Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na3PO4 + 3HBR = 3NaBR + H3PO4Na3PO4 + 3HBR = 3NaBR + H3PO4
Na3PO4 + 3HBR = 3NaBR + H3PO4Na3PO4 + 3HBR = 3NaBR + H3PO4
Na3PO4 + 3HBR = 3NaBR + H3PO4Na3PO4 + 3HBR = 3NaBR + H3PO4
NaCN+NH3+H2O=NH4CN+NaOHNaCN + NH3 + H2O = NH4CN + NaOH
N2(g)+3Cl2(g)=2NCl3(g)N2(g) + 3Cl2(g) = 2NCl3(g)
NO2 + NaOH =NaNO2 + NaNO3 + H2O2NO2 + 2NaOH = NaNO2 + NaNO3 + H2O
NiI2 + Al2(SO3)3= AlI + Ni(SO3)3NiI2 + Al2(SO3)3 = 2AlI + Ni(SO3)3
NaCl + H2SO4 = HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
Na2CO3 + H3PO4 = CO2 + H2O + Na3PO43Na2CO3 + 2H3PO4 = 3CO2 + 3H2O + 2Na3PO4
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NiF2(aq) + Fe2(SO4)3(aq) = NiSO4(aq) + FeF3(s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
NaHCO3 = Na2CO3 + H2CO32NaHCO3 = Na2CO3 + H2CO3
NaOH(aq) + H2SO4 = Na2SO4+ 2H2O2NaOH(aq) + H2SO4 = Na2SO4 + 2H2O
Na2S+NaIO3+H2SO4=NaHSO4+I2+H2O5Na2S + 8NaIO3 + 13H2SO4 = 18NaHSO4 + 4I2 + 4H2O
Na2O + Na2O2 + NaBr = Na3OBrNa2O + 0Na2O2 + NaBr = Na3OBr
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + 3 O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl(aq)+Mg(C2H3O2)2=Na(C2H3O2)2+MgClNaCl(aq) + Mg(C2H3O2)2 = Na(C2H3O2)2 + MgCl
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH + AlBr3 = NaBr + Al(OH)33NaOH + AlBr3 = 3NaBr + Al(OH)3
Na2CO3 + H2SO4 = 2Na2SO4 + 2CO2 + 3H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O+HCl=NaCl+H2ONa2O + 2HCl = 2NaCl + H2O
Na2CO3 + H2SO4 = 2Na2SO4 + 2CO2 + 3H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH4OH (aq) + H2SO4 (aq) = (NH4)2SO4 (aq) + H2O (l)2NH4OH(aq) + H2SO4(aq) = (NH4)2SO4(aq) + 2H2O(l)
NH4OH (aq) + H2SO4 (aq) = (NH4)2SO4 (aq) + H2O (l)2NH4OH(aq) + H2SO4(aq) = (NH4)2SO4(aq) + 2H2O(l)
NH4OH (aq) + H2SO4 (aq) = (NH4)2SO4 (aq) + H2O (l)2NH4OH(aq) + H2SO4(aq) = (NH4)2SO4(aq) + 2H2O(l)
NH4OH (aq) + H2SO4 (aq) = (NH4)2SO4 (aq) + H2O (l)2NH4OH(aq) + H2SO4(aq) = (NH4)2SO4(aq) + 2H2O(l)
NaIO4+NaCl+NaCrO4+H2O=CrI3+NaOH+Cl2 3NaIO4 + 28NaCl + NaCrO4 + 16H2O = CrI3 + 32NaOH + 14Cl2
NaIO4+NaCl+NaCrO4+H2O=CrI3+NaOH+Cl2 3NaIO4 + 28NaCl + NaCrO4 + 16H2O = CrI3 + 32NaOH + 14Cl2
NaNO3 + CaCl2 = Ca(NO3)2 + NaCl2NaNO3 + CaCl2 = Ca(NO3)2 + 2NaCl
NaCl + BeF2 = NaF + BeCl22NaCl + BeF2 = 2NaF + BeCl2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na3PO4 + HCl = NaCl + H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaOH + NaNO2 + Al + H2O = NH3 +NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
NaOH + NaNO2 + Al + H2O = NH +NaAlO2NaOH + 3NaNO2 + 4Al + H2O = 3NH + 4NaAlO2
NaHCO3(aq) + CH3COOH(aq) = NaCH3COO(aq) + H2O(l) + CO2NaHCO3(aq) + CH3COOH(aq) = NaCH3COO(aq) + H2O(l) + CO2
NH3+CuO = Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaN3 = Na + N22NaN3 = 2Na + 3N2
Na + KNO3 = K2O + Na2O + N210Na + 2KNO3 = K2O + 5Na2O + N2
NaO + H2O = NaOH + H2-2NaO + 0H2O = -2NaOH + H2
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na+H2O=Na(OH)2+H2Na + 2H2O = Na(OH)2 + H2
NiCl2 + K2S2O8 = 2KCl + NiS2O8NiCl2 + K2S2O8 = 2KCl + NiS2O8
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2CO3 + H2SO4 = 2Na2SO4 + 2CO2 + 3H2ONa2CO3 + H2SO4 = Na2SO4 + CO2 + H2O
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
N2 + O2 = N2O2N2 + O2 = 2N2O
N2 + O2 = N2O2N2 + O2 = 2N2O
Na + I2 = NaI2Na + I2 = 2NaI
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
