Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaClO2 + HOCl = ClO2 + NaCl + NaOH2NaClO2 + HOCl = 2ClO2 + NaCl + NaOH
NaClO2 + HOCl = ClO2 + NaCl + NaOH(aq)2NaClO2 + HOCl = 2ClO2 + NaCl + NaOH(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl=Na+Cl22NaCl = 2Na + Cl2
NaHCO3 + H3C6H5O7 = CO2 +H2O +Na3C6H5O73NaHCO3 + H3C6H5O7 = 3CO2 + 3H2O + Na3C6H5O7
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Nb+ Cl=NbCl5Nb + 5Cl = NbCl5
Nb+ Cl=NbCl5Nb + 5Cl = NbCl5
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na3PO4+ KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
Na2CO3 + MgCl2 = NaCl + MgCO3Na2CO3 + MgCl2 = 2NaCl + MgCO3
Na + HCl = H2 + NaCl2Na + 2HCl = H2 + 2NaCl
NO + O2 = NO22NO + O2 = 2NO2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na3PO4+Ba(NO3)2=NaNO3+Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
NaCl = 2Na + Cl22NaCl = 2Na + Cl2
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
Na + MgF2 = 2NaF + Mg2Na + MgF2 = 2NaF + Mg
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
NaCl=Na+Cl22NaCl = 2Na + Cl2
Na+HCl=NaCl+H22Na + 2HCl = 2NaCl + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + O2 = NaO2Na + O2 = NaO2
Na + O2 = NaO2Na + O2 = NaO2
NH4NO3=H2O+N2ONH4NO3 = 2H2O + N2O
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na3PO4 + Ba(NO3)2=Ba3(PO4)2 + NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
NaCl + H2SO4 = NaHSO4 + HClNaCl + H2SO4 = NaHSO4 + HCl
Na3PO4 + Sr(NO3)2 = Na3(NO3) + Sr(PO4)22Na3PO4 + Sr(NO3)2 = 2Na3(NO3) + Sr(PO4)2
NaBr (aq) + H2SO4 (aq) = Br2 (l) + SO2 (g) + H2O (l) + Na2SO4 (aq)2NaBr(aq) + 2H2SO4(aq) = Br2(l) + SO2(g) + 2H2O(l) + Na2SO4(aq)
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+NO = N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
NaF (aq) + H2SO4 (aq) = HF (aq) + Na2SO4 (aq)2NaF(aq) + H2SO4(aq) = 2HF(aq) + Na2SO4(aq)
NaOH+H2SO4=NaSO4+H2O+HNaOH + H2SO4 = NaSO4 + H2O + H
N2O=N2+O22N2O = 2N2 + O2
NaOH+NaNO2+Al+H2O = NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
NaOH+NaNO2+Al(s)+H2O = NH3+NaAlO2NaOH + NaNO2 + 2Al(s) + H2O = NH3 + 2NaAlO2
Na2CO3(aq) + NiCl2(aq) = Na2Cl2(aq) + NiCO3(s)Na2CO3(aq) + NiCl2(aq) = Na2Cl2(aq) + NiCO3(s)
Na2CO3(aq) + NiCl2(aq) = Na2Cl2(aq) + NiCO3(s)Na2CO3(aq) + NiCl2(aq) = Na2Cl2(aq) + NiCO3(s)
NaBH4 + BF3 = NaBF4 + B2H63NaBH4 + 4BF3 = 3NaBF4 + 2B2H6
NaBH4 + BF3 = NaBF4 + B2H63NaBH4 + 4BF3 = 3NaBF4 + 2B2H6
NaCN+CuCO3=Na2CO3+Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
Na + H2O = NaOH +O2-4Na - 2H2O = -4NaOH + O2
NaCN+CuCO3=Na2CO3+Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
NH3+O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
N2O4 + H2O2 = HNO4 + H2ON2O4 + 3H2O2 = 2HNO4 + 2H2O
NaH+BF3=B2H6+NaF6NaH + 2BF3 = B2H6 + 6NaF
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na3N=Na+N22Na3N = 6Na + N2
N4+S2=N4S10N4 + 5S2 = N4S10
Na2SO4(aq) + CaCl2(aq) = CaSO4(s) + NaCl(aq)Na2SO4(aq) + CaCl2(aq) = CaSO4(s) + 2NaCl(aq)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NaOH(aq) +H2SO4(aq)=Na2SO4(aq)+H2O(l)2NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l)
