Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + HNO2 = H2O + Na + N-3NaOH + HNO2 = -1H2O - 3Na + N
Na(s) + Br2(l) = NaBr(s)2Na(s) + Br2(l) = 2NaBr(s)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaN3=Na+N22NaN3 = 2Na + 3N2
N2 H4 + N2 O4 = H2 O + N22N2H4 + N2O4 = 4H2O + 3N2
N H4 N O3 = N2 + O2 + H2 O2NH4NO3 = 2N2 + O2 + 4H2O
NaClO+H2O2=NaClO2 +H2ONaClO + H2O2 = NaClO2 + H2O
NaClO+H2O2=NaClO2 +H1O0NaClO + H2O2 = 0NaClO2 + 2H1O
NaClO+H2O2=NaClO2 +H2O20NaClO + H2O2 = 0NaClO2 + H2O2
NaClO+H2O2=NaClO2 +H2ONaClO + H2O2 = NaClO2 + H2O
NaClO+H2O2=NaClO2 +H2O20NaClO + H2O2 = 0NaClO2 + H2O2
NaClO+H2O2=NaClO2 +H2O20NaClO + H2O2 = 0NaClO2 + H2O2
NaClO+H2O2=NaClO2 +H+ +O-1NaClO + 0H2O2 = -1NaClO2 + 0H+ + O
NaClO+H2O2=NaClO+ +H+ +O-2NaClO + H2O2 = -2NaClO+ + 2H+ + 2O
NaClO+H2O2=NaClO++++H+++O-4NaClO + 3H2O2 = -4NaClO+++ + 6H++ + 6O
NaClO+H2O2=NaClO2+H2ONaClO + H2O2 = NaClO2 + H2O
NaClO+H2O2=NaClO2+H2ONaClO + H2O2 = NaClO2 + H2O
NH3+02 = N0+H200NH3+02 = -1N0 + H20
NiS+O2=SO2+NiO(s)2NiS + 3O2 = 2SO2 + 2NiO(s)
NiS+O2=SO2+Ni(s)NiS + O2 = SO2 + Ni(s)
NaSO4 + Fe3+ = Fe + SO4 + Na NaSO4 + 0Fe3+ = 0Fe + SO4 + Na
NaSO4 + Fe3+ = Fe + SO4 + Na NaSO4 + 0Fe3+ = 0Fe + SO4 + Na
NaSO4 + Al3+ = Al + SO4 + NaNaSO4 + 0Al3+ = 0Al + SO4 + Na
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na+O2=Na2O4Na + O2 = 2Na2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + O = NaONa + O = NaO
NaCO3 + Ca(OH) = NaOH + CaCO3NaCO3 + Ca(OH) = NaOH + CaCO3
NaBr + Ca3(PO4)2 = CaBr2 + Na3PO46NaBr + Ca3(PO4)2 = 3CaBr2 + 2Na3PO4
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaH+B2H6=NaBH42NaH + B2H6 = 2NaBH4
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na(OH)+I2=NaI+NaIO3+H2O6Na(OH) + 3I2 = 5NaI + NaIO3 + 3H2O
NH4VO3 + HNO3 = VO3NO3 + NO2 + H2ONH4VO3 + 10HNO3 = VO3NO3 + 10NO2 + 7H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+CO2=Na2CO3+CO2Na + 2CO2 = Na2CO3 + CO
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + O2 = Na2O22Na + O2 = Na2O2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 + CuSO4 = Na2SO4 + CuCO3Na2CO3 + CuSO4 = Na2SO4 + CuCO3
Na2CO3 + CuSO4 = Na2SO4 + CuCO3Na2CO3 + CuSO4 = Na2SO4 + CuCO3
Na2SO3 + KMnO4+NaHSO4=Na2SO4+MnSO4+K2SO4+H2O5Na2SO3 + 2KMnO4 + 6NaHSO4 = 8Na2SO4 + 2MnSO4 + K2SO4 + 3H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaO2 +2H2O=4NaOH +3O24NaO2 + 2H2O = 4NaOH + 3O2
NaO2 +2H2O=4NaOH +3O24NaO2 + 2H2O = 4NaOH + 3O2
NaO2 +2H2O=4NaOH +3O24NaO2 + 2H2O = 4NaOH + 3O2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaL+Br2=NaBr+L22NaL + Br2 = 2NaBr + L2
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3 + Br + NaOH = N + NaBr + H2ONH3 + 3Br + 3NaOH = N + 3NaBr + 3H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NH4NO3 (aq) = N2 (g) + O2 (g) + 2 H2O (l)2NH4NO3(aq) = 2N2(g) + O2(g) + 4H2O(l)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(NO3)3 + PbBr4 = NiBr3 + Pb(NO3)44Ni(NO3)3 + 3PbBr4 = 4NiBr3 + 3Pb(NO3)4
