Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaN3 + HCl = NaN3H + ClNaN3 + HCl = NaN3H + Cl
NaCl + Pb(NO3)2 = Na(NO3) + PbCl22NaCl + Pb(NO3)2 = 2Na(NO3) + PbCl2
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
Na + O2=Na2 O4Na + O2 = 2Na2O
Na + O2=NaNaO4Na + O2 = 2NaNaO
Na3PO4+Mg(NO3)2=NaNO3+Mg3(PO4)22Na3PO4 + 3Mg(NO3)2 = 6NaNO3 + Mg3(PO4)2
N2O = N2 + O22N2O = 2N2 + O2
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NiCl2(s) + O2(g) = NiO(s) + Cl2O5(g)NiCl2(s) + 3O2(g) = NiO(s) + Cl2O5(g)
Na(s) + MgI2(aq) = NaI(aq) + Mg2(s)4Na(s) + 2MgI2(aq) = 4NaI(aq) + Mg2(s)
Na+N2=Na3N6Na + N2 = 2Na3N
NaHCO3 + H3O + Cl = NaCl + CO2 + H2ONaHCO3 + H3O + Cl = NaCl + CO2 + 2H2O
NH4I(aq)+KOH(aq)=KI (aq) + H2O (l) + NH3 (g) NH4I(aq) + KOH(aq) = KI(aq) + H2O(l) + NH3(g)
NaHCO3(aq) + HBr(aq)= NaBr(aq) + CO2(g) + H2O(l) NaHCO3(aq) + HBr(aq) = NaBr(aq) + CO2(g) + H2O(l)
Na2CO3 + H3O + Cl = NaCl + CO2 + H2ONa2CO3 + 2H3O + 2Cl = 2NaCl + CO2 + 3H2O
NaCHO3 + H3O + Cl = NaCl + CO2 + H2ONaCHO3 + H3O + Cl = NaCl + CO2 + 2H2O
N2+I2=NI3N2 + 3I2 = 2NI3
N+I=NI3N + 3I = NI3
NiSO4 (aq) + Na2S (aq) = Ni2S (s) + NaSO4 (aq)2NiSO4(aq) + Na2S(aq) = Ni2S(s) + 2NaSO4(aq)
Na2CO3+NaHCO3=CO+H2O+Na3Na2CO3 - 4NaHCO3 = -1CO - 2H2O + 2Na
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Ni(ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
Na2NH + 2H2O = NH3 + 2NaOHNa2NH + 2H2O = NH3 + 2NaOH
Na2NH +2H2O = NH3 + 2NaOHNa2NH + 2H2O = NH3 + 2NaOH
Na2NH +2H2O = NH3 + 2NaOHNa2NH + 2H2O = NH3 + 2NaOH
NaOH + (NH4)3PO4 = Na3PO4 + H2O + NH33NaOH + (NH4)3PO4 = Na3PO4 + 3H2O + 3NH3
Na2CO3+Na2S+SO2=Na2SO2 +CO22Na2CO3 + Na2S + 2SO2 = 3Na2SO2 + 2CO2
Na2CO3 +Na2S + SO2 = Na2S2O3 + CO2Na2CO3 + 2Na2S + 4SO2 = 3Na2S2O3 + CO2
NO(g)+CO(g)=N2(g)+CO2(g)2NO(g) + 2CO(g) = N2(g) + 2CO2(g)
NiSO4+NaOH=Na2SO4 Ni(OH)2NiSO4 + 2NaOH = Na2SO4Ni(OH)2
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
Ni(s)+HCl(aq)=NiCl(aq)+H2(g)2Ni(s) + 2HCl(aq) = 2NiCl(aq) + H2(g)
Ni(s)+HCl(aq)=NiCl(aq)+H2(g)2Ni(s) + 2HCl(aq) = 2NiCl(aq) + H2(g)
N2H4(g)+N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
Na + O2 = Na2O4Na + O2 = 2Na2O
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaHCO3 + HCl = CO2 + HOH + NaClNaHCO3 + HCl = CO2 + HOH + NaCl
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2SO4+Pb(NO3)2=PbSO4+NaNO3Na2SO4 + Pb(NO3)2 = PbSO4 + 2NaNO3
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NO2(g)+H2O(l) = HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4 Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaHCO3+C6H8O7=Na3C6H5O7+CO2+H2O3NaHCO3 + C6H8O7 = Na3C6H5O7 + 3CO2 + 3H2O
Ni(NO2)2 + KF = NiF2 + KNO2Ni(NO2)2 + 2KF = NiF2 + 2KNO2
Ni(NO2)2 + KF = NiF2 + KNO2Ni(NO2)2 + 2KF = NiF2 + 2KNO2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+NaNO3=Na2O2=N24Na + 2NaNO3 = 3Na2O2 + N2
Na+NaNO3=Na2O2=N24Na + 2NaNO3 = 3Na2O2 + N2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + Li2S + H2O = (NH4)2S + LiOH2NH3 + Li2S + 2H2O = (NH4)2S + 2LiOH