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+H2SO4=NH4+SO42NH3 + H2SO4 = 2NH4 + SO4
NI3=N2+I22NI3 = N2 + 3I2
NH3=N2+H22NH3 = N2 + 3H2
Na2CO3 = CO2 + Na2ONa2CO3 = CO2 + Na2O
N2O4=NO2N2O4 = 2NO2
Na + H2O =NaOH +HNa + H2O = NaOH + H
Na+HCl=H2+NaCl2Na + 2HCl = H2 + 2NaCl
Na+O2=Na2O4Na + O2 = 2Na2O
NaCl=Na+Cl22NaCl = 2Na + Cl2
NaCl=Na+ClNaCl = Na + Cl
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O= NaOH +H22Na + 2H2O = 2NaOH + H2
Na+H2O= NaOH +H22Na + 2H2O = 2NaOH + H2
N2+O2=NON2 + O2 = 2NO
Na+H2O=NaOH+HNa + H2O = NaOH + H
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na2(Co3) + Ba(No3)2= Na2(No3)2 + Co3(Ba)Na2(Co3) + Ba(No3)2 = Na2(No3)2 + Co3(Ba)
Na2(Co3) + NH4No3= Na2(No3) + Co3(NH4)Na2(Co3) + NH4No3 = Na2(No3) + Co3(NH4)
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO2+6H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaOH+NaNO2+Al+H2O=NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
Na2S + KIO3 = K2S + NaIO3Na2S + 2KIO3 = K2S + 2NaIO3
NaOH+NaNO2+Al+H2O=NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
NaCl(aq)+Mg(C2H3O2)2(aq)=Na(C2H3O2)2+MgClNaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2 + MgCl
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O32N2 + 3O2 = 2N2O3
Na2CO3+HCl = CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NO + CO = N2 + CO22NO + 2CO = N2 + 2CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2+O2=N2O2N2 + O2 = 2N2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2(g) + O2(g) = N2O3(l)2N2(g) + 3O2(g) = 2N2O3(l)
N2+H2=2NH3N2 + 3H2 = 2NH3
NaCl+AgNO3+K2SO4=NaNO3+Ag2SO4+KCl2NaCl + 2AgNO3 + K2SO4 = 2NaNO3 + Ag2SO4 + 2KCl
NaI + H2SO4 = I2 + H2S + H2O + Na2SO48NaI + 5H2SO4 = 4I2 + H2S + 4H2O + 4Na2SO4
NaI + H2SO4 = I2 + H2S + H2O + Na2SO48NaI + 5H2SO4 = 4I2 + H2S + 4H2O + 4Na2SO4
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaI + Br2 = NaBr + I22NaI + Br2 = 2NaBr + I2
Na + H2O = NaOH + H2O0Na + H2O = 0NaOH + H2O
Na + H2O = NaOH + H2O0Na + H2O = 0NaOH + H2O
NH3+O2=NO2+6H2O4NH3 + 7O2 = 4NO2 + 6H2O
Ni(OH)2 + H2SO4 = NiSO4 + H2ONi(OH)2 + H2SO4 = NiSO4 + 2H2O
NiSO4 +NaOH =Na2SO4 + Ni(OH)2NiSO4 + 2NaOH = Na2SO4 + Ni(OH)2
N2H4+N2O4=H2O+N22N2H4 + N2O4 = 4H2O + 3N2
N2H4+N2O4=H2O+N44N2H4 + 2N2O4 = 8H2O + 3N4
Na2SO4 = Na2S + O2Na2SO4 = Na2S + 2O2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NH4NO3+NaOH=NaNO3+NH3+H2ONH4NO3 + NaOH = NaNO3 + NH3 + H2O
NH3+O2=N2O4+3H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na3PO4+KHCO3=NaHCO3+K3PO4Na3PO4 + 3KHCO3 = 3NaHCO3 + K3PO4
Na3PO4+Cu(NO3)2= NaNO3+Cu3(PO4)22Na3PO4 + 3Cu(NO3)2 = 6NaNO3 + Cu3(PO4)2
NH4NO3(s) = N2(g) + O2(g) + H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + Al2O3 = Na2O + Al6Na + Al2O3 = 3Na2O + 2Al
NH4NO2=N+H2ONH4NO2 = 2N + 2H2O
Na3PO4+Mg(NO3)2=NaNO3+Mg3(PO4)22Na3PO4 + 3Mg(NO3)2 = 6NaNO3 + Mg3(PO4)2
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NiCl2+NaOH=Ni(OH)2+NaClNiCl2 + 2NaOH = Ni(OH)2 + 2NaCl
