Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Na2C2O4 + Ca(OH)2 = CaC2O4 + 2NaHONa2C2O4 + Ca(OH)2 = CaC2O4 + 2NaHO
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na3(PO4) + CaS = Na2S + Ca3(PO4)22Na3(PO4) + 3CaS = 3Na2S + Ca3(PO4)2
NH3=H2 = N22NH3 = 3H2 + N2
NaOH + HC6H7O6 = NaC6H7O6 + H2ONaOH + HC6H7O6 = NaC6H7O6 + H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2H4+O2=NO2+H2ON2H4 + 3O2 = 2NO2 + 2H2O
Na(OH)+(NH4)2SO4=Na2(SO4)+H2O+NH32Na(OH) + (NH4)2SO4 = Na2(SO4) + 2H2O + 2NH3
NH3 + Cl2 = + N2 + NH4Cl8NH3 + 3Cl2 = N2 + 6NH4Cl
NH3 + Cl2 = + NCl3 + HClNH3 + 3Cl2 = NCl3 + 3HCl
Na2CO3(aq) + HCl = NaCl + H20 + CO310Na2CO3(aq) + 20HCl = 20NaCl + H20 + 10CO3
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NO2+H2O+2O=HNO32NO2 + H2O + O = 2HNO3
Na + S = Na2S2Na + S = Na2S
N2+3H2=2NH3N2 + 3H2 = 2NH3
NaHCO3 HCl C6H8O7 = CO2 H2O Cl C6H8O7+ NaNaHCO3HClC6H8O7 = CO2H2OClC6H8O7 + Na
Na2CO3+Ni(NO3)3=NaNO3+Ni2(CO3)33Na2CO3 + 2Ni(NO3)3 = 6NaNO3 + Ni2(CO3)3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl = Na +Cl22NaCl = 2Na + Cl2
NaHCO3 = Na2CO3 + CO2 = H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2CO3 ( H2O) = Na2CO3 + H2ONa2CO3(H2O) = Na2CO3 + H2O
Na NO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na 2O + H 2O = NaOHNa2O + H2O = 2NaOH
NaOOCH3+H2O=NaOH+CH3COOH2NaOOCH3 + 0H2O = 2NaOH + CH3COOH
Na2Cr2O7+HCl=NaCl+CrCl3+H2O+Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na2SO3 + S8 = Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NH3(g) + F2(g) = NH4F(s) + NF3(g)4NH3(g) + 3F2(g) = 3NH4F(s) + NF3(g)
NO + Cl2 = NOCl2NO + Cl2 = 2NOCl
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2Cr2O7 + H3BO3 = Na2B4O7 + Cr2(B4O7)3 + O2 + H2O2Na2Cr2O7 + 32H3BO3 = 2Na2B4O7 + 2Cr2(B4O7)3 + 3O2 + 48H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+Ca(SO4) =Na2(SO4)+Ca(OH)22NaOH + Ca(SO4) = Na2(SO4) + Ca(OH)2
Na3(PO4) +Zn(SO4) = Na2 (SO4) +Zn3(PO4)22Na3(PO4) + 3Zn(SO4) = 3Na2(SO4) + Zn3(PO4)2
NiCl2+HCl+KMnO4=H2O+KCl+MnCl2+NiCl35NiCl2 + 8HCl + KMnO4 = 4H2O + KCl + MnCl2 + 5NiCl3
NaH2PO4 + KOH= H2O + Na + KHPO4NaH2PO4 + KOH = H2O + Na + KHPO4
NaH2PO4 + KOH= KH2PO4 +NaOHNaH2PO4 + KOH = KH2PO4 + NaOH
NaHCO3 + NaCl=Na2CO3 + HClNaHCO3 + NaCl = Na2CO3 + HCl
Na2Co3 = Na3+ Co26Na2Co3 = 4Na3 + 9Co2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3+ Ca(OH)2= NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na2CrO4 + H = Na2Cr2O7 + Na + H2O2Na2CrO4 + 2H = Na2Cr2O7 + 2Na + H2O
NH3+H2O = NH4OHNH3 + H2O = NH4OH
N2Cl4+CH4=CCl4+N2+H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
Na + CaF2= Ca+ NaF2Na + CaF2 = Ca + 2NaF
Na+F2=NaF2Na + F2 = 2NaF
NH3+HCl= NH4ClNH3 + HCl = NH4Cl
NaCl + MnO2 + H2SO4 = NaH2SO4 + MnSO4 + H2O +ClNaCl + 0MnO2 + H2SO4 = NaH2SO4 + 0MnSO4 + 0H2O + Cl
