Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaOH+MgNO3=NaNO3+MgOHNaOH + MgNO3 = NaNO3 + MgOH
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na(OH) + HI = NaI + H2ONa(OH) + HI = NaI + H2O
NH4NO2 =N2 + H2ONH4NO2 = N2 + 2H2O
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3 + H2SO4 = Na2SO4 + CO2 + H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na+ Cl2 = NaCl2Na + Cl2 = 2NaCl
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2(g)+ 3Cl2(g)= 2NCl3(g) N2(g) + 3Cl2(g) = 2NCl3(g)
Na+O2=NaO2Na + O2 = NaO2
Na(OH) + Pb (No3)2 = Na( No3) + Pb(OH)22Na(OH) + Pb(No3)2 = 2Na(No3) + Pb(OH)2
NaClO3 +K2SnO2 = NaCl + K2SnO3NaClO3 + 3K2SnO2 = NaCl + 3K2SnO3
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NH4CH3COO+AgNO3=NH4NO3+AgCH3COONH4CH3COO + AgNO3 = NH4NO3 + AgCH3COO
NH3 + H2O + Cu(NO3)2 = NH4NO3 + Cu(OH)22NH3 + 2H2O + Cu(NO3)2 = 2NH4NO3 + Cu(OH)2
NH3 + O = NO2 + H2O2NH3 + 7O = 2NO2 + 3H2O
NaClO3 + K2SnO2= NaCl+ K2SnO3NaClO3 + 3K2SnO2 = NaCl + 3K2SnO3
NaClO3 + K2SnO2= NaCl+ K2SnO3NaClO3 + 3K2SnO2 = NaCl + 3K2SnO3
NH4ClO4+Pb3(N)2=NH4Pb3+ClO4(N)2NH4ClO4 + Pb3(N)2 = NH4Pb3 + ClO4(N)2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N + H2 = NH32N + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2H4+N2O4= N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaH+CO3 = Na2CO3 + H2O + CO22NaH + 2CO3 = Na2CO3 + H2O + CO2
Na+HOH=NaOH+H22Na + 2HOH = 2NaOH + H2
Ni(s) + FeCl2(aq) = NiCl2(aq) + Fe(s)Ni(s) + FeCl2(aq) = NiCl2(aq) + Fe(s)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na+O2=Na2O4Na + O2 = 2Na2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2+F2=NF3N2 + 3F2 = 2NF3
NaOH+Ca(NO3)2=NaNO3+Ca(OH)22NaOH + Ca(NO3)2 = 2NaNO3 + Ca(OH)2
N2+F2=NF3N2 + 3F2 = 2NF3
NaOH+Ca(NO3)2=NaNO3+Ca(OH)22NaOH + Ca(NO3)2 = 2NaNO3 + Ca(OH)2
N2 + H2 =NH3N2 + 3H2 = 2NH3
Na+3H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaH+CO3 = Na2CO3 + H2O + CO22NaH + 2CO3 = Na2CO3 + H2O + CO2
NH3+ Cl2= NH4Cl+ N28NH3 + 3Cl2 = 6NH4Cl + N2
NH3+ Cl2= NH4Cl+ N28NH3 + 3Cl2 = 6NH4Cl + N2
N2O + O2 = NO22N2O + 3O2 = 4NO2
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaBr + Ca(OH)2 = CaBr2 + NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NaClO + HCl = NaCl + H2O + Cl2NaClO + 2HCl = NaCl + H2O + Cl2
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NH3(g)+NO(g) = N2(g)+H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
N2 +2O2 = 2NO2N2 + 2O2 = 2NO2
NH3+NO = N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
NH3(g) + NO(g) = N2(g) + H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
N2+H2=NH3N2 + 3H2 = 2NH3
Ni(NO3)2+NH4OH=Ni(OH)2+NH4(NO3)Ni(NO3)2 + 2NH4OH = Ni(OH)2 + 2NH4(NO3)
Na3(PO4)+CaCl2=Ca3(PO4)2+NaCl2Na3(PO4) + 3CaCl2 = Ca3(PO4)2 + 6NaCl
Na2CO3 + FeCl3 = Fe2(CO3)3 + NaCl3Na2CO3 + 2FeCl3 = Fe2(CO3)3 + 6NaCl
Na2S + Ni(NO3)2 = NiS + NaNO3Na2S + Ni(NO3)2 = NiS + 2NaNO3
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na2CO3(s) + HNO3 = NaNO3 + CO2 + H2O Na2CO3(s) + 2HNO3 = 2NaNO3 + CO2 + H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO3 + CaCl2 = NaCl2 + Ca NO3NaNO3 + CaCl2 = NaCl2 + CaNO3
NaNO3 + CaCl2 = NaCl2 + Ca (NO3)NaNO3 + CaCl2 = NaCl2 + Ca(NO3)
