Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Na2CO3+C+N2=NaCN+CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH4Cl= NH3+HClNH4Cl = NH3 + HCl
NaCl + H2SO4 = Na2SO4 + HCl 2NaCl + H2SO4 = Na2SO4 + 2HCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NaClO3 = NaCl + O22NaClO3 = 2NaCl + 3O2
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
Na2O + H2O=NaOHNa2O + H2O = 2NaOH
Ni(NO3)2+NaOH=Ni(OH)2+NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
NaOH(aq) + CaCl 2(aq) = Ca(OH)2(s) + NaCl(aq) 2NaOH(aq) + CaCl2(aq) = Ca(OH)2(s) + 2NaCl(aq)
NH4SCN + O2 = NH42O + SO2 + CO2 + NO221NH4SCN + 83O2 = 2NH42O + 21SO2 + 21CO2 + 40NO2
NH4SCN + O2 = NH42O + SO2 + CO2 + NO221NH4SCN + 83O2 = 2NH42O + 21SO2 + 21CO2 + 40NO2
NH4Cl + KOH = NH3 + H2O + KClNH4Cl + KOH = NH3 + H2O + KCl
NH4Cl + KOH = NH3 + H2O + KClNH4Cl + KOH = NH3 + H2O + KCl
NaOH+(NH4)2SO4=Na2SO4+H2O+NH32NaOH + (NH4)2SO4 = Na2SO4 + 2H2O + 2NH3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+F2=NF3N2 + 3F2 = 2NF3
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=HNO2+H2O2NH3 + 3O2 = 2HNO2 + 2H2O
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
N2+O2=N2O2N2 + O2 = 2N2O
NH3 + CO2 = (NH2)2CO + H2O 2NH3 + CO2 = (NH2)2CO + H2O
Na + I2 = NaI2Na + I2 = 2NaI
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NH4NO3=N2O+ H2ONH4NO3 = N2O + 2H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na2O+H2O=NaOHNa2O + H2O = 2NaOH
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaOH + CuSO4 = Na2SO4 + Cu(OH)22NaOH + CuSO4 = Na2SO4 + Cu(OH)2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
NaOHKOH + HCl = HNaOH + KOHClNaOHKOH + HCl = HNaOH + KOHCl
NaOHKOH + HCl = HNa + OHKOHClNaOHKOH + HCl = HNa + OHKOHCl
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaN3=Na+N22NaN3 = 2Na + 3N2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NiS + O2 = Ni2S3 + Ni2SO44NiS + 2O2 = Ni2S3 + Ni2SO4
NiS + O2 = Ni2S3 + NiSO4NiS + 2O2 = 0Ni2S3 + NiSO4
NiS + O2 = Ni2S3 + NiO6NiS + O2 = 2Ni2S3 + 2NiO
NiS + O2 = Ni2S3 + O0NiS + O2 = 0Ni2S3 + 2O
NH3+O2=NO=H2020NH3 + 10O2 = 20NO + 3H20
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
Na +H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na +H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na +H2O=NaOH+H2O0Na + H2O = 0NaOH + H2O
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
Na2CO3 + Mg(NO3)2 = MgCO3 + NaNO3Na2CO3 + Mg(NO3)2 = MgCO3 + 2NaNO3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Na3PO4 + AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NH4I + Cl2 = NH4Cl + I22NH4I + Cl2 = 2NH4Cl + I2
NO+O2=NO22NO + O2 = 2NO2
