Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:






Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NF3 = N2 + F22NF3 = N2 + 3F2
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na + Cu3(PO4)2 = Na3PO4 + Cu6Na + Cu3(PO4)2 = 2Na3PO4 + 3Cu
Na2B4O7 + C = 4B + Na + CONa2B4O7 + 7C = 4B + 2Na + 7CO
Na2Cr2O7 + 6 HCl + H2O = 2 CrCl2 + 4 H2O2 + 2 NaCl Na2Cr2O7 + 6HCl + H2O = 2CrCl2 + 4H2O2 + 2NaCl
Na2SO4 + 2C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
Na2SO4 + 2C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
N2O5 = 4NO2 + O22N2O5 = 4NO2 + O2
NaHCO3 =Na2CO3 + H2O +CO22NaHCO3 = Na2CO3 + H2O + CO2
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaN3(s)=Na(s)+N2(g) 2NaN3(s) = 2Na(s) + 3N2(g)
NaS + ZnNO3 = NaNO3 + ZnSNaS + ZnNO3 = NaNO3 + ZnS
NaS + ZnNO3 = NaNO3 + ZnSNaS + ZnNO3 = NaNO3 + ZnS
NaS + ZnNO3 = NaNO3 + ZnSNaS + ZnNO3 = NaNO3 + ZnS
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2H4(g)+N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH4OH +AlCl3=Al(OH)3 +NH4Cl3NH4OH + AlCl3 = Al(OH)3 + 3NH4Cl
NaOH + H3PO4 = 3H + 2O2 + NaPO42NaOH + 2H3PO4 = 8H + O2 + 2NaPO4
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl +AgNO3=AgCl + NaNO3 NaCl + AgNO3 = AgCl + NaNO3
NaHCO3+H2SO4=Na2SO4+H2OCO22NaHCO3 + H2SO4 = Na2SO4 + 2H2OCO2
NH3 + O2 = N2O4 + H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH2 + O2 = N2O4 + H2O2NH2 + 3O2 = N2O4 + 2H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaOH+Cu(NO3)2=Cu(OH)2+NaNO32NaOH + Cu(NO3)2 = Cu(OH)2 + 2NaNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+MnO2+H2SO4=NaHSO4+MnSO4+Cl2+H2O2NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + Cl2 + 2H2O
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NH3(g)=N2(g)+H2(g)2NH3(g) = N2(g) + 3H2(g)
NH3=N2+H22NH3 = N2 + 3H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3+H2SO4=Na2SO4+H2OCO22NaHCO3 + H2SO4 = Na2SO4 + 2H2OCO2
NaOH(aq) + Sr(NO3)2(aq) = Na(NO3)(aq) + Sr(OH)2(s) 2NaOH(aq) + Sr(NO3)2(aq) = 2Na(NO3)(aq) + Sr(OH)2(s)
Na I+Pb (SO4)2 =Pb I4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO2 = NO3 + NO2NO2 = 0NO3 + NO2
NaL+F2=NaF+L22NaL + F2 = 2NaF + L2
Na+Cu3(PO4)2=Na3PO4+Cu6Na + Cu3(PO4)2 = 2Na3PO4 + 3Cu
NO2(g )+ C(s) = CO2(g) + NO(g)2NO2(g) + C(s) = CO2(g) + 2NO(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Na2SO3+H3PO4=H2SO3+Na3PO43Na2SO3 + 2H3PO4 = 3H2SO3 + 2Na3PO4
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+ F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NO3- + H2SO4 + Fe2+ = Fe3+ + NO + SO42- + H2O39NO3- + 2H2SO4 + 111Fe2+ = 74Fe3+ + 39NO + 2SO42- + 2H2O
Na+S=NaSNa + S = NaS
NH4OH + H3PO4 = NH4 + PO4 3 + H2O81NH4OH + H3PO4 = 81NH4 + PO43 + 42H2O
NH4OH + H3PO4 = NH4 + PO4 3 + H2O81NH4OH + H3PO4 = 81NH4 + PO43 + 42H2O
NH4OH + H3PO4 = NH4 + PO4 3 + H2O81NH4OH + H3PO4 = 81NH4 + PO43 + 42H2O
NaNO3 + PbBr2 + NaI = NaBr + Pb(NO3) + I22NaNO3 + 2PbBr2 + 2NaI = 4NaBr + 2Pb(NO3) + I2
NaNO3 + PbBr2 + NaI = NaBr + PbNO3 + I22NaNO3 + 2PbBr2 + 2NaI = 4NaBr + 2PbNO3 + I2
NaNO3 + PbBr2 + NaI = Na2Br2 + PbNO3 + I22NaNO3 + 2PbBr2 + 2NaI = 2Na2Br2 + 2PbNO3 + I2
