Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaHCO3 + HCl = NaCl + H2O +CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na2CO3 + K = K2CO3 + NaNa2CO3 + 2K = K2CO3 + 2Na
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaNO3 + KMnO4 = NaNO2 + MnO4 + KONaNO3 + KMnO4 = NaNO2 + MnO4 + KO
NaNO3 + KMnO4 + H2SO4= NaNO2 + MnO4 + KSO4 + H2ONaNO3 + KMnO4 + H2SO4 = NaNO2 + MnO4 + KSO4 + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na + H2O=NaOH + HNa + H2O = NaOH + H
NH3(g) + O2(g) = NO(g) + H2O(l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
NH4OH+MgCl2=Mg(OH)2+NH4Cl2NH4OH + MgCl2 = Mg(OH)2 + 2NH4Cl
NH4OH+H2SO4=H2O+(NH4)2SO42NH4OH + H2SO4 = 2H2O + (NH4)2SO4
NH4OH+HC2H3O2=H2O+NH4C2H3O2NH4OH + HC2H3O2 = H2O + NH4C2H3O2
Na+ H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaOH +H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NiCl2 = Ni + ClNiCl2 = Ni + 2Cl
N2+3H2=2NH3N2 + 3H2 = 2NH3
Na2S+I2+NaOH=Na2SO4+NaI+H2ONa2S + 4I2 + 8NaOH = Na2SO4 + 8NaI + 4H2O
NH3 + CO2 = CN2H4O + H2O2NH3 + CO2 = CN2H4O + H2O
NaCl+H2SO4=Na2SO4+HCl 2NaCl + H2SO4 = Na2SO4 + 2HCl
Na+HO2=NaOH+H2-4Na - 2HO2 = -4NaOH + H2
N2 + H2 = NH4N2 + 4H2 = 2NH4
Na2CO3 + MgCl2 = NaCl + MgCO3Na2CO3 + MgCl2 = 2NaCl + MgCO3
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
Na2CO3 + 2 H2SO4 =Na2SO4 + 2 H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
NH4NO3 + NaOH = NaNO3 + NH3 + H2ONH4NO3 + NaOH = NaNO3 + NH3 + H2O
NaClO3 = Na(s) + Cl2(g) + O2(g)2NaClO3 = 2Na(s) + Cl2(g) + 3O2(g)
NaClO3 = Na(s) + ClO3(g)NaClO3 = Na(s) + ClO3(g)
NaClO3 = NaCl + O2(g)2NaClO3 = 2NaCl + 3O2(g)
Na2CO3+Ca(OH)2=CaCO3+NaOHNa2CO3 + Ca(OH)2 = CaCO3 + 2NaOH
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NH4OH=NH3+H2ONH4OH = NH3 + H2O
NH4OH=NH3+H2ONH4OH = NH3 + H2O
NH4OH + KC1 = KOH + NH4C1NH4OH + KC1 = KOH + NH4C1
NH3 + CuO =Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH3 + CuO =Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH2 + 2OH =NO2H4NH2 + 2OH = NO2H4
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
N2O5 +H2O=HNO3N2O5 + H2O = 2HNO3
N2O5 +H2O=HNO3N2O5 + H2O = 2HNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO+Zn(NO3)2+H2O=HNO3+Zn2NO + 3Zn(NO3)2 + 4H2O = 8HNO3 + 3Zn
NaHCO3=CO2+H2O+Na2CO32NaHCO3 = CO2 + H2O + Na2CO3
NaCl =Na+Cl22NaCl = 2Na + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + H2SO4 = NaHSO4 +HClNaCl + H2SO4 = NaHSO4 + HCl
NaCl + H2SO4 = NaHSO4 +HClNaCl + H2SO4 = NaHSO4 + HCl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2S2O3(s) + I2(aq) = Na2S4O6(s) + NaI(aq)2Na2S2O3(s) + I2(aq) = Na2S4O6(s) + 2NaI(aq)
NaOH+H2SO4=HOH+Na2SO42NaOH + H2SO4 = 2HOH + Na2SO4
NaOH+H2SO4=HOH+Na2SO42NaOH + H2SO4 = 2HOH + Na2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+O2+H20=HNO320NO2 + 10O2 + H20 = 20HNO3
NiC2O4*2H2O=NiCO3+H2O+CONiC2O4*2H2O = NiCO3 + 2H2O + CO
