Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH4ClO=N2+Cl2+O2+H2O2NH4ClO = N2 + Cl2 - O2 + 4H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2S+HCl=NaCl+H2SNa2S + 2HCl = 2NaCl + H2S
NaCl=Na+Cl22NaCl = 2Na + Cl2
NaAl(CO3)(OH2) + 4H = Na + Al +3H2O + CO2NaAl(CO3)(OH2) + 2H = Na + Al + 2H2O + CO2
NiS + O2 = NiO + SO22NiS + 3O2 = 2NiO + 2SO2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2 +H2 = NH3N2 + 3H2 = 2NH3
Na (s)+Cl2 (g)=NaCl (s)2Na(s) + Cl2(g) = 2NaCl(s)
N2 (g)+O2 (g)=NO (g)N2(g) + O2(g) = 2NO(g)
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na3PO4+Ni(NO3)2=Ni3(PO4)2+NaNO32Na3PO4 + 3Ni(NO3)2 = Ni3(PO4)2 + 6NaNO3
Na2CO3 + C + N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
Na2SO4 + K2Cl = Na2Cl + K2SO4Na2SO4 + K2Cl = Na2Cl + K2SO4
Na2SO4 + C + NaOH = Na2CO3+Na2S+H2ONa2SO4 + 2C + 4NaOH = 2Na2CO3 + Na2S + 2H2O
Na2SO4 + C + NaOH = Na2CO3+Na2S+H2ONa2SO4 + 2C + 4NaOH = 2Na2CO3 + Na2S + 2H2O
Na + H3PO4 = H2 + Na3PO46Na + 2H3PO4 = 3H2 + 2Na3PO4
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NH4 + NO3=N2O+H2ONH4 + NO3 = N2O + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)2NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)
NO2(g) + H2O(l) + O2(g) = HNO3(aq)4NO2(g) + 2H2O(l) + O2(g) = 4HNO3(aq)
NH3+H3PO4=(NH4)3+PO43NH3 + H3PO4 = (NH4)3 + PO4
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2CO3 + CaCl2 = NaCl + CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
NaOH + Cu(NO3)2 =Cu(OH)2 + NaNO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+ F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NaCN+ CuCO3= Na2CO3+ Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na(HCO3)+HC6H8O7 = NaC6H8O7+H2O+CO2Na(HCO3) + HC6H8O7 = NaC6H8O7 + H2O + CO2
N2 + O2 + H2O = 4HNO32N2 + 5O2 + 2H2O = 4HNO3
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
NaOH + HCl= NaCl +H2ONaOH + HCl = NaCl + H2O
NaOH + HCl= NaOHHClNaOH + HCl = NaOHHCl
NaN3(s) = Na(s) + N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NaN3(s) = Na(s) + N(g)NaN3(s) = Na(s) + 3N(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaBr+AgNO3=AgBr+Na(NO3)NaBr + AgNO3 = AgBr + Na(NO3)
Na + MgF2 = NaF + Mg2Na + MgF2 = 2NaF + Mg
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaOH+Ni(NO3)2=Na(NO3)2+NiOHNaOH + Ni(NO3)2 = Na(NO3)2 + NiOH
NO(g) + Cl2(g) = NOCl(g)2NO(g) + Cl2(g) = 2NOCl(g)
N2O3+H2O=HNO2N2O3 + H2O = 2HNO2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Ni(CO)4 = Ni + CONi(CO)4 = Ni + 4CO
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + Al2S3 = NaS3 + Al2ClNaCl + Al2S3 = NaS3 + Al2Cl
Ni(CO)4 = Ni + CONi(CO)4 = Ni + 4CO
Na2CO3 +HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)2NaHCO3(aq) = Na2CO3(aq) + H2O(l) + CO2(g)
Na + KNO3 = Na2O + K2O + N210Na + 2KNO3 = 5Na2O + K2O + N2
NiCl2 + O2 = NiO + Cl2O5NiCl2 + 3O2 = NiO + Cl2O5
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO2 2NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NaNO3=NaNO2+ONaNO3 = NaNO2 + O
NaNO3=NaNO2+ONaNO3 = NaNO2 + O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH3 +NO2 = N2 + H2O8NH3 + 6NO2 = 7N2 + 12H2O