NaNO3 + PbBr2 + NaI = Na2Br2 + PbNO3 + I22NaNO3 + 2PbBr2 + 2NaI = 2Na2Br2 + 2PbNO3 + I2
NaNO3 + PbBr2 + NaI = Na2Br2 + PbNO3 + INaNO3 + PbBr2 + NaI = Na2Br2 + PbNO3 + I
N2+H2=NH2N2 + 2H2 = 2NH2
N2+H2=NH2N2 + 2H2 = 2NH2
Na3PO4(aq)+CoSO4(aq)=Co3(PO4)2(s)+Na2SO4(aq) 2Na3PO4(aq) + 3CoSO4(aq) = Co3(PO4)2(s) + 3Na2SO4(aq)
N2(g) + H2(g)= NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO3- + H2SO4 + Fe++ = Fe+++ + NO + SO4-- + H2ONO3- + 2H2SO4 + 3Fe++ = 3Fe+++ + NO + 2SO4-- + 2H2O
N2H2+H2O2=N2+H2ON2H2 + H2O2 = N2 + 2H2O
Na3PO4+Pb2(CO3)4=Na2CO3+Pb3(PO4)48Na3PO4 + 3Pb2(CO3)4 = 12Na2CO3 + 2Pb3(PO4)4
Na + FeBr3=NaBr3 + Fe22Na + 2FeBr3 = 2NaBr3 + Fe2
Na2SO4(aq) + Sr(NO3)2(aq) = SrSO4(s) + NaNO3(aq)Na2SO4(aq) + Sr(NO3)2(aq) = SrSO4(s) + 2NaNO3(aq)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + H2O = HCl + NaOHNaCl + H2O = HCl + NaOH
NO(g) + H2(g)=NH3(g) + H2O(g) 2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
Na+H2O=OHNa+O2-4Na - 2H2O = -4OHNa + O2
NaHCO3 + H2SO4 = Na2SO4 + CO2 + H2O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaPO3+H2O2=HPO4+NaOHNaPO3 + H2O2 = HPO4 + NaOH
Na2CO3+SrCl2=SrCO3+NaClNa2CO3 + SrCl2 = SrCO3 + 2NaCl
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH3(g) = H2(g) + N2(g)2NH3(g) = 3H2(g) + N2(g)
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH3+N2O=N2+H2O2NH3 + 3N2O = 4N2 + 3H2O
NaCl=Na+Cl22NaCl = 2Na + Cl2
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
N2 + 6H2 = 2NH3 N2 + 3H2 = 2NH3
N2 + 6H2 = 2NH3 N2 + 3H2 = 2NH3
N2 + 6H2 = 2NH3 N2 + 3H2 = 2NH3
NaH + BF3 = B2H6 + NaF6NaH + 2BF3 = B2H6 + 6NaF
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaI + Cl2 = NaCl + I22NaI + Cl2 = 2NaCl + I2
NH3+O2=N2O4+H2O4NH3 + 7O2 = 2N2O4 + 6H2O
NH3 + O2 = H2O + N4NH3 + 3O2 = 6H2O + 4N
NH4OH+ H3PO4=NH4+ PO4+ H2O3NH4OH + H3PO4 = 3NH4 + PO4 + 3H2O
NH4OH+ H3PO=NH4+ PO4+ H2O9NH4OH + H3PO = 9NH4 + PO4 + 6H2O
N2H4(g) + N2O4(g) = N2(g) + H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NaOH + S + H2O=Na2S + 2H2O0NaOH + 0S + H2O = 0Na2S + H2O
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
N2O5=NO2+O22N2O5 = 4NO2 + O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2S(aq) + Ni(NO3)2(aq)= NaNO3(aq) + NiS (s)Na2S(aq) + Ni(NO3)2(aq) = 2NaNO3(aq) + NiS(s)
N2(g)+ H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaI + Cl2 = NaCl + I2NaI + Cl2 = 2NaCl + 2I
NO+O2=NO22NO + O2 = 2NO2
NaN3=Na+N22NaN3 = 2Na + 3N2
NaOH+Pb(NO3)2=Na(NO3)2+PbOHNaOH + Pb(NO3)2 = Na(NO3)2 + PbOH
N2+H2=NH3N2 + 3H2 = 2NH3
NaH(s) + H2O(l) = NaOH(aq) + H2(g)NaH(s) + H2O(l) = NaOH(aq) + H2(g)
NaOH(aq) + HClO4(aq)=NaClO4(aq) + H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
N2O5 = NO2 + O22N2O5 = 4NO2 + O2
Na2O(s)+H2O(l)=NaOH(aq)Na2O(s) + H2O(l) = 2NaOH(aq)
Na2S + KI = KS + I + NaNa2S + KI = KS + I + 2Na
NH4Cl(aq) + Pb(NO3)4(aq) = NH4(NO3)4 + PbClNH4Cl(aq) + Pb(NO3)4(aq) = NH4(NO3)4 + PbCl
Na2SO3 + H3PO4 = Na3PO4 + H2O + SO23Na2SO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3SO2
NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
Na2S + HCl = NaCl + H2SNa2S + 2HCl = 2NaCl + H2S
NaHSO4 + NaOH = Na2SO4 +H2O NaHSO4 + NaOH = Na2SO4 + H2O
