Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NH3 + O2= NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO3 = NaCl+ O22NaClO3 = 2NaCl + 3O2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+O2+CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+O2+H2 =HNO3N2 + 3O2 + H2 = 2HNO3
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na + HF = NaF + H22Na + 2HF = 2NaF + H2
NaCl + O2 = Na2O + Cl2O2NaCl + O2 = Na2O + Cl2O
NaF + Ni2(SO4)3 = Na2SO4 + NiF36NaF + Ni2(SO4)3 = 3Na2SO4 + 2NiF3
NiCl3 + Pb(NO3)2 = Ni(NO3)3 + PbCl22NiCl3 + 3Pb(NO3)2 = 2Ni(NO3)3 + 3PbCl2
Na2S +Fe(NO3)3 = NaNO3 + Fe2S33Na2S + 2Fe(NO3)3 = 6NaNO3 + Fe2S3
NaOH+I2=NaI+NaIO3+H2O6NaOH + 3I2 = 5NaI + NaIO3 + 3H2O
NH3+Cl=N2+NH4Cl8NH3 + 6Cl = N2 + 6NH4Cl
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Nh4No3+CuSo4 =(Nh4)2So4+Cu(No3)22Nh4No3 + CuSo4 = (Nh4)2So4 + Cu(No3)2
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na2(SO3) + I2 + H2O = Na2(SO4) + HINa2(SO3) + I2 + H2O = Na2(SO4) + 2HI
NiSO4+K3PO4=NiPO4+K3SO4NiSO4 + K3PO4 = NiPO4 + K3SO4
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na(IO3)+Na(HSO3)= I2+Na(HSO4)+Na2(SO4)+H2O2Na(IO3) + 5Na(HSO3) = I2 + 3Na(HSO4) + 2Na2(SO4) + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3(g)+NO(g)=N2(g)+H2O(g)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(g)
Na2SO4+BaCl2=BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na2SO4+BaCl2=BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NaCl + AgNO3 =AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NaNO3+Al(C2H3O2)3=AlNO3+Na(C2H3O2)3NaNO3 + Al(C2H3O2)3 = AlNO3 + Na(C2H3O2)3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na OH+HCl= NaCl +H2ONaOH + HCl = NaCl + H2O
Ni(s) + HCl(aq) = NiCl2(aq) + H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
N2 + O2 = (N2O)22N2 + O2 = (N2O)2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4Cl+NaOCl = NH2Cl + NaOHClNH4Cl + 2NaOCl = NH2Cl + 2NaOHCl
NaHCO3 + HCl = H2CO3 + NaClNaHCO3 + HCl = H2CO3 + NaCl
NH4+NO2=N2+H2ONH4 + NO2 = N2 + 2H2O
Na+O2=Na2O4Na + O2 = 2Na2O
NaCl + Pb(NO3)2 = PbCl2 + NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NH3(g)+O2(g)+CH4(g)=HCN(aq)=H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
Ni(NO3)2+Li2SO4=Ni(SO4)+Li(NO3)Ni(NO3)2 + Li2SO4 = Ni(SO4) + 2Li(NO3)
NaF + Ca(NO3)2 = NaNO3 + CaF22NaF + Ca(NO3)2 = 2NaNO3 + CaF2
NaOH + HC7H5O2 = NaC7H5O2 + H2ONaOH + HC7H5O2 = NaC7H5O2 + H2O
Na2S2O3 + I2 = Na2S4O6 + NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
Na2S2O3 + I2 = Na2S4O6 + NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Ni+HNO3=Ni(NO3)2+NO+H2O3Ni + 8HNO3 = 3Ni(NO3)2 + 2NO + 4H2O
NH3+O2= NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2=N2O2N2 + O2 = 2N2O
Na2CrO4 + AgNO3 = NaNO3 + Ag2CrO4Na2CrO4 + 2AgNO3 = 2NaNO3 + Ag2CrO4
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
