Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
N2+ 3H2=NH3N2 + 3H2 = 2NH3
N2H4 = NH3 +N23N2H4 = 4NH3 + N2
N2 + H2 = NH2N2 + 2H2 = 2NH2
Na + H2O=NaO + HNa + H2O = NaO + 2H
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH4NO3 + HCl = NH4Cl + HNO3NH4NO3 + HCl = NH4Cl + HNO3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na3PO4 + Pb(NO3)2 = Pb3(PO4)2 + NaNO32Na3PO4 + 3Pb(NO3)2 = Pb3(PO4)2 + 6NaNO3
Ni(CO)4=Ni+CONi(CO)4 = Ni + 4CO
Na+KNO3=Na2O+K2O+N210Na + 2KNO3 = 5Na2O + K2O + N2
NH3+O=NO2+H2O2NH3 + 7O = 2NO2 + 3H2O
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na + H2O = NaOH + HNa + H2O = NaOH + H
Na3PO4+Pb(NO3)2=Pb3(PO4)2+NaNO32Na3PO4 + 3Pb(NO3)2 = Pb3(PO4)2 + 6NaNO3
NaOH + H3PO4 =Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO2+H2O+NH3=NH4NO38NO2 + 5H2O + 6NH3 = 7NH4NO3
NH4 + O2 + CH4 = HCN + H2O4NH4 + 7O2 + 4CH4 = 4HCN + 14H2O
NH4 + O2 + CH4 = HCN + H2O4NH4 + 7O2 + 4CH4 = 4HCN + 14H2O
NaHCO3= Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3= Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3= Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2O+C2H4O2=C2H3NaO2+H2ONa2O + 2C2H4O2 = 2C2H3NaO2 + H2O
NH4NO3+O2=NO2+H2NH4NO3 + O2 = 4NO2 + 8H
NH3 + H2O = NH4 + OHNH3 + H2O = NH4 + OH
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaHCO3 + CH3COOH = CH3COONa + H2O + CO2(g)NaHCO3 + CH3COOH = CH3COONa + H2O + CO2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaNO3 + H2SO4 = Na2SO4 + HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O 2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NO + O2 = NO22NO + O2 = 2NO2
Na2CO3+NH4OH=(NH4)2CO3+NaOHNa2CO3 + 2NH4OH = (NH4)2CO3 + 2NaOH
Na2CO3+NH4OH=NH3+H2CO3+NaOHNa2CO3 + 2NH4OH = 2NH3 + H2CO3 + 2NaOH
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2 + H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 2H2 = 2NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + F2 = 2NF3N2 + 3F2 = 2NF3
Na(NO3) + S = SO2+Na2O+NO4Na(NO3) + 3S = 3SO2 + 2Na2O + 4NO
Na(NO3) + S = SO2+Na2O+NO4Na(NO3) + 3S = 3SO2 + 2Na2O + 4NO
Na(NO3) + S = SO2+Na2O+NO4Na(NO3) + 3S = 3SO2 + 2Na2O + 4NO
N2+H2=NH3N2 + 3H2 = 2NH3
NO2+H2O+NH3=NH4NO38NO2 + 5H2O + 6NH3 = 7NH4NO3
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOCl+(NH2)2CO=N2H4+NaCl+CO2NaOCl + (NH2)2CO = N2H4 + NaCl + CO2
NaOH+HCL=NaCL+H2ONaOH + HCL = NaCL + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+Na=Na3NN2 + 6Na = 2Na3N
NH4Cl(aq)+NaOH(aq)=H2O(l)+NH3(g)+NaCl(aq)NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq)
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH4ClO4 = N2 + Cl2 + O2 + H2010NH4ClO4 = 5N2 + 5Cl2 + 20O2 + 2H20
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5 + H2O=HNO3N2O5 + H2O = 2HNO3