N3H8 + O2 = NO2 + 2H2ON3H8 + 5O2 = 3NO2 + 4H2O
N3H8 + O2 = NO2 + 2H2ON3H8 + 5O2 = 3NO2 + 4H2O
N3H8 + O2 = NO2 + H2ON3H8 + 5O2 = 3NO2 + 4H2O
NaNO3+KCl=NaCl+KNO3NaNO3 + KCl = NaCl + KNO3
NA+H2O=NAOH+H22NA + 2H2O = 2NAOH + H2
Na3PO4(aq)+CaCl2(aq)=Ca3(PO4)2(s)+NaCl(aq)2Na3PO4(aq) + 3CaCl2(aq) = Ca3(PO4)2(s) + 6NaCl(aq)
NH3(g)+O2(g)=NO(g)+H2O(l)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(l)
NH3(g)+O2(g)=NO(g)+H2O4NH3(g) + 5O2(g) = 4NO(g) + 6H2O
NaCl(s)+SO2(g)+H2O(g)+O2(g)=Na2SO4(s)+HCl(g)4NaCl(s) + 2SO2(g) + 2H2O(g) + O2(g) = 2Na2SO4(s) + 4HCl(g)
Na2O2(s)+H2O(l)=NaOH+H2O2(aq)Na2O2(s) + 2H2O(l) = 2NaOH + H2O2(aq)
NH3(g)+NO(g)=N2(g)+H2O(g)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(g)
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
NH3 + F2 = N2F4 + HF2NH3 + 5F2 = N2F4 + 6HF
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH(aq)+HClO4(aq)=NaClO4(aq)+H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
NaOH(aq)+HClO4(aq)=NaClO4(aq)+H2O(l)NaOH(aq) + HClO4(aq) = NaClO4(aq) + H2O(l)
Na2SO4 (aq) + AgNO3 (aq) =Ag2SO4 (s) + NaNO3 (aq)Na2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2NaNO3(aq)
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3(g)+O2(g)=N2(g)+H2O(l)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(l)
Na2SO4 = Na + SO4Na2SO4 = 2Na + SO4
NH4NO3= N2O+ H2ONH4NO3 = N2O + 2H2O
Na+MgI2=NaI+Mg2Na + MgI2 = 2NaI + Mg
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH4+F=NH3+HFNH4 + F = NH3 + HF
Na2SO3 + 2HCl = 2NaCl + SO2 + H2ONa2SO3 + 2HCl = 2NaCl + SO2 + H2O
Na2+H2O=NaOH + H2Na2 + 2H2O = 2NaOH + H2
Na2(COO)2+ 2 HCl=2 NaCl+ (COOH)2Na2(COO)2 + 2HCl = 2NaCl + (COOH)2
N2 + 3H2 = NH3N2 + 3H2 = 2NH3
Na+ O2 = Na2O 4Na + O2 = 2Na2O
N2+H2 = NH3N2 + 3H2 = 2NH3
NF3 + AlCl3 = N2 + Cl2 + AlF32NF3 + 2AlCl3 = N2 + 3Cl2 + 2AlF3
Na2O (aq) + MgCl2 (aq) = MgO (s) + 2 NaCl (aq)Na2O(aq) + MgCl2(aq) = MgO(s) + 2NaCl(aq)
Na2O (aq) + MgCl2 (aq) = MgO (s) + 2 NaCl (aq)Na2O(aq) + MgCl2(aq) = MgO(s) + 2NaCl(aq)
Na2CO3+H2O+CO2=NaHCO3Na2CO3 + H2O + CO2 = 2NaHCO3
NH4OH + FeCl3 + Na2SO3 =NH4Cl+Na2SO4+FeCl2+NaCl+H2O2NH4OH + 2FeCl3 + Na2SO3 = 2NH4Cl + Na2SO4 + 2FeCl2 + 0NaCl + H2O
NH4OH + FeCl3 + Na2SO3 =NH4Cl+Na2SO4+FeCl2+FeOH22NH4OH + 0FeCl3 + Na2SO3 = 2NH4Cl + Na2SO4 - FeCl2 + FeOH2
NH4OH + FeCl3 + Na2SO3 =NH4Cl+Na2SO4+FeCl2+FeOHNH4OH - FeCl3 + 0Na2SO3 = NH4Cl + 0Na2SO4 - 2FeCl2 + FeOH
N2H4 + O3 = H2O +N3N2H4 + 2O3 = 6H2O + 6N
N2H2 + O3 = H2O +N3N2H2 + O3 = 3H2O + 6N
NaOH + H2SO3 = Na2SO3 + H2O2NaOH + H2SO3 = Na2SO3 + 2H2O
NaOH + H2SO3 = Na2SO3 + H2O2NaOH + H2SO3 = Na2SO3 + 2H2O
NaCl + Bi2S3 = BiCl3 + Na2S6NaCl + Bi2S3 = 2BiCl3 + 3Na2S
NaCl + Bi2S3 = BiCl3 + Na2S6NaCl + Bi2S3 = 2BiCl3 + 3Na2S
N2+H2=NH3N2 + 3H2 = 2NH3
NaC6H6NO3S + FeSO4= Fe(C6H6NO3S)2 + Na2SO42NaC6H6NO3S + FeSO4 = Fe(C6H6NO3S)2 + Na2SO4
Na(OH) + H(ClO) = Na(ClO) + H2ONa(OH) + H(ClO) = Na(ClO) + H2O
NH3(g)+O2(g)=N2(g)+H2O(l)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(l)
NO2 + H2O + O2 = HNO3 4NO2 + 2H2O + O2 = 4HNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
NaHSO3 + HCl + KMnO4 = NaHSO4 + KCl + MnCl2 + H2O5NaHSO3 + 6HCl + 2KMnO4 = 5NaHSO4 + 2KCl + 2MnCl2 + 3H2O
NaHSO3+HCl+K2Cr2O7=NaHSO4+KCl+Cr2O3+H2O3NaHSO3 + 2HCl + K2Cr2O7 = 3NaHSO4 + 2KCl + Cr2O3 + H2O
NaHSO3+HCl+KMnO4=NaHSO4+KCl+MnCl2+H2O5NaHSO3 + 6HCl + 2KMnO4 = 5NaHSO4 + 2KCl + 2MnCl2 + 3H2O
Na+H2O =H2+ NaOH2Na + 2H2O = H2 + 2NaOH