Na2CO3 + HCI = NaCI + H2O + CO2Na2CO3 + 2HCI = 2NaCI + H2O + CO2
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na + HNO3 = NaNO3 + H22Na + 2HNO3 = 2NaNO3 + H2
N2 + O2=N2O52N2 + 5O2 = 2N2O5
Na2SO3 + H3PO4 = H2SO3 + Na3PO43Na2SO3 + 2H3PO4 = 3H2SO3 + 2Na3PO4
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na 2 SO 4 + C =Na 2 S + CO 2 Na2SO4 + 2C = Na2S + 2CO2
Na2SO4+KCl=NaCl=K2SO4Na2SO4 + 2KCl = 2NaCl + K2SO4
Na2SO3(aq) + HCl(aq) = NaCl(aq) + SO2(g) + H2SO3(g) Na2SO3(aq) + 2HCl(aq) = 2NaCl(aq) + 0SO2(g) + H2SO3(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + O2 = Na2O4Na + O2 = 2Na2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaN3 = Na + N22NaN3 = 2Na + 3N2
N2 + H2O = 2H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaIO3+NaHSO3 = NaI+ NaHSO4NaIO3 + 3NaHSO3 = NaI + 3NaHSO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaH2PO4 =NaPO3 + H2ONaH2PO4 = NaPO3 + H2O
N2 + 3 H2= 2 NH3 N2 + 3H2 = 2NH3
N2 + 2 O2= 2 NO2 N2 + 2O2 = 2NO2
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Na2Cr7O7 + H2C2O4 + HCl = CrCl3 + CO2 + H2O + NaCl2Na2Cr7O7 - 9H2C2O4 + 46HCl = 14CrCl3 - 18CO2 + 14H2O + 4NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4OH = NH3 + H2ONH4OH = NH3 + H2O
N2(g) + O2(g) = N2O5(g)2N2(g) + 5O2(g) = 2N2O5(g)
Na + O2 = Na2O4Na + O2 = 2Na2O
NpF3 + O2 + HF = NpF4 + H2O4NpF3 + O2 + 4HF = 4NpF4 + 2H2O
Na3PO4 + KOH = NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaBr+ Ca(OH)2 = CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NH3+ H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
N2H4 + H2O2 = N2 + 4H2ON2H4 + 2H2O2 = N2 + 4H2O
N2O5 + H2O = 2HNO3N2O5 + H2O = 2HNO3
N2H2 + NO2 = N2 +H2O4N2H2 + 2NO2 = 5N2 + 4H2O
NH3 + 2O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl + F2 = 2NaF + Cl22NaCl + F2 = 2NaF + Cl2
NH4Cl + NaNO2 = N2 + NaCl + H2ONH4Cl + NaNO2 = N2 + NaCl + 2H2O
N2 + H2O = 2H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
N2 + NO = N2ON2 + 2NO = 2N2O
N2 + NO = NO0N2 + NO = NO
NH3 + O2 = 2N2 + 6H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NaNO3+H2SO4=Na2SO4+HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NH4Cl+Ca(OH)2=CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NO+O2=NO22NO + O2 = 2NO2
N2 + HNO3 = N2O4 + H2ON2 + 8HNO3 = 5N2O4 + 4H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl + H2SO4=Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na+FeBr3 = NaBr + Fe3Na + FeBr3 = 3NaBr + Fe
Na+FeBr3 = NaBr + Fe3Na + FeBr3 = 3NaBr + Fe
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
N2Cl4+CH4 = CCl4+H2+N2N2Cl4 + CH4 = CCl4 + 2H2 + N2
NaIO3+HI= I2+NaI+H2ONaIO3 + 6HI = 3I2 + NaI + 3H2O
Na2CO3+HCl = NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaHCO3 = Na2O+H2O+CO22NaHCO3 = Na2O + H2O + 2CO2
NaHCO3 = Na2O+H2O+CO22NaHCO3 = Na2O + H2O + 2CO2
Na2CO3 + H2SO4 = Na2SO4 + H2CO3Na2CO3 + H2SO4 = Na2SO4 + H2CO3
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH2N2 + 2H2 = 2NH2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2SO3(aq) + S8(s) = Na2S2O3(aq)8Na2SO3(aq) + S8(s) = 8Na2S2O3(aq)