NaOH(aq)+NaNO2(aq)+ Al(s)+H2O(l) = NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + HOCl = NO3 + Cl +2HNO2 + HOCl = NO3 + Cl + H
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2+H2O=NO+HNO33NO2 + H2O = NO + 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na + H2O = NaOH +HNa + H2O = NaOH + H
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
N2+O2=NO N2 + O2 = 2NO
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na+H2SO4=H2+Na2SO42Na + H2SO4 = H2 + Na2SO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na+O2=Na2O4Na + O2 = 2Na2O
Na2S(aq)+CuCl2(aq)=CuS(s)+2NaCl(aq)Na2S(aq) + CuCl2(aq) = CuS(s) + 2NaCl(aq)
NH3+O2=N2O+H2O2NH3 + 2O2 = N2O + 3H2O
Na2CO3+H3AsO4=Na3AsO4+CO2+H2O3Na2CO3 + 2H3AsO4 = 2Na3AsO4 + 3CO2 + 3H2O
Na2CO3(aq)+Ca(OH)2(aq)=CaCO3(s)+2NaOH(aq)Na2CO3(aq) + Ca(OH)2(aq) = CaCO3(s) + 2NaOH(aq)
Na2CO3(aq)+Ca(OH)2(aq)=CaCO3(s)+2NaOH(aq)Na2CO3(aq) + Ca(OH)2(aq) = CaCO3(s) + 2NaOH(aq)
Na2CO3(aq)+Ca(OH)2(aq)=CaCO3(s)+2NaOH(aq)Na2CO3(aq) + Ca(OH)2(aq) = CaCO3(s) + 2NaOH(aq)
N2+H2 = NH3N2 + 3H2 = 2NH3
Na2S(aq)+CuCl2(aq)=CuS(s)+2NaCl(aq)Na2S(aq) + CuCl2(aq) = CuS(s) + 2NaCl(aq)
Na2PtCl6 + CH2O2 = Pt + NaCl + HCl + CO2Na2PtCl6 + 2CH2O2 = Pt + 2NaCl + 4HCl + 2CO2
N2+O2=NON2 + O2 = 2NO
Na2TeO3 + NaI + HCl = NaCl + Te + I2 + H2ONa2TeO3 + 4NaI + 6HCl = 6NaCl + Te + 2I2 + 3H2O
Na2SO4+ Ca (NO3)2= 2 NaNO3 + CaSO4Na2SO4 + Ca(NO3)2 = 2NaNO3 + CaSO4
Na2CrO4+AgNO3 = Ag2CrO4+NaNO3Na2CrO4 + 2AgNO3 = Ag2CrO4 + 2NaNO3
Na2SO4 + AgNO3 = NaNO3 + Ag2SO4Na2SO4 + 2AgNO3 = 2NaNO3 + Ag2SO4
Na3P+Cl2=NaCl+P44Na3P + 6Cl2 = 12NaCl + P4
NiBr2+Fe=FeBr3+Ni3NiBr2 + 2Fe = 2FeBr3 + 3Ni
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaCl(s) + NH3(g) + H2O(l) +CO2 = NaHCO3(s)+NH4Cl(aq)NaCl(s) + NH3(g) + H2O(l) + CO2 = NaHCO3(s) + NH4Cl(aq)
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaCl = Na + Cl22NaCl = 2Na + Cl2
NaCl = Na + NaCl22NaCl = Na + NaCl2
N2 + O2 = NO2N2 + 2O2 = 2NO2
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO+O2=NO22NO + O2 = 2NO2
NO2+H2O+O2=HNO3 4NO2 + 2H2O + O2 = 4HNO3
N2 (g) + H2 (g) = NH3 (g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3 (s) = N2O (g) + H2O (g)NH4NO3(s) = N2O(g) + 2H2O(g)
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH4NO3 (s) = N2 (g) + O2 (g) + H2O (g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaHCO3 + CH3COOH = CO2 + H2O + CH3COONaNaHCO3 + CH3COOH = CO2 + H2O + CH3COONa
NO2 + H2O +O2 =HNO4NO2 + 2H2O - 3O2 = 4HNO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NO3 + Mg = MgNO3NO3 + Mg = MgNO3
NO3 + Mg = MgNO3NO3 + Mg = MgNO3
NO3 + Mg = NO3MgNO3 + Mg = NO3Mg
NO3 + Mg = MgNO3NO3 + Mg = MgNO3
NO3 + Mg = Mg(NO3)NO3 + Mg = Mg(NO3)
NO3 + Mg = Mg(NO3)22NO3 + Mg = Mg(NO3)2