Na2SO4 + CO2 +Al(OH)3 = NaHCO3 + Al2(SO4)33Na2SO4 + 6CO2 + 2Al(OH)3 = 6NaHCO3 + Al2(SO4)3
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NH4 + CO3 = (NH4)3CO33NH4 + CO3 = (NH4)3CO3
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
Na2Co3 + Ba(No3)2 = BaCo3 + NaNo3Na2Co3 + Ba(No3)2 = BaCo3 + 2NaNo3
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na2Co3 + Ni(No3)2 = NaNo3 + NiCo3Na2Co3 + Ni(No3)2 = 2NaNo3 + NiCo3
N(g) + O(g) = NO(g)N(g) + O(g) = NO(g)
NO(g) + O2(g) = NO2(g)2NO(g) + O2(g) = 2NO2(g)
NH4Cl(aq) = NH3(g) + HCl(aq)NH4Cl(aq) = NH3(g) + HCl(aq)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2 + O2 = NON2 + O2 = 2NO
Na3PO4+ KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH3(g)+Cl2(g)=N2H4(l)+NH4Cl(s)4NH3(g) + Cl2(g) = N2H4(l) + 2NH4Cl(s)
N2O=N2+O22N2O = 2N2 + O2
N2+H2=NH3N2 + 3H2 = 2NH3
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NaCl+HgNO3=Hg2Cl2+NaNO32NaCl + 2HgNO3 = Hg2Cl2 + 2NaNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + I2 = NI3N2 + 3I2 = 2NI3
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO4(s)+C(s)=Na2S(s)+CO(g)Na2SO4(s) + 4C(s) = Na2S(s) + 4CO(g)
N2O5 + H2O = H(NO3)N2O5 + H2O = 2H(NO3)
Ni (aq) + Sn(NO3)2 (aq) = Sn(s) + Ni(NO3)2 (s)Ni(aq) + Sn(NO3)2(aq) = Sn(s) + Ni(NO3)2(s)
Ni (s) + Sn(NO3)2 (aq) = Sn(s) + Ni(NO3)2 (s)Ni(s) + Sn(NO3)2(aq) = Sn(s) + Ni(NO3)2(s)
Ni (s) + Sn(NO3)2 (aq) = Sn + Ni(NO3)2 Ni(s) + Sn(NO3)2(aq) = Sn + Ni(NO3)2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + AgNO3= Na2NO3+AgCO3Na2CO3 + AgNO3 = Na2NO3 + AgCO3
NaHCO3(aq)+HBr(aq)=NaBr+HHCO3NaHCO3(aq) + HBr(aq) = NaBr + HHCO3
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2SO4+C=Na2S+CO2Na2SO4 + 2C = Na2S + 2CO2
NiSO4 + NaOH = Na2SO4 + Ni(OH)2NiSO4 + 2NaOH = Na2SO4 + Ni(OH)2
Ni(OH)2 + H2SO4 = NiSO4 + H2ONi(OH)2 + H2SO4 = NiSO4 + 2H2O
NaOH + HCl =NaCl + H2ONaOH + HCl = NaCl + H2O
Na + Br2 = NaBr2Na + Br2 = 2NaBr
NaOH+HCl =NaCl +H2ONaOH + HCl = NaCl + H2O
Na2CO3 + K3PO4 = Na3PO4 + K2CO33Na2CO3 + 2K3PO4 = 2Na3PO4 + 3K2CO3
NH4NO3 = N2O + 2 H2O NH4NO3 = N2O + 2H2O
N2O=N2+O22N2O = 2N2 + O2
N2+O2=N2O32N2 + 3O2 = 2N2O3
NH3(g)+Cl2(g)=N2H4(l)+NH4Cl(s)4NH3(g) + Cl2(g) = N2H4(l) + 2NH4Cl(s)
Na2O+2HCl=2NaH+Cl2ONa2O + 2HCl = 2NaH + Cl2O
Na2O+2HCl=2NaH+Cl2ONa2O + 2HCl = 2NaH + Cl2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+O2=N2O2N2 + O2 = 2N2O
Na+I2=NaI2Na + I2 = 2NaI
Na+I2=NaI2Na + I2 = 2NaI
Na2CO3 + HCL = NaCL + H2O + CO2Na2CO3 + 2HCL = 2NaCL + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O + 2HCl = 2NaH + Cl2ONa2O + 2HCl = 2NaH + Cl2O
NO+O2=NO22NO + O2 = 2NO2
NaOH+FeBr3=NaFe+Br3OHNaOH + FeBr3 = NaFe + Br3OH
NaCN + HI = NaI + HCNNaCN + HI = NaI + HCN
NaCN + HI = NaI + HCNNaCN + HI = NaI + HCN
NaOH + Pb(NO3)2 = PbOH + Na(NO3)2NaOH + Pb(NO3)2 = PbOH + Na(NO3)2
NaCN + HI = NaI + HCNNaCN + HI = NaI + HCN
