Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NH4Cl+Hg2(NO3)2=NH4NO3+HgCl2NH4Cl + Hg2(NO3)2 = 2NH4NO3 + 2HgCl
NaCl+AgNO3= AgCl + Na(NO3) NaCl + AgNO3 = AgCl + Na(NO3)
NaClO2 + HCl = ClO2 + NaClO3 + H-2NaClO2 + HCl = ClO2 - 2NaClO3 + H
NaClO2 + HCl = ClO2 + NaClO3 + H-2NaClO2 + HCl = ClO2 - 2NaClO3 + H
NaClO2 + HCl = ClO2 + NaClO3 + H20-40NaClO2 + 20HCl = 20ClO2 - 40NaClO3 + H20
NH3+CuO=N2+Cu+H2O2NH3 + 3CuO = N2 + 3Cu + 3H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaBr+NaClO=NaBrO+NaCl NaBr + NaClO = NaBrO + NaCl
Na2CO3+Mg(NO3)2=MgCO3+NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
Na3PO4+AgNO3=NaNO3+Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NO+CH4=HCN+H2O+H22NO + 2CH4 = 2HCN + 2H2O + H2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NBr3+NaOH=N2+NaBr+HBrO2NBr3 + 3NaOH = N2 + 3NaBr + 3HBrO
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NH3+O2=N2O+H2O2NH3 + 2O2 = N2O + 3H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CrO4 + AgNO3 = NaNO3 + Ag2CrO4Na2CrO4 + 2AgNO3 = 2NaNO3 + Ag2CrO4
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O + HBr = NaBr + H2ONa2O + 2HBr = 2NaBr + H2O
NaCl+Pb(NO3)2=PbCl2+NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NaCl+Pb(NO3)2=PbCl2+NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na3PO4 + CaCl2= NaCl + Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH4OH + Al2S3 = NH4S3 + Al2OHNH4OH + Al2S3 = NH4S3 + Al2OH
NaOH+NiCl2=NaCl2+NiOHNaOH + NiCl2 = NaCl2 + NiOH
NaOH+Ba(NO3)2=Na(NO3)2+BaOHNaOH + Ba(NO3)2 = Na(NO3)2 + BaOH
NaOH+AgNO3=NaNO3+AgOHNaOH + AgNO3 = NaNO3 + AgOH
NaOH+CuCl2=NaCl2+CuOHNaOH + CuCl2 = NaCl2 + CuOH
Na2O + H2O = 2NaOHNa2O + H2O = 2NaOH
NaOH+CoCl2=NaCl2+CoOHNaOH + CoCl2 = NaCl2 + CoOH
Na2SO4+Ba(NO3)2=Na2(NO3)2+BaSO4Na2SO4 + Ba(NO3)2 = Na2(NO3)2 + BaSO4
Na3PO4+NiCl2=Na3Cl2+NiPO4Na3PO4 + NiCl2 = Na3Cl2 + NiPO4
Na3PO4+CuCl2=Na3Cl2+CuPO4Na3PO4 + CuCl2 = Na3Cl2 + CuPO4
Na3PO4+CoCl2=Na3Cl2+CoPO4Na3PO4 + CoCl2 = Na3Cl2 + CoPO4
NaCO3+NiCl2=NaCl2+NiCO3NaCO3 + NiCl2 = NaCl2 + NiCO3
NaOH + HF = NaF + H2ONaOH + HF = NaF + H2O
NaCO3+NiCl2=NaCl2+NiCO3NaCO3 + NiCl2 = NaCl2 + NiCO3
NaCO3+Ba(NO3)2=Na(NO3)2+BaCO3NaCO3 + Ba(NO3)2 = Na(NO3)2 + BaCO3
NaCO3+AgNO3=NaNO3+AgCO3NaCO3 + AgNO3 = NaNO3 + AgCO3
NaCO3+CuCl2=NaCl2+CuCO3NaCO3 + CuCl2 = NaCl2 + CuCO3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3(g)+HCl(g)=NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
NO+O2=NO22NO + O2 = 2NO2
NaCO3+ CuCl2=NaCl2+CuCO3NaCO3 + CuCl2 = NaCl2 + CuCO3
NaCO3+ CoCl2=NaCl2+CoCO3NaCO3 + CoCl2 = NaCl2 + CoCO3
Na PO + Ag NO = Na NO + Ag PO NaPO + AgNO = NaNO + AgPO
NaPO + AgNO = NaNO + AgPONaPO + AgNO = NaNO + AgPO
NaHCO3 + HCl = CO2 + HOH + NaClNaHCO3 + HCl = CO2 + HOH + NaCl
