Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaNO2 + NaI + HCl = NO + I2 + NaCl + H2O2NaNO2 + 2NaI + 4HCl = 2NO + I2 + 4NaCl + 2H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NaClO + S8 = Cl2 + SO2 +Na16NaClO + S8 = 8Cl2 + 8SO2 + 16Na
Na + ZnI2 = NaI + Zn2Na + ZnI2 = 2NaI + Zn
NaCl = Na + Cl22NaCl = 2Na + Cl2
Na2C2O4(aq) + Mn(NO3)2(aq) = MnC2O4(s) + 2NO3Na(aq)Na2C2O4(aq) + Mn(NO3)2(aq) = MnC2O4(s) + 2NO3Na(aq)
Na2C2O4(aq) + Mn(NO3)2(aq) = MnC2O4(s) + 2NO3Na(aq)Na2C2O4(aq) + Mn(NO3)2(aq) = MnC2O4(s) + 2NO3Na(aq)
Na2C2O4(aq) + Mn(NO3)2(aq) = MnC2O4(s) + 2NO3Na(aq)Na2C2O4(aq) + Mn(NO3)2(aq) = MnC2O4(s) + 2NO3Na(aq)
Na2S + 2H3O = 2Na + SO + 2H2O-1Na2S + 2H3O = -2Na - SO + 3H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO2+N2O3=N2O54NO2 - N2O3 = N2O5
Na + O2 = Na2O22Na + O2 = Na2O2
Na2SO3+HCl=NaCl + H2SO3Na2SO3 + 2HCl = 2NaCl + H2SO3
N2O3+NO2=N2O5-1N2O3 + 4NO2 = N2O5
NaKC4H4O6 + H2O2 = H2O + CO2 + NaOH + KOH NaKC4H4O6 + 5H2O2 = 6H2O + 4CO2 + NaOH + KOH
NO+ H2O=NH3+O24NO + 6H2O = 4NH3 + 5O2
NO + O2= NO22NO + O2 = 2NO2
Na(NO3)(s)=Na(NO2)(s)+O2(g)2Na(NO3)(s) = 2Na(NO2)(s) + O2(g)
Na+H+C+O2=NaHCO32Na + 2H + 2C + 3O2 = 2NaHCO3
Na+H+C+O2=NaHCO2Na + H + C + O2 = NaHCO2
N2+H2=NH3N2 + 3H2 = 2NH3
N+H=NHN + H = NH
Na2B4O7(s) + H2SO4(aq) + H2O(l) = H3BO3(s) + Na2SO4(aq)Na2B4O7(s) + H2SO4(aq) + 5H2O(l) = 4H3BO3(s) + Na2SO4(aq)
NH4Br + Pb(C2H3O2)2 = (NH4)2Pb+ Br(C2H3O2)2NH4Br + Pb(C2H3O2)2 = (NH4)2Pb + 2Br(C2H3O2)
Na+F2=NaF2Na + F2 = 2NaF
NaHCO3 + PbSO4 = H2O + CO2 + PbCO3 + Na2SO42NaHCO3 + PbSO4 = H2O + CO2 + PbCO3 + Na2SO4
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl(s) + NH3(g) + CO2(g) + H2O (l) = NH4Cl(aq) + NaHCO3(s)NaCl(s) + NH3(g) + CO2(g) + H2O(l) = NH4Cl(aq) + NaHCO3(s)
NH4 + NO = N + H2ONH4 + 2NO = 3N + 2H2O
Na2C2O4 + AgNO3 = Ag2C2O4 + NaNO3Na2C2O4 + 2AgNO3 = Ag2C2O4 + 2NaNO3
Na2CO3+H2SO4=CO2+Na2SO4+H2ONa2CO3 + H2SO4 = CO2 + Na2SO4 + H2O
NO2+H2O=NO+HNO33NO2 + H2O = NO + 2HNO3
NaBrO3 + H2S = NaBr + H2O + SNaBrO3 + 3H2S = NaBr + 3H2O + 3S
NaOH + KI + K2Cr2O7 = I2 + K2CrO4 + KOH + Na2O 2NaOH + 0KI - K2Cr2O7 = 0I2 - 2K2CrO4 + 2KOH + Na2O
Ni(OH)2 + NH3 = Ni(NH3)6 + OHNi(OH)2 + 6NH3 = Ni(NH3)6 + 2OH
NaNO3(s) = NaNO2(s) + O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
NaNO3(s) = NaNO2(s) + O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
NH4NO3=N2O + H2ONH4NO3 = N2O + 2H2O
N2 + 3 H2=2 NH3N2 + 3H2 = 2NH3
NiO(OH)+H2O+e-=Ni(OH)2+OH-2NiO(OH) + 2H2O + e- = 2Ni(OH)2 + 2OH-
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l)=NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NH3 (g) + O2 (g)=N2 (g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+HNO3=N2+H2O5NH3 + 3HNO3 = 4N2 + 9H2O
Na(s)+ MgI2(aq)=NaI(aq)+Mg(s)2Na(s) + MgI2(aq) = 2NaI(aq) + Mg(s)
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na + H2O = H2 + Na2O2Na + H2O = H2 + Na2O
NO2(aq)+Cr2O7(aq)=Cr(aq)+NO3(aq)7NO2(aq) + Cr2O7(aq) = 2Cr(aq) + 7NO3(aq)