NaIO3 + NaHSO3 = NaHSO4 + Na2SO4 + H2O + I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4Cl(aq) + AgNO3(aq) = NH4NO3 + AgClNH4Cl(aq) + AgNO3(aq) = NH4NO3 + AgCl
NaOH + Mg = MgOH + NaNaOH + Mg = MgOH + Na
NaL+CoCl2=CoL+NaCl2NaL + CoCl2 = CoL + NaCl2
NaClO3 = NaCl + O2 2NaClO3 = 2NaCl + 3O2
Na + Cl = NaCl Na + Cl = NaCl
Na + Cl= NaCl Na + Cl = NaCl
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2S(aq) + I2 = NaI + S88Na2S(aq) + 8I2 = 16NaI + S8
Na2S(aq) + I2 = NaI + SNa2S(aq) + I2 = 2NaI + S
NO3- + H2SO4 + Fe2+ = Fe3+ + NO + SO4 2- + H2O39NO3- + 2H2SO4 + 111Fe2+ = 74Fe3+ + 39NO + 2SO42- + 2H2O
NH4NO3 = N2O +H2O NH4NO3 = N2O + 2H2O
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NH4Cl + Cu(NO3)2 = NH4NO3 + Cu(Cl2)2NH4Cl + Cu(NO3)2 = 2NH4NO3 + Cu(Cl2)
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
NO2+OH(-) =NO3(-)+NO2(-)+H20 20NO2 + 20OH(-) = 20NO3(-) + 0NO2(-) + H20
NaVO3+Pb(CH3COO)2=Pb(VO3)2+NaCH3COO2NaVO3 + Pb(CH3COO)2 = Pb(VO3)2 + 2NaCH3COO
Na+H2O=H+NaOHNa + H2O = H + NaOH
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaH2PO4 = NaPO3 + H2ONaH2PO4 = NaPO3 + H2O
Na2O2 + KI + H2SO4 = I2 + Na2SO4 + K2SO4 + H2ONa2O2 + 2KI + 2H2SO4 = I2 + Na2SO4 + K2SO4 + 2H2O
Ni + NH4OH = Ni(NH3)6 + H2ONi + 6NH4OH = Ni(NH3)6 + 6H2O
Ni + NH4OH = Ni(NH3)6 + H2ONi + 6NH4OH = Ni(NH3)6 + 6H2O
Na + H2O = Na OH + HNa + H2O = NaOH + H
NaOH+KBr=NaBr+KOHNaOH + KBr = NaBr + KOH
Na + H2O = Na OH + HNa + H2O = NaOH + H
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na+HCl=NaCl+H22Na + 2HCl = 2NaCl + H2
NH3 + H2SO4 (aq) = (NH4)2SO4 2NH3 + H2SO4(aq) = (NH4)2SO4
Na3PO4*12H2O + Zn(C2H3O2)2*2H2O = Zn3(PO4)2*4H2O + NaC2H3O2 + H2O2Na3PO4*12H2O + 3Zn(C2H3O2)2*2H2O = Zn3(PO4)2*4H2O + 6NaC2H3O2 + 26H2O
N2 +O2 =N2O2N2 + O2 = 2N2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na3PO4 + Pb2(CO3)4 = Na2CO3 + 4Pb3(PO4)48Na3PO4 + 3Pb2(CO3)4 = 12Na2CO3 + 2Pb3(PO4)4
N2H4 = 2H2+ N2N2H4 = 2H2 + N2
NiBr2 = Ni + BrNiBr2 = Ni + 2Br
NO+H2O=HNO+NONO + 0H2O = 0HNO + NO
NaNO2+NaI+H2SO4 = NO+I2+Na2SO4+H2O2NaNO2 + 2NaI + 2H2SO4 = 2NO + I2 + 2Na2SO4 + 2H2O
NaNO2+NaI+H2SO4 = NO+I2+NaSO4+H2ONaNO2 + 0NaI + H2SO4 = NO + 0I2 + NaSO4 + H2O
NaNO2+NaI+H2SO4 = N+I2+NaSO4+H2O2NaNO2 + 2NaI + 4H2SO4 = 2N + I2 + 4NaSO4 + 4H2O
NaClO(aq)+Na2S2O3(aq)+NaOH(aq)=NaCl(aq)+Na2SO4(aq)+H2O(l)4NaClO(aq) + Na2S2O3(aq) + 2NaOH(aq) = 4NaCl(aq) + 2Na2SO4(aq) + H2O(l)
NaClO(aq)+Na2S2O3(aq)+NaOH(aq)=NaCl(aq)+Na2SO4(aq)+H2O(l)4NaClO(aq) + Na2S2O3(aq) + 2NaOH(aq) = 4NaCl(aq) + 2Na2SO4(aq) + H2O(l)
NaCl+H2SO4+MnO2 = NaHSO4+MnSO4+H2O+Cl22NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
Na2S + Hg(NO3)2 = HgS + NaNO3Na2S + Hg(NO3)2 = HgS + 2NaNO3
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NaCl + AgNO3 = AgCl + NaNO3NaCl + AgNO3 = AgCl + NaNO3
N2H4(g) + N2O4(g) = N2(g) + H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
N2H4(g) + N2O4(g) = N2(g) + H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
N2H4(g) + N2O4(g) = N2(g) + H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NaN3(s)=Na(s) +N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NaBr(aq) +H3PO4(aq)=Na3PO4(aq) + HBr(aq)3NaBr(aq) + H3PO4(aq) = Na3PO4(aq) + 3HBr(aq)