Na2S+Pb(NO3)2=NaNO3+PbSNa2S + Pb(NO3)2 = 2NaNO3 + PbS
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaOH+Al+H2O = NaAl(OH)4+H22NaOH + 2Al + 6H2O = 2NaAl(OH)4 + 3H2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na3 PO4 + H2O = H3PO4 + NaOHNa3PO4 + 3H2O = H3PO4 + 3NaOH
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3 + LiOH = NH3 + H2O + LiNO3NH4NO3 + LiOH = NH3 + H2O + LiNO3
NH4NO3 + LiOH = NH3 + H2O + LiNO3NH4NO3 + LiOH = NH3 + H2O + LiNO3
Na2CO3 + HNO3 = NaNO3 + CO2 +H2ONa2CO3 + 2HNO3 = 2NaNO3 + CO2 + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 (g) = N2 (g) + H2 (g)2NH3(g) = N2(g) + 3H2(g)
NO + Cl2 = NOCl2NO + Cl2 = 2NOCl
Na2HPO4 + Al(NO3)3 = NaNO3 + Al2(HPO4)33Na2HPO4 + 2Al(NO3)3 = 6NaNO3 + Al2(HPO4)3
NO2(g) + H2O(l) = HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2 + O2 = NON2 + O2 = 2NO
NaHCO3 (aq) + H3C6H5O7 (aq) = Na3C6H5O7 (aq) + H2O (l) + CO2 (g)3NaHCO3(aq) + H3C6H5O7(aq) = Na3C6H5O7(aq) + 3H2O(l) + 3CO2(g)
NaOH + H2SO4 = Na + SO4 + H2O2NaOH + H2SO4 = 2Na + SO4 + 2H2O
NaOH + H2SO4 = Na + SO4 + H2O2NaOH + H2SO4 = 2Na + SO4 + 2H2O
NH4SCN + Hg(NO3)2 = Hg(SCN)2 + NH4NO32NH4SCN + Hg(NO3)2 = Hg(SCN)2 + 2NH4NO3
N2+ H2 = NH3N2 + 3H2 = 2NH3
Na+O2=NaO2Na + O2 = NaO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NO + Cl2 = NOCl2NO + Cl2 = 2NOCl
Na2CO3+Ca2OH(aq) = 2CaCO3(s)+2Na(aq)+2H+OH2Na2CO3 + Ca2OH(aq) = 2CaCO3(s) + 4Na(aq) + 0H + OH
NaHCO3+Ca2OH = 2CaCO3+2Na+2H+OH2NaHCO3 + Ca2OH = 2CaCO3 + 2Na + 2H + OH
NaHCO3+Ca2OH = CaCO3+Na+H+OH2NaHCO3 + Ca2OH = 2CaCO3 + 2Na + 2H + OH
NaHCO3+Ca2OH = CaCO3+Na+H+OH2NaHCO3 + Ca2OH = 2CaCO3 + 2Na + 2H + OH
Na+ H2O=NaO +H2Na + H2O = NaO + H2
Na + HNO3 = NaNO3 + NO2 + H2ONa + 2HNO3 = NaNO3 + NO2 + H2O
N2O3 + CaO = Ca(NO2)2N2O3 + CaO = Ca(NO2)2
N2O5 + Ca(OH)2 = Ca(NO3)2 + H2ON2O5 + Ca(OH)2 = Ca(NO3)2 + H2O
N2O3 + Ca(OH)2 = Ca(NO2)2 + H2ON2O3 + Ca(OH)2 = Ca(NO2)2 + H2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NiS + O2 = NiO + SO22NiS + 3O2 = 2NiO + 2SO2
Na2O+SO2+O2=Na2SO42Na2O + 2SO2 + O2 = 2Na2SO4
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NH4NO3 = N2O + 2 H2ONH4NO3 = N2O + 2H2O
Na+Cl2=NaCl2Na + Cl2 = NaCl2
NaIO3 + Na2SO3 + NaHSO3 = I2 + Na2SO4 + H2O 2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
NaIO3 + SO2 + H2O = NaHSO4 + H2SO4 +I22NaIO3 + 5SO2 + 4H2O = 2NaHSO4 + 3H2SO4 + I2
NaIO3 + SO2 + H2O = NaHSO4 + H2SO4 +I22NaIO3 + 5SO2 + 4H2O = 2NaHSO4 + 3H2SO4 + I2
NaIO3 + SO2 + H2O = NaHSO4 + H2SO4 +I22NaIO3 + 5SO2 + 4H2O = 2NaHSO4 + 3H2SO4 + I2
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 + H2SO4 = CO2 + Na2SO4 + H2O2NaHCO3 + H2SO4 = 2CO2 + Na2SO4 + 2H2O
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2CO3=Na2O+CO2Na2CO3 = Na2O + CO2
NH4OH+HBr=H2O+NH4BrNH4OH + HBr = H2O + NH4Br
