Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO3 + KMnO4 + NaHSO4 = Na2SO4 + MnSO4 + K2SO4 + H2O5Na2SO3 + 2KMnO4 + 6NaHSO4 = 8Na2SO4 + 2MnSO4 + K2SO4 + 3H2O
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na+MgF2=NaF+Mg2Na + MgF2 = 2NaF + Mg
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
N2+O2=NON2 + O2 = 2NO
Na + H2O = 2NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
N2 H4 = NH3 + N23N2H4 = 4NH3 + N2
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+O2=Na2O4Na + O2 = 2Na2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NaH +H2O=NaOH +H2NaH + H2O = NaOH + H2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2SO4 + CaCO3 + 2C = Na2CO3 + CaS + 2CO2Na2SO4 + CaCO3 + 2C = Na2CO3 + CaS + 2CO2
NO2=NO+O22NO2 = 2NO + O2
Na + H2 = NaH2Na + H2 = 2NaH
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
Na3PO4+HCl=NaCl+H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NaN3+KNO3= N2 +KO2+NaO22NaN3 + 4KNO3 = 5N2 + 4KO2 + 2NaO2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaN3+KNO3= N2 +KO2+Na022NaN3 + 0KNO3 = 3N2 + 0KO2 + Na02
N2H4 + BrO4- = Br- + N2 + H2O2N2H4 + BrO4- = Br- + 2N2 + 4H2O
N2H4+N2O4=N2+18H2O2N2H4 + N2O4 = 3N2 + 4H2O
NaHCO3+H3C6H5O7=Na3C6H5O7+H2O+CO23NaHCO3 + H3C6H5O7 = Na3C6H5O7 + 3H2O + 3CO2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaOH = NaO + H2020NaOH = 20NaO + H20
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
N2H4+5N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2H4+5N2O4=3N2+4H2O2N2H4 + N2O4 = 3N2 + 4H2O
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
Na2O(s)+H2O(l)=NaOH(aq)Na2O(s) + H2O(l) = 2NaOH(aq)
N2+F2=NF3N2 + 3F2 = 2NF3
Na+I2=NaI2Na + I2 = 2NaI
NaCl+H2SO4=Na2SO4(aq)+HCl2NaCl + H2SO4 = Na2SO4(aq) + 2HCl
N2(g) + Cl2(g) = N2Cl2 (g)N2(g) + Cl2(g) = N2Cl2(g)
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaBr + Ca(OH)2 = CaBr2 + NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
Na + HNO3 = NaNO3 + H22Na + 2HNO3 = 2NaNO3 + H2
NH 4 NO 3=N 2 O+H 2 ONH4NO3 = N2O + 2H2O
Na 2 S+Cu(NO 3 ) 2 =NaNO 3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaCl = Na + Cl22NaCl = 2Na + Cl2
NaPO4 +BaNO3= NaNO3 +BaPO4NaPO4 + BaNO3 = NaNO3 + BaPO4
NaPO4 +BaNO3= NaNO3 +BaPO4NaPO4 + BaNO3 = NaNO3 + BaPO4
NaNO3+NiSO4=Na(SO4)+Ni(NO3)NaNO3 + NiSO4 = Na(SO4) + Ni(NO3)
Na2O + P4O10 = Na3PO46Na2O + P4O10 = 4Na3PO4
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
N2 + H2O = H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
NaIO3 + NaHSO3 = NaHSO4 + Na2SO4 + H2O + I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
NH3 + CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
Na3P+CaF2=NaF+CaP+Ca3P22Na3P + 3CaF2 = 6NaF + 0CaP + Ca3P2