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
NH4Cl+NaOH=NaCl+H2O+NH3NH4Cl + NaOH = NaCl + H2O + NH3
NH4Cl+Ca(OH)2=CaCl2+NH3+H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
N + 3H = NH3N + 3H = NH3
Na + H2O = H2 + 2NaOH2Na + 2H2O = H2 + 2NaOH
Na+CO3+HBr=NaBr+HCO3Na + CO3 + HBr = NaBr + HCO3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+H3PO4=(NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
N2+H2=NH3N2 + 3H2 = 2NH3
NaBr+H3PO4=Na2HPO4+HBr2NaBr + H3PO4 = Na2HPO4 + 2HBr
NH3(g) + O2(g) = NO2(g) + H2O2(g) 2NH3(g) + 5O2(g) = 2NO2(g) + 3H2O2(g)
NH3+O2 = NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+HNa + H2O = NaOH + H
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4NO3=N2O +H2ONH4NO3 = N2O + 2H2O
NaCl + MnO2 + H2SO4= NaHSO4 + Cl2 + MnSO4 + H2O2NaCl + MnO2 + 3H2SO4 = 2NaHSO4 + Cl2 + MnSO4 + 2H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaHCO3 + C6H8O6 + H2SO4 = H2O + CO2 + NaS2O320NaHCO3 + 7C6H8O6 + 40H2SO4 = 78H2O + 62CO2 + 20NaS2O3
NiCl3 + K2CO3 = Ni2(CO3)3 + KCl2NiCl3 + 3K2CO3 = Ni2(CO3)3 + 6KCl
NH3(g) + O2(g) = NO2(g) + H2O2(g) 2NH3(g) + 5O2(g) = 2NO2(g) + 3H2O2(g)
NH3(g) + O2(g) = NO2(g) + H2O2(g) 2NH3(g) + 5O2(g) = 2NO2(g) + 3H2O2(g)
Nd2O3 + 2NH4H2PO4 + Al2O3 = Nd2Al2P2O5 + 3H2O + 2NH3 + 3O2Nd2O3 + 2NH4H2PO4 + Al2O3 = Nd2Al2P2O5 + 3H2O + 2NH3 + 3O2
Na3PO4 + Ba(NO3)2  = NaNO3 + Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
NiSO4 + Li3PO4 = Ni3(PO4)2 + Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
N2O5+H2O=H (NO3)N2O5 + H2O = 2H(NO3)
NH3+Cl2=HCl+N22NH3 + 3Cl2 = 6HCl + N2
Na2O2+H2O=Na (OH)+O22Na2O2 + 2H2O = 4Na(OH) + O2
Na+H3PO4=Na3PO4+H26Na + 2H3PO4 = 2Na3PO4 + 3H2
Na2SO4+BaCl2=BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na+H3PO4=Na3PO4+H26Na + 2H3PO4 = 2Na3PO4 + 3H2
Na2S (s) + 2 HNO3 (aq) = H2S (g) + 2 NaNO3 (aq)Na2S(s) + 2HNO3(aq) = H2S(g) + 2NaNO3(aq)
NiCl2+H2C2O4+H2O=NiC2O4*2H2O+2HClNiCl2 + H2C2O4 + 2H2O = NiC2O4*2H2O + 2HCl
Na3P+H2O=PH3+NaOHNa3P + 3H2O = PH3 + 3NaOH
Na(s) + O2(g) = Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
NH3 + O2 = NO + H2020NH3 + 10O2 = 20NO + 3H20
Na2CO3+FeCr2O7+O2=Fe2O3+Na2CrO4+CO28Na2CO3 + 4FeCr2O7 + O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
NiF2+NH3=Ni3N+NH4F+N26NiF2 + 16NH3 = 2Ni3N + 12NH4F + N2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4ClO4 = N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na(s) + O2(g) = Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
N+H2=NH2N + H2 = 2NH
N+H=NHN + H = NH
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NO(g)+H2=NH3(g)+H2O(g)2NO(g) + 5H2 = 2NH3(g) + 2H2O(g)
N+H=N2H42N + 4H = N2H4
N+O=N2O32N + 3O = N2O3
N+H=NH3N + 3H = NH3
N+H=NH5N + 5H = NH5
N3+O=NON3 + 3O = 3NO
Na2CO3 + C = CO + NaNa2CO3 + 2C = 3CO + 2Na
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O2+N2O3=N2O5-2N2O2 + 3N2O3 = N2O5
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+H2SO4 = (NH4)2 SO42NH3 + H2SO4 = (NH4)2SO4
N2+ Cl2+ O2+ H2O = NH4ClO4N2 + Cl2 + 2O2 + 4H2O = 2NH4ClO4
NO + O2 = NO22NO + O2 = 2NO2
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na + H2O =NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO2 = N2 +H2ONH4NO2 = N2 + 2H2O
NaCl + Al2S3 = NaS3 + ClAl2NaCl + Al2S3 = NaS3 + ClAl2
Na2O2+H2O=O2+NaOH2Na2O2 + 2H2O = O2 + 4NaOH
Na2O2+H2O=O2+NaOH2Na2O2 + 2H2O = O2 + 4NaOH