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Na2S(aq) + Cu(NO3)2(aq) = NaNO3 + CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3 + CuS(s)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaI+PbO2+H2SO4=Na2SO4+PbSO4+I2+H2O2NaI + PbO2 + 2H2SO4 = Na2SO4 + PbSO4 + I2 + 2H2O
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
Na2TeO3+NaI+HCI=NaCI+Te+H2O+I2Na2TeO3 + 4NaI + 6HCI = 6NaCI + Te + 3H2O + 2I2
NaCl+H2SO4+MnO2=Na3SO4+MnCl2+Cl2+H2O6NaCl + 2H2SO4 + MnO2 = 2Na3SO4 + MnCl2 + 2Cl2 + 2H2O
NO+ Cl2=NOCl2NO + Cl2 = 2NOCl
Ni(s)+HCl(aq)=NiCl(aq)+H2(g)2Ni(s) + 2HCl(aq) = 2NiCl(aq) + H2(g)
Na3AsO3+I2+H2O=Na3AsO4+HINa3AsO3 + I2 + H2O = Na3AsO4 + 2HI
NH4CI+NaNO2=NaCI+N2+H2ONH4CI + NaNO2 = NaCI + N2 + 2H2O
Na3PO4 + BaCl2 = Na2Cl2 + Ba3(PO4)22Na3PO4 + 3BaCl2 = 3Na2Cl2 + Ba3(PO4)2
N + O2 = N2O54N + 5O2 = 2N2O5
NH4OH + AlCl3 = Al(OH)3 + NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3+H3PO4=((NH4)3PO4)3NH3 + H3PO4 = ((NH4)3PO4)
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NH4+O2=NO+H2O2NH4 + 3O2 = 2NO + 4H2O
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+KNO3=K2O+Na2O+N210Na + 2KNO3 = K2O + 5Na2O + N2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
N2O5+H2O=NHO3N2O5 + H2O = 2NHO3
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaCl+KNO3=NaNO3+KClNaCl + KNO3 = NaNO3 + KCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Ni(OH)2+H2SO4=NiSO4+H2ONi(OH)2 + H2SO4 = NiSO4 + 2H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH=Na2O+H2O2NaOH = Na2O + H2O
Na + F2 = NaF2Na + F2 = 2NaF
NH3+O2+CH4=CHN+H2O2NH3 + 3O2 + 2CH4 = 2CHN + 6H2O
NA+H2O=NAOH+H22NA + 2H2O = 2NAOH + H2
N2+O2=N2O2N2 + O2 = 2N2O
N2+O2=N2O2N2 + O2 = 2N2O
Na2S+ZnCl2=NaCl+ZnSNa2S + ZnCl2 = 2NaCl + ZnS
NaCl+AgNo3=NaNo3+AgClNaCl + AgNo3 = NaNo3 + AgCl
NH3+HCl = NH4ClNH3 + HCl = NH4Cl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NHO3 + NaOH = NaNO3 + H2ONHO3 + NaOH = NaNO3 + H2O
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaI+Cl2=NaCl+I2NaI + Cl2 = 2NaCl + 2I
NaI+Cl2=NaCl+I2NaI + Cl2 = 2NaCl + 2I
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2SO3 + H3PO4 = H2SO3 + Na3PO43Na2SO3 + 2H3PO4 = 3H2SO3 + 2Na3PO4
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
Na + AlCl3 = NaCl + Al3Na + AlCl3 = 3NaCl + Al
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NaCN + H2SO4 = HCN + Na2SO4 2NaCN + H2SO4 = 2HCN + Na2SO4
NaHCO3+CH3COOH=CH3COONa+H2O+CO2NaHCO3 + CH3COOH = CH3COONa + H2O + CO2
Na3PO4+ Ba(NO3)2 = NaNO3+ Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaCl+KNO3=NaNO3+KClNaCl + KNO3 = NaNO3 + KCl
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+CaBr2=Ca(OH)2+Na Br2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Ni(NO2)2+KF=NiF2+KNO2Ni(NO2)2 + 2KF = NiF2 + 2KNO2