NiC2O4*2H2O+O2=NiCO3+H2O+CONiC2O4*2H2O + 0O2 = NiCO3 + 2H2O + CO
NO + O2 = NO22NO + O2 = 2NO2
NiC2O4*2H2O+O2=Ni2O3+H2O+CO24NiC2O4*2H2O + 3O2 = 2Ni2O3 + 8H2O + 8CO2
NiC2O4*2H2O+O2=NiO+H2O+CO22NiC2O4*2H2O + O2 = 2NiO + 4H2O + 4CO2
Na + H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3 + H = N2H42NH3 - 2H = N2H4
N2+H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH+H2SO4=HOH+Na2SO42NaOH + H2SO4 = 2HOH + Na2SO4
Na2CO3+Fe(NO3)3 = Fe2(CO3)3 + NaNO33Na2CO3 + 2Fe(NO3)3 = Fe2(CO3)3 + 6NaNO3
NiS + 6 HCl + KClO3 = NiCl + KCl + 3 S2 + 3 H2O6NiS + 6HCl + KClO3 = 6NiCl + KCl + 3S2 + 3H2O
Na+I2=NaI2Na + I2 = 2NaI
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Ni2Cl3=Ni3+Cl26Ni2Cl3 = 4Ni3 + 9Cl2
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na Cl = NaClNaCl = NaCl
Na2S + Cd(NO3)2 = CdS + Na(NO3)Na2S + Cd(NO3)2 = CdS + 2Na(NO3)
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
Na + H2SO4 = H + Na2SO42Na + H2SO4 = 2H + Na2SO4
Na2 O + (NH4)2 SO4 = Na2 SO4 + H2O + NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
NH4 Cl + Ba (OH)2 = Ba Cl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na2 CO3 + HCl = Na Cl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
N H3 + O2 = N O + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + O2 = NO2N2 + 2O2 = 2NO2
NaNO3(s)=NaNO2(s)+O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
Na + 2H2O = NaOH + 2H22Na + 2H2O = 2NaOH + H2
Na2O2=Na2O+O22Na2O2 = 2Na2O + O2
N2+F2=NF3N2 + 3F2 = 2NF3
NaF + Br2 = NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3 + H2O + CO2 = NaHCO3 Na2CO3 + H2O + CO2 = 2NaHCO3
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+O2=ONN2 + O2 = 2ON
N2+O2=NON2 + O2 = 2NO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
NO+O2=NO22NO + O2 = 2NO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaNO3 + H2SO4 = Na2SO4 + HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2Cr2O7+H2O+H2SO4=H2CrO4+NaHSO4Na2Cr2O7 + H2O + 2H2SO4 = 2H2CrO4 + 2NaHSO4
N2 (g) + Cl2 (g) = NCl3 (l)N2(g) + 3Cl2(g) = 2NCl3(l)
N2 + 3H2= 2NH3N2 + 3H2 = 2NH3
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2O+HNO2=NaNO2+H2ONa2O + 2HNO2 = 2NaNO2 + H2O
Na + 2H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3+NaOH=NaNO3+NH3+H2ONH4NO3 + NaOH = NaNO3 + NH3 + H2O
NaOH + NH4Cl = NaCl + NH4OHNaOH + NH4Cl = NaCl + NH4OH
NaBr=Na+BrNaBr = Na + Br
Na(s)+Cl(g)=NaCl(s)Na(s) + Cl(g) = NaCl(s)
Na+Cl=NaClNa + Cl = NaCl
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
Na3PO4(aq) + Ag2SO4(s) = Na2SO4(aq) + Ag3PO4(s)2Na3PO4(aq) + 3Ag2SO4(s) = 3Na2SO4(aq) + 2Ag3PO4(s)
NaOH(aq) + H2SO4(aq) =H2O(l) + Na2SO4(aq)2NaOH(aq) + H2SO4(aq) = 2H2O(l) + Na2SO4(aq)
NH4OH(aq) + H2CO3(aq) = H2O(l) + (NH4)2CO3(aq)2NH4OH(aq) + H2CO3(aq) = 2H2O(l) + (NH4)2CO3(aq)
NH3(g) = N2(g) + H2(g)2NH3(g) = N2(g) + 3H2(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NO + O2 = NO22NO + O2 = 2NO2