NH4VO3 + HNO3 = VO3NO3 + NO2 + H2ONH4VO3 + 10HNO3 = VO3NO3 + 10NO2 + 7H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
N2+O2=NO2N2 + 2O2 = 2NO2
N2+O2=N2O2N2 + O2 = N2O2
N2+O2=2NON2 + O2 = 2NO
Na (s) + MgF2 =2NaF (s) + Mg (s)2Na(s) + MgF2 = 2NaF(s) + Mg(s)
Na (s) + O2 (g) = Na2O4Na(s) + O2(g) = 2Na2O
Na3PO4 + Ca(OH)2 = NaOH + (PO4)2Ca32Na3PO4 + 3Ca(OH)2 = 6NaOH + (PO4)2Ca3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g) = N2(g) + H2(g)2NH3(g) = N2(g) + 3H2(g)
Na + 2H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + FeCr2O4 + O2 = Fe2O3 + Na2CrO4 + CO38Na2CO3 + 4FeCr2O4 + 11O2 = 2Fe2O3 + 8Na2CrO4 + 8CO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
NH4NO3 = N2O + 2H2ONH4NO3 = N2O + 2H2O
NaOH+CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
NH3+O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH3+O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Ni(NO6)2 +NaOH = Ni(OH)2 +NaNO6Ni(NO6)2 + 2NaOH = Ni(OH)2 + 2NaNO6
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NH3 + O2 =NO+ H2O4NH3 + 5O2 = 4NO + 6H2O
NO + O2 =NO22NO + O2 = 2NO2
NiS+O2 = NiO + SO22NiS + 3O2 = 2NiO + 2SO2
Na2O+P4O10=Na3PO46Na2O + P4O10 = 4Na3PO4
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2CO3+ 2HNO3 = 2NaNO3 + H2O +CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH4Cl + MgO = (NH4)2O + MgCl22NH4Cl + MgO = (NH4)2O + MgCl2
NH4Cl + MgO = (NH4)2O + MgCl22NH4Cl + MgO = (NH4)2O + MgCl2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O3=NO+H2O6NH3 + 5O3 = 6NO + 9H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2O2=H2O+ Na2O22NaOH + H2O2 = 2H2O + Na2O2
NaOH+H2O2=H2O+ NaO2NaOH + H2O2 = 2H2O + 2NaO
NaOH+H2O2=H2O+ Na2O2NaOH + 0H2O2 = H2O + Na2O
NaOH+H2O2=H2O+ Na2O22NaOH + H2O2 = 2H2O + Na2O2
NH4I + Cl2 = NH4Cl + I22NH4I + Cl2 = 2NH4Cl + I2
NH3 + Cl2 +H2O = NH4Cl + H2O0NH3 + 0Cl2 + H2O = 0NH4Cl + H2O
NaH+B2H6=NaBH42NaH + B2H6 = 2NaBH4
NaH+B2H6=NaBH42NaH + B2H6 = 2NaBH4
Na2SO3+S8=Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
NO +Cl2=NOCl2NO + Cl2 = 2NOCl
N2O5 + H2O = 5HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = 1HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = 2 HNO3N2O5 + H2O = 2HNO3
NaOH+H2O2= Na2O2+H2O2NaOH + H2O2 = Na2O2 + 2H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3 = N2+ H22NH3 = N2 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NiCn + LiC2H3O2 = NiC2H3O2 + LiCnNiCn + LiC2H3O2 = NiC2H3O2 + LiCn
Na + Br2 = NaBr2Na + Br2 = 2NaBr
Na + Br2 = NaBr2Na + Br2 = 2NaBr
Na + Br2 = NaBr2Na + Br2 = 2NaBr
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na3PO4(aq) + MgCl2(aq) = Mg3(PO4)2 + NaCl2Na3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2 + 6NaCl