NaCN + HI = NaI + HCNNaCN + HI = NaI + HCN
NaCN + HI = NaI + HCNNaCN + HI = NaI + HCN
NaCN(aq) + HI(aq) = NaI(aq) + HCN(aq)NaCN(aq) + HI(aq) = NaI(aq) + HCN(aq)
NH3 +CuO = Cu + N2 +H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NO+O2=NO22NO + O2 = 2NO2
N2+H2=2NH3N2 + 3H2 = 2NH3
NH3 + CoCl2 = CoH3 + NCl2NH3 + CoCl2 = CoH3 + NCl2
N2+H2O=NH3+NO33N2 + 6H2O = 4NH3 + 2NO3
NH4Cl + Ca(OH)2 = CaCl2 + NH 3 + H 2 O 2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NaNO 3 + H 2 SO4 = Na2SO4 + HNO3 2NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaHCO3 = Na2CO3 + H2O +CO22NaHCO3 = Na2CO3 + H2O + CO2
NH3+Na2S=NH3Na2SNH3 + Na2S = NH3Na2S
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NO + O 2 = NO 2 2NO + O2 = 2NO2
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NH4Cl + O2 = HNO2 + HCl + H2O2NH4Cl + 3O2 = 2HNO2 + 2HCl + 2H2O
NaNO 3 + H 2 SO4 = Na2SO4 + HNO3 2NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NH4Cl + O2 = HNO2 + HCl + H2O2NH4Cl + 3O2 = 2HNO2 + 2HCl + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
N2O5 = N2O4 + O22N2O5 = 2N2O4 + O2
NaOH +H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4(l)+O2(g)=NO2(g)+H2O(g) N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+O2=NON2 + O2 = 2NO
NaBr+Cl2=NaCl+Br2NaBr + Cl2 = 2NaCl + 2Br
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=Na2O4Na + O2 = 2Na2O
N2+3H2=NH3N2 + 3H2 = 2NH3
N2+H2=2NH3N2 + 3H2 = 2NH3
NaCHO3+H2SO4=CO2+H2O+Na2SO42NaCHO3 + H2SO4 = 2CO2 + 2H2O + Na2SO4
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
N2+H2=NH3N2 + 3H2 = 2NH3
Na3PO4+Cu(NO3)2=Cu3(PO4)2+NaNO32Na3PO4 + 3Cu(NO3)2 = Cu3(PO4)2 + 6NaNO3
Na+HCO3=NaCO3+H2O+CO2Na + 2HCO3 = NaCO3 + H2O + CO2
NaHCO3+HI=NaIH2O+CO2NaHCO3 + HI = NaIH2O + CO2
NH4OH+H2SO4=NH4SO4+OH3NH4OH + H2SO4 = NH4SO4 + OH3
NiF 2 (aq)+Fe 2 (SO 4 ) 3 (aq)= NiSO 4 (aq)+FeF 3 (s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
NO2 + CH3 = H20 + N2 + CO10NO2 + 20CH3 = 3H20 + 5N2 + 20CO
Na3PO4+HCI=NaCI+H3PO4Na3PO4 + 3HCI = 3NaCI + H3PO4
NH4Cl = NH3 + HClNH4Cl = NH3 + HCl
NH3+CuSO4=H3Cu+NSO4NH3 + CuSO4 = H3Cu + NSO4
NH3+CoCl2=NCl2+H3CoNH3 + CoCl2 = NCl2 + H3Co
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO3 + H2SO4 = Na2SO4 + HNO3 2NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O 2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4 Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NO + O2 = NO2 2NO + O2 = 2NO2
NH3(g)+O2(g)=NO2(g)+H2O(l) 4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(l)
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na + Cl2= NaCl2Na + Cl2 = 2NaCl
Na+O2=Na2O4Na + O2 = 2Na2O
NH3 (aq) + Na2S (aq) = Na3N (aq) + H2S (aq)2NH3(aq) + 3Na2S(aq) = 2Na3N(aq) + 3H2S(aq)
NH3+CuO = Cu+H2O+N22NH3 + 3CuO = 3Cu + 3H2O + N2
NaOH+Fe(NO3)2 = Fe(OH)2+NaNO32NaOH + Fe(NO3)2 = Fe(OH)2 + 2NaNO3
NaOH+H3PO4 = Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH3 (aq) + NaOH (aq) = Na3N + H2ONH3(aq) + 3NaOH(aq) = Na3N + 3H2O