NO(aq)+Cr2O7(aq)=Cr(aq)+NO(aq)NO(aq) + 0Cr2O7(aq) = 0Cr(aq) + NO(aq)
NO(aq)+Cr2O2(aq)=Cr(aq)+NO(aq)NO(aq) + 0Cr2O2(aq) = 0Cr(aq) + NO(aq)
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Na + Cl2= NaCl 2Na + Cl2 = 2NaCl
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na3PO4+3KOH=NaOH+K3PO4 Na3PO4 + 3KOH = 3NaOH + K3PO4
NaNO3+H2SO4=Na2SO4+HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
Na + Br2 = NaBr2Na + Br2 = 2NaBr
N2 + 5O2 = N2O52N2 + 5O2 = 2N2O5
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NH4Cl + NaNO2 = N2 + NaCl + 2H2ONH4Cl + NaNO2 = N2 + NaCl + 2H2O
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na3PO3+CuSO4=Na3SO4+CuPO3Na3PO3 + CuSO4 = Na3SO4 + CuPO3
Na3PO3+CuSO4=Na3SO4+CuPO3Na3PO3 + CuSO4 = Na3SO4 + CuPO3
NaOH+Pb2+C2H3O2=NaC2H3O2+PbOH2NaOH + Pb2 + 2C2H3O2 = 2NaC2H3O2 + 2PbOH
NaOH+PbC2H3O2=NaC2H3O2+PbOHNaOH + PbC2H3O2 = NaC2H3O2 + PbOH
N2 + H2= NH3N2 + 3H2 = 2NH3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
Na2CO3+BaCl2=NaCl+BaCO3Na2CO3 + BaCl2 = 2NaCl + BaCO3
NH4OH + HCL = 2NH4CL + 4H2ONH4OH + HCL = NH4CL + H2O
NH4OH + HCL = 2NH4CL + 4H2ONH4OH + HCL = NH4CL + H2O
Na+O2 = 2NaO2Na + O2 = 2NaO
Na+O2 = 2NaO2Na + O2 = 2NaO
NO+H2=NH3+H2O2NO + 5H2 = 2NH3 + 2H2O
Ni(CO)4 = Ni+CONi(CO)4 = Ni + 4CO
Ni+Br2=NiBr2Ni + Br2 = NiBr2
Ni+Br2=NiBr2Ni + Br2 = NiBr2
NH4Cl + BaO2H2 = BaCl2 + NH3 + H2O2NH4Cl + BaO2H2 = BaCl2 + 2NH3 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3+CaCl2=NaCl+CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH4NO3 = 2N2 + H2O+O22NH4NO3 = 2N2 + 4H2O + O2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na (s) + MgI2 = NaI (aq) + Mg (s)2Na(s) + MgI2 = 2NaI(aq) + Mg(s)
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+HNa + H2O = NaOH + H
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2S+AgNO3=NaNO3+Ag2SNa2S + 2AgNO3 = 2NaNO3 + Ag2S
Na2S+AgNO3=NaNO3+Ag2SNa2S + 2AgNO3 = 2NaNO3 + Ag2S
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH4OH+Hg(NO3)2= Hg(OH)2+NH4NO32NH4OH + Hg(NO3)2 = Hg(OH)2 + 2NH4NO3
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
N2+O2=N2O2N2 + O2 = 2N2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+MgF2= NaF+Mg2Na + MgF2 = 2NaF + Mg
Na +O2 =Na2O4Na + O2 = 2Na2O
Ni(ClO3)2 =NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
Na(s)+MgI2(aq)=NaI(aq)+Mg(s)2Na(s) + MgI2(aq) = 2NaI(aq) + Mg(s)
NH3(g) + O2(s) = NO(g) + H2O(g)4NH3(g) + 5O2(s) = 4NO(g) + 6H2O(g)
NH3 + O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH3(g)+O2(g) = N2(g)+H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NbI3+I2=NbI5NbI3 + I2 = NbI5
Na2CO3 + HCOOH = H2O + CO2 + HCOONaNa2CO3 + 2HCOOH = H2O + CO2 + 2HCOONa
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3   + O2=N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=Na2O22Na + O2 = Na2O2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
N2+H2=NH3N2 + 3H2 = 2NH3
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NaNO3 + Al2(CO3)3 = Na2CO3 + Al(NO3)36NaNO3 + Al2(CO3)3 = 3Na2CO3 + 2Al(NO3)3