Na3PO4 + MgCl2 = Mg3(PO4)2 + NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
NaOH+HNO3=H2O+NaNO3NaOH + HNO3 = H2O + NaNO3
NO2 + H2O = H3NO3 + NO-1NO2 - 3H2O = -2H3NO3 + NO
Na + Cl2 = 2 NaCl2Na + Cl2 = 2NaCl
Ni2O3 + CO = Ni + CO2Ni2O3 + 3CO = 2Ni + 3CO2
Ni2O3 + CO = Ni + CO2Ni2O3 + 3CO = 2Ni + 3CO2
Na + H2O = NaOH + H2O0Na + H2O = 0NaOH + H2O
NHO3+S=NO2+H2O+H2SO46NHO3 + S = 6NO2 + 2H2O + H2SO4
NH3+Cl2=NH4Cl+N28NH3 + 3Cl2 = 6NH4Cl + N2
NH3+O2=NO2+H2020NH3 + 20O2 = 20NO2 + 3H20
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH +CO2 = Na2CO3 + H2O 2NaOH + CO2 = Na2CO3 + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4Cl + Ca(OH)2 = NH3 + HOH + CaCl22NH4Cl + Ca(OH)2 = 2NH3 + 2HOH + CaCl2
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2 + H2=NH3N2 + 3H2 = 2NH3
Na2CO3+NO+O2=NaNO2+CO22Na2CO3 + 4NO + O2 = 4NaNO2 + 2CO2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO + O2 = NO22NO + O2 = 2NO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Ni + 2Ag+ = Ni2+ + 2Ag2Ni + Ag+ = Ni2+ + Ag
Ni + 2Ag+ = Ni2+ + 2Ag2Ni + Ag+ = Ni2+ + Ag
NO2(g)+H2O(l)=NO(g)+HNO3(aq)3NO2(g) + H2O(l) = NO(g) + 2HNO3(aq)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+Cl2=NH4Cl+N28NH3 + 3Cl2 = 6NH4Cl + N2
Na2NH+H2O=NH3+NaOHNa2NH + 2H2O = NH3 + 2NaOH
N2(g)+O2(g)=NO2(g)N2(g) + 2O2(g) = 2NO2(g)
NaOH+Cl2=NaClO3+H20+NaCl60NaOH + 30Cl2 = 20NaClO3 + 3H20 + 40NaCl
NaOH + H3PO4 = NaH2PO4 + H2ONaOH + H3PO4 = NaH2PO4 + H2O
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2CO3 + CO2 + H2O = NaHCO3Na2CO3 + CO2 + H2O = 2NaHCO3
NaOH=Na2O + H2O2NaOH = Na2O + H2O
Na2CO3 + CuSO4 = Na2SO4 + CuCO3Na2CO3 + CuSO4 = Na2SO4 + CuCO3
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NO2 + NO3 = N2O5NO2 + NO3 = N2O5
NO2 + NO3 = N2O5NO2 + NO3 = N2O5
NaCl = Cl2 + Na2NaCl = Cl2 + 2Na
N2 + O2 = N1O1N2 + O2 = 2N1O1
NO = N2 + O22NO = N2 + O2
NaOH = Na2O + H2O2NaOH = Na2O + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2Cr2O7+AlPO4=Na3PO4+Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
Ni(NO3)3+PbBr4=NiBr3+Pb(NO3)44Ni(NO3)3 + 3PbBr4 = 4NiBr3 + 3Pb(NO3)4
NaHCO3+NaH2PO4=Na2H2P2O7+CO2+H2O0NaHCO3 + 2NaH2PO4 = Na2H2P2O7 + 0CO2 + H2O
NaHCO3+NaH2PO4=Na2HPO4+CO2+H2ONaHCO3 + NaH2PO4 = Na2HPO4 + CO2 + H2O
Na2CrO4+Pb(NO3)2=NaNO3+PbCrO4Na2CrO4 + Pb(NO3)2 = 2NaNO3 + PbCrO4
NaI + Cr(NO3)3 = NaNO3 + CrI33NaI + Cr(NO3)3 = 3NaNO3 + CrI3
Na2CrO4 + AgNO3 = NaNO3 + Ag2CrO4Na2CrO4 + 2AgNO3 = 2NaNO3 + Ag2CrO4
NaI + Pb(NO3)2 = NaNO3 + PbI22NaI + Pb(NO3)2 = 2NaNO3 + PbI2
NaI + Cr(NO3)3 = NaNO3 + CrI33NaI + Cr(NO3)3 = 3NaNO3 + CrI3
NaI + AgNO3 = NaNO3 + AgINaI + AgNO3 = NaNO3 + AgI
Na3PO4 + Pb(NO3)2 = NaNO3 + Pb3 (PO4)22Na3PO4 + 3Pb(NO3)2 = 6NaNO3 + Pb3(PO4)2
Na3PO4 + Cr(NO3)3 = NaNO3 + CrPO4Na3PO4 + Cr(NO3)3 = 3NaNO3 + CrPO4