Na2SO4 (aq) + AgNO3 (aq) = Ag2SO4 (s) + NaNO3 (aq)Na2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2NaNO3(aq)
Na2SO4 (aq) + AgNO3 (aq) = Ag2SO4 (s) + NaNO3 (aq)Na2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2NaNO3(aq)
Na + H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+CuO=N2+Cu+H2O2NH3 + 3CuO = N2 + 3Cu + 3H2O
Na2SO3 + HCl= NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na + Cl2= NaCl2Na + Cl2 = 2NaCl
Na + Cl = NaClNa + Cl = NaCl
Na2 + H2O = NaOH + H2Na2 + 2H2O = 2NaOH + H2
NaBH4 + H2SO4 = B2H6 + H2 + Na2SO42NaBH4 + H2SO4 = B2H6 + 2H2 + Na2SO4
NaCl + Pb(NO3)2 = PbCl2 + NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
Na2CO3+Pb(NO3)2=NaNO3+Pb2(CO3)22Na2CO3 + 2Pb(NO3)2 = 4NaNO3 + Pb2(CO3)2
Na2CO3+Ba(OH)2=Ba2(CO3)2+NaOH2Na2CO3 + 2Ba(OH)2 = Ba2(CO3)2 + 4NaOH
Na2CO3+CuSO4=Cu2(CO3)2+Na2SO42Na2CO3 + 2CuSO4 = Cu2(CO3)2 + 2Na2SO4
NaCl + Cl2 = 2NaClNaCl + 0Cl2 = NaCl
NaCl+BeI2 = NaI+BeCl22NaCl + BeI2 = 2NaI + BeCl2
NaCl+BeI2 = NaI+BeCl22NaCl + BeI2 = 2NaI + BeCl2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaI + AgNO3 = NaNO3 + AgINaI + AgNO3 = NaNO3 + AgI
NO2(g) + O2(g) = NO3(g)2NO2(g) + O2(g) = 2NO3(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NO2 + H2O = HNO2 + HNO32NO2 + H2O = HNO2 + HNO3
Na+H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl + H2SO4 + MnO2 = NaSO4 + MnSO4 + H2O + Cl22NaCl + 4H2SO4 + 2MnO2 = 2NaSO4 + 2MnSO4 + 4H2O + Cl2
NH4NO3 = N2O + H2O NH4NO3 = N2O + 2H2O
NaN3 = Na + N2 2NaN3 = 2Na + 3N2
N2O5 + H2O = HNO3 N2O5 + H2O = 2HNO3
Na + O2 =Na2O4Na + O2 = 2Na2O
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl = NaClNa + Cl = NaCl
Ni(NO3)2+Ca(ClO4)2+HNO3=Ni(NO3)3+CaCl2+H2O16Ni(NO3)2 + Ca(ClO4)2 + 16HNO3 = 16Ni(NO3)3 + CaCl2 + 8H2O
Ni(NO3)2+Ca(ClO4)2+HNO3=Ni(NO3)3+CaCl2+H2O16Ni(NO3)2 + Ca(ClO4)2 + 16HNO3 = 16Ni(NO3)3 + CaCl2 + 8H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
NH3(g)+O2(g)=NO2(g)+H2O(l) 4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(l)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaCN + HNO3 = NaNO3 + HCNNaCN + HNO3 = NaNO3 + HCN
Na3PO4 (aq) + CuSO4 (aq) = Na2SO4 (aq) + Cu3(PO4)2 (s) 2Na3PO4(aq) + 3CuSO4(aq) = 3Na2SO4(aq) + Cu3(PO4)2(s)
NO+O2=NO22NO + O2 = 2NO2
NH4OH + Mg = MgNH3 + H2ONH4OH + Mg = MgNH3 + H2O
NH3 + O2= NO + H22NH3 + O2 = 2NO + 3H2
NH4NO3=H2O+N2ONH4NO3 = 2H2O + N2O
N2+O2=N2O2N2 + O2 = 2N2O
Na2SO4 + Al(OH)3 = Al2(SO4)3 + NaOH 3Na2SO4 + 2Al(OH)3 = Al2(SO4)3 + 6NaOH
Ni(ClO3)2 = NiCl2 + O2 Ni(ClO3)2 = NiCl2 + 3O2
N2(g)+O2(g)=NO2(g)N2(g) + 2O2(g) = 2NO2(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaHSO4 + H2O2 = NaHSO5 + H2ONaHSO4 + H2O2 = NaHSO5 + H2O
NaHSO4 + H2O2 = NaHSO5 + H2ONaHSO4 + H2O2 = NaHSO5 + H2O
Na2B4O7*10H2O+NaOH=NaBO2+H2ONa2B4O7*10H2O + 2NaOH = 4NaBO2 + 11H2O
NH3+H2O=NH4OHNH3 + H2O = NH4OH