NH4OH + (NH4)2CO3 + Cu2(OH)2CO3 = Cu(NH3)4CO3 +H2O6NH4OH + (NH4)2CO3 + Cu2(OH)2CO3 = 2Cu(NH3)4CO3 + 8H2O
NH3+H3PO4=(NH4) 2HPO42NH3 + H3PO4 = (NH4)2HPO4
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Ni3O4 + K2Cr2O7 + HCl = NiCl3 + CrCl3 + ClK + H2O6Ni3O4 + K2Cr2O7 + 62HCl = 18NiCl3 + 2CrCl3 + 2ClK + 31H2O
NaN3 =Na +N2 2NaN3 = 2Na + 3N2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+O2= HNO3+H2ONH3 + 2O2 = HNO3 + H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4 Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NaH+H2O=H2+Na2O2NaH + H2O = 2H2 + Na2O
NaH+H2O=H2+NaO2NaH + 2H2O = 3H2 + 2NaO
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na(s) + O2(g) = Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NH3+O2+CH4 = HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2O5 + H2O= HNO3N2O5 + H2O = 2HNO3
Na2SiO3 + 2KOH = K2SiO3 +2NaOHNa2SiO3 + 2KOH = K2SiO3 + 2NaOH
NaSO3 + H2SO4 = Na2SO4 + H2O + SO22NaSO3 + 0H2SO4 = Na2SO4 + 0H2O + SO2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
NaO+H2O= NaOH+H2-2NaO + 0H2O = -2NaOH + H2
Na2CO3 + FeCr2O7 + O2 = Fe2O3 + Na2CrO4 + CO28Na2CO3 + 4FeCr2O7 + O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
Na2Co3 + FeCr2O7 + O2 = Fe2O3 + Na2CrO4 + Co28Na2Co3 + 4FeCr2O7 + 5O2 = 2Fe2O3 + 8Na2CrO4 + 12Co2
Na2CO3 + FeCr2O7 + O2 = Fe2O3 + Na2CrO4 + CO28Na2CO3 + 4FeCr2O7 + O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
NiF2 +NH3 = Ni3N + NH4F + N26NiF2 + 16NH3 = 2Ni3N + 12NH4F + N2
Na2O + (NH4)2SO4 = Na2SO4 + H2O + NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
Na2CO3+FeCrO7+O2=Fe2O3+Na2CrO4+CO24Na2CO3 + 4FeCrO7 - 5O2 = 2Fe2O3 + 4Na2CrO4 + 4CO2
NiF2+NH3=NiN+NH4F+N2-6NiF2 - 16NH3 = -6NiN - 12NH4F + N2
NaHCO3+HCl=NaCl+H2CO3NaHCO3 + HCl = NaCl + H2CO3
NH3 + 2 O2 = H++NO3- + H2ONH3 + 2O2 = H+ + NO3- + H2O
NH3 + 2 O2 = H++NO3- + H2ONH3 + 2O2 = H+ + NO3- + H2O
Na2SO4(aq)+MgCl2(aq)=NaCl(aq)+MgSO4(s)Na2SO4(aq) + MgCl2(aq) = 2NaCl(aq) + MgSO4(s)
Na + Zn(NO3)2 = Zn + NaNO3 2Na + Zn(NO3)2 = Zn + 2NaNO3
NaSO3 + O2 = NaSO42NaSO3 + O2 = 2NaSO4
NaCN+H2O2+O2=NH3+NaHCO32NaCN + 4H2O2 - O2 = 2NH3 + 2NaHCO3
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
Na+H2O=NaOH + HNa + H2O = NaOH + H
Na+H2O=NaOH + H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH + H22Na + 2H2O = 2NaOH + H2
Na2Cr2O7 + HCl = NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
NaH +H2O = NaOH + H2NaH + H2O = NaOH + H2
NH3 + CO2 + H2O = (NH4)2CO32NH3 + CO2 + H2O = (NH4)2CO3
Ni(s) + HCl (aq) = NiCl2 (aq) + H2 (g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Ni+ HCl = NiCl2 + H2Ni + 2HCl = NiCl2 + H2
Ni(s) + HCl (aq) = NiCl2 (aq) + H2 (g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+H2O=H3O+NaONaOH + H2O = H3O + NaO
NaOH + H2O = H3O + NaONaOH + H2O = H3O + NaO
NaCN + H2O2 + H2O = NaHCO3 + NH3NaCN + H2O2 + H2O = NaHCO3 + NH3
N2O=N2+O22N2O = 2N2 + O2
NaCl+O2=Na2O+Cl24NaCl + O2 = 2Na2O + 2Cl2
Na2CO3+NiCl2= 2NaCl+NiCO3Na2CO3 + NiCl2 = 2NaCl + NiCO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
NH4+ + S2Cl2 = S4N4 + S + H+ + Cl-4NH4+ + 6S2Cl2 = S4N4 + 8S + 16H+ + 12Cl-
NaCN+H2O2+H2O=NaHCO3 +NH3NaCN + H2O2 + H2O = NaHCO3 + NH3
NaCN+H2O2+H2O=NaHCO3 +NH3NaCN + H2O2 + H2O = NaHCO3 + NH3
N2H4 = NH3(g) + N2 (g)3N2H4 = 4NH3(g) + N2(g)
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
