(aq) = NiS(s) + 2NaC2H3O2(aq)
Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NaClO2(s) = NaCl(s) + O2(g)NaClO2(s) = NaCl(s) + O2(g)
Ni(OH)2 (s) + HBr (aq) = NiBr + H(OH)2Ni(OH)2(s) + HBr(aq) = NiBr + H(OH)2
Na2SO3(aq) + CuCl2(aq) =CuSO3(s) + NaCl(aq)Na2SO3(aq) + CuCl2(aq) = CuSO3(s) + 2NaCl(aq)
Na2SO4(aq) + BaCl2(aq) = 2NaCl(aq) + BaSO4 (s)Na2SO4(aq) + BaCl2(aq) = 2NaCl(aq) + BaSO4(s)
N2O5(s) + H2O(l) =HNO3(aq)N2O5(s) + H2O(l) = 2HNO3(aq)
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
N2H4(l)+O2(g) = NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Ni(s) + HCl(aq) = NiCl2(aq) + H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Na2CO3 + Mg(NO3)2=MgCO3 + NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NH4I(aq)+NaOH(aq)=NH4OH+NaINH4I(aq) + NaOH(aq) = NH4OH + NaI
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NiS(s)+ O 2 (g)=NiO(s)+ SO 2 (g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NH4NO3=N2O +H2ONH4NO3 = N2O + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + H2SO4 + MnO2 = NaSO4 + MnCl2 + Cl2 +H2O2NaCl + 2H2SO4 + MnO2 = 2NaSO4 + MnCl2 + 0Cl2 + 2H2O
Na(s) + NiSO3(aq) = NaSO3 + NiNa(s) + NiSO3(aq) = NaSO3 + Ni
N2(g) + O2(g) =  NO(g)N2(g) + O2(g) = 2NO(g)
NO(g) + O2(g) =  NO2(aq)2NO(g) + O2(g) = 2NO2(aq)
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NiSO4 + Na2CrO4 = Na2SO4 + NiCrO4NiSO4 + Na2CrO4 = Na2SO4 + NiCrO4
NO2 + H2O = HNO3 +NO3NO2 + H2O = 2HNO3 + NO
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH2OH(l)+O2(g)=N2+H2O4NH2OH(l) + O2(g) = 2N2 + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaClO + 2HCl = Cl2 + H2O + NaClNaClO + 2HCl = Cl2 + H2O + NaCl
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NH3+Cl2+NaOH = N2H2+NaCl+H2O2NH3 + 2Cl2 + 4NaOH = N2H2 + 4NaCl + 4H2O
Na2CO3 + C = Na + CONa2CO3 + 2C = 2Na + 3CO
Na2O+HNO3=NaNO3+H2ONa2O + 2HNO3 = 2NaNO3 + H2O
Na+O2=Na2O4Na + O2 = 2Na2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
NO2+H2O=NH2+O3NO2 + H2O = NH2 + O3
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaNO3(aq) + (NH4)2CO3(aq)=Na2CO3+NH4NO32NaNO3(aq) + (NH4)2CO3(aq) = Na2CO3 + 2NH4NO3
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2CO3 + Ca(OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na2S(aq) + Cu(NO3)2(aq) = 2 NaNO3 + CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3 + CuS(s)
Na2S(aq) + Cu(NO3)2(aq) = 2 NaNO3 + CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3 + CuS(s)
Na2S(aq) + Cu(NO3)2(aq) = 2 NaNO3 + CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3 + CuS(s)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2S2O3 + 2HCl = NaCl + S + H2O + SO2Na2S2O3 + 2HCl = 2NaCl + S + H2O + SO2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2SO4 + KMnO4 + BaCl2 = BaSO4 + K2SO4 + MnSO4 + NaClNa2SO4 + 0KMnO4 + BaCl2 = BaSO4 + 0K2SO4 + 0MnSO4 + 2NaCl