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaOH = Na2O + H2O2NaOH = Na2O + H2O
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaNO3(aq) + KI(aq) = KNO3 + NaINaNO3(aq) + KI(aq) = KNO3 + NaI
Na+Pb(NO3)2=NaNO3+Pb2Na + Pb(NO3)2 = 2NaNO3 + Pb
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaOCl + NaHSO3 = NaCl + NaHSO4NaOCl + NaHSO3 = NaCl + NaHSO4
NH4Cl+KOH=KCl+H2O+NH3NH4Cl + KOH = KCl + H2O + NH3
Na +Cl=NaClNa + Cl = NaCl
Na +Cl=NaClNa + Cl = NaCl
N2(g)+ 3H2(g) = 2NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaMnO4 + NaOH + Na2C2O4 = MnO2 + Na2CO3 + H2O2NaMnO4 + 4NaOH + 3Na2C2O4 = 2MnO2 + 6Na2CO3 + 2H2O
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaClO2+HCl=NaCl+ClO2+H22NaClO2 + 2HCl = 2NaCl + 2ClO2 + H2
NaClO2+HCl=NaCl+ClO2+H2O5NaClO2 + 4HCl = 5NaCl + 4ClO2 + 2H2O
NaClO2+HCl=NaCl+ClO2+H2O23NaClO2 + 2HCl = 3NaCl + 2ClO2 + H2O2
NO2+H2=2NH3+2H2O2NO2 + 7H2 = 2NH3 + 4H2O
N2 O5 = N2 + O22N2O5 = 2N2 + 5O2
NaHCO3+HCL=NaCL+H2O+CO2NaHCO3 + HCL = NaCL + H2O + CO2
NaN3=Na+N22NaN3 = 2Na + 3N2
NaNO3+NH3 = NaNH2 + HNO3NaNO3 + NH3 = NaNH2 + HNO3
NiCO3 + H2SO4 = NiSO4 + CO2 + H2ONiCO3 + H2SO4 = NiSO4 + CO2 + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
Na2SO4+MgCl2=2NaCl+MgSO4Na2SO4 + MgCl2 = 2NaCl + MgSO4
NH3 (g)+ NO (g)=N2 (g) + H2O (l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
N2 + H2 = 2 NH3N2 + 3H2 = 2NH3
N2 + H2 = 2NH3N2 + 3H2 = 2NH3
NaNO3= NaN+ONaNO3 = NaN + 3O
NH4NO2=N2+2H2ONH4NO2 = N2 + 2H2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H2O0Na + H2O = 0NaOH + H2O
NaCN + NaClO + NaOH = NaCl +N2 + Na2CO3 + H2O2NaCN + 5NaClO + 2NaOH = 5NaCl + N2 + 2Na2CO3 + H2O
NaH + BF3 = B2H6 + NaF6NaH + 2BF3 = B2H6 + 6NaF
N2+H2=NH3N2 + 3H2 = 2NH3
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4NO3=N2O + H2ONH4NO3 = N2O + 2H2O
NH3 + I2 = N2I6 + H22NH3 + 3I2 = N2I6 + 3H2
Na2HAsO3+KBrO3+HCl= NaCl+KBr+H3AsO43Na2HAsO3 + KBrO3 + 6HCl = 6NaCl + KBr + 3H3AsO4
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NO3+H2S=NO+S+H2ONO3 + 2H2S = NO + 2S + 2H2O
NO3+H2S=NO+S+H200NO3 + 10H2S = 0NO + 10S + H20
Na2CO3+HCl= NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2C2H5O2+CrCl2+H2=Cr(C2H5O2)2+NaCl+HCl-2Na2C2H5O2 - CrCl2 + H2 = -1Cr(C2H5O2)2 - 4NaCl + 2HCl
Na2C2H5O2+CrCl3+H2=Cr(C2H5O2)2+NaCl+HCl-4Na2C2H5O2 - 2CrCl3 + H2 = -2Cr(C2H5O2)2 - 8NaCl + 2HCl
Na2CO3 + HCl = Na2Cl + HCO3Na2CO3 + HCl = Na2Cl + HCO3
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl + KNO3 = NaNO3 + KClNaCl + KNO3 = NaNO3 + KCl
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
N2H4+N2O=N2+H2ON2H4 + 2N2O = 3N2 + 2H2O
N2 (g) + H2 (g) = NH3 (g)N2(g) + 3H2(g) = 2NH3(g)
NH4OH + KOH = KNO3 + H2 + H2O-1NH4OH - KOH = -1KNO3 - 4H2 + H2O