NaClO3 = NaCl + O2 2NaClO3 = 2NaCl + 3O2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH4NO3+Pb(ClO4)2= Pb(NO3)2 +NH4ClO42NH4NO3 + Pb(ClO4)2 = Pb(NO3)2 + 2NH4ClO4
NH4NO3+Pb(ClO4)2= Pb(NO3)2 +NH4ClO42NH4NO3 + Pb(ClO4)2 = Pb(NO3)2 + 2NH4ClO4
NO(g)+CO(g)=N2(g)+CO2(g)2NO(g) + 2CO(g) = N2(g) + 2CO2(g)
NaOH + H2O = NaH + OHNaOH + H2O = NaH + 2OH
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Na2So3+NaBr=Na2Br+NaSo3Na2So3 + NaBr = Na2Br + NaSo3
Na2So3+NaBr=NaSo3+BrNa2Na2So3 + NaBr = NaSo3 + BrNa2
Na2C2O4 + Pb(NO3)2 = Na2(NO3)2 + PbC2O4Na2C2O4 + Pb(NO3)2 = Na2(NO3)2 + PbC2O4
Na2C2O4 + Pb(NO3)2 = Na2(NO3)2 + PbC2O4Na2C2O4 + Pb(NO3)2 = Na2(NO3)2 + PbC2O4
NH3+HNO3=2H2O+N2ONH3 + HNO3 = 2H2O + N2O
NH3+HNO3=2H2O+N2ONH3 + HNO3 = 2H2O + N2O
NaN03 + K2S04 = KN03 + Na2S042NaN03 + K2S04 = 2KN03 + Na2S04
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na2S+CaCl2=CaS+NaClNa2S + CaCl2 = CaS + 2NaCl
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na + H2O = NaOH + H2 2Na + 2H2O = 2NaOH + H2
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH3+F2=N2F4+HF2NH3 + 5F2 = N2F4 + 6HF
NH3+F2=N2F4+HF2NH3 + 5F2 = N2F4 + 6HF
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
Na2CrO4+Cr(No3)3=Cr2(CrO4)3+NaNo33Na2CrO4 + 2Cr(No3)3 = Cr2(CrO4)3 + 6NaNo3
NH3+H3PO4=(NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NH3+H3PO4=(NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
Na2 S O3 + S8 = Na2 S2 O38Na2SO3 + S8 = 8Na2S2O3
Na2SO3+S8=Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
Na2S+ZnCl2=NaCl+ZnSNa2S + ZnCl2 = 2NaCl + ZnS
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3+HCl=H2O(l)+NaCl+CO2NaHCO3 + HCl = H2O(l) + NaCl + CO2
NH3 + O2 = H2O + N24NH3 + 3O2 = 6H2O + 2N2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl=Na+Cl22NaCl = 2Na + Cl2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaOH+H3PO4=H2O+Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NH3+SO2+FeS=N2O3+H2S+FeO 2NH3 + 2SO2 + FeS = N2O3 + 3H2S + FeO
N2H4 + HNO2 = H2O + HN3N2H4 + HNO2 = 2H2O + HN3
Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
NH4Cl + Cl2 = HCl + NCl3NH4Cl + 3Cl2 = 4HCl + NCl3
NO3+NH3 = NH4+NO3NO3 + 0NH3 = 0NH4 + NO3
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O+H2O=Na(OH)Na2O + H2O = 2Na(OH)
Na3(AsO4)+Ca(NO3)2=Na(NO3)+Ca3(AsO4)22Na3(AsO4) + 3Ca(NO3)2 = 6Na(NO3) + Ca3(AsO4)2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = NO2N2 + 2O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
N2Cl4 + CH4 = CCl4 + N2 + 2H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
N2Cl4 + CH4= CCl4 + N2 + 2H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
N2Cl4 + CH4= CCl4 + N2 + 2H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
NaCN+CuCO3=Na2CO3+ Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