NH2OH+H2SO4= 2H2O+ NH3SO4NH2OH + H2SO4 = H2O + NH3SO4
Na2SiO3 + HF = H2SiF6 + NaF + H2ONa2SiO3 + 8HF = H2SiF6 + 2NaF + 3H2O
NaCrO2+Na2O2+H2O=Na2CrO4+NaOH2NaCrO2 + 3Na2O2 + 2H2O = 2Na2CrO4 + 4NaOH
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NaOH+CO2=Na2CO3+HOH2NaOH + CO2 = Na2CO3 + HOH
N2H4 + O2 = H2O2 + N2N2H4 + 2O2 = 2H2O2 + N2
Na2SiO3 + HF = H2SiF6 + NaF + H2ONa2SiO3 + 8HF = H2SiF6 + 2NaF + 3H2O
Na2SiO3 + HF = H2SiF6 + NaF + H2ONa2SiO3 + 8HF = H2SiF6 + 2NaF + 3H2O
NaBrO3+NaBr+H2SO4=Br2+Na2SO4+H2ONaBrO3 + 5NaBr + 3H2SO4 = 3Br2 + 3Na2SO4 + 3H2O
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NiCl2+Pb=PbCl2+NiNiCl2 + Pb = PbCl2 + Ni
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaClO4=NaCl+O2NaClO4 = NaCl + 2O2
Na2CO3 + KOH= K2CO3 + NaOHNa2CO3 + 2KOH = K2CO3 + 2NaOH
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + CuSO4=CuCO3 + Na2SO4Na2CO3 + CuSO4 = CuCO3 + Na2SO4
NO + MnO4- = NO3- + MnO2NO + MnO4- = NO3- + MnO2
Na2CO3 + BaCl2 = Na2Cl2 + BaCO3Na2CO3 + BaCl2 = Na2Cl2 + BaCO3
NaCO3 + BaCl2 = NaCl2 + BaCO3NaCO3 + BaCl2 = NaCl2 + BaCO3
Na2SO4= Na2SO3+O2=2Na2SO4 = 2Na2SO3 + O2
Na2SO4= Na2SO3+O2=2Na2SO4 = 2Na2SO3 + O2
Na2SO4= Na2SO3+O2=2Na2SO4 = 2Na2SO3 + O2
Na2SO4= Na2SO3+O2=2Na2SO4 = 2Na2SO3 + O2
NaClO4 = NaCl + ONaClO4 = NaCl + 4O
Na+H4O=H2+NaOH2Na + 2H4O = 3H2 + 2NaOH
N2O4=NO2N2O4 = 2NO2
Na2 S + Pb(NO3)2 = Na2 NO3 + Pb S22Na2S + Pb(NO3)2 = 2Na2NO3 + PbS2
NH3 + H2SO4 = (NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na+ HCl=NaCl+HNa + HCl = NaCl + H
NaNO3+PbO=Pb(NO3)2+Na2O2NaNO3 + PbO = Pb(NO3)2 + Na2O
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
Na2SO4+BaCl2=BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NH4Cl + KOH = NH3 + H2O + KClNH4Cl + KOH = NH3 + H2O + KCl
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
Na+O2=Na2O4Na + O2 = 2Na2O
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
Ni(ClO3)2=NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na+O2=Na2O4Na + O2 = 2Na2O
Na2SO4(aq)+KI(aq)=Na2I+KSO4Na2SO4(aq) + KI(aq) = Na2I + KSO4
NO(g) + O2(g) = NO2(g)2NO(g) + O2(g) = 2NO2(g)
NaClO3=O2+NaCl2NaClO3 = 3O2 + 2NaCl
NH3(g) + O2(g) = N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH3(g) + O2(g) = N2(g) + H2O(g)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(g)
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + O2 = Na2O4Na + O2 = 2Na2O
NaOH + H2CO3 = Na2CO3 + H2O 2NaOH + H2CO3 = Na2CO3 + 2H2O
N2 + O2 = N2O52N2 + 5O2 = 2N2O5
Na + O2 = Na2O22Na + O2 = Na2O2
Na + NaNO3 = Na2O + N210Na + 2NaNO3 = 6Na2O + N2