NO+O2=NO22NO + O2 = 2NO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaHCO3 + HCl = NaCl + NaCO3 + H2O + CO2NaHCO3 + HCl = NaCl + 0NaCO3 + H2O + CO2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+K2(Cr2)O7+H2SO4=N2O5+Cr2(SO4)3+K2SO4+H2O6NH3 + 8K2(Cr2)O7 + 32H2SO4 = 3N2O5 + 8Cr2(SO4)3 + 8K2SO4 + 41H2O
NaCl+CuO=Na2O+ CuCl22NaCl + CuO = Na2O + CuCl2
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
Ni+HNO2=NiO+NO+H2ONi + 2HNO2 = NiO + 2NO + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaN3=Na+N22NaN3 = 2Na + 3N2
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaHCO3(s)+ HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)NaHCO3(s) + HCl(aq) = NaCl(aq) + H2O(l) + CO2(g)
NH3 (g) + O2 (g) + CH4 (g) = HCN (aq) + H2O (l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq) Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
N2+O2= N2O32N2 + 3O2 = 2N2O3
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
NO= N2O + NO23NO = N2O + NO2
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NaClO2(aq) + CaCl2(aq) = NaCl(aq) + Ca(ClO4)2(s)4NaClO2(aq) + CaCl2(aq) = 4NaCl(aq) + Ca(ClO4)2(s)
N2(g) + 2 O2(g) = 2 NO2(g)N2(g) + 2O2(g) = 2NO2(g)
N2O2 (g)=NO2 + O2-1N2O2(g) = -2NO2 + O2
NaClO2(aq) + CaCl2(aq) = NaCl(aq) + Ca(ClO4)2(s)4NaClO2(aq) + CaCl2(aq) = 4NaCl(aq) + Ca(ClO4)2(s)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaOH + Cl2 = NaCl + NaClO3+ H2O6NaOH + 3Cl2 = 5NaCl + NaClO3 + 3H2O
NO3 - + H + + Fe = Fe ++ + NH4+ + H2ONO3- + 10H+ + 4Fe = 4Fe++ + NH4+ + 3H2O
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO2=NO+O22NO2 = 2NO + O2
NH3 (g) +O2 (g) =N2 (g) +H2O (g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g)020Na(s) + 20H2O(l) = 20NaOH(aq) + H2(g)0
NaCl+MnO2+H2SO4=Cl2+MnSO4+NaSO4+H2O2NaCl + 2MnO2 + 4H2SO4 = Cl2 + 2MnSO4 + 2NaSO4 + 4H2O
Na2SO3=Na2S+Na2SO44Na2SO3 = Na2S + 3Na2SO4
NH3(g) + O2(g) = NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O=N2+O22N2O = 2N2 + O2
Na+ Cl2=NaCl2Na + Cl2 = 2NaCl
NaCIO3=NaCI+O22NaCIO3 = 2NaCI + 3O2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2Co3+H2+Co2=NaHCo32Na2Co3 + 2H2 + 3Co2 = 4NaHCo3
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + I2 = NaI2Na + I2 = 2NaI
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = 2NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2SiF6(s) + Na(s) = Si(s) +NaF(s)Na2SiF6(s) + 4Na(s) = Si(s) + 6NaF(s)
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaCl (aq) + Ca(NO3)2 = NaNO3 (aq) + CaCl2 (s)2NaCl(aq) + Ca(NO3)2 = 2NaNO3(aq) + CaCl2(s)
NO+ O2=2NO3NO + O2 = NO3
NO+O2=NO3NO + O2 = NO3
NO+O2=NO3NO + O2 = NO3
NO+O2=N2O34NO + O2 = 2N2O3
NH4NO3(aq)=N2O(g)+H2O(g)NH4NO3(aq) = N2O(g) + 2H2O(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3(g) + O2(g)=NO(g) +H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
N( g) + H (g) = NH3 (g)N(g) + 3H(g) = NH3(g)
N + H = NH3N + 3H = NH3
NaBr + Ca3(PO4)2 =CaBr2 + Na3PO46NaBr + Ca3(PO4)2 = 3CaBr2 + 2Na3PO4