NH3 + CUO = CU + N2 + H2O 2NH3 + 3CUO = 3CU + N2 + 3H2O
Na3PO4+KOH=K3PO4+NaOHNa3PO4 + 3KOH = K3PO4 + 3NaOH
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3+HCl=NaCl+H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2CO3+CaCl2=CaCO3+NaClNa2CO3 + CaCl2 = CaCO3 + 2NaCl
NaCl+SO2+H2O+O2=Na2SO4+HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
NH4OH+FeCl3=NH4Cl+Fe(OH)33NH4OH + FeCl3 = 3NH4Cl + Fe(OH)3
NH3+I2=N2I6+H22NH3 + 3I2 = N2I6 + 3H2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na3P+CaF2= NaF+ Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4OH+FeCl3=Fe (OH)3+NH4Cl3NH4OH + FeCl3 = Fe(OH)3 + 3NH4Cl
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NaOH+Al2 (SO3)3=Na2SO3+Al (OH)36NaOH + Al2(SO3)3 = 3Na2SO3 + 2Al(OH)3
NaOH+2H2SO4=Na2SO4+2H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+Al2 (SO3)3=Na2SO3+Al (OH)36NaOH + Al2(SO3)3 = 3Na2SO3 + 2Al(OH)3
NaNO2 +HNO3=NaNO3 + HNO30NaNO2 + HNO3 = 0NaNO3 + HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4OH+FeCl3=Fe (OH)3+NH4Cl3NH4OH + FeCl3 = Fe(OH)3 + 3NH4Cl
Na+H2SO4=Na2SO4+H22Na + H2SO4 = Na2SO4 + H2
NH4S2 + Pb2NO3 = NH4NO3 + Pb2S2NH4S2 + Pb2NO3 = NH4NO3 + Pb2S2
NaOH+CuSO4=Na2SO4+Cu(OH)22NaOH + CuSO4 = Na2SO4 + Cu(OH)2
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NH4OH=NH3+H2ONH4OH = NH3 + H2O
NO2 + HSO3NH2 = HSO4 + H2O + N2NO2 + HSO3NH2 = HSO4 + H2O + N2
NO2+HSO3NH2=HSO4+H2O+N2NO2 + HSO3NH2 = HSO4 + H2O + N2
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
Na3PO4+HCL=NaCL+H3PO4Na3PO4 + 3HCL = 3NaCL + H3PO4
Na3PO4+CaCl2=NaCl+Ca3 (PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na3PO4+BaCl2=Ba3(PO4)2+NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
N2H4+O2=N2+H2ON2H4 + O2 = N2 + 2H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=NON2 + O2 = 2NO
N2+O2=NON2 + O2 = 2NO
N2+O2=NO2N2 + 2O2 = 2NO2
N2+O2=NO2N2 + 2O2 = 2NO2
N2+O2=NO3N2 + 3O2 = 2NO3
NF3+AlCl3=N2+Cl2+AlF32NF3 + 2AlCl3 = N2 + 3Cl2 + 2AlF3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3 + O2=NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaOH(aq)+FeBr3(aq)=3NaBr(aq)+Fe(OH)3(s)3NaOH(aq) + FeBr3(aq) = 3NaBr(aq) + Fe(OH)3(s)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Na3PO4 + NaOH = NaH2PO4 + H2O-1Na3PO4 + 2NaOH = -1NaH2PO4 + 2H2O
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaOH(aq) + Sr(NO3)2(aq) = NaNO3(aq) + Sr(OH)2(s)2NaOH(aq) + Sr(NO3)2(aq) = 2NaNO3(aq) + Sr(OH)2(s)
Na2CrO4+FeI3=NaI+Fe2(CrO4)33Na2CrO4 + 2FeI3 = 6NaI + Fe2(CrO4)3
NaOH + 2KNO3 = NaNO3 + 2KOHNaOH + KNO3 = NaNO3 + KOH
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4(l) + O2(g) = H2O(g) + N2(g)N2H4(l) + O2(g) = 2H2O(g) + N2(g)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2H4(l) =NH3(s) + N2(g)3N2H4(l) = 4NH3(s) + N2(g)