NaCO3+56H=Na+CO2+H2ONaCO3 + 2H = Na + CO2 + H2O
NaCO3+3H=Na+CO2+H2ONaCO3 + 2H = Na + CO2 + H2O
NaCO3+3H=Na+CO2+H2ONaCO3 + 2H = Na + CO2 + H2O
NaCO3+3H=Na+CO2+H2ONaCO3 + 2H = Na + CO2 + H2O
NaCO3+H=Na+CO2+H2ONaCO3 + 2H = Na + CO2 + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NH3+O2 = NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S2O3+Cl+H2O = NaHSO4 + HClNa2S2O3 + 8Cl + 5H2O = 2NaHSO4 + 8HCl
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na2SO4 + Ba(NO3)2 = NaNO3 + BaSO4Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na+O2=Na2O4Na + O2 = 2Na2O
NO+O2=NO22NO + O2 = 2NO2
N2+O2=NON2 + O2 = 2NO
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 = N2+H22NH3 = N2 + 3H2
Ni(s) + Cu(NO3)2 (aq) = Ni (NO3)2 + CuNi(s) + Cu(NO3)2(aq) = Ni(NO3)2 + Cu
NaOH +NaNO2 + Al +H2O = NH3 + NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
NH3+CuO=H2O+N2+Cu2NH3 + 3CuO = 3H2O + N2 + 3Cu
NH3 + I2 = NI2 + H22NH3 + 2I2 = 2NI2 + 3H2
NH3+I2=NI2+H22NH3 + 2I2 = 2NI2 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 (g) + O2(g) = NO2(g) + H2O (g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
N2O= N2+O22N2O = 2N2 + O2
NH3+O2=H2O+NO4NH3 + 5O2 = 6H2O + 4NO
NH4=N2+H++e-2NH4 = N2 + 8H+ + 4e-
NaHCO3 + CH3COOH = CO2+ CH3COONa + H2ONaHCO3 + CH3COOH = CO2 + CH3COONa + H2O
Na2SiF6  +  Na   =  Si  +  NaFNa2SiF6 + 4Na = Si + 6NaF
Na3PO4  +  NiSO4   =   Ni3(PO4)2  +  Na2SO42Na3PO4 + 3NiSO4 = Ni3(PO4)2 + 3Na2SO4
Na2SiF6  +  Na   =   Si  +  NaFNa2SiF6 + 4Na = Si + 6NaF
Na2SiF6  +  Na   =   Si  +  NaFNa2SiF6 + 4Na = Si + 6NaF
Na3PO4 + CuCl2 = Cu3 (PO4)2 + NaCl2Na3PO4 + 3CuCl2 = Cu3(PO4)2 + 6NaCl
NiCl2+Fe=Ni+FeCl2NiCl2 + Fe = Ni + FeCl2
NiCl2+Fe=Ni+FeCl2NiCl2 + Fe = Ni + FeCl2
NiCl2+Fe=Ni+FeCl2NiCl2 + Fe = Ni + FeCl2
NiCl2+Fe=Ni+FeCl2NiCl2 + Fe = Ni + FeCl2
NO2 + H2O = HNO3 + NO 3NO2 + H2O = 2HNO3 + NO
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4I (aq) + NaOH (aq) = NaI (aq) + NH4OH (g)NH4I(aq) + NaOH(aq) = NaI(aq) + NH4OH(g)
N2O4(l) + 2 N2H4(l)=3 N2(g) + 4 H2O(g)N2O4(l) + 2N2H4(l) = 3N2(g) + 4H2O(g)
Na + Fe2O3 =Na2O + Fe6Na + Fe2O3 = 3Na2O + 2Fe
NaCl + F2 = 2NaF + Cl22NaCl + F2 = 2NaF + Cl2
Na2CO3(aq)+CaCl2(aq)=CaCO3(s)+NaCl(aq)Na2CO3(aq) + CaCl2(aq) = CaCO3(s) + 2NaCl(aq)
N2O5 + O2 = NO22N2O5 - O2 = 4NO2
N+O=NON + O = NO
NH4ClO4+Al=AlCl3+Al2O3+H2O+N26NH4ClO4 + 10Al = 2AlCl3 + 4Al2O3 + 12H2O + 3N2
N2+H2=NH3N2 + 3H2 = 2NH3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3+MgI2=MgCO3 +NaINa2CO3 + MgI2 = MgCO3 + 2NaI
NO+(SO2)4=NO3 +SO2 0NO + (SO2)4 = 0NO3 + 4SO2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na3PO4(aq)+CuCl2(aq)=Cu3(PO4)2(s)+NaCl 2Na3PO4(aq) + 3CuCl2(aq) = Cu3(PO4)2(s) + 6NaCl
Na3PO4(aq)+NiCl2(aq)=Ni3(PO4)2(s)+NaCl 2Na3PO4(aq) + 3NiCl2(aq) = Ni3(PO4)2(s) + 6NaCl
Na3PO4 (aq)+MgSO4 (aq)=Na2SO4 (aq)+Mg3(PO4 )2 (aq)2Na3PO4(aq) + 3MgSO4(aq) = 3Na2SO4(aq) + Mg3(PO4)2(aq)
