Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Ni + Cu(NO3)2 = Cu + Ni(NO3)2 Ni + Cu(NO3)2 = Cu + Ni(NO3)2
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2(g) + 2O2 (g) = 2NO2 (g)N2(g) + 2O2(g) = 2NO2(g)
N2+3H2=2NH3N2 + 3H2 = 2NH3
NH3+O2=H2O+NO24NH3 + 7O2 = 6H2O + 4NO2
NaO+Cl2O=NaCl+O24NaO + 2Cl2O = 4NaCl + 3O2
NH3+CO2=(NH2)2CO+H2O 2NH3 + CO2 = (NH2)2CO + H2O
Na2S + Fe(NO3)2 = NaNO3 + FeSNa2S + Fe(NO3)2 = 2NaNO3 + FeS
N2O(g) + H2(g) = NH3(g) + H2O(g)N2O(g) + 4H2(g) = 2NH3(g) + H2O(g)
Na2SO4 + KI = K2SO4 + NaINa2SO4 + 2KI = K2SO4 + 2NaI
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NaCl + Cr2O7= NaO7 + Cr2ClNaCl + Cr2O7 = NaO7 + Cr2Cl
Na2SO4+Ca(NO3)2=CaSO4+2NaNO3Na2SO4 + Ca(NO3)2 = CaSO4 + 2NaNO3
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO2 +O2 = N2O34NO2 - O2 = 2N2O3
NO2 +O2 = N2O34NO2 - O2 = 2N2O3
Ni(OH)2 + 2 HBr = NiBr2 + 2 H2ONi(OH)2 + 2HBr = NiBr2 + 2H2O
NH3 + O2 = NO2 + H2O 4NH3 + 7O2 = 4NO2 + 6H2O
Na2C2O4+CaSO4=CaC2O4+Na2SO4Na2C2O4 + CaSO4 = CaC2O4 + Na2SO4
Na2CO3 + Pb(NO3)2 = PbCO3 + NaNO3Na2CO3 + Pb(NO3)2 = PbCO3 + 2NaNO3
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
NH4Br + Na2CO3 = (NH4)2CO3 +NaBr2NH4Br + Na2CO3 = (NH4)2CO3 + 2NaBr
N3PO4 +NH3=NH4+PO4N3PO4 - 12NH3 = -9NH4 + PO4
Na (s) + H2O (g) = NaOH (aq) + H2 (g)2Na(s) + 2H2O(g) = 2NaOH(aq) + H2(g)
NO2+H2=NH3+H2O2NO2 + 7H2 = 2NH3 + 4H2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2TeO3 + NaI + HCl = NaCl + Te + 6H2O + I2Na2TeO3 + 4NaI + 6HCl = 6NaCl + Te + 3H2O + 2I2
Na2TeO3 + NaI + HCl = NaCl + Te + H2O + I2Na2TeO3 + 4NaI + 6HCl = 6NaCl + Te + 3H2O + 2I2
NaHCO3+H2SO4=Na2SO4+ CO2+ H2O2NaHCO3 + H2SO4 = Na2SO4 + 2CO2 + 2H2O
NO2 + H2O  = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaCO3 + HCl = NaCl2 + CO2 + H2ONaCO3 + 2HCl = NaCl2 + CO2 + H2O
Na2CO3(aq) + HCl(aq) = NaCl(aq) + CO2(g) + H2O(l) Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + CO2(g) + H2O(l)
Ni + NO3 + H+ = Ni+ + H2O + NO4Ni + NO3 + 4H+ = 4Ni+ + 2H2O + NO
Ni + NO3- + H+ = Ni2+ + H2O + NO6Ni + NO3- + 4H+ = 3Ni2+ + 2H2O + NO
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na2SO4(aq) + Ca(NO3)2(aq) = CaSO4(s) + 2 NaNO3(aq)Na2SO4(aq) + Ca(NO3)2(aq) = CaSO4(s) + 2NaNO3(aq)
NO2 + H2O + O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NaHCO3+HCl=CO2+NaCl+H2ONaHCO3 + HCl = CO2 + NaCl + H2O
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO2(g)=NO(g)+ O2(g)2NO2(g) = 2NO(g) + O2(g)
NaCl=Na+Cl22NaCl = 2Na + Cl2
Na2S2O3 + I2 = Na2S4O6 + NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
NH4 =N2+H22NH4 = N2 + 4H2
NO+O2=NO22NO + O2 = 2NO2
Ni(OH)2+ H2SO4= NiSO4+H2ONi(OH)2 + H2SO4 = NiSO4 + 2H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3=N2+H22NH3 = N2 + 3H2
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaOH+CaBr2 = Ca(OH)2+Na Br2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
Na3PO4*12H2O (aq) +Zn(C2H3O2)2*2H2O (aq) =Zn3(PO4)2*4H2O (s) + NaC2H3O2 (aq) + H2O (l) 2Na3PO4*12H2O(aq) + 3Zn(C2H3O2)2*2H2O(aq) = Zn3(PO4)2*4H2O(s) + 6NaC2H3O2(aq) + 26H2O(l)