NaHCO3(aq)+ NiCl2(aq)= NaCl(s) +Ni(HCO3)2(aq) 2NaHCO3(aq) + NiCl2(aq) = 2NaCl(s) + Ni(HCO3)2(aq)
NaHCO3+NiCL2=NaCL2+NiHCO3NaHCO3 + NiCL2 = NaCL2 + NiHCO3
NaHCO3+NiCL2=NaCL2+NiHCO3NaHCO3 + NiCL2 = NaCL2 + NiHCO3
NaHCO3+NiCL2=NaCL2+NiHCO3NaHCO3 + NiCL2 = NaCL2 + NiHCO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g) + O2(g) + H2O(l) = HNO3(l)NH3(g) + 2O2(g) - H2O(l) = HNO3(l)
Na2B4O7 + H2SO4 +H2O = H3BO3 + Na2SO4Na2B4O7 + H2SO4 + 5H2O = 4H3BO3 + Na2SO4
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+Cl2=NCl3N2 + 3Cl2 = 2NCl3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NO2+H2O=HNO2+HNO32NO2 + H2O = HNO2 + HNO3
N2O = N2 + O22N2O = 2N2 + O2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaCN + H2SO4= Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
Ni (OH) 2 + 2 HNO3 =Ni (NO3) 2 + 2 H2ONi(OH)2 + 2HNO3 = Ni(NO3)2 + 2H2O
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2SO4=H2O+Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Ni(OH)3=Ni2O3+H2O2Ni(OH)3 = Ni2O3 + 3H2O
NH4NO3(aq)=N2O(g)+H2O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)
NaI+ Br= NaBr+ INaI + Br = NaBr + I
NH4Cl + MgO = (NH4)2O + MgCl22NH4Cl + MgO = (NH4)2O + MgCl2
Ni2+ + Al = Ni + Al3+Ni2+ + 3Al = 2Ni + Al3+
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na+H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaHCO3Aq + NaOH = Na2CO3Aq + H2ONaHCO3Aq + NaOH = Na2CO3Aq + H2O
NaHCO3Aq + HO= NaCO3Aq + H2ONaHCO3Aq + HO = NaCO3Aq + H2O
NaClO + KI + H20 = I2 + KCl + NaOH20NaClO + 20KI + H20 = 10I2 + 20KCl + 20NaOH
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na3PO4+Ag(NO3)3=NaNO3+AgPO4Na3PO4 + Ag(NO3)3 = 3NaNO3 + AgPO4
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Ni + O2 = Ni2O34Ni + 3O2 = 2Ni2O3
Ni + O2 = NiO32Ni + 3O2 = 2NiO3
NaI + O2 + H2O = I2 + NaOH4NaI + O2 + 2H2O = 2I2 + 4NaOH
Na+O2=Na2O4Na + O2 = 2Na2O
NH4NO3 = N2O + H2O NH4NO3 = N2O + 2H2O
Na + H2O = NaOH + H2 2Na + 2H2O = 2NaOH + H2
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N + 3H = NH3N + 3H = NH3
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 + HI = NH4INH3 + HI = NH4I
NO + Fe++ + H2O = NO2- + Fe + H+2NO + Fe++ + 2H2O = 2NO2- + Fe + 4H+
Na2S2O3 + KIO3 + H2SO4= Na2S4O6 + I2 + H2O + K2SO4-5Na2S2O3 + 6KIO3 - 7H2SO4 = -5Na2S4O6 + 3I2 - 7H2O + 3K2SO4
Ni(s) + H2O(l) = NiO + H2Ni(s) + H2O(l) = NiO + H2
Ni(s) + H2O(l) = NiO + H2Ni(s) + H2O(l) = NiO + H2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+CO2=NaHCO3NaOH + CO2 = NaHCO3
NH3+H3Cl2=N2+NH4Cl10NH3 + 6H3Cl2 = -1N2 + 12NH4Cl
Ni + O2 = Ni2O34Ni + 3O2 = 2Ni2O3
NaHCO3 + HCl = H2O + CO2 + NaClNaHCO3 + HCl = H2O + CO2 + NaCl
NH4NO3 = N2O + 2 H2O NH4NO3 = N2O + 2H2O
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
NH4NO3 = N2O + 2 H2ONH4NO3 = N2O + 2H2O