NO + O2 = 4NO22NO + O2 = 2NO2
NaOH + (COOH)2 = Na2 (COO)2 + H2O2NaOH + (COOH)2 = Na2(COO)2 + 2H2O
NaOH+MgSO4=Mg(OH)2+Na2SO42NaOH + MgSO4 = Mg(OH)2 + Na2SO4
Na+O2=Na2O4Na + O2 = 2Na2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O3Si+HF=NaF+H2O+SiO2Na2O3Si + 2HF = 2NaF + H2O + SiO2
Na2SO3 + 3 H2O = 2 Na + 5 OH + SOHNa2SO3 + 3H2O = 2Na + 5OH + SOH
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH+CH3COOH=CH3COONa+H2ONaOH + CH3COOH = CH3COONa + H2O
NH4OH + H2O + MgCl2 = Mg(OH)2 + NH4Cl 2NH4OH + 0H2O + MgCl2 = Mg(OH)2 + 2NH4Cl
NH4OH + H2O + MgCl2 = Mg(OH)2 + NH4Cl 2NH4OH + 0H2O + MgCl2 = Mg(OH)2 + 2NH4Cl
NiCl2 + KHCO3= Ni(HCO3)2 + KClNiCl2 + 2KHCO3 = Ni(HCO3)2 + 2KCl
NaHCO3+CH3COOH=CH3COONa+H2O+CO2NaHCO3 + CH3COOH = CH3COONa + H2O + CO2
Na+O2=Na2O4Na + O2 = 2Na2O
NH3=N2+H22NH3 = N2 + 3H2
Na + H2O = Na(OH) + H22Na + 2H2O = 2Na(OH) + H2
N2+O2=NO2N2 + 2O2 = 2NO2
NaCl +AgNO3 = NaNO3 +AgClNaCl + AgNO3 = NaNO3 + AgCl
Na2CO3+AlPO4=Na3PO4+Al2(CO3)33Na2CO3 + 2AlPO4 = 2Na3PO4 + Al2(CO3)3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaNO3 + Zn + H20 = NH3 + Zn(OH)2 + NaOH10NaNO3 + 10Zn + 3H20 = 10NH3 + 10Zn(OH)2 + 10NaOH
NaNO3 + Zn + H20 = NH3 + Zn(OH)2 + NaOH10NaNO3 + 10Zn + 3H20 = 10NH3 + 10Zn(OH)2 + 10NaOH
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
NH4NO3(s)= N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+CH2O=N+CH2+O20NH3 + 2CH2O = 0N + 2CH2 + O2
NH4+Ca(H2PO4)2+KCl=N2+P2O5+K2O+CaCl2+H2O0NH4 + Ca(H2PO4)2 + 2KCl = 0N2 + P2O5 + K2O + CaCl2 + 2H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHSO3 + NaOH = Na2SO3 + H2ONaHSO3 + NaOH = Na2SO3 + H2O
NO + H2 = N2 + 2H2O2NO + 2H2 = N2 + 2H2O
NaCN + H2SO4 = Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
N2 +2 O2 =2NO2N2 + 2O2 = 2NO2
NaOH + H2S = Na2S + H2O2NaOH + H2S = Na2S + 2H2O
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + CuO = Cu + NO2 + H2O2NH3 + 7CuO = 7Cu + 2NO2 + 3H2O
N2+O2=NON2 + O2 = 2NO
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NaCN + H2SO4=Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NaOH + HCl = H2O + NaClNaOH + HCl = H2O + NaCl
N2+H2=NH2N2 + 2H2 = 2NH2
Na2So4+Zn(No3)2 = ZnSo4 + NaNo3Na2So4 + Zn(No3)2 = ZnSo4 + 2NaNo3
NaNO3 + Zn + H2O = NH3 + Zn(OH)2 + NaOHNaNO3 + 4Zn + 6H2O = NH3 + 4Zn(OH)2 + NaOH
Na3P+H2O=NaOH+PH3Na3P + 3H2O = 3NaOH + PH3
NO=NO2+O2-2NO = -2NO2 + O2
NH3+Cu2O=N2+Cu2+H2O2NH3 + 3Cu2O = N2 + 3Cu2 + 3H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2S2O + Cl2 + H2O = Na2SO4 + 2HCl + SNa2S2O + 3Cl2 + 3H2O = Na2SO4 + 6HCl + S
Na2S2O + Cl2 + H2O = Na2SO4 + 2HCl + SNa2S2O + 3Cl2 + 3H2O = Na2SO4 + 6HCl + S
Na2S2O + Cl2 + H2O = Na2SO4 + 2HCl + SNa2S2O + 3Cl2 + 3H2O = Na2SO4 + 6HCl + S
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2O=HNO3+NO3N2 - 2H2O = -4HNO3 + 10NO
NaNO3+CaCl2=Ca (NO3)2+NaCl2NaNO3 + CaCl2 = Ca(NO3)2 + 2NaCl