NaPO4 + CaCl2 = NaCl + Ca(PO4)22NaPO4 + CaCl2 = 2NaCl + Ca(PO4)2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH4+NO3=N2O+H2ONH4 + NO3 = N2O + 2H2O
NaOH+ZnCrO4=Na2CrO4+Zn(OH)22NaOH + ZnCrO4 = Na2CrO4 + Zn(OH)2
NaN3=Na+N22NaN3 = 2Na + 3N2
NaN3=Na+N22NaN3 = 2Na + 3N2
NH4OH + (ClO)- = H+ + Cl- + H2O + N22NH4OH + 3(ClO)- = 0H+ + 3Cl- + 5H2O + N2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2+Cl2=NCl3N2 + 3Cl2 = 2NCl3
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaCIO3= NaCI+ O22NaCIO3 = 2NaCI + 3O2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
NH3+ O2= N2+ H2O4NH3 + 3O2 = 2N2 + 6H2O
NiCl + KOH= NiOH + KClNiCl + KOH = NiOH + KCl
NaOH + H2CO3 = Na2CO3 + H2O 2NaOH + H2CO3 = Na2CO3 + 2H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na2O2 +H2O =NaOH +O22Na2O2 + 2H2O = 4NaOH + O2
NaCO3(aq)+CoCl2(aq)=CoCO3+NaCl2NaCO3(aq) + CoCl2(aq) = CoCO3 + NaCl2
NaCO3(aq)+CoCl2(aq)=CoCO3(s)+NaCl2(s)NaCO3(aq) + CoCl2(aq) = CoCO3(s) + NaCl2(s)
NaCO3+CoCl2=CoCO3+NaCl2NaCO3 + CoCl2 = CoCO3 + NaCl2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g) NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
NO + CO = N + CO2NO + CO = N + CO2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
Na2O + F2 = NaF + O22Na2O + 2F2 = 4NaF + O2
NO + CO2 = N + CO20NO + CO2 = 0N + CO2
NO + CO2 = N + CO20NO + CO2 = 0N + CO2
NH4ClO4 = N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
N2+Cl2= NCl3N2 + 3Cl2 = 2NCl3
N2+Cl2= NClN2 + Cl2 = 2NCl
Na+H2O=Na(OH)+HNa + H2O = Na(OH) + H
Na2O + (NH4)2SO4 = Na2SO4 + H2O + NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4NO3(s)=N2O(g)+H2O(g)NH4NO3(s) = N2O(g) + 2H2O(g)
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
Na2CO3 + H2O2 = Na2O + HCO32Na2CO3 + H2O2 = 2Na2O + 2HCO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2C2O4+2H2O=NaCO+H2O0NaOH + 0H2C2O4 + H2O = 0NaCO + H2O
NaOH+Cu(ClO3)2=Cu(OH)2+NaClO32NaOH + Cu(ClO3)2 = Cu(OH)2 + 2NaClO3
NA+H2O= NAOH+H22NA + 2H2O = 2NAOH + H2
NH4ClO4 + Al = Al2O3 + AlCl3 + NO + H2O3NH4ClO4 + 3Al = Al2O3 + AlCl3 + 3NO + 6H2O
NaHCO3 = NaOH +CO2NaHCO3 = NaOH + CO2
NaOH+H2O=NaH+OHNaOH + H2O = NaH + 2OH
NaOH+H2O=Na+OHNaOH + 0H2O = Na + OH
NaOH+H2O=NaH+OHNaOH + H2O = NaH + 2OH
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaOH+CO2=NaHCO3NaOH + CO2 = NaHCO3
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na2CO3+Na2S+SO2 = Na2S2O3+CO2Na2CO3 + 2Na2S + 4SO2 = 3Na2S2O3 + CO2
NH4NO3(s) =N2(g) + O2(g) + H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na+O2= Na2O4Na + O2 = 2Na2O
Na2CO3 + PbBr2 = PbCO3 + NaBrNa2CO3 + PbBr2 = PbCO3 + 2NaBr
NO2 + H2O = HNO3 = NO3NO2 + H2O = 2HNO3 + NO
NO2 + H2O = HNO3 = NO3NO2 + H2O = 2HNO3 + NO