NH3(g)+O2(g)=H2O+N2(g)4NH3(g) + 3O2(g) = 6H2O + 2N2(g)
N2+ H2 = NH2N2 + 2H2 = 2NH2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na2 SO4+Fe(NO3)3 = NaNO3+Fe2(SO4)33Na2SO4 + 2Fe(NO3)3 = 6NaNO3 + Fe2(SO4)3
Na2SO4(aq)+CaI2(aq)=CaSO4(s)+2NaI(aq)Na2SO4(aq) + CaI2(aq) = CaSO4(s) + 2NaI(aq)
NH4OH + SnCl2 = NH4Cl + Sn(OH)22NH4OH + SnCl2 = 2NH4Cl + Sn(OH)2
Na2O + HOH = 2NaOHNa2O + HOH = 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
N3H7O + NO2 = N2O + H2O 6N3H7O + 16NO2 = 17N2O + 21H2O
NH3 + O2= NO2 +H2O 4NH3 + 7O2 = 4NO2 + 6H2O
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3
Ni+HNO3=Ni(NO3)2+H2O+NO3Ni + 8HNO3 = 3Ni(NO3)2 + 4H2O + 2NO
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NH4OH + H3PO4 =(NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NO + Cl2 = 2NOCl2NO + Cl2 = 2NOCl
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Ni + Cu2+ = Ni2+ + Cu2Ni + Cu2+ = Ni2+ + 2Cu
Na3PO4 + Ca(NO3)2 = Ca3(PO4)2 + NaNO32Na3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6NaNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
NaClO(aq) + Na2S2O3(aq)+NaOH(aq) = NaCl(aq)+Na2SO4(aq)+H2O(l)4NaClO(aq) + Na2S2O3(aq) + 2NaOH(aq) = 4NaCl(aq) + 2Na2SO4(aq) + H2O(l)
NO2 +H2O= HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na(s) +H2O (l) =NaOH (aq) +H2 (g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaOH + P4 +H2O =NaH2PO2+ PH33NaOH + P4 + 3H2O = 3NaH2PO2 + PH3
NH4Cl + HCl = NH4 + HCl0NH4Cl + HCl = 0NH4 + HCl
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Na2SO3+HCl=H2SO3+NaClNa2SO3 + 2HCl = H2SO3 + 2NaCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaOH + Si + H2O = Na2SiO3 + H22NaOH + Si + H2O = Na2SiO3 + 2H2
NO2- + H+ + Sn2+ = N2 + H2O + Sn4+-2NO2- - 8H+ + 12Sn2+ = -1N2 - 4H2O + 6Sn4+
NO2- + H+ + Sn2+ = N2 + H2O + Sn4+-2NO2- - 8H+ + 12Sn2+ = -1N2 - 4H2O + 6Sn4+
NO2- + H+ +Sn2+= N2 + H2O + Sn4+-2NO2- - 8H+ + 12Sn2+ = -1N2 - 4H2O + 6Sn4+
NH4NO3 = N2+H20+O210NH4NO3 = 10N2 + 2H20 + 15O2
NH3(g) + O2(g) = H2O(g) + NO2(g)4NH3(g) + 7O2(g) = 6H2O(g) + 4NO2(g)
NO2- + 8H+ + Sn2+ =N2 +H2O +Sn4+-2NO2- - 8H+ + 12Sn2+ = -1N2 - 4H2O + 6Sn4+
NaOH+NaNO2+Al+H2O=NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
Ni(OH)2 = NiO(s) + H2O(g) Ni(OH)2 = NiO(s) + H2O(g)
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3 + PbO == Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na2S4O6 + HCl + Al = NaCl+Al2Cl6+H2O+H2SNa2S4O6 + 20HCl + 6Al = 2NaCl + 3Al2Cl6 + 6H2O + 4H2S
NH3 + O2 =NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na + F2 = NaF2Na + F2 = NaF2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na(s)+Br2(l)=NaBr(s)2Na(s) + Br2(l) = 2NaBr(s)
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Na2CO3 + HCl = Na2Cl + HCO3Na2CO3 + HCl = Na2Cl + HCO3
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl + KNO3 = NaNO3 + KClNaCl + KNO3 = NaNO3 + KCl
Na+O2=Na2O4Na + O2 = 2Na2O