NO + KMnO4 = MnO2 + KNO3NO + KMnO4 = MnO2 + KNO3
NH4NO2+BaCl2=NH4Cl+Ba(NO2)22NH4NO2 + BaCl2 = 2NH4Cl + Ba(NO2)2
NaIO3 + NaHSO4 + Na2CO3 = I2 + Na2SO4 + CO2 + H2O0NaIO3 + 2NaHSO4 + Na2CO3 = 0I2 + 2Na2SO4 + CO2 + H2O
Na2SO4+HCl+H2O=NaCl+S+H2O0Na2SO4 + 0HCl + H2O = 0NaCl + 0S + H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NI3=N2+I22NI3 = N2 + 3I2
NI=N2+I22NI = N2 + I2
NI=N2+I22NI = N2 + I2
NI=N2+I36NI = 3N2 + 2I3
NH3=N2+H22NH3 = N2 + 3H2
NH3=N2+H22NH3 = N2 + 3H2
NaCl + H2SO4 = HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
NH3+H2O+O2=HNO3NH3 - H2O + 2O2 = HNO3
NiS+HCl+HNO3=NiCl2+NO+S+H2O3NiS + 6HCl + 2HNO3 = 3NiCl2 + 2NO + 3S + 4H2O
Ni(NO3)2 + Na2(SO3)= Ni(SO3)+Na(NO3)Ni(NO3)2 + Na2(SO3) = Ni(SO3) + 2Na(NO3)
Ni(NO3)2+Na2SO3=Ni(SO3)+Na(NO3)Ni(NO3)2 + Na2SO3 = Ni(SO3) + 2Na(NO3)
NO + H2 = N2O + H2O2NO + H2 = N2O + H2O
NaCl + F= NaF + ClNaCl + F = NaF + Cl
NaOH+NH2SO3H=NaNO3+H2O+H2SNaOH + NH2SO3H = NaNO3 + H2O + H2S
NaOH+NH2SO3H=NaNO3+H2S+H2ONaOH + NH2SO3H = NaNO3 + H2S + H2O
Na2O2 +H2SO4 = Na2SO4 + H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2O2 +H2SO4 = Na2SO4 + H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
NH4NO3 + NaOH = NaNO3 + NH3 + H2ONH4NO3 + NaOH = NaNO3 + NH3 + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH4HS=NH3+H2SNH4HS = NH3 + H2S
NH4HS=NH3+H2SNH4HS = NH3 + H2S
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2 + H2 = 2 NH3N2 + 3H2 = 2NH3
NaClO3 = NaCl +O22NaClO3 = 2NaCl + 3O2
Na + C2H6O = C2H5ONa + H2 2Na + 2C2H6O = 2C2H5ONa + H2
NH4NO3=2NO +N2+4H2O2NH4NO3 = 2NO + N2 + 4H2O
NH4NO3=2NO +N2+4H2O2NH4NO3 = 2NO + N2 + 4H2O
NaNO3+CaCl2=Ca(NO3)2+NaCl2NaNO3 + CaCl2 = Ca(NO3)2 + 2NaCl
N2 + H2 = 2NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaBH4 + H2O = NaBO + H2NaBH4 + H2O = NaBO + 3H2
NaNO3=NaNO2+2O22NaNO3 = 2NaNO2 + O2
NI3=N2+I2 2NI3 = N2 + 3I2
N2O4=NO2N2O4 = 2NO2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2HPO4=Na4P2O7+H2O2Na2HPO4 = Na4P2O7 + H2O
NaHSO4=Na2S2O7+H2O2NaHSO4 = Na2S2O7 + H2O
Na2CO3+Ca(OH)2=NaOH+CaCO3 Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na2CO3+Ca(OH)2=2NaOH+CaCO3 Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NaBrO+NH2CONH2=NaBr+CO2+H2O+N23NaBrO + NH2CONH2 = 3NaBr + CO2 + 2H2O + N2
Na2SO4 (aq) + 2Al(NO3)3 (aq) = Al2 (SO4)3 (s) + 6 NaNO3 (aq)3Na2SO4(aq) + 2Al(NO3)3(aq) = Al2(SO4)3(s) + 6NaNO3(aq)
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3 + NaOH = NH3 + H20 + NaNO310NH4NO3 + 15NaOH = 5NH3 + 2H20 + 15NaNO3
NO2+H20=HNO3+NO40NO2 + H20 = 20HNO3 + 20NO
Ni (CO)4 = Ni + CONi(CO)4 = Ni + 4CO
Ni (CO)4 = Ni + CONi(CO)4 = Ni + 4CO
Na + K NO3 = Na2 O + K2 O N210Na + 2KNO3 = 5Na2O + K2ON2
Na2 CO3 + H3 PO 4 = Na3 PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O + (NH4)2 SO4 = Na2 SO4 + H2O + NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
