Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2O + H2O = 2NaOHNa2O + H2O = 2NaOH
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na2 SO4 + H2O = NaO + (H2)2SO4Na2SO4 + 2H2O = 2NaO + (H2)2SO4
N2H4=NH3+N23N2H4 = 4NH3 + N2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2 + O2 = NON2 + O2 = 2NO
NH4I+Cl2=NH4Cl+I22NH4I + Cl2 = 2NH4Cl + I2
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NH3+Cl2=N2+NH4Cl8NH3 + 3Cl2 = N2 + 6NH4Cl
Na2S(aq) + Cu(NO3)2(aq) = 2 NaNO3 + CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3 + CuS(s)
NaOH + NaNO2 + Al + H20 = NH3 + NaAlO20NaOH + 20NaNO2 + 20Al + 3H20 = 20NH3 + 20NaAlO2
NO + NH3 = N2 + H2O6NO + 4NH3 = 5N2 + 6H2O
NaOH(aq) + K2SO4(aq) = Na2SO4(aq) + KOH(aq)2NaOH(aq) + K2SO4(aq) = Na2SO4(aq) + 2KOH(aq)
N2O5(g)+H2O(l)=2HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
Na+H2O= NaOH+H22Na + 2H2O = 2NaOH + H2
NaNO2+ H2 O=HNO2+ NaOHNaNO2 + H2O = HNO2 + NaOH
N H 4 N O 3 (s)=N 2 (g)+ O 2 (g)+ H 2 O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NaNO2+ H2O=HNO2+ NaOHNaNO2 + H2O = HNO2 + NaOH
NaNO2+ H2O=HNO2+ NaOHNaNO2 + H2O = HNO2 + NaOH
NaCIO3 = NaCI+O22NaCIO3 = 2NaCI + 3O2
NaCIO3 = NaCI+O22NaCIO3 = 2NaCI + 3O2
NaCIO3 = NaCI+O22NaCIO3 = 2NaCI + 3O2
NaCIO3 = NaCI+O22NaCIO3 = 2NaCI + 3O2
NaCIO3 = NaCI+O22NaCIO3 = 2NaCI + 3O2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO2 + SO2 = SO3 + NONO2 + SO2 = SO3 + NO
N2O5(g)+H2O(l)=HNO3(aq) N2O5(g) + H2O(l) = 2HNO3(aq)
N2O5(g)+H2O(l)=HNO3(aq) N2O5(g) + H2O(l) = 2HNO3(aq)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2H4 + H2O2= N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NaHSO3+HNO3 = NaNO3+H2SO3NaHSO3 + HNO3 = NaNO3 + H2SO3
NaHCO3+ CH3COOH= CH3COONa + H2CO3NaHCO3 + CH3COOH = CH3COONa + H2CO3
NO+SO4=NO3+SO40NO + SO4 = 0NO3 + SO4
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2+F2=NF3N2 + 3F2 = 2NF3
Na3PO4+CaCl2=NaCl+Ca3(PO4)22Na3PO4 + 3CaCl2 = 6NaCl + Ca3(PO4)2
NaF+Br2=NaBr+F22NaF + Br2 = 2NaBr + F2
N2+H2=NH3N2 + 3H2 = 2NH3
NaBrO3 + N2H4 = NaBr + N2 + H2O2NaBrO3 + 3N2H4 = 2NaBr + 3N2 + 6H2O
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
NaBrO3 + N2H4 = NaBr + N2 + H2O2NaBrO3 + 3N2H4 = 2NaBr + 3N2 + 6H2O
N2+O2=NON2 + O2 = 2NO
NaBrO4+N2H4= NaBr+N2+H2ONaBrO4 + 2N2H4 = NaBr + 2N2 + 4H2O
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
Na3PO4+KOH =NaOH+ K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NaHCO3(aq) + H3C6H5O7(aq) = H2O(l) + CO2(g) + Na3C6H5O7(aq)3NaHCO3(aq) + H3C6H5O7(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7(aq)
NO + 3O2 + 6H2O = 4NO3- + 4H3O+4NO + 3O2 + 6H2O = 4NO3- + 4H3O+