NaAlO2 + H2O + CO2 = Al(OH)3 + Na2CO32NaAlO2 + 3H2O + CO2 = 2Al(OH)3 + Na2CO3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3+F2=N2F4+HF2NH3 + 5F2 = N2F4 + 6HF
Na2SO3 + H2SO3 = Na2SO4 + H2SO30Na2SO3 + H2SO3 = 0Na2SO4 + H2SO3
Na2SO3 + H2SO3 = NaSO4 + HSO4-1Na2SO3 + H2SO3 = -2NaSO4 + 2HSO4
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3+8O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaC2H3O2 + HCl = NaCl + HC2H3O2NaC2H3O2 + HCl = NaCl + HC2H3O2
Na2SO3 + Cl2 + H2O = Na2SO4 + HClNa2SO3 + Cl2 + H2O = Na2SO4 + 2HCl
Ni(NO3)2 + H2S = NiS + H2(NO3)2Ni(NO3)2 + H2S = NiS + H2(NO3)2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na2NO3 + HCO3 = NaNO3 + HCO3 0Na2NO3 + HCO3 = 0NaNO3 + HCO3
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na2CrO4 + Pb(C2H3O2)2 = Na2(C2H3O2)2 + PbCrO4Na2CrO4 + Pb(C2H3O2)2 = Na2(C2H3O2)2 + PbCrO4
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaC2H3O2 + HCl = NaCl+ C2H4O2NaC2H3O2 + HCl = NaCl + C2H4O2
Na+MgI2=NaI2+MgNa + MgI2 = NaI2 + Mg
NH4OH + Na2CrO4 = NH4CrO4 + Na2OHNH4OH + Na2CrO4 = NH4CrO4 + Na2OH
Na+H2= Na2H22Na + H2 = Na2H2
Na+H2= Na2H22Na + H2 = Na2H2
NH4NO3(s) = N2(g) + O2(g) + H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g) + HNO3(aq) = NH4NO3(s)NH3(g) + HNO3(aq) = NH4NO3(s)
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
N2H4+9N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2H4+9N2O2=N2+H2ON2H4 + N2O2 = 2N2 + 2H2O
N2H4+9(N2O2)=N2+H2ON2H4 + (N2O2) = 2N2 + 2H2O
N2H4+9N2O2=N2+H2ON2H4 + N2O2 = 2N2 + 2H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH4Cl+NaNO2=NaCl+N2+H2ONH4Cl + NaNO2 = NaCl + N2 + 2H2O
NO3H + I2 = IO3H + NO + H2O 10NO3H + 3I2 = 6IO3H + 10NO + 2H2O
NaCl + H2SO4 = NaHSO4 + HClNaCl + H2SO4 = NaHSO4 + HCl
Na3PO4 + CaCl2 = Na3Cl2 + CaPO4Na3PO4 + CaCl2 = Na3Cl2 + CaPO4
NH3+O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=NaO2Na + O2 = NaO2
NaClO + H2O2 = NaClO3 + H2ONaClO + 2H2O2 = NaClO3 + 2H2O
NO3H+I2=IO3H+NO+H2O10NO3H + 3I2 = 6IO3H + 10NO + 2H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2=N2O2N2 + O2 = 2N2O
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na3PO4(aq) + SrCl2 = 3Na + 2Cl + Sr(PO4)Na3PO4(aq) + SrCl2 = 3Na + 2Cl + Sr(PO4)
NH4Cl + Ca(OH) 2 = NH3 + H2O + CaCl22NH4Cl + Ca(OH)2 = 2NH3 + 2H2O + CaCl2
Na3PO4 + SrCl2 = Na3Cl2 + SrPO4Na3PO4 + SrCl2 = Na3Cl2 + SrPO4
NaHCO3+HCl=H2O+NaCl+CO2NaHCO3 + HCl = H2O + NaCl + CO2
Na3PO4 + SrCl2 = Na3Cl2 + SrPO4Na3PO4 + SrCl2 = Na3Cl2 + SrPO4
NH3(g) + O2(g) =NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH4NO3 + NaOH = NH4 + H2O + NaNO39NH4NO3 + 10NaOH = 8NH4 + 7H2O + 10NaNO3
NaOH(aq) + HNO3(aq) = NaNO3(aq) + H2O(l)NaOH(aq) + HNO3(aq) = NaNO3(aq) + H2O(l)
N2 + Cl2 = NCl3N2 + 3Cl2 = 2NCl3