NaCIO+H2O = HOCI+NaOHNaCIO + H2O = HOCI + NaOH
NaHCO3 + H2O = NaOH + H2CO3NaHCO3 + H2O = NaOH + H2CO3
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2+O2=N2O32N2 + 3O2 = 2N2O3
N2+O2=N2O32N2 + 3O2 = 2N2O3
NaCrO2 + NaClO4 + NaOH = Na2CrO4 + NaCl + H2O8NaCrO2 + 3NaClO4 + 8NaOH = 8Na2CrO4 + 3NaCl + 4H2O
Na2O4 + 2Al + H2O = NaOH + Al2O3Na2O4 + 2Al + H2O = 2NaOH + Al2O3
Na2S2O3+I2=NaS4O6+NaI4Na2S2O3 + 3I2 = 2NaS4O6 + 6NaI
NH3+Cl2=HN4Cl+NCl3-1NH3 + 15Cl2 = -3HN4Cl + 11NCl3
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
NaOH + HF = NaF + H2O NaOH + HF = NaF + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
NaOH + S = Na2S2O3 + Na2S + H2O6NaOH + 4S = Na2S2O3 + 2Na2S + 3H2O
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NH3+ O2 = N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+ O2 = N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NO2+ClO=NO3+ClNO2 + ClO = NO3 + Cl
NO2+ClO2=NO3+Cl2NO2 + ClO2 = 2NO3 + Cl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl + Al2(SO4)3 = Na2SO4 + AlCl36NaCl + Al2(SO4)3 = 3Na2SO4 + 2AlCl3
Na3P+H2O=PH3+NaOHNa3P + 3H2O = PH3 + 3NaOH
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3= NaCl+O22NaClO3 = 2NaCl + 3O2
N2+H2=NH3N2 + 3H2 = 2NH3
NH4SH + NaClO + NaOH = N2 + Na2SO4 + NaCl + H2O2NH4SH + 11NaClO + 4NaOH = N2 + 2Na2SO4 + 11NaCl + 7H2O
N2+F2=NF3N2 + 3F2 = 2NF3
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
N2+H2=NH3N2 + 3H2 = 2NH3
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
N2+H3= 2N3H9N2 + 2H3 = 6N3H
NaClO + NaHSO3 = NaCl + NaHSO4NaClO + NaHSO3 = NaCl + NaHSO4
Na + O2 = Na2O4Na + O2 = 2Na2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na + O2 = Na2O4Na + O2 = 2Na2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NH 4 NO 3 (aq)=N 2 O(g)+H 2 O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4 Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
Na + L2 = NaL2Na + L2 = 2NaL
N2O+O2 = NO22N2O + 3O2 = 4NO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO3 + I2 = IO3 + NO26NO3 + I2 = 2IO3 + 6NO2
NO3 + I2 = IO3 + NO26NO3 + I2 = 2IO3 + 6NO2
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2 + F2 = NF3N2 + 3F2 = 2NF3
N2+O2=N2O2N2 + O2 = 2N2O
N2+O2=N2O2N2 + O2 = 2N2O
Na3PO4 + CaCl2 = NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHSO3+HCl=SO2+H2O+NaClNaHSO3 + HCl = SO2 + H2O + NaCl
NH4Cl+CaO=NH3+CaCl2+H2O2NH4Cl + CaO = 2NH3 + CaCl2 + H2O
N2 + 3 Cl2 = 2NCl3N2 + 3Cl2 = 2NCl3
Na2S2O3 + H2O2 + NaOH = Na2SO3 + H2ONa2S2O3 + 2H2O2 + 2NaOH = 2Na2SO3 + 3H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S+H3PO4=Na3PO4+H2S3Na2S + 2H3PO4 = 2Na3PO4 + 3H2S
NO2- + NaOH = NaNO2 + OH-NO2- + NaOH = NaNO2 + OH-
NO2- + NaOH = NaNO2 + OH-NO2- + NaOH = NaNO2 + OH-