Na+H2O=NaO+H2Na + H2O = NaO + H2
Na+H2O=NaO+H2Na + H2O = NaO + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2O5(g) + 5H2(g) = 5H2O(g) + N2(g) N2O5(g) + 5H2(g) = 5H2O(g) + N2(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH + AgNO3 = NaNO3 + AgOHNaOH + AgNO3 = NaNO3 + AgOH
NaOH + AgNO3 = NaNO3 + AgOHNaOH + AgNO3 = NaNO3 + AgOH
NaHCO3 + HCl = NaCl + CO2 + H2ONaHCO3 + HCl = NaCl + CO2 + H2O
NaHCO3 + HCl = NaCl + 3CO2 + H2ONaHCO3 + HCl = NaCl + CO2 + H2O
N2 +H2 =NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NH4OH + H3PO4 = NH4 + PO4 + H2O3NH4OH + H3PO4 = 3NH4 + PO4 + 3H2O
Na2CO3 + C + N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NH4OH + H3PO4 = NH4 + (PO4) 3 + H2O9NH4OH + 3H3PO4 = 9NH4 + (PO4)3 + 9H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NO3 + H2SO4 + Cu = CuSO4 +NO2 + H20NO3 + H2SO4 + Cu = CuSO4 + 0NO2 + H2
NO3 + H2SO4 + Cu = CuSO4 +NO2 + H20NO3 + H2SO4 + Cu = CuSO4 + 0NO2 + H2
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na3PO4 + Ba(NO3)2 = Ba3(PO4)2 + NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO3- + H2SO4 + Fe2+ = Fe3+ +NO + SO4 + H2ONO3- + 2H2SO4 + 3Fe2+ = 2Fe3+ + NO + 2SO4 + 2H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
Na3PO4 + Ba(NO3)2 = Ba3(PO4)2 + NaNO32Na3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6NaNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NaHCO3 + C6H8O7 + HCl = CO2 + H2O + NaClNaHCO3 + 0C6H8O7 + HCl = CO2 + H2O + NaCl
NaCl+H2O=NaOH+H2=Cl22NaCl + 2H2O = 2NaOH + H2 + Cl2
Na2SO4 + Sr(OH)2 = SrSO4 + NaOHNa2SO4 + Sr(OH)2 = SrSO4 + 2NaOH
NH4+ + NaOH = Na+ + NH3 + H2ONH4+ + NaOH = Na+ + NH3 + H2O
NH4+ + NaOH = Na+ + NH3 + H2ONH4+ + NaOH = Na+ + NH3 + H2O
NH3(g) + H2S(g) = (NH4)2S(s)2NH3(g) + H2S(g) = (NH4)2S(s)
NaOH + H3PO4 = Na2HPO4 + H2O2NaOH + H3PO4 = Na2HPO4 + 2H2O
Na + O2 = Na2O22Na + O2 = Na2O2
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaOH + CuSO4 = Na2SO4 + Cu(OH)22NaOH + CuSO4 = Na2SO4 + Cu(OH)2
Na2CO3 (aq) + CaCl2 (aq) = NaCl (aq) + CaCO3 (s)Na2CO3(aq) + CaCl2(aq) = 2NaCl(aq) + CaCO3(s)
Na+H2O =NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O =NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O =NaOH+H22Na + 2H2O = 2NaOH + H2
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NaOH+BaCl2=Ba(OH)2+NaCl2NaOH + BaCl2 = Ba(OH)2 + 2NaCl
NaCl+KBr = KCl + NaBrNaCl + KBr = KCl + NaBr
NH4OH+H3PO4=(NH4)3PO4+H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na(s) + Pb(ClO3)2 (aq) = Na(ClO3)2 (s) + Pb(aq)Na(s) + Pb(ClO3)2(aq) = Na(ClO3)2(s) + Pb(aq)
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3(aq)+CoCl2(aq) =2NaCl(aq) + CoCO3(s)Na2CO3(aq) + CoCl2(aq) = 2NaCl(aq) + CoCO3(s)
NaCNO+NaOCl+H2O=NaCl+N2+NaHCO32NaCNO + 3NaOCl + H2O = 3NaCl + N2 + 2NaHCO3
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3(g) + O2(g)= N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NO(g) + H2O(g) = NH3(g) + O2(g)4NO(g) + 6H2O(g) = 4NH3(g) + 5O2(g)
NH3(g) + O2(g) = N2(g) + H2O (g) 4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NaHCO3=Na2CO3 + CO2 +H2O 2NaHCO3 = Na2CO3 + CO2 + H2O