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na AsO4 + Ag NO3 = Na NO3 + Ag AsO4NaAsO4 + AgNO3 = NaNO3 + AgAsO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NH3+H3PO4=(NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NH3+H3PO4=(NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4+Pb(NO3)2=NaNO3+PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NH4OH + H2CO3 = H2O + (NH4)2CO32NH4OH + H2CO3 = 2H2O + (NH4)2CO3
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
Na2(CO3) + Ba(NO3)2 = Ba2(CO3)2 + Na(NO3)2Na2(CO3) + 2Ba(NO3)2 = Ba2(CO3)2 + 4Na(NO3)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH + H2 = Na + H2O2NaOH + H2 = 2Na + 2H2O
Na2O+CuCl2=2NaCl+CuONa2O + CuCl2 = 2NaCl + CuO
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+O2=Na2O22Na + O2 = Na2O2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NaOH + CuSO4 = NaSO4 + CuOHNaOH + CuSO4 = NaSO4 + CuOH
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na(OH) + Ca(NO3)2 = Ca(OH)2 + Na(NO3)2Na(OH) + Ca(NO3)2 = Ca(OH)2 + 2Na(NO3)
Ni(s)+AgNO3(aq)=Ni(NO3)2(aq)+Ag(s)Ni(s) + 2AgNO3(aq) = Ni(NO3)2(aq) + 2Ag(s)
NH4OH=NH3+H2ONH4OH = NH3 + H2O
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na(OH) + Ba(NO3)2 = Ba(OH)2 + Na(NO3)2Na(OH) + Ba(NO3)2 = Ba(OH)2 + 2Na(NO3)
Na2CO3 + FeCl = NaCl + Fe2CO3Na2CO3 + 2FeCl = 2NaCl + Fe2CO3
NaOH+Ca(OH)2+C+ClO2=NaClO2+CaCO3+H2O4NaOH + Ca(OH)2 + C + 4ClO2 = 4NaClO2 + CaCO3 + 3H2O
NaCl +H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2O3 + H2O = HNO2N2O3 + H2O = 2HNO2
N2O3 + H2O = HNO2N2O3 + H2O = 2HNO2
NH3+O2=N2O4+H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
N2+O2=N2O2N2 + O2 = 2N2O
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NiCl3+KOH=Ni(OH)3+KClNiCl3 + 3KOH = Ni(OH)3 + 3KCl
N2(g) + I2(s) = NI3(s)N2(g) + 3I2(s) = 2NI3(s)
NaN3=Na+N22NaN3 = 2Na + 3N2
NaN3=Na=N22NaN3 = 2Na + 3N2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2SO4 + CaCl2 = CaSO4 + NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaCl=Na+Cl22NaCl = 2Na + Cl2
NaCN+H2SO4=HCN+Na2SO42NaCN + H2SO4 = 2HCN + Na2SO4
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
N2 + H2O= NH3 + O22N2 + 6H2O = 4NH3 + 3O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH + FeCl3 = NaCl + Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+O=NaONa + O = NaO
Na3PO4+TiBr2=NaBr+Ti3(PO4)22Na3PO4 + 3TiBr2 = 6NaBr + Ti3(PO4)2
Ni(s)+CO(g)=Ni(CO)4(g)Ni(s) + 4CO(g) = Ni(CO)4(g)
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + O2 = Na2O4Na + O2 = 2Na2O
NaOH + H2(CO3) = Na2(CO3) + H2O2NaOH + H2(CO3) = Na2(CO3) + 2H2O
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na + O2 = Na2O22Na + O2 = Na2O2
NI3(s) = N2(g) + I2(s)2NI3(s) = N2(g) + 3I2(s)
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
Ni(s) + CO(g) = Ni(CO)4 Ni(s) + 4CO(g) = Ni(CO)4
Na+ZnI2=NaI+Zn2Na + ZnI2 = 2NaI + Zn
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni+S=NiSNi + S = NiS
Na+H2O=NaOH=H22Na + 2H2O = 2NaOH + H2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3(g) + NO(g) =N2(g) + H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NaOH= Na2O+H2O 2NaOH = Na2O + H2O
NaOH= Na2O+H2O 2NaOH = Na2O + H2O
NaHCO3=(Na)2O+CO2+H2O2NaHCO3 = (Na)2O + 2CO2 + H2O
NaHCO3=(Na)2CO3+CO2+H2O2NaHCO3 = (Na)2CO3 + CO2 + H2O
NaHCO3=NaCO3+CO2+H2020NaHCO3 = 20NaCO3 + 0CO2 + H20
Na+H2O=Na(OH)+H22Na + 2H2O = 2Na(OH) + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO+O2=NO22NO + O2 = 2NO2