NH3+O2=N+H2O4NH3 + 3O2 = 4N + 6H2O
Na+O2=Na2O4Na + O2 = 2Na2O
NH3+CuO=N2+Cu+H2O2NH3 + 3CuO = N2 + 3Cu + 3H2O
Na3PO4(aq)+Ca(OH)2(aq)=Ca3(PO4)2(s)+NaOH(aq)2Na3PO4(aq) + 3Ca(OH)2(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NiF2(aq)+Fe2(SO4)3(aq)=NiSO4(aq)+FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NaOH+HCI = NaCI+H2ONaOH + HCI = NaCI + H2O
Na2CO3+AgNO3=Ag2CO3+NaNO3Na2CO3 + 2AgNO3 = Ag2CO3 + 2NaNO3
NH4=N2+H22NH4 = N2 + 4H2
NaHCO 3 (aq)+HCl(aq)= H 2 O(l)+NaCl(aq)+ CO 2 (g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Na 2 S(aq)+ Cu(NO 3 ) 2 (aq)=NaNO 3 (aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na+O2=Na2O4Na + O2 = 2Na2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+S= NaSNa + S = NaS
N2 + H2 = NH3 N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3 N2 + 3H2 = 2NH3
Na+S=NaSNa + S = NaS
Na+S=NaS2Na + 2S = NaS2
Na+S=NaSNa + S = NaS
NH4NO3(s) = N2O(g) + H2O(g)NH4NO3(s) = N2O(g) + 2H2O(g)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
Na3PO3 + CaCl2 = Na3Cl2 + CaPO3Na3PO3 + CaCl2 = Na3Cl2 + CaPO3
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+FeCl2=NaCl+Fe2Na + FeCl2 = 2NaCl + Fe
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+H20=HNO3+NO40NO2 + H20 = 20HNO3 + 20NO
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NO2+2H2 = 2H2O + N22NO2 + 4H2 = 4H2O + N2
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
Na3PO4+HCl=NaCl+H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2(g)+O2(g)+H2O=HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
NaCl= Cl2 + Na2NaCl = Cl2 + 2Na
NaClO3 + SO2 = Na2SO4 + Cl2 +O2 2NaClO3 + SO2 = Na2SO4 + Cl2 + 2O2
NaClO3 + SO2 = Na2SO4 + ClO2 2NaClO3 + SO2 = Na2SO4 + 2ClO2
NH4NO3= N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3 + H2O + CO2 = NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3 + CaCl2 = NaCl + CaCO3Na2CO3 + CaCl2 = 2NaCl + CaCO3
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2H4(l)+O2(g)=NO2(g)+H2O(l)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(l)
NH4ClO4(s)=N2(g)+Cl2(g)+H2O(g)+O2(g)2NH4ClO4(s) = N2(g) + Cl2(g) + 4H2O(g) + 2O2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaCIO = NaCI + NaCIO33NaCIO = 2NaCI + NaCIO3
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaBr + HgNO3 = NaNO3 + HgBrNaBr + HgNO3 = NaNO3 + HgBr
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaCl = Na + Cl22NaCl = 2Na + Cl2
Na(s)+H2O(l) = NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
NO+O2=NO22NO + O2 = 2NO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3 + BaCl2 = Na2Cl2 + BaCO3Na2CO3 + BaCl2 = Na2Cl2 + BaCO3
Na2S(aq)+CaCl2(g)=CaS(s)+NaCl(aq)Na2S(aq) + CaCl2(g) = CaS(s) + 2NaCl(aq)
NH3   +   CuO = Cu   +   N2   +    H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH4Cl +NaNO2 = NaCl + N2 + H2ONH4Cl + NaNO2 = NaCl + N2 + 2H2O