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaAlO2 + H2 = Al+ NaOH + H2O2NaAlO2 + 3H2 = 2Al + 2NaOH + 2H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na + Cl2 = 2NaCl2Na + Cl2 = 2NaCl
NaOH ( aq ) + H 2 SO 4 ( aq ) =H 2 O ( l ) + Na 2 SO 4 ( aq )2NaOH(aq) + H2SO4(aq) = 2H2O(l) + Na2SO4(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4Cl = NH3 + HClNH4Cl = NH3 + HCl
Na+H2O=H2+NaOH 2Na + 2H2O = H2 + 2NaOH
NaI + BaS = Na2S + BaI22NaI + BaS = Na2S + BaI2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2 + H2 = 2NH3N2 + 3H2 = 2NH3
Na(s)+H2O(l)=Na2O(aq)+H2(g)2Na(s) + H2O(l) = Na2O(aq) + H2(g)
Na(s)+H2O(l)=Na2O(aq)+H2(g)2Na(s) + H2O(l) = Na2O(aq) + H2(g)
NaNO3 + H2SO4 = HNO3 + NaHSO4NaNO3 + H2SO4 = HNO3 + NaHSO4
NaNO3 + H2SO4 = HNO3 + NaHSO4NaNO3 + H2SO4 = HNO3 + NaHSO4
NaOH + I2 = NaI + NaIO + H2O2NaOH + I2 = NaI + NaIO + H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
Na+H2O=NaOH=H22Na + 2H2O = 2NaOH + H2
N2+H3=NH3N2 + 2H3 = 2NH3
NO2 + H2O =HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaHCO3 + H2SO4 = Na2SO4 + CO2 + H2O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
NaHCO3 + H2O =NaOH+ H2CO3NaHCO3 + H2O = NaOH + H2CO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O2O4NH3 + 11O2 = 4NO + 6H2O2O
Ni(ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + S= NaSNa + S = NaS
NaIO3 + NaH2S2O5 = Na2S2O5 + Na2SO4 + I + H2O-1NaIO3 + 3NaH2S2O5 = 5Na2S2O5 - 4Na2SO4 - I + 3H2O
NaIO3 + SNaH2S2O5 = Na2S2O5 + Na2SO4 + I + H2ONaIO3 + 3SNaH2S2O5 = 7Na2S2O5 - 5Na2SO4 + I + 3H2O
Ni + CO = NiO + CNi + CO = NiO + C
NaHCO3+HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na2CO3(s) =Na2O (s) + 2CO2 (g) Na2CO3(s) = Na2O(s) + CO2(g)
NH3+N2O=N2+H2O2NH3 + 3N2O = 4N2 + 3H2O
Na + AlCl3 = NaCl +Al3Na + AlCl3 = 3NaCl + Al
N+H2=NH32N + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + H2SO4 = (NH4) 2SO42NH3 + H2SO4 = (NH4)2SO4
Na2CO3 +H2SO4 =Na2SO4 +CO2 + H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na5P3O10 + H2O = NaO + P2O5 + H2O0Na5P3O10 + H2O = 0NaO + 0P2O5 + H2O
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Ni+CaCO3=NiCO3+CaNi + CaCO3 = NiCO3 + Ca
Na2SO3 + K2Cr2O7 + H2SO4 = Na2SO4 + Cr2(SO4)3 + H2O + K2SO4 3Na2SO3 + K2Cr2O7 + 4H2SO4 = 3Na2SO4 + Cr2(SO4)3 + 4H2O + K2SO4
Na + H2O = NaOH + H2 2Na + 2H2O = 2NaOH + H2
Ni(NO3)2 + Li3(PO4) = Ni(PO4) + Li3(NO3)2Ni(NO3)2 + Li3(PO4) = Ni(PO4) + Li3(NO3)2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na+Cl2=2NaCl2Na + Cl2 = 2NaCl
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO(g)+H2(g)=NH3(g)+H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2+O2 =NON2 + O2 = 2NO
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaOH+H2S=Na2S+H2O2NaOH + H2S = Na2S + 2H2O