NaHCO3+H2SO4= Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na2CO3 + HC2H3O2 = Na(C2H3O2) + H20 + CO210Na2CO3 + 25HC2H3O2 = 20Na(C2H3O2) + 2H20 + 20CO2
NaOH + HC2H3O2 = Na(C2H3O2) + H2ONaOH + HC2H3O2 = Na(C2H3O2) + H2O
NaHCO3+H2SO4= Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na2CO3+Cu(NO3)2= NaNO3+CuCO3Na2CO3 + Cu(NO3)2 = 2NaNO3 + CuCO3
Na2CO3+CaCl2=NaCl+CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
Na2CO3+HCl = NaCl+H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
Ni(HCO3)2=NiCO3+H2O+CO2Ni(HCO3)2 = NiCO3 + H2O + CO2
Na2CO3+HCl=Na2Cl+HCO3Na2CO3 + HCl = Na2Cl + HCO3
NaI (aq) + Ca(NO3)2 (aq) = NaNO3 (aq) + CaI2 (s)2NaI(aq) + Ca(NO3)2(aq) = 2NaNO3(aq) + CaI2(s)
NaI(aq)+ Ca(NO3)2(aq)=NaNO3(aq)+CaI2(s)2NaI(aq) + Ca(NO3)2(aq) = 2NaNO3(aq) + CaI2(s)
NH3 + KSCN = NH3KSCNNH3 + KSCN = NH3KSCN
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2(aq) + MgCl(aq)NaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2(aq) + MgCl(aq)
NaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2 + MgClNaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2 + MgCl
NaI (aq) + AgNO3 (aq) = NaNO3+AgINaI(aq) + AgNO3(aq) = NaNO3 + AgI
NaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2 + MgClNaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2 + MgCl
NaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2 + MgClNaCl(aq) + Mg(C2H3O2)2(aq) = Na(C2H3O2)2 + MgCl
NaI (aq) + H2SO4 (aq)= I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2=NO2N2 + 2O2 = 2NO2
Na+O2=Na2O4Na + O2 = 2Na2O
Na+Cl+O2=NaClO2Na + 2Cl + O2 = 2NaClO
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Na2C2O4+K2Cr2O7+H2SO4=Na2SO4+K2SO4+Cr2(SO4)3+H2O+CO23Na2C2O4 + K2Cr2O7 + 7H2SO4 = 3Na2SO4 + K2SO4 + Cr2(SO4)3 + 7H2O + 6CO2
Na + H2O = NaO + H2Na + H2O = NaO + H2
NO3(aq)+K(aq)=KNO3(aq)NO3(aq) + K(aq) = KNO3(aq)
NO+O2=NO22NO + O2 = 2NO2
Na2CO3 + HCl = CO2 + H2O + NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
N2+O2=NO2N2 + 2O2 = 2NO2
NaOH(aq)+H2S(g)=Na2S(aq)+H2O(l)2NaOH(aq) + H2S(g) = Na2S(aq) + 2H2O(l)
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=NO2N2 + 2O2 = 2NO2
N2+O2=NO2N2 + 2O2 = 2NO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+FeCr2O4+O2=Fe2O3+Na2CrO4+CO28Na2CO3 + 4FeCr2O4 + 7O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
NiF2+NH3=Ni3N+NH4 F+N26NiF2 + 16NH3 = 2Ni3N + 12NH4F + N2
NaF (aq) + H2SO4 (aq) =HF (aq) + Na2SO4 (aq)2NaF(aq) + H2SO4(aq) = 2HF(aq) + Na2SO4(aq)
NO3(aq)+K(aq)=KNO3(aq)NO3(aq) + K(aq) = KNO3(aq)
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
Ni(OH)2 + H2SO4 =NiSO4 + H2ONi(OH)2 + H2SO4 = NiSO4 + 2H2O
Ni(OH)2 + H2SO4 =NiSO4 + H2ONi(OH)2 + H2SO4 = NiSO4 + 2H2O
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
Na2CO3 + C2H4O2 = C2H3NaO2 + CO2 +H2ONa2CO3 + 2C2H4O2 = 2C2H3NaO2 + CO2 + H2O
N + 2O = NO2N + 2O = NO2
Ni(NO3)2 + CuCl2 = NiCl2 + Cu(NO3)2Ni(NO3)2 + CuCl2 = NiCl2 + Cu(NO3)2
NO + H2O = HNO3 + O2-4NO - 2H2O = -4HNO3 + 3O2
NO + H2O = HNO3 + O2-4NO - 2H2O = -4HNO3 + 3O2
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NO + H2O = HNO3 + O2-4NO - 2H2O = -4HNO3 + 3O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S+ HNO3 = NaNO3 + NO + S + H2O3Na2S + 8HNO3 = 6NaNO3 + 2NO + 3S + 4H2O