Na + HNO3=NaNO3 + H22Na + 2HNO3 = 2NaNO3 + H2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
Na3CO3 + CH3OOH = CO2+CH3COONa+NaOH12Na3CO3 + 13CH3OOH = 9CO2 + 8CH3COONa + 28NaOH
NiSO4+CaCl2=NiCl2+CaSO4NiSO4 + CaCl2 = NiCl2 + CaSO4
Na(s) + KNO3(s) =K2O(s) + Na2O(s) + N2(g)10Na(s) + 2KNO3(s) = K2O(s) + 5Na2O(s) + N2(g)
Na2O = Na + ONa2O = 2Na + O
Na+Br2=NaBr2Na + Br2 = 2NaBr
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO3 + KMnO4 + H2O = Na2SO4 + MnO2 + KOH3Na2SO3 + 2KMnO4 + H2O = 3Na2SO4 + 2MnO2 + 2KOH
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na + Pb(NO3)2 = NaNO3 + Pb2Na + Pb(NO3)2 = 2NaNO3 + Pb
Na + Pb(NO3)2 = NaNO3 + Pb2Na + Pb(NO3)2 = 2NaNO3 + Pb
N2 + O2 = NO2N2 + 2O2 = 2NO2
NO2 + O2 = N2O54NO2 + O2 = 2N2O5
NaCl+H2SO4+O2=Na2SO4+H2O+Cl24NaCl + 2H2SO4 + O2 = 2Na2SO4 + 2H2O + 2Cl2
NaH2PO4 = NaPO3 + H2ONaH2PO4 = NaPO3 + H2O
NaOH+Cu=CuO+Na2O+H22NaOH + Cu = CuO + Na2O + H2
NaOH+Al+H2O=NaAlO2+H22NaOH + 2Al + 2H2O = 2NaAlO2 + 3H2
NaOH + Mg =Na2O +MgO+H22NaOH + Mg = Na2O + MgO + H2
NaOH + Mg =NaO +MgO+H22NaOH + 0Mg = 2NaO + 0MgO + H2
NaCl+H2O2= NaOH +HCl+ONaCl + H2O2 = NaOH + HCl + O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO(g)+O2(g)=NO2(g)2NO(g) + O2(g) = 2NO2(g)
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaCl + O2 = NaClO32NaCl + 3O2 = 2NaClO3
NaBr+Cl2= NaCl+ Br22NaBr + Cl2 = 2NaCl + Br2
N2+H2=HN33N2 + H2 = 2HN3
N2 + O2= NO2N2 + 2O2 = 2NO2
NH4NO3+NaL = NH4Na+ NO3LNH4NO3 + NaL = NH4Na + NO3L
Na3PO4+MgCl2=Mg3(PO4)2+NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
Na2CO3=Na2O + CO2Na2CO3 = Na2O + CO2
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na2Cr2O7 +FeCl2 + HCl = CrCl3 + FeCl 3 +NaCl + H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
N2 + F2 = NF3N2 + 3F2 = 2NF3
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3O2 = 2NO2N2 + 2O2 = 2NO2
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na2S2O3+I2=NaI+Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
Na2SO3+S8=Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
Na2S2O3(aq)+I2(aq)=Na2S4O6(aq)+NaI(aq)2Na2S2O3(aq) + I2(aq) = Na2S4O6(aq) + 2NaI(aq)
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
Na2SO4+Ba(NO3)2=NaNO3+BaSO4Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
Na2CO3 + HNO3 = NaNO3 + H2O +CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
Na2SO2+Hg2Cl2=Hg2SO2+Na2Cl2Na2SO2 + Hg2Cl2 = Hg2SO2 + Na2Cl2
Na2O+H3PO4=Na3PO4+H2O3Na2O + 2H3PO4 = 2Na3PO4 + 3H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3 + O2 = N + H2O4NH3 + 3O2 = 4N + 6H2O
NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO3NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO3
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaOH+H2SO4 = H2O+Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
N2H4+H2O2 = N+H2ON2H4 + 2H2O2 = 2N + 4H2O
NaPO3+CuO=NaCuPO4NaPO3 + CuO = NaCuPO4
NaPO3+CuO=NaCuPO4NaPO3 + CuO = NaCuPO4
NaPO3+CuO=NaCuPO4NaPO3 + CuO = NaCuPO4
NaPO3+CuO=NaCuPO4NaPO3 + CuO = NaCuPO4
NaPO3+CuO=NaCuPO4NaPO3 + CuO = NaCuPO4
NaPO3+CuO=NaCuPO4NaPO3 + CuO = NaCuPO4
NaPO3 + CuO = NaCuPO4NaPO3 + CuO = NaCuPO4