Na + O2 = Na2O4Na + O2 = 2Na2O
NaCl = Na +Cl22NaCl = 2Na + Cl2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3=N2+H22NH3 = N2 + 3H2
NH4Cl (aq)= NH3 (g) + HCl (aq)NH4Cl(aq) = NH3(g) + HCl(aq)
NH3 + CuO =H2O + N2 + Cu2NH3 + 3CuO = 3H2O + N2 + 3Cu
NH3(g) +O2(g) = NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + Cl = NaClNa + Cl = NaCl
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4OH + HC2H3O2=NH4C2H3O2 + H2ONH4OH + HC2H3O2 = NH4C2H3O2 + H2O
NaHPO4 + 3AgNO3 = Ag3PO4 + NaH(NO3)3NaHPO4 + 3AgNO3 = Ag3PO4 + NaH(NO3)3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3+CaSO4 = CaCO3+Na2SO4Na2CO3 + CaSO4 = CaCO3 + Na2SO4
Na2CO3+CaSO4 = CaCO3+Na2SO4Na2CO3 + CaSO4 = CaCO3 + Na2SO4
Na2+CO3+CaSO4 = CaCO3+Na2SO4Na2 + CO3 + CaSO4 = CaCO3 + Na2SO4
Na2CO3 + KNO3 = NaNO3 + K2CO3Na2CO3 + 2KNO3 = 2NaNO3 + K2CO3
NaOH + KNO3 = NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
Na +O2=Na2O4Na + O2 = 2Na2O
NH3 + H2CO3 = ( NH4)2 CO32NH3 + H2CO3 = (NH4)2CO3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=N2O2N2 + O2 = 2N2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na2CO3 + Ca(OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NaOH+H3PO4=Na2HPO4+H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaOH + HCl = H2O + NaClNaOH + HCl = H2O + NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + CaCl2 = 2NaCl + CO3CaNa2CO3 + CaCl2 = 2NaCl + CO3Ca
NaOH+NH4Br=NaBr+NH3+H2ONaOH + NH4Br = NaBr + NH3 + H2O
Na3PO4+HCI=NaCI+H3PO4Na3PO4 + 3HCI = 3NaCI + H3PO4
NO(g)+NH3(g)=N2(g)+H2O(l)6NO(g) + 4NH3(g) = 5N2(g) + 6H2O(l)
N2O4+N2H4=N2+H2ON2O4 + 2N2H4 = 3N2 + 4H2O
N2H4+N2O4 =H2O+N2 2N2H4 + N2O4 = 4H2O + 3N2
Na2+H2O=NaOH+H2Na2 + 2H2O = 2NaOH + H2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2+H2O=NaOH+H2Na2 + 2H2O = 2NaOH + H2
Na2CO3 + H2O + CO2 = NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2H4+O2=NO2+H2O N2H4 + 3O2 = 2NO2 + 2H2O
NH3 = H2 + N22NH3 = 3H2 + N2
NH3 + O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
N2 + O2 = N2O32N2 + 3O2 = 2N2O3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + 2O2 = 3NO + 4H2O4NH3 + 5O2 = 4NO + 6H2O
NH4(g)+O2(g)=NO(g)+H2O2NH4(g) + 3O2(g) = 2NO(g) + 4H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2O5 (g) + H2O (l) = HNO3N2O5(g) + H2O(l) = 2HNO3
NH4(g)+O(g)=NO(g)+H2ONH4(g) + 3O(g) = NO(g) + 2H2O
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
NaCl+Ag2SO4=Na2SO4+AgCl2NaCl + Ag2SO4 = Na2SO4 + 2AgCl
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaOH+Cl2=NaCl+H2O+NaClO36NaOH + 3Cl2 = 5NaCl + 3H2O + NaClO3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na + H2O = 2NaOH + H22Na + 2H2O = 2NaOH + H2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NO + NH3 = N2 + H2O6NO + 4NH3 = 5N2 + 6H2O