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NaI + AgNO3 = NaNO3 + AgINaI + AgNO3 = NaNO3 + AgI
Na3PO4(aq) + NiCl2 (aq)= Na3Cl2 + Ni (PO4)Na3PO4(aq) + NiCl2(aq) = Na3Cl2 + Ni(PO4)
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 =NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N H3 + O2 = N2 + H2 O4NH3 + 3O2 = 2N2 + 6H2O
Na + O2 = Na2 O4Na + O2 = 2Na2O
Na + O2 = Na2 O4Na + O2 = 2Na2O
NAIO3 + NA2SO3 = NAI + NA2SO4NAIO3 + 3NA2SO3 = NAI + 3NA2SO4
NO2 +FeCl3 = FeNO2 +Cl3NO2 + FeCl3 = FeNO2 + Cl3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Ni + Ag (NO3) = Ni (NO3) + AgNi + Ag(NO3) = Ni(NO3) + Ag
Ni + Fe Cl3 = Ni Cl3 + FeNi + FeCl3 = NiCl3 + Fe
Ni2 + Fe Cl3 = Ni2 Cl3 + FeNi2 + FeCl3 = Ni2Cl3 + Fe
Ni + K4 Fe (CN) = Ni Fe (CN) + K4Ni + K4Fe(CN) = NiFe(CN) + K4
Ni + 2Na (OH) = Ni(OH)2 + 2NaNi + 2Na(OH) = Ni(OH)2 + 2Na
Ni + 2NH4 (SCN) = Ni(SCN)2 + 2NH4Ni + 2NH4(SCN) = Ni(SCN)2 + 2NH4
Ni2 + 2NH4 (SCN) = Ni(SCN)2 + 2NH4Ni2 + 4NH4(SCN) = 2Ni(SCN)2 + 4NH4
Ni + Na2 (CO3) = Ni CO3 + 2NaNi + Na2(CO3) = NiCO3 + 2Na
Ni + Hg Cl2 = Ni Cl2 + HgNi + HgCl2 = NiCl2 + Hg
Ni2 + Hg Cl2 = Ni Cl2 + HgNi2 + 2HgCl2 = 2NiCl2 + 2Hg
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2 CO3 + NaOH = Na2 OH+NaCO3 Na2CO3 + NaOH = Na2OH + NaCO3
N H3 + F2 = N2 F4 + H F2NH3 + 5F2 = N2F4 + 6HF
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=NON2 + O2 = 2NO
Na+Br2=NaBr2Na + Br2 = 2NaBr
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
N2+O2=NO2N2 + 2O2 = 2NO2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2 + H2O =HNO3 + NO 3NO2 + H2O = 2HNO3 + NO
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+F2=NF3N2 + 3F2 = 2NF3
N2+F2=NF2N2 + 2F2 = 2NF2
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
N+H=NH3N + 3H = NH3
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NO+O2=NO22NO + O2 = 2NO2
NH3=N2+H22NH3 = N2 + 3H2
NaOH+MgBr2=Mg(OH)2+NaBr2NaOH + MgBr2 = Mg(OH)2 + 2NaBr
Na2Cr2O7+AlPO4=Na3PO4+Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
NaCl+MnO2+H2SO4=NaHSO4+MnSO4+H2O+Cl22NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NaN3=Na+N22NaN3 = 2Na + 3N2
NH4I + Cl2 =NH4Cl + I2 2NH4I + Cl2 = 2NH4Cl + I2
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NaCl=Na2+Cl22NaCl = Na2 + Cl2
Na2B4O7+H2SO4+H2O=H3BO3+Na2SO4Na2B4O7 + H2SO4 + 5H2O = 4H3BO3 + Na2SO4
NaOH+KNO3=NaNO3+KOHNaOH + KNO3 = NaNO3 + KOH
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
NCl3=N2+Cl22NCl3 = N2 + 3Cl2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2 + O2 = N2O2N2 + O2 = N2O2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3=N2+H22NH3 = N2 + 3H2
Na2CO3+Ga(NO2)3=Ga2(CO3)3+NaNO23Na2CO3 + 2Ga(NO2)3 = Ga2(CO3)3 + 6NaNO2
Na + S = NaSNa + S = NaS
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na+Mg(NO3)2=Mg+NaNO32Na + Mg(NO3)2 = Mg + 2NaNO3