Na3PO4 + PbSO4 = Na2SO4 + Pb3(PO4)22Na3PO4 + 3PbSO4 = 3Na2SO4 + Pb3(PO4)2
NaNO3 + Ca3P2 = Na3P + Ca(NO3)26NaNO3 + Ca3P2 = 2Na3P + 3Ca(NO3)2
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3 +O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
Na3PO4 +HC1=NaC1+H3PO4Na3PO4 + 3HC1 = 3NaC1 + H3PO4
NH4Cl + Ba(OH)2 = NH3 +BaCl2 + H2O2NH4Cl + Ba(OH)2 = 2NH3 + BaCl2 + 2H2O
NaOH + (NH4)2 PO4 = Na2PO4 + H2O + NH32NaOH + (NH4)2PO4 = Na2PO4 + 2H2O + 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3(aq)+2HNO3(aq)=2NaNO3(aq)+CO2(g)+H2O(l)Na2CO3(aq) + 2HNO3(aq) = 2NaNO3(aq) + CO2(g) + H2O(l)
N2H4 + H2O2 = NO2 + H2ON2H4 + 6H2O2 = 2NO2 + 8H2O
N2H4 + H2O2 = NO2 + H205N2H4 + 10H2O2 = 10NO2 + 2H20
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaNO3 + KOH = KNO3 + NaOHNaNO3 + KOH = KNO3 + NaOH
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Nb + 5O2 = 2Nb2O54Nb + 5O2 = 2Nb2O5
NaClO3 + SO2 + H2SO4=ClO2 + 2NaHSO42NaClO3 + SO2 + H2SO4 = 2ClO2 + 2NaHSO4
NH3 + 6H2 = NH3NH3 + 0H2 = NH3
NaBH4 + H2SO4 = B2H6 + H2 + Na2SO42NaBH4 + H2SO4 = B2H6 + 2H2 + Na2SO4
N2O5 = 4NO2 + O22N2O5 = 4NO2 + O2
NH3 + 5O2 = 4NO + 6H2O4NH3 + 5O2 = 4NO + 6H2O
Ni2 + NaOH= 2NiOH+NaNi2 + 2NaOH = 2NiOH + 2Na
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + Cl2 = H2O + NaOCl + NaCl2NaOH + Cl2 = H2O + NaOCl + NaCl
NaOH + Cl2 = H2O + NaOCl + NaCl2NaOH + Cl2 = H2O + NaOCl + NaCl
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2 O4=2NO2 N2O4 = 2NO2
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na2SO4(l)+CO=Na2S+CO2Na2SO4(l) + 4CO = Na2S + 4CO2
Na2SO4(l)+CO=Na2S+CO2Na2SO4(l) + 4CO = Na2S + 4CO2
NaOH+CuCl2=NaCl+Cu(OH)22NaOH + CuCl2 = 2NaCl + Cu(OH)2
N2O = 2N2 + O22N2O = 2N2 + O2
NH4Cl+MgCO3=Cl2CO3+Mg(NH4)22NH4Cl + MgCO3 = Cl2CO3 + Mg(NH4)2
NaN 3 (s)=Na(s)+ N 2 (g)2NaN3(s) = 2Na(s) + 3N2(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3+O2(g)=NO+H2O(g)4NH3 + 5O2(g) = 4NO + 6H2O(g)
NH3+O2(g)=NO4+H2O(g)4NH3 + 11O2(g) = 4NO4 + 6H2O(g)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3 + O3 = NO + H2O 6NH3 + 5O3 = 6NO + 9H2O
Na3PO4 + Ba(OH)2 = Na3(OH)2 + BaPO4Na3PO4 + Ba(OH)2 = Na3(OH)2 + BaPO4
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3(g)+HBr(g)=NH4Br(s)NH3(g) + HBr(g) = NH4Br(s)
NH3(g) + CO2(g) + H2O(l) = NH4HCO3(aq)NH3(g) + CO2(g) + H2O(l) = NH4HCO3(aq)
NH3(g) + CO2(g) + H2O(l) = NH4HCO3(aq)NH3(g) + CO2(g) + H2O(l) = NH4HCO3(aq)
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NaHCO3=Na2CO3+H2O=CO22NaHCO3 = Na2CO3 + H2O + CO2
NO2(g) + H2O(l)= HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaOH(aq) + BaCl2(aq)= Ba(OH)2(s) + NaCl(aq)2NaOH(aq) + BaCl2(aq) = Ba(OH)2(s) + 2NaCl(aq)
NH4I(aq) + Cl2(g) = NH4Cl(aq) + I2(g)2NH4I(aq) + Cl2(g) = 2NH4Cl(aq) + I2(g)
Na2CO3+HCl=CO2+H2O+2NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2 O +2 HCl = 2NaCl + H2ONa2O + 2HCl = 2NaCl + H2O