NH3 (aq) + NaOH (aq) = Na3N + H2ONH3(aq) + 3NaOH(aq) = Na3N + 3H2O
NH3 (aq) + NaOH (aq) = Na3N + H2ONH3(aq) + 3NaOH(aq) = Na3N + 3H2O
NH3 (aq) + Na2CO3 (aq) = Na3N (aq) + H2CO32NH3(aq) + 3Na2CO3(aq) = 2Na3N(aq) + 3H2CO3
NaOH + MnCl2 = NaCl2 + MnOHNaOH + MnCl2 = NaCl2 + MnOH
NaCN + CuCO3 = Na2CO3 + Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
Na3P + CaF2 = NaF + Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
Na2O + H2SO4 = H2O + Na2SO4Na2O + H2SO4 = H2O + Na2SO4
Na2SO4 (aq) + 2 AgNO3 (aq) = 2 NaNO3(aq) + Ag2SO4 (s)Na2SO4(aq) + 2AgNO3(aq) = 2NaNO3(aq) + Ag2SO4(s)
NaHCO3 + HBr = NaBr + CO2 + H2ONaHCO3 + HBr = NaBr + CO2 + H2O
NH4NO3 + KOH = KNO3 + NH4OHNH4NO3 + KOH = KNO3 + NH4OH
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+Na2S= NS+Na2H3NH3 + Na2S = NS + Na2H3
Na+H2O=Na(OH)=H22Na + 2H2O = 2Na(OH) + H2
N2H4+O2=NO2+H2ON2H4 + 3O2 = 2NO2 + 2H2O
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
Na2NH+H2O=NH3+NaOHNa2NH + 2H2O = NH3 + 2NaOH
NH3 (aq) + CoCl2 (aq) = Co3N2 + HCl (aq)2NH3(aq) + 3CoCl2(aq) = Co3N2 + 6HCl(aq)
NH3 (aq) + BaCl2 (aq) = Ba3N2 (aq) + HCl (aq)2NH3(aq) + 3BaCl2(aq) = Ba3N2(aq) + 6HCl(aq)
NH3 (aq) + BaCl2 (aq) = Ba3N2 (aq) + HCl (aq)2NH3(aq) + 3BaCl2(aq) = Ba3N2(aq) + 6HCl(aq)
Na2CO3 + HCl=NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2S + Pb(C2H3O2)2 = PbS + NaC2H3O2Na2S + Pb(C2H3O2)2 = PbS + 2NaC2H3O2
Ni + Cl = NiCl3Ni + 3Cl = NiCl3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + SO2 = NO + S + H2O4NH3 + 5SO2 = 4NO + 5S + 6H2O
NO2 + O2 = N2O54NO2 + O2 = 2N2O5
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
NO + O2= NO22NO + O2 = 2NO2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NaF=Na+FNaF = Na + F
NH3+ NO= N2+ H2O4NH3 + 6NO = 5N2 + 6H2O
Na(s) + H2O(l) = NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
N2(g) + O2(g) = N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
NaOH(aq)+H3PO3(aq)=Na3PO3+H2O3NaOH(aq) + H3PO3(aq) = Na3PO3 + 3H2O
NH4Br + H2O = NH3 + Br2 + H2O0NH4Br + H2O = 0NH3 + 0Br2 + H2O
NO+O2=NO22NO + O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaHCO3 = NaOH + CO2NaHCO3 = NaOH + CO2
NH4OH+H2C2O4=(NH4)2C2O4+H2O2NH4OH + H2C2O4 = (NH4)2C2O4 + 2H2O
NH4OH+H2C2O4=(NH4)2C2O4+H2O2NH4OH + H2C2O4 = (NH4)2C2O4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaH+H2O= NaOH+H2NaH + H2O = NaOH + H2
Ni(NO3)2 + NaOH = Ni(OH)2 + NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Ni+HCl=NiCl2+H2Ni + 2HCl = NiCl2 + H2
NH3 + NO = N2+ H2O4NH3 + 6NO = 5N2 + 6H2O
Na2C2O4(aq) + CaCl2(aq) =2NaCl(aq) + CaC2O4(s)Na2C2O4(aq) + CaCl2(aq) = 2NaCl(aq) + CaC2O4(s)
Na2C2O4(aq) + CaCl2(aq) =2NaCl(aq) + CaC2O4(aq)Na2C2O4(aq) + CaCl2(aq) = 2NaCl(aq) + CaC2O4(aq)
N2+H2=NH3N2 + 3H2 = 2NH3
N2H4(l) = NH3(g) + N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NiBr2+2KOH=Ni(OH)2+2KBrNiBr2 + 2KOH = Ni(OH)2 + 2KBr