Na+NaNO3=Na2O+N210Na + 2NaNO3 = 6Na2O + N2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + CO2 + H2O = (NH4)2CO32NH3 + CO2 + H2O = (NH4)2CO3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = N2O2N2 + O2 = 2N2O
NaPO4+Pb=PbPO4+NaNaPO4 + Pb = PbPO4 + Na
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaOH+H2O+Al=NaAl(OH)4+H22NaOH + 6H2O + 2Al = 2NaAl(OH)4 + 3H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+ClO-=NH2Cl+OH-NH3 + ClO- = NH2Cl + OH-
NaCl+H2SO4=Na2SO4+HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NiCl2+NaOH=Ni(OH)2+NaClNiCl2 + 2NaOH = Ni(OH)2 + 2NaCl
Na+O2=Na2O4Na + O2 = 2Na2O
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaHCO3 = NaOH + CO2 NaHCO3 = NaOH + CO2
N 2 O 5 (g)+H 2 O(l)=HNO 3 (aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N2CL4 + CH4 = N + H + CCLN2CL4 + 7CH4 = 2N + 28H + 4CCL
Na2CO3+Ca(OH)2=2NaOH+CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaOH+H2SO4=H2O+Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na2CO3 + C + N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NH4Cl+Ba(OH)2=BaCl2+NH3+H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
N2 + H2O=NH3 + O22N2 + 6H2O = 4NH3 + 3O2
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaHCO3+CH3COOH = CO2+H2O+NaCH3COONaHCO3 + CH3COOH = CO2 + H2O + NaCH3COO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Ni(s) + HCl(aq) = NiCl + H22Ni(s) + 2HCl(aq) = 2NiCl + H2
Ni(s) + HCl(aq) = NiCl + HNi(s) + HCl(aq) = NiCl + H
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
Na + Cl2 = Na Cl2Na + Cl2 = 2NaCl
Na + O2=Na2O4Na + O2 = 2Na2O
Na + O =Na2O2Na + O = Na2O
NH3+H2O=NH4OHNH3 + H2O = NH4OH
Na+Br2=NaBr2Na + Br2 = 2NaBr
Na2O+CO2=Na2CO3Na2O + CO2 = Na2CO3
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NaCl+AgNO3=NaNO3+AgClNaCl + AgNO3 = NaNO3 + AgCl
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
NaHCO3 + HCl = NaCl + H2O + CO2 NaHCO3 + HCl = NaCl + H2O + CO2
NaCl(aq) + AgNO3(aq)= AgCl + NaNO3NaCl(aq) + AgNO3(aq) = AgCl + NaNO3
Ni + H2SO4= NiSO4+ H2Ni + H2SO4 = NiSO4 + H2
Ni(s) + H2SO4(aq) = NiSO4(aq) + H2(g)Ni(s) + H2SO4(aq) = NiSO4(aq) + H2(g)
N2+O3=N2O3N2 + O3 = N2O3
Na2CO3 + FeBr3 = Fe2(CO3)3 + NaBr3Na2CO3 + 2FeBr3 = Fe2(CO3)3 + 6NaBr
Na3PO4 + SrCl2 = Sr3(PO4)2 + NaCl2Na3PO4 + 3SrCl2 = Sr3(PO4)2 + 6NaCl
Na3PO4 + CoCl3 = CoPO4 + NaClNa3PO4 + CoCl3 = CoPO4 + 3NaCl
NO3- + C6H12O6 + H+ = N2O + CO2 + H2O6NO3- + C6H12O6 + 6H+ = 3N2O + 6CO2 + 9H2O
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na2S+Cu(NO3)2=NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NaBr + Cl2 = NaCl + Br22NaBr + Cl2 = 2NaCl + Br2
NH3+O2=N+H2O4NH3 + 3O2 = 4N + 6H2O