Na2SO3+HCl=NaCl+H2O+SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na2SO3+HCl=NaCl+H2O+SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na + H3PO4 = Na3PO4 + H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NiCl2+Al(PO4) =Ni3(PO4)2+AlCl33NiCl2 + 2Al(PO4) = Ni3(PO4)2 + 2AlCl3
Na(s)+ H 2 O(l) = NaOH(aq)+ H 2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2O4 + Na2SO3 + H2O = NaNO3 + SO2 + H2O0N2O4 + 0Na2SO3 + H2O = 0NaNO3 + 0SO2 + H2O
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO(g)+CO(g)=N2(g)+CO2(g)2NO(g) + 2CO(g) = N2(g) + 2CO2(g)
N2O=N2+O22N2O = 2N2 + O2
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
N2+O2=N2O2N2 + O2 = 2N2O
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na(s)+ H 2 O(l) = NaOH(aq)+ H 2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH4NO2 = H2O + N2NH4NO2 = 2H2O + N2
NH4NO2 = H2O + N2NH4NO2 = 2H2O + N2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NO2 = NO +O 22NO2 = 2NO + O2
Na2CO3+Cu(NO3)2=Na(NO3)+CuCO3Na2CO3 + Cu(NO3)2 = 2Na(NO3) + CuCO3
Na2CO3+Na3PO4=Na2PO4+Na3CO3Na2CO3 + Na3PO4 = Na2PO4 + Na3CO3
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
N2+O2= N2O2N2 + O2 = 2N2O
N2(g) + Cl2(g) = ClNN2(g) + Cl2(g) = 2ClN
N H 3 (l)+ O 2 (g)=2 N 2 (g)+6 H 2 O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH3(g)+O2(g)+CH4(g)=HNC(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HNC(aq) + 6H2O(l)
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaNO3+KCl=NaCl+KNO3NaNO3 + KCl = NaCl + KNO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHCO3 + HC6H7O7 = NaC6H7O7 + H2O + CO2NaHCO3 + HC6H7O7 = NaC6H7O7 + H2O + CO2
NaCrO4 + OH + H = NaCr2O7 + H2O0NaCrO4 + OH + H = 0NaCr2O7 + H2O
NaCrO4 + OH + H = NaCr2O7 + H2O0NaCrO4 + OH + H = 0NaCr2O7 + H2O
NH3 + O2 = H2O + NO34NH3 + 9O2 = 6H2O + 4NO3
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl=Na+Cl22NaCl = 2Na + Cl2
Na2S(aq)+CuSO4(aq)=SSO4+Na2CuNa2S(aq) + CuSO4(aq) = SSO4 + Na2Cu
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na + ZnBr2 = NaBr2 + ZnNa + ZnBr2 = NaBr2 + Zn
Na + ZnBr2 = NaBr + Zn2Na + ZnBr2 = 2NaBr + Zn
N H 4 N O 3 (aq)=N 2 O(g)+ H 2 O(g)NH4NO3(aq) = N2O(g) + 2H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO(g) + H2(g) = NH3(g) + H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
NaCl+ Li2(SO4)= LiCl+ Na2(SO4) 2NaCl + Li2(SO4) = 2LiCl + Na2(SO4)
NaCl+Li2(SO4)= LiCl+ Na2(SO4) 2NaCl + Li2(SO4) = 2LiCl + Na2(SO4)
NH4NO3= N2O+H2ONH4NO3 = N2O + 2H2O
NH4NO3= N2O + H2ONH4NO3 = N2O + 2H2O
NaOH(aq)+HCl(aq)=H2O(l)+NaCl(aq)NaOH(aq) + HCl(aq) = H2O(l) + NaCl(aq)
NH3 + NaClO =N2H4 + NaCl + H2O2NH3 + NaClO = N2H4 + NaCl + H2O
N H 3 (l)+ O 2 (g)=2 N 2 (g)+6 H 2 O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
N O 2 (g)+ O 2 (g)=N 2 O 5 (g)4NO2(g) + O2(g) = 2N2O5(g)
N 2 O= N 2 + O 22N2O = 2N2 + O2
NACLO=NACL+NACLO33NACLO = 2NACL + NACLO3
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH4Cl + KNO3 = NH4NO3 + KClNH4Cl + KNO3 = NH4NO3 + KCl
Na(s)+H2O(l) = NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
NaCl + Ag(C2H3O2) = Na(C2H3O2) + AgClNaCl + Ag(C2H3O2) = Na(C2H3O2) + AgCl