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na2CO3(aq) +HCl(aq) = NaCl(aq) +H2O(l) + CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NaHCO3 + HCl = H2O + CO2 + NaClNaHCO3 + HCl = H2O + CO2 + NaCl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na+H2O=NaOH+H2(g)2Na + 2H2O = 2NaOH + H2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4+BaCl2=NaCl+BaSO4Na2SO4 + BaCl2 = 2NaCl + BaSO4
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NaNO3+KCl=NaCl+KNO3NaNO3 + KCl = NaCl + KNO3
NaCl=Na+Cl22NaCl = 2Na + Cl2
NaNO2 + HCl = NaCl + NO + NO2 + H2O2NaNO2 + 2HCl = 2NaCl + NO + NO2 + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Ni (ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
Ni (ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
Na2CO3 + Al2Cl6 = Al2(CO3)3 + NaCl3Na2CO3 + Al2Cl6 = Al2(CO3)3 + 6NaCl
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
Na2S(s) + HI(aq)= H2S(g) + NaI(aq)Na2S(s) + 2HI(aq) = H2S(g) + 2NaI(aq)
Na2SO3 + I2 + H2O = Na2SO4 + HINa2SO3 + I2 + H2O = Na2SO4 + 2HI
NH4NO3 (aq) = N2O (g) + H2ONH4NO3(aq) = N2O(g) + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H20(g)10NH4NO3(s) = 10N2(g) + 15O2(g) + 2H20(g)
Na+H2+C+O2=NaHCO32Na + H2 + 2C + 3O2 = 2NaHCO3
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3+C6H5OH=C6H5ONH4NH3 + C6H5OH = C6H5ONH4
Na(s) + O2(g) = Na2O(s)4Na(s) + O2(g) = 2Na2O(s)
Na(s) + O2(g) = Na2O(s)4Na(s) + O2(g) = 2Na2O(s)
Na2O(s) + HBr(aq)= H2O(l) + NaBr(aq)Na2O(s) + 2HBr(aq) = H2O(l) + 2NaBr(aq)
Ni3N+Ca=CaN+NiNi3N + Ca = CaN + 3Ni
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NaN3 + Fe2O3 = Na2O + Fe + N26NaN3 + Fe2O3 = 3Na2O + 2Fe + 9N2
NH4NO3 + NaCl = NaNO3 + NH4ClNH4NO3 + NaCl = NaNO3 + NH4Cl
NaNO3+HCl=NaCl+H2O+N2O+Cl22NaNO3 + 10HCl = 2NaCl + 5H2O + N2O + 4Cl2
NaNO3+HCl=NaCl+H2O+N2O+Cl22NaNO3 + 10HCl = 2NaCl + 5H2O + N2O + 4Cl2
NH4ClO4+NaNO3=NaCl+N2+O2+H2O2NH4ClO4 + 2NaNO3 = 2NaCl + 2N2 + 5O2 + 4H2O
NH4ClO4+NaNO3=NaCl+N2+O2=H2O2NH4ClO4 + 2NaNO3 = 2NaCl + 2N2 + 5O2 + 4H2O
NH4ClO4+NaNO3+NH4NO3=NaCl+N2+H2O-1NH4ClO4 - NaNO3 + 5NH4NO3 = -1NaCl + 4N2 + 8H2O
Na2Cr2O2 + H2O + S = SO2 + NaOH + Cr2O3Na2Cr2O2 + H2O - S = -1SO2 + 2NaOH + Cr2O3
NaNO2 + C2H4O2 = HNO2 + NaC2H3O2NaNO2 + C2H4O2 = HNO2 + NaC2H3O2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NiS + HNO3 = Ni(NO3)3 + Ni2(SO4)3 + H2O + NO3NiS + 12HNO3 = Ni(NO3)3 + Ni2(SO4)3 + 6H2O + 9NO
N2H4+O2=NO2 + H2ON2H4 + 3O2 = 2NO2 + 2H2O
Na3PO4 + Ba(NO3)2=Ba3(PO4)2+NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na2CO3(aq)+BaCl2(aq)=BaCO3(s)+NaCl(aq)Na2CO3(aq) + BaCl2(aq) = BaCO3(s) + 2NaCl(aq)
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Ni(NO3)2(aq) + CuSO4(aq) = NiSO4 + Cu(NO3)2Ni(NO3)2(aq) + CuSO4(aq) = NiSO4 + Cu(NO3)2
Ni(NO3)2 + CuSO4 = NiSO4 + Cu(NO3)2Ni(NO3)2 + CuSO4 = NiSO4 + Cu(NO3)2
Na2SO4(aq)+CaI2(aq)=CaSO4(s)+2NaI(aq)Na2SO4(aq) + CaI2(aq) = CaSO4(s) + 2NaI(aq)
N2O=N2+O22N2O = 2N2 + O2