Na+O2=Na2O4Na + O2 = 2Na2O
NH4Cl + NaOH = NH4OH + NaClNH4Cl + NaOH = NH4OH + NaCl
N2 + O2 = N2O2N2 + O2 = 2N2O
Na +Br2 = NaBr2Na + Br2 = 2NaBr
N2 + H2O = H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
N2O = N2+O22N2O = 2N2 + O2
N2+O2 =N2O2N2 + O2 = 2N2O
NaOH + CO2 = H2CO3 + Na2O2NaOH + CO2 = H2CO3 + Na2O
NaOH + CO2 = H2CO3 + Na2O2NaOH + CO2 = H2CO3 + Na2O
NH3 + HNO2 = N2 + H2ONH3 + HNO2 = N2 + 2H2O
NH4VO3 + HNO3 = VO2NO3 + NO2 + H2ONH4VO3 + 8HNO3 = VO2NO3 + 8NO2 + 6H2O
NH4VO3 + HNO3 = VO3NO3 + NO2 + H2ONH4VO3 + 10HNO3 = VO3NO3 + 10NO2 + 7H2O
NH4VO3 + HNO3 = VO4NO3 + NO2 + H2ONH4VO3 + 12HNO3 = VO4NO3 + 12NO2 + 8H2O
N2O5(g)=NO2(g)+O2(g)2N2O5(g) = 4NO2(g) + O2(g)
N2O5(g)=NO2(g)+O2(g)2N2O5(g) = 4NO2(g) + O2(g)
NH4NO3 = N2 + O2 +H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 +H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 +H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2CrO4(aq)+Pb(NO3)2(aq)=PbCrO4(s)+NaNO3(aq)Na2CrO4(aq) + Pb(NO3)2(aq) = PbCrO4(s) + 2NaNO3(aq)
NH4OH + H2C2O4 = NH4C2O4 + H2OHNH4OH + H2C2O4 = NH4C2O4 + H2OH
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH4OH + KAl(SO4)2 * 12H2O = Al(OH)3 + (NH4)2SO4 + KOH + H2O4NH4OH + KAl(SO4)2*12H2O = Al(OH)3 + 2(NH4)2SO4 + KOH + 12H2O
NH4OH + KAl(SO4)2 * 12H2O = Al(OH)3 + (NH4)2SO4 + KOH + H2O4NH4OH + KAl(SO4)2*12H2O = Al(OH)3 + 2(NH4)2SO4 + KOH + 12H2O
Na2CO3 + NaClO + Cr(OH)3 = Na2CrO4 + NaCl + CO2 + H2O2Na2CO3 + 3NaClO + 2Cr(OH)3 = 2Na2CrO4 + 3NaCl + 2CO2 + 3H2O
NaClO=NaCl+NaClO33NaClO = 2NaCl + NaClO3
NaClO=NaCl+NaClO33NaClO = 2NaCl + NaClO3
NaHCO3 + CH3COOH = CO2 + H2O + NaC2H3O2NaHCO3 + CH3COOH = CO2 + H2O + NaC2H3O2
Na+AgNO3=Na2NO3+Ag2Na + AgNO3 = Na2NO3 + Ag
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaI+Hg2(C2H3O2)2=Hg2I2+2Na(C2H3O2)2NaI + Hg2(C2H3O2)2 = Hg2I2 + 2Na(C2H3O2)
N2+H2=NH3N2 + 3H2 = 2NH3
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2SO4(aq)+CaI2(aq)=CaSO4(s)+2NaI(aq)Na2SO4(aq) + CaI2(aq) = CaSO4(s) + 2NaI(aq)
N2 + H2 =NH3N2 + 3H2 = 2NH3
NaCl + MnO2 + H2SO4 = NaHSO4 + Cl2 + MnSO4 + H2O2NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + Cl2 + MnSO4 + 2H2O
NH3+I2=N2I6+H22NH3 + 3I2 = N2I6 + 3H2
NaOH+H2SO4=H2O+Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaIO3+NaHSO3=NaHSO4+Na2SO4+H2O+I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
NaCl +Ag2SO4=Na2SO4+AgCl2NaCl + Ag2SO4 = Na2SO4 + 2AgCl
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NaCl+AgNO3=Na(NO3)+AgClNaCl + AgNO3 = Na(NO3) + AgCl
N2+H2 =NH3N2 + 3H2 = 2NH3
N2+H2 =NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4ClO4=(N2)+(Cl2)+(O2)+(H2O)2NH4ClO4 = (N2) + (Cl2) + 2(O2) + 4(H2O)
NO 2 (g)+H 2 O(l)=HNO 3 (aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaCl + Ag2SO4 = Na2SO4 + AgCl2NaCl + Ag2SO4 = Na2SO4 + 2AgCl