Na+O2=Na2O4Na + O2 = 2Na2O
NiCl2+ KOH = Ni(OH)2 + KClNiCl2 + 2KOH = Ni(OH)2 + 2KCl
Na2CO3 + Na2S + SO2 = CO2+Na2S2O3 Na2CO3 + 2Na2S + 4SO2 = CO2 + 3Na2S2O3
Na2SO4(aq) + Ba(OH)2(aq) = BaSO4(s) + 2 NaOH(aq)Na2SO4(aq) + Ba(OH)2(aq) = BaSO4(s) + 2NaOH(aq)
Na2SO4(aq) + Ba(OH)2(aq) = BaSO4(s) + 2 NaOH(aq)Na2SO4(aq) + Ba(OH)2(aq) = BaSO4(s) + 2NaOH(aq)
NaBr + AgNO3 = NaNO3 + AgBrNaBr + AgNO3 = NaNO3 + AgBr
NH3+ NO= N2+ H2O4NH3 + 6NO = 5N2 + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH4+ + 4MnO2 + 6H+ = NO3- + 4Mn2+ +5H2O7NH4+ + 16MnO2 - 6H+ = 7NO3- + 8Mn2+ + 11H2O
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na + O2 =NaO2Na + O2 = 2NaO
N aCl + H2CO3 = Na2CO3 + HCl2NaCl + H2CO3 = Na2CO3 + 2HCl
Na2S+HNO3=H2S+NaNO3Na2S + 2HNO3 = H2S + 2NaNO3
Na2S+HNO3=H2S+NaNO3Na2S + 2HNO3 = H2S + 2NaNO3
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO(g) + H2(g) =NH3(g) + H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
Na(s)+H2O(l) = NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3 +O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaHCO3+HCl=H2O+NaCl+CO2NaHCO3 + HCl = H2O + NaCl + CO2
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2CO3(aq)+CaCl2=NaCl(aq)+CaCO3Na2CO3(aq) + CaCl2 = 2NaCl(aq) + CaCO3
NaI + H2SO3 = NaSO3 +H2INaI + H2SO3 = NaSO3 + H2I
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
Na2SO3+Na2Cr2O7+H2O+HCl=Cr(OH)2+Na2SO4+NaCl4Na2SO3 + Na2Cr2O7 + H2O + 2HCl = 2Cr(OH)2 + 4Na2SO4 + 2NaCl
NaHCO3 + NaOH = Na2CO3 + H2ONaHCO3 + NaOH = Na2CO3 + H2O
NaClO4 = 2O2 + NaClNaClO4 = 2O2 + NaCl
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N H 3 (l)+ O 2 (g)=2 N 2 (g)+6 H 2 O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NaO + Ag=AgO +NaNaO + Ag = AgO + Na
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NH4Cl + NaOH = NH3 + NaCl + H2ONH4Cl + NaOH = NH3 + NaCl + H2O
Na+S=Na2S2Na + S = Na2S
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NO2 + H2O + O2 = HNO34NO2 + 2H2O + O2 = 4HNO3
Na2 + CO3 + HCl = NaCl + CO2 + H2ONa2 + CO3 + 2HCl = 2NaCl + CO2 + H2O
Na2SO4 + BaCl2 = NaCl + BaSO4Na2SO4 + BaCl2 = 2NaCl + BaSO4
NH3+O2=NO2=H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3+O2=NO2=H2O4NH3 + 7O2 = 4NO2 + 6H2O
Ni + Fe3(PO4)2 = NiPO4 + Fe2Ni + Fe3(PO4)2 = 2NiPO4 + 3Fe
NH3 =N2 + H22NH3 = N2 + 3H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Cl2+O2=NaClO32Na + Cl2 + 3O2 = 2NaClO3
NH3 =N2 + H22NH3 = N2 + 3H2
Ni + Fe3(PO4)2 = NiPO4 + Fe2Ni + Fe3(PO4)2 = 2NiPO4 + 3Fe
Ni2O3=Ni+O22Ni2O3 = 4Ni + 3O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O + AlN = Na3N + Al2O33Na2O + 2AlN = 2Na3N + Al2O3
Na+Fe2(SO4)3=Fe+Na2SO46Na + Fe2(SO4)3 = 2Fe + 3Na2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
Na OH + Li2 So4 = Na2 So4 + Li OH2NaOH + Li2So4 = Na2So4 + 2LiOH
Na OH + Li2 So4 = Na2 So4 + Li OH2NaOH + Li2So4 = Na2So4 + 2LiOH
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2H4(l)=NH3(g)+N2(g) 3N2H4(l) = 4NH3(g) + N2(g)
N2O = ON2N2O = ON2
N2O = N2ON2O = N2O