Na2 O +2 HCl = 2NaCl + H2ONa2O + 2HCl = 2NaCl + H2O
Na2 O +2 HCl = 2NaCl + H2ONa2O + 2HCl = 2NaCl + H2O
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NHO3+P+H2O=H3PO4+NO5NHO3 + 3P + 2H2O = 3H3PO4 + 5NO
NH3+P+H2O=H3POH4+NONH3 + P + 2H2O = H3POH4 + NO
Na(s)+ O2(s) =Na2O4Na(s) + O2(s) = 2Na2O
NO (g) + H2 (g) = N2 (g) + H2O (l)2NO(g) + 2H2(g) = N2(g) + 2H2O(l)
NH3 (g) + O2 (g) = NO (g) + H2O (g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH4+ + OH-= NH3 + H2ONH4+ + OH- = NH3 + H2O
NH3 (g) + 2O2 (g) = NO (g)+ 3 H2O (l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
N 2 H 4 (l)+ O 2 (g)=N O 2 (g)+ H 2 O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NO2(g)+H2(g)=NH3(g)+H2O(l)2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(l)
Na2S(aq) + Cu(NO3)2(aq) = 2 NaNO3 + CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3 + CuS(s)
Na2SO4+Cu(NO3)2=Na(NO3)+CuSO4Na2SO4 + Cu(NO3)2 = 2Na(NO3) + CuSO4
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NH3+N2=N2H44NH3 + N2 = 3N2H4
N2H4+N2O4 = H2O+N22N2H4 + N2O4 = 4H2O + 3N2
N2H4+N2O4 = H2O+N22N2H4 + N2O4 = 4H2O + 3N2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHCO3(s)+H2SO4(aq)=NaSO4+H2O+HCO2NaHCO3(s) + H2SO4(aq) = NaSO4 + H2O + HCO2
Na2O + N2H8SO4 = Na2SO4 + H2O + NH3Na2O + N2H8SO4 = Na2SO4 + H2O + 2NH3
Na2O + N2H8SO4 = Na2SO4 + H2O + NH3Na2O + N2H8SO4 = Na2SO4 + H2O + 2NH3
Na +O2 = Na2O4Na + O2 = 2Na2O
N2 + 3 H2 = 2 NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Ni(NO3)2 + 2NH4OH = Ni(OH)2 + 2NH4NO3Ni(NO3)2 + 2NH4OH = Ni(OH)2 + 2NH4NO3
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
Na(s)+HCl(AQ)=NaCl(AQ)+H2(g)2Na(s) + 2HCl(AQ) = 2NaCl(AQ) + H2(g)
NaHCO3(aq) + HBr(aq) = NaBr(aq) + CO2(g) + H2O(l)NaHCO3(aq) + HBr(aq) = NaBr(aq) + CO2(g) + H2O(l)
NaHCO3(aq) + HBr(aq) = NaBr(aq) + CO2(g) + H2O(l)NaHCO3(aq) + HBr(aq) = NaBr(aq) + CO2(g) + H2O(l)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2O=NH3+NO5N2 + 6H2O = 4NH3 + 6NO
NaIO3 + N2H2 + HCl = N2 + NaICl2 + H2ONaIO3 + 2N2H2 + 2HCl = 2N2 + NaICl2 + 3H2O
NH4OH(aq)+Pb(NO3)2(aq)=Pb(OH)2(s)+NH4NO3(aq)2NH4OH(aq) + Pb(NO3)2(aq) = Pb(OH)2(s) + 2NH4NO3(aq)
NaI +B4C3 = Na4C +BI312NaI + B4C3 = 3Na4C + 4BI3
NaI +B4C3 = Na4C +BI312NaI + B4C3 = 3Na4C + 4BI3
NaI +B4C3 =Na4C +BI312NaI + B4C3 = 3Na4C + 4BI3
NaHCO3 + CuSO4 = Na2SO4 = Cu(HCO3)22NaHCO3 + CuSO4 = Na2SO4 + Cu(HCO3)2
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na + O2 = Na2O4Na + O2 = 2Na2O
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
N2H4 + H2O2 = N2 +H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 +CH3COOH = CH3COONa(aq) + H2CO3(l)NaHCO3 + CH3COOH = CH3COONa(aq) + H2CO3(l)
Na2SO4 + CACl2 = CASO4 + 2 NaClNa2SO4 + CACl2 = CASO4 + 2NaCl
NaF (aq) + H2SO4 (aq) = HF (aq) + Na2SO4 (aq)2NaF(aq) + H2SO4(aq) = 2HF(aq) + Na2SO4(aq)
N2+O2=N2O52N2 + 5O2 = 2N2O5