NaOH+H2S=H2OH+NaSNaOH + H2S = H2OH + NaS
N2O5 + H2O = 2HNO3N2O5 + H2O = 2HNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2+H2O = NH3+O22N2 + 6H2O = 4NH3 + 3O2
Na3PO4 + Bi(NO3)3 = BiPO4 + NaNO3Na3PO4 + Bi(NO3)3 = BiPO4 + 3NaNO3
NH3+ O2 + H2O = HNO3NH3 + 2O2 - H2O = HNO3
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
N2+3H2=3NH3N2 + 3H2 = 2NH3
Na+F2= NaF2Na + F2 = 2NaF
NaBiO3 + H2SO4 + NaAsO2 = H3AsO4 + H2O + Na2SO4 + Bi2 (SO4) 32NaBiO3 + 5H2SO4 + 2NaAsO2 = 2H3AsO4 + 2H2O + 2Na2SO4 + Bi2(SO4)3
N2+3H2(g) =2NH3(g)N2 + 3H2(g) = 2NH3(g)
N2 + H2 =NH3N2 + 3H2 = 2NH3
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = NaO2Na + O2 = 2NaO
Na3PO4+Mg(C2H3O2)2=NaC2H3O2+Mg3(PO4)22Na3PO4 + 3Mg(C2H3O2)2 = 6NaC2H3O2 + Mg3(PO4)2
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4Cl+Ba(OH)2=BaCl2+NH3+H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
NaOH + NCl3 = HOCl + N2 + NaCl3NaOH + 2NCl3 = 3HOCl + N2 + 3NaCl
NaIO3 + HI = I2 + NaI + H2ONaIO3 + 6HI = 3I2 + NaI + 3H2O
NaNO3(s)=NaNO2(s)+O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaOH+MnO2+NaClO3=NaMnO4+NaCl+H2O2NaOH + 2MnO2 + NaClO3 = 2NaMnO4 + NaCl + H2O
NaOH+MnO2+NaClO3=NaMnO4+NaCl+H2=6NaOH + 6MnO2 + 2NaClO3 = 6NaMnO4 + 2NaCl + 3H2
NH3+HCl = NH4ClNH3 + HCl = NH4Cl
NH4OH + Co2(SO4)3 = (NH4)2SO4 + Co(OH)36NH4OH + Co2(SO4)3 = 3(NH4)2SO4 + 2Co(OH)3
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2 + H2= NH3N2 + 3H2 = 2NH3
NaBr + Ca(OH)2 = CaBr2 + NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NaC2H3O2 + HNO3 = NaNO3 + HC2H3O2NaC2H3O2 + HNO3 = NaNO3 + HC2H3O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
N2+O2=N2O2N2 + O2 = 2N2O
Na2CO3 + HCLO3 = NaCLO3 + CO2 + H2ONa2CO3 + 2HCLO3 = 2NaCLO3 + CO2 + H2O
NaNO3 + Zn + NaOH +H2O =Na Zn(OH)3 + NH3NaNO3 + 4Zn + 3NaOH + 6H2O = 4NaZn(OH)3 + NH3
N2H4+ N2O4=N2+ H2O2N2H4 + N2O4 = 3N2 + 4H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH4Cl+Ca(OH)2=NH3+H2O+CaCl22NH4Cl + Ca(OH)2 = 2NH3 + 2H2O + CaCl2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaI + Pb(SO4)2 = PbI4 + Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaOH +Cl2 = NaCl + NaClO + H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NaOH + FeCl3 = NaCl + Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
Na2O = Na +O22Na2O = 4Na + O2
NH3+H2O=NH4(OH)NH3 + H2O = NH4(OH)
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaNO3= NaNO2 + O22NaNO3 = 2NaNO2 + O2
N2H4 + O2 = NH4 + H2O-1N2H4 + O2 = -2NH4 + 2H2O
NO2 = NO +O22NO2 = 2NO + O2
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH(aq) + MgCl2(aq) = NaCl(aq) + Mg(OH)2(s)2NaOH(aq) + MgCl2(aq) = 2NaCl(aq) + Mg(OH)2(s)