NaCl(aq)+Ba(NO3)2(aq) = Na(NO3)(aq)+BaCl2(aq)2NaCl(aq) + Ba(NO3)2(aq) = 2Na(NO3)(aq) + BaCl2(aq)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NaCO3+H2O=CO2+NaOH+H2O0NaCO3 + H2O = 0CO2 + 0NaOH + H2O
Na2CO3+NH4I=NaI+(NH4)2CO3Na2CO3 + 2NH4I = 2NaI + (NH4)2CO3
Na+HCl=H2+NaCl2Na + 2HCl = H2 + 2NaCl
Na+HCl=H2+NaCl2Na + 2HCl = H2 + 2NaCl
NaCO3+H2O=CO2+NaOH+H2O0NaCO3 + H2O = 0CO2 + 0NaOH + H2O
Na2CO3+C3H6O3=CO2+H2O+NaC3H5O3Na2CO3 + 2C3H6O3 = CO2 + H2O + 2NaC3H5O3
Na2S+KOH=2NaOH+S+2KNa2S + 2KOH = 2NaOH + S + 2K
NiCr + 2NaCl2 + 2O2= NiCl + CrCl2 + 2NaO4NiCr + 6NaCl2 + 3O2 = 4NiCl + 4CrCl2 + 6NaO
NiCr + 2NaCl2 + O2= NiCl + CrCl2 + 2NaO4NiCr + 6NaCl2 + 3O2 = 4NiCl + 4CrCl2 + 6NaO
Na3Po4+CoBr2=Na3Br2+CoPo4Na3Po4 + CoBr2 = Na3Br2 + CoPo4
NiCl2 + NaN3 = NaCl + Ni(N3)2NiCl2 + 2NaN3 = 2NaCl + Ni(N3)2
NaHCO3 + C2H4O2 = NaC2H3O2 + CO2 + H2ONaHCO3 + C2H4O2 = NaC2H3O2 + CO2 + H2O
Na3AsO3 + H2O2 + AgNO3 = Ag3AsO4 + NaNO3 + H2ONa3AsO3 + H2O2 + 3AgNO3 = Ag3AsO4 + 3NaNO3 + H2O
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaN3(s)=Na(g)+N2(g)2NaN3(s) = 2Na(g) + 3N2(g)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na3PO4(aq) + (CH3COO)2Zn = CH3COONa (aq) + Zn3(PO4)2(s) 2Na3PO4(aq) + 3(CH3COO)2Zn = 6CH3COONa(aq) + Zn3(PO4)2(s)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2 + H2 =NH3 N2 + 3H2 = 2NH3
Na3PO4(aq) + (CH3COO)2Zn = CH3COONa (aq) + Zn3(PO4)2(s) 2Na3PO4(aq) + 3(CH3COO)2Zn = 6CH3COONa(aq) + Zn3(PO4)2(s)
NO(g) + H2(g) = NH3(g) + H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
Na3PO4(aq) + (CH3COO)2Zn =CH3COONa (aq) + Zn3(PO4)2(s) 2Na3PO4(aq) + 3(CH3COO)2Zn = 6CH3COONa(aq) + Zn3(PO4)2(s)
Na3PO4(aq)+(CH3COO)2Zn(aq)=CH3COONa(aq)+Zn3(PO4)2(s)2Na3PO4(aq) + 3(CH3COO)2Zn(aq) = 6CH3COONa(aq) + Zn3(PO4)2(s)
Na2CO3 + 2HCl = 2NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na3PO4+AgCl=Na3Cl+AgPO4Na3PO4 + AgCl = Na3Cl + AgPO4
N2O + NH3 = N2 + H2O3N2O + 2NH3 = 4N2 + 3H2O
NaNO3 = 2NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na + Cl2 =NaCl2Na + Cl2 = 2NaCl
NaOH(aq)+FeCl3(aq)=NaCl3+FeOHNaOH(aq) + FeCl3(aq) = NaCl3 + FeOH
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NH3 + O2= NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaClO = NaCl + NaClO33NaClO = 2NaCl + NaClO3
N2O4+N2H4=N2+H2ON2O4 + 2N2H4 = 3N2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2(SO3)+NaCr2O7+H2O+HCl=Cr(OH)2+Na2(SO4)+NaCl9Na2(SO3) + 2NaCr2O7 + 3H2O + 2HCl = 4Cr(OH)2 + 9Na2(SO4) + 2NaCl
N2H4 + O2 = H2O2 + N2N2H4 + 2O2 = 2H2O2 + N2
Na2SO3+H2SO4=Na2SO4+H2O+SO2Na2SO3 + H2SO4 = Na2SO4 + H2O + SO2
N2H4 + O2 = H2O2 + N2N2H4 + 2O2 = 2H2O2 + N2
NaOH +KNO3 =NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
N2H4 + O2 = H2O2 + N2N2H4 + 2O2 = 2H2O2 + N2
Ni + HCl = NiCl2 + H2Ni + 2HCl = NiCl2 + H2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaOH +KNO3=NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
NaOH +KNO3=NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
N2H4 + O2 = H2O2 + N2N2H4 + 2O2 = 2H2O2 + N2