NaPO3 + CuO = NaCuPO4NaPO3 + CuO = NaCuPO4
NaOH + Cu(NO3)2= Cu(OH)2 + NaNO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2S (aq) + Cu(NO3)2 (aq) =NaNO3 (aq) + CuS (s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3(g) + H2SO4(aq) = (NH4)2SO4(aq)2NH3(g) + H2SO4(aq) = (NH4)2SO4(aq)
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NaBr + Ca(OH)2 = CaBr2 + NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NH3 (g) + O2 (g) = NO2 (g) + H2O (g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
Na2Co3 + Na2S + SO3 = Co2 + Na2S2O3 0Na2Co3 + Na2S + SO3 = 0Co2 + Na2S2O3
Na2Co3 + Na2S + SO3 = Co2 + Na2S2O3 0Na2Co3 + Na2S + SO3 = 0Co2 + Na2S2O3
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NO3 + Cl = NO + Cl20NO3 + 2Cl = 0NO + Cl2
N2 + H2O = H2O2 + N2H4N2 + 4H2O = 2H2O2 + N2H4
N2(g) +H2(g)=NH3(g) N2(g) + 3H2(g) = 2NH3(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO3 + S8= Na2S2O38Na2SO3 + S8 = 8Na2S2O3
Na2SO3 + S8= Na2S2O38Na2SO3 + S8 = 8Na2S2O3
NaHCO3 + HCL= NaCL + H2O + CO2 NaHCO3 + HCL = NaCL + H2O + CO2
Na2O2=Na2O+O22Na2O2 = 2Na2O + O2
Na2O2=Na2+O2Na2O2 = Na2 + O2
Ni(OH)3+H2SO3=Ni2(SO3)3+H2O2Ni(OH)3 + 3H2SO3 = Ni2(SO3)3 + 6H2O
Na2CO3 + H2(CO3) = NaHCO3Na2CO3 + H2(CO3) = 2NaHCO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaClO + Al = Na + O2 + AlCl36NaClO + 2Al = 6Na + 3O2 + 2AlCl3
Na2CO3= Na2O + CO2Na2CO3 = Na2O + CO2
Na2CO3= Na2O + CO2Na2CO3 = Na2O + CO2
Na+O2=Na2O4Na + O2 = 2Na2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NiCl2*6H2O + SOCl2 = NiCl2 + SO2 + HClNiCl2*6H2O + 6SOCl2 = NiCl2 + 6SO2 + 12HCl
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2 = N2O + H2O2NH3 + 2O2 = N2O + 3H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3 = CO2 + Na2ONa2CO3 = CO2 + Na2O
NO+H2O=NH3+O24NO + 6H2O = 4NH3 + 5O2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + K2CO3 = Na2CO3 + KOH2NaOH + K2CO3 = Na2CO3 + 2KOH
NaOH + K3PO4 = Na3PO4 + KOH3NaOH + K3PO4 = Na3PO4 + 3KOH
NH3+F2=NH4F+NF34NH3 + 3F2 = 3NH4F + NF3
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2O=N2+O22N2O = 2N2 + O2
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+O2=Na2O22Na + O2 = Na2O2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na + H2O= NaOH + H22Na + 2H2O = 2NaOH + H2
NiI2(aq) + (NH4)2CO3(aq) = NiCO3(s) + 2 NH4I(aq)NiI2(aq) + (NH4)2CO3(aq) = NiCO3(s) + 2NH4I(aq)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
NaNO3=NaNO2 + O22NaNO3 = 2NaNO2 + O2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH4Cl + Ba(OH)2 = NH3 + BaCl2 + H2O2NH4Cl + Ba(OH)2 = 2NH3 + BaCl2 + 2H2O
NaOH (aq) + H2SO4 (aq) = Na2SO4 (aq) + H2O (l)2NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l)
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2S + H2S = NaSHNa2S + H2S = 2NaSH
N2H4 + Cl2 = N2 + HClN2H4 + 2Cl2 = N2 + 4HCl
N2O5=N2O4+O22N2O5 = 2N2O4 + O2
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N + I = NIN + I = NI
N2 +O2=N2O2N2 + O2 = 2N2O
NH4OH + H2O2 = NH3 + H2ONH4OH + 0H2O2 = NH3 + H2O
NH4NO3=N2O + H2ONH4NO3 = N2O + 2H2O
Na3PO4(aq)+Ca(OH)2(aq)=Ca3(PO4)2(s)+NaOH(aq)2Na3PO4(aq) + 3Ca(OH)2(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + CO2 = (NH2)2CO + H2O2NH3 + CO2 = (NH2)2CO + H2O