NaOH+H3PO4=Na2HPO4+H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NaOH + H2SO4=Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaOH + H2SO4=Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NCl3+H2O=NH3+HClONCl3 + 3H2O = NH3 + 3HClO
Na2CO3 + Br2 = NaBr + NaBrO3 + CO23Na2CO3 + 3Br2 = 5NaBr + NaBrO3 + 3CO2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2H2(SO3)+Cu(SO4)=Na2(SO4)+Cu2H4(SO3)22Na2H2(SO3) + 2Cu(SO4) = 2Na2(SO4) + Cu2H4(SO3)2
Na2S+Ca(NO3)2 = 2NaNO3 + CaS Na2S + Ca(NO3)2 = 2NaNO3 + CaS
Na2S+Ca(NO3)2 = 2NaNO3 + CaS Na2S + Ca(NO3)2 = 2NaNO3 + CaS
Na2S+Ca(NO3)2 = 2NaNO3 + CaS Na2S + Ca(NO3)2 = 2NaNO3 + CaS
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
N2H2 + H2O = N2 + H2O0N2H2 + H2O = 0N2 + H2O
N2H2 + H2O = N2 + H2O0N2H2 + H2O = 0N2 + H2O
Ni3(PO4)2 + H2SO4 = NiSO4 + H3PO4Ni3(PO4)2 + 3H2SO4 = 3NiSO4 + 2H3PO4
Ni3(PO4)2 + H2SO4 = NiSO4 + H3PO4Ni3(PO4)2 + 3H2SO4 = 3NiSO4 + 2H3PO4
Ni3(PO4)2 + H2SO4 = NiSO4 + H3PO4Ni3(PO4)2 + 3H2SO4 = 3NiSO4 + 2H3PO4
Na+HNO3=NaNO3+H22Na + 2HNO3 = 2NaNO3 + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S + Fe(NO3)2 =NaNO3 + FeSNa2S + Fe(NO3)2 = 2NaNO3 + FeS
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+H2O=NH4OHNH3 + H2O = NH4OH
N2H4 + 2O2 = 2NO2 + 2H2ON2H4 + 3O2 = 2NO2 + 2H2O
N2H4 + 2O2 = 2NO2 + 2H2ON2H4 + 3O2 = 2NO2 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaBiO3 + NaI + H2SO4 = Bi2(SO4)3 + I2 + Na2SO4 + H2O2NaBiO3 + 4NaI + 6H2SO4 = Bi2(SO4)3 + 2I2 + 3Na2SO4 + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2- + H+ = NO3- + NO + H2O3NO2- + 2H+ = NO3- + 2NO + H2O
Na2S(aq)+ZnSO4(aq)=ZnS(s)+Na2SO4(aq)Na2S(aq) + ZnSO4(aq) = ZnS(s) + Na2SO4(aq)
Na2 CO3 + HCIO3=NaCIO3 + CO2 + H2 ONa2CO3 + 2HCIO3 = 2NaCIO3 + CO2 + H2O
Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + 2CO2(g) + H2O(l) Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + CO2(g) + H2O(l)
Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + 2CO2(g) + H2O(l) Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + CO2(g) + H2O(l)
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
Na2S203+H2O2=Na2SO4+H2SO4+H2ONa2S203 + 610H2O2 = Na2SO4 + 202H2SO4 + 408H2O
N2H4 + Br2 = N2 + Br- + HN2H4 + 0Br2 = N2 + 0Br- + 4H
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2CO3 + Pb(NO3)4 = Na2(NO3)4 + PbCO3Na2CO3 + Pb(NO3)4 = Na2(NO3)4 + PbCO3
Na2CO3 + Pb(NO3)4 = 2Na(NO3)2 + PbCO3Na2CO3 + Pb(NO3)4 = 2Na(NO3)2 + PbCO3
NO + Br2 + H2O= HNO2 + Br- + HNO + 0Br2 + H2O = HNO2 + 0Br- + H
NO + Br2 + H= HNO2 + Br- + H2O-1NO + 0Br2 + H = -1HNO2 + 0Br- + H2O
N2 + H2O + e = N2H4 + OH-N2 + 4H2O + 4e = N2H4 + 4OH-
NO3- + H2O+e = NO2+OHNO3- + H2O - e = NO2 + 2OH
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na+I2=NaI2Na + I2 = 2NaI
N2+O2=N2O2N2 + O2 = 2N2O
Na3PO4+Ba(NO3)2=NaNO3+Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