NH3+O2+CH4 =HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaHCO3(aq) + H3C6H5O7(aq) = H2O(l) + CO2(g) + Na3C6H5O7(aq)3NaHCO3(aq) + H3C6H5O7(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7(aq)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH3 (g) + O2 (g) = NO2 (g) + H2O (g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NaBrO3+N2H4=NaBr+N2+H2O2NaBrO3 + 3N2H4 = 2NaBr + 3N2 + 6H2O
NaN 3 (s)=Na(s)+ N 2 (g)2NaN3(s) = 2Na(s) + 3N2(g)
NO2+O2+H2O = HNO34NO2 + O2 + 2H2O = 4HNO3
Ni(s) + HCl(aq)= NiCl2(aq) + H2(g)=Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
N2 (g) + H2 (g) = NH3 (g)N2(g) + 3H2(g) = 2NH3(g)
Na2CO3 + BaCl2 = BaCO3 + NaClNa2CO3 + BaCl2 = BaCO3 + 2NaCl
Na3PO4(aq)+NiCl2(aq)=Ni3(PO4)2(s)+NaCl(aq)2Na3PO4(aq) + 3NiCl2(aq) = Ni3(PO4)2(s) + 6NaCl(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2O(g) + H2(g) =NH3(g) + H2O(g) N2O(g) + 4H2(g) = 2NH3(g) + H2O(g)
Ni+HNO3=Ni(NO3)2+N2O+H2O4Ni + 10HNO3 = 4Ni(NO3)2 + N2O + 5H2O
NH3+H2SO4=(NH4)2SO42NH3 + H2SO4 = (NH4)2SO4
N2+H2=NH3N2 + 3H2 = 2NH3
Ni+HNO3=Ni(NO3)2+N2O+H2O4Ni + 10HNO3 = 4Ni(NO3)2 + N2O + 5H2O
NH3 (g) + O2 (g) =NO2 (g) + H2O (g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NaF(aq) + HNO3(aq)= NaNO3(aq) + HF(aq)NaF(aq) + HNO3(aq) = NaNO3(aq) + HF(aq)
NH4Br+Pb(C2H3O2)2=NH4(C2H3O2)+PbBr22NH4Br + Pb(C2H3O2)2 = 2NH4(C2H3O2) + PbBr2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2(g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2
NaHCO3(aq)+HCl(aq)=H2O(l)+NaCl(aq)+CO2NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3= N2O+H2ONH4NO3 = N2O + 2H2O
NiCl2 +NaOH=NiOH+NaCl2NiCl2 + NaOH = NiOH + NaCl2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NO2+O2+H2O=HNO34NO2 + O2 + 2H2O = 4HNO3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NA+HCO3=NA2+CO3+CO2+H200NA + 20HCO3 = 0NA2 + 20CO3 + 0CO2 + H20
NaOH + Mg = Mg(OH)2 + Na2NaOH + Mg = Mg(OH)2 + 2Na
NO2(g) + H2O(l) = HNO3(aq) + HNO2(aq)2NO2(g) + H2O(l) = HNO3(aq) + HNO2(aq)
NaOH + Al + H2O = NaAlOH2 + H2-2NaOH - 2Al + 0H2O = -2NaAlOH2 + H2
Na+H2O = H+NaHO2Na + 2H2O = 3H + NaHO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO+H2=H2O+NH32NO + 5H2 = 2H2O + 2NH3
NO+H=H2O+NH3NO + 5H = H2O + NH3
NO+O2=NO22NO + O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NHN2 + H2 = 2NH
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
N2Cl2 + CH4 = CCl4+H2+N22N2Cl2 + CH4 = CCl4 + 2H2 + 2N2
Na+S=NaSNa + S = NaS
NaHCO 3 (aq)+HCl(aq)=H 2 O(l)+NaCl(aq)+ CO 2 (g)NaHCO3(aq) + HCl(aq) = H2O(l) + NaCl(aq) + CO2(g)
N2O5 (g) + H2O (l) =HNO3 (aq) N2O5(g) + H2O(l) = 2HNO3(aq)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na + Cl2 = NaCl 2Na + Cl2 = 2NaCl
N2 + O2 = NO N2 + O2 = 2NO