NaHSO3 + HCl + K2Cr2O7 = NaHSO4 + KCl + Cr2O3 + H2O3NaHSO3 + 2HCl + K2Cr2O7 = 3NaHSO4 + 2KCl + Cr2O3 + H2O
NaHSO3 + HCl + KMnO4 = NaHSO4 + KCl +MnCl2 +H2O5NaHSO3 + 6HCl + 2KMnO4 = 5NaHSO4 + 2KCl + 2MnCl2 + 3H2O
NaHSO3 + HCl + KMnO4 = NaHSO4 + KCl +MnCl2 +H2O5NaHSO3 + 6HCl + 2KMnO4 = 5NaHSO4 + 2KCl + 2MnCl2 + 3H2O
NaHSO3 + HCl + K2Cr2O7 = NaHSO4 + KCl + Cr2O3 + H2O3NaHSO3 + 2HCl + K2Cr2O7 = 3NaHSO4 + 2KCl + Cr2O3 + H2O
Na2CO3+FeCr2O7+O2=Fe2O3+Na2CrO4+CO28Na2CO3 + 4FeCr2O7 + O2 = 2Fe2O3 + 8Na2CrO4 + 8CO2
NiF2+NH3=Ni3N+NH4F+N26NiF2 + 16NH3 = 2Ni3N + 12NH4F + N2
NiF2+NH3=Ni3N+NH4F+N3NiF2 + 8NH3 = Ni3N + 6NH4F + N
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Ni + O2= Ni2O34Ni + 3O2 = 2Ni2O3
Ni + O2= Ni2O34Ni + 3O2 = 2Ni2O3
NaCN+H2O2+H2O=NaHCO3 +NH3NaCN + H2O2 + H2O = NaHCO3 + NH3
NaI+Cl2=NaCl+I22NaI + Cl2 = 2NaCl + I2
NaNO3+H2SO4=Na2SO4+HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaO+H2O=NaOH+H-1NaO + 0H2O = -1NaOH + H
Na2C2O4 + C12H22O11 = NaHCO3 + CO2 + H2-13Na2C2O4 + 2C12H22O11 = -26NaHCO3 + 24CO2 + 35H2
Na2C2O4 + C12H22O11 = NaHCO2 + CO + H2-1Na2C2O4 + 0C12H22O11 = -2NaHCO2 + 0CO + H2
Na2C2O4 + C12H22O11 = NaHCO2 + CO2 + H2-1Na2C2O4 + 0C12H22O11 = -2NaHCO2 + 0CO2 + H2
Na2C2O4 + C12H22O11 = NaHCO3 + CO2 + H2-13Na2C2O4 + 2C12H22O11 = -26NaHCO3 + 24CO2 + 35H2
Na2C2O4 + C12H22O11 = NaHCO3 + CO2 + H2-13Na2C2O4 + 2C12H22O11 = -26NaHCO3 + 24CO2 + 35H2
Na2C2O4 + C12H22O11 = NaHCO3 + CO + H2-1Na2C2O4 + 2C12H22O11 = -2NaHCO3 + 24CO + 23H2
Na2C2O4 + C12H22O11 = NaHCO3 + CO2 + H2-13Na2C2O4 + 2C12H22O11 = -26NaHCO3 + 24CO2 + 35H2
Na2C2O4 + C12H22O11 = NaHCO3 + CO2 + H2-13Na2C2O4 + 2C12H22O11 = -26NaHCO3 + 24CO2 + 35H2
Na2C2O4 + C12H22O11 = NaO2 + CO2 + H2O-6Na2C2O4 + C12H22O11 = -12NaO2 + 0CO2 + 11H2O
Na2C2O4 + C12H22O11 = NaHCO3 + CO2 + H2O-24Na2C2O4 + C12H22O11 = -48NaHCO3 + 12CO2 + 35H2O
Na2C2O4 + C12H22O11 = NaHCO3 + CO2 + H2-13Na2C2O4 + 2C12H22O11 = -26NaHCO3 + 24CO2 + 35H2
Na2C2O4 + C12H22O11 = NaO2 + CO2 + H2-13Na2C2O4 + 4C12H22O11 = -26NaO2 + 22CO2 + 44H2
NH3 (g) +O2 (g) = NO (g) + H2O (g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NaCI+H2SO4=Na2SO4+HCI2NaCI + H2SO4 = Na2SO4 + 2HCI
Na+I2=NaI2Na + I2 = 2NaI
Na2TeO3 + NaI + HCl =NaCl + Te + H2O + I2Na2TeO3 + 4NaI + 6HCl = 6NaCl + Te + 3H2O + 2I2
NiSO4 + Li3PO4 = Ni3(PO4)2 + Li2SO43NiSO4 + 2Li3PO4 = Ni3(PO4)2 + 3Li2SO4
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
Na + O2 = NaO2Na + O2 = 2NaO
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaCl + H2O = HCl + NaOHNaCl + H2O = HCl + NaOH
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + H2O = NaOH +H2 2Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 +O2 +CH4=HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NO2+H2O=HNO2+HNO32NO2 + H2O = HNO2 + HNO3
Na + H2O = NaOH +H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH +HNa + H2O = NaOH + H
NO + KMnO4 = KNO3 + MnO2NO + KMnO4 = KNO3 + MnO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+H2 = NH3N2 + 3H2 = 2NH3
N+H = NH3N + 3H = NH3
Na2SO3 + Cl2 = SO2 + Na2SO4 + 2NaCl2Na2SO3 + Cl2 = SO2 + Na2SO4 + 2NaCl
Na3PO4 + 3AgNO3 =NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
Na(s) + H2O(l) = NaOH(aq) + H(g)Na(s) + H2O(l) = NaOH(aq) + H(g)
Na(s) + H2O(l) = NaOH(aq) + H(g)Na(s) + H2O(l) = NaOH(aq) + H(g)
Na(s) + H2O(l) = NaOH(aq) + H(g)Na(s) + H2O(l) = NaOH(aq) + H(g)