NH3(g) + H2O(g) = H2(g) + NO2(g)2NH3(g) + 4H2O(g) = 7H2(g) + 2NO2(g)
NaOH+HCl=NaCl+HOHNaOH + HCl = NaCl + HOH
NaHCO3+HCl=CO2+H2O+NaClNaHCO3 + HCl = CO2 + H2O + NaCl
Na3PO4 + HCl = NaCl + H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2 + O2 + H2O = HNO32N2 + 5O2 + 2H2O = 4HNO3
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na+O2=Na2O4Na + O2 = 2Na2O
Na + Cl = NaClNa + Cl = NaCl
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO +H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+O2=NON2 + O2 = 2NO
NiCl2+O2=NiO+Cl2O5NiCl2 + 3O2 = NiO + Cl2O5
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+Br2=NaBr2Na + Br2 = 2NaBr
NiSO4+K3PO4 = K3SO4+ NiPO4NiSO4 + K3PO4 = K3SO4 + NiPO4
NiSO4+K3PO4 = K3SO4+ NiPO4NiSO4 + K3PO4 = K3SO4 + NiPO4
Na2O + P4O10 = Na3PO46Na2O + P4O10 = 4Na3PO4
Na+H3PO4=Na3PO4+H26Na + 2H3PO4 = 2Na3PO4 + 3H2
NaHCO3 = Na2CO3 + H2O + CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2S2O3+AgBr=Na3Ag(S2O3)2+NaBr2Na2S2O3 + AgBr = Na3Ag(S2O3)2 + NaBr
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
N2 + H2=NH3N2 + 3H2 = 2NH3
N2 + 2 H2= 2 NH3N2 + 3H2 = 2NH3
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Ni (ClO3)2 = NiCl2 + O2Ni(ClO3)2 = NiCl2 + 3O2
Na2CO3 + CoSO4 = Co2CO3+ Na(SO4)Na2CO3 + 2CoSO4 = Co2CO3 + 2Na(SO4)
NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Na2S + 2HNO3 = H2S + 2NaNO3Na2S + 2HNO3 = H2S + 2NaNO3
NaOH + NH4Cl = NH3 + H2O + NaClNaOH + NH4Cl = NH3 + H2O + NaCl
NaNO3 + MgI2 = MgNO3 + NaI2NaNO3 + MgI2 = MgNO3 + NaI2
NO + H2O = NH3 + O24NO + 6H2O = 4NH3 + 5O2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NaNO2+H2O=NO+O2+NaOH4NaNO2 + 2H2O = 4NO + O2 + 4NaOH
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NH4NO2=N2+H2ONH4NO2 = N2 + 2H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaOH + H2O=Na+OHNaOH + 0H2O = Na + OH
Na(s)+H2O(l)=NaOH(aq)+H22Na(s) + 2H2O(l) = 2NaOH(aq) + H2
NO +Cl2= NCl 3 + O 22NO + 3Cl2 = 2NCl3 + O2
NaHCO3+HC2H3O2=NaC2H3O2+H2CO3NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO3
N2H4+H2O2=N2+H2ON2H4 + 2H2O2 = N2 + 4H2O
NaI+Pb(SO4)2=PbI4+Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NaI+Ca(SO4)=Na(SO4)+CaINaI + Ca(SO4) = Na(SO4) + CaI
N2+O2=NO2N2 + 2O2 = 2NO2
NH4OH + H3PO4= (NH4)3PO4+ H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaBr + Ba(NO3)2 = BaBr2 + Na(NO3)2NaBr + Ba(NO3)2 = BaBr2 + 2Na(NO3)
NaBr + Ba(NO3)2 = BaBr2 + Na(NO3)2NaBr + Ba(NO3)2 = BaBr2 + 2Na(NO3)
NH4NO3 + H2O = NH4 + NO3NH4NO3 + 0H2O = NH4 + NO3
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaN3 = Na + N22NaN3 = 2Na + 3N2
NO + O2 = NO22NO + O2 = 2NO2
N2+F2=NF3N2 + 3F2 = 2NF3