NH3 + 2O2 = NO3- + H+ + H2ONH3 + 2O2 = NO3- + H+ + H2O
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH3+Cl2=N2H4+NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
NH3 + ClO = N2H4 + Cl + H2O2NH3 + ClO = N2H4 + Cl + H2O
NH3 + ClO = NH2Cl + N2H2 + N2O-2NH3 + 4ClO = 4NH2Cl - 7N2H2 + 4N2O
Na2CO3+HNO3=CO2+NaNO3+H2ONa2CO3 + 2HNO3 = CO2 + 2NaNO3 + H2O
NH3+O2=2N2+6H2O4NH3 + 3O2 = 2N2 + 6H2O
NO2+O2= N2O54NO2 + O2 = 2N2O5
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO2(g)+O2(g)=N2O5(g) 4NO2(g) + O2(g) = 2N2O5(g)
NH3 + O2 + CH4 = HCN +H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Ni(s)+HCl(aq)=NiCl(aq)+H2(g)2Ni(s) + 2HCl(aq) = 2NiCl(aq) + H2(g)
NH4Cl(aq) + Ca(OH)2(aq) = NH3(g) + H2O(l) + Ca Cl2(aq)2NH4Cl(aq) + Ca(OH)2(aq) = 2NH3(g) + 2H2O(l) + CaCl2(aq)
NO2+O2=N2O54NO2 + O2 = 2N2O5
N2O=N2+O22N2O = 2N2 + O2
Na+ H2O = NaOH+ H22Na + 2H2O = 2NaOH + H2
Na+ H2O = NaOH+ H22Na + 2H2O = 2NaOH + H2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2H4(g)+6N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
N2H4(g)+6N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O = NaOH +H2O0Na + H2O = 0NaOH + H2O
Na+H2O = NaOH +2H2O0Na + H2O = 0NaOH + H2O
NO3-+5CH3OH = 3N2+5CO2+7H2O+O0NO3- - CH3OH = 0N2 - CO2 - 2H2O + 3O
NO3-+5CH3OH = 3N2+5CO2+7H2O+O0NO3- - CH3OH = 0N2 - CO2 - 2H2O + 3O
NO3--+5CH3 OH = 3N2+5CO2+7H2 O+O0NO3-- - CH3OH = 0N2 - CO2 - 2H2O + 3O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O=N2+O2 2N2O = 2N2 + O2
Na2C2O4+KMnO4+H2SO4=K2SO4+Na2SO4+H2O+MnSO4+CO25Na2C2O4 + 2KMnO4 + 8H2SO4 = K2SO4 + 5Na2SO4 + 8H2O + 2MnSO4 + 10CO2
Na(s) + H2O(l) = NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na2HAsO3+KBrO3+HCl=NaCl+KBr+H3AsO43Na2HAsO3 + KBrO3 + 6HCl = 6NaCl + KBr + 3H3AsO4
NaOH + CH3COOH = CH3COONa + H2ONaOH + CH3COOH = CH3COONa + H2O
NaOH + CH3COOH = CH3COONa + H2ONaOH + CH3COOH = CH3COONa + H2O
NaHCO3+HBr = NaBr+CO2+H2ONaHCO3 + HBr = NaBr + CO2 + H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
N2O3(g)+NO2(g)=N2O5(g)-1N2O3(g) + 4NO2(g) = N2O5(g)
Na2CO3 + 2KI = 2NaI + K2CO3Na2CO3 + 2KI = 2NaI + K2CO3
NO2 + H2O = NH4NO3 + HNO38NO2 + 5H2O = NH4NO3 + 6HNO3
NO2 + H2O = NH4NO3 + HNO24NO2 + H2O = -1NH4NO3 + 6HNO2
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
N2O=N2+O22N2O = 2N2 + O2
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NiBr2+NaClO3=NiClO3+NaBr2NiBr2 + NaClO3 = NiClO3 + NaBr2
NaCl + CaCO3 = NaCO3 + CaClNaCl + CaCO3 = NaCO3 + CaCl
N2+H2 =NH3N2 + 3H2 = 2NH3
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2(g)+H2O(l)=HN03(aq)+NO(g)7NO2(g) - H2O(l) = -2HN03(aq) + 13NO(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
Na2CO3 + Pb(NO3)2 = 2NaNO3 + PbCO3Na2CO3 + Pb(NO3)2 = 2NaNO3 + PbCO3
Na+O2=Na2O22Na + O2 = Na2O2
N2+3H2=2NH3N2 + 3H2 = 2NH3
NaOCl + 2NaClO2 = NaOClNaOCl + 0NaClO2 = NaOCl