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHCO3 + C6H8O7 = CO2 + H2O + Na3C6H5O73NaHCO3 + C6H8O7 = 3CO2 + 3H2O + Na3C6H5O7
NaCL+Ag(C2H3O2)=Na(C2H3O2)+AgCLNaCL + Ag(C2H3O2) = Na(C2H3O2) + AgCL
N2+H2=NH3N2 + 3H2 = 2NH3
Na + Al+++ = Na+ + Al3Na + Al+++ = 3Na+ + Al
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2H4(l)+O2(g) =NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NH 3 + O 2 = NO 2 + H 2O 4NH3 + 7O2 = 4NO2 + 6H2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2O + H2O = NaOH Na2O + H2O = 2NaOH
NaH + Cl2 = NaCl + H22NaH + Cl2 = 2NaCl + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO+Cl2=NOCl2NO + Cl2 = 2NOCl
NO+C12=NOC112NO + C12 = 12NOC1
NaCl+Br2=Na+Br2ClNaCl + Br2 = Na + Br2Cl
NH3 + H2O = NH4OHNH3 + H2O = NH4OH
Na+Au2S=Au2+Na2S2Na + Au2S = Au2 + Na2S
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NH3+I2=N2I6+H22NH3 + 3I2 = N2I6 + 3H2
NH3(g)+O2(g)=NO2(g)+H2O(l) 4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(l)
NaOH(aq) + CH2(COOH)2(aq) = CH2(COO)2Na- + H3O+NaOH(aq) + CH2(COOH)2(aq) = CH2(COO)2Na- + H3O+
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
NaBr(s) + H2SO4(aq) = Na2SO4(aq) + SO2(g) + Br2(g) + H2O(l) 2NaBr(s) + 2H2SO4(aq) = Na2SO4(aq) + SO2(g) + Br2(g) + 2H2O(l)
NaBr(s) + H2SO4(aq) = Na2SO4(aq) + SO2(g) + Br2(g) + H2O(l) 2NaBr(s) + 2H2SO4(aq) = Na2SO4(aq) + SO2(g) + Br2(g) + 2H2O(l)
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na + H2O = H2 + Na+ + OH-2Na + 2H2O = H2 + 2Na+ + 2OH-
Na3PO4+ZnSO4=Na2SO4+Zn3(PO4)22Na3PO4 + 3ZnSO4 = 3Na2SO4 + Zn3(PO4)2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2S2O3+Cl2+H2O = NaHSO4 +HClNa2S2O3 + 4Cl2 + 5H2O = 2NaHSO4 + 8HCl
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
Na+H2O=Na++OH-+H22Na + 2H2O = 2Na+ + 2OH- + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO2+Ba(OH)2=NH4OH+Ba(NO2)22NH4NO2 + Ba(OH)2 = 2NH4OH + Ba(NO2)2
N2O+H2=NH4NO3+H2O-1N2O + 0H2 = -1NH4NO3 + 2H2O
NH4Cl+Ca(OH)2=CaCl2+NH4OH2NH4Cl + Ca(OH)2 = CaCl2 + 2NH4OH
NH3 + O2 = N2+ H2O4NH3 + 3O2 = 2N2 + 6H2O
NO2 + H20=HNO3 + NO 40NO2 + H20 = 20HNO3 + 20NO
NaCl +H2SO4=Na2SO4 + HCl 2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2SO3 + H3PO4 = H2SO3 + Na3PO43Na2SO3 + 2H3PO4 = 3H2SO3 + 2Na3PO4
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2H4+N2O=N2+H2ON2H4 + 2N2O = 3N2 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NaN3 = Na + N22NaN3 = 2Na + 3N2
NaOH(aq)+HCl(aq)=NaCl(aq)+H2O(l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
NaOH(aq)+HCl(aq)=NaCl(aq)+H2O(l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
NaIO3+SrCl2=NaCl2+SrIO3NaIO3 + SrCl2 = NaCl2 + SrIO3
Na2CO3+HNO3=CO2+NaNO3+H2ONa2CO3 + 2HNO3 = CO2 + 2NaNO3 + H2O
Na+6H2O=Na(H2O)6Na + 6H2O = Na(H2O)6
Na2O+H2O=HNaONa2O + H2O = 2HNaO
Na+O2=Na2O22Na + O2 = Na2O2
N2+H2=NH3N2 + 3H2 = 2NH3