Na3PO4+CaCi2=NaCi+Ca3(PO4)22Na3PO4 + 3CaCi2 = 6NaCi + Ca3(PO4)2
Na + P = NaPNa + P = NaP
Na3PO4 + 3AgNO3 = NaNO3 + Ag3PO4Na3PO4 + 3AgNO3 = 3NaNO3 + Ag3PO4
NH4OH + H3PO4= (NH4)3PO4+ H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
NH4OH + H3PO4= (NH4)3PO4+ H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
NaCl + AgNO3 = NaNO3 + AgClNaCl + AgNO3 = NaNO3 + AgCl
N2+F2=NF3N2 + 3F2 = 2NF3
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
Na2CO3+FeCl2= Na2Cl2+ FeCO3Na2CO3 + FeCl2 = Na2Cl2 + FeCO3
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
Na2S2O3+Cl2+H2O=NaHSO4+HClNa2S2O3 + 4Cl2 + 5H2O = 2NaHSO4 + 8HCl
Na2S2O3+Cl2+H2O=NaHSO4+HClNa2S2O3 + 4Cl2 + 5H2O = 2NaHSO4 + 8HCl
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+Cl2=NH4Cl+N28NH3 + 3Cl2 = 6NH4Cl + N2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH3 + H2O = NH4OHNH3 + H2O = NH4OH
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na+H2O =NaOH +H22Na + 2H2O = 2NaOH + H2
NH4NO3(s)=N2O(g)+H2O(l) NH4NO3(s) = N2O(g) + 2H2O(l)
NaCl+SO2+H2O+O2=Na2SO4+HCl4NaCl + 2SO2 + 2H2O + O2 = 2Na2SO4 + 4HCl
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Ni+O2=Ni2O34Ni + 3O2 = 2Ni2O3
Na2Cr2O7 + AlPO4 = Na3PO4 + Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
NaOCI+H2S2O3=Na2SO4+HCI+H2O-4NaOCI - H2S2O3 = -2Na2SO4 - 4HCI + H2O
N2O5 (g) + H2O (l) = 2HNO3 (l)N2O5(g) + H2O(l) = 2HNO3(l)
NO+O2=NO22NO + O2 = 2NO2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaNO3+KCl=NaCl+KNO3NaNO3 + KCl = NaCl + KNO3
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NO2=NO+O22NO2 = 2NO + O2
Na+O2=Na2O4Na + O2 = 2Na2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
N2+O2=N2O2N2 + O2 = 2N2O
NaOH+HC2H3O2=NaC2H3O2+HOHNaOH + HC2H3O2 = NaC2H3O2 + HOH
NO + Cl2 = NOCl2NO + Cl2 = 2NOCl
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NO(g) + H2(g) = NH3(g) + H2O(g) 2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
Na+Cl=NaClNa + Cl = NaCl
NH4OH + NH4Cl = 2NH4 + ClOHNH4OH + NH4Cl = 2NH4 + ClOH
N2+F2=NF3N2 + 3F2 = 2NF3
NH3 + HCl = NH4ClNH3 + HCl = NH4Cl
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH4Cl=NH3+HClNH4Cl = NH3 + HCl
NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2CO3+CoCl2=NaCl+CoCO3Na2CO3 + CoCl2 = 2NaCl + CoCO3
Na2SO3+H3PO4=H2SO3+Na3PO43Na2SO3 + 2H3PO4 = 3H2SO3 + 2Na3PO4
N2 + H2 = NH4N2 + 4H2 = 2NH4
NaNO2 + NH4Cl = NaCl + N2 + H2ONaNO2 + NH4Cl = NaCl + N2 + 2H2O
NaCl+AgC2H3O2=NaC2H3O2+AgClNaCl + AgC2H3O2 = NaC2H3O2 + AgCl
NaHCO3 + HCl = CO2 + HOH + NaClNaHCO3 + HCl = CO2 + HOH + NaCl
NaHCO3 = Na2CO3 + CO2 + HOH2NaHCO3 = Na2CO3 + CO2 + HOH