NH4OH+HBr=H2O+NH4BrNH4OH + HBr = H2O + NH4Br
NaCl+MnO2+H2SO4 = NaH2S + MnSO4+H2O+Cl22NaCl - 8MnO2 - 6H2SO4 = 2NaH2S - 8MnSO4 - 8H2O + Cl2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + Cl2 = NaCl(s)2Na + Cl2 = 2NaCl(s)
NaOH + FeCl3 = Fe(OH)3 + NaCl3NaOH + FeCl3 = Fe(OH)3 + 3NaCl
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na + Cl =NaClNa + Cl = NaCl
Na2O2+HOH=NaOH+O22Na2O2 + 2HOH = 4NaOH + O2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO2=N2+O2+H2ONH4NO2 = N2 + 0O2 + 2H2O
Na3PO4+CuSO4=Na(SO4)+Cu3PO4Na3PO4 + 3CuSO4 = 3Na(SO4) + Cu3PO4
NaOH + H2SO4 = NaSO4 + H3ONaOH + H2SO4 = NaSO4 + H3O
Na3PO4+CuSO4=Na(SO4)+Cu3PO4Na3PO4 + 3CuSO4 = 3Na(SO4) + Cu3PO4
NaOH+CuSO4=Na(SO4)+CuOHNaOH + CuSO4 = Na(SO4) + CuOH
NaOH+CuSO4=Na(SO4)+CuOHNaOH + CuSO4 = Na(SO4) + CuOH
Na3PO4+AgNO3=3Na(NO3)=Ag3(PO4)Na3PO4 + 3AgNO3 = 3Na(NO3) + Ag3(PO4)
NaOH+AgNO3=Na(NO3)+AgOHNaOH + AgNO3 = Na(NO3) + AgOH
NaOH+AgNO3=Na(NO3)+AgOHNaOH + AgNO3 = Na(NO3) + AgOH
NaCl+AgNO3=Na(NO3)+AgClNaCl + AgNO3 = Na(NO3) + AgCl
NaH + H2O = Na2O + H22NaH + H2O = Na2O + 2H2
Na2(s) + H2O9(l) = NaOH(aq) + H2(g)-9Na2(s) - 2H2O9(l) = -18NaOH(aq) + 7H2(g)
Na + H2O = Na2O + H22Na + H2O = Na2O + H2
NO2 +H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4I(aq) + Cl2(g)= NH4Cl(aq) + I2(g)2NH4I(aq) + Cl2(g) = 2NH4Cl(aq) + I2(g)
NaOH(aq) + BaCl2(aq)= Ba(OH)2(s) + NaCl(aq)2NaOH(aq) + BaCl2(aq) = Ba(OH)2(s) + 2NaCl(aq)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3(g) = N2(g) + H2(g)2NH3(g) = N2(g) + 3H2(g)
NaClO2 + CH3COOH = ClO2 + NaHCO2 + CH3NaClO2 + CH3COOH = ClO2 + NaHCO2 + CH3
NaClO2 + CH3COOH = ClO2 + NaHCO2 + CH3NaClO2 + CH3COOH = ClO2 + NaHCO2 + CH3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NAOH+HCL=NACL+H2ONAOH + HCL = NACL + H2O
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na3PO4+HgNO3=Hg3PO4+NaNO3Na3PO4 + 3HgNO3 = Hg3PO4 + 3NaNO3
Na2O + HNO2 = NaNO2 + H2ONa2O + 2HNO2 = 2NaNO2 + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2SiF6 + Na = Si + NaFNa2SiF6 + 4Na = Si + 6NaF
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NO2(g) + H2O(l)= HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaOH(aq) + BaCl2(aq) =Ba(OH)2(s) + NaCl(aq)2NaOH(aq) + BaCl2(aq) = Ba(OH)2(s) + 2NaCl(aq)
NaI + H2SO4 = H2S + I2 + Na2SO4 + H2O8NaI + 5H2SO4 = H2S + 4I2 + 4Na2SO4 + 4H2O
NaI + H2SO4 = H2O + I2 + Na2SO4 + H2O0NaI + 0H2SO4 = -1H2O + 0I2 + 0Na2SO4 + H2O
NO2(g) + H2O(l)= HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaOH(aq) + BaCl2(aq)= Ba(OH)2(s) + NaCl(aq)2NaOH(aq) + BaCl2(aq) = Ba(OH)2(s) + 2NaCl(aq)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NH4OH + AlCl3 =Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4+O2=NO+H2O2NH4 + 3O2 = 2NO + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH(aq) + BaCl2(aq)= Ba(OH)2(s) + NaCl(aq)2NaOH(aq) + BaCl2(aq) = Ba(OH)2(s) + 2NaCl(aq)