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
Na2CO3 + Al3 = Na2 + Al3CO3Na2CO3 + Al3 = Na2 + Al3CO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2CO3 + Ca(OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NH3 +O2 +CH3 = HCN +H2O4NH3 + 5O2 + 4CH3 = 4HCN + 10H2O
N2H4(g)+O2(g)=NO2(g)+H2O(g)N2H4(g) + 3O2(g) = 2NO2(g) + 2H2O(g)
N2H4(g)+O2(g)=NO2(g)+H2O(g)N2H4(g) + 3O2(g) = 2NO2(g) + 2H2O(g)
NaOH+CuSO4=CuOH+NaSO4NaOH + CuSO4 = CuOH + NaSO4
NaCO3+H2O+CO2 = 2NaOH+CO20NaCO3 + 0H2O + CO2 = 0NaOH + CO2
NI3=N2+I22NI3 = N2 + 3I2
NH3+HNO3=NH4NO3NH3 + HNO3 = NH4NO3
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaN3=Na+N22NaN3 = 2Na + 3N2
NiF2+Fe2(SO4)3=NiSO4+FeF33NiF2 + Fe2(SO4)3 = 3NiSO4 + 2FeF3
N+Cl=NCl3N + 3Cl = NCl3
NaOH + CuN2O6 = CuO2H2 + 2NaNO32NaOH + CuN2O6 = CuO2H2 + 2NaNO3
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NH4NO3 = N2O + 2 H2ONH4NO3 = N2O + 2H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NaCl(aq)+Hg2(C2H3O2)2(aq)=Na(C2H3O2)(aq)+HgCl(s)2NaCl(aq) + Hg2(C2H3O2)2(aq) = 2Na(C2H3O2)(aq) + 2HgCl(s)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2+H2O=NO+HNO33NO2 + H2O = NO + 2HNO3
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
N2(g) + O2(g)=N2O3(g)2N2(g) + 3O2(g) = 2N2O3(g)
N2(g) + O2(g)=N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
N2O=N2+O22N2O = 2N2 + O2
Na(s) + H2O(l)=NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g) + O2(g)=NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH3+H2CO3=(NH4)2CO32NH3 + H2CO3 = (NH4)2CO3
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
NO2 + H2O2 = HNO32NO2 + H2O2 = 2HNO3
NaOH + Na2CO3 = NaCO + NaOHNaOH + 0Na2CO3 = 0NaCO + NaOH
NO2- +(NH2)2CS = N2 +NCS- +H2ONO2- + (NH2)2CS = N2 + NCS- + 2H2O
Na+CuCl= Cu+NaClNa + CuCl = Cu + NaCl
NaOH(aq) + NaNO2(aq) + Al(s) + H2O(l) = NH3(aq) + NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S(aq) + ZnCl2(aq)= ZnS + NaCl(aq)Na2S(aq) + ZnCl2(aq) = ZnS + 2NaCl(aq)
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
Na2S(aq) + AgC2H3O2(aq)=NaC2H3O2(aq) + Ag2S(s)Na2S(aq) + 2AgC2H3O2(aq) = 2NaC2H3O2(aq) + Ag2S(s)
N2H2=NH3+N23N2H2 = 2NH3 + 2N2
Na2S+Cu(NO3)2= NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2CO3 + HNO3 = CO2 + H2O + NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
Na2CO3 + HNO3 = CO2 + H2O + NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
N + H = NH3N + 3H = NH3
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NH4OH+NiSO4=NH4SO4+NiOHNH4OH + NiSO4 = NH4SO4 + NiOH
NH4NO3 + H2O = NH4 + NO3NH4NO3 + 0H2O = NH4 + NO3
NH4NO3 + H2O = NH4 + NO3NH4NO3 + 0H2O = NH4 + NO3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
NH4Cl+NaOH = NaCl+NH3+H2ONH4Cl + NaOH = NaCl + NH3 + H2O
NaClO + 4NaI + HCl = NaCl + 2I2 +H2ONaClO + 2NaI + 2HCl = 3NaCl + I2 + H2O
NaClO + NaI + HCl = NaCl + I2 +H2ONaClO + 2NaI + 2HCl = 3NaCl + I2 + H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na + Cl2=2NaCl2Na + Cl2 = 2NaCl