NaBr + H2SO4 = Na2SO4 + HBr2NaBr + H2SO4 = Na2SO4 + 2HBr
N2 + H2 =NH3N2 + 3H2 = 2NH3
NH4+ + 2O2 = H2O + NO3- + 2H+NH4+ + 2O2 = H2O + NO3- + 2H+
N2H4+H2O=N2+H2O0N2H4 + H2O = 0N2 + H2O
N3(PO4)2+H2SO4 = N2(SO4)2+H3PO42N3(PO4)2 + 6H2SO4 = 3N2(SO4)2 + 4H3PO4
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na(OH) + H2SO4 = Na2(SO4) + H2O2Na(OH) + H2SO4 = Na2(SO4) + 2H2O
Na3AsO3 + KOH + I2 =Na3AsO4 + KI + H2ONa3AsO3 + 2KOH + I2 = Na3AsO4 + 2KI + H2O
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaCl + LiNO3 = NaNO3 + LiClNaCl + LiNO3 = NaNO3 + LiCl
Na2Cr2O7 + HCl = NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
Na2Cr2O7 + HCl = NaCl + CrCl3 + H2O + Cl2Na2Cr2O7 + 14HCl = 2NaCl + 2CrCl3 + 7H2O + 3Cl2
NH4OH + FeSO4 = NH4SO4 + FeOHNH4OH + FeSO4 = NH4SO4 + FeOH
Na2SiO3 + Fe(NO3)2 + H2O = Fe(OH)2 + NaNO3 +SiO2Na2SiO3 + Fe(NO3)2 + H2O = Fe(OH)2 + 2NaNO3 + SiO2
NO2=NO+O22NO2 = 2NO + O2
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO2=NO+O22NO2 = 2NO + O2
NHO3 + O2 = NO3 + H2O4NHO3 + O2 = 4NO3 + 2H2O
NHO3 + O2 = NO2 + H2O4NHO3 - O2 = 4NO2 + 2H2O
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NaCl+ Pb(NO3)2 =NaNO3 + PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
NO2 + H2O = N2O + OH2NO2 + 3H2O = N2O + 6OH
NaCl + CO2 = NaCO3 + COCl NaCl + 2CO2 = NaCO3 + COCl
NaNO3 +CO2 =NaCO3 +NO2NaNO3 + CO2 = NaCO3 + NO2
Na2SiO3 + Fe(NO3)2 + H2O = Fe(OH)2 + NaNO3 +SiO2Na2SiO3 + Fe(NO3)2 + H2O = Fe(OH)2 + 2NaNO3 + SiO2
Na2SiO3 + FeCl3 + H2O = Fe(OH)3 + NaCl +SiO23Na2SiO3 + 2FeCl3 + 3H2O = 2Fe(OH)3 + 6NaCl + 3SiO2
Na2SiO3 + FeSO4 + H2O = Fe(OH)2 + Na2SO4 +SiO2Na2SiO3 + FeSO4 + H2O = Fe(OH)2 + Na2SO4 + SiO2
Na2SiO3 + FeSO4 =FeSiO3 + Na2SO4Na2SiO3 + FeSO4 = FeSiO3 + Na2SO4
NaHCO3 + HNO2 = NaHNO2 + HCO3NaHCO3 + HNO2 = NaHNO2 + HCO3
NaI + H2SO4 = I2 + H2S + H2O + NaSO44NaI + 5H2SO4 = 2I2 + H2S + 4H2O + 4NaSO4
Na + O2 = Na2O22Na + O2 = Na2O2
Na2B4O7 + H2O = NaOH + H3BO3Na2B4O7 + 7H2O = 2NaOH + 4H3BO3
NO2 = NO+O22NO2 = 2NO + O2
Na2CO3+H3PO4=Na3PO4+H2O+CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH4F+AlCl3=NH4Cl+AlF33NH4F + AlCl3 = 3NH4Cl + AlF3
NH4F+AlCl3=NH4Cl+AlF33NH4F + AlCl3 = 3NH4Cl + AlF3
N2+O2=N2O2N2 + O2 = 2N2O
Na+H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
NH4HCO3 + KI = NH4I + KHCO3NH4HCO3 + KI = NH4I + KHCO3
NaC2H3O2 + CaO + NaOH = CH4 + Ca(OH)2 + Na2CO3NaC2H3O2 + 0CaO + NaOH = CH4 + 0Ca(OH)2 + Na2CO3
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
Na3PO4 + PbSO4 = Na3SO4 + PbPO4Na3PO4 + PbSO4 = Na3SO4 + PbPO4
Nb(NO3)5(aq) + Na2O(aq) = Nb2O5(s) + NaNO3(aq)2Nb(NO3)5(aq) + 5Na2O(aq) = Nb2O5(s) + 10NaNO3(aq)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+H2O = NaOH+ H22Na + 2H2O = 2NaOH + H2
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Na(s)+H2O(l)=NaOH(aq)+H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH3 + CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
NaHSO3+HCI+K2Cr2O7=NaHSO4+KCI+Cr2O3+H2O3NaHSO3 + 2HCI + K2Cr2O7 = 3NaHSO4 + 2KCI + Cr2O3 + H2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NaOH+H3PO4=Na3PO4+H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
NO=N2O+NO23NO = N2O + NO2
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NaH2O = NaOH + H22NaH2O = 2NaOH + H2
NaOH + Ba(C2H3O2)2=BaOH +Na(C2H3O2)2NaOH + Ba(C2H3O2)2 = BaOH + Na(C2H3O2)2
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