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaNO3+PbO= Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH3(g)+NO(g)=N2(g)+H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NH3(g) + NO(g) = N2(g) + H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
Na2CO3 + HCl = NaCl + H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3+ H2So4= CO2 +Na2 + H2So40Na2CO3 + H2So4 = 0CO2 + 0Na2 + H2So4
NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2
NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2NaHCO3 + HC2H3O2 = CO2 + H2O + NaC2H3O2
NaHCO3 + CH3COOH = CH3COONa + H2O + CO2NaHCO3 + CH3COOH = CH3COONa + H2O + CO2
NH3(g)+ NO(g)=N2(g) +H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NiSO4+Ca(NO3)2=CaSO4+Ni(NO3)2NiSO4 + Ca(NO3)2 = CaSO4 + Ni(NO3)2
NaNO3 = 2NaNO2+O22NaNO3 = 2NaNO2 + O2
NH4Br + CaCO3 = CaBr2 + CO2 + (NH4)2O2NH4Br + CaCO3 = CaBr2 + CO2 + (NH4)2O
Na+I2=NaI2Na + I2 = 2NaI
Na2Si6+NaF=Si+NaF0Na2Si6 + NaF = 0Si + NaF
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NH3+CuO=N2+Cu+H2O2NH3 + 3CuO = N2 + 3Cu + 3H2O
Na3PO4+HCl=NaCl+H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
Ni(ClO3)2=NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
NaClO3 = NaCl+O22NaClO3 = 2NaCl + 3O2
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
N2+O2=N2O2N2 + O2 = 2N2O
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
Na2S2O3+I2=Na2S4O6+NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
Na2S2O3+I2=Na2S4O6+NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
NH3+NO2=N2O=H2O6NH3 + 8NO2 = 7N2O + 9H2O
NO+Cl2=NOCl2NO + Cl2 = 2NOCl
NO+Cl2=NOCl2NO + Cl2 = 2NOCl
Na2SO3+S8=Na2S2O38Na2SO3 + S8 = 8Na2S2O3
Na2O=Na+ONa2O = 2Na + O
N2O4+N2H4=N2+H2ON2O4 + 2N2H4 = 3N2 + 4H2O
Na2SO3+S8=Na2S2O38Na2SO3 + S8 = 8Na2S2O3
Na+F2=NaF2Na + F2 = 2NaF
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NO+O2=NO22NO + O2 = 2NO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl + ClO2 = NaClO2 + Cl22NaCl + 2ClO2 = 2NaClO2 + Cl2
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2S2O3+I2=Na2S4O6+NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
NO+Cl2=NOCl2NO + Cl2 = 2NOCl
NaCl + ClO2 = NaClO2 + Cl22NaCl + 2ClO2 = 2NaClO2 + Cl2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO3+S8=Na2S2O38Na2SO3 + S8 = 8Na2S2O3
N2H4+O2=NO2+H2ON2H4 + 3O2 = 2NO2 + 2H2O
Na+Cl=NaClNa + Cl = NaCl
NH3(g)+NO(g) = N2(g) + H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaOH+SO2=Na2SO3+H2O2NaOH + SO2 = Na2SO3 + H2O
NH4OH + FeCl3 = NH4Cl + Fe(OH)33NH4OH + FeCl3 = 3NH4Cl + Fe(OH)3
Na2CO3 + CaCl2 = CaCO3 + NaClNa2CO3 + CaCl2 = CaCO3 + 2NaCl
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
Na3PO4 + BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
NaOH + CuSO4 = Na2SO4 + Cu(OH)22NaOH + CuSO4 = Na2SO4 + Cu(OH)2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2H3CH + N2O4= H2O + N2 + CO2N2H3CH + N2O4 = 2H2O + 2N2 + CO2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NA- + H2O = NAOH- + H2O0NA- + H2O = 0NAOH- + H2O
NH4 + H2O = NH4OH + HNH4 + H2O = NH4OH + H
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3 + HCl = Na2Cl + HCO3Na2CO3 + HCl = Na2Cl + HCO3
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2C2O4+KMnO4+H2SO4=K2SO4+MnSO4+Na2SO4+CO2+H2O5Na2C2O4 + 2KMnO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 10CO2 + 8H2O
N2+3H2=2NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaI+Pb(SO4)2=PbI4+Na2(SO4)4NaI + Pb(SO4)2 = PbI4 + 2Na2(SO4)