Na3P + H2O = PH3 + Na2O2Na3P + 3H2O = 2PH3 + 3Na2O
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NO + SO2 = N2 + SO32NO + 2SO2 = N2 + 2SO3
Na + Cl2=2NaCl2Na + Cl2 = 2NaCl
NH3 = N2 +H22NH3 = N2 + 3H2
Na + Cl2=NaCl2Na + Cl2 = NaCl2
NaCl = Na + Cl22NaCl = 2Na + Cl2
Na + Cl2=2NaCl2Na + Cl2 = 2NaCl
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaCl + Hg (OH)2 = HgCl2 + Na(OH)2NaCl + Hg(OH)2 = HgCl2 + 2Na(OH)
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
Na3PO4+AgNO3=Ag3PO4+NaNO3Na3PO4 + 3AgNO3 = Ag3PO4 + 3NaNO3
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NH3(aq) + O2(aq) = NO(g) + H2O(l)4NH3(aq) + 5O2(aq) = 4NO(g) + 6H2O(l)
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH3+O2=HNO3+H2ONH3 + 2O2 = HNO3 + H2O
NaBr (aq) + 2H2SO4 (aq) = Br2 (l) + 3SO2 (g) + 4H2O (l) + Na2SO4 (aq)2NaBr(aq) + 2H2SO4(aq) = Br2(l) + SO2(g) + 2H2O(l) + Na2SO4(aq)
N2H4 = NH3+N23N2H4 = 4NH3 + N2
Na2C2O4+KMnO4+H2SO4=K2SO4+MnSO4+Na2SO4+H2O+CO25Na2C2O4 + 2KMnO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 8H2O + 10CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
N2+O2=N2O32N2 + 3O2 = 2N2O3
Na2CO3(s)+2HCl(aq)=2HCO3+Na2ClNa2CO3(s) + HCl(aq) = HCO3 + Na2Cl
NH4NO3 = N2 + O2 + H2010NH4NO3 = 10N2 + 15O2 + 2H20
NH4NO3 = N2 + O2 + H2010NH4NO3 = 10N2 + 15O2 + 2H20
NH4NO3 = N2 + O2 + H2010NH4NO3 = 10N2 + 15O2 + 2H20
NH4ClO+Al=AlCl3+Al2O3+H2O+N26NH4ClO - 2Al = 2AlCl3 - 2Al2O3 + 12H2O + 3N2
Na3PO4+Fe(NO3)3+KNO3=Na3NO3+K3PO4+Fe(NO3)30Na3PO4 + Fe(NO3)3 + 0KNO3 = 0Na3NO3 + 0K3PO4 + Fe(NO3)3
NO+O2=NO22NO + O2 = 2NO2
Na3PO4+Fe(NO3)3+KNO3=Na3NO3+FePO4+K(NO3)3Na3PO4 + Fe(NO3)3 + KNO3 = Na3NO3 + FePO4 + K(NO3)3
NH4Cl(aq) + AgNO3(aq) = AgCl(s) + NH4NO3(aq)NH4Cl(aq) + AgNO3(aq) = AgCl(s) + NH4NO3(aq)
NO+O2=NO22NO + O2 = 2NO2
NH4Cl + AgNO3 = AgCl + NH4NO3NH4Cl + AgNO3 = AgCl + NH4NO3
N2+O=NON2 + 2O = 2NO
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l)=NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3(s) = N2(g) +O2(g) +H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na + TiCl4 = NaCl + Ti4Na + TiCl4 = 4NaCl + Ti
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4NO3 + Ca(OH)2 = Ca(NO3)2 + NH3 + H2O2NH4NO3 + Ca(OH)2 = Ca(NO3)2 + 2NH3 + 2H2O
Na3PO4 + BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
N2O5 = NO2 + O22N2O5 = 4NO2 + O2
NaOH + H3PO4 = Na3PO4 +H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
N2+ H2= +NH3N2 + 3H2 = 2NH3
N2+ O2= +NO2N2 + 2O2 = 2NO2
NH3 + HCI = NH4CINH3 + HCI = NH4CI
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na + CaBr2 = NaBr + Ca2Na + CaBr2 = 2NaBr + Ca
NaH + H2O=NaOH+H2NaH + H2O = NaOH + H2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3 + 3Al = 2Na + Al3CO3Na2CO3 + 3Al = 2Na + Al3CO3
Ni + N2O4 = Ni(NO3)2 + NONi + 2N2O4 = Ni(NO3)2 + 2NO
Ni + N2O4 = Ni(NO3)2 + NONi + 2N2O4 = Ni(NO3)2 + 2NO
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NaO + H20 = NaOH20NaO + H20 = 20NaOH
N2H4 + O2 = H2O + N2N2H4 + O2 = 2H2O + N2
Na2SO4 + Sr(NO3)2 = NaNO3+ SrSO4 Na2SO4 + Sr(NO3)2 = 2NaNO3 + SrSO4