N2O3 + NO2 = N2O5-1N2O3 + 4NO2 = N2O5
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2CO3 + HCl = NaCl + CO2 + H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaOH + 3HNO3 = NaNO3 + 2H2ONaOH + HNO3 = NaNO3 + H2O
NaF + Ca(CHO) = CaF + Na(CHO)NaF + Ca(CHO) = CaF + Na(CHO)
NH4Cl + MnO2 + H2SO4= NHSO4+ MnSO4 +H2O+Cl22NH4Cl + 5MnO2 + 7H2SO4 = 2NHSO4 + 5MnSO4 + 10H2O + Cl2
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + O2 = NaO2Na + O2 = 2NaO
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
NH3 + H2SO4 =(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
Na2CO3+ H2O= Na2O + H2CO3Na2CO3 + H2O = Na2O + H2CO3
NaHCO3+ Ga2O3 = NaHO3 + Ga2CO3NaHCO3 + Ga2O3 = NaHO3 + Ga2CO3
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
N2+C+Na2CO3 = NaCN+CO22N2 + 5C + 2Na2CO3 = 4NaCN + 3CO2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaOH +CuSO4 = Na2SO4 + Cu(OH)22NaOH + CuSO4 = Na2SO4 + Cu(OH)2
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + 2 H2SO4 = Na2SO4(aq) + H2O2NaOH + H2SO4 = Na2SO4(aq) + 2H2O
NaNO2 + KMnO4 = NaMnO4 + KNO2NaNO2 + KMnO4 = NaMnO4 + KNO2
NO2+NaOH = NaNO2 + OHNO2 + NaOH = NaNO2 + OH
NaI + KMnO4 = NaMnO4 + KINaI + KMnO4 = NaMnO4 + KI
NO2 + KOH = KNO2 + KNO3 + H2O2NO2 + 2KOH = KNO2 + KNO3 + H2O
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NH3 + O2 = NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2SO4(aq)+C4H6CaO4(aq)=Na2SO(aq)+C4H6CaO4(aq)0Na2SO4(aq) + C4H6CaO4(aq) = 0Na2SO(aq) + C4H6CaO4(aq)
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NaBr(aq)+AgNO3(aq)=AgBr(s)+NaNO3(aq)NaBr(aq) + AgNO3(aq) = AgBr(s) + NaNO3(aq)
NaBr(aq)+AgNO3(aq)=AgBr(s)+NaNO3(aq)NaBr(aq) + AgNO3(aq) = AgBr(s) + NaNO3(aq)
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
NiCO3+HNO3=Ni(NO3)2+CO2+H2ONiCO3 + 2HNO3 = Ni(NO3)2 + CO2 + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Ni + FeCl2 = NiCl2 + FeNi + FeCl2 = NiCl2 + Fe
NaCu(NO3)2 + NaNO2 + NaOH= CuOH + NaNO20NaCu(NO3)2 + NaNO2 + 0NaOH = 0CuOH + NaNO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NH + CuO = Cu + N2 + H2O2NH + CuO = Cu + N2 + H2O
NH + CuO = Cu + N2 + H2O2NH + CuO = Cu + N2 + H2O
NaOH+(NH4)2SO4=Na2SO4+NH4OH2NaOH + (NH4)2SO4 = Na2SO4 + 2NH4OH
NiCl2 + KNO3 = Ni(NO3) + KCl2NiCl2 + KNO3 = Ni(NO3) + KCl2
NaL + Pb(SO4)2 = PbL4 + Na2SO44NaL + Pb(SO4)2 = PbL4 + 2Na2SO4
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO2 = H2O + N2NH4NO2 = 2H2O + N2
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
Na2SO4 + 4C = Na2S + 4CO2Na2SO4 + 2C = Na2S + 2CO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+H6=6H(N)26N2 + H6 = 6H(N)2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NaI+Br2=NaBr+I22NaI + Br2 = 2NaBr + I2
NH4NO3(aq)+NiCl2(aq)=NiNO3+Cl2NH4NH4NO3(aq) + NiCl2(aq) = NiNO3 + Cl2NH4
NH4Cl+Ba(OH)2=H2O+NH3+BaCl22NH4Cl + Ba(OH)2 = 2H2O + 2NH3 + BaCl2
NaCl (aq) + AgNO3 (aq)=NaNO3 (aq) + AgCl (s) NaCl(aq) + AgNO3(aq) = NaNO3(aq) + AgCl(s)
NaHCO3 = Na2CO3 + H2O +CO2 2NaHCO3 = Na2CO3 + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na2S + HCl = NaCl + H2SNa2S + 2HCl = 2NaCl + H2S
NaCl = Na + Cl22NaCl = 2Na + Cl2
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na3PO4+AgNO3= NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NO + CH4 = HCN + H2O + H22NO + 2CH4 = 2HCN + 2H2O + H2
Na+HOH=NaOH+H22Na + 2HOH = 2NaOH + H2