Ni (ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
NaCl + Ag2SO4 = Na2SO4 + AgCl2NaCl + Ag2SO4 = Na2SO4 + 2AgCl
NaHCO3 + HCl= NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NaO + H2O = Na(OH)2NaO + H2O = Na(OH)2
NaO + H2O = NaOH + O24NaO + 2H2O = 4NaOH + O2
Ni (ClO3)2 = NiCl2 + O2 Ni(ClO3)2 = NiCl2 + 3O2
Ni + O2 = Ni2O34Ni + 3O2 = 2Ni2O3
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaI + 2AgNO3 =NaNO3+ AgINaI + AgNO3 = NaNO3 + AgI
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaI + Pb(SO4)2 = PbI4 + Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NaI + Cl = NaCl + INaI + Cl = NaCl + I
N + H = NH3N + 3H = NH3
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaI + Pb(SO4)2 = PbI4 + Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
Ni + O2 = Ni2O34Ni + 3O2 = 2Ni2O3
NO2 + O2 + H2O = HNO34NO2 + O2 + 2H2O = 4HNO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
Ni + O2 = Ni2O34Ni + 3O2 = 2Ni2O3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NaBH4+BF3=NaBF4+B2H63NaBH4 + 4BF3 = 3NaBF4 + 2B2H6
NaCl(aq) + AgNO3(aq) = NaNO3(aq) +AgClNaCl(aq) + AgNO3(aq) = NaNO3(aq) + AgCl
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaCo3 + Cr (No3) 3=Na (No3) 3 + CrCo3NaCo3 + Cr(No3)3 = Na(No3)3 + CrCo3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHCO3=CO2+H2O + Na2CO32NaHCO3 = CO2 + H2O + Na2CO3
NO2 + NaOH = NaNO3 + NaNO2 + H2O2NO2 + 2NaOH = NaNO3 + NaNO2 + H2O
NO2 + Ca(OH)2 = Ca(NO3)2 + Ca(NO2)2 + H2O4NO2 + 2Ca(OH)2 = Ca(NO3)2 + Ca(NO2)2 + 2H2O
N2H4(l)= NH3(g) + N2(g) 3N2H4(l) = 4NH3(g) + N2(g)
NH3 + O2 + H2O = HNO3NH3 + 2O2 - H2O = HNO3
N2H4(l)= NH3(g) + N2(g) 3N2H4(l) = 4NH3(g) + N2(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 + H2O = HNO3NH3 + 2O2 - H2O = HNO3
N2+F2=NF3N2 + 3F2 = 2NF3
N2O+H2O=NH4NO3N2O + 2H2O = NH4NO3
N2O+H2O=NH4NO3N2O + 2H2O = NH4NO3
N2O + H2O = NH4NO3N2O + 2H2O = NH4NO3
Na3PO4 + KOH = NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH4Cl + MgO = (NH4)2O + MgCl22NH4Cl + MgO = (NH4)2O + MgCl2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
N2O5(s) + Ca(OH)2(aq) = Ca(NO3)2 + H2ON2O5(s) + Ca(OH)2(aq) = Ca(NO3)2 + H2O
Na+Cl2= NaCl2Na + Cl2 = 2NaCl
Na+Cl= NaClNa + Cl = NaCl
Na + Cl= NaClNa + Cl = NaCl
NaOH(aq) + K2SO4(aq) = Na2SO4 + KOH2NaOH(aq) + K2SO4(aq) = Na2SO4 + 2KOH
N2+O2 = NO2N2 + 2O2 = 2NO2
N2O=N2+O22N2O = 2N2 + O2
Ni+O2 = Ni2 O34Ni + 3O2 = 2Ni2O3
Na2C2O4 + NH4(NO3)2 =Na(NO3) + NH4C2O4Na2C2O4 + NH4(NO3)2 = 2Na(NO3) + NH4C2O4
Ni2O3 + H2(SO4) = Ni2(SO4)3 + H2ONi2O3 + 3H2(SO4) = Ni2(SO4)3 + 3H2O
Na2O+HNO3=NaNO3+H2ONa2O + 2HNO3 = 2NaNO3 + H2O
N2O=N2=O22N2O = 2N2 + O2
NH4PO4+BaCl=NH4Cl+BaPO4NH4PO4 + BaCl = NH4Cl + BaPO4
N5O=N2O+O-2N5O = -5N2O + 3O
N2O=N+ON2O = 2N + O
N2O5+H2O=HNO2+HNO3N2O5 + H2O = 0HNO2 + 2HNO3
N2O5+H2O=HNO2+HNO3N2O5 + H2O = 0HNO2 + 2HNO3