Na2SO4+C=Na2S+CO2Na2SO4 + 2C = Na2S + 2CO2
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH3 + H2S= (NH4)2S2NH3 + H2S = (NH4)2S
NaHCO3(s) + CH3COOH(aq) = CH3COONa(aq) + H2O(l) + CO2(g)NaHCO3(s) + CH3COOH(aq) = CH3COONa(aq) + H2O(l) + CO2(g)
Na2O2+ H2O = NaOH +O22Na2O2 + 2H2O = 4NaOH + O2
Na2CO3 + S + SO2 = CO2 + Na2S2O3Na2CO3 + S + SO2 = CO2 + Na2S2O3
Na2CO3 + S + SO2 = CO2 + Na2S2O3Na2CO3 + S + SO2 = CO2 + Na2S2O3
Na2SO4 + CaCl2= CaSO4 + NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
Na+CI=NaCINa + CI = NaCI
NH3+H2S=(NH4)2S2NH3 + H2S = (NH4)2S
NH3+H2S=(NH4)2S2NH3 + H2S = (NH4)2S
Na2S2O3+Cl2+H2O=Na2SO4+HCl +H2SO4Na2S2O3 + 4Cl2 + 5H2O = Na2SO4 + 8HCl + H2SO4
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na2S2O3+Cl2+H2O=Na2SO4+HCl +H2SO4Na2S2O3 + 4Cl2 + 5H2O = Na2SO4 + 8HCl + H2SO4
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NH4OH + Al2S3 = (NH4)2S + Al(OH)36NH4OH + Al2S3 = 3(NH4)2S + 2Al(OH)3
NH3(g)= N2(g)+H2(g)2NH3(g) = N2(g) + 3H2(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaOH(aq) + HNO3(aq) = H2O(l) + NaNO3(aq)NaOH(aq) + HNO3(aq) = H2O(l) + NaNO3(aq)
NaOH(aq) + HCl(aq) = H2O(l) + NaCl(aq)NaOH(aq) + HCl(aq) = H2O(l) + NaCl(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+O2=N2O2N2 + O2 = 2N2O
N2(g)+H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NO2 + O2 = N2O54NO2 + O2 = 2N2O5
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl+KNO3=NaNO3+KClNaCl + KNO3 = NaNO3 + KCl
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NO2 + H2O = HNO3 +NO3NO2 + H2O = 2HNO3 + NO
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4 NO2= N2+H2ONH4NO2 = N2 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH + Na2S = NaS + Na2OHNaOH + Na2S = NaS + Na2OH
NaOH+CaBr2=Ca(OH)2+Na Br2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
Na+Fe2O3=Na2O+Fe6Na + Fe2O3 = 3Na2O + 2Fe
Na+Br2=NaBr2Na + Br2 = 2NaBr
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NH4OH + Al2S3 = (NH4)2S + Al(OH)36NH4OH + Al2S3 = 3(NH4)2S + 2Al(OH)3
NaBr + BaCl2 = NaCl2 + BaBrNaBr + BaCl2 = NaCl2 + BaBr
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2S2O3(aq) + I2(aq) = Na2S4O6(aq) + NaI(aq)2Na2S2O3(aq) + I2(aq) = Na2S4O6(aq) + 2NaI(aq)
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)
Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)
Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)Na2CO3(aq) + S(s) + SO2(g) = CO2(g) + Na2S2O3(aq)
NaCN+CuCO3=Na2CO3+Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
Na+O2=Na2O4Na + O2 = 2Na2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na2CO3+C+N2=NaCN+CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+P4O10=Na3PO46Na2O + P4O10 = 4Na3PO4
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na2SO4+BaCl2=BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na+HNO3=NaNO3+H22Na + 2HNO3 = 2NaNO3 + H2
Na + H2 = NaH2Na + H2 = 2NaH
NH3 + NO = N2+ H2O4NH3 + 6NO = 5N2 + 6H2O
NO(g)+O2(g)=NO2(g)2NO(g) + O2(g) = 2NO2(g)
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NO(g)+O2(g)=NO2(g)2NO(g) + O2(g) = 2NO2(g)