NiC2O4*2H2O(s) + O2 = NiCO(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) - O2 = NiCO(s) + 2H2O(g) + CO(g)
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NiF2 + 2HNO3 = Ni(NO3)2 + 2HFNiF2 + 2HNO3 = Ni(NO3)2 + 2HF
NH4Br+Pb(C2H3O2)2 = PbBr2+NH4C2H3O22NH4Br + Pb(C2H3O2)2 = PbBr2 + 2NH4C2H3O2
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NaO+H2O=NaOH+H2O0NaO + H2O = 0NaOH + H2O
Na2SO4+C = Na2S+ CONa2SO4 + 4C = Na2S + 4CO
NaCO3+2NO+O2=2NaNO2+CO2NaCO3 + NO + 0O2 = NaNO2 + CO2
N2H4(l) + H2O2(l) = N2(g) + H2O(g)N2H4(l) + 2H2O2(l) = N2(g) + 4H2O(g)
NH3 + Fe=NFe +HNH3 + Fe = NFe + 3H
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4Cl + Ba(OH)2 = NH3 +H2O +BaCl22NH4Cl + Ba(OH)2 = 2NH3 + 2H2O + BaCl2
Na2S4O6 + H2O2 = Na2SO4 + H2O + H2SO4Na2S4O6 + 7H2O2 = Na2SO4 + 4H2O + 3H2SO4
Na2SO3 + H2O = NaOH + H2SO3Na2SO3 + 2H2O = 2NaOH + H2SO3
NaNO3 + H2O = NaOH + HNO3 NaNO3 + H2O = NaOH + HNO3
NaNO3 + NH4Cl = N2O + NaCl + H2ONaNO3 + NH4Cl = N2O + NaCl + 2H2O
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaI(aq) + AgNO3(aq) = NaNO3(aq) + AgI(s)NaI(aq) + AgNO3(aq) = NaNO3(aq) + AgI(s)
NH4HCO3(s)+NaOH(aq)=NH4OH+NaHCO3NH4HCO3(s) + NaOH(aq) = NH4OH + NaHCO3
NH4HCO3(s)+NaOH(aq)=NH4OH+NaHCO3NH4HCO3(s) + NaOH(aq) = NH4OH + NaHCO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3(g) + O2(g) =N2(g) + H2O(l)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(l)
Na(s) + H3PO4(aq) =Na3PO4(aq) + H2(g)6Na(s) + 2H3PO4(aq) = 2Na3PO4(aq) + 3H2(g)
Na3PO4(aq) + CrCl3(aq) = CrPO4(s) + NaCl(s)Na3PO4(aq) + CrCl3(aq) = CrPO4(s) + 3NaCl(s)
Na(s) + H2O(l) = NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NO2 + NaOH + B = NaNO2 + Na3BO3 + H2O3NO2 + 6NaOH + B = 3NaNO2 + Na3BO3 + 3H2O
NaNH2+NaNO3=NaN3+NaOH+NH33NaNH2 + NaNO3 = NaN3 + 3NaOH + NH3
Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + H2O(l) + HNO3(aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NiC2O4*2H2O(s) + O2(g) =Ni2O3(s) + H2O(g) +CO2(g)4NiC2O4*2H2O(s) + 3O2(g) = 2Ni2O3(s) + 8H2O(g) + 8CO2(g)
NiC2O4*2H2O(s) = NiCO3(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) = NiCO3(s) + 2H2O(g) + CO(g)
NaOH +NaNO2 + Al + H2O = NH3 + NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
NaOH +NaNO + Al + H2O = NH3 + NaAlO2NaOH + 3NaNO + 4Al + 4H2O = 3NH3 + 4NaAlO2
N2H4 =NH3 + N23N2H4 = 4NH3 + N2
Ni(s) + Sn(NO3)2(aq) =Ni(NO3)2(aq) + Sn(s)Ni(s) + Sn(NO3)2(aq) = Ni(NO3)2(aq) + Sn(s)
Ni(s) + Sn(NO3)2(aq) =Ni(NO3)2(aq) + Sn(s)Ni(s) + Sn(NO3)2(aq) = Ni(NO3)2(aq) + Sn(s)
Na + NaNO3 = Na2O +N210Na + 2NaNO3 = 6Na2O + N2
NH3(g)+HCl(g)=NH4Cl(s)NH3(g) + HCl(g) = NH4Cl(s)