N+H2=NH32N + 3H2 = 2NH3
N2+H2=NHN2 + H2 = 2NH
N2+H2=NHN2 + H2 = 2NH
NH4VO3 + LiNO3 + HNO3 = LiV3O8 + NO3 + NH49NH4VO3 + 3LiNO3 - 4HNO3 = 3LiV3O8 + 0NO3 + 8NH4
NH4VO3 + LiNO3 + HNO3 = LiV2O5 + NO3 + NH46NH4VO3 + 3LiNO3 - 4HNO3 = 3LiV2O5 + 0NO3 + 5NH4
NH4VO3 + LiNO3 + HNO3 = LiV2O5 + NO3 + NH46NH4VO3 + 3LiNO3 - 4HNO3 = 3LiV2O5 + 0NO3 + 5NH4
NH4VO3 + LiNO3 + HNO3 = LiV2O5 + NO3 + NH46NH4VO3 + 3LiNO3 - 4HNO3 = 3LiV2O5 + 0NO3 + 5NH4
NH4VO3 + LiNO3 + HNO3 = LiV2O5 + NO3 + NH46NH4VO3 + 3LiNO3 - 4HNO3 = 3LiV2O5 + 0NO3 + 5NH4
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na + S=Na2S2Na + S = Na2S
N2 + O2 = NON2 + O2 = 2NO
N2 + O2 = NON2 + O2 = 2NO
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4 + S = Na2S2O3 + SO22Na2SO4 + 3S = 2Na2S2O3 + SO2
Na2CuCl4+Cu=NaCuCl2Na2CuCl4 + Cu = 2NaCuCl2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+Na=H2+NaNH22NH3 + 2Na = H2 + 2NaNH2
Ni + 2H3NSO3 = Ni(NH2SO3)2 + H2Ni + 2H3NSO3 = Ni(NH2SO3)2 + H2
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
NH4OH+FeCi3 = NH4Ci + Fe(OH)33NH4OH + FeCi3 = 3NH4Ci + Fe(OH)3
Ni+CoBr2=NiBr2+CoNi + CoBr2 = NiBr2 + Co
Ni+CoBr2=NiBr2+CoNi + CoBr2 = NiBr2 + Co
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaCl + H2SO4 = HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
NaI + Cl2 = NaCl + I22NaI + Cl2 = 2NaCl + I2
NaOH+HCl=H2O+NaClNaOH + HCl = H2O + NaCl
NH4Cl+Ca(OH)2=NH3+CaCl2+H2O2NH4Cl + Ca(OH)2 = 2NH3 + CaCl2 + 2H2O
NH3+H2O=N+H3ONH3 + 3H2O = N + 3H3O
NH3+H2O=NO+HNH3 + H2O = NO + 5H
N2+H3=NH3N2 + 2H3 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + NO2 = N2 + H2O8NH3 + 6NO2 = 7N2 + 12H2O
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
Na+Br2=NaBr2Na + Br2 = 2NaBr
N2 + O2 = N2O2N2 + O2 = 2N2O
NaNO3 = NaNO2 +O22NaNO3 = 2NaNO2 + O2
Na+ H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5 =N2 + O22N2O5 = 2N2 + 5O2
Na2SO4(aq) + MgCl2(aq) = NaCl(aq) + MgSO4(s)Na2SO4(aq) + MgCl2(aq) = 2NaCl(aq) + MgSO4(s)
NaI + MnO2 + H2SO4 = NaSO4 + MnSO4 + H2O + I22NaI + 2MnO2 + 4H2SO4 = 2NaSO4 + 2MnSO4 + 4H2O + I2
NaI+MnO2+H2SO4=Na2SO4+MnSO4+I2+H2O2NaI + MnO2 + 2H2SO4 = Na2SO4 + MnSO4 + I2 + 2H2O
NH4NO3+HNO3=NO2+H2ONH4NO3 + 6HNO3 = 8NO2 + 5H2O
N2O + KClO + KOH = KCl + KNO2 + H2ON2O + 2KClO + 2KOH = 2KCl + 2KNO2 + H2O
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + H2= 2NH3N2 + 3H2 = 2NH3
NaIO3 + NaHSO3 = NaHSO4 + Na2SO4 +H2O + I2 2NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
NO2+O2+H2O= HNO34NO2 + O2 + 2H2O = 4HNO3
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na3PO4+ZnSO4=Na2SO4+Zn3(PO4)22Na3PO4 + 3ZnSO4 = 3Na2SO4 + Zn3(PO4)2
N2+H2=NH3N2 + 3H2 = 2NH3
N2(g) + H2 (g) = NH3 (g)N2(g) + 3H2(g) = 2NH3(g)
NH4+ + MnO2 + 2e = Mn2O3 + NH3 + H2O2NH4+ + 2MnO2 + 2e = Mn2O3 + 2NH3 + H2O