NO + NH3 = N2 + H2O6NO + 4NH3 = 5N2 + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+H2O+SiO2=HCl+Na2SiO32NaCl + H2O + SiO2 = 2HCl + Na2SiO3
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH4Cl+Ca(OH)2=NH3+H2O+CaCl22NH4Cl + Ca(OH)2 = 2NH3 + 2H2O + CaCl2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2=NO+O22NO2 = 2NO + O2
NO3=NO+O2NO3 = NO + O2
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
NaOH+HClO4=NaClO4+H2ONaOH + HClO4 = NaClO4 + H2O
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + NiCl2 = NaCl2 + NiOHNaOH + NiCl2 = NaCl2 + NiOH
NaHCO3(s)= Na2CO3 (s) + CO2 (g) + H2O (g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
Na2CO3 + MnCl2 = NaCl + MnCO3Na2CO3 + MnCl2 = 2NaCl + MnCO3
Na2C2O4 +KMnO4+H2SO4 = K2SO4 + Na2SO + H2O + MnSO4 + CO2 5Na2C2O4 - 4KMnO4 - H2SO4 = -2K2SO4 + 5Na2SO - H2O - 4MnSO4 + 10CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaSiF6 + FeCl3 = Si + NaF + FeF3 + Cl26NaSiF6 + 10FeCl3 = 6Si + 6NaF + 10FeF3 + 15Cl2
NaSiF6 + HCl = Si + Cl2 + NaF + HF2NaSiF6 + 10HCl = 2Si + 5Cl2 + 2NaF + 10HF
Ni(NO3)2 + 2 NH4OH = 2 NH4NO3 + Ni(OH)2Ni(NO3)2 + 2NH4OH = 2NH4NO3 + Ni(OH)2
Ni(NO3)2 + 2 NH4OH = 2 NH4NO3 + Ni(OH)2Ni(NO3)2 + 2NH4OH = 2NH4NO3 + Ni(OH)2
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na + H2O= NaOH + H22Na + 2H2O = 2NaOH + H2
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2O4+CO=N2O+CO2N2O4 + 3CO = N2O + 3CO2
N2O4+CO2=N2O+CO20N2O4 + CO2 = 0N2O + CO2
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
Na2O+O2=2NaO2Na2O + O2 = 4NaO
Na2+O=Na2O2Na2 + 2O = Na2O2
N2+O2=NON2 + O2 = 2NO
NaOH(aq)+NaNO2(aq)+Al(s)+H2O(l)=NH3(aq)+NaAlO2(aq)NaOH(aq) + NaNO2(aq) + 2Al(s) + H2O(l) = NH3(aq) + 2NaAlO2(aq)
Na2SO4 +O2=NaO2+SO4Na2SO4 + 2O2 = 2NaO2 + SO4
NaH+BF3=B2H6+NaF6NaH + 2BF3 = B2H6 + 6NaF
NH 4 NO 2 (s)=N 2 (g)+H 2 O(l) NH4NO2(s) = N2(g) + 2H2O(l)
NH 4 NO 2 (s)=N 2 (g)+H 2 O(l) NH4NO2(s) = N2(g) + 2H2O(l)
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=N2O2N2 + O2 = 2N2O
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
Na2CO3 + NHO3 = CO2 + H2O + NaNO3Na2CO3 + 2NHO3 = CO2 + H2O + 2NaNO3
NaOH + H2SO4 = NaHSO4 + H2ONaOH + H2SO4 = NaHSO4 + H2O
NH3+CL=N2H4+NH4CL4NH3 + 2CL = N2H4 + 2NH4CL
Na2S(aq) + Al(NO3)3(aq) = Na(NO3)(aq) + Al2S3(s)3Na2S(aq) + 2Al(NO3)3(aq) = 6Na(NO3)(aq) + Al2S3(s)
N2+O2=NON2 + O2 = 2NO
Na2S(aq) + Al(NO3)3(aq) = Na(NO3)(aq) + Al2S3(s)3Na2S(aq) + 2Al(NO3)3(aq) = 6Na(NO3)(aq) + Al2S3(s)
NH3 = H2 + N22NH3 = 3H2 + N2
NH3+I2=N2I6+H22NH3 + 3I2 = N2I6 + 3H2
NO+CO=N+CO2NO + CO = N + CO2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NO + CO = N2 + CO22NO + 2CO = N2 + 2CO2
NaBr+H3PO4=Na3PO4=HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NaOH+HC2H3O2= NaC2H3O2+H2ONaOH + HC2H3O2 = NaC2H3O2 + H2O