NaClO +KI +Na2S2O3 + H = K2SO3 + NaIO3 + HCl + H2O-2NaClO - 4KI - Na2S2O3 + 24H = -2K2SO3 - 4NaIO3 - 2HCl + 13H2O
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaHCO3 =Na2CO3 +H2O+ CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4+O2=NO+H2O2NH4 + 3O2 = 2NO + 4H2O
NH4+O2=NO+H2O2NH4 + 3O2 = 2NO + 4H2O
Na + Cl2 =NaCl2Na + Cl2 = 2NaCl
Na + Cl2 =NaCl2Na + Cl2 = 2NaCl
Na + Cl2 =NaCl2Na + Cl2 = 2NaCl
NaOH + HCl = H2O + NaClNaOH + HCl = H2O + NaCl
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na+H2SO4=Na2SO4+H22Na + H2SO4 = Na2SO4 + H2
N2H4 + N2O4 = N2 + H2O2N2H4 + N2O4 = 3N2 + 4H2O
N5+O2=N2O54N5 + 25O2 = 10N2O5
NaOH + (NH4)2SO4 = Na2SO4 + H2O + NH32NaOH + (NH4)2SO4 = Na2SO4 + 2H2O + 2NH3
NH4OH = H2O +NH3NH4OH = H2O + NH3
Na(s) + N2(g) = Na3N(s)6Na(s) + N2(g) = 2Na3N(s)
NH4ClO4 + Al = Al2O3 + AlCl3 + H2O + NO3NH4ClO4 + 3Al = Al2O3 + AlCl3 + 6H2O + 3NO
N2H4 + N2O4 = N2 + H2O2N2H4 + N2O4 = 3N2 + 4H2O
Na+H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NaIO3 + Na2SO3 + NaHSO3 = Na2SO4 + I2 + H22NaIO3 + 4Na2SO3 + 2NaHSO3 = 6Na2SO4 + I2 + H2
NaCl = Na+Cl22NaCl = 2Na + Cl2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4Cl + NaOH = H2O + NH3 + NaClNH4Cl + NaOH = H2O + NH3 + NaCl
NaI+Cl2=I2+NaCl2NaI + Cl2 = I2 + 2NaCl
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NaCl+H2SO4=HCl+Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
N2+H2=NH3N2 + 3H2 = 2NH3
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l)=NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na + H2O = Na O H + H22Na + 2H2O = 2NaOH + H2
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
Na2CO3 = Na2O + CO2 Na2CO3 = Na2O + CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + Cl2= NaCl2Na + Cl2 = 2NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
N 2 (g)+H 2 (g)=NH 3 (g) N2(g) + 3H2(g) = 2NH3(g)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH 4 NO 3 (s)=N 2 O(g)+H 2 O(l) NH4NO3(s) = N2O(g) + 2H2O(l)
NaOH + KNO3 = NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2CO3 (aq) + C6H8O7 (aq) = Na3C6H5O7 (aq) + CO2 (g) +H2O (l)3Na2CO3(aq) + 2C6H8O7(aq) = 2Na3C6H5O7(aq) + 3CO2(g) + 3H2O(l)
NaHCO3 + O2= CO2 + H2O + Na2CO32NaHCO3 + 0O2 = CO2 + H2O + Na2CO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na2(SO4) + Fe(NO3)3 = NaNO3 + Fe2(SO4)33Na2(SO4) + 2Fe(NO3)3 = 6NaNO3 + Fe2(SO4)3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na2CO3+H2O=NaOH+CO2Na2CO3 + H2O = 2NaOH + CO2
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + O2 =Na4O24Na + O2 = Na4O2
Na + O2 =Na2O4Na + O2 = 2Na2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