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NH3(g)+NO(g)=N2(g) + H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NH3(g)+NO(g)=N2(g) + H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NH3(g)+NO(g)=N2(g) + H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
N2(g)+O2(g) = N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
NaOH+FeSO4=Na2SO4+Fe(OH)22NaOH + FeSO4 = Na2SO4 + Fe(OH)2
NH3+O2=HNO3+H2ONH3 + 2O2 = HNO3 + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2SO4=Na2SO4+H22Na + H2SO4 = Na2SO4 + H2
Na+H2SO4=Na2SO4+H22Na + H2SO4 = Na2SO4 + H2
Na2CO3 + HCl = Na2Cl + CO3HNa2CO3 + HCl = Na2Cl + CO3H
NO + CO = N +CO2NO + CO = N + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NH + H2O2NH3 + O2 = 2NH + 2H2O
NH3 + H2SO4 = (NH4)02SO42NH3 + H2SO4 = (NH4)02SO4
NH3 + H2SO4 = (NH4)02SO42NH3 + H2SO4 = (NH4)02SO4
NaCl + H2So4 = HCl + (Na2So4)24NaCl + 2H2So4 = 4HCl + (Na2So4)2
No2+H2O=HNo3+H2O0No2 + H2O = 0HNo3 + H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaHCO3 + HNO3 = NaNO3 + H2O CO2NaHCO3 + HNO3 = NaNO3 + H2OCO2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NF3=N2+F22NF3 = N2 + 3F2
NO3- + Sn++ +H+=NO2 + Sn++++ + H2O2NO3- + Sn++ + 4H+ = 2NO2 + Sn++++ + 2H2O
NO3- + Sn++ +H2O=NO2 + Sn++++ + H2-2NO3- + Sn++ + 2H2O = -2NO2 + Sn++++ + 2H2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + F2 = NaF2Na + F2 = 2NaF
NH3=N2+H22NH3 = N2 + 3H2
NH4Cl + Ba(OH)2 = NH3 + BaCl2 + H2O2NH4Cl + Ba(OH)2 = 2NH3 + BaCl2 + 2H2O
N2 + O2 = NO N2 + O2 = 2NO
N + H = NH3N + 3H = NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N + H = NH3N + 3H = NH3
N + H = NH3N + 3H = NH3
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaNO3 = NaNO2 +O22NaNO3 = 2NaNO2 + O2
Na3PO4+FeCl3=NaCl+FePO4Na3PO4 + FeCl3 = 3NaCl + FePO4
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
NaAlSi3O8 + H2O +CO2 = Al2Si2O5(OH)4 + Na +HCO3 +H4SiO42NaAlSi3O8 + 11H2O + 2CO2 = Al2Si2O5(OH)4 + 2Na + 2HCO3 + 4H4SiO4
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na2S2O3 + 2 CH3COOH = H2S2O3 + 2 NaCH3COONa2S2O3 + 2CH3COOH = H2S2O3 + 2NaCH3COO
N2+H2=NH3N2 + 3H2 = 2NH3
NaBr+AgNO3=AgBr+NaNO3NaBr + AgNO3 = AgBr + NaNO3
NaHCO3(aq) + C2H4O2(aq) = CH3COONa(s) + H2O(l) + CO2(g)NaHCO3(aq) + C2H4O2(aq) = CH3COONa(s) + H2O(l) + CO2(g)
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+F2=NF3N2 + 3F2 = 2NF3
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + Cl2 = NH4Cl + NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
NaHCO3=CO2+H2O+Na2CO32NaHCO3 = CO2 + H2O + Na2CO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NH4NO3+H2O=NH4 +NO3NH4NO3 + 0H2O = NH4 + NO3
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
NO+O2=NO22NO + O2 = 2NO2
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NO2 + H2O= HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O= HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na2Cr2O7 + HCl = NaCl + CrCl3 + Cl2 + H2ONa2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 3Cl2 + 7H2O
Na+S=NaSNa + S = NaS
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + H2SO4 = Na2SO4 + H2O 2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2CO3 + HCl = NaCl + H2O +CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NO2 + H2O= HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + H2O = Na(OH) + O2-4Na - 2H2O = -4Na(OH) + O2