NH4 Cl + Ba (OH)2 = Ba Cl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na2 CO3 + HCl = Na Cl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4CH3COO + AgNO3 = NH4NO3 + AgCH3COONH4CH3COO + AgNO3 = NH4NO3 + AgCH3COO
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
Na+ZnCl=Zn+NaClNa + ZnCl = Zn + NaCl
Ni2O3 + H2SO3 = H2O + Ni2(SO3)3Ni2O3 + 3H2SO3 = 3H2O + Ni2(SO3)3
Na2SO4 + Au2(CO3)3 = Na2CO3 + Au2(SO4)33Na2SO4 + Au2(CO3)3 = 3Na2CO3 + Au2(SO4)3
Na2SO4 (aq) + Al(NO3)3 (aq) = Al2(SO4)3 (s) + NaNO3 (aq)3Na2SO4(aq) + 2Al(NO3)3(aq) = Al2(SO4)3(s) + 6NaNO3(aq)
N2+3H2=2NH3N2 + 3H2 = 2NH3
NH4Cl +Ca(OH)2 = CaCl2 + H2O + NH32NH4Cl + Ca(OH)2 = CaCl2 + 2H2O + 2NH3
Na+HCl=H2+NaCl2Na + 2HCl = H2 + 2NaCl
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3+NaClO=N2H4+NaCl+H2O2NH3 + NaClO = N2H4 + NaCl + H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaHCO3+C2H4O2=NaC2H3O2+H2O+CO2NaHCO3 + C2H4O2 = NaC2H3O2 + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH=H22Na + 2H2O = 2NaOH + H2
NiSO4 +Li3PO4 =Ni3(PO4)2 + Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
NaOH+FeCl3 = NaCl + Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
N2+H2=NH3N2 + 3H2 = 2NH3
N2H4+H2O=N2+H2O0N2H4 + H2O = 0N2 + H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
NaBr+AlClO3=NaClO3+AlBrNaBr + AlClO3 = NaClO3 + AlBr
NaOH+H2O2+H2S=Na2SO4+H2O2NaOH + 4H2O2 + H2S = Na2SO4 + 6H2O
NaOH+FeBr3=FeOH+NaBr3NaOH + FeBr3 = FeOH + NaBr3
NH3+O=NO+H2O2NH3 + 5O = 2NO + 3H2O
NaF (aq) + Pb(NO3)2 (aq) = NaNO3 (aq) + PbF2 (s)2NaF(aq) + Pb(NO3)2(aq) = 2NaNO3(aq) + PbF2(s)
Na+O2+NH3=NaNH2+OH2Na + O2 + 2NH3 = 2NaNH2 + 2OH
N2H4+O2=NO2+H2ON2H4 + 3O2 = 2NO2 + 2H2O
NO2+H2O= HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2+H2O= HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3 + Cl2 = NH4Cl + NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NO + H2 = NH3 + O22NO + 3H2 = 2NH3 + O2
Ni(ClO3)2= NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
N2(g)+ H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Ni(NO3)2+NaCl=NiCl+Na(NO3)2Ni(NO3)2 + NaCl = NiCl + Na(NO3)2
NH3+F3= NH4F+NF34NH3 + 2F3 = 3NH4F + NF3
NH3+F3= NH4F+NF34NH3 + 2F3 = 3NH4F + NF3
NaCl+MnO2+H2SO4=NaSO4+MnSO4+Cl2+H2O2NaCl + 2MnO2 + 4H2SO4 = 2NaSO4 + 2MnSO4 + Cl2 + 4H2O
Na2 Cr2 O7 + SO2 + H2O = Cr(OH)SO4 + Na2 SO4Na2Cr2O7 + 3SO2 + H2O = 2Cr(OH)SO4 + Na2SO4
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl = Na + Cl22NaCl = 2Na + Cl2
NaI + XeO3 + HNO3 = Xe + NaI3 + H2O + NaNO39NaI + XeO3 + 6HNO3 = Xe + 3NaI3 + 3H2O + 6NaNO3
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NO+H=NH3+H2ONO + 5H = NH3 + H2O
NO+H=NH4+H2ONO + 6H = NH4 + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3(g) +O2(g)=N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O + O2 = HNO34NO2 + 2H2O + O2 = 4HNO3
NO2 + H2O + O2 =HNO34NO2 + 2H2O + O2 = 4HNO3
NaI+H2SO4=H2S+I2+NaSO4+H2O4NaI + 5H2SO4 = H2S + 2I2 + 4NaSO4 + 4H2O