N2O5(g)=NO2(g)+O2(g)2N2O5(g) = 4NO2(g) + O2(g)
NH4 NO3 = N2O + 2H2ONH4NO3 = N2O + 2H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
N2(g)+O2(g)+H20=HNO3(aq)10N2(g) + 30O2(g) + H20 = 20HNO3(aq)
Na OH + Cu( NO3)2 = Cu(OH)2 + Na NO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaClO + Cl- + H+ = Cl2 + H2O + Na+ NaClO + Cl- + 2H+ = Cl2 + H2O + Na+
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaCI+H2SO4 = Na2SO4 + HCI2NaCI + H2SO4 = Na2SO4 + 2HCI
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + O2-4Na - 2H2O = -4NaOH + O2
NaHCO3 = H2O+CO2+Na2CO32NaHCO3 = H2O + CO2 + Na2CO3
Na2HPO4+ BaCl2= 2NaCl+BaHPO4Na2HPO4 + BaCl2 = 2NaCl + BaHPO4
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 (g) + O2 (g) + H2O = HNO3 (aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NH3+I2=N2I6+H22NH3 + 3I2 = N2I6 + 3H2
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NaI+Pb(NO3)2=PbI2+ NaNO32NaI + Pb(NO3)2 = PbI2 + 2NaNO3
NaIO3 + HI = I2 + NaI + H2ONaIO3 + 6HI = 3I2 + NaI + 3H2O
Na3PO4+Zn(NO3)2=Zn3(PO4)2+ NaNO32Na3PO4 + 3Zn(NO3)2 = Zn3(PO4)2 + 6NaNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+NH4Cl=NH3+H2O+NaClNaOH + NH4Cl = NH3 + H2O + NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaBr(aq) + CaF2 (aq) = NaF(aq) + CaBr2 (aq)2NaBr(aq) + CaF2(aq) = 2NaF(aq) + CaBr2(aq)
NaH + BF3 = B2H6 + NaF6NaH + 2BF3 = B2H6 + 6NaF
NH3 + Cl = NH4Cl + NCl34NH3 + 6Cl = 3NH4Cl + NCl3
NO+O2=NO22NO + O2 = 2NO2
NH3 + O2 = H2O +N24NH3 + 3O2 = 6H2O + 2N2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na3N = Na + N22Na3N = 6Na + N2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na3PO4+HCl=NaCl+H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NaOH +H2CO3 =H2O + Na2CO32NaOH + H2CO3 = 2H2O + Na2CO3
Na + 2CI = 2NaCINa + CI = NaCI
Na + 2CI = 2NaCINa + CI = NaCI
NaOH + Cu(NO3)2 = Cu(OH)2 + NaNO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NH3 + H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Ni+AuBr3=NiBr2+Au3Ni + 2AuBr3 = 3NiBr2 + 2Au
NH3+F2=NH4F +NF3 4NH3 + 3F2 = 3NH4F + NF3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na3PO4 + KOH = 3NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na3PO4+KOH=3NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na3PO4+KOH=3NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
N2+I2=NI3N2 + 3I2 = 2NI3
NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO3NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO3
NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO0NaHCO3 + HC2H3O2 = 0NaC2H3O2 + 2H2CO
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + Al2(SO3)3 = Na2SO3 + Al(OH)36NaOH + Al2(SO3)3 = 3Na2SO3 + 2Al(OH)3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NH4ClO4 = N2 + O2 + H2O + HCl4NH4ClO4 = 2N2 + 5O2 + 6H2O + 4HCl
NH4ClO = N2 + O2 + H2O + HCl4NH4ClO = 2N2 - O2 + 6H2O + 4HCl
N2 + H2= NH3N2 + 3H2 = 2NH3
Na2CO3+ZnSO4=Na2SO4+ZnCO3Na2CO3 + ZnSO4 = Na2SO4 + ZnCO3
Na + O2 = NaO2Na + O2 = 2NaO