Na3PO4 + HCl = NaCl + H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NH4OH(aq) + KAl(SO4)2 * 12H2O(s) = Al(OH)3(s) + (NH4)2SO4(aq) + KOH(aq) + H2O(l) 4NH4OH(aq) + KAl(SO4)2*12H2O(s) = Al(OH)3(s) + 2(NH4)2SO4(aq) + KOH(aq) + 12H2O(l)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O3 + NaOH = NaNO2 + H2ON2O3 + 2NaOH = 2NaNO2 + H2O
N2O3 + NaOH = NaNO2 + H2ON2O3 + 2NaOH = 2NaNO2 + H2O
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NaHCO3 + NaOH=H2O + Na2CO3NaHCO3 + NaOH = H2O + Na2CO3
NaNO3 + (NH4)2S = Na2S + (NH4)NO32NaNO3 + (NH4)2S = Na2S + 2(NH4)NO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NCl3 + H2O = N2 + HCl + N2O2NCl3 + 3H2O = -2N2 + 6HCl + 3N2O
NH3+O2=H2O+NO4NH3 + 5O2 = 6H2O + 4NO
NaClO2 + H2SO4 = ClO2 + Na2SO4 + NaCl + H2O5NaClO2 + 2H2SO4 = 4ClO2 + 2Na2SO4 + NaCl + 2H2O
NH3SO4 + BaCl2 = NH3Cl2 + BaSO4NH3SO4 + BaCl2 = NH3Cl2 + BaSO4
NaOH=H2O+Na2O2NaOH = H2O + Na2O
Na+H2=NaH2Na + H2 = 2NaH
Na+HCl=NaCl+H22Na + 2HCl = 2NaCl + H2
NaOH = H2O + Na2O2NaOH = H2O + Na2O
N + H2O = NOH + H2O0N + H2O = 0NOH + H2O
N + O2 = N2O4N + O2 = 2N2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaNO3+KCl=NaCl+KNO3NaNO3 + KCl = NaCl + KNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NO3- + H2O2 = O2 + NO + H2O0NO3- + 2H2O2 = O2 + 0NO + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
Na + Cl = NaClNa + Cl = NaCl
Na + Cl = NaClNa + Cl = NaCl
NaNO3+H2SO4=NaHSO4+HNO3NaNO3 + H2SO4 = NaHSO4 + HNO3
NaNO3+H2SO4=NaHSO4+HNO3NaNO3 + H2SO4 = NaHSO4 + HNO3
NaSO4 + PbCl2 = NaCl2 + PbSO4NaSO4 + PbCl2 = NaCl2 + PbSO4
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
Ni + Cd++ = Ni++ + CdNi + Cd++ = Ni++ + Cd
Na2S2O3+KIO3+HCl=Na2SO4+K2SO4+ICl+H2ONa2S2O3 + 2KIO3 + 2HCl = Na2SO4 + K2SO4 + 2ICl + H2O
Na2C2O4 + BaBr2 = NaBr + BaC2O4Na2C2O4 + BaBr2 = 2NaBr + BaC2O4
NH4Cl(aq)+NaOH(aq)=H2O(l)+NH3(g)+NaCl(aq)NH4Cl(aq) + NaOH(aq) = H2O(l) + NH3(g) + NaCl(aq)
NH4OH + HF = NH4F + H2ONH4OH + HF = NH4F + H2O
NaN3=Na2+N32NaN3 = Na2 + 2N3
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na + MnCl2 = ClNa + Mn2Na + MnCl2 = 2ClNa + Mn
NH4 + NaOH = NH3 + H2O + NaOH0NH4 + NaOH = 0NH3 + 0H2O + NaOH
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Ni2(CO3)3=Ni+CO3Ni2(CO3)3 = 2Ni + 3CO3
Ni2(CO3)=Ni+CO3Ni2(CO3) = 2Ni + CO3
NaCLO3+K2SnO2=NaCL+K2SnO3NaCLO3 + 3K2SnO2 = NaCL + 3K2SnO3
NaCLO3+K2SnO2=NaCL+K2SnO3NaCLO3 + 3K2SnO2 = NaCL + 3K2SnO3
Na2SO4(aq) + CaCl2(aq)=CaSO4(s) + NaCl(aq)Na2SO4(aq) + CaCl2(aq) = CaSO4(s) + 2NaCl(aq)
Na2SO4(aq) + CaCl2(aq)= CaSO4(s) + 2NaCl(aq)Na2SO4(aq) + CaCl2(aq) = CaSO4(s) + 2NaCl(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH2N2 + 2H2 = 2NH2
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NaOH + H2O = NaO + H3ONaOH + H2O = NaO + H3O