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na3PO4+MgCl2=Mg3(PO4)2+NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NH4NO2 = N2 + 2H2ONH4NO2 = N2 + 2H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+H3PO4=(NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NH3+H3+PO4=(NH4)3PO43NH3 + H3 + PO4 = (NH4)3PO4
NaI+Pb(NO3)2=PbI2+NaNO32NaI + Pb(NO3)2 = PbI2 + 2NaNO3
Na + Cl + H2O = NaO + ClHNa + 2Cl + H2O = NaO + 2ClH
NH3 + O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 + H2SO4 = Na2SO4 + CO2 + H2O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH3 + H2O = NH4 + OHNH3 + H2O = NH4 + OH
NH3(g) + O2(g) = NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaI + Pb(SO4)2 = PbI4 + Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NaI + Hg2(C2H3O2)2 = Hg2I + Na(C2H3O2)2NaI + Hg2(C2H3O2)2 = Hg2I + Na(C2H3O2)2
N2 + 3 H2 = 2 NH3N2 + 3H2 = 2NH3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NpF3+O2+HF=NpF4+H2O4NpF3 + O2 + 4HF = 4NpF4 + 2H2O
NaPb+C2H5Cl=Pb(C2H5)4+Pb+NaCl4NaPb + 4C2H5Cl = Pb(C2H5)4 + 3Pb + 4NaCl
NH4Cl+CaO=NH3+CaCl2+H2O2NH4Cl + CaO = 2NH3 + CaCl2 + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaF+CaO+H2O=CaF2+NaOH2NaF + CaO + H2O = CaF2 + 2NaOH
Na+ZnI2=NaI+NaZn49Na + 4ZnI2 = 8NaI + NaZn4
NH4NO3 + LiOH = LiNO3 + NH4OHNH4NO3 + LiOH = LiNO3 + NH4OH
NH4NO3 + LiOH = LiNO3 + H2O + NH49NH4NO3 + 10LiOH = 10LiNO3 + 7H2O + 8NH4
NH3+O2=N2H4+H2O4NH3 + O2 = 2N2H4 + 2H2O
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NH3 + O2 = NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + Cl = NaClNa + Cl = NaCl
NH4Cl + MgO = (NH4)2O + MgCl22NH4Cl + MgO = (NH4)2O + MgCl2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni + NaCl + H2O = NiCl2+NaOH+H2Ni + 2NaCl + 2H2O = NiCl2 + 2NaOH + H2
Ni(NO3)2+Na2C2O4=NiC2O4+NO3NaNi(NO3)2 + Na2C2O4 = NiC2O4 + 2NO3Na
Na2S2O3+HCl=NaCl+S+SO2+H2ONa2S2O3 + 2HCl = 2NaCl + S + SO2 + H2O
N2(g) + O2(g) = NO(g)N2(g) + O2(g) = 2NO(g)
NH4Cl + Na2S = NaCl + NH3 + H2S2NH4Cl + Na2S = 2NaCl + 2NH3 + H2S
N2H4 + H2O2=N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
Na+ + Cl- = NaClNa+ + Cl- = NaCl
NH4Cl + Na2S=NaCl + NH3 + H2S2NH4Cl + Na2S = 2NaCl + 2NH3 + H2S
Na + S = Na2 S2Na + S = Na2S
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NACL+2SO2=CLO2+NASNACL + SO2 = CLO2 + NAS
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4 =NH3+N23N2H4 = 4NH3 + N2
NH3+ O2= N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4+NO3=N2O=H2ONH4 + NO3 = N2O + 2H2O
N2H4 + O3 = NO + H2O3N2H4 + 4O3 = 6NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + O2 = Na2O22Na + O2 = Na2O2
Na3Po4 + Ca = Ca3(Po4)2 + Na2Na3Po4 + 3Ca = Ca3(Po4)2 + 6Na
NaCH3COO(aq) + CaI2(aq) = NaI2 + CaCH3COONaCH3COO(aq) + CaI2(aq) = NaI2 + CaCH3COO