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2SO4=Na2SO4+2H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2S2O3 + KIO3 + HCl = Na2SO4 + K2SO4 + ICl + H2ONa2S2O3 + 2KIO3 + 2HCl = Na2SO4 + K2SO4 + 2ICl + H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO+O2=NO22NO + O2 = 2NO2
N2+O2=N2O52N2 + 5O2 = 2N2O5
Na+O2=Na2O22Na + O2 = Na2O2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NaHCO3 + HCl = NaCl + H(HCO3)NaHCO3 + HCl = NaCl + H(HCO3)
NaHCO3+H2SO4=Na2SO4+CO2+H2O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
Na2CO3 + HCl = CO2 + H2O + NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH3 + CO2 = (NH2)2CO + H2O2NH3 + CO2 = (NH2)2CO + H2O
NH3 + CO2 = (NH2)2CO + H2O2NH3 + CO2 = (NH2)2CO + H2O
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
N2+H2=NH3N2 + 3H2 = 2NH3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na+ H2O= NaOH+ H22Na + 2H2O = 2NaOH + H2
N2+O2 = NON2 + O2 = 2NO
NO(g) + H2(g) = NH3(g) + H2O(g) 2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NO2 + O2 = N2O34NO2 - O2 = 2N2O3
N2O4=NO2N2O4 = 2NO2
N2O4 =NO2N2O4 = 2NO2
NH3 + HC2H3O2 = NH4 + C2H3O2NH3 + HC2H3O2 = NH4 + C2H3O2
NH3 + HC2H3O2 = NH4 + C2H3O2NH3 + HC2H3O2 = NH4 + C2H3O2
Na+FeBr3=NaBr+Fe3Na + FeBr3 = 3NaBr + Fe
Na2Co3+Ca(NO3)2=CaCo3(s)+NaNO3(aq)Na2Co3 + Ca(NO3)2 = CaCo3(s) + 2NaNO3(aq)
NO(g) + H2(g) = NH3(g) + H2O(g) 2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na2SO3 + 12HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na + Cu3(PO4)2 = Na3PO4 + Cu6Na + Cu3(PO4)2 = 2Na3PO4 + 3Cu
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3 =N2O + H2ONH4NO3 = N2O + 2H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO + H2O = NH3 + O24NO + 6H2O = 4NH3 + 5O2
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
NH3 + H2SO4 = (NH4) 2SO42NH3 + H2SO4 = (NH4)2SO4
Na+O2=Na2O4Na + O2 = 2Na2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO3+ KMnO4+ NaHSO4= Na2SO4+ MnSO4+ K2SO4+H2O5Na2SO3 + 2KMnO4 + 6NaHSO4 = 8Na2SO4 + 2MnSO4 + K2SO4 + 3H2O
Na2Cr2O7+FeCl2+HCl=CrCl3+FeCl3+NaCl+H2ONa2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2NaCl + 7H2O
Na2SO4 +NH4NO3 = (NH4)2SO4 + NaNO3Na2SO4 + 2NH4NO3 = (NH4)2SO4 + 2NaNO3
Na2SO4 +NH4NO3 = (NH4)2SO4 + NaNO3Na2SO4 + 2NH4NO3 = (NH4)2SO4 + 2NaNO3
Na2SO4 + C = Na2S + CONa2SO4 + 4C = Na2S + 4CO
NO2+H2O=NO+HNO33NO2 + H2O = NO + 2HNO3
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
N2O5 = NO2 + O22N2O5 = 4NO2 + O2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2+6Li=2Li3NN2 + 6Li = 2Li3N
N2+6Li=2Li3NN2 + 6Li = 2Li3N
N2+6Li=2Li3NN2 + 6Li = 2Li3N
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + 3H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O + H2O = NH4NO3N2O + 2H2O = NH4NO3
NaCn + CuCO3 = Na2CO3 + Cu(Cn)22NaCn + CuCO3 = Na2CO3 + Cu(Cn)2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + FeBr2= 2 NaBr + FeCO3Na2CO3 + FeBr2 = 2NaBr + FeCO3
Na2CO3 + FeBr2= 2 NaBr + FeCO3Na2CO3 + FeBr2 = 2NaBr + FeCO3
Na2S + 2AgNO3 = Ag2S+ 2NaNO3Na2S + 2AgNO3 = Ag2S + 2NaNO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3 + O2 = NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH3 N2 + 3H2 = 2NH3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.