NH3 + H2SO4 =(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + Cl2 = NH4Cl + NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
Na3PO4 + SrCl2 = Na3Cl2 + SrPO4Na3PO4 + SrCl2 = Na3Cl2 + SrPO4
Na + H2CO3 = NaHCO3 + H22Na + 2H2CO3 = 2NaHCO3 + H2
NaHCO3+HC2H3O2=H2O+CO2+NaC2H3O2NaHCO3 + HC2H3O2 = H2O + CO2 + NaC2H3O2
N2H4(g)+7N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
Na3PO4 + SrCl2 = Na3Sr + Cl2PO4Na3PO4 + SrCl2 = Na3Sr + Cl2PO4
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NaNO3+PBO=PB(NO3)2+Na2O2NaNO3 + PBO = PB(NO3)2 + Na2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaCl+BeF2=NaF+BeCl22NaCl + BeF2 = 2NaF + BeCl2
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2SO4+Cu2S2=Cu2(SO4)2+Na2SO4Na2SO4 + 0Cu2S2 = 0Cu2(SO4)2 + Na2SO4
NaOH+Ag(NO3)=Na(NO3)+Ag(OH)NaOH + Ag(NO3) = Na(NO3) + Ag(OH)
NaOH+Co(NO3)2=Na(NO3)+Co(OH)22NaOH + Co(NO3)2 = 2Na(NO3) + Co(OH)2
NaOH+Pb(NO3)2=Na(NO3)+Pb(OH)22NaOH + Pb(NO3)2 = 2Na(NO3) + Pb(OH)2
NaOH+Cu(NO3)2=Na(NO3)+Cu(OH)22NaOH + Cu(NO3)2 = 2Na(NO3) + Cu(OH)2
Na2SO3=Na2+SO3Na2SO3 = Na2 + SO3
NNaO2=Na+NO2NNaO2 = Na + NO2
Na+O2=NaO2Na + O2 = NaO2
Na+O=NaONa + O = NaO
Na+O=NaONa + O = NaO
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaOH + H2CO3 = Na2CO3 + H2O 2NaOH + H2CO3 = Na2CO3 + 2H2O
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na2S + SO2 +H20 = Na2SO3 + H2S20Na2S + 30SO2 + 3H20 = 20Na2SO3 + 30H2S
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2CO3+Na2S+SO2=Na2S2O3+CO2Na2CO3 + 2Na2S + 4SO2 = 3Na2S2O3 + CO2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaOH +H3PO4 =Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na3PO4 + SrCl2 = Na3Sr + Cl2PO4Na3PO4 + SrCl2 = Na3Sr + Cl2PO4
Na3PO4 + SrCl2 = Na3Sr + Cl2PO4Na3PO4 + SrCl2 = Na3Sr + Cl2PO4
NO + H = N + H2ONO + 2H = N + H2O
NaPO4 + MgSO4 = MgPO4 + NaSO4NaPO4 + MgSO4 = MgPO4 + NaSO4
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na 2 CO 3 (aq)+CoCl 2 (aq)=CoCO3(s)+2NaCl(aq)Na2CO3(aq) + CoCl2(aq) = CoCO3(s) + 2NaCl(aq)
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaNO3 = NaNO2+O22NaNO3 = 2NaNO2 + O2
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2CO3 + FeCl2 = FeCO3 + NaClNa2CO3 + FeCl2 = FeCO3 + 2NaCl
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + Pb(NO3)2 = PbCl2 + NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NaCl + Pb(NO3)2 = PbCl2 + NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NaCl + NH3 + CO2 + H2O = NH4Cl + NaHCO3NaCl + NH3 + CO2 + H2O = NH4Cl + NaHCO3
Na + O2 = Na2O4Na + O2 = 2Na2O
Na+O2=Na2O4Na + O2 = 2Na2O
Na+O2=Na2O4Na + O2 = 2Na2O
NH3+O2=NO+3H2O4NH3 + 5O2 = 4NO + 6H2O
NaHSO4 + NaClO4 + NaCl = Cl2 + Na2SO4 + H2O 8NaHSO4 + NaClO4 + 7NaCl = 4Cl2 + 8Na2SO4 + 4H2O
N2H4 + H2O2 = N2 +H2ON2H4 + 2H2O2 = N2 + 4H2O