NaO2 + H2O = NaOH + O24NaO2 + 2H2O = 4NaOH + 3O2
NaHCO3 + H2 SO4 = Na2 SO4 + CO2 + H2 O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
N2O5+H2O=2HNO3N2O5 + H2O = 2HNO3
NH3 + HOCl = NH2Cl + H2ONH3 + HOCl = NH2Cl + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl+F2=NaF+Cl2NaCl + F2 = 2NaF + 2Cl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH + K2Cr2O7 = KOH + Na2Cr2O72NaOH + K2Cr2O7 = 2KOH + Na2Cr2O7
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
N2O + OH = NO2 + H2ON2O + 6OH = 2NO2 + 3H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + OH = NO3 + H2ONO2 + 2OH = NO3 + H2O
NH4CO3 + AlCl = NH4Cl + AlCO3NH4CO3 + AlCl = NH4Cl + AlCO3
Na2CO3 + 2HCl = 2NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2 SO4 + HCl = Na2Cl8S + 2H4O2Na2SO4 + 8HCl = Na2Cl8S + 2H4O2
Na3PO4+NiCl2=Ni3(PO4)2+NaCl2Na3PO4 + 3NiCl2 = Ni3(PO4)2 + 6NaCl
N2H4 + N2O4 = H2O + N22N2H4 + N2O4 = 4H2O + 3N2
NH4NO3 = N2 +O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaNO3 = NaNO2+O22NaNO3 = 2NaNO2 + O2
NaNO3 = NaNO2+O22NaNO3 = 2NaNO2 + O2
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3 + O2 = N2O + H2ONH4NO3 + 0O2 = N2O + 2H2O
NaNO3 = NaNO2+O22NaNO3 = 2NaNO2 + O2
Na + HCL = NaCL + H22Na + 2HCL = 2NaCL + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na+O2 =Na2O 4Na + O2 = 2Na2O
NaOH=Na+OHNaOH = Na + OH
NaOH=Na+O+HNaOH = Na + O + H
NaOH=Na+OHNaOH = Na + OH
NH3 + O2=NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + O2-4Na - 2H2O = -4NaOH + O2
NaIO3 + SO2 + H20 = I2 + NaHSO4 + H2SO410NaIO3 + 15SO2 + H20 = 5I2 + 10NaHSO4 + 5H2SO4
NaOH + SO2 = NaHSO3NaOH + SO2 = NaHSO3
Ni S + HCl+HNO3=NiCl2+NO+S+H2O3NiS + 6HCl + 2HNO3 = 3NiCl2 + 2NO + 3S + 4H2O
Ni S + HCl+HNO3=NiCl2+NO+S+H2010NiS + 20HCl + 0HNO3 = 10NiCl2 + 0NO + 10S + H20
NaHCO3 + HCl =NaCl + CO3 +H33NaHCO3 + 3HCl = 3NaCl + 3CO3 + 2H3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2O +H2O = NO +H2O0N2O + H2O = 0NO + H2O
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaI + CaCl2 = NaCl2 + CaINaI + CaCl2 = NaCl2 + CaI
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2Cr2O7+HCl=NaCl+CrCl3+H2O+Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
NaN3 = Na+N22NaN3 = 2Na + 3N2
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na+N=Na3N3Na + N = Na3N
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na+N=NaNNa + N = NaN
Na2Cr2O7+ SO2+ H2O = CrOHSO4+ Na2SO4Na2Cr2O7 + 3SO2 + H2O = 2CrOHSO4 + Na2SO4
Na+KNO3 = Na2O+K2O+N210Na + 2KNO3 = 5Na2O + K2O + N2
Na2CO3+ H3PO4 = Na3PO4+ H2O+ CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3+ O2 = NO+ H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+ HCL = NaCL+ H2O+ CO2Na2CO3 + 2HCL = 2NaCL + H2O + CO2