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + Cu O = N2 + Cu + H2O 2NH3 + 3CuO = N2 + 3Cu + 3H2O
Na2CO3+HCl=CO2+NaCl+H2ONa2CO3 + 2HCl = CO2 + 2NaCl + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+AgNo3=AgCl+NaNo3NaCl + AgNo3 = AgCl + NaNo3
NaCl+AgNo3=AgCl+NaNo3NaCl + AgNo3 = AgCl + NaNo3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaAl(OH)2CO3 + HCl = NaCl + AlCl3 + H2O + CO2NaAl(OH)2CO3 + 4HCl = NaCl + AlCl3 + 3H2O + CO2
NH3(g) +O2(g)=N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NaCl + CaO =NaO + CaClNaCl + CaO = NaO + CaCl
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+(NH4)2O=O2+(NH4)3N2N2 + 6(NH4)2O = 3O2 + 4(NH4)3N
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NiSO4 + Li3PO4 = Ni3(PO4)2 + Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
Na2SO4 + BaCl2= BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na2SO4+BaCl2=NaCl+BaSO4Na2SO4 + BaCl2 = 2NaCl + BaSO4
NiSO4 + Li3PO4 = Ni3(PO4)2 + Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
NiSO4 + Li3PO4 = Ni3(PO4)2 + Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
NiSO4 + Li3PO4 =Ni3(PO4)2 + Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
N2(g)+H2(g)= NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2Co3+CoCl2=CoCo3+NaClNa2Co3 + CoCl2 = CoCo3 + 2NaCl
NaOH+FeBr3=FeOH+NaBr3NaOH + FeBr3 = FeOH + NaBr3
NaOH+FeBr3=FeOH+NaBr3NaOH + FeBr3 = FeOH + NaBr3
NH4Cl+CaO = CaCl2+Ca(OH)2+NH3 2NH4Cl + 2CaO = CaCl2 + Ca(OH)2 + 2NH3
Na2CO3 +HCl = NaCl +CO2 +H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4CL + NANO2 = NACL+N2 + H2ONH4CL + NANO2 = NACL + N2 + 2H2O
NaCl = Na = Cl22NaCl = 2Na + Cl2
NH4OH+AgCl=Ag(NH3)2Cl+H2O2NH4OH + AgCl = Ag(NH3)2Cl + 2H2O
NaOH+F2=OF2+NaF+H2O2NaOH + 2F2 = OF2 + 2NaF + H2O
Na+NH3=NaNH2+H22Na + 2NH3 = 2NaNH2 + H2
NaHCO3+ HCl =NaCl + CO2 + H2ONaHCO3 + HCl = NaCl + CO2 + H2O
Na2Cr2O7 + H2SO4 = H2S + Na2SO4 + Cr2(SO4)3 + H2O4Na2Cr2O7 + 13H2SO4 = -3H2S + 4Na2SO4 + 4Cr2(SO4)3 + 16H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NO3+OH+Al=NH3+Al(OH)40NO3 + 4OH + Al = 0NH3 + Al(OH)4
Na2HPO4 + Pb(NO3)2 = PbHPO4 + 2Na(NO3)Na2HPO4 + Pb(NO3)2 = PbHPO4 + 2Na(NO3)
Na2SO4 (aq) + Sr(OH)2 (aq) = SrSO4 (s) + NaOH(aq)Na2SO4(aq) + Sr(OH)2(aq) = SrSO4(s) + 2NaOH(aq)
NO2 + H20 = HN03 + NO60NO2 - H20 = -20HN03 + 120NO
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na+HCl=H2+NaCl2Na + 2HCl = H2 + 2NaCl
N2O3 + H2O = HNO2N2O3 + H2O = 2HNO2
NH3=N2+H22NH3 = N2 + 3H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaNO3 + H2SO4 = Na2SO4 + HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaCl + KNO3 = NaNO3 + KClNaCl + KNO3 = NaNO3 + KCl
Na2SO4 (aq) + AgNO3 (aq) = Ag2SO4 (s) + NaNO3 (aq)Na2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2NaNO3(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NO2+H2O=3HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO+O2=NO22NO + O2 = 2NO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