N2H2 + O2 = H2O2 + N2N2H2 + O2 = H2O2 + N2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaNO3(s)=NaNO2(s)+O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
N2+H2O=HNO3+NO3-1N2 - 6H2O = -12HNO3 + 10NO3
NaCrO4 + LiF = NaF + LiCrO4NaCrO4 + LiF = NaF + LiCrO4
N2+H2O=HNO3+NO3N2 - 2H2O = -4HNO3 + 10NO
N2+H2O=HNO3+NO3N2 - 2H2O = -4HNO3 + 10NO
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+I2=NI3N2 + 3I2 = 2NI3
N2+I6=2NI3N2 + I6 = 2NI3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Na2SO3(aq) + S8(s) = Na2S2O3(aq)8Na2SO3(aq) + S8(s) = 8Na2S2O3(aq)
Na3PO4+MgCl2=Mg3(PO4)2+NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
NH4NO3(s) = N2(g) +O2(g) + H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3 = N2(g) +O2(g) + H2O(g)2NH4NO3 = 2N2(g) + O2(g) + 4H2O(g)
N2O5(g) + H2O (l) = HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NO2+O2=N2O54NO2 + O2 = 2N2O5
Ni(No3)2(aq) + Na2S(aq) = NiS(s) + NaNo3(aq)Ni(No3)2(aq) + Na2S(aq) = NiS(s) + 2NaNo3(aq)
NH4+ + O2 = NO3 + H2O + H+4NH4+ + 9O2 = 4NO3 + 6H2O + 4H+
NO2 +O2= N2O42NO2 + 0O2 = N2O4
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
N2H4 + N2O4 = H2O + N22N2H4 + N2O4 = 4H2O + 3N2
N2 H4 + H2 O = N2 + H2 O0N2H4 + H2O = 0N2 + H2O
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
NI3(s)=N2(g)+I2(g)2NI3(s) = N2(g) + 3I2(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
Na2CO3+HCl=NaCl+H2O+CO2(g)Na2CO3 + 2HCl = 2NaCl + H2O + CO2(g)
Na2CO3 + BaI2 = BaCO3 + NaINa2CO3 + BaI2 = BaCO3 + 2NaI
Na2CO3 + BaI2 = BaCO3 + NaINa2CO3 + BaI2 = BaCO3 + 2NaI
Na2CO3 + BaI2 = BaCO3 + NaINa2CO3 + BaI2 = BaCO3 + 2NaI
NH4Cl(aq)+NaNO2(aq)=N2(g)+NaCl(aq)+2H2O(l)NH4Cl(aq) + NaNO2(aq) = N2(g) + NaCl(aq) + 2H2O(l)
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 +H2 =NH4N2 + 4H2 = 2NH4
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2 + H2 = NH4N2 + 4H2 = 2NH4
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2(g)+O2(g)=N2O5(g)4NO2(g) + O2(g) = 2N2O5(g)
Na+H2O=NaOH+HNa + H2O = NaOH + H
NH4I+Cl2=NH4Cl+I22NH4I + Cl2 = 2NH4Cl + I2
NH4I+Cl2=NH4Cl+I22NH4I + Cl2 = 2NH4Cl + I2
Na3P + H2O = PH3 + NaOHNa3P + 3H2O = PH3 + 3NaOH
Na3P + H2O = PH3 + NaOHNa3P + 3H2O = PH3 + 3NaOH
NaCl (aq) +F2(g) = NaF (aq) +Cl22NaCl(aq) + F2(g) = 2NaF(aq) + Cl2
Na2O(s)+HCl(aq)=NaCl(aq)+H2O(l)Na2O(s) + 2HCl(aq) = 2NaCl(aq) + H2O(l)
Na(s) + O2(g) = Na2O(s)4Na(s) + O2(g) = 2Na2O(s)
NH4NO3(s)= N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NO2(g)+O2(g)=N2O5(g) 4NO2(g) + O2(g) = 2N2O5(g)
N2O=N2+O2 2N2O = 2N2 + O2
NHO3+Fe=H2+Fe(NO3)22NHO3 + Fe = H2 + Fe(NO3)2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NH 3 ( g ) + HCl ( g ) = NH 4 Cl ( s )NH3(g) + HCl(g) = NH4Cl(s)
NaBr + NaClO + 2H = Br2 + NaCl + H2O0NaBr + NaClO + 2H = 0Br2 + NaCl + H2O
NH4NO3+ H2O= NH4 +NO3NH4NO3 + 0H2O = NH4 + NO3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH4Cl(aq) + Pb(NO3)2(aq) = NH4(NO3) + PbCl22NH4Cl(aq) + Pb(NO3)2(aq) = 2NH4(NO3) + PbCl2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na2CO3(aq)+Ca(NO3)2(aq) = CaCO3(s)+2NaNO3(aq) Na2CO3(aq) + Ca(NO3)2(aq) = CaCO3(s) + 2NaNO3(aq)