NaHCO3 + HCl = NaCl+H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaHCO3 + HCl = NaCl+H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na2CO3 + MnCl2 = NaCl + MnCO3Na2CO3 + MnCl2 = 2NaCl + MnCO3
N2 + O2 =N2O6N2 + 3O2 = N2O6
N2 + O2 =NON2 + O2 = 2NO
N2+H2=NH3N2 + 3H2 = 2NH3
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NaHCO3 = Na2O + CO2 + H2O2NaHCO3 = Na2O + 2CO2 + H2O
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaHCO3 = Na + C + H2 + O22NaHCO3 = 2Na + 2C + H2 + 3O2
NO2+O2=N2O34NO2 - O2 = 2N2O3
NaHCO3 = NaOH + CO2NaHCO3 = NaOH + CO2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4Cl + Fe (NO3)3 = NH4 (NO3)3 + FeClNH4Cl + Fe(NO3)3 = NH4(NO3)3 + FeCl
NaCl+SO2+H2O+O2=Na2SO4+HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
NH4Cl + Fe (NO3)3 = NH4 (NO3)3 + FeClNH4Cl + Fe(NO3)3 = NH4(NO3)3 + FeCl
Na2CO3 + FeCr2O7 + O2 = Fe2O3 + Na2CrO4 + CO28Na2CO3 + 4FeCr2O7 + O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
NiF2 + NH3 = Ni3N + NH4F + N26NiF2 + 16NH3 = 2Ni3N + 12NH4F + N2
N2H2+H2O2=N2+H2ON2H2 + H2O2 = N2 + 2H2O
N2O+H2=NH3+H2ON2O + 4H2 = 2NH3 + H2O
NaCl+KNO3=NaNO3+KClNaCl + KNO3 = NaNO3 + KCl
NaOH + H3PO4 = Na3PO4 +H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NH4CO3+Fe(OH)3=NH4OH+Fe(CO3)33NH4CO3 + Fe(OH)3 = 3NH4OH + Fe(CO3)3
NH4CO3+Fe(OH)3=NH4OH+Fe(CO3)33NH4CO3 + Fe(OH)3 = 3NH4OH + Fe(CO3)3
NH4CO3+Fe(OH)3=NH4OH+Fe(CO3)33NH4CO3 + Fe(OH)3 = 3NH4OH + Fe(CO3)3
NaN3 = Na + N22NaN3 = 2Na + 3N2
NH3 + NO3 = (NH3)(NO3) NH3 + NO3 = (NH3)(NO3)
NaOH+NaNO2+Al+H2O=NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2S2O3 + I2 =Na2S4O6 + NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
NH3 = N + HNH3 = N + 3H
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaF + MgCl2 = MgF2 + NaCl2NaF + MgCl2 = MgF2 + 2NaCl
Na3PO4 + CaCl2 =Ca3(PO4)2 + NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaOH+Al= Na3AlO3+H26NaOH + 2Al = 2Na3AlO3 + 3H2
Na3PO4 + SnBr2 = NaBr + Sn3(PO4)22Na3PO4 + 3SnBr2 = 6NaBr + Sn3(PO4)2
Na2CO3 + AlCl3 = Al2(CO3)3 + NaCl3Na2CO3 + 2AlCl3 = Al2(CO3)3 + 6NaCl
Na2SO4 + BaCl2 =BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
N2O3+H2O=H2+N2O3N2O3 + 0H2O = 0H2 + N2O3
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na2SO4+Fe(NO3)3=NaNO3+Fe2(SO4)33Na2SO4 + 2Fe(NO3)3 = 6NaNO3 + Fe2(SO4)3
Na+H2O=H2+NaONa + H2O = H2 + NaO
NaOH+H3PO4=H2O+Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NaClO + H2SO4 = Na2SO4 + HCl + O22NaClO + H2SO4 = Na2SO4 + 2HCl + O2
Ni2S + O2 = 2Ni + SO2Ni2S + O2 = 2Ni + SO2
Na2SO4 +Ba(NO3)2 = NaNO3 + Ba2(SO4)2 2Na2SO4 + 2Ba(NO3)2 = 4NaNO3 + Ba2(SO4)2
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaOH + Al2(SO4)3 = Al(OH)3 + Na2SO46NaOH + Al2(SO4)3 = 2Al(OH)3 + 3Na2SO4