Na (s) + MgF2 = 2NaF (s) + Mg (s)2Na(s) + MgF2 = 2NaF(s) + Mg(s)
N2 +H2=NH3 N2 + 3H2 = 2NH3
Na (s) + O2 (g) = Na2O4Na(s) + O2(g) = 2Na2O
N2(g) + O2(g) = NO2(g)N2(g) + 2O2(g) = 2NO2(g)
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NH3+Cl2 = NH4Cl + NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
NH3 + O2= N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2(g)+ H2(g)=NH2(g)N2(g) + 2H2(g) = 2NH2(g)
N2(g)+ H2(g)=NH2(g)N2(g) + 2H2(g) = 2NH2(g)
NH4OH + H3PO4= NH4+ PO4+ H2O3NH4OH + H3PO4 = 3NH4 + PO4 + 3H2O
NH4C2H3O2 + Fe2(SO4)3 = Fe2(C2H3O2) +NH4(SO4)3NH4C2H3O2 + Fe2(SO4)3 = Fe2(C2H3O2) + NH4(SO4)3
NH4C2H3O2 + Fe2(SO4)3 = Fe2(C2H3O2) +NH4(SO4)3NH4C2H3O2 + Fe2(SO4)3 = Fe2(C2H3O2) + NH4(SO4)3
N2 + O2 = 2 NON2 + O2 = 2NO
Na+MgF2=NaF+Mg 2Na + MgF2 = 2NaF + Mg
NH4OH = NH3+ HOHNH4OH = NH3 + HOH
NH4NO3 =N2O+H2O NH4NO3 = N2O + 2H2O
NH4NO3 =N2O+H2O NH4NO3 = N2O + 2H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+Cu2O=N2+Cu2+H2O2NH3 + 3Cu2O = N2 + 3Cu2 + 3H2O
NO + NaOH = NaNO2 + H2O + N2O4NO + 2NaOH = 2NaNO2 + H2O + N2O
NaCl(s)+ H2SO4(s)+ MnO2(s)=Na2SO4(s)+ MnCl2(s)+ H2O(g)+ Cl2(g) 4NaCl(s) + 2H2SO4(s) + MnO2(s) = 2Na2SO4(s) + MnCl2(s) + 2H2O(g) + Cl2(g)
NaOH(aq) + Fe(NO3)3(aq)= Fe(OH)3(s) + NaNO3(aq)3NaOH(aq) + Fe(NO3)3(aq) = Fe(OH)3(s) + 3NaNO3(aq)
NaN3=Na+N22NaN3 = 2Na + 3N2
Na+Fe2O3=Na2O+Fe6Na + Fe2O3 = 3Na2O + 2Fe
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
N2+F2=NF3N2 + 3F2 = 2NF3
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+Cl=NaClNa + Cl = NaCl
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3(g) + O2(g) = N2(g) + H2O(l)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(l)
NaN3 + HNO3 = N2 + HNO2 + NaOHNaN3 - HNO3 = 2N2 - 2HNO2 + NaOH
NaN3+HNO3=N2+HNO2+NaOHNaN3 - HNO3 = 2N2 - 2HNO2 + NaOH
Na2Pb(OH)4 +H2O = PbO2 + NaOH +H2O0Na2Pb(OH)4 + H2O = 0PbO2 + 0NaOH + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3 + Ca(OH)2=Ca(NO3)2 + NH3 + H2O2NH4NO3 + Ca(OH)2 = Ca(NO3)2 + 2NH3 + 2H2O
Na2S + H2O = NaOH + NaHSNa2S + H2O = NaOH + NaHS
Na3Cr(OH)6 + H2O2 = Na2Cr2O4 + NaOH + H2O2Na3Cr(OH)6 + 0H2O2 = Na2Cr2O4 + 4NaOH + 4H2O
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na3Cr(OH)6 + H2O2 = Na2CrO4 + NaOH + H2O2Na3Cr(OH)6 + 3H2O2 = 2Na2CrO4 + 2NaOH + 8H2O
Na3Cr(OH)6 + H2O2 = Na2CrO4 + NaOH + H2O2Na3Cr(OH)6 + 3H2O2 = 2Na2CrO4 + 2NaOH + 8H2O
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
Na2S2O3 + H2SO4 = Na2SO4 + H2S2O3Na2S2O3 + H2SO4 = Na2SO4 + H2S2O3
NaI + MnO2 + H2SO4 = I2 + MnSO4 + Na2SO4 + H2O2NaI + MnO2 + 2H2SO4 = I2 + MnSO4 + Na2SO4 + 2H2O
Na2S2O3+Fe(NO3)3=Fe(S2O3)2+Na+NO32Na2S2O3 + Fe(NO3)3 = Fe(S2O3)2 + 4Na + 3NO3
Na2S2O3+Fe(NO3)3=Fe(S2O3)2+Na+NO32Na2S2O3 + Fe(NO3)3 = Fe(S2O3)2 + 4Na + 3NO3
NaNO2 + K2Cr2O7 + H2SO4 = Cr2(SO4)3 + K2SO4 + Na2SO4 + NO2 + H2O6NaNO2 + K2Cr2O7 + 7H2SO4 = Cr2(SO4)3 + K2SO4 + 3Na2SO4 + 6NO2 + 7H2O
NaHCO3+HCl=H2O+CO2+NaClNaHCO3 + HCl = H2O + CO2 + NaCl
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NO2 + O2 = N2O54NO2 + O2 = 2N2O5
NaSO4+CaCl=NaCl+CaSO4NaSO4 + CaCl = NaCl + CaSO4
Na2S+Fe(NO3)2=NaNO3+FeSNa2S + Fe(NO3)2 = 2NaNO3 + FeS