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH3 + CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NH3 + CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2Cr2O7 + Na2C2O4 + H2SO4 = Na2SO4 + Cr2(SO4)3 + CO2 + H2ONa2Cr2O7 + 3Na2C2O4 + 7H2SO4 = 4Na2SO4 + Cr2(SO4)3 + 6CO2 + 7H2O
NaHCO3(s)+HCl(aq) = NaCl(aq)+H2CO3(aq)NaHCO3(s) + HCl(aq) = NaCl(aq) + H2CO3(aq)
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Na2O + H2O =NaOHNa2O + H2O = 2NaOH
NH3 + O2 =NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+H2O=NaOH+Cl2+H22NaCl + 2H2O = 2NaOH + Cl2 + H2
NaHSO4 + Na2CO3 = NaCO3 + Na2HSO4NaHSO4 + Na2CO3 = NaCO3 + Na2HSO4
NaOH + CuCl2 = NaCl + Cu(OH)22NaOH + CuCl2 = 2NaCl + Cu(OH)2
N2+H2= N2H4N2 + 2H2 = N2H4
Na + H2O = NaOH + HNa + H2O = NaOH + H
Na + H2O = NaOH + HNa + H2O = NaOH + H
No-3 + Cu = No + Cu2+-1No-3 + 6Cu = -1No + 3Cu2+
No-3 + Cu = No + Cu2+-1No-3 + 6Cu = -1No + 3Cu2+
NH3 + O2=NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 (l) + C (s) =2 Na (g) + 3 CO (g)Na2CO3(l) + 2C(s) = 2Na(g) + 3CO(g)
N2 + H2= NH3N2 + 3H2 = 2NH3
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2 + H2= NH3 N2 + 3H2 = 2NH3
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na3PO4 + AlCl3 = AlPO4 + 3 NaClNa3PO4 + AlCl3 = AlPO4 + 3NaCl
Na3PO4 + HCl= NaCl + H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NaHSO4 + Na2CO3 = NaCO3 + Na2HSO4NaHSO4 + Na2CO3 = NaCO3 + Na2HSO4
NaClO =NaCl +NaClO33NaClO = 2NaCl + NaClO3
Na2CO3+HCl = NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
N2O=N2+O22N2O = 2N2 + O2
Na + Br2 = NaBr2Na + Br2 = 2NaBr
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
Na+Zn(SO4)=Na2(SO4)+Zn2Na + Zn(SO4) = Na2(SO4) + Zn
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
N2O=N2+O22N2O = 2N2 + O2
Na(s)+H2O(l)=NaOH(aq)+H2(g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaHCO3 + HNO3 = H2CO3 + NaNO3NaHCO3 + HNO3 = H2CO3 + NaNO3
NaHCO3 + HNO3 = H2CO3 + NaNO3NaHCO3 + HNO3 = H2CO3 + NaNO3
NaC2H3O2 + AgNO3 = NaNO3 + AgC2H3O2NaC2H3O2 + AgNO3 = NaNO3 + AgC2H3O2
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaCl + NH4NO3 = NaNO3 + NH4ClNaCl + NH4NO3 = NaNO3 + NH4Cl
N2 + 2H2 = N2H4N2 + 2H2 = N2H4
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
NaNO3+4H2O=Na(H2O)4+NO3NaNO3 + 4H2O = Na(H2O)4 + NO3
Na + Zn(SO4) = Na2(SO4) + Zn2Na + Zn(SO4) = Na2(SO4) + Zn
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
Na + Br2 = NaBr2Na + Br2 = 2NaBr
Na + Br = NaBrNa + Br = NaBr
NaCl + Pb(NO3)2 = NaNO3 + PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
Na2CO3 + AgNO3 = Ag2CO3 + NaNO3Na2CO3 + 2AgNO3 = Ag2CO3 + 2NaNO3
Na2CO3 (l) + C (s) = 2 Na (g) + 3 CO (g)Na2CO3(l) + 2C(s) = 2Na(g) + 3CO(g)
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NH3+NO2=N2+H2O8NH3 + 6NO2 = 7N2 + 12H2O
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.