NaHCO3 + HC2H3O2= 3CO2 + CH3OH + NaHNaHCO3 + HC2H3O2 = 2CO2 + CH3OH + NaH
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO + O2 + H2O = HNO34NO + 3O2 + 2H2O = 4HNO3
NO+O2=NO22NO + O2 = 2NO2
NiF2+NH3=Ni3N+NH4F+N26NiF2 + 16NH3 = 2Ni3N + 12NH4F + N2
NH3+O2=NO+6H2O4NH3 + 5O2 = 4NO + 6H2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2H4 =NH3 + N23N2H4 = 4NH3 + N2
NH4NO3 + Ca3(PO4)2 = (NH4)3PO4 + Ca(NO3)26NH4NO3 + Ca3(PO4)2 = 2(NH4)3PO4 + 3Ca(NO3)2
NaIO3 + Na2SO3 + NaHSO3 = I2 + Na2SO4 + H2O2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
Na2SO4 + C = CO2 + Na2SNa2SO4 + 2C = 2CO2 + Na2S
Na +H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + H2O = NH4OHNH3 + H2O = NH4OH
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + H2O = HCl + NaOHNaCl + H2O = HCl + NaOH
Na + Cl2 = 2NaCl2Na + Cl2 = 2NaCl
Na + 2Cl = 2NaClNa + Cl = NaCl
NO2 + H20 = NH3 + O220NO2 + 3H20 = 20NH3 + 20O2
NH3 + Na = H2 + NaNH22NH3 + 2Na = H2 + 2NaNH2
NH3 + Na = H2 + NaNH22NH3 + 2Na = H2 + 2NaNH2
NaBr(aq) + Ni(NO3)(aq) = Na(NO3)(aq) + NiBr(s)NaBr(aq) + Ni(NO3)(aq) = Na(NO3)(aq) + NiBr(s)
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaNo3 + Al= Al(No3)3 + Na3NaNo3 + Al = Al(No3)3 + 3Na
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NaOH + CO2 = Na2CO3 + H2O2NaOH + CO2 = Na2CO3 + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na CO3 + Mg(NO3) = MgCO3 + Na NO3NaCO3 + Mg(NO3) = MgCO3 + NaNO3
Na3PO4+ZnCO3=Na2CO3+Zn3(PO4)22Na3PO4 + 3ZnCO3 = 3Na2CO3 + Zn3(PO4)2
NaOH+ H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NaCl + AgC2H3O2 = NaC2H3O2 + AgClNaCl + AgC2H3O2 = NaC2H3O2 + AgCl
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2SO4 + HCl = NaCl + SO2 + H2O + O22Na2SO4 + 4HCl = 4NaCl + 2SO2 + 2H2O + O2
NH3+Rb=RbNH2+H22NH3 + 2Rb = 2RbNH2 + H2
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
Ni+Br2=NiBr32Ni + 3Br2 = 2NiBr3
NaOH + 2H2O + Al = NaAl(OH)4 +H22NaOH + 6H2O + 2Al = 2NaAl(OH)4 + 3H2
NaOH(aq) + LiNO3(aq) = NaNO3(aq) + LiOH(aq)NaOH(aq) + LiNO3(aq) = NaNO3(aq) + LiOH(aq)
Na2SO4 + MgF2 = NaF + MgSO4Na2SO4 + MgF2 = 2NaF + MgSO4
NaOH+H2SO4= H2O+Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + H2O = N2H4 + NO2-12NH3 + 4H2O = -7N2H4 + 2NO2
NH4OH+HBr=BrNH4+H2ONH4OH + HBr = BrNH4 + H2O
Nb2O5+Al= Al2O3+Nb3Nb2O5 + 10Al = 5Al2O3 + 6Nb
N2O + NaClO + NaOH = NaCl + NaNO3 + H2ON2O + 4NaClO + 2NaOH = 4NaCl + 2NaNO3 + H2O
NaPO4+BaNO3=NaNO3+BaPO4NaPO4 + BaNO3 = NaNO3 + BaPO4
NaPO4 + BaNO3 = NaNO3 + BaPO4NaPO4 + BaNO3 = NaNO3 + BaPO4
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
N2O + ClO = NO2 + ClN2O + 3ClO = 2NO2 + 3Cl
N2O5+SrO=Sr(NO3)2N2O5 + SrO = Sr(NO3)2
N2O5+SrO=Sr(NO3)2N2O5 + SrO = Sr(NO3)2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+O=Na2O2Na + O = Na2O
Na+Br=Na1Br2Na + 2Br = Na1Br2