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
N2H4= NH3+N23N2H4 = 4NH3 + N2
Na2S+ Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + Zn(NO3)2 = 2 NaNO3 + ZnCO3Na2CO3 + Zn(NO3)2 = 2NaNO3 + ZnCO3
NH4Cl(aq) + AgNO3(aq) = AgCl(s) + NH4NO3(aq)NH4Cl(aq) + AgNO3(aq) = AgCl(s) + NH4NO3(aq)
NH4F+AlCl3= NH4Cl+AlF33NH4F + AlCl3 = 3NH4Cl + AlF3
N2+H2O=H+NO3N2 + 6H2O = 12H + 2NO3
NaOH(aq) + HNO3(aq) = NaNO3(aq) + H2O(l)NaOH(aq) + HNO3(aq) = NaNO3(aq) + H2O(l)
N2+H2O=NO3+HN2 + 6H2O = 2NO3 + 12H
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
Na(C6H5COO) + HCl = C6H5COOH + NaClNa(C6H5COO) + HCl = C6H5COOH + NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + 2Cl2 = 2NaCl2Na + Cl2 = 2NaCl
NA + H2O = NAOH + H22NA + 2H2O = 2NAOH + H2
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaOH + AlCl3 = NaCl+ Al(OH)33NaOH + AlCl3 = 3NaCl + Al(OH)3
NH4NO2=N+H2ONH4NO2 = 2N + 2H2O
NiS+O2=SO2+Ni2O34NiS + 7O2 = 4SO2 + 2Ni2O3
NiS+O2=SO2+Ni2O34NiS + 7O2 = 4SO2 + 2Ni2O3
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2(g) = NO(g) + O2(g) 2NO2(g) = 2NO(g) + O2(g)
NaCl + Ag2SO4 = Na2SO4 + AgCl 2NaCl + Ag2SO4 = Na2SO4 + 2AgCl
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NH2(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)4NH2(g) + 5O2(g) + 4CH4(g) = 4HCN(aq) + 10H2O(l)
NO3 +I= IO3 + NO23NO3 + I = IO3 + 3NO2
NO +I= IO3 + NO23NO - I = -1IO3 + 3NO2
Na2SiF6(s) + Na(s) = Si(s) +NaF(s) Na2SiF6(s) + 4Na(s) = Si(s) + 6NaF(s)
N2(g) + O2 (g) = N2O3(g)2N2(g) + 3O2(g) = 2N2O3(g)
NaOH+CuCl2=Cu(OH)2+NaCl2NaOH + CuCl2 = Cu(OH)2 + 2NaCl
NaCl+Pb(NO3)2=PbCl2+NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
Na + HCl = H2 + NaCl2Na + 2HCl = H2 + 2NaCl
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
Na + O2 = Na2O4Na + O2 = 2Na2O
N2+F2=NF3N2 + 3F2 = 2NF3
N2+Mg=Mg3N2N2 + 3Mg = Mg3N2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = Na2O22Na + O2 = Na2O2
NiCO3 + CrBr6 = Cr(CO3)3 + NiBr23NiCO3 + CrBr6 = Cr(CO3)3 + 3NiBr2
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NaCIO3 = NaCI + O22NaCIO3 = 2NaCI + 3O2
NaF+Br2=2NaBr+F22NaF + Br2 = 2NaBr + F2
Ni+O2=Ni2O34Ni + 3O2 = 2Ni2O3
N3H7O+NO2=N2O+H2O 6N3H7O + 16NO2 = 17N2O + 21H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na3PO4 + FeCl2 = NaCl+ Fe3(PO4)22Na3PO4 + 3FeCl2 = 6NaCl + Fe3(PO4)2
NaNO2 + Al + HCl = NaCl + AlCl3 + NH4Cl +H2ONaNO2 + 2Al + 8HCl = NaCl + 2AlCl3 + NH4Cl + 2H2O
NH3 + F2 = NH4F + NF34NH3 + 3F2 = 3NH4F + NF3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O4 + O2 + H2O = HNO32N2O4 + O2 + 2H2O = 4HNO3
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO3 + H2O = NO + OHNO3 + 2H2O = NO + 4OH
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na(s)+H2O(l) = NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na(HCO3) + H(C2H3O2) = Na(C2H3O2) + H2CO3Na(HCO3) + H(C2H3O2) = Na(C2H3O2) + H2CO3
NH4Cl + NaOH = NH3 + H2O + NaClNH4Cl + NaOH = NH3 + H2O + NaCl