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaI + MnO2 + H2SO4 = I2 + MnSO4 + Na2SO4 + H2O2NaI + MnO2 + 2H2SO4 = I2 + MnSO4 + Na2SO4 + 2H2O
Na2CO3+Cu(NO3)2=Na2(NO3)2+CuCO3Na2CO3 + Cu(NO3)2 = Na2(NO3)2 + CuCO3
Na+H2O=NaOH+HNa + H2O = NaOH + H
Na2CO3 + Cu(NO3)2 = Na2(NO3)2 + Cu CO3Na2CO3 + Cu(NO3)2 = Na2(NO3)2 + CuCO3
Na2CO3 + CuSO4 = Na2SO4 + CuCO3Na2CO3 + CuSO4 = Na2SO4 + CuCO3
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3 + CaCl2 + H20 = CO2 + CaCO3 + NaCl + H2O2NaHCO3 + CaCl2 + 0H20 = CO2 + CaCO3 + 2NaCl + H2O
NaOH + Ca(OH)2 + C + ClO2 = NaClO2 + CaCO3 + H2O4NaOH + Ca(OH)2 + C + 4ClO2 = 4NaClO2 + CaCO3 + 3H2O
Na2O2+2H2O=2NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
Na2O2+2H2O=2NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2(g)+O2(g)+H2O(l)=HNO3(aq)2N2(g) + 5O2(g) + 2H2O(l) = 4HNO3(aq)
NaCl(s)+ H2SO4(s)+ MnO2(s)=Na2SO4(s)+ MnCl2(s)+ H2O(g)+ Cl2(g) 4NaCl(s) + 2H2SO4(s) + MnO2(s) = 2Na2SO4(s) + MnCl2(s) + 2H2O(g) + Cl2(g)
Na3PO4(aq)+MgCl2(aq)=Mg3(PO4)2(s)+NaCl2Na3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6NaCl
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2(g)+O2=2NO(g)N2(g) + O2 = 2NO(g)
N2(g)+O2=2NON2(g) + O2 = 2NO
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g) Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
NaCl (aq) +AgC2H3O2 (aq) = NaC2H3O2 (aq) + AgCl (s)NaCl(aq) + AgC2H3O2(aq) = NaC2H3O2(aq) + AgCl(s)
Ni(NO3)2 (aq) +NaOH (aq) = Ni(OH)2 (s) +NaNO3 (aq)Ni(NO3)2(aq) + 2NaOH(aq) = Ni(OH)2(s) + 2NaNO3(aq)
Ni(NO3)2 (aq) +NaOH (aq) = Ni(OH)2 (s) +NaNO3 (aq)Ni(NO3)2(aq) + 2NaOH(aq) = Ni(OH)2(s) + 2NaNO3(aq)
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl (aq) + AgC2H3O2 (aq) = NaC2H3O2 (aq) + AgCl (s)NaCl(aq) + AgC2H3O2(aq) = NaC2H3O2(aq) + AgCl(s)
NO3- + CH2O + H3O+ = NH4+ + CO2 + H2ONO3- + 2CH2O + 2H3O+ = NH4+ + 2CO2 + 3H2O
NO3- +CH2O+H3O+ = NH4+ +CO2 +H2ONO3- + 2CH2O + 2H3O+ = NH4+ + 2CO2 + 3H2O
Ni(NO3)2 (aq) + NaOH (aq) = Ni(OH)2 (s) + NaNO3 (aq)Ni(NO3)2(aq) + 2NaOH(aq) = Ni(OH)2(s) + 2NaNO3(aq)
N2+3H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2+H2=NH3N2 + 3H2 = 2NH3
NO+O2= NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
N2H4(g) + N2O4(g) = H2O(g) + N2(g)2N2H4(g) + N2O4(g) = 4H2O(g) + 3N2(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO+O2=NO22NO + O2 = 2NO2
N2 + F2 = NF3N2 + 3F2 = 2NF3
N2O5 + 2 H2O = HNO3N2O5 + H2O = 2HNO3
NaCl + SO2 + H2O + O2= Na2SO4 + HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
NaHCO3+C6H8O7+HCl=CO2+H2O+NaClNaHCO3 + 0C6H8O7 + HCl = CO2 + H2O + NaCl
NaClO + HBr = HClO + NaBrNaClO + HBr = HClO + NaBr
NaOH=Na2O+H2O2NaOH = Na2O + H2O
NaOH+CO2=NaHCO3NaOH + CO2 = NaHCO3
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaHCO3=Na2O+CO2+H2O2NaHCO3 = Na2O + 2CO2 + H2O
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NO3- +CH2O+H3O+=NH4+ +CO2 +H2ONO3- + 2CH2O + 2H3O+ = NH4+ + 2CO2 + 3H2O
Na2CO3+HCl=NaCl+NaHCO3Na2CO3 + HCl = NaCl + NaHCO3
NO+O2 = NO22NO + O2 = 2NO2
N2+O2 = NON2 + O2 = 2NO
NaBr + Ca3(PO4)2 = CaBr2 + Na3PO4 6NaBr + Ca3(PO4)2 = 3CaBr2 + 2Na3PO4