Na2SO4+ NH4OH= NaOH +(NH4)2SO4Na2SO4 + 2NH4OH = 2NaOH + (NH4)2SO4
Na2SO4 + KOH = NaOH +K2SO4 Na2SO4 + 2KOH = 2NaOH + K2SO4
Na2SO4 + BaCl2 = NaCl + BaSO4Na2SO4 + BaCl2 = 2NaCl + BaSO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4ClO4 = N2 + Cl2 + O2 + H2010NH4ClO4 = 5N2 + 5Cl2 + 20O2 + 2H20
NaCN + HNO3 = NO3 + NaHCNNaCN + HNO3 = NO3 + NaHCN
Na2CO3 + 2 HCl = 2NaCl + H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
Ni(NO3)2 + (NH4)2CO3 = NiCO3 + 2NH4NO3Ni(NO3)2 + (NH4)2CO3 = NiCO3 + 2NH4NO3
Ni(NO3)2 + (NH4)2CO3 = NiCO3 + 2(NH4)(NO3)Ni(NO3)2 + (NH4)2CO3 = NiCO3 + 2(NH4)(NO3)
Ni(NO3)2 + (NH4)2CO3 = NiCO3 + (NH4)2(NO3)2Ni(NO3)2 + (NH4)2CO3 = NiCO3 + (NH4)2(NO3)2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na OH +H2 SO4= Na SO4 + H2 OHNaOH + H2SO4 = NaSO4 + H2OH
NaOH +H2SO4= NaSO4 + H2OHNaOH + H2SO4 = NaSO4 + H2OH
Na OH +H2 SO4= Na SO4 + H2 OHNaOH + H2SO4 = NaSO4 + H2OH
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2H4 = NH3 + N23N2H4 = 4NH3 + N2
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NaOH+NaNO2+Al+H2O=NH2+NaAlO22NaOH + 3NaNO2 + 5Al + 2H2O = 3NH2 + 5NaAlO2
NaOH+NaNO2+Al+H2O=NH2+NaAlO22NaOH + 3NaNO2 + 5Al + 2H2O = 3NH2 + 5NaAlO2
Na2TeO3+NaI+HCl=NaCl+Te+H2O+I2Na2TeO3 + 4NaI + 6HCl = 6NaCl + Te + 3H2O + 2I2
NaClO+NaI+HCl=NaCl+I2+H2ONaClO + 2NaI + 2HCl = 3NaCl + I2 + H2O
Na2S(aq) + AgC2H3O2(aq) =NaC2H3O2(aq) + Ag2S(s)Na2S(aq) + 2AgC2H3O2(aq) = 2NaC2H3O2(aq) + Ag2S(s)
Na3PO4+CaCl2=Ca3(PO4)2+NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
Na2S (aq) + Cu (NO3)2 (aq) = NaNO3 (aq) + CuS (s) Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3+CO2=CH4N2O+H2O2NH3 + CO2 = CH4N2O + H2O
Na + FeBr3 = NaBr3 + FeNa + FeBr3 = NaBr3 + Fe
Na2SO4 + Ba(NO3)2 = BaSO4 + NaNO3Na2SO4 + Ba(NO3)2 = BaSO4 + 2NaNO3
NH4CN(aq)+ CuSO4(aq)= Cu(CN)2 (s)+(NH4)2SO4(aq)2NH4CN(aq) + CuSO4(aq) = Cu(CN)2(s) + (NH4)2SO4(aq)
NH4CN(aq)+ CuSO4(aq)= Cu(CN)2 (s)+(NH4)2SO4(aq)2NH4CN(aq) + CuSO4(aq) = Cu(CN)2(s) + (NH4)2SO4(aq)
NH4CN(aq)+ CuSO4(aq)= Cu(CN)2 (s)+(NH4)2SO4(aq)2NH4CN(aq) + CuSO4(aq) = Cu(CN)2(s) + (NH4)2SO4(aq)
NH4CN(aq)+ CuSO4(aq)= Cu(CN)2 (s)+(NH4)2SO4(aq)2NH4CN(aq) + CuSO4(aq) = Cu(CN)2(s) + (NH4)2SO4(aq)
Na2SO4 + Ba(NO3)2 = BaSO4 + NaNO3Na2SO4 + Ba(NO3)2 = BaSO4 + 2NaNO3
Na3PO4(aq)+NiCl2(aq)=Ni3(PO4)2(s)+NaCl(aq)2Na3PO4(aq) + 3NiCl2(aq) = Ni3(PO4)2(s) + 6NaCl(aq)
Na2CO3+HNO3=CO2+H2O+NaNO3Na2CO3 + 2HNO3 = CO2 + H2O + 2NaNO3
NaCl + AgC2H3O2 = NaC2H3O2 + AgClNaCl + AgC2H3O2 = NaC2H3O2 + AgCl
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Ni+HCl=NiCl2+H2Ni + 2HCl = NiCl2 + H2
Ni+HCl = NiCl2 + H2Ni + 2HCl = NiCl2 + H2
Ni+HCl = NiCl2 + H2Ni + 2HCl = NiCl2 + H2
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NH3 + O = NO2 + H2O2NH3 + 7O = 2NO2 + 3H2O
NaCl+KSO4=KCl+NaSO4NaCl + KSO4 = KCl + NaSO4
NaOH+Li= LiOH + NaNaOH + Li = LiOH + Na
NaHCO3 + H3O + Cl = NaCl + CO2 + H2ONaHCO3 + H3O + Cl = NaCl + CO2 + 2H2O
Na2CO3 + H3O + Cl = NaCl + CO2 + H2ONa2CO3 + 2H3O + 2Cl = 2NaCl + CO2 + 3H2O
Na3PO4 + Ba(NO3)2 =NaNO3 + Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