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3 + H2O = NaOH + H2CO3NaHCO3 + H2O = NaOH + H2CO3
NH3+I2=N2I6=H22NH3 + 3I2 = N2I6 + 3H2
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
N2 + H2 = NH4N2 + 4H2 = 2NH4
N + H = NH4N + 4H = NH4
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
Na + Cu2SO4 = NaSO4 + CuNa + Cu2SO4 = NaSO4 + 2Cu
NaBr (aq) + H2SO4 (aq) = Br2 (l) + SO2 (g) + H2O (l) + Na2SO4 (aq)2NaBr(aq) + 2H2SO4(aq) = Br2(l) + SO2(g) + 2H2O(l) + Na2SO4(aq)
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NO2 + O2 = N2O54NO2 + O2 = 2N2O5
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
NaOH + CaBr2 = Ca(OH)2 + NaBr2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
NaOH + CaBr2 = Ca(OH)2 + NaBr2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
Na2SO4 + AgNO3 = Na2NO3 + AgSO4Na2SO4 + AgNO3 = Na2NO3 + AgSO4
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
Na2CO3 + HCl + H2O = NaCl + H2CO3 Na2CO3 + 2HCl + 0H2O = 2NaCl + H2CO3
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na2SO4 + KNO3 = Na2NO3 + KSO4Na2SO4 + KNO3 = Na2NO3 + KSO4
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
NaOH+CuSO4=Na2SO4+Cu(OH)22NaOH + CuSO4 = Na2SO4 + Cu(OH)2
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na3PO4+BaCl2=Ba3(PO4)2+NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
Nh4(aq)+MnO2= Mn2O3(s)+Nh3(aq)3Nh4(aq) + 0MnO2 = 0Mn2O3(s) + 4Nh3(aq)
Na2CO3+CaCl2=CaCO3+NaClNa2CO3 + CaCl2 = CaCO3 + 2NaCl
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4OH+FeCl3=NH4Cl+Fe(OH)33NH4OH + FeCl3 = 3NH4Cl + Fe(OH)3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
N2+H2= NH3N2 + 3H2 = 2NH3
NaOH+H2CO=Na2CO3+H2010NaOH + 5H2CO = 5Na2CO3 + H20
NaOH+H2CO=Na2CO3+H2010NaOH + 5H2CO = 5Na2CO3 + H20
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
NaCl+H2SO4=NaHSO4+HClNaCl + H2SO4 = NaHSO4 + HCl
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Ni(s)+HCl(aq)= NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Ni(s)+HCl(aq)= NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
NH4Cl + CaO=NH3 + CaCl2 + H2O2NH4Cl + CaO = 2NH3 + CaCl2 + H2O
N2 + I2 = NI3N2 + 3I2 = 2NI3
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na + NaNO3 = N2 + Na2O10Na + 2NaNO3 = N2 + 6Na2O
Na2SO4+S8=Na2S2O3 +O28Na2SO4 + S8 = 8Na2S2O3 + 4O2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + C + N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NO2+O2=N2O54NO2 + O2 = 2N2O5
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3+I2 = N2I6+H22NH3 + 3I2 = N2I6 + 3H2
N2O=N2+O22N2O = 2N2 + O2
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NaI+H2SO4=I2+H2S+H2O+Na2SO48NaI + 5H2SO4 = 4I2 + H2S + 4H2O + 4Na2SO4
N2O4=NO2N2O4 = 2NO2
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
N2+H2=NH4N2 + 4H2 = 2NH4
NH3 + O2 = N2O + H2O2NH3 + 2O2 = N2O + 3H2O
NH3 + O2 = N2O + H2O2NH3 + 2O2 = N2O + 3H2O
NH4NO3 + NAOH = NANO3 + NH3 + H2ONH4NO3 + NAOH = NANO3 + NH3 + H2O