Na+H2O=Na2O+H22Na + H2O = Na2O + H2
NH3(g)+NO2(g)=N2(g)+6H2O(l)8NH3(g) + 6NO2(g) = 7N2(g) + 12H2O(l)
Na 2Cr2O7 + HCl = NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na 2Cr2O7 + FeCl2 + HCl = CrCl3 + FeCl3 + NaCl + H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
Na + Cl2=NaCl2Na + Cl2 = NaCl2
Na + Cl2=NaCl2Na + Cl2 = NaCl2
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + HNa + H2O = NaOH + H
Na + H2O = NaOH + HNa + H2O = NaOH + H
NaF + Ca(C2H3O2)2(aq) = CaF2(s) + 2Na(C2H3O2)(aq)2NaF + Ca(C2H3O2)2(aq) = CaF2(s) + 2Na(C2H3O2)(aq)
Na3Po4 + KOh = NaOh + K3Po4Na3Po4 + 3KOh = 3NaOh + K3Po4
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2SnO4+Bi(OH)3=Bi+Na2SnO3+H2O-3Na2SnO4 + 2Bi(OH)3 = 2Bi - 3Na2SnO3 + 3H2O
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na(s) + Cl2(g) = NaCl(g)2Na(s) + Cl2(g) = 2NaCl(g)
NO(g)+H2O(g)=NH3(g)+O2(g)4NO(g) + 6H2O(g) = 4NH3(g) + 5O2(g)
NH3(g)+O2(g)=N2(g)+H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
N2(g)+O2(g)=NO2(g)N2(g) + 2O2(g) = 2NO2(g)
Na2SO4 +MgN2=NaN+MgSO4Na2SO4 + MgN2 = 2NaN + MgSO4
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaNO3+Cu+H2SO4=CuSO4+NO+Na2SO4+H2O2NaNO3 + 3Cu + 4H2SO4 = 3CuSO4 + 2NO + Na2SO4 + 4H2O
Na2SO4 +NaCl =Na2Cl +Na2SO4Na2SO4 + 0NaCl = 0Na2Cl + Na2SO4
NaOH+Cl2=NaCl+NaClO3+H2O6NaOH + 3Cl2 = 5NaCl + NaClO3 + 3H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO=NaCl+O22NaClO = 2NaCl + O2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na + I2 = NaI2Na + I2 = 2NaI
NH3+Br2=N2+NH4Br8NH3 + 3Br2 = N2 + 6NH4Br
NaOH + Cl= NaClO + NaCl4 + H2O2NaOH + 5Cl = NaClO + NaCl4 + H2O
NaHO2 + Cl= NaClO + NaCl4 + H2O2NaHO2 - Cl = 3NaClO - NaCl4 + H2O
NaIO3+Na2SO3+NaHSO3=I2+Na2SO4+H2O2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NiS+O2=NiO+SO22NiS + 3O2 = 2NiO + 2SO2
NaCl + Fe(ClO4)3 = NaClO4 + FeCl33NaCl + Fe(ClO4)3 = 3NaClO4 + FeCl3
NH4Cl+Ca(OH)2=CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S+MnSO4=MnS+Na2SO4Na2S + MnSO4 = MnS + Na2SO4
Na2S+MnSO4=MnS+Na2SO4Na2S + MnSO4 = MnS + Na2SO4
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na(s)+O2(g)=NaO(s)2Na(s) + O2(g) = 2NaO(s)
Na(s)+O2(g)=NaO(s)2Na(s) + O2(g) = 2NaO(s)
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaOH+Zn(NO3)2=NaNO3+Zn(OH)22NaOH + Zn(NO3)2 = 2NaNO3 + Zn(OH)2
NH3+CO2=CO(NH2)2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
NaOH(aq)+CO2(s)=Na2CO3(aq)+H2O(l)2NaOH(aq) + CO2(s) = Na2CO3(aq) + H2O(l)
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+I2=N2I6+H22NH3 + 3I2 = N2I6 + 3H2
NaI+CuCl2=NaCl+CuI+I2NaI + CuCl2 = 2NaCl + CuI + I
Na2C2O4 + KMnO4 + H2SO4 = K2SO4 + Na2SO4 + MnSO4 + CO2 + H2O5Na2C2O4 + 2KMnO4 + 8H2SO4 = K2SO4 + 5Na2SO4 + 2MnSO4 + 10CO2 + 8H2O