NaCl(aq)+Pb(C2H3O2)2(aq)=PbCl2+Na(C2H3O2)2NaCl(aq) + Pb(C2H3O2)2(aq) = PbCl2 + 2Na(C2H3O2)
Ni(s) + FeCl2 (aq) = NiCl2(aq) + Fe(s)Ni(s) + FeCl2(aq) = NiCl2(aq) + Fe(s)
NiSO4(aq)+FeCl2(aq)=NiCl2(s)+FeSO4(aq)NiSO4(aq) + FeCl2(aq) = NiCl2(s) + FeSO4(aq)
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NO2(g) = NO(g) + O2(g)2NO2(g) = 2NO(g) + O2(g)
NaC6H5O7 + H2CO3 + Na2CO3 = Na3C6H5O7 + H2CO30NaC6H5O7 + H2CO3 + 0Na2CO3 = 0Na3C6H5O7 + H2CO3
Na+H2O= H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NiF 2 (aq)+ Fe 2 ( SO 4 ) 3 (aq)=NiSO 4 (aq)+ FeF 3 (s)3NiF2(aq) + Fe2(SO4)3(aq) = 3NiSO4(aq) + 2FeF3(s)
N2O4=2NO2N2O4 = 2NO2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NH3 + O2 = N2O + H2O2NH3 + 2O2 = N2O + 3H2O
Ni(s) + Sn(NO3)2(aq) =Ni(NO3)2(aq) + Sn(s)Ni(s) + Sn(NO3)2(aq) = Ni(NO3)2(aq) + Sn(s)
Ni(s) + Sn(NO3)2(aq) =Ni(NO3)2(aq) + Sn(s)Ni(s) + Sn(NO3)2(aq) = Ni(NO3)2(aq) + Sn(s)
NH4NO3(aq) + NaOH(aq) = NaNO3(aq) + NH3(g) + H2O(l) NH4NO3(aq) + NaOH(aq) = NaNO3(aq) + NH3(g) + H2O(l)
NaH + H2O= NaOH +H2NaH + H2O = NaOH + H2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
N2O3(g) + H2O(l) = HNO2(aq)N2O3(g) + H2O(l) = 2HNO2(aq)
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NO2+O2+H2O=HNO34NO2 + O2 + 2H2O = 4HNO3
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na + O2 = Na2O4Na + O2 = 2Na2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NiC2O4*2H2O+O2=NiO+H2O+CO22NiC2O4*2H2O + O2 = 2NiO + 4H2O + 4CO2
Ni(NO 3 ) 2 (aq)+ Na 2 S(aq)=NiS(s)+ NaNO 3 (aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
NaOH + NaNO2 + Al + H2O = NH3 + NaAlO2NaOH + NaNO2 + 2Al + H2O = NH3 + 2NaAlO2
Na2Cr2O9 + HCl = NaCl + CrCl3 + H2O + Cl2Na2Cr2O9 + 18HCl = 2NaCl + 2CrCl3 + 9H2O + 5Cl2
NO(g) + Cl2(g) = NOCl(g) 2NO(g) + Cl2(g) = 2NOCl(g)
NaOH(aq) + HBr(aq) = NaBr(aq) + H2O(l) NaOH(aq) + HBr(aq) = NaBr(aq) + H2O(l)
NaCN(aq) + HNO3(aq) = NaNO3(aq) + HCN(aq)NaCN(aq) + HNO3(aq) = NaNO3(aq) + HCN(aq)
NaCN + HNO3 = NaNO3 + HCNNaCN + HNO3 = NaNO3 + HCN
NaCN + HNO3 = NaNO3 + HCNNaCN + HNO3 = NaNO3 + HCN
Na2SO4(aq) + PbCl2(aq) = PbSO4(s) + NaCl(aq) Na2SO4(aq) + PbCl2(aq) = PbSO4(s) + 2NaCl(aq)
NaCN(aq) + HNO3(aq) = NaNO3(aq) + HCN(aq)NaCN(aq) + HNO3(aq) = NaNO3(aq) + HCN(aq)
Na + Cl2 = NaCl 2Na + Cl2 = 2NaCl
NH4NO3(aq)=N2O(g)+H2O(g)NH4NO3(aq) = N2O(g) + 2H2O(g)
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaF(aq) + HNO3(aq) = NaNO3(aq) + HF(aq)NaF(aq) + HNO3(aq) = NaNO3(aq) + HF(aq)
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2CO3 +Co(NO3)3=Na(NO3)3+Co2(CO3)Na2CO3 + 2Co(NO3)3 = 2Na(NO3)3 + Co2(CO3)
NH3+HF+SIF4 = NH4HSIF6NH3 + 2HF + SIF4 = NH4HSIF6
NaNO3 = NaNO2 +O22NaNO3 = 2NaNO2 + O2
NaNO3 = NaNO2 +O22NaNO3 = 2NaNO2 + O2