NCl3 (g) = N2 (g) + Cl2 (g)2NCl3(g) = N2(g) + 3Cl2(g)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3 + H3PO4 = (NH4)H2PO4NH3 + H3PO4 = (NH4)H2PO4
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2SO4 + Al(OH)3 = Al2(SO4)3 +NaOH3Na2SO4 + 2Al(OH)3 = Al2(SO4)3 + 6NaOH
NH4Cl + H2SO4 = NH4SO4 + H2ClNH4Cl + H2SO4 = NH4SO4 + H2Cl
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NaHCO3+HCl=H2O+NaCl+CO2NaHCO3 + HCl = H2O + NaCl + CO2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaClO + Na2S2O3 + NaOH = NaCl + Na2SO4 + H2O4NaClO + Na2S2O3 + 2NaOH = 4NaCl + 2Na2SO4 + H2O
NaCl +Hg2(C2H3O2)2 = Na2(C2H3O2) +HgCl24NaCl + Hg2(C2H3O2)2 = 2Na2(C2H3O2) + 2HgCl2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na+O2=Na2O4Na + O2 = 2Na2O
Na3PO4 + Cu(NO3) = Cu3(PO4) + Na(NO3)Na3PO4 + 3Cu(NO3) = Cu3(PO4) + 3Na(NO3)
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
N2H4+9N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO3 + H2O4NH3 + 9O2 = 4NO3 + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
N2 + O2 = N2O2N2 + O2 = 2N2O
N(s) +O2(g)=NO3(g)2N(s) + 3O2(g) = 2NO3(g)
N2+O2=NO2N2 + 2O2 = 2NO2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3=N+HNH3 = N + 3H
NO2(g) + H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Nh3+ BeCl2= BeNh+ ClNh3 + 3BeCl2 = 3BeNh + 6Cl
NH4OH = NH3 + H2ONH4OH = NH3 + H2O
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
Na2CO3 = CO2 + Na2ONa2CO3 = CO2 + Na2O
NH3 + O2 = NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
Ni + Co3 = Ni(Co)43Ni + 4Co3 = 3Ni(Co)4
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na+H2S=Na2S+H22Na + H2S = Na2S + H2
Na(s) + H2O(l) = NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na2SO4+AlBr3=Al2(SO4)3+NaBr3Na2SO4 + 2AlBr3 = Al2(SO4)3 + 6NaBr
Na2SO4+AlBr3=Al2(SO4)3+NaBr3Na2SO4 + 2AlBr3 = Al2(SO4)3 + 6NaBr
Na2CO3 + CH3COOH=NaCH3OO+H2O+CO2Na2CO3 + CH3COOH = 2NaCH3OO - H2O + CO2
NHO3+Mg=Mg(NO3) +H22NHO3 + 2Mg = 2Mg(NO3) + H2
NHO3+Mg=Mg(NO3)2 +H22NHO3 + Mg = Mg(NO3)2 + H2
Na2Cr2O7+AlPO4 = Na3PO4+Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
NaCL+AgNO3=NaNO3+AgCLNaCL + AgNO3 = NaNO3 + AgCL
Na2CO3 + Ca(OH)2 = CaCO3 + NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH3+O2=HNO3+H2ONH3 + 2O2 = HNO3 + H2O
NaOH(aq) + HI(aq)= NaI(aq)+H2O(l)NaOH(aq) + HI(aq) = NaI(aq) + H2O(l)
NaS2O3+Cl2+8H2O=Na2SO4+S+HCl-2NaS2O3 + 2Cl2 + 2H2O = -1Na2SO4 - 3S + 4HCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2=NaH2Na + H2 = 2NaH
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3(g) + H2CO3(aq) = (NH4)2CO3(s)2NH3(g) + H2CO3(aq) = (NH4)2CO3(s)
NaN3(s) = Na3N(s) + N2(g)3NaN3(s) = Na3N(s) + 4N2(g)
NH3(g) + H2CO3(aq) = (NH4)2CO3(s)2NH3(g) + H2CO3(aq) = (NH4)2CO3(s)