NH3+NO2=N2+H2O8NH3 + 6NO2 = 7N2 + 12H2O
N2+O2=2NON2 + O2 = 2NO
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
Na2CO3+CaCl2=NaCl+CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na(s)+O2(g)=Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na+O2=Na2O4Na + O2 = 2Na2O
Na+O2=NaO2Na + O2 = NaO2
NaHCO3 = NaOH + CO2NaHCO3 = NaOH + CO2
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaHCO3=Na2O+H2O+CO22NaHCO3 = Na2O + H2O + 2CO2
NaCl(aq)+Hg2(C2H3O2)2(aq)=Na(C2H3O2)(aq)+Hg2Cl2(s)2NaCl(aq) + Hg2(C2H3O2)2(aq) = 2Na(C2H3O2)(aq) + Hg2Cl2(s)
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
Na2Co3 + Ca(OH)2 = NaOH + CaCo3Na2Co3 + Ca(OH)2 = 2NaOH + CaCo3
NaOH + CaBr2 = Ca(OH)2 + NaBr2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
NaOH + CaBr2 = Ca(OH)2 + NaBr2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
Na+KNO3=K2O+Na2O+N10Na + 2KNO3 = K2O + 5Na2O + 2N
Na2SO4(s) + C(s)=Na2S(s) + CO2(g)Na2SO4(s) + 2C(s) = Na2S(s) + 2CO2(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaBr + MnO2 + H2SO4 = MnSO4 + Br2 + H2O + NaHSO42NaBr + MnO2 + 3H2SO4 = MnSO4 + Br2 + 2H2O + 2NaHSO4
NaCl + AgNo3 = AgCl + NaNo3NaCl + AgNo3 = AgCl + NaNo3
NaCl AgNo3 = AgCl NaNo3NaClAgNo3 = AgClNaNo3
N+5H2O= N(OH)5+H22N + 10H2O = 2N(OH)5 + 5H2
Na2Cr2O7+PbBr2+HBr=PbBr4+ CrBr3+ NaBr +H2ONa2Cr2O7 + 3PbBr2 + 14HBr = 3PbBr4 + 2CrBr3 + 2NaBr + 7H2O
NH4Cl+Ba (OH)2=BaCl2+NH3+H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
NO(g)+Cl2=NOCl(g)2NO(g) + Cl2 = 2NOCl(g)
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaBrO3 + XeF2 + H2O = NaBrO4 +HF+XeNaBrO3 + XeF2 + H2O = NaBrO4 + 2HF + Xe
Na2S (aq) + CaCl2 (aq) = NaCl (aq) + CaS (s)Na2S(aq) + CaCl2(aq) = 2NaCl(aq) + CaS(s)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaCl+H2SO4=HCl+Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
Na2S2O3 + SO4 = Na2SO4 + S2O3Na2S2O3 + SO4 = Na2SO4 + S2O3
Na2S2O3 + SO4 = Na2SO4 + S2O3Na2S2O3 + SO4 = Na2SO4 + S2O3
NO + Cl2= NOCl2NO + Cl2 = 2NOCl
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N3O7 = N2 + O22N3O7 = 3N2 + 7O2
NH3 + NO = N + H2O2NH3 + 3NO = 5N + 3H2O
Na2O + P4O10 = Na3PO46Na2O + P4O10 = 4Na3PO4
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2SO4 +Pb(NO3)2=NaNO3 +PbSO4 Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NH3+HCI=NH4CINH3 + HCI = NH4CI
NH3+HCI=NH4CINH3 + HCI = NH4CI
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaCl + H2SO4 = HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
NaOH + H3PO4 = Na3PO4 + 6H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na + Cl2= NaCl2Na + Cl2 = 2NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaI+H2SO4=H2S+I2+NaSO4+H2O4NaI + 5H2SO4 = H2S + 2I2 + 4NaSO4 + 4H2O
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4OH+HBr=BrNH4+H2ONH4OH + HBr = BrNH4 + H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.