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NH4OH + H2SO3 = (NH4)2SO3 +H2O2NH4OH + H2SO3 = (NH4)2SO3 + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4Cl(aq)+NaOH(aq) = H2O(l)+NH3(g)+NaCl(aq)NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq)
NH4Cl(aq)+NaOH(aq) = H2O(l)+NH3(g)+NaCl(aq)NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq)
NH4+ + OH-= NH3= H2ONH4+ + OH- = NH3 + H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NH4NO2= N2+2H2ONH4NO2 = N2 + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaI (aq) + H2SO4 (aq) =I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO3 +H3PO4= H2SO3 +Na3PO43Na2SO3 + 2H3PO4 = 3H2SO3 + 2Na3PO4
Ni(s) + HCl(aq)= NiCl2(aq) + H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
NH3 +O2= NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO(g)+CO(g)=N2(g)+CO2(g)2NO(g) + 2CO(g) = N2(g) + 2CO2(g)
Na2O2 + H2SO4 = Na2SO4 + H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2O2 + H2SO4 = Na2SO4 + H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2S2O3+I2=NaS4O6+NaI4Na2S2O3 + 3I2 = 2NaS4O6 + 6NaI
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3+H=NH4NH3 + H = NH4
N2 + O2 + H2O = HNO3 2N2 + 5O2 + 2H2O = 4HNO3
NaCl(s) + SO2(g) + H2O(l) + O2(g)=NaSO4(s) + HCl(g)4NaCl(s) + 4SO2(g) + 2H2O(l) + 3O2(g) = 4NaSO4(s) + 4HCl(g)
N2+O2=NON2 + O2 = 2NO
N2O=N2+O22N2O = 2N2 + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2O=N2+O22N2O = 2N2 + O2
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
NaH2PO4+NaOH=Na3PO4+H2ONaH2PO4 + 2NaOH = Na3PO4 + 2H2O
N2H4(l) = NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq) = NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g) + HCl (g) = NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
NiCl2*6H2O + 3Na2CO3 = NiCO3 + 2NaCl + H2ONiCl2*6H2O + Na2CO3 = NiCO3 + 2NaCl + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Ni(NO2)2 + Na2CO3 = NiCO3 + 2NaNO2Ni(NO2)2 + Na2CO3 = NiCO3 + 2NaNO2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+Cl2+NaOH=N2H2+NaCl+H2O2NH3 + 2Cl2 + 4NaOH = N2H2 + 4NaCl + 4H2O
Na3PO4+Ba(NO3)2=Ba3(PO4)2+NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
NaNO3+CaCl2=Ca(NO3)2+NaCl2NaNO3 + CaCl2 = Ca(NO3)2 + 2NaCl
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NH3(g)+HCl(g)=NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
N2+H2=NH3N2 + 3H2 = 2NH3
NaBrO3(aq) + NaBr(aq) + H2SO4(aq) =Br2(aq) +Na2SO4(aq) +H2O(l)NaBrO3(aq) + 5NaBr(aq) + 3H2SO4(aq) = 3Br2(aq) + 3Na2SO4(aq) + 3H2O(l)
NaOCl(aq) + NaCl(aq) + H2SO4(aq) =Cl2(aq) +Na2SO4(aq) +H2O(l)NaOCl(aq) + NaCl(aq) + H2SO4(aq) = Cl2(aq) + Na2SO4(aq) + H2O(l)
Na2CO3+Na2S=NaS+NaCO3Na2CO3 - Na2S = -1NaS + NaCO3
NH3 + O2 = N2 +H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+I2=N2I6+H22NH3 + 3I2 = N2I6 + 3H2
NaNO3 + H2O = NaOH + HNO3NaNO3 + H2O = NaOH + HNO3
NaNO3 + H2O = NaOH + HNO3NaNO3 + H2O = NaOH + HNO3
NH3=N2+H22NH3 = N2 + 3H2