Na2CO3(aq)+2HCl(aq)=2NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NaN3=Na+N22NaN3 = 2Na + 3N2
NaOH + H3PO3 = Na3PO3 + H2O3NaOH + H3PO3 = Na3PO3 + 3H2O
N2+O2= NON2 + O2 = 2NO
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na2S+HBr=NaBr+H2SNa2S + 2HBr = 2NaBr + H2S
Ni + HCl = NiCl2 + H2Ni + 2HCl = NiCl2 + H2
NH3 + N2O = N2 + H2O2NH3 + 3N2O = 4N2 + 3H2O
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g) 3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaCl +H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Na2SO4 + BaCl2 = Na2Cl2 + BaSO4Na2SO4 + BaCl2 = Na2Cl2 + BaSO4
Na2CO3 + BaCl2 = NaCl + CO3 + BaNa2CO3 + BaCl2 = 2NaCl + CO3 + Ba
Na2Co3 + BaCl2 = BaNa2 + Co3 + Cl2Na2Co3 + BaCl2 = BaNa2 + Co3 + Cl2
N2 + O2 =2NON2 + O2 = 2NO
N2 +H2 = NH3N2 + 3H2 = 2NH3
Na3Po4 + Ca = Ca3(Po4)2 + Na2Na3Po4 + 3Ca = Ca3(Po4)2 + 6Na
Nb + Oh = Nb- + Oh--1Nb + Oh = -1Nb- + Oh-
NaOH + Fe(NO3)3 = Fe(OH)3 + NaNO33NaOH + Fe(NO3)3 = Fe(OH)3 + 3NaNO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaHCO3+CH3COOH= CH3COONa+CO2+H2010NaHCO3 + 15CH3COOH = 10CH3COONa + 20CO2 + 2H20
Na3P+H2O = NaOH+PH3Na3P + 3H2O = 3NaOH + PH3
NH4++NO2- = N2+H2ONH4+ + NO2- = N2 + 2H2O
Na2Cr2O7 + FeCl2 +HCl = CrCl3 + FeCl3 + NaCl +H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
Na2Cr2O7 + FeCl2 +HCl = CrCl3 + FeCl3 + NaCl +H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
Na2Cr2O7 + HCl = NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na2CO3(aq)+HCl(aq) = NaCl(aq)+H2O(l)+CO2(g) =Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NiCl3+K2CO3=Ni2(CO3)3+KCl2NiCl3 + 3K2CO3 = Ni2(CO3)3 + 6KCl
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2+H2 =NH3N2 + 3H2 = 2NH3
N2 + 3 H2 =2 NH3N2 + 3H2 = 2NH3
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaCl + Pb(NO3)2 = PbCl2 + NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NaI + NaIO3 + H2SO4 = I2 + Na2SO4 + H2O5NaI + NaIO3 + 3H2SO4 = 3I2 + 3Na2SO4 + 3H2O
NaHCO3(aq) + HBr(aq) = NaBr(aq) + CO2(g) + H2O(l) NaHCO3(aq) + HBr(aq) = NaBr(aq) + CO2(g) + H2O(l)
N2+O2=NON2 + O2 = 2NO
NaCl=Cl+NaNaCl = Cl + Na
Ni + O2= NiO2Ni + O2 = 2NiO
NaOH+MgSO4=NaO4+OS+HMgNaOH + MgSO4 = NaO4 + OS + HMg
Na2CO3 + FeCr2O7 + O2 = Fe2O3 + Na2CrO4 + CO28Na2CO3 + 4FeCr2O7 + O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
NH4OH = NH3+H2ONH4OH = NH3 + H2O
NaCl + Pb(NO 3 ) 2 = PbCl 2 + NaNO 32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NaBH4 + H2SO4 =B2H6 + H2 + Na2SO42NaBH4 + H2SO4 = B2H6 + 2H2 + Na2SO4
NaCN + H2SO4 = Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
Na + H2O = Na(OH) + H22Na + 2H2O = 2Na(OH) + H2
Na2S(aq)+Pb(NO3)2(aq)=NaNO3(aq)+PbS(s)Na2S(aq) + Pb(NO3)2(aq) = 2NaNO3(aq) + PbS(s)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = 2NH3N2 + 3H2 = 2NH3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.