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaOH + Al2(SO4)3 = Al(OH)3 + Na2SO46NaOH + Al2(SO4)3 = 2Al(OH)3 + 3Na2SO4
N2H4(l) + H2O2(l) = HNO3(aq) + H2O(l)N2H4(l) + 7H2O2(l) = 2HNO3(aq) + 8H2O(l)
N2H4(l) + H2O2(l) = HNO3(aq) + H2O(l)N2H4(l) + 7H2O2(l) = 2HNO3(aq) + 8H2O(l)
NH4Cl+Ba(OH)2=NH3+BaCl2+H2O2NH4Cl + Ba(OH)2 = 2NH3 + BaCl2 + 2H2O
NaHSO3 + HNO3 = NaNO3 + SO2 + H2ONaHSO3 + HNO3 = NaNO3 + SO2 + H2O
NH4NO3 + BaCl2 = NH4Cl2 + BaNO3NH4NO3 + BaCl2 = NH4Cl2 + BaNO3
N2H4(g)+5N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH+FeBr3=Br3OH +FeNaNaOH + FeBr3 = Br3OH + FeNa
Na + S = Na2S2Na + S = Na2S
NH3 = N2+H22NH3 = N2 + 3H2
Na+ H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaHCO3(aq)+C6H8O7(aq) = H2O(l)+CO2(g)+Na3C6H5O7(aq)3NaHCO3(aq) + C6H8O7(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7(aq)
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2O+O2=NO22N2O + 3O2 = 4NO2
N2O+O2=N2ON2O + 0O2 = N2O
NaHCO3 + H2SO4 = Na2SO4 + CO2 + H2O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
N2H4(g)+5N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
Ni(s)+HCl(aq)=NiCl(aq)+H2(g)2Ni(s) + 2HCl(aq) = 2NiCl(aq) + H2(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaOH + 3 Al2(SO4)3 = 6 Al(OH)3 + 3 Na2SO46NaOH + Al2(SO4)3 = 2Al(OH)3 + 3Na2SO4
NH4OH+HClO4=NH4ClO4+H2ONH4OH + HClO4 = NH4ClO4 + H2O
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NaCl + O2 = NaClO32NaCl + 3O2 = 2NaClO3
NO + O2 = NO22NO + O2 = 2NO2
Ni(No3)2(aq) + 2 NaOH(aq) = Ni(OH)2(s) + 2 NaNo3(aq)Ni(No3)2(aq) + 2NaOH(aq) = Ni(OH)2(s) + 2NaNo3(aq)
NaOH + MnCl2=MnOH + NaCl2NaOH + MnCl2 = MnOH + NaCl2
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Na3PO4+KOH= NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NaHCO3+HCl=NaCl+H2O+CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NH3 + N2O = N2 + H2O2NH3 + 3N2O = 4N2 + 3H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
N + H2 = NH32N + 3H2 = 2NH3
NCl3 + H2O = NH3 + HOClNCl3 + 3H2O = NH3 + 3HOCl
Na2CrO4 + Pb(NO3)2 = PbCrO4 + NaNO3Na2CrO4 + Pb(NO3)2 = PbCrO4 + 2NaNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2(g) + H2(g) = NH3(g) + H2O(l)2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(l)
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaCl + HNO3 NaNO3 + HCl = NaCl + HNO3
NaNO3 + HCl = NaClHNO3 NaNO3 + HCl = NaClHNO3
NaNO3 + HCl = NaCl + HNO3 NaNO3 + HCl = NaCl + HNO3
NaNO3 + HCl = NaNO3HClNaNO3 + HCl = NaNO3HCl
N2H4(g)+7N2O4(g)=N2(g)+H2O2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O
N2H4(g)+7N2O4(g)=N2(g)+H2O2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O
N2H4(g)+7N2O4(g)=N2(g)+H2O2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O