Na + H2O = NaOH + H 22Na + 2H2O = 2NaOH + H2
N2 + F2 = NF3N2 + 3F2 = 2NF3
NaHCO3 + HNO3 = NaNO3 + CO2 + H2ONaHCO3 + HNO3 = NaNO3 + CO2 + H2O
Na+HC1=H2+NaC12Na + 2HC1 = H2 + 2NaC1
Na+HC1=H2+NaC12Na + 2HC1 = H2 + 2NaC1
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2O5 = NO2 + O2 2N2O5 = 4NO2 + O2
NO + O2 = NO22NO + O2 = 2NO2
Na+O2=Na2O4Na + O2 = 2Na2O
NaC1=Na+C1212NaC1 = 12Na + C12
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na2CO3 + Ca(OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2 =HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NH4OH + FeCl3 = Fe(OH)3 + NH4Cl3NH4OH + FeCl3 = Fe(OH)3 + 3NH4Cl
N2 + O2 = NO2N2 + 2O2 = 2NO2
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N + O2 = NO32N + 3O2 = 2NO3
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
Na2S + H2S = NaSHNa2S + H2S = 2NaSH
N2H4 + Cl2 = N2 + HClN2H4 + 2Cl2 = N2 + 4HCl
NaOH + H3 PO4 = Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na+S=Na2S2Na + S = Na2S
Na+S=Na2S2Na + S = Na2S
Na+S=Na2S2Na + S = Na2S
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NaNO2+HCl=NaCl+HNO2NaNO2 + HCl = NaCl + HNO2
NaNO2+ NH4Cl= NaCl+ NH4NO2NaNO2 + NH4Cl = NaCl + NH4NO2
Na3PO4+CoCl2=Co3(PO4)2+NaCl2Na3PO4 + 3CoCl2 = Co3(PO4)2 + 6NaCl
Na+H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O= NaOH=H22Na + 2H2O = 2NaOH + H2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + H2SO4 = Na2SO4 + CO2 + H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NO2+H2O= HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O= HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3(g)+Cl2(g)=N2H4(l)+NH4Cl(s)4NH3(g) + Cl2(g) = N2H4(l) + 2NH4Cl(s)
NH3 +Br2 =NH4+ +Br-+N28NH3 + 3Br2 = 6NH4+ + 6Br- + N2
NH3(g)+O2(g)=N2O4(g)+H2O(g)4NH3(g) + 7O2(g) = 2N2O4(g) + 6H2O(g)
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
Na2O2+NO3=NaNO3+O2Na2O2 + 2NO3 = 2NaNO3 + O2
NaCN + Sr(OH)2=NaOH + Sr(CN)22NaCN + Sr(OH)2 = 2NaOH + Sr(CN)2
N2H4+O2=NO2+H2ON2H4 + 3O2 = 2NO2 + 2H2O
NaCl (aq) + Pb(CH3COO)2 (aq) = 2 Na(CH3COO) (aq) + PbCl2 (s) 2NaCl(aq) + Pb(CH3COO)2(aq) = 2Na(CH3COO)(aq) + PbCl2(s)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH3(l)+O2(g) = 2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NCl3+H2O=NH3+ HOClNCl3 + 3H2O = NH3 + 3HOCl
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2H4 + N2O3= N2 +H2O3N2H4 + 2N2O3 = 5N2 + 6H2O
Na2S (aq)+ Cu(NO3)2 (aq) =NaNO3 (aq) = CuS (s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NH3 + I2 = NI2 + H22NH3 + 2I2 = 2NI2 + 3H2
NaHCO3 +HCl= NaCl+CO2+H2ONaHCO3 + HCl = NaCl + CO2 + H2O
NO2(g)+H2O(l)=HNO3(aq)=NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaNO2(aq)+HCl(aq)=NaCl(aq)+HNO2(aq)NaNO2(aq) + HCl(aq) = NaCl(aq) + HNO2(aq)
NH3 = H2 + N22NH3 = 3H2 + N2
NO2 +H20=HNO3 + NO40NO2 + H20 = 20HNO3 + 20NO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.