Na2CO3 + H3O + Cl = NaCl + CO2 + H2ONa2CO3 + 2H3O + 2Cl = 2NaCl + CO2 + 3H2O
NH4OH + Al(NO3)3 = Al(OH)3 + NH4NO33NH4OH + Al(NO3)3 = Al(OH)3 + 3NH4NO3
N+H=NH3N + 3H = NH3
NaC2H3O2 + (NH4)3PO4 = Na3PO4 + (NH4)C2H3O23NaC2H3O2 + (NH4)3PO4 = Na3PO4 + 3(NH4)C2H3O2
NO = N2O + NO23NO = N2O + NO2
NaHCO3 = Na2CO3 + H2O +CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2CO3+Ca(OH)2=CaCO3+NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2O5 = NO2 + O22N2O5 = 4NO2 + O2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O4+N2H4=N2+H2ON2O4 + 2N2H4 = 3N2 + 4H2O
Na2SO3 + S8 = Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH3 + O2=NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na2CO3+Ca(OH)2=CaCO3+NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
Na + H2SO4 = Na2SO4 + H22Na + H2SO4 = Na2SO4 + H2
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2+O2=N2O54NO2 + O2 = 2N2O5
Na2CO3(s)+HCl(aq)=CO2(g)+H2O(l)+NaCl(aq)Na2CO3(s) + 2HCl(aq) = CO2(g) + H2O(l) + 2NaCl(aq)
NO(g)+CO(g)=N2(g)+CO2(g)2NO(g) + 2CO(g) = N2(g) + 2CO2(g)
NH3 (g) + 2O2 (g) = NO (g)+ 3 H2O (l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
Na (s)+H2O (l)=NaOH (aq)+H2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na + H2O = NaOH + H2 2Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H2 2Na + 2H2O = 2NaOH + H2
NH3 + O2 +CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4Cl + KCl + H2O = KN + Cl + H2O0NH4Cl + 0KCl + H2O = 0KN + 0Cl + H2O
Na + H2O = NaHO + H22Na + 2H2O = 2NaHO + H2
NaI + H2SO4 = I2 + H2S + H2O + Na2SO4 8NaI + 5H2SO4 = 4I2 + H2S + 4H2O + 4Na2SO4
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2SO4+C=Na2S+CO2Na2SO4 + 2C = Na2S + 2CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH 3 (g)+CO 2 (g)=CO(NH 2 ) 2 (s)+H 2 O(l) 2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaF + H2SO4 = HF + Na2SO42NaF + H2SO4 = 2HF + Na2SO4
Na+Br=NaBrNa + Br = NaBr
NH4I+KOH=KI+NH4OHNH4I + KOH = KI + NH4OH
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2TeO3+NaI+HCl=NaCl+H2O+Te+I2Na2TeO3 + 4NaI + 6HCl = 6NaCl + 3H2O + Te + 2I2
Na+Br2=NaBr2Na + Br2 = 2NaBr
Na+Br=NaBrNa + Br = NaBr
Na2CO3 + (CaCl2) 2H2O = CaCO3 + 2 NaCl + 2 H2O2Na2CO3 + (CaCl2)2H2O = 2CaCO3 + 4NaCl + H2O
Na3PO4 + Li2SO4 = Na3SO4 + Li2PO4Na3PO4 + Li2SO4 = Na3SO4 + Li2PO4
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2H2=NH3+N23N2H2 = 2NH3 + 2N2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NiCl2 + H3PO4 = Ni3(PO4)2 + HCl3NiCl2 + 2H3PO4 = Ni3(PO4)2 + 6HCl
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Ni(C2H3O2)2+4H2O+Na3PO4=Ni3(PO4)2+NaC2H302+H2O0Ni(C2H3O2)2 + H2O + 0Na3PO4 = 0Ni3(PO4)2 + 0NaC2H302 + H2O
Ni(C2H3O2)2+4H2O+Na3PO4=Ni3(PO4)2+NaC2H302+H2O0Ni(C2H3O2)2 + H2O + 0Na3PO4 = 0Ni3(PO4)2 + 0NaC2H302 + H2O
NBr3+NaOH=N2+NaBr+HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
NaOH+P4+H2O=NaH2PO2+PH33NaOH + P4 + 3H2O = 3NaH2PO2 + PH3
NaBH4+BF3=NaBF4+B2H63NaBH4 + 4BF3 = 3NaBF4 + 2B2H6
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3+Al3=Na2 + Al3CO3Na2CO3 + Al3 = Na2 + Al3CO3