NaC2H3O2 + H2SO4 = Na2SO4 + HC2H3O22NaC2H3O2 + H2SO4 = Na2SO4 + 2HC2H3O2
NH4Cl + NaOH = NH3 + H2O + NaClNH4Cl + NaOH = NH3 + H2O + NaCl
NH4Cl +Ca(OH)2 = CaCl2 +NH3 +H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na3PO4 + KOH= NaOH+ K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NaCLO = NaCL + NaCLO33NaCLO = 2NaCL + NaCLO3
NH3(l) + CO2(g) = CO(NH2)2(s) + H2O(l)2NH3(l) + CO2(g) = CO(NH2)2(s) + H2O(l)
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaN3=Na+N22NaN3 = 2Na + 3N2
Na2S + 2AgC2H3O2 = 2NaC2H3O2 + Ag2SNa2S + 2AgC2H3O2 = 2NaC2H3O2 + Ag2S
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na2S + 2AgC2H3O2 = 2NaC2H3O2 + Ag2SNa2S + 2AgC2H3O2 = 2NaC2H3O2 + Ag2S
NO + I3- = NO--- + I--2NO + 3I3- = -2NO--- + 9I-
NaCl(s)+SO2(g)+H2O(g)+O2(g) = Na2SO4(s)+HCl(g)4NaCl(s) + 2SO2(g) + 2H2O(g) + O2(g) = 2Na2SO4(s) + 4HCl(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2O(g)+H2O(l)=2NaOH(g)Na2O(g) + H2O(l) = 2NaOH(g)
NO2- + H+ +SN2+= N2 + H2O + SN4+0NO2- + 0H+ + SN2+ = -1N2 + 0H2O + SN4+
NaI + H2SO4=H2S + I2 + Na2SO4+H2020NaI + 10H2SO4 = 0H2S + 10I2 + 10Na2SO4 + H20
NaI + H2SO4=H2S + I2 + Na2SO4+H2020NaI + 10H2SO4 = 0H2S + 10I2 + 10Na2SO4 + H20
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l)=NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
NaOH=Na+O2+H2O4NaOH = 4Na + O2 + 2H2O
NH3+5O2=NO+6H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2+Sr=Sr(NO3)2N2 + 3O2 + Sr = Sr(NO3)2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO3=NaNO2+ONaNO3 = NaNO2 + O
NH3 + O = NO + H2O2NH3 + 5O = 2NO + 3H2O
NaClO + HCl = Cl2 + NaCl + H2ONaClO + 2HCl = Cl2 + NaCl + H2O
NaC2H3O2+HNO3=NaNO3+HC2H3O2NaC2H3O2 + HNO3 = NaNO3 + HC2H3O2
Na(s) + H2 O(l) = NaOH(aq) + H2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaCl(s) + H2SO4 (l) = HCl(g) + NaHSO4 (s)NaCl(s) + H2SO4(l) = HCl(g) + NaHSO4(s)
NaOH + NaNO2 + Al + H2O = NH3 + NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
Na(s) + H2 O(l) = NaOH(aq) + H2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2O5=N2O4+O22N2O5 = 2N2O4 + O2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NO3- + CH3OH = N2 + HCO3- + H2O + OH-6NO3- + 5CH3OH = 3N2 + 5HCO3- + 7H2O + OH-
NO3- + CH3OH = N2 + HCO3- + H2O + OH-6NO3- + 5CH3OH = 3N2 + 5HCO3- + 7H2O + OH-
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na (g) + 2HCl (g) = H2 (g) + 2NaCl (s) 2Na(g) + 2HCl(g) = H2(g) + 2NaCl(s)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaNO3+H2SO4=Na2SO4+HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
Na2CO3 + 2HCl = 2NaCl +H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaClO+Al=Na+AlCl3+O3NaClO + Al = 3Na + AlCl3 + 3O
NO2 + H2O = NO + HNO33NO2 + H2O = NO + 2HNO3
NaCl + CO2 = CCl4 + Na2O4NaCl + CO2 = CCl4 + 2Na2O
Na2O + HCl = NaCl +H2ONa2O + 2HCl = 2NaCl + H2O
NO3- + CH3OH = N2 + HCO3- + H2O + OH-6NO3- + 5CH3OH = 3N2 + 5HCO3- + 7H2O + OH-
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3 N2 + 3H2 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