NiCl2 + H3PO4 = Ni3(PO4)2 + HCl3NiCl2 + 2H3PO4 = Ni3(PO4)2 + 6HCl
NH3 + F2= N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Na2(CO3) +CuCl2 = NaCl + Cu(CO3)Na2(CO3) + CuCl2 = 2NaCl + Cu(CO3)
NO2(g) + H2(g) = NH3(g) + H2O(l)2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(l)
NH4NO3 =N2O + H2ONH4NO3 = N2O + 2H2O
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NH3+S2Cl2=S4N4+S8+NH4Cl16NH3 + 6S2Cl2 = S4N4 + S8 + 12NH4Cl
N2+H2=NH3N2 + 3H2 = 2NH3
N2+I2=NI3N2 + 3I2 = 2NI3
N2+I2=NI3N2 + 3I2 = 2NI3
NaOH +HCl = NaCl +H2ONaOH + HCl = NaCl + H2O
Na2CO3 + 2HCl = 2NaCl +CO3 +H2Na2CO3 + 2HCl = 2NaCl + CO3 + H2
Na2SO4 + CO2 + Al(OH)3 = NaCHO3 + Al2(SO4)33Na2SO4 + 6CO2 + 2Al(OH)3 = 6NaCHO3 + Al2(SO4)3
NaHCO3 = CO2 + Na2CO3 + H2O2NaHCO3 = CO2 + Na2CO3 + H2O
Na2CO3+Mg(NO3)2=Na(NO3)2+Mg2CO3Na2CO3 + 2Mg(NO3)2 = 2Na(NO3)2 + Mg2CO3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaOH+Na2CO3=NaCO3+NaOHNaOH + 0Na2CO3 = 0NaCO3 + NaOH
N2H4+O=NO2+H2ON2H4 + 6O = 2NO2 + 2H2O
Na2SO4 + CuCl2 =NaCl + CuSO4Na2SO4 + CuCl2 = 2NaCl + CuSO4
NaOH+Mg(NO3)2=Na(NO3)2+MgOHNaOH + Mg(NO3)2 = Na(NO3)2 + MgOH
N2O=N2+O22N2O = 2N2 + O2
NaOH+Li2SO4=NaSO4+Li2OHNaOH + Li2SO4 = NaSO4 + Li2OH
NaOH+Li2SO4=NaSO4+Li2OHNaOH + Li2SO4 = NaSO4 + Li2OH
Na2CO3+Li2SO4=Na2SO4+Li2CO3Na2CO3 + Li2SO4 = Na2SO4 + Li2CO3
N2O5=NO2+O22N2O5 = 4NO2 + O2
NO2+H2O2=HNO32NO2 + H2O2 = 2HNO3
N2+H2=NH2N2 + 2H2 = 2NH2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO3(s)=NaNO2(s) + O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
Ni+HCl=NiCl2+H2Ni + 2HCl = NiCl2 + H2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+ZnSO4=Na2SO4+Zn2Na + ZnSO4 = Na2SO4 + Zn
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na + O2 = Na2O4Na + O2 = 2Na2O
Na+2MgI=NaI+2MgNa + MgI = NaI + Mg
Na+2MgI=NaI+2MgNa + MgI = NaI + Mg
Na+2MgI=NaI+2MgNa + MgI = NaI + Mg
Na+2MgI=NaI+2MgNa + MgI = NaI + Mg
Na+2MgI=NaI+2MgNa + MgI = NaI + Mg
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
Na+MgI=NaI+MgNa + MgI = NaI + Mg
NaHCO3(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)+CO2(g)2NaHCO3(s) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l) + 2CO2(g)
NaHCO3(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)+CO2(g)2NaHCO3(s) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l) + 2CO2(g)
NaHCO3(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)+CO2(g)2NaHCO3(s) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l) + 2CO2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
Na+O2=Na2O4Na + O2 = 2Na2O
NaI (aq) + H2SO4 (aq)= I2(aq) + H2S (g) + H2O (l) + Na2SO4 (aq)8NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4(aq)
NaOH(aq)+Al(NO3)3(aq)=NaNO3(aq)+Al(OH)3(aq)3NaOH(aq) + Al(NO3)3(aq) = 3NaNO3(aq) + Al(OH)3(aq)
Na3PO4(aq)+AgNO3(aq)=NaNO3(aq)+Ag3PO4(aq)Na3PO4(aq) + 3AgNO3(aq) = 3NaNO3(aq) + Ag3PO4(aq)
Ni (ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+ H2O = HNO3 +NO3NO2 + H2O = 2HNO3 + NO