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na+O2=Na2O4Na + O2 = 2Na2O
Na2 CO3 + BaNO3 = NaNO3 + Ba2 CO3Na2CO3 + 2BaNO3 = 2NaNO3 + Ba2CO3
NH4NO3+Na3PO4=(NH4)3PO4+NaNO33NH4NO3 + Na3PO4 = (NH4)3PO4 + 3NaNO3
NH4NO3+Na3PO4=(NH4)3PO4+NaNO33NH4NO3 + Na3PO4 = (NH4)3PO4 + 3NaNO3
NaCO3 + BaNO3 = NaNO3 + BaCO3NaCO3 + BaNO3 = NaNO3 + BaCO3
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na3PO4 + CaCl2 = NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
NO3 + H = NO + H2ONO3 + 4H = NO + 2H2O
Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
Na2SO3+HCl=NaCl+H2O+SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NO3 + H = NO + H2ONO3 + 4H = NO + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2O = N2H4 + OHN2 + 4H2O = N2H4 + 4OH
Na+O2=Na2O4Na + O2 = 2Na2O
N2 + H2O = N2H4 + OHN2 + 4H2O = N2H4 + 4OH
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaOH+SO2=Na2SO3+H2O2NaOH + SO2 = Na2SO3 + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + Cl = NaClNa + Cl = NaCl
Na3N = Na + NNa3N = 3Na + N
NaOH+MgSO4=Mg(OH)2+Na2SO42NaOH + MgSO4 = Mg(OH)2 + Na2SO4
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NO = N2O + NO23NO = N2O + NO2
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2S + AgF = NaF + Ag2SNa2S + 2AgF = 2NaF + Ag2S
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaNO3+ PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na + Br2 = Na Br2Na + Br2 = 2NaBr
NaNO3+ PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3+ PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na2CO3 + Zn(NO3)2 = ZnCO3 + Na2(NO3)2Na2CO3 + Zn(NO3)2 = ZnCO3 + Na2(NO3)2
Na2CO3+Zn(NO3)2=ZnCO3+Na2(NO3)2Na2CO3 + Zn(NO3)2 = ZnCO3 + Na2(NO3)2
Ni(ClO3)2=NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
NH4NO3=N2O+2H2ONH4NO3 = N2O + 2H2O
NH4NO3=N2O+2H2ONH4NO3 = N2O + 2H2O
N2H2+H2O= N2+2H2O0N2H2 + H2O = 0N2 + H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na3PO4(aq) + MgCl2(aq) = NaCl(aq) +Mg3(PO4)2(s)2Na3PO4(aq) + 3MgCl2(aq) = 6NaCl(aq) + Mg3(PO4)2(s)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(OH)2+KOH=K2NiO2+H2ONi(OH)2 + 2KOH = K2NiO2 + 2H2O
NiO+NaOH=Na2NiO2+H2ONiO + 2NaOH = Na2NiO2 + H2O
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH4OH+AlCl3=Al(OH)3+NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2Cr2O7 + FeCl2+HCl = CrCl3+ FeCl3 + NaCl+H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
Na3PO4 + CaCl2 = Ca3(PO4)2 + NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
NH3 = N2 + H22NH3 = N2 + 3H2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaCl+H2SO4=Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na+H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3(g)+NO(g)=N2(g)+H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na2CO3+2HCl=2NaCl+H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
NaL + Pb(SO4)2 = PbL4 + Na2SO44NaL + Pb(SO4)2 = PbL4 + 2Na2SO4
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na(s) + H2O(l) = H2(g) + NaOH(aq)2Na(s) + 2H2O(l) = H2(g) + 2NaOH(aq)
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2H2 + O2 = H2O + N22N2H2 + O2 = 2H2O + 2N2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
NO2+O2 = N2O54NO2 + O2 = 2N2O5
N2+H2=NH3N2 + 3H2 = 2NH3
Na+O2=Na2O4Na + O2 = 2Na2O
NO3 + H2O = NO2 + OHNO3 + H2O = NO2 + 2OH