NO(g) + O2(g) = NO2(g)2NO(g) + O2(g) = 2NO2(g)
N2+Cl2=NClN2 + Cl2 = 2NCl
N2+Cl2=N2Cl2N2 + Cl2 = N2Cl2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+C+N2=NaCN+CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaI+Hg2(NO3)2=Na(NO3)+HgI2NaI + Hg2(NO3)2 = 2Na(NO3) + 2HgI
NaCl + MnO2 + H2SO4 = NaSO4 + MnSO4 + Cl3 + H2O3NaCl + 3MnO2 + 6H2SO4 = 3NaSO4 + 3MnSO4 + Cl3 + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2SO3+HCl=NaCl+H2O+SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NH4OH + CoCl2 = 2NH4Cl + Co(OH)22NH4OH + CoCl2 = 2NH4Cl + Co(OH)2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2H4 + O2 = 2H2O + N2N2H4 + O2 = 2H2O + N2
N2H4 = NH3 + N23N2H4 = 4NH3 + N2
Ne+2F2=NeF2Ne + F2 = 2NeF
NH3 (g) + 2O2 (g) = NO (g)+ 3 H2O (l) 4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
NH3 (g) + 2O2 (g) = NO (g)+ 3 H2O (l) 4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
Na2S2O3(aq) + I2(aq) = Na2S4O6(aq) + NaI(aq)2Na2S2O3(aq) + I2(aq) = Na2S4O6(aq) + 2NaI(aq)
NH4NO3 + NaOH = NaNO3 + NH3 + H2ONH4NO3 + NaOH = NaNO3 + NH3 + H2O
NiS(s) + O2(g) = NiO(s) + SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
Na2SO4(s) + C(s) = Na2S(s) + CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
Ni(NO3)2 + NaOH = Ni(OH)2 + NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NiCl2 + H2S = NiS + HClNiCl2 + H2S = NiS + 2HCl
Na + MgCl2 = NaCl + Mg2Na + MgCl2 = 2NaCl + Mg
Na2SO4 + Ca(NO3)2 = NaNO3 + CaSO4Na2SO4 + Ca(NO3)2 = 2NaNO3 + CaSO4
N + H = NH3N + 3H = NH3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na2CO3+ Ni(NO3)3 = NaNO3+ Ni2(CO3)33Na2CO3 + 2Ni(NO3)3 = 6NaNO3 + Ni2(CO3)3
N2 + O2 = N2O2N2 + O2 = 2N2O
Na2CO3+ Ni(NO3)3 = NaNO3+ Ni2(CO3)33Na2CO3 + 2Ni(NO3)3 = 6NaNO3 + Ni2(CO3)3
NH3 + I2 = NH4I + N28NH3 + 3I2 = 6NH4I + N2
Na + I2 = NaI2Na + I2 = 2NaI
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
N2O5 = O2 + NO22N2O5 = O2 + 4NO2
NaClO+Na2S2O3+NaOH=NaCl+Na2SO4+H2O4NaClO + Na2S2O3 + 2NaOH = 4NaCl + 2Na2SO4 + H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O3 = Na2O6Na + O3 = 3Na2O
NaCl(l)=Na(l)+Cl2(g)2NaCl(l) = 2Na(l) + Cl2(g)
NH3(g)=H2(g)+N2(g)2NH3(g) = 3H2(g) + N2(g)
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH4Cl+BaO2H2 = BaCl2+NH3+H2O2NH4Cl + BaO2H2 = BaCl2 + 2NH3 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5(g) + H2O(l) = HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
N2O3+H2O=HNO2N2O3 + H2O = 2HNO2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
N2=N2N2 = N2
Na2O2+H2O=Na1O1H1+O22Na2O2 + 2H2O = 4Na1O1H1 + O2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3(g) + O2(g) = NO(g) + H2O(l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
Na+O2=Na2O4Na + O2 = 2Na2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.