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
NaClO + AgNO = NaNO + AgClONaClO + AgNO = NaNO + AgClO
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + HNO3 = NaNO3 + H2O + NH4NO38Na + 10HNO3 = 8NaNO3 + 3H2O + NH4NO3
Na + H2 = NaH2Na + H2 = 2NaH
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
NH4NO3 = N2O +H2ONH4NO3 = N2O + 2H2O
NaOH + Cl2 = NaCl + NaClO +H2O2NaOH + Cl2 = NaCl + NaClO + H2O
NH4Br + LiOH = NH4OH + LiBrNH4Br + LiOH = NH4OH + LiBr
NH3(g)+NO(g)=N2(g)+H2O(l)4NH3(g) + 6NO(g) = 5N2(g) + 6H2O(l)
Na+Cl=NaClNa + Cl = NaCl
Na+O2=Na2O4Na + O2 = 2Na2O
Na+H2O=NaOH=H22Na + 2H2O = 2NaOH + H2
NaNO3 = NaNO2 + O22NaNO3 = 2NaNO2 + O2
NaOH + H3PO4 = Na3PO4 + H2O3NaOH + H3PO4 = Na3PO4 + 3H2O
Na3PO4 + BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
Na2SO4 + CuCl2 = CuSO4 +NaClNa2SO4 + CuCl2 = CuSO4 + 2NaCl
Na3PO4 + CoCl3 = CoPO4 + NaClNa3PO4 + CoCl3 = CoPO4 + 3NaCl
NaCl + H2SO4 =Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
Na2SO4 + C = Na2S + CO2Na2SO4 + 2C = Na2S + 2CO2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2O+(NH4)2SO4=Na2SO4+H2O+NH3Na2O + (NH4)2SO4 = Na2SO4 + H2O + 2NH3
NH4Cl+Ba(OH)2=BaCl2+NH3+H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na2S2O3+I2=NaI+Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + F2 = NaF + Cl22NaCl + F2 = 2NaF + Cl2
NH4I+Cl2=NH4Cl+I22NH4I + Cl2 = 2NH4Cl + I2
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
NaBr+Cl2=NaCl+Br22NaBr + Cl2 = 2NaCl + Br2
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl=NaClNa + Cl = NaCl
NH4ClO4 = N2 + Cl2 + O2 + H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
N2H4=NH3+N23N2H4 = 4NH3 + N2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na + H2CO3=NaHCO3 + H22Na + 2H2CO3 = 2NaHCO3 + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na2SO4+Pb(NO3)2=NaNO3+PbSO4 Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
Na2SO4+Pb(NO3)2=NaNO3+PbSO4 Na2SO4 + Pb(NO3)2 = 2NaNO3 + PbSO4
NH3 + O = NO2 + H2O2NH3 + 7O = 2NO2 + 3H2O
NO+O2=NO22NO + O2 = 2NO2
Na(OH) + CoCl2 = NaCl + Co(OH)22Na(OH) + CoCl2 = 2NaCl + Co(OH)2
N2+H2=NH3N2 + 3H2 = 2NH3
Na(CH3COO) + HCl = (CH3COO)H + NaClNa(CH3COO) + HCl = (CH3COO)H + NaCl
NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2S2+NaClO3=NaCl+SO2+Na2O3Na2S2 + 5NaClO3 = 5NaCl + 6SO2 + 3Na2O
Na2CO3 + Ca(OH)2 = NaOH + CaCO3Na2CO3 + Ca(OH)2 = 2NaOH + CaCO3
NH3 + O2 = N2 + H2O4NH3 + 3O2 = 2N2 + 6H2O
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NH4O2 = H2O + N22NH4O2 = 4H2O + N2
NH4OH + HCl = H2O + NH4ClNH4OH + HCl = H2O + NH4Cl
NO3+Sn=NO2+Sn0NO3 + Sn = 0NO2 + Sn