NaCl(aq)+ZnNO3(aq) = Na(NO3)(aq)+ ZnClNaCl(aq) + ZnNO3(aq) = Na(NO3)(aq) + ZnCl
NaCl(aq)+AgNO3(aq) = Na(NO3)(aq)+ AgCl(s)NaCl(aq) + AgNO3(aq) = Na(NO3)(aq) + AgCl(s)
Na2SO4 + MnO2 + NaOH = Na2SO3 + NaMnO4 + H2O3Na2SO4 + 2MnO2 + 2NaOH = 3Na2SO3 + 2NaMnO4 + H2O
NH4I+NaOH=NaI+NH4OHNH4I + NaOH = NaI + NH4OH
Na3AsO4 + NO + HNO3 = As2O3 + NaNO3 + H2O6Na3AsO4 + 4NO + 14HNO3 = 3As2O3 + 18NaNO3 + 7H2O
Na2CO3+Ca(OH)2=NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
NaCO3+HC2H3O2= NaC2H3O2+H2O+CO28NaCO3 + 9HC2H3O2 = 8NaC2H3O2 + 6H2O + 10CO2
N2O5 + H2 = NH3 + H2ON2O5 + 8H2 = 2NH3 + 5H2O
Na +MgCl2=NaCl +Mg2Na + MgCl2 = 2NaCl + Mg
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na2CO3(s) = Na2O(s) + CO2(g) Na2CO3(s) = Na2O(s) + CO2(g)
Na2CO3(s) = Na2O(s) + CO2(g) Na2CO3(s) = Na2O(s) + CO2(g)
NaOH(aq) + HBr(aq) = NaBr(aq) + H2O(g)NaOH(aq) + HBr(aq) = NaBr(aq) + H2O(g)
NH3 + O2 =NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NaBr(aq) + NaClO(aq) + H = Br2(l) + NaCl(aq) + H2O0NaBr(aq) + NaClO(aq) + 2H = 0Br2(l) + NaCl(aq) + H2O
Na2S(aq) + Ba(NO3)2(aq) =BaS(s) +NaNO3(aq)Na2S(aq) + Ba(NO3)2(aq) = BaS(s) + 2NaNO3(aq)
Na2SO4(aq)+Ca(NO3)2(aq)=CaSO4(s)+NaNO3(aq)Na2SO4(aq) + Ca(NO3)2(aq) = CaSO4(s) + 2NaNO3(aq)
NO+O2=NO22NO + O2 = 2NO2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NH3 = N2 + H22NH3 = N2 + 3H2
N2+H2=NH3N2 + 3H2 = 2NH3
NO + CO = N2 + CO22NO + 2CO = N2 + 2CO2
NaOH+H2CO3=Na2CO3+H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2=N2O52N2 + 5O2 = 2N2O5
NA2SO3=NA2S+NA2SO44NA2SO3 = NA2S + 3NA2SO4
NaOH(aq)+Zn(NO3)2(aq) = Zn(OH)2(s)+NaNO3(aq)2NaOH(aq) + Zn(NO3)2(aq) = Zn(OH)2(s) + 2NaNO3(aq)
NO+NH3=N2+H2O6NO + 4NH3 = 5N2 + 6H2O
N2(g) + 6 HCl(g)=2 NH3(g) + 3 Cl2(g)N2(g) + 6HCl(g) = 2NH3(g) + 3Cl2(g)
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NO2+H2O=HNO3+N2O8NO2 + 3H2O = 6HNO3 + N2O
NaMnO4+HI=MnI2+NaI+H2O+O24NaMnO4 + 12HI = 4MnI2 + 4NaI + 6H2O + 5O2
NaOH+CuCl2=NaCl+Cu(OH)22NaOH + CuCl2 = 2NaCl + Cu(OH)2
NH3+4H=4NH3NH3 + 0H = NH3
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
NaBr + Al203 = Na20 + AlBr312180NaBr + 20Al203 = 609Na20 + 4060AlBr3
NaBr + Al203 = Na20 + AlBr312180NaBr + 20Al203 = 609Na20 + 4060AlBr3
NaOH + KNO3 = NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
NaOH + KNO3 = NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
NaOH + KNO3 = NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
NaOH + KNO3 = NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
NaOH + KNO3 = NaNO3 + KOHNaOH + KNO3 = NaNO3 + KOH
NaNO3+H2SO4=Na2SO4+HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaCl(aq)+Ba(NO3)2(aq) = Na(NO3)2(aq)+BaCl(aq)NaCl(aq) + Ba(NO3)2(aq) = Na(NO3)2(aq) + BaCl(aq)
NH3 + O2 =4NO + 6H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + FeCl3=Fe(OH)3 + 3NaCl3NaOH + FeCl3 = Fe(OH)3 + 3NaCl
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NaCl+Pb(NO3)2=PbCl2+NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