N 2 H 4 (g)+ N 2 O 4 (g)=3 N 2 (g)+4 H 2 O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
N2O5 (g) + H2O (l) = HNO3 (aq) N2O5(g) + H2O(l) = 2HNO3(aq)
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
N2(g)+O2(g)=NO(g)N2(g) + O2(g) = 2NO(g)
N2(g)+O2(g)=NO(g)=N2(g) + O2(g) = 2NO(g)
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
N2O5 (g) + H2O (l) = HNO3 (aq) N2O5(g) + H2O(l) = 2HNO3(aq)
NH4Cl + Ca(OH)2 = NH3 + CaCl2 +H2O2NH4Cl + Ca(OH)2 = 2NH3 + CaCl2 + 2H2O
NH3 (g) + O2 (g) = NO2 (g) + H2O (g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
Na + HCl = NaCl + H22Na + 2HCl = 2NaCl + H2
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na + Al(NO3)2 = Na NO3 + Al2Na + Al(NO3)2 = 2NaNO3 + Al
NH4NO3(aq)=N2O(g)+H2O(l) NH4NO3(aq) = N2O(g) + 2H2O(l)
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
Na2SO3 + HCl = NaCl + H2O + SO2Na2SO3 + 2HCl = 2NaCl + H2O + SO2
N2O5 + H2O =HNO3 N2O5 + H2O = 2HNO3
N2H4(l) + H2O2(l) = N2(g) + H2O(g)N2H4(l) + 2H2O2(l) = N2(g) + 4H2O(g)
NI3(s)=N2(g)+I2(g)2NI3(s) = N2(g) + 3I2(g)
NaCl + H2SO4 + MnO2 = Na2SO4 + MnSO4 + H2O + Cl22NaCl + 2H2SO4 + MnO2 = Na2SO4 + MnSO4 + 2H2O + Cl2
Na2O(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)Na2O(s) + H2SO4(aq) = Na2SO4(aq) + H2O(l)
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Ni + HCl =NiCl2 + H2Ni + 2HCl = NiCl2 + H2
NH4NO(s)+O2(g)=NO2(g)+H2O(g)2NH4NO(s) + 5O2(g) = 4NO2(g) + 4H2O(g)
NiC2O4*2H2O(s) = NiCO3(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) = NiCO3(s) + 2H2O(g) + CO(g)
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NiC2O4*2H2O(s) + O2 = NiCO(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) - O2 = NiCO(s) + 2H2O(g) + CO(g)
NiC2O4*2H2O(s) + O2 = NiCO3(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) + 0O2 = NiCO3(s) + 2H2O(g) + CO(g)
NiC2O4*2H2O(s) = NiCO3(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) = NiCO3(s) + 2H2O(g) + CO(g)
Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
NH4NO2(s)=N2(g)+H2O(g)NH4NO2(s) = N2(g) + 2H2O(g)
NH4NO2(s)=N2(g)+H2O(l)NH4NO2(s) = N2(g) + 2H2O(l)
NaNO3(s)=NaNO2(s)+O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
NH4NO3(aq) = N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaNO3(s)=NaNO2(s)+O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
NiC2O4*2H2O(s) = NiCO3(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) = NiCO3(s) + 2H2O(g) + CO(g)
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
Ni(NO3)2*6H2O+H2C2O4=NiC2O4*2H2O+HNO3+4H2ONi(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 2HNO3 + 4H2O
Ni(NO3)2*6H2O+H2C2O4=NiC2O4*2H2O+HNO3+4H2ONi(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 2HNO3 + 4H2O
NO + H2 = N2 + H2O 2NO + 2H2 = N2 + 2H2O
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O +HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NH3 (g) + O2 (g) =NO2 (g) + H2O (g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
NH3(g) + O2(g) +CH4(g) = HCN(aq) + H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NO2+O2+H2O=HNO34NO2 + O2 + 2H2O = 4HNO3
NO + O2 = NO22NO + O2 = 2NO2
NO2(g) + NO3(g) = N2O5(g)NO2(g) + NO3(g) = N2O5(g)
NaN3(s)=Na(s)+N2(g)2NaN3(s) = 2Na(s) + 3N2(g)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NO+H2=NH3(g)+H2O(g)2NO + 5H2 = 2NH3(g) + 2H2O(g)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
Na2CO3(s)+CuBr2(aq)=CuCO3(s)+2NaBr(aq)Na2CO3(s) + CuBr2(aq) = CuCO3(s) + 2NaBr(aq)
NiC2O4*2H2O = NiCO3 + H2O + CONiC2O4*2H2O = NiCO3 + 2H2O + CO
NH 4 NO 3 (aq)= N 2 O(g)+ H 2 O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NaBr(aq)+Cl2(g)=NaCl(aq)+Br2(l)2NaBr(aq) + Cl2(g) = 2NaCl(aq) + Br2(l)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na+Cl2= NaCl2Na + Cl2 = 2NaCl
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
N2H4(g)+9N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
N2 + O2=N2O52N2 + 5O2 = 2N2O5
NiC2O4*2H2O(s) = NiCO3(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) = NiCO3(s) + 2H2O(g) + CO(g)
NH3(g)+O2(g)=NO2(g)+H2O(l) 4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(l)
NH4NO3+O2= NO2+ H2O2NH4NO3 + 3O2 = 4NO2 + 4H2O
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NO2 + N2H4 = N2 +H2O2NO2 + 2N2H4 = 3N2 + 4H2O
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH4 + Li2CO3 = NCO3 + Li2H4NH4 + Li2CO3 = NCO3 + Li2H4
NCl3 + OH- = NH3 + OCl-NCl3 + 3OH- = NH3 + 3OCl-
NaOH (aq) + HCl (aq) = NaCl (aq) + H2ONaOH(aq) + HCl(aq) = NaCl(aq) + H2O
NaOH (aq) + HCl (aq) = NaCl (aq) + H2ONaOH(aq) + HCl(aq) = NaCl(aq) + H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3+H3PO4=(NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
NaCN+H2SO4=Na2SO4+HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
NO+O2=NO22NO + O2 = 2NO2
Na2S(aq)+Cu(NO3)2(aq) = NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaH + H2O = NaOH + H2NaH + H2O = NaOH + H2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na2CO3 + Ba(OH)2 =9BaCO3 + 2NaOHNa2CO3 + Ba(OH)2 = BaCO3 + 2NaOH
Na2CO3 + Ba(OH)2 =9BaCO3 + 2NaOHNa2CO3 + Ba(OH)2 = BaCO3 + 2NaOH
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NO+O2=NO22NO + O2 = 2NO2
Na2CO3+2AgNO3=NaNO3+Ag2CO3Na2CO3 + 2AgNO3 = 2NaNO3 + Ag2CO3
NH3 +O2 = NO2 + H+ +H2O4NH3 + 7O2 = 4NO2 + 0H+ + 6H2O
NO + NH2OH = N2 + H2O2NO + 4NH2OH = 3N2 + 6H2O
N2H4+N