Na2O + H2SO4 = Na2SO4 + H2O Na2O + H2SO4 = Na2SO4 + H2O
NaNO3=NaNO2=O22NaNO3 = 2NaNO2 + O2
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na3PO4+H2O=H3O+Na+PNa3PO4 - 12H2O = -8H3O + 3Na + P
NiCO3=NiO+CO2NiCO3 = NiO + CO2
NiCO3=NiO+CO2NiCO3 = NiO + CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2 + O2 = N2O54NO2 + O2 = 2N2O5
NH3+O=NO+H2O2NH3 + 5O = 2NO + 3H2O
NiCl2= Ni+Cl2NiCl2 = Ni + Cl2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4NO3=N2+H2+O22NH4NO3 = 2N2 + 4H2 + 3O2
NH4NO2=N2+H2+O2NH4NO2 = N2 + 2H2 + O2
NaHS+H2SO4=Na2SO4+H2S2NaHS + H2SO4 = Na2SO4 + 2H2S
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaOH + H2SO4 = Na2SO4 + H2O 2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2H4(l)=NH3(g)+N2(g) 3N2H4(l) = 4NH3(g) + N2(g)
NO2F + H2O = HF + HNO3NO2F + H2O = HF + HNO3
Na(II)S+HCl = NaCl+H(II)SNa(II)S + HCl = NaCl + H(II)S
N2 + O2 + Br2 = 2NOBrN2 + O2 + Br2 = 2NOBr
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NaCl + S= Na2S +Cl22NaCl + S = Na2S + Cl2
NH4Br + CaCl2 = NH4Cl2 + CaBrNH4Br + CaCl2 = NH4Cl2 + CaBr
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaH+H2O=NaOH +H2NaH + H2O = NaOH + H2
NaH+H2O= NaOH +H2NaH + H2O = NaOH + H2
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N2(g) + O2(g) = NO(g)N2(g) + O2(g) = 2NO(g)
NiCl2 + NaBr = NiBr2 + NaClNiCl2 + 2NaBr = NiBr2 + 2NaCl
NH3 +CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
Na + Cu3 (PO4)2 = Na3PO4 +Cu6Na + Cu3(PO4)2 = 2Na3PO4 + 3Cu
Na(OH) + H2(SO4) = 2Na(SO4) + H2(OH)Na(OH) + H2(SO4) = Na(SO4) + H2(OH)
Na(OH) + H2(SO4) = Na(SO4) + H2(OH)Na(OH) + H2(SO4) = Na(SO4) + H2(OH)
Na + FeBr3 = Fe + NaBr3Na + FeBr3 = Fe + NaBr3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = Na2O4Na + O2 = 2Na2O
NaCl = Na + Cl22NaCl = 2Na + Cl2
NaClO + HCl = NaCl + H2O + Cl2NaClO + 2HCl = NaCl + H2O + Cl2
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaHCO3 + HC2H3O2= NaC2H3O2 + H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3 + HC2H3O2= NaC2H3O2 + H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NaHCO3+HC2H3O2=NaC2H3O2+H2O+CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NaNO3+H2SO4=Na2SO4+HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaHCO3+HC2H3O2=NaC2H3O2+H2CO3NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO3
Na2S+CaCl2=2NaCl+CaSNa2S + CaCl2 = 2NaCl + CaS
Na2S+CaCl2=2NaCl+CaSNa2S + CaCl2 = 2NaCl + CaS
NaOH+H2SO4 = Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
N2O5=N2O4+ON2O5 = N2O4 + O
NaOH+SO2 = Na2SO3+H2O2NaOH + SO2 = Na2SO3 + H2O
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NO2- + Al+ H2O = NH4+ + AlO2-NO2- + 2Al + 2H2O = NH4+ + 2AlO2-
NO2- + Cr2O7-- + H+ = NO3- + Cr+++ + H2O3NO2- + Cr2O7-- + 8H+ = 3NO3- + 2Cr+++ + 4H2O
NO2- + Cr2O72- + H+ = NO3- + Cr3+ + H2O427NO2- + 6Cr2O72- + 10H+ = 427NO3- + 4Cr3+ + 5H2O
NO2- + Cr2O72- +H+ = NO3-+ Cr3++H2O427NO2- + 6Cr2O72- + 10H+ = 427NO3- + 4Cr3+ + 5H2O
