Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NiCO3+HNO3=Ni(NO3)2+CO2+H2ONiCO3 + 2HNO3 = Ni(NO3)2 + CO2 + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Ni + FeCl2 = NiCl2 + FeNi + FeCl2 = NiCl2 + Fe
NaCu(NO3)2 + NaNO2 + NaOH= CuOH + NaNO20NaCu(NO3)2 + NaNO2 + 0NaOH = 0CuOH + NaNO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH + CuO = Cu + N2 + H2O2NH + CuO = Cu + N2 + H2O
NH + CuO = Cu + N2 + H2O2NH + CuO = Cu + N2 + H2O
NaOH+(NH4)2SO4=Na2SO4+NH4OH2NaOH + (NH4)2SO4 = Na2SO4 + 2NH4OH
NiCl2 + KNO3 = Ni(NO3) + KCl2NiCl2 + KNO3 = Ni(NO3) + KCl2
NaL + Pb(SO4)2 = PbL4 + Na2SO44NaL + Pb(SO4)2 = PbL4 + 2Na2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO2 = H2O + N2NH4NO2 = 2H2O + N2
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
Na2SO4 + 4C = Na2S + 4CO2Na2SO4 + 2C = Na2S + 2CO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+H6=6H(N)26N2 + H6 = 6H(N)2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NH4NO3(aq)+NiCl2(aq)=NiNO3+Cl2NH4NH4NO3(aq) + NiCl2(aq) = NiNO3 + Cl2NH4
NH4Cl+Ba(OH)2=H2O+NH3+BaCl22NH4Cl + Ba(OH)2 = 2H2O + 2NH3 + BaCl2
NaCl (aq) + AgNO3 (aq)=NaNO3 (aq) + AgCl (s) NaCl(aq) + AgNO3(aq) = NaNO3(aq) + AgCl(s)
NaHCO3 = Na2CO3 + H2O +CO2 2NaHCO3 = Na2CO3 + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na2S + HCl = NaCl + H2SNa2S + 2HCl = 2NaCl + H2S
NaCl = Na + Cl22NaCl = 2Na + Cl2
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na3PO4+AgNO3= NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NO + CH4 = HCN + H2O + H22NO + 2CH4 = 2HCN + 2H2O + H2
Na+HOH=NaOH+H22Na + 2HOH = 2NaOH + H2
NH3+ O2 +CH4 = HCN+ H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NH3 + O2 = N2O + H2O2NH3 + 2O2 = N2O + 3H2O
Na + H2O= NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + NO =N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 (s) + HCl (aq) = NaCl (aq) + H2O (l) + CO2 (g)Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NaF + Ca(CHO) =CaF + Na(CHO)NaF + Ca(CHO) = CaF + Na(CHO)
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NH4 + O2 = NO + H2010NH4 + 5O2 = 10NO + 2H20
NH4 + O2 = NO + H2010NH4 + 5O2 = 10NO + 2H20
NH4 + 5O2 = NO + H2010NH4 + 5O2 = 10NO + 2H20
Ni(OH)2+H3O=H2O+NiNi(OH)2 + 2H3O = 4H2O + Ni
NaCH3-COO + Na(OH) + Ca( OH)2=CH4 + Na2CO3 + CaO + H2O0NaCH3-COO + 0Na(OH) + Ca(OH)2 = 0CH4 + 0Na2CO3 + CaO + H2O
NaCH3-COO + Na(OH) + Ca( OH)2=CH4 + Na2CO3 + CaO + H2O0NaCH3-COO + 0Na(OH) + Ca(OH)2 = 0CH4 + 0Na2CO3 + CaO + H2O
NaCH3-COO + Na(OH) + Ca( OH)2=CH4 + Na2 CO3 + CaO + H2O0NaCH3-COO + 0Na(OH) + Ca(OH)2 = 0CH4 + 0Na2CO3 + CaO + H2O
NaHCO3(aq)+H3C6H5O7(aq)=H2O(l)+CO2(g)+Na3C6H5O73NaHCO3(aq) + H3C6H5O7(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7
NaHCO2(aq)+H3C6H5O7(aq)=H2O(aq)+CO2(aq)+Na3C6H5O79NaHCO2(aq) + 2H3C6H5O7(aq) = 5H2O(aq) + 3CO2(aq) + 3Na3C6H5O7
NaHCO2(aq)+H3C6H5O7(aq)=H2O+CO2+Na3C6H5O79NaHCO2(aq) + 2H3C6H5O7(aq) = 5H2O + 3CO2 + 3Na3C6H5O7
NaBr + Cl2 =NaCl +Br22NaBr + Cl2 = 2NaCl + Br2
NO2- + H+ + I- = I2 + N2 + H2O2NO2- + 8H+ + 6I- = 3I2 + N2 + 4H2O
NaI + Cl2 = NaCl + I22NaI + Cl2 = 2NaCl + I2