NaCl + H2O = ClH + NaO + HNaCl + H2O = ClH + NaO + H
NH3+O2=N2O+H2O2NH3 + 2O2 = N2O + 3H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+I2=N2I+H24NH3 + I2 = 2N2I + 6H2
NH3(g)+Cl2(g)=NH4Cl(s)+NCl3(g)4NH3(g) + 3Cl2(g) = 3NH4Cl(s) + NCl3(g)
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Na2S4O6+KMnO4+HNO3=Na2SO4+H2SO4+Mn(NO3)2+KNO3+H2O5Na2S4O6 + 14KMnO4 + 42HNO3 = 5Na2SO4 + 15H2SO4 + 14Mn(NO3)2 + 14KNO3 + 6H2O
Na+HNO3=NaNO3+N2O+H2O8Na + 10HNO3 = 8NaNO3 + N2O + 5H2O
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Ni(ClO3)2 = 1 NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
Nh4 + Cl2 = Nh4Cl2Nh4 + Cl2 = 2Nh4Cl
N2O=N2+O22N2O = 2N2 + O2
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NaCl(aq)+AgNO3(aq)=AgCl+NaNO3NaCl(aq) + AgNO3(aq) = AgCl + NaNO3
NaOCl + Fe(HCO3)2 + OH- = Na+ + Cl- + CO2 + Fe(OH)3 +H2O-1NaOCl - 2Fe(HCO3)2 + 0OH- = -1Na+ - Cl- - 4CO2 - 2Fe(OH)3 + H2O
NaOCl + Fe(HCO3)2 + OH- = Na+ + Cl- + CO2 + Fe(OH)3 + H2O-1NaOCl - 2Fe(HCO3)2 + 0OH- = -1Na+ - Cl- - 4CO2 - 2Fe(OH)3 + H2O
NaOCl + Fe(HCO3)2 + H2O = Na+ + Cl- + CO2 + Fe(OH)3NaOCl + 2Fe(HCO3)2 + H2O = Na+ + Cl- + 4CO2 + 2Fe(OH)3
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3(g)+Cl2(g)=NH4Cl(s)+NCl3(g)4NH3(g) + 3Cl2(g) = 3NH4Cl(s) + NCl3(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOCl + Fe(HCO3)2 + H2O = Na+ + Cl- + CO2 + Fe(OH)3NaOCl + 2Fe(HCO3)2 + H2O = Na+ + Cl- + 4CO2 + 2Fe(OH)3
NaOCl + Fe(HCO3)2 + H2O = Na+ + Cl- + CO2 + Fe(OH)3NaOCl + 2Fe(HCO3)2 + H2O = Na+ + Cl- + 4CO2 + 2Fe(OH)3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO4= Na + SO4Na2SO4 = 2Na + SO4
Na + Cl = NaClNa + Cl = NaCl
N2H4(aq) + Cu(OH)2(s) = N2(g)+Cu(s) + H2ON2H4(aq) + 2Cu(OH)2(s) = N2(g) + 2Cu(s) + 4H2O
NO2+H20=HNO3+NO40NO2 + H20 = 20HNO3 + 20NO
N2O3 + Ni = Ni(NO3)2 + NO4N2O3 + Ni = Ni(NO3)2 + 6NO
NO+O2+Na2CO3=CO2+ NaNO24NO + O2 + 2Na2CO3 = 2CO2 + 4NaNO2
Na2 SO4(aq) + Sr(NO3)2(aq)= 2NaNO3(aq)+SrSO4(s)Na2SO4(aq) + Sr(NO3)2(aq) = 2NaNO3(aq) + SrSO4(s)
N2O + H2 = NH3 + H2ON2O + 4H2 = 2NH3 + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
N2O=N2+O22N2O = 2N2 + O2
N2O=N2+O22N2O = 2N2 + O2
NaBr+Cl2+H2O=NaCl+HBrO3+HBr6NaBr + 3Cl2 + 3H2O = 6NaCl + HBrO3 + 5HBr
Na2B4O7 + H2SO4 = H2O + H3BO3 + Na2SO4Na2B4O7 + H2SO4 = -5H2O + 4H3BO3 + Na2SO4
N2O5 (g)=NO2 (g)+O2 (g)2N2O5(g) = 4NO2(g) + O2(g)
NaCl + H2SO4 = HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
NaHCO3 + HC2H3O = NaC2H3 + CO2 + H2O 5NaHCO3 + 6HC2H3O = 5NaC2H3 + 7CO2 + 7H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NH3 + N2O = H2O + N22NH3 + 3N2O = 3H2O + 4N2
NH4NO3 + H2O= HNO3 + NH4OHNH4NO3 + H2O = HNO3 + NH4OH
NH4NO3 + H20 = HNO3 + NH4OH10NH4NO3 + 2H20 = 5HNO3 + 15NH4OH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3 + Cr(NO3)3 = NaNO3 + Cr2(CO3)33Na2CO3 + 2Cr(NO3)3 = 6NaNO3 + Cr2(CO3)3
NH4+NO3=2 H2O + N26NH4 + 4NO3 = 12H2O + 5N2
Na2CO3 + 2 H2SO4=Na2SO4 + 2 H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na3PO4 + Ba(NO3)2 = Ba3(PO4)2 + NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.