NH3+ O2 +CH4 = HCN+ H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaHCO3 + H2SO4 = Na2SO4 + H2O + CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NH3 + O2 = N2O + H2O2NH3 + 2O2 = N2O + 3H2O
Na + H2O= NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + NO =N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 (s) + HCl (aq) = NaCl (aq) + H2O (l) + CO2 (g)Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
NaF + Ca(CHO) =CaF + Na(CHO)NaF + Ca(CHO) = CaF + Na(CHO)
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NH4 + O2 = NO + H2010NH4 + 5O2 = 10NO + 2H20
NH4 + O2 = NO + H2010NH4 + 5O2 = 10NO + 2H20
NH4 + 5O2 = NO + H2010NH4 + 5O2 = 10NO + 2H20
Ni(OH)2+H3O=H2O+NiNi(OH)2 + 2H3O = 4H2O + Ni
NaCH3-COO + Na(OH) + Ca( OH)2=CH4 + Na2CO3 + CaO + H2O0NaCH3-COO + 0Na(OH) + Ca(OH)2 = 0CH4 + 0Na2CO3 + CaO + H2O
NaCH3-COO + Na(OH) + Ca( OH)2=CH4 + Na2CO3 + CaO + H2O0NaCH3-COO + 0Na(OH) + Ca(OH)2 = 0CH4 + 0Na2CO3 + CaO + H2O
NaCH3-COO + Na(OH) + Ca( OH)2=CH4 + Na2 CO3 + CaO + H2O0NaCH3-COO + 0Na(OH) + Ca(OH)2 = 0CH4 + 0Na2CO3 + CaO + H2O
NaHCO3(aq)+H3C6H5O7(aq)=H2O(l)+CO2(g)+Na3C6H5O73NaHCO3(aq) + H3C6H5O7(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7
NaHCO2(aq)+H3C6H5O7(aq)=H2O(aq)+CO2(aq)+Na3C6H5O79NaHCO2(aq) + 2H3C6H5O7(aq) = 5H2O(aq) + 3CO2(aq) + 3Na3C6H5O7
NaHCO2(aq)+H3C6H5O7(aq)=H2O+CO2+Na3C6H5O79NaHCO2(aq) + 2H3C6H5O7(aq) = 5H2O + 3CO2 + 3Na3C6H5O7
NaBr + Cl2 =NaCl +Br22NaBr + Cl2 = 2NaCl + Br2
NO2- + H+ + I- = I2 + N2 + H2O2NO2- + 8H+ + 6I- = 3I2 + N2 + 4H2O
NaI + Cl2 = NaCl + I22NaI + Cl2 = 2NaCl + I2
NaNO3 + H2SO4 = Na2SO4 + HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na2CO3+Pb(NO3)2=PbCO3+Na2(NO3)2Na2CO3 + Pb(NO3)2 = PbCO3 + Na2(NO3)2
Na2CO3+Pb(NO3)2=PbCO3+Na2(NO3)2Na2CO3 + Pb(NO3)2 = PbCO3 + Na2(NO3)2
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=Na(OH)+H22Na + 2H2O = 2Na(OH) + H2
Na2S+AgNO3=Na2NO3+AgSNa2S + AgNO3 = Na2NO3 + AgS
Na2CO3+AgNO3=Na2NO3+AgCO3Na2CO3 + AgNO3 = Na2NO3 + AgCO3
NH3= N2+ H22NH3 = N2 + 3H2
NH3+ Na=H2+ NaNH22NH3 + 2Na = H2 + 2NaNH2
NiCl2= Ni+ Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NiCl2=Ni+Cl2NiCl2 = Ni + Cl2
NaCO3 + H2SO4 = NaSO4 + H2O + CO2NaCO3 + H2SO4 = NaSO4 + H2O + CO2
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + O = Na2O2Na + O = Na2O
Na + O2 = Na2O4Na + O2 = 2Na2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3SO4 + MgCl2 = NH3Cl2 + MgSO4NH3SO4 + MgCl2 = NH3Cl2 + MgSO4
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NH3 + O2 = HNO3 + H2NH3 + 3O2 = 2HNO3 + 4H
NaHCO3 = NaCO3 + CO2 + H2020NaHCO3 = 20NaCO3 + 0CO2 + H20
NO + H2 = H2O +N22NO + 2H2 = 2H2O + N2
NaCl + SO2 + H2O + O2 = HCl + Na2SO44NaCl + 2SO2 + 2H2O + O2 = 4HCl + 2Na2SO4
NaBr + AgNO3 = NaNO3 + AgBrNaBr + AgNO3 = NaNO3 + AgBr
NaCl + Pb(NO3)2 = NaNO3 + PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
N2(g) + H2(g) =NH3N2(g) + 3H2(g) = 2NH3
NH4NO3(s) =N2O(g) + H2O(l) NH4NO3(s) = N2O(g) + 2H2O(l)
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Na2SO4 + 2 NH4NO3 = (NH4)2SO4 + 2 NaNO3Na2SO4 + 2NH4NO3 = (NH4)2SO4 + 2NaNO3
NiSO4 + AgNO3 = Ni(NO3)2 + Ag2SO4NiSO4 + 2AgNO3 = Ni(NO3)2 + Ag2SO4
Na + O2 = Na2O22Na + O2 = Na2O2
Na(s) + O2(g) = Na2O2(s)2Na(s) + O2(g) = Na2O2(s)
Na2SO4 + Pb(NO3)2 = NaNO3 + PbSO4Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NaOH + H3PO4= H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.