NaNO3 + H2SO4 = Na2SO4 + HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na2CO3+Pb(NO3)2=PbCO3+Na2(NO3)2Na2CO3 + Pb(NO3)2 = PbCO3 + Na2(NO3)2
Na2CO3+Pb(NO3)2=PbCO3+Na2(NO3)2Na2CO3 + Pb(NO3)2 = PbCO3 + Na2(NO3)2
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=Na(OH)+H22Na + 2H2O = 2Na(OH) + H2
Na2S+AgNO3=Na2NO3+AgSNa2S + AgNO3 = Na2NO3 + AgS
Na2CO3+AgNO3=Na2NO3+AgCO3Na2CO3 + AgNO3 = Na2NO3 + AgCO3
NH3= N2+ H22NH3 = N2 + 3H2
NH3+ Na=H2+ NaNH22NH3 + 2Na = H2 + 2NaNH2
NiCl2= Ni+ Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NaCO3 + H2SO4 = NaSO4 + H2O + CO2NaCO3 + H2SO4 = NaSO4 + H2O + CO2
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + O = Na2O2Na + O = Na2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3SO4 + MgCl2 = NH3Cl2 + MgSO4NH3SO4 + MgCl2 = NH3Cl2 + MgSO4
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NH3 + O2 = HNO3 + H2NH3 + 3O2 = 2HNO3 + 4H
NaHCO3 = NaCO3 + CO2 + H2020NaHCO3 = 20NaCO3 + 0CO2 + H20
NO + H2 = H2O +N22NO + 2H2 = 2H2O + N2
NaCl + SO2 + H2O + O2 = HCl + Na2SO44NaCl + 2SO2 + 2H2O + O2 = 4HCl + 2Na2SO4
NaBr + AgNO3 = NaNO3 + AgBrNaBr + AgNO3 = NaNO3 + AgBr
NaCl + Pb(NO3)2 = NaNO3 + PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
N2(g) + H2(g) =NH3N2(g) + 3H2(g) = 2NH3
NH4NO3(s) =N2O(g) + H2O(l) NH4NO3(s) = N2O(g) + 2H2O(l)
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Na2SO4 + 2 NH4NO3 = (NH4)2SO4 + 2 NaNO3Na2SO4 + 2NH4NO3 = (NH4)2SO4 + 2NaNO3
NiSO4 + AgNO3 = Ni(NO3)2 + Ag2SO4NiSO4 + 2AgNO3 = Ni(NO3)2 + Ag2SO4
Na + O2 = Na2O22Na + O2 = Na2O2
Na(s) + O2(g) = Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaOH + H3PO4= H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NH4+HNO3=NH4NO3+H2O8NH4 + 10HNO3 = 9NH4NO3 + 3H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2H4 + H2O2 = N2 +H2ON2H4 + 2H2O2 = N2 + 4H2O
N2+F2=NF3N2 + 3F2 = 2NF3
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH3 + Cl2 = N2 + HCl2NH3 + 3Cl2 = N2 + 6HCl
Na + H2SO4 = Na2SO4 + SO2 + H2O2Na + 2H2SO4 = Na2SO4 + SO2 + 2H2O
Na2CO3+H2SO4=Na2SO4+H2O+CO2Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
NaOH+K3PO4=Na3PO4+KOH3NaOH + K3PO4 = Na3PO4 + 3KOH
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH+ H22Na + 2H2O = 2NaOH + H2
Na2SO3 + KMnO4 + H2O = MnO2 + Na2SO4 + KOH3Na2SO3 + 2KMnO4 + H2O = 2MnO2 + 3Na2SO4 + 2KOH
NaOH + O2=Na2O2 + H2O4NaOH + O2 = 2Na2O2 + 2H2O
NaOH + O2=NaO + H2O4NaOH + O2 = 4NaO + 2H2O
Na2SO3+Al+NaOH=Na2S+Na3AlO3+H2ONa2SO3 + 2Al + 6NaOH = Na2S + 2Na3AlO3 + 3H2O
NaHCO3 + H2O = H20 +OH- + Na+ + CO2NaHCO3 + 0H2O = 0H20 + OH- + Na+ + CO2
NaCl + H2SO4 + MnO2 = NaHSO4 + MnSO4 + H2O + Cl22NaCl + 3H2SO4 + MnO2 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NO2- + H+ = NO + NO3- + H2O3NO2- + 2H+ = 2NO + NO3- + H2O
N2O(g) + H2(g) = NH3(g) + H2O(g)N2O(g) + 4H2(g) = 2NH3(g) + H2O(g)
NO2- + H+ = NO + NO3- + H2O3NO2- + 2H+ = 2NO + NO3- + H2O
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2O + H2 = NH3 + H2ON2O + 4H2 = 2NH3 + H2O
NaI+Co(NO3)2=Na(NO3)+CoI22NaI + Co(NO3)2 = 2Na(NO3) + CoI2
NaI+Co(NO3)2=Na2(NO3)2+CoI22NaI + Co(NO3)2 = Na2(NO3)2 + CoI2
NaI+Co(NO3)2=NaNO3+CoI22NaI + Co(NO3)2 = 2NaNO3 + CoI2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