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2S + HCl = NaCl + H2SNa2S + 2HCl = 2NaCl + H2S
NO4+H2O=HNO3+NO-1NO4 - H2O = -2HNO3 + NO
NaCl = Na + Cl22NaCl = 2Na + Cl2
NH3+O2=N2O+H2020NH3 + 5O2 = 10N2O + 3H20
Na+Cl=NaClNa + Cl = NaCl
Na3PO4(aq)+MgSO4(aq)=Na2SO4(aq)+Mg3(PO4)2(s)2Na3PO4(aq) + 3MgSO4(aq) = 3Na2SO4(aq) + Mg3(PO4)2(s)
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na2S2O3+I2=NaI+Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NBr3+NaOH=N2+NaBr+HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2S + 2AgClO3 = 2NaClO3 + Ag2SNa2S + 2AgClO3 = 2NaClO3 + Ag2S
Na2S + 2AgClO3 = 2NaClO3 + Ag2SNa2S + 2AgClO3 = 2NaClO3 + Ag2S
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaHCO3 = Na2O + CO2 + H2O2NaHCO3 = Na2O + 2CO2 + H2O
NaHCO3 = Na2CO3 + CO2 + H2O 2NaHCO3 = Na2CO3 + CO2 + H2O
NaHCO3 = Na + H2 + C + O22NaHCO3 = 2Na + H2 + 2C + 3O2
NH3 + CO2 = CO(NH2)2 +H2O2NH3 + CO2 = CO(NH2)2 + H2O
NaCl=Na+Cl22NaCl = 2Na + Cl2
NO + CO = N2 + CO22NO + 2CO = N2 + 2CO2
Na+H2O =NaOH+H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2 = NaH2Na + H2 = 2NaH
NaHCO3==Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na + SO4 = NaSO4Na + SO4 = NaSO4
Na2S4O6 + HCl + Al = NaCl+ Al2Cl6 + H2O + H2SNa2S4O6 + 20HCl + 6Al = 2NaCl + 3Al2Cl6 + 6H2O + 4H2S
NaCl + Ba3(PO4)2 = Na3PO4 + BaCl26NaCl + Ba3(PO4)2 = 2Na3PO4 + 3BaCl2
Na3PO4+CaCl2=Ca3(PO4)2+NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NiCl2+O=NiO+Cl2O5NiCl2 + 6O = NiO + Cl2O5
Na+MgI2=NaI+Mg2Na + MgI2 = 2NaI + Mg
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NH3=N+H22NH3 = 2N + 3H2
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na3PO4+Ca(C2H302)2=Na6(C2H302)6+Ca3(PO4)22Na3PO4 + 3Ca(C2H302)2 = Na6(C2H302)6 + Ca3(PO4)2
Na3PO4+Ca(C2H302)2=Na6(C2H302)6+Ca3(PO4)22Na3PO4 + 3Ca(C2H302)2 = Na6(C2H302)6 + Ca3(PO4)2
NaMnO4 +NH3 = NaNO3 + MnO2 + NaOH + H2O8NaMnO4 + 3NH3 = 3NaNO3 + 8MnO2 + 5NaOH + 2H2O
NaCl + H2SO4 + MnO2 = NaHSO4 + MnSO4 + H2O + Cl2 2NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
Na2S4O6 + HCl + Al = NaCl + Al2Cl6 + H2O + H2SNa2S4O6 + 20HCl + 6Al = 2NaCl + 3Al2Cl6 + 6H2O + 4H2S
N2+ O2=N2O2N2 + O2 = 2N2O
N2+ O2=N2O2N2 + O2 = 2N2O
N2+ O2=N2O2N2 + O2 = 2N2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2O + H2O= NaOHNa2O + H2O = 2NaOH
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na3PO4*12H2O+Zn(C2H3O2)2*2H2O=Zn3(PO4)2*4H2O+NaC2H3O2+H2O2Na3PO4*12H2O + 3Zn(C2H3O2)2*2H2O = Zn3(PO4)2*4H2O + 6NaC2H3O2 + 26H2O
NH3 +O2=NO2+ H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NH2OH+O2=NH2+H2O4NH2OH - O2 = 4NH2 + 2H2O
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
N2+O2=NON2 + O2 = 2NO
NaOH + H2 = NaH + OH2NaOH + H2 = 2NaH + 2OH
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaCl+Fe2O3=FeCl3+Na2O6NaCl + Fe2O3 = 2FeCl3 + 3Na2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
Na2CO3+AgNO3=Ag2CO3+NaNO3Na2CO3 + 2AgNO3 = Ag2CO3 + 2NaNO3
NA + H2O = H2 + NAOH2NA + 2H2O = H2 + 2NAOH
NaHCO3 + HCL= NaCL+ CO2+H2ONaHCO3 + HCL = NaCL + CO2 + H2O
Na3PO4(aq)+Ca(OH)2(aq)=Ca3(PO4)2(s)+NaOH(aq)2Na3PO4(aq) + 3Ca(OH)2(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