NH4OH = H2O + NH3NH4OH = H2O + NH3
Na2SO3+HCl=NaCl+H2O+SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NH3 + H2O = NH4OHNH3 + H2O = NH4OH
NH4ClO4 + Al =Al2O3 + AlCl3 + NO + H2O3NH4ClO4 + 3Al = Al2O3 + AlCl3 + 3NO + 6H2O
NH3 + H2O = NH4OHNH3 + H2O = NH4OH
NH3 + H2O = NH4OHNH3 + H2O = NH4OH
NH4NO3 = N2O +H2ONH4NO3 = N2O + 2H2O
NaF+Ba(OH)2= Na(OH)+BaF22NaF + Ba(OH)2 = 2Na(OH) + BaF2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NaI + AgNO3 = NaNO3 + AgINaI + AgNO3 = NaNO3 + AgI
NO+O2=NO22NO + O2 = 2NO2
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Na2CO3 + FeCr2O7 + O2 = Fe2O3 + Na2CrO4 + CO28Na2CO3 + 4FeCr2O7 + O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
NaCl+BCl3=NaB+Cl4NaCl + BCl3 = NaB + Cl4
NH3 +CuO =Cu +N2 +H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH+NH4Br=NaBr+NH3+H2ONaOH + NH4Br = NaBr + NH3 + H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH4OH + HC2H3O2=NH4C2H3O2 + H2ONH4OH + HC2H3O2 = NH4C2H3O2 + H2O
NH3 + 3O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + 3O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2H4+(CH3)2N2H2+N2O4=N2CO2+H2O-2N2H4 + 3(CH3)2N2H2 + 5N2O4 = 6N2CO2 + 8H2O
N2H4+(CH3)2N2H2+N2O4=N2CO2+H2O-2N2H4 + 3(CH3)2N2H2 + 5N2O4 = 6N2CO2 + 8H2O
Na+2H2O=NaOH=H22Na + 2H2O = 2NaOH + H2
NH3+HF=NH4+FNH3 + HF = NH4 + F
NH3+H=NH4NH3 + H = NH4
Na3PO4+Ba(NO3)2=Ba3(PO4)2+NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
NaN3 = Na + N22NaN3 = 2Na + 3N2
Na2+O2 = 2Na2O2Na2 + O2 = 2Na2O
Na+O2 = Na2O4Na + O2 = 2Na2O
Na3PO4+Sn(NO3)4=Sn3(PO4)4+NaNO34Na3PO4 + 3Sn(NO3)4 = Sn3(PO4)4 + 12NaNO3
NH3 +F2=N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NaCO3 + PbPO4 = NaPO4 + PbCO3NaCO3 + PbPO4 = NaPO4 + PbCO3
NO+O2=NO22NO + O2 = 2NO2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H20=HNO310N2 + 30O2 + H20 = 20HNO3
NO + O2 = NO22NO + O2 = 2NO2
NO + O2 = NO22NO + O2 = 2NO2
N2 + O2 = NON2 + O2 = 2NO
Na3PO4+HCl=NaCl+H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
Na1+Cl=NaClNa1 + Cl = NaCl
NH3 + O2= NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2(g)+H2O(l) = HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2(g)+H2O(l) = HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH3 + O2 =NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + F2 = NF3N2 + 3F2 = 2NF3
NaCl + Cr2SO4=NaSO4 + Cr2Cl NaCl + Cr2SO4 = NaSO4 + Cr2Cl
NH4CH3CO2 + CaCl2=NH4Cl2 + CaCH3CO2NH4CH3CO2 + CaCl2 = NH4Cl2 + CaCH3CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2SO4(aq)+CaI2(aq)=CaSO4(s)+2NaI(aq)Na2SO4(aq) + CaI2(aq) = CaSO4(s) + 2NaI(aq)
Na2CO3+Al(CH3COO)3=Na(CH3COO)+Al2(CO3)33Na2CO3 + 2Al(CH3COO)3 = 6Na(CH3COO) + Al2(CO3)3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na+H2O=NaOH+HNa + H2O = NaOH + H