Na2CO3 + Ca(OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na3PO4+CsOH=NaOH+Cs3PO4Na3PO4 + 3CsOH = 3NaOH + Cs3PO4
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaNO3+BeF2=Be(NO3)2+NaF2NaNO3 + BeF2 = Be(NO3)2 + 2NaF
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO3 + H2SO4 + KClO3 = Na2SO4 + K2SO4 + Cl2 + H2O5Na2SO3 + H2SO4 + 2KClO3 = 5Na2SO4 + K2SO4 + Cl2 + H2O
Na + Al+++ =Na+ + Al3Na + Al+++ = 3Na+ + Al
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+CuO=Cu+N2+H2O 2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na + Al+3 = Na+ + Al3Na + Al+3 = 3Na+ + Al
Na +Cu3 (PO4)2= Na3PO4+Cu6Na + Cu3(PO4)2 = 2Na3PO4 + 3Cu
Na (s) +H2O(l) =NaOH (aq) +H2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3 (g) + HCl (g)= NH4Cl (s) NH3(g) + HCl(g) = NH4Cl(s)
NO3 (g)= N2 (g) + O2 (g)2NO3(g) = N2(g) + 3O2(g)
Na2S (s) = Na (s) + S (s) Na2S(s) = 2Na(s) + S(s)
Na2SO3 + NaBr = BrSO3 + NaNa2Na2SO3 + NaBr = BrSO3 + NaNa2
N2 + Mg = Mg3N2N2 + 3Mg = Mg3N2
NH4Cl = NH3 + HClNH4Cl = NH3 + HCl
Na2S(aq) + Cu(NO3)2(aq) = NaNO3 + CuSNa2S(aq) + Cu(NO3)2(aq) = 2NaNO3 + CuS
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na(s) + H2O(l) = NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NO2 + NH3 = N2 + H2O6NO2 + 8NH3 = 7N2 + 12H2O
Ni (NO3)2 + Ca3 (PO4)2 = Ca3 (NO3)2 + Ni (PO4)2 Ni(NO3)2 + Ca3(PO4)2 = Ca3(NO3)2 + Ni(PO4)2
NaCl + NH3 + CO2 + H2O =NH4Cl + NaHCO3 NaCl + NH3 + CO2 + H2O = NH4Cl + NaHCO3
NaCl(aq) + Ba(s)= BaCl2(aq) + Na(s)2NaCl(aq) + Ba(s) = BaCl2(aq) + 2Na(s)
Na3PO4(aq) + AlCl3(aq) = NaCl(aq) + AlPO4(s)Na3PO4(aq) + AlCl3(aq) = 3NaCl(aq) + AlPO4(s)
Na2CO3 + AgNO3 = Ag2CO3 + NaNO3Na2CO3 + 2AgNO3 = Ag2CO3 + 2NaNO3
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2(g) + O2(g) + H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2Cl4+CH4 = CCl4+H2+N2N2Cl4 + CH4 = CCl4 + 2H2 + N2
Na+2HCl=H2+2NaCl2Na + 2HCl = H2 + 2NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2- + H+ + Sn2+ = N2 + H2O + Sn4+-2NO2- - 8H+ + 12Sn2+ = -1N2 - 4H2O + 6Sn4+
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2S+ (CH3COO)2Pb = PbS + 2Na(CH3COO)Na2S + (CH3COO)2Pb = PbS + 2Na(CH3COO)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na I +H 2 S O 4 = H 2 S + I 2 + Na 2 S O 4 + H 2 O8NaI + 5H2SO4 = H2S + 4I2 + 4Na2SO4 + 4H2O
NaOH+HNO3=NaNO3+H2ONaOH + HNO3 = NaNO3 + H2O
Ni + FeSO4 = Ni2(SO4)3 + Fe2Ni + 3FeSO4 = Ni2(SO4)3 + 3Fe
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCO3 + KClO3 = NaClO3 + KCO3NaCO3 + KClO3 = NaClO3 + KCO3
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NO + NH3 = N2 + H2O6NO + 4NH3 = 5N2 + 6H2O
NaCO3 + SnNO2 = NaNO2 + SnCO3NaCO3 + SnNO2 = NaNO2 + SnCO3
Ni + FeSO4 = NiSO4 + FeNi + FeSO4 = NiSO4 + Fe
NiSO4+NaCr2O7+H2SO4=Ni2(SO4)3+Cr2(SO4)3+NaSO4+H2O6NiSO4 + NaCr2O7 + 7H2SO4 = 3Ni2(SO4)3 + Cr2(SO4)3 + NaSO4 + 7H2O
NaNO2 + HI = NaI + HNO2NaNO2 + HI = NaI + HNO2