NH3+O2 = NO+H2O14NH3 + 5O2 = 4NO + 6H2O1
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = NaO2Na + O2 = 2NaO
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na+O2=Na2O4Na + O2 = 2Na2O
NH3+O2=H2O+N24NH3 + 3O2 = 6H2O + 2N2
NH3+O2=H2O+N24NH3 + 3O2 = 6H2O + 2N2
NH3+O2=H2O+N24NH3 + 3O2 = 6H2O + 2N2
NH3+O2=H2O+N24NH3 + 3O2 = 6H2O + 2N2
NO+O2=NO22NO + O2 = 2NO2
NH3+O2=HNO3+H2ONH3 + 2O2 = HNO3 + H2O
Na2Cr2O7 + NH4Cl = Cr2O3 + NaCl + N + H2ONa2Cr2O7 + 2NH4Cl = Cr2O3 + 2NaCl + 2N + 4H2O
Na2Cr2O7 + NH4Cl = Cr2O3 + NaCl + N + H2ONa2Cr2O7 + 2NH4Cl = Cr2O3 + 2NaCl + 2N + 4H2O
Na2Cr2O7 + NH4Cl = Cr2O3 + NaCl + N + H2ONa2Cr2O7 + 2NH4Cl = Cr2O3 + 2NaCl + 2N + 4H2O
NH4Cl+NaNH2=NH3+NaClNH4Cl + NaNH2 = 2NH3 + NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2H4=NH3+N23N2H4 = 4NH3 + N2
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na+H2O=NaOH+O2-4Na - 2H2O = -4NaOH + O2
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NO+O2=NO22NO + O2 = 2NO2
Na2S2O3 + KIO3 + HCl = Na2SO4 + K2SO4 + ICl + H2ONa2S2O3 + 2KIO3 + 2HCl = Na2SO4 + K2SO4 + 2ICl + H2O
Na2Cr2O7+HCl=NaCl+CrCl3+H2O+Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na2Cr2O7+HCl=NaCl+CrCl3+H2O+Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
NaIO3 + SO2 + H2O = NaHSO4 + H2SO4 +I22NaIO3 + 5SO2 + 4H2O = 2NaHSO4 + 3H2SO4 + I2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na2O + H2O = 2NaOHNa2O + H2O = 2NaOH
NaCl + MnO2 + H2SO4 = NaHSO4 + MnSO4 + Cl2 + H2O2NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + Cl2 + 2H2O
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO3 + NaOH + Al = NH3 + Na2O + Al2O32NO3 + 6NaOH + 6Al = 2NH3 + 3Na2O + 3Al2O3
NaCl+Mg(NO3)2 = MgCl2+NaNO32NaCl + Mg(NO3)2 = MgCl2 + 2NaNO3
Na2CO3 + SO2 + H2O = NaHSO3 + CO2Na2CO3 + 2SO2 + H2O = 2NaHSO3 + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2+H2O=NaOH+H2Na2 + 2H2O = 2NaOH + H2
NH3 + O2 = N + H2O4NH3 + 3O2 = 4N + 6H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na2CO3+H3PO4=Na3PO4+H2CO33Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2CO3
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaBr+AgNO3=NaNO3+AgBrNaBr + AgNO3 = NaNO3 + AgBr
NaNO2 + Zn + NaOH = Na2ZnO2 + H2O + NH3NaNO2 + 3Zn + 5NaOH = 3Na2ZnO2 + H2O + NH3
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+HIO3=NO3+HI+H2O2NH3 + 3HIO3 = 2NO3 + 3HI + 3H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3+O2= NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4Br = NH3 + HBrNH4Br = NH3 + HBr
NaCl = Na + ClNaCl = Na + Cl
NH3 + HPo4 = (NH4)Po4NH3 + HPo4 = (NH4)Po4
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
N2H4+Cu(OH)2=N2+Cu+H2ON2H4 + 2Cu(OH)2 = N2 + 2Cu + 4H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.