NaOH + H2CO3 = Na2CO3 + H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+O2=Na2O4Na + O2 = 2Na2O
Na2S4O6 + HCl + Al = NaCl + Al2Cl6 + H2O + H2SNa2S4O6 + 20HCl + 6Al = 2NaCl + 3Al2Cl6 + 6H2O + 4H2S
NH4OH + CaCl2 = NH4Cl + Ca(OH)22NH4OH + CaCl2 = 2NH4Cl + Ca(OH)2
Na2CO3+H2SO4=Na2SO4+CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
NH4OH + CaCl2 = NH4Cl + Ca(OH)22NH4OH + CaCl2 = 2NH4Cl + Ca(OH)2
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na2CO3+HNO3=NaNO3+H2O+CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
NO + O2 = NO22NO + O2 = 2NO2
NO3H4N=N2O+H2ONO3H4N = N2O + 2H2O
NaHCO3+HC2H3O2=NaC2H3O2+HHCO3NaHCO3 + HC2H3O2 = NaC2H3O2 + HHCO3
NaCl + H2SO4 + MnO2 = NaHSO4 + MnSO4 + H2O + Cl2 2NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH4OH + Fe2S3 = (NH4)2S + Fe(OH)36NH4OH + Fe2S3 = 3(NH4)2S + 2Fe(OH)3
NO3- + CH2O + H3O+ = NH4+ + CO2 + H2ONO3- + 2CH2O + 2H3O+ = NH4+ + 2CO2 + 3H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaI+H2SO4=H2S+I2+Na2SO4+H2O8NaI + 5H2SO4 = H2S + 4I2 + 4Na2SO4 + 4H2O
NaBr+H2SO4=SO2+Br2+Na2SO4+H2O2NaBr + 2H2SO4 = SO2 + Br2 + Na2SO4 + 2H2O
N2H3 + HO2 = H2O + HNO33N2H3 + 13HO2 = 8H2O + 6HNO3
N2H2 + HO2 = H2O + HNO3N2H2 + 4HO2 = 2H2O + 2HNO3
N2 +O2 =NO2 N2 + 2O2 = 2NO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni (ClO3)2=NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
NH3 +O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 +F2=N2F4 +HF2NH3 + 5F2 = N2F4 + 6HF
NaNO3 + FeCl3 = NaCl3 + FeNO3NaNO3 + FeCl3 = NaCl3 + FeNO3
NaCl + H2SO4 + MnO2 = NaHSO4 + MnSO4 + H2O + Cl22NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NaCl + H2SO4 + MnO2 = NaHSO4 + MnSO4 + H2O + Cl22NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaCl + H2SO4 + MnO2 = NaHSO4 + MnSO4 + H2O + Cl22NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NO2(g)+O2(g)=N2O54NO2(g) + O2(g) = 2N2O5
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NaOH + HCl = H2O + NaClNaOH + HCl = H2O + NaCl
NH4OH + H3PO4 = (NH4)3PO4 + HOH3NH4OH + H3PO4 = (NH4)3PO4 + 3HOH
NH4NO3 + CaCl2 = NH4Cl + Ca(NO3)22NH4NO3 + CaCl2 = 2NH4Cl + Ca(NO3)2
NO2 + NaSH + H2O = N2 + S + NaOH2NO2 + 4NaSH + 0H2O = N2 + 4S + 4NaOH
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
N2+H2=NH3N2 + 3H2 = 2NH3
NO2 + NaSH + NaOH = NaNO2 + Na2S2O3 + H2O8NO2 + 2NaSH + 8NaOH = 8NaNO2 + Na2S2O3 + 5H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Ni + (ClO3)2 = NiCl2 + O2Ni + (ClO3)2 = NiCl2 + 3O2
Na2 O+ H2O= Na + OHNa2O + H2O = 2Na + 2OH
Na+O2= Na2 O4Na + O2 = 2Na2O
NaCl(aq) + AgNO3(aq) = AgCl(s) + NaNO3(aq)NaCl(aq) + AgNO3(aq) = AgCl(s) + NaNO3(aq)
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na+O2=Na2O4Na + O2 = 2Na2O
NaOH+NaNO2+Al+H2O=NH3+NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
Na2S + 2HCl = 2NaCl + H2SNa2S + 2HCl = 2NaCl + H2S
Na2S + 2HCl = 2NaCl + H2SNa2S + 2HCl = 2NaCl + H2S
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH4NO3+H2O=NH4OH+HNO3NH4NO3 + H2O = NH4OH + HNO3
Na+H2O=NaOH+HNa + H2O = NaOH + H
Ni+CO3=NiCO3Ni + CO3 = NiCO3
NaCl = Cl2 + Na2NaCl = Cl2 + 2Na
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.