NH4NO3(s) = N2O(g) + H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na(s) + Cl2(g) = NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na(s) + Cl2(g) = NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4(l) + H2O2(l) = HNO3(aq) + H2O(l)N2H4(l) + 7H2O2(l) = 2HNO3(aq) + 8H2O(l)
NH4NO3=N2O + H2ONH4NO3 = N2O + 2H2O
NH3 + Cl2= N2H4 + NH4Cl 4NH3 + Cl2 = N2H4 + 2NH4Cl
NaOH + Cu(NO3)2 = Cu(OH)2 + NaNO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2SO3 + HCl = NaCl + H2SO3Na2SO3 + 2HCl = 2NaCl + H2SO3
N + H = NH3N + 3H = NH3
NaBr + Cl = Br + NaCl NaBr + Cl = Br + NaCl
NaCl+AgC2H3O2=NaC2H3O2+AgClNaCl + AgC2H3O2 = NaC2H3O2 + AgCl
Ni(NO3)2+NaOH=Ni(OH)2+NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2= NaCl2Na + Cl2 = 2NaCl
NaCl + AgBr = NaBr + AgClNaCl + AgBr = NaBr + AgCl
NH3(g)+HCl(g)=NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
NH4Cl + Ca(OH)2 = NH3 + H2O +CaCl22NH4Cl + Ca(OH)2 = 2NH3 + 2H2O + CaCl2
NO- + H+ +Sn2+ = N2 + H2O + Sn4+-2NO- - 4H+ + 4Sn2+ = -1N2 - 2H2O + 2Sn4+
Na(s)+O2(g) = Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na2CO3 + H2SO4 = Na2SO4 + CO2 + H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
N2O3+H2O2=HNO3+NO20N2O3 - H2O2 = -2HNO3 + 2NO2
Na2O + P2O5 = Na3PO43Na2O + P2O5 = 2Na3PO4
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
Na(g)+O2(g)=Na2O2(s)2Na(g) + O2(g) = Na2O2(s)
N2+O2=NON2 + O2 = 2NO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2+ CH4 = HCN +H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO + O2 = NO22NO + O2 = 2NO2
NaOH + NaHCO3 = Na2CO3 + H2ONaOH + NaHCO3 = Na2CO3 + H2O
NaHCO3 + HNO3 = NaNO3 + H2CO3NaHCO3 + HNO3 = NaNO3 + H2CO3
NO3- + SO3 2- = NO2- + SO4 2-10NO3- + SO32- = 10NO2- + SO42-
NO3- + H2O+ Al = NO2- + 2OH- + Al3+NO3- + H2O + 6Al = NO2- + 2OH- + 2Al3+
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3(s) + HCl(aq) = CO2(g) + H2O(l) + NaCl(aq)Na2CO3(s) + 2HCl(aq) = CO2(g) + H2O(l) + 2NaCl(aq)
NH3+NaCLO=N2H4+NaCL+H2O2NH3 + NaCLO = N2H4 + NaCL + H2O
NaCLO=NaCL+NaCLO33NaCLO = 2NaCL + NaCLO3
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3=N2+O2+H22NH4NO3 = 2N2 + 3O2 + 4H2
NaHSO3+Sr(OH)2=NaOH+Na2SO3+SrSO30NaHSO3 + Sr(OH)2 = 2NaOH - Na2SO3 + SrSO3
Na2SO3 + H2SO4 = Na2SO4 +H2O + 2SO2Na2SO3 + H2SO4 = Na2SO4 + H2O + SO2
Na2SO3 + H2SO4 = Na2SO4 +H2O + 2SO2Na2SO3 + H2SO4 = Na2SO4 + H2O + SO2
NH4NO3(aq)=N2O(g)+H2O(g) NH4NO3(aq) = N2O(g) + 2H2O(g)
NH3(l)+O2(g)=2N2(g)+6H2O(l) 4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaF+CaO=NaO+CaFNaF + CaO = NaO + CaF
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N2O5=NO2+O22N2O5 = 4NO2 + O2
N2O5=NO2+O22N2O5 = 4NO2 + O2
N2O5=NO2+O22N2O5 = 4NO2 + O2
NH4NO3=N2O +H2ONH4NO3 = N2O + 2H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NCl3(aq) + H2O(l) = NH3(aq) + HOCl(aq)NCl3(aq) + 3H2O(l) = NH3(aq) + 3HOCl(aq)
Na2S+HCl = NaCl+H2SNa2S + 2HCl = 2NaCl + H2S
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaNO3 + H2SO4 = Na2SO4 + HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.