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO + CO = N2 + CO22NO + 2CO = N2 + 2CO2
NiS + O2 = NiO +SO22NiS + 3O2 = 2NiO + 2SO2
NH3 + O2 = H2O + NO4NH3 + 5O2 = 6H2O + 4NO
NaN3 = Na + N22NaN3 = 2Na + 3N2
NH3 + H2SO4 =(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NO2 + H2 = NH3 + H2O2NO2 + 7H2 = 2NH3 + 4H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2(g)+I2(g) = NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NH3 = N2 + H22NH3 = N2 + 3H2
Na2CO3(aq)+CoCl2(aq)=NaCl(aq)+CoCO3(s)Na2CO3(aq) + CoCl2(aq) = 2NaCl(aq) + CoCO3(s)
Na2CO3(aq)+CoCl2(aq)=Na2Cl2(aq)+CoCO3(s)Na2CO3(aq) + CoCl2(aq) = Na2Cl2(aq) + CoCO3(s)
Na2CO3(aq)+CoCl2(aq) = NaCl(aq)+CoCO3(s)Na2CO3(aq) + CoCl2(aq) = 2NaCl(aq) + CoCO3(s)
Na2CO3(aq)+CoCl2(aq) = NaCl(aq)+CoCO3(s)Na2CO3(aq) + CoCl2(aq) = 2NaCl(aq) + CoCO3(s)
Na2CO3(aq)+CoCl2(aq) = 2NaCl(aq)+CoCO3(s)Na2CO3(aq) + CoCl2(aq) = 2NaCl(aq) + CoCO3(s)
NO2 + H2O + O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH3+O2=NO2+2H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S2O3 + I2 + H2O = Na2SO4 + HI + NaI-1Na2S2O3 - 4I2 - 5H2O = -2Na2SO4 - 10HI + 2NaI
Na2S2O3 + I2 + H2O = Na2SO4 + NaI + HINa2S2O3 + 4I2 + 5H2O = 2Na2SO4 - 2NaI + 10HI
Na2S2O3 + I2 + H2O = Na2SO4 + NaOH + HINa2S2O3 + 4I2 + 3H2O = 2Na2SO4 - 2NaOH + 8HI
Na2S2O3 + Cl2 + H2O = H2SO4 + NaCl + HClNa2S2O3 + 4Cl2 + 5H2O = 2H2SO4 + 2NaCl + 6HCl
Na2SO4 + CaCl2 = CaSO4 + NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na2SO4 + CaCl2 = CaSO4 + NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
Na2S+Al(NO3)3=Na2(NO3)3+AlSNa2S + Al(NO3)3 = Na2(NO3)3 + AlS
N2O5(g) = NO2(g) + O2(g)2N2O5(g) = 4NO2(g) + O2(g)
NH3+O2= NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2SO3 + Cr2(SO4)3 + H2O = Cr(OH)3 + Na2SO4 + SO23Na2SO3 + Cr2(SO4)3 + 3H2O = 2Cr(OH)3 + 3Na2SO4 + 3SO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2SO3 + Al2(SO4)3 + H2O = Al(OH)3 + Na2SO4 + SO23Na2SO3 + Al2(SO4)3 + 3H2O = 2Al(OH)3 + 3Na2SO4 + 3SO2
NaClO3 =NaCl + O22NaClO3 = 2NaCl + 3O2
NaClO + H2S = NaCl + H2SO44NaClO + H2S = 4NaCl + H2SO4
Na2CrO4 + Al2(O2)3 =Na2O2 + Al2(CrO4)33Na2CrO4 + Al2(O2)3 = 3Na2O2 + Al2(CrO4)3
Na(s)+O2(s)=Na2O(s)4Na(s) + O2(s) = 2Na2O(s)
Na3N + CaO = Na2O + Ca3N22Na3N + 3CaO = 3Na2O + Ca3N2
NaClO= Na+ + Cl- + O2 (g)2NaClO = 2Na+ + 2Cl- + O2(g)
Na2CO3+HCL=NaCL+H2O+CO2Na2CO3 + 2HCL = 2NaCL + H2O + CO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NaCl(s)+SO2(g)+H2O(g)+O2(g)=Na2SO4(s)+HCl(g)4NaCl(s) + 2SO2(g) + 2H2O(g) + O2(g) = 2Na2SO4(s) + 4HCl(g)
Na No3 + Al2 (So4)3 = Na2 So4 +Al (No3)36NaNo3 + Al2(So4)3 = 3Na2So4 + 2Al(No3)3
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaHCO3+H2C4H4O6=NaH4O6+H2HCO3-1NaHCO3 + H2C4H4O6 = -1NaH4O6 + 3H2HCO3
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NaBH4 + AgNO3 + H2O = NaB(OH)4 + Ag + HNO3NaBH4 + 8AgNO3 + 4H2O = NaB(OH)4 + 8Ag + 8HNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