N2+H2+Cl2=NH4ClN2 + 4H2 + Cl2 = 2NH4Cl
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
N2+O2 = 2NON2 + O2 = 2NO
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaCl + H2SO4= NaHSO4 + HClNaCl + H2SO4 = NaHSO4 + HCl
NaCl + H2SO4= NaHSO4 + HClNaCl + H2SO4 = NaHSO4 + HCl
NaOH (aq) + H2SO4 (aq)= Na2SO4 (aq) + H2O (l)2NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l)
N2+H2=NH3N2 + 3H2 = 2NH3
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NaHCO3+HCl=NaCl+H2CO3NaHCO3 + HCl = NaCl + H2CO3
Na2CO3 + CaCl2 = NaCl + CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
NaHSO4+Na2CO3=NaCO3+NaHSO4NaHSO4 + 0Na2CO3 = 0NaCO3 + NaHSO4
NaOH+AgNO3=NaNO3+AgOHNaOH + AgNO3 = NaNO3 + AgOH
NH4OH+CuSO4=NH4SO4+CuOHNH4OH + CuSO4 = NH4SO4 + CuOH
NaHCO3+CuSO4=CuHCO3+NaSO4NaHCO3 + CuSO4 = CuHCO3 + NaSO4
NH4OH + H2SO4 = (NH4)2SO4 + H2O 2NH4OH + H2SO4 = (NH4)2SO4 + 2H2O
NaCI + H2SO4 = HCI + Na2SO42NaCI + H2SO4 = 2HCI + Na2SO4
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaOH + HCl = NaCl + H2O NaOH + HCl = NaCl + H2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NH3 +O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 + HCl = CO2 + H2O + NaClNaHCO3 + HCl = CO2 + H2O + NaCl
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + Cl = NaClNa + Cl = NaCl
NaBr + Ca(OH)2 = CaBr2 + NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaI + Pb(SO4)2 = PbI4 +Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
Na2SO4+Ba(NO3)2=BaSO4+Na2(NO3)2Na2SO4 + Ba(NO3)2 = BaSO4 + Na2(NO3)2
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl+MnO2+H2SO4=NaHSO4+MnSO4+H2O+Cl22NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NaOH + H2SO4= Na2SO4 +H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na3PO4+3AgNO3=Ag3PO4+3NaNO3Na3PO4 + 3AgNO3 = Ag3PO4 + 3NaNO3
Na2SiF6+Na=Si+NaFNa2SiF6 + 4Na = Si + 6NaF
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na2CO3+Zn(NO3)2=ZnCO3+Na2(NO3)2Na2CO3 + Zn(NO3)2 = ZnCO3 + Na2(NO3)2
Na2S(aq)+Pb(NO3)2(aq)=NaNO3(aq)+PbS(s)Na2S(aq) + Pb(NO3)2(aq) = 2NaNO3(aq) + PbS(s)
Na2CO3+AgNO3=Ag2CO3+Na2(NO3)2Na2CO3 + 2AgNO3 = Ag2CO3 + Na2(NO3)2
NaHCO3(aq)=Na2CO3(aq)+H2O(l)+CO2(g)2NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)
N2H4+N2O4=3N2+18H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2H4+N2O4=3N2+4H2O2N2H4 + N2O4 = 3N2 + 4H2O
NO + O2 = NO22NO + O2 = 2NO2
NaI + FeSO4 = FeI + NaSO4NaI + FeSO4 = FeI + NaSO4
NH3(g)+CO2(g)=(NH2)2CO(s)+H2O(g)2NH3(g) + CO2(g) = (NH2)2CO(s) + H2O(g)
NaI + FeSO4 = FeI + NaSO4NaI + FeSO4 = FeI + NaSO4
NaI + FeSO4 = FeI + NaSO4NaI + FeSO4 = FeI + NaSO4
NaOH(aq)+HClO4(aq)=NaClO4(aq)+H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
NaNO3=Na+N+O3NaNO3 = Na + N + O3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.