N2 + Cr2O3 + H2O= (NH4)2Cr2O7N2 + Cr2O3 + 4H2O = (NH4)2Cr2O7
NaI + Cl2 = I2 + NaCl2NaI + Cl2 = I2 + 2NaCl
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaHCO3=Na2O+CO2+H2O2NaHCO3 = Na2O + 2CO2 + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2(So4)+CaCl2=CaSo4+NaClNa2(So4) + CaCl2 = CaSo4 + 2NaCl
Na+O2=Na2O4Na + O2 = 2Na2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
N2+Br2 = NBr3N2 + 3Br2 = 2NBr3
NaBr + Cl2 = NaCl+ Br22NaBr + Cl2 = 2NaCl + Br2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaCIO3 = NaCI + O22NaCIO3 = 2NaCI + 3O2
NaOH+H2 So4 =Na2 So4+H2O2NaOH + H2So4 = Na2So4 + 2H2O
NaOH+H2 So4 =Na2 So4+H2O2NaOH + H2So4 = Na2So4 + 2H2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
N2O4 = NO2N2O4 = 2NO2
NH3(g)+NO(g)=N2(g)+H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
NaOH+NH4Cl=NH3+NaCl+H2ONaOH + NH4Cl = NH3 + NaCl + H2O
NaOH+HCl=H2O +NaClNaOH + HCl = H2O + NaCl
NaNO3+AgNO3=NaNO+AgNO-1NaNO3 + AgNO3 = -1NaNO + AgNO
NaNO3+FeNO3=NaNO+FeNO-1NaNO3 + FeNO3 = -1NaNO + FeNO
Na2Cr2O7 + HCl =NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na2Cr2O7+HCl=NaCl+CrCl3+H2O+Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na2O(s)+HCl(aq)=NaCl(aq)+H2O(l)Na2O(s) + 2HCl(aq) = 2NaCl(aq) + H2O(l)
Na2CO3 + Mg(CIO4)2 = Na(CIO4) + MgCO3Na2CO3 + Mg(CIO4)2 = 2Na(CIO4) + MgCO3
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH4HCO3+HNO3=NH4NO3+H2O+CO2NH4HCO3 + HNO3 = NH4NO3 + H2O + CO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaOH + Cl2 = NaCl + NaClO3 + H2O6NaOH + 3Cl2 = 5NaCl + NaClO3 + 3H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Ni + Cl2 = Ni Cl2Ni + Cl2 = NiCl2
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaIO3 = NaI + O22NaIO3 = 2NaI + 3O2
Na + O2 = Na2O4Na + O2 = 2Na2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 = H2 + N22NH3 = 3H2 + N2
NO3 + H2O = NO2 + OHNO3 + H2O = NO2 + 2OH
NaHCO3 + C8H8O3 = Na2CO3 + CO2 + H2O2NaHCO3 + 0C8H8O3 = Na2CO3 + CO2 + H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaN + PbO = NaO + PbNNaN + PbO = NaO + PbN
NaN + Pb2O = NaO + Pb2NNaN + Pb2O = NaO + Pb2N
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2CO3 + Mg(NO3)2 = MgCO3 + NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Ni(NO3)2 (aq) + NaOH (aq)=NiOH (s) + Na(NO3)2(aq)Ni(NO3)2(aq) + NaOH(aq) = NiOH(s) + Na(NO3)2(aq)
N2 + H2O = N2H4 + OHN2 + 4H2O = N2H4 + 4OH
N2O5 + H2O= HNO3N2O5 + H2O = 2HNO3
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaHCO3 =Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NO + H2O = HNO3 + HNO + 2H2O = HNO3 + 3H
N2+H2=NH3N2 + 3H2 = 2NH3
NO3 + H = NO2 + H2ONO3 + 2H = NO2 + H2O
NH3NO2=N2+H2+O22NH3NO2 = 2N2 + 3H2 + 2O2
Na3PO4+HCI=NaCI+H3PO4Na3PO4 + 3HCI = 3NaCI + H3PO4
NO + CH4 = HCN + H2O + H22NO + 2CH4 = 2HCN + 2H2O + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO3 + H = NO2 + H2ONO3 + 2H = NO2 + H2O
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NO3 + H = NO2 + H2ONO3 + 2H = NO2 + H2O
Na +H2O = NaOH +H2 2Na + 2H2O = 2NaOH + H2
Na +H2O = NaOH +H2 2Na + 2H2O = 2NaOH + H2
NH3 + HNO3=NH4 + NO3NH3 + HNO3 = NH4 + NO3
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
Na2CO3+AlCl3=NaCl+Al2(CO3)33Na2CO3 + 2AlCl3 = 6NaCl + Al2(CO3)3
NO + H2O = NO3 + HNO + 2H2O = NO3 + 4H
N2H4 + OH = N2 + H2ON2H4 + 4OH = N2 + 4H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.