NaCl + H2O = NaOH + H2 + Cl22NaCl + 2H2O = 2NaOH + H2 + Cl2
Na + Cl = NaClNa + Cl = NaCl
Na + Cl = NaClNa + Cl = NaCl
Na2S+Cu(NO3)2 = NaNO3+CuSNa2S + Cu(NO3)2 = 2NaNO3 + CuS
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4Cl + Ca (OH)2 = CaCl2 + NH3 +H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH4Cl + KOH = NH3 + H2O + KClNH4Cl + KOH = NH3 + H2O + KCl
NO2+O2=N2O54NO2 + O2 = 2N2O5
N2O+NH3=N2+H2O3N2O + 2NH3 = 4N2 + 3H2O
NO2+H20=HNO3=NO40NO2 + H20 = 20HNO3 + 20NO
NaCl=Na+Cl22NaCl = 2Na + Cl2
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
NaBr+Ca(OH)2=CaBr2+NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na2S+NiSO4=Na2SO4+NiSNa2S + NiSO4 = Na2SO4 + NiS
Na(s)+S(s)=Na2S(s)2Na(s) + S(s) = Na2S(s)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N3 + H2 = NH32N3 + 9H2 = 6NH3
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2SO4(s) + C(s) = Na2S(s) + CO(g)Na2SO4(s) + 4C(s) = Na2S(s) + 4CO(g)
Na2SO4 + CaCO3 = CaSO4 + Na2CO3Na2SO4 + CaCO3 = CaSO4 + Na2CO3
Na2CO3+2HCI=2NaCI+H2O+CO2Na2CO3 + 2HCI = 2NaCI + H2O + CO2
N2+2H2=NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaCl+2H2SO4+MnO2 = Na2SO4+MnSO4+H2O+Cl22NaCl + 2H2SO4 + MnO2 = Na2SO4 + MnSO4 + 2H2O + Cl2
N2+2H2 =NH3N2 + 3H2 = 2NH3
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
N2O5 + H2O = H NO3N2O5 + H2O = 2HNO3
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Ni2S3 + O2 = Ni2O3 + SO22Ni2S3 + 9O2 = 2Ni2O3 + 6SO2
NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
NaBr + CaF2 = NaF + CaBr22NaBr + CaF2 = 2NaF + CaBr2
NH3+NO=N2+H2O4NH3 + 6NO = 5N2 + 6H2O
Ni2S3 + O2 = Ni2O3 + SO22Ni2S3 + 9O2 = 2Ni2O3 + 6SO2
N2 + O2 = N2O32N2 + 3O2 = 2N2O3
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NaOH + H2SO4 =H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
NH3+CuO=Cu+N2+H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaHCO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
Na2SO4+BaCl2=BaSO4+NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
Na+H3PO4=Na3PO4+H26Na + 2H3PO4 = 2Na3PO4 + 3H2
Na2CO3+HCl=NaCl+CO2+H2ONa2CO3 + 2HCl = 2NaCl + CO2 + H2O
NaHCO3(s)=Na2CO3(s)+CO2(g)+H2O(g)2NaHCO3(s) = Na2CO3(s) + CO2(g) + H2O(g)
NH4L+Cl2=NH4Cl+L22NH4L + Cl2 = 2NH4Cl + L2
NH4L+Cl2=NH4Cl+L22NH4L + Cl2 = 2NH4Cl + L2
NaHCO3 (aq) + C6H8O7 (aq) = Na3C6H5O7 (aq) + CO2 (g) + H2O (l) 3NaHCO3(aq) + C6H8O7(aq) = Na3C6H5O7(aq) + 3CO2(g) + 3H2O(l)
Na(s) + N2(g) = Na3N(s)6Na(s) + N2(g) = 2Na3N(s)
NO + H2O + O2 = HNO34NO + 2H2O + 3O2 = 4HNO3
Na + H2O = NaHO + H22Na + 2H2O = 2NaHO + H2
Na + H2O = NaHO + H22Na + 2H2O = 2NaHO + H2
Na + H2O = NaOH +H2 2Na + 2H2O = 2NaOH + H2