N2O5 +H2O = NH3 +O33N2O5 + 9H2O = 6NH3 + 8O3
Na + H2 = NaH2Na + H2 = NaH2
Na + H2 = NaH2Na + H2 = NaH2
Na2SO4 + Ba (NO3)2 = NaNO3 + BaSO4Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
Na2SO3 + S8 = Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NaOH+ Fe(NO3)3= NaNO3+ Fe(OH)33NaOH + Fe(NO3)3 = 3NaNO3 + Fe(OH)3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + S2Cl2 = S8 + S4N4 + NH4Cl16NH3 + 6S2Cl2 = S8 + S4N4 + 12NH4Cl
NH3 + CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
Na2S + Sn(SO4)2 = NaSO4 + SnSNa2S + Sn(SO4)2 = 2NaSO4 + SnS
NiCl2(aq)+Na2S(aq)=NiS(s)+2NaCl(aq)NiCl2(aq) + Na2S(aq) = NiS(s) + 2NaCl(aq)
Ni(OH)2 + H2SO4 =NiSO4 + H2ONi(OH)2 + H2SO4 = NiSO4 + 2H2O
N2 + H2 = 2NH3N2 + 3H2 = 2NH3
Na3PO4+Ba(NO3)2=Ba3(PO4)2+NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaCl + H2SO4 = NaHSO4 + HClNaCl + H2SO4 = NaHSO4 + HCl
NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
N2 + 2O2=N2O4N2 + 2O2 = N2O4
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 == NO3 + H2O4NH3 + 9O2 = 4NO3 + 6H2O
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaOH + H = Na + H2ONaOH + H = Na + H2O
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
N2 + O2 = NO2N2 + 2O2 = 2NO2
NH3 + NO2 = N2O + H2O6NH3 + 8NO2 = 7N2O + 9H2O
Na2O+(NH4)2(SO4)=Na2(SO4)+H2O+NH3Na2O + (NH4)2(SO4) = Na2(SO4) + H2O + 2NH3
NiSO4 + NaOH = Na2SO4 + Ni(OH)2NiSO4 + 2NaOH = Na2SO4 + Ni(OH)2
NH4NO3=N2+O2+H2010NH4NO3 = 10N2 + 15O2 + 2H20
NH4NO3=N2+O2+H2010NH4NO3 = 10N2 + 15O2 + 2H20
NaOH+H2S=H2O+Na2S2NaOH + H2S = 2H2O + Na2S
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NiCl2 + Na3PO4 = Ni3(PO4)2 + (Na3)2(Cl2)33NiCl2 + 2Na3PO4 = Ni3(PO4)2 + (Na3)2(Cl2)3
NH3 + SO3 + H2O = (NH4)2SO42NH3 + SO3 + H2O = (NH4)2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
Na3P+CaF2=NaF+Ca3P22Na3P + 3CaF2 = 6NaF + Ca3P2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + H2O + Fe(NO3)3 = Fe(OH)3 + NH4NO33NH3 + 3H2O + Fe(NO3)3 = Fe(OH)3 + 3NH4NO3
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO3+HCl=Na2Cl+HSO3Na2SO3 + HCl = Na2Cl + HSO3
NH3 +O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+Cl2= NH4Cl+ NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
Na3 PO4 + MgCl2 = Mg3(PO4)2 + NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
N2H4+O2=NO2+H2ON2H4 + 3O2 = 2NO2 + 2H2O
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N+O=NON + O = NO
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH4NO3=N2O(g)+H2O(l)NH4NO3 = N2O(g) + 2H2O(l)
N2+H2 = NH3N2 + 3H2 = 2NH3
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaI (aq) + H2SO4 (aq) = I2(aq) + H2S (g) + H2O (l) + Na2SO48NaI(aq) + 5H2SO4(aq) = 4I2(aq) + H2S(g) + 4H2O(l) + 4Na2SO4
NH3+O2 = NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + H2O = NaH3O2NaOH + H2O = NaH3O2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.