Na+H2PO4=NaPO4+H2Na + H2PO4 = NaPO4 + H2
Na+H2PO4=NaPO4+H2Na + H2PO4 = NaPO4 + H2
NaCl+Al(OH)3=NaOH+AlCl33NaCl + Al(OH)3 = 3NaOH + AlCl3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na2(S2O3) + HNO3 = NaNO3 + H2O + S + SO2Na2(S2O3) + 2HNO3 = 2NaNO3 + H2O + S + SO2
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2H4+O2=NO2+H2ON2H4 + 3O2 = 2NO2 + 2H2O
Na2CO3(aq) + H3C6H5O7(aq) = CO2 + H2O + NaHCO3Na2CO3(aq) + 0H3C6H5O7(aq) = -1CO2 - H2O + 2NaHCO3
NO2 (g) + H2O (l) = HNO (aq) + HNO2 (aq) 2NO2(g) + H2O(l) = -1HNO(aq) + 3HNO2(aq)
NO3- + C2O4-- + H+ = NO2 + CO2 + H2O2NO3- + C2O4-- + 4H+ = 2NO2 + 2CO2 + 2H2O
Na + H2 = NaH2Na + H2 = 2NaH
Na2 + H2 = NaHNa2 + H2 = 2NaH
Na2S+Hg(NO3)2=HgS+2NaNO3Na2S + Hg(NO3)2 = HgS + 2NaNO3
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
N2O + H2 = NH3 + H2ON2O + 4H2 = 2NH3 + H2O
NH4CN + Mg(HCO3)2 = NH4HCO3 + Mg(CN) 22NH4CN + Mg(HCO3)2 = 2NH4HCO3 + Mg(CN)2
Na3PO4 + Ba(NO3)2 = NaNO3 + Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
NO + CO = N + CO2NO + CO = N + CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CrO4+HCl= Na2Cr2O7+NaCl+H2O2Na2CrO4 + 2HCl = Na2Cr2O7 + 2NaCl + H2O
Na2Cr2O7+KCl= K2Cr2O7+NaClNa2Cr2O7 + 2KCl = K2Cr2O7 + 2NaCl
Na2CO3(aq)+CaCl2(aq)=NaCl(aq)+CaCO3(s)Na2CO3(aq) + CaCl2(aq) = 2NaCl(aq) + CaCO3(s)
Na2CO3(aq)+CaCl2(aq)=NaCl(aq)+CaCO3(aq)Na2CO3(aq) + CaCl2(aq) = 2NaCl(aq) + CaCO3(aq)
NaOH(aq)+H2SO4(aq)=Na2SO4(aq)+H2O2NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + 2H2O
N2O5 + 3H2O=HNO3N2O5 + H2O = 2HNO3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH(aq) + H3PO4(aq) = Na3PO4(aq) + H2O(l)3NaOH(aq) + H3PO4(aq) = Na3PO4(aq) + 3H2O(l)
Na2S2O3 + KMnO4 + H2O = Na2SO4 + K2SO4 + MnO2 + KOH3Na2S2O3 + 8KMnO4 + H2O = 3Na2SO4 + 3K2SO4 + 8MnO2 + 2KOH
N2O + H2 = NH3 + H2ON2O + 4H2 = 2NH3 + H2O
NH4NO3(aq)=N2O(g)+H2O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)
NH3(g)+HCl(g)=NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
NH3(g)+HCl(g)=NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
NaCl + Pb(NO3)2 = NaNO3 + PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaI + KOH = NaOH +KINaI + KOH = NaOH + KI
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO+H2=N2O+H2O2NO + H2 = N2O + H2O
NiBr2 + K2CO3 = KBr + Ni + CO3NiBr2 + K2CO3 = 2KBr + Ni + CO3
NH3(g)+NO(g)=N2(g)+H2O(g)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(g)
Na2Co2 +HCI = NaCI + H20 + Co210Na2Co2 + 20HCI = 20NaCI + H20 + 10Co2
Na2TeO3+NaI+HCI=NaCI+Te+H2O+I2Na2TeO3 + 4NaI + 6HCI = 6NaCI + Te + 3H2O + 2I2
NaIO3 + NaHSO3 = I2 + NaHSO4 + Na2SO4 + H2O2NaIO3 + 5NaHSO3 = I2 + 3NaHSO4 + 2Na2SO4 + H2O
N2+O2+H2=HNO3N2 + 3O2 + H2 = 2HNO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+ H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + H2SO4 + MnO2 = Na2SO4 + MnSO4 + H2O + Cl22NaCl + 2H2SO4 + MnO2 = Na2SO4 + MnSO4 + 2H2O + Cl2
Ni(NO3)2 + H2S = NiS + HNO3Ni(NO3)2 + H2S = NiS + 2HNO3
Na2SO2 + S = S2O3 + Na3Na2SO2 + S = 2S2O3 + 6Na
Na2SO2 + S = S2O3 + Na3Na2SO2 + S = 2S2O3 + 6Na
N2+O2=2NON2 + O2 = 2NO
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NaBr+Cl2=NaCl+Br2NaBr + Cl2 = 2NaCl + 2Br
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NaF + Sr(NO3)2 = Na(NO3)2 + SrFNaF + Sr(NO3)2 = Na(NO3)2 + SrF
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaCl+H2O=Na2O+HCl2NaCl + H2O = Na2O + 2HCl
NaCl+H2O=Na2O+HCl2NaCl + H2O = Na2O + 2HCl
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na3PO4+CaL2=Ca3(PO4)2+NaL2Na3PO4 + 3CaL2 = Ca3(PO4)2 + 6NaL
Na2S+MgI2=2NaI+MgSNa2S + MgI2 = 2NaI + MgS
N2(g) + H2(g) = NH3(g) N2(g) + 3H2(g) = 2NH3(g)
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NaOH+FeCl3=NaCl+Fe(OH)33NaOH + FeCl3 = 3NaCl + Fe(OH)3
NH4Cl+H3PO4=(NH4)3(PO4)+HCl3NH4Cl + H3PO4 = (NH4)3(PO4) + 3HCl
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Ni (NO3)2 + 6H2O= HNO3 + NiONi(NO3)2 + H2O = 2HNO3 + NiO
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+KNO3=Na2O+K2O+N210Na + 2KNO3 = 5Na2O + K2O + N2
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
Na+ + CO3- = NaCO3Na+ + CO3- = NaCO3
Na+ + Cl- = NaClNa+ + Cl- = NaCl
N2H4 + H2O2 = N2 + 4 H2ON2H4 + 2H2O2 = N2 + 4H2O
NaNO3 + PbO = Pb(NO3)2 + Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaN3 = Na + N22NaN3 = 2Na + 3N2
N2O5 + H2O= HNO3N2O5 + H2O = 2HNO3
NaF + Ca(NO3)2 = NaNO3 + CaF22NaF + Ca(NO3)2 = 2NaNO3 + CaF2
Na + HCl = NaCl + H2 2Na + 2HCl = 2NaCl + H2
Na2CO3(s)+HCl(l)=CO2(g)+H2O(l)+NaCl(aq)Na2CO3(s) + 2HCl(l) = CO2(g) + H2O(l) + 2NaCl(aq)
Na + O2 = Na2O4Na + O2 = 2Na2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Ni (NO3)2 + Na2CO3 = NiCO3 +2 NaNO3Ni(NO3)2 + Na2CO3 = NiCO3 + 2NaNO3
Na2S + CuSO4 = Na2SO4 + CuSNa2S + CuSO4 = Na2SO4 + CuS
Na2SO3 + Ba(C2H3O2)2 = NaC2H3O2 + BaSO3Na2SO3 + Ba(C2H3O2)2 = 2NaC2H3O2 + BaSO3
NaCl + KNO3 = KCl + NaNO3NaCl + KNO3 = KCl + NaNO3
NaCl + KNO3 = KCl + NaNO3NaCl + KNO3 = KCl + NaNO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH + MnO2 = Mn2O3 + NH3 + H2O-1NH + 2MnO2 = Mn2O3 - NH3 + H2O
NH + MnO2 = Mn2O3 + NH3 + H2O-1NH + 2MnO2 = Mn2O3 - NH3 + H2O
NH + MnO = Mn2O3 + NH3 + H2O-1NH - 2MnO = -1Mn2O3 - NH3 + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH4HCO3+H2SO4=(NH4)2SO4+H2O+CO22NH4HCO3 + H2SO4 = (NH4)2SO4 + 2H2O + 2CO2
NH4HCO3+H2SO4=(NH4)2SO4+H2O+CO22NH4HCO3 + H2SO4 = (NH4)2SO4 + 2H2O + 2CO2
NO + O2 = NO22NO + O2 = 2NO2
N2 + H2 =2 NH3N2 + 3H2 = 2NH3
Na HCO3(s) = Na + H + CO3NaHCO3(s) = Na + H + CO3
Na HCO3(s) = Na + H + CO3NaHCO3(s) = Na + H + CO3
Na2SO4 + BaCl2 = NaCl + BaSO4Na2SO4 + BaCl2 = 2NaCl + BaSO4
Na2Cr2O7 + 2H2SO4 = 2NaHSO4 + 2CrO3 +H2ONa2Cr2O7 + 2H2SO4 = 2NaHSO4 + 2CrO3 + H2O
Nd2O3+2NH4H2PO4+Al2O3=Nd2Al2P2O5+H2O+NH3+O2Nd2O3 + 2NH4H2PO4 + Al2O3 = Nd2Al2P2O5 + 3H2O + 2NH3 + 3O2
NaIO3 + Na2SO3 + NaHSO4 = I2 + NaSO4 + H2O2NaIO3 - 2Na2SO3 + 16NaHSO4 = I2 + 14NaSO4 + 8H2O
NaOH + H2O = NaO2 + H3NaOH + H2O = NaO2 + H3
NaOH + H2O = NaO2 + H3NaOH + H2O = NaO2 + H3
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na + O2 = NaO 2Na + O2 = 2NaO
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + HOH = NaOH + H22Na + 2HOH = 2NaOH + H2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
N2(g)+O2(g)=2NO(g)N2(g) + O2(g) = 2NO(g)
Na2CO3 + Al2Cl6 = Al2(CO3)3 + NaCl3Na2CO3 + Al2Cl6 = Al2(CO3)3 + 6NaCl
N2O5 = NO2 + O22N2O5 = 4NO2 + O2
NH3+O2=N2O3+H2O2NH3 + 3O2 = N2O3 + 3H2O
NaNO3+CuS = Na2S+Cu(NO3)22NaNO3 + CuS = Na2S + Cu(NO3)2
Na3PO4 + KOH = NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na3PO4 + KOH = NaOH + K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NAOH + SI + H2O = NASIO3 + H22NAOH + 2SI + 4H2O = 2NASIO3 + 5H2
Na2WO4*2H2O+HCl = H2WO4+H2O+NaClNa2WO4*2H2O + 2HCl = H2WO4 + 2H2O + 2NaCl
Na2CO3+AlCl3=NaCl+Al2(CO3)33Na2CO3 + 2AlCl3 = 6NaCl + Al2(CO3)3
Na2CO3+AlCl3=NaCl+Al2(CO3)33Na2CO3 + 2AlCl3 = 6NaCl + Al2(CO3)3
Na2CO3+H2O=NaOH+H2CO3Na2CO3 + 2H2O = 2NaOH + H2CO3
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NO3(g)+H2O(g)=HNO3(g)+HNO2(g)-2NO3(g) - H2O(g) = -3HNO3(g) + HNO2(g)
NaOH + H2SO4=Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NO3 + H2O = HNO3 + HNO2-2NO3 - H2O = -3HNO3 + HNO2
Na2CrO4 + Zn(NO3)2 = NaNO3 + Zn2(CrO4)22Na2CrO4 + 2Zn(NO3)2 = 4NaNO3 + Zn2(CrO4)2
Na2CrO4 + AgNO3 = NaNO3 + Ag2CrO4Na2CrO4 + 2AgNO3 = 2NaNO3 + Ag2CrO4
Na2CrO4 + Ba(NO3)2 = NaNO3 + Ba2(CrO4)22Na2CrO4 + 2Ba(NO3)2 = 4NaNO3 + Ba2(CrO4)2
Na2CrO4 + Co(NO3)2 = NaNO3 + Co2(CrO4)22Na2CrO4 + 2Co(NO3)2 = 4NaNO3 + Co2(CrO4)2
Na2CrO4 + AlCl3 = NaCl + Al2(CrO4)33Na2CrO4 + 2AlCl3 = 6NaCl + Al2(CrO4)3
Na2CrO4 + AlCl3 = NaCl + Al2(CrO4)33Na2CrO4 + 2AlCl3 = 6NaCl + Al2(CrO4)3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaCl+KNO3=KCl+NaNO3NaCl + KNO3 = KCl + NaNO3
NaCl+KNO3=KCl+NaNO3NaCl + KNO3 = KCl + NaNO3
NO3(g) + H2O(g) = HNO3(g) + HNO2(g)-2NO3(g) - H2O(g) = -3HNO3(g) + HNO2(g)
NO3(g) + H2O(g) = HNO3(g) + HNO2(g)-2NO3(g) - H2O(g) = -3HNO3(g) + HNO2(g)
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NO3 + H2O = HNO3 + HNO2-2NO3 - H2O = -3HNO3 + HNO2
NH3 + H2CO3 = (NH4)2CO3 2NH3 + H2CO3 = (NH4)2CO3
NO3+H2O=HNO3+HNO2-2NO3 - H2O = -3HNO3 + HNO2
NO3 + H2O = HNO3 + HNO2-2NO3 - H2O = -3HNO3 + HNO2
NiSO4+K3PO4=NiPO4+K3SO4NiSO4 + K3PO4 = NiPO4 + K3SO4
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2+H2=NH3N2 + 3H2 = 2NH3
NaOCl + 2 HCl+ 2 Fe(NH4)2(SO4)2= 2 NH4Cl(aq) + (NH4)2SO4(aq) + Fe2(SO4)3(aq) + NaCl(aq) + H2O(l) NaOCl + 2HCl + 2Fe(NH4)2(SO4)2 = 2NH4Cl(aq) + (NH4)2SO4(aq) + Fe2(SO4)3(aq) + NaCl(aq) + H2O(l)
N2H3CH3 + O2 = N2 + CO2 + H2O2N2H3CH3 + 5O2 = 2N2 + 2CO2 + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+H2CO3=(NH4)2CO32NH3 + H2CO3 = (NH4)2CO3
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2S2O3 + KMnO4 + H2O = NaSO4 + K2SO4 +MnO2 +KOH 3Na2S2O3 + 10KMnO4 + 5H2O = 6NaSO4 + 0K2SO4 + 10MnO2 + 10KOH
Na2S2O3 + KMnO4 + H2O = NaSO4 + K2SO4 +MnO2 +KOH 3Na2S2O3 + 10KMnO4 + 5H2O = 6NaSO4 + 0K2SO4 + 10MnO2 + 10KOH
Na + Fe2O3 = Na2O + Fe6Na + Fe2O3 = 3Na2O + 2Fe
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NO3 (g) + H2O (g) = HNO3 (g) + HNO2 (g)-2NO3(g) - H2O(g) = -3HNO3(g) + HNO2(g)
NO3 (g) + H2O (g) = HNO3 (g) + HNO2 (g)-2NO3(g) - H2O(g) = -3HNO3(g) + HNO2(g)
Na2O2 + H2O=NaOH + O2 2Na2O2 + 2H2O = 4NaOH + O2
Na2CO3 + HCl=NaCl + H2O + CO2 Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + H2O=NaOH + H2 2Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2SO4+BaCl2=BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NaOH + H3PO4 = H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
Na2CO3 + 2AgNO3 = 2NaNO3 + 2Ag2CO3 Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
Na2CO3 + 2AgNO3 = 2NaNO3 + 2Ag2CO3 Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
Na2CO3 + 2AgNO3 = 2NaNO3 + 2Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
Na2SO4 + Fe(NO3)3 = NaNO3 + Fe2(SO4)33Na2SO4 + 2Fe(NO3)3 = 6NaNO3 + Fe2(SO4)3
NaCl+H2O=NaOH+2HClNaCl + H2O = NaOH + HCl
NaH + H2O = NaOH+H2NaH + H2O = NaOH + H2
NaH + H2O = NaOH+H2010NaH + 10H2O = 10NaOH + H20
N2+H2=NH3N2 + 3H2 = 2NH3
NH4(Cr2O7)2 + SnPO4=NH4+PO4+Sn(Cr2O7)NH4(Cr2O7)2 + 2SnPO4 = NH4 + 2PO4 + 2Sn(Cr2O7)
Na3AsO4 + CaCl2 = NaCl + Ca3(AsO4)22Na3AsO4 + 3CaCl2 = 6NaCl + Ca3(AsO4)2
Na2CO3 + 2AgNO3 = 2NaNO3 + 2Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
Na2CO3 + 2AgNO3 = 2NaNO3 + 2Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaF + Br2 = NaBr + F2 2NaF + Br2 = 2NaBr + F2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaOH + H2SO = Na2SO + H2O2NaOH + H2SO = Na2SO + 2H2O
N2 + F2 = NF3N2 + 3F2 = 2NF3
Na+H2O=HNaO+HNa + H2O = HNaO + H
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
NaCl + NH3 + H2O + CO2 = NH4Cl + NaHCO3NaCl + NH3 + H2O + CO2 = NH4Cl + NaHCO3
NH4ClO4 + Al = Al2O3 + AlCl3 + NO +H2O3NH4ClO4 + 3Al = Al2O3 + AlCl3 + 3NO + 6H2O
NaHCO3 + H2SO4 = Na2SO4 + H2O +CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH + H3PO4 = Na3PO4 + H2O 3NaOH + H3PO4 = Na3PO4 + 3H2O
Ni (ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
NaOH+H2SO4 = Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NO + H2 = NH3 + H2O2NO + 5H2 = 2NH3 + 2H2O
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NO2+H2O=HNO2+HNO32NO2 + H2O = HNO2 + HNO3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+F2=NF3N2 + 3F2 = 2NF3
N2+F2=NF2N2 + 2F2 = 2NF2
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NH4NO3(s) = N2(g) + O2(g) + H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3 + Ca(CH3CO2)2 = Ca(CO3)2 +2Na + 2CH3CO22Na2CO3 + Ca(CH3CO2)2 = Ca(CO3)2 + 4Na + 2CH3CO2
N2+H2=NH3N2 + 3H2 = 2NH3
N2H4(l) = NH3(g) + N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO(g) + H2(g) = NH3(g) + H2O(g) 2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NO2+H2O=HNO2+HNO32NO2 + H2O = HNO2 + HNO3
NO2+H2O=HNO2+HNO32NO2 + H2O = HNO2 + HNO3
NH4Cl(aq)+Ag(NO3)(aq) = AgCl (s) + NH4(NO3)(aq)NH4Cl(aq) + Ag(NO3)(aq) = AgCl(s) + NH4(NO3)(aq)
NaOH+Se(-)+H2O=Na2SeO3+HSe(-)+H20NaOH - 2Se(-) + 0H2O = 0Na2SeO3 - 2HSe(-) + H2
Na2MoO4 2H2O + H2O = MoO3 + NaOH + 2H2O0Na2MoO42H2O + H2O = 0MoO3 + 0NaOH + H2O
Na2MoO4 2H2O + H2O = MoO3 + 2NaOH + 2H2O0Na2MoO42H2O + H2O = 0MoO3 + 0NaOH + H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na2CO3 + Ca(CH3CO2)2 = Ca(CO3)2 +2Na + 2CH3CO22Na2CO3 + Ca(CH3CO2)2 = Ca(CO3)2 + 4Na + 2CH3CO2
NH3 + O2 = HNO3 + H2ONH3 + 2O2 = HNO3 + H2O
NaI + Br2=NaBr + I22NaI + Br2 = 2NaBr + I2
Ni(ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
Na2CO3+H2SO4=Na2SO4+CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na2CO3+H2SO4=Na2SO4+CO2+H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na2CO3 + HCl=NaCl +CO2 +H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2CO3= Na2CO3 Na2CO3 = Na2CO3
N2H4(g)+N2O4(g)=H2O(g)+N2(g)2N2H4(g) + N2O4(g) = 4H2O(g) + 3N2(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Ni(ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NO + H2O + O2 = HNO34NO + 2H2O + 3O2 = 4HNO3
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na+Br2=NaBr2Na + Br2 = 2NaBr
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+Cl2=N2H4+NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
NaOH+FeBr3=NaBr(aq)+Fe(OH)33NaOH + FeBr3 = 3NaBr(aq) + Fe(OH)3
NaOH+FeBr3=NaBr(aq)+Fe(OH)33NaOH + FeBr3 = 3NaBr(aq) + Fe(OH)3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
Ni(NO3)2(aq)+NaOH(aq)=Ni(OH)2(s)+NaNO3(aq)Ni(NO3)2(aq) + 2NaOH(aq) = Ni(OH)2(s) + 2NaNO3(aq)
NH3(g)+O2(g)=NO2(g)+H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH3(g)+O2(g)=NO2(g)+H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH3 +H2O +NaCl =NH4Cl +NaOHNH3 + H2O + NaCl = NH4Cl + NaOH
NH3 +H2O +MgCl2 =NH4Cl +Mg(OH)22NH3 + 2H2O + MgCl2 = 2NH4Cl + Mg(OH)2
NH4NO3 =N2O + H2ONH4NO3 = N2O + 2H2O
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
N2O5=NO2+O22N2O5 = 4NO2 + O2
N2O4=NO2N2O4 = 2NO2
NH4Cl+Ca(OH)2=NH3+CaCl2+H2O2NH4Cl + Ca(OH)2 = 2NH3 + CaCl2 + 2H2O
Na + Zn So4 = Na2 So4 + Zn2Na + ZnSo4 = Na2So4 + Zn
NaOH(aq)+FeBr3(aq)=FeOH(s)+NaBr3NaOH(aq) + FeBr3(aq) = FeOH(s) + NaBr3
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+I2=NI3N2 + 3I2 = 2NI3
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NH4Cl+Ca(OH)2=CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NiCO3 + Fe = FeCO3 + NiNiCO3 + Fe = FeCO3 + Ni
NCl3 (aq )+3H2O(l)=NH3(aq)+3HOCl(aq)NCl3(aq) + 3H2O(l) = NH3(aq) + 3HOCl(aq)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 (s) =Na2CO3 (s) +CO2 (g) + H2O (l) 2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(l)
NO2 (g) +H2O(l) = HNO3 (aq) + NO (g) 3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH3 + O2 = H2O + N24NH3 + 3O2 = 6H2O + 2N2
NH4Cl(aq) + KOH(aq) = KCl + NH3 + H2ONH4Cl(aq) + KOH(aq) = KCl + NH3 + H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O2 + H2O = NaOH + O22Na2O2 + 2H2O = 4NaOH + O2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
N2 + O2 = N2O4N2 + 2O2 = N2O4
N2 + H2 = NH3N2 + 3H2 = 2NH3
NO+O2=NO22NO + O2 = 2NO2
NO+O2=NO22NO + O2 = 2NO2
NiSO4 + Hg2(NO3)2 = Hg2SO4 + Ni(NO3)2NiSO4 + Hg2(NO3)2 = Hg2SO4 + Ni(NO3)2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na3PO4+AlCl3=AlPO4+NaClNa3PO4 + AlCl3 = AlPO4 + 3NaCl
NaCl+MnO2+H2SO4=NaHSO4+MnSO4+H2O+Cl22NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + MnSO4 + 2H2O + Cl2
NaBr+NaBrO3+H2SO4=Br2+NaSO4+H2O4NaBr + 2NaBrO3 + 6H2SO4 = 3Br2 + 6NaSO4 + 6H2O
NH3+Br2=NH4Br+N28NH3 + 3Br2 = 6NH4Br + N2
N2+3I2=2NI3N2 + 3I2 = 2NI3
Ni(s) + HCl(aq) = NiCl2 + H2(g)Ni(s) + 2HCl(aq) = NiCl2 + H2(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O2+H2O=NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2S(aq)+Cu(NO3)2(aq)= NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
N2 + O2 =N2O4N2 + 2O2 = N2O4
N2 +H2 =NH3N2 + 3H2 = 2NH3
NH3 + H2SO4 = S8 + HNO3 + H20160NH3 + 120H2SO4 = 15S8 + 160HNO3 + 28H20
NH4 + H2(SO4) = S8 + H(NO3) + H20160NH4 + 120H2(SO4) = 15S8 + 160H(NO3) + 36H20
NH4 + H2SO4 = S8 + HNO3 + H20160NH4 + 120H2SO4 = 15S8 + 160HNO3 + 36H20
NO + CO = N + CO2NO + CO = N + CO2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaNO3 + Li = Na + LiNO3NaNO3 + Li = Na + LiNO3
NH4I(s)+CI2(g)=NH4CI(s)+I2(s)NH4I(s) + CI2(g) = NH4CI(s) + I2(s)
NH4I(s)+CI2(g)=NH4CI(s)+I2(s)NH4I(s) + CI2(g) = NH4CI(s) + I2(s)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s) Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH3+ O2= NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Ni + O2 = Ni2O34Ni + 3O2 = 2Ni2O3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4+NO3=N2O+H2ONH4 + NO3 = N2O + 2H2O
NH4+NO3=N2O+H5NH4 + NO3 = 3N2O + 20H
NH3(g)+O2(g)=NO2(g)+H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
Na2O + Al(NO3)3 =NaNO3 + Al2O33Na2O + 2Al(NO3)3 = 6NaNO3 + Al2O3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NH4Cl+AgNO3=NH4NO3+AgClNH4Cl + AgNO3 = NH4NO3 + AgCl
Na Cl + Br2 = Na Br + Cl22NaCl + Br2 = 2NaBr + Cl2
N2+F2=NF3N2 + 3F2 = 2NF3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NH3(g)+2O2(g)=HNO3(g)+H2O(g)NH3(g) + 2O2(g) = HNO3(g) + H2O(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCN + H2SO4=Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
NH4Cl + H20 = HCl + NH3NH4Cl + 0H20 = HCl + NH3
NH4Cl + H20 = HCl + NH3NH4Cl + 0H20 = HCl + NH3
NaO + H2O = NaOH + H2-2NaO + 0H2O = -2NaOH + H2
NO+O2=N2O54NO + 3O2 = 2N2O5
NO+O2=N2O54NO + 3O2 = 2N2O5
NO+O2=N2O54NO + 3O2 = 2N2O5
NO+O2=N2O54NO + 3O2 = 2N2O5
NO+O2=N2O54NO + 3O2 = 2N2O5
NaH(CO3)+Ca(ClO)2 = Ca(CO3)+NaH(ClO)2NaH(CO3) + Ca(ClO)2 = Ca(CO3) + NaH(ClO)2
NaH(CO3)+Ca(ClO)2 = Ca(CO3)+NaH(ClO)2NaH(CO3) + Ca(ClO)2 = Ca(CO3) + NaH(ClO)2
N2O5+ H2O = HNO3N2O5 + H2O = 2HNO3
NaCl + Pb(SO4)2 = PbCl2 + NaSO42NaCl + Pb(SO4)2 = PbCl2 + 2NaSO4
NaCl+BeF2 = NaF+BeCl22NaCl + BeF2 = 2NaF + BeCl2
NaBr + H2O2 + H2SO4 =Na2SO4 + H2O + Br22NaBr + H2O2 + H2SO4 = Na2SO4 + 2H2O + Br2
NaCl + H2O2 + H2SO4 = Na2SO4 + H2O + Cl22NaCl + H2O2 + H2SO4 = Na2SO4 + 2H2O + Cl2
NaOH + Al2O3 + Fe2O3 = Na (Al (OH))+Fe-2NaOH - Al2O3 + Fe2O3 = -2Na(Al(OH)) + 2Fe
NaCl + KMnO4 + H2SO4 = MnSO4 + Na2SO4 + K2SO4 +H2O + Cl2 10NaCl + 2KMnO4 + 8H2SO4 = 2MnSO4 + 5Na2SO4 + K2SO4 + 8H2O + 5Cl2
NaI(s) + H3PO4(l) =NaH2PO4(s) + HINaI(s) + H3PO4(l) = NaH2PO4(s) + HI
NaCl(s) + H3PO4(l) =NaH2PO4 (s) + HCl(aq)NaCl(s) + H3PO4(l) = NaH2PO4(s) + HCl(aq)
Na + H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
Na+ H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
Na + H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
N2(g) + 3 H2 =2NH3 (g)N2(g) + 3H2 = 2NH3(g)
N2(g) + 3 H2 = 2NH3 (g) N2(g) + 3H2 = 2NH3(g)
N2(g) + 3 H2 =2NH3 (g) N2(g) + 3H2 = 2NH3(g)
NaClO2 = NaCl + O2NaClO2 = NaCl + O2
NaClO2 = NaCl + O2NaClO2 = NaCl + O2
NaClO2 = NaCl + O2NaClO2 = NaCl + O2
NaClO2 = NaCl + O2NaClO2 = NaCl + O2
NaClO2 = NaCl + O2NaClO2 = NaCl + O2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.