NaBr(aq)+NH4NO3(aq)=NaNO3+BrNH4NaBr(aq) + NH4NO3(aq) = NaNO3 + BrNH4
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2O5=N2O4+O22N2O5 = 2N2O4 + O2
NaBr(aq)+NH4NO3(aq)=NaHBr+H2NO2+H2O-2NaBr(aq) - NH4NO3(aq) = -2NaHBr - 2H2NO2 + H2O
NaBr(aq)+NH4NO3(aq)=NaHBr+H2NO2+H2O-2NaBr(aq) - NH4NO3(aq) = -2NaHBr - 2H2NO2 + H2O
NaClO3=NaCl(s)+O2(g)2NaClO3 = 2NaCl(s) + 3O2(g)
Na3PO4 + Cr(IO3)2 = NaIO3 +Cr3(PO4)22Na3PO4 + 3Cr(IO3)2 = 6NaIO3 + Cr3(PO4)2
NO + 2CO = CO2 + N22NO + 2CO = 2CO2 + N2
N2O3 + CaO2 = N2O2 + CaO3N2O3 + CaO2 = N2O2 + CaO3
N2O3 + CaO2 = N2O2 + CaO3N2O3 + CaO2 = N2O2 + CaO3
NaCl2+NaBr=NaCl+Br22NaCl2 + 2NaBr = 4NaCl + Br2
NH3(g) + O2(g) =H2O(l) + NO4NH3(g) + 5O2(g) = 6H2O(l) + 4NO
Na2CO3 = Na2O + CO2Na2CO3 = Na2O + CO2
Na2SO3+Na2Cr2O7+H2O+HCl = Cr(OH)2+Na2SO4+NaCl 4Na2SO3 + Na2Cr2O7 + H2O + 2HCl = 2Cr(OH)2 + 4Na2SO4 + 2NaCl
N2(g)+O2(g)=NO2(g)N2(g) + 2O2(g) = 2NO2(g)
NO2(g)+O2(g)=N2O5(g) 4NO2(g) + O2(g) = 2N2O5(g)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NO2(g)+H2O(l)=2HNO3(g)+NO(g)3NO2(g) + H2O(l) = 2HNO3(g) + NO(g)
NO2+H2O=2HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3(l)+O2(g)=2N2(g)+6H2O(l)4NH3(l) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2+ H2O =NH3+O24NO2 + 6H2O = 4NH3 + 7O2
NCl3+H2O=HCl+HNO2NCl3 + 2H2O = 3HCl + HNO2
Na3PO4+CuSO4=CuPO4+Na3SO4Na3PO4 + CuSO4 = CuPO4 + Na3SO4
Na3PO4+FeCl3=FePO4+NaClNa3PO4 + FeCl3 = FePO4 + 3NaCl
NaCl+Ba(NO3)2=Na(NO3)2+ClBaNaCl + Ba(NO3)2 = Na(NO3)2 + ClBa
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3(g) +O2(g) =N2(g)+H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NaHCO3 + NaOH = Na2CO3 + H2ONaHCO3 + NaOH = Na2CO3 + H2O
Na3PO4 + SnO2 + Cu = Na2SnO3 + P4 + CuO4Na3PO4 + 6SnO2 + 10Cu = 6Na2SnO3 + P4 + 10CuO
NO(g)+O2=NO2(g)2NO(g) + O2 = 2NO2(g)
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+ O2= N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NO2= NO+ O22NO2 = 2NO + O2
NaNO3 + CaCl2 = Ca(NO3)2 + NaCl2NaNO3 + CaCl2 = Ca(NO3)2 + 2NaCl
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaOH(aq)+NH4C2H3O2(aq)=NH4OH(aq)+NaC2H3O2(s)NaOH(aq) + NH4C2H3O2(aq) = NH4OH(aq) + NaC2H3O2(s)
NO2 + SO3 + H20 = HNO3 + H2SO4-20NO2 + 20SO3 + H20 = -20HNO3 + 20H2SO4
N2+H2=NH3N2 + 3H2 = 2NH3
Na(So4)+CaCl=Ca(So4)+NaClNa(So4) + CaCl = Ca(So4) + NaCl
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NH3 (g) + O2 (g) = N2 (g) + H2O (g) 4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH3= N2+H22NH3 = N2 + 3H2
NO2+OH2=HO4N+NO5NO2 + OH2 = 2HO4N + 3NO
NH3(g) + O2(g) = N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
Ni(OH)2(s)= NiO(s) + H2O(g) Ni(OH)2(s) = NiO(s) + H2O(g)
N2+H2=NH3N2 + 3H2 = 2NH3
Ni(NO3)2+Na3PO4=Ni3(PO4)2+NaNO33Ni(NO3)2 + 2Na3PO4 = Ni3(PO4)2 + 6NaNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2=NH3N2 + 3H2 = 2NH3
NaClO3+K2SnO2=NaCl+K2SnO3NaClO3 + 3K2SnO2 = NaCl + 3K2SnO3
NCL3 +L2 =NL3 + CL2NCL3 + L2 = NL3 + CL2
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.