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
Na+ HNO3 = NaNO3 + NO + H2O3Na + 4HNO3 = 3NaNO3 + NO + 2H2O
Na2CO3 (s) + HCl (aq)=NaCl (aq) + CO2 (g) + H2O (l)Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + CO2(g) + H2O(l)
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3 +H2O= NH4 +OHNH3 + H2O = NH4 + OH
N2O5 + H2O = HNO3 N2O5 + H2O = 2HNO3
Na2CO3+HCl=NaCl+H2O+CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
NaH CO3=Na2CO3+H2O+CO22NaHCO3 = Na2CO3 + H2O + CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO=N2O +NO2 3NO = N2O + NO2
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
NaCl+F2=NaF+Cl22NaCl + F2 = 2NaF + Cl2
NO2 + H2O = NH3 + O24NO2 + 6H2O = 4NH3 + 7O2
Na2Cr2O7 + AlPO4 = Na3PO4 + Al2(Cr2O7)33Na2Cr2O7 + 2AlPO4 = 2Na3PO4 + Al2(Cr2O7)3
NaNO3 + H2SO4 = Na2SO4 + HNO32NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NH4Cl + Ca(OH)2 = CaCl2 + NH3 + H2O2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NO + O2 = NO22NO + O2 = 2NO2
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na+O2=Na2O4Na + O2 = 2Na2O
N2+H2=NH3N2 + 3H2 = 2NH3
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+H2=NH3N2 + 3H2 = 2NH3
Na+Cl=NaClNa + Cl = NaCl
NaCl+H2SO4=HCl+Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
NH3+Cl2=NH4Cl+NCl34NH3 + 3Cl2 = 3NH4Cl + NCl3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NiS+O2=NiO+SO22NiS + 3O2 = 2NiO + 2SO2
NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
Na2O2+H2O+CO2=NaHCO3+O22Na2O2 + 2H2O + 4CO2 = 4NaHCO3 + O2
NaHCO3+HC2H3O2=NaC2H3O2+H2O+CO2NaHCO3 + HC2H3O2 = NaC2H3O2 + H2O + CO2
Na+S=NaSNa + S = NaS
Na+I2=NaI2Na + I2 = 2NaI
NO3- + Sn++ + H+ = NO2 + H2O + Sn++++2NO3- + Sn++ + 4H+ = 2NO2 + 2H2O + Sn++++
N2 + Li = Li3NN2 + 6Li = 2Li3N
Na+Br2=NaBr2Na + Br2 = NaBr2
Na+Br2=NaBr2Na + Br2 = 2NaBr
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
Na+S=NaSNa + S = NaS
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO(g)+H2(g)=N2O(g)+H2O(g)2NO(g) + H2(g) = N2O(g) + H2O(g)
NaI + Pb(SO4)2 = PbI4 + Na2SO44NaI + Pb(SO4)2 = PbI4 + 2Na2SO4
NH3+NO=N+H2O2NH3 + 3NO = 5N + 3H2O
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
Na2CO3 + 2HNO3 = H2O + CO2 + 2NaNO3Na2CO3 + 2HNO3 = H2O + CO2 + 2NaNO3
NaOH+H2SO4 =Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2H4 + H2O2 = NO + H2ON2H4 + 4H2O2 = 2NO + 6H2O
NH3 + CO2 = CO(NH2)2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2CO3+Mg(NO3)2=NaNO3+MgCO3Na2CO3 + Mg(NO3)2 = 2NaNO3 + MgCO3
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
Na(ClO3) = NaCl + O22Na(ClO3) = 2NaCl + 3O2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.