N2O + KClO + KOH = KCl + KNO2 + H2ON2O + 2KClO + 2KOH = 2KCl + 2KNO2 + H2O
N2 + 2O2 = 2NO2N2 + 2O2 = 2NO2
N2 + 6H2 = 2NH3 N2 + 3H2 = 2NH3
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na2TeO3+NaI+HCl=NaCl+Te+I2+H2ONa2TeO3 + 4NaI + 6HCl = 6NaCl + Te + 2I2 + 3H2O
NaIO3+SO2+H2O=NaHSO4+H2SO4+I22NaIO3 + 5SO2 + 4H2O = 2NaHSO4 + 3H2SO4 + I2
NH3N + O2 = HNO3 + H2O4NH3N + 13O2 = 8HNO3 + 2H2O
N2 (g) + H2 (g) = NH3 (g)N2(g) + 3H2(g) = 2NH3(g)
N2 (g) + O2 (g) = N2O4N2(g) + 2O2(g) = N2O4
NH3N + O2 = NO + H2O4NH3N + 7O2 = 8NO + 6H2O
NH3N + O2 = NO2 + H2O4NH3N + 11O2 = 8NO2 + 6H2O
NH3N + O2 = NO3 + H2O4NH3N + 15O2 = 8NO3 + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaL (s) = Na (s) + L2 (s)2NaL(s) = 2Na(s) + L2(s)
NHO3+NaHCO3=NaNO3+H2O+CO2NHO3 + NaHCO3 = NaNO3 + H2O + CO2
Na (aq)+H2O=Na2O(s)+H2 (g)2Na(aq) + H2O = Na2O(s) + H2(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NH3+NHO3=N2+H2O5NH3 + 3NHO3 = 4N2 + 9H2O
Na2CO3 + HCl = NaCl + CO2 +H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2CO3 + HCl = NaCl + CO2 +H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
N2+H2=HN33N2 + H2 = 2HN3
Na2O + 2CO2 = Na2CO3Na2O + CO2 = Na2CO3
Na+B2O3=Na2O+B6Na + B2O3 = 3Na2O + 2B
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaIO3 + NaHSO3=NaHSO4 + Na2SO4 + H2O + I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+F2=NF3N2 + 3F2 = 2NF3
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2 =N2O+NH3NH3 + 0O2 = 0N2O + NH3
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
NbI3+I2=NbI5NbI3 + I2 = NbI5
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+S8=Na2S16Na + S8 = 8Na2S
Na2(SO4)+CaCl2=NaCl+Ca(SO4)Na2(SO4) + CaCl2 = 2NaCl + Ca(SO4)
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
Na2(SO4)+CaCl2=NaCl+Ca(SO4)Na2(SO4) + CaCl2 = 2NaCl + Ca(SO4)
Na2O + H2SO4 = Na2SO4 + H2ONa2O + H2SO4 = Na2SO4 + H2O
NO2 + H2O = HNO3 + O2-4NO2 - 2H2O = -4HNO3 + O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Ni(OH)3+K2SnO2=K2SnO3+Ni+H2O2Ni(OH)3 + 3K2SnO2 = 3K2SnO3 + 2Ni + 3H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NH3 + O2 = H2O + NO24NH3 + 7O2 = 6H2O + 4NO2
NaOH+H2O=H3O+Na2O2NaOH - H2O = 0H3O + Na2O
N2O5+FeO = NO2+Fe2O3N2O5 + 2FeO = 2NO2 + Fe2O3
N2(g) + H2(g) = NH3(g) N2(g) + 3H2(g) = 2NH3(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2S2O3+I2=NaS4O6+NaI4Na2S2O3 + 3I2 = 2NaS4O6 + 6NaI
N2O=N2+O22N2O = 2N2 + O2
Na2Cr2O7+NaCl+H2SO4=Cr2(SO4)3+Na2SO4+H20+Cl20Na2Cr2O7 + 20NaCl + 10H2SO4 = 0Cr2(SO4)3 + 10Na2SO4 + H20 + 10Cl2
NH3= N2+H22NH3 = N2 + 3H2
NH3= N2+H22NH3 = N2 + 3H2
Na3PO4 + 3CuSO4 = Cu3(PO4)2 + Na2SO42Na3PO4 + 3CuSO4 = Cu3(PO4)2 + 3Na2SO4
Na+Cl2=NaCl2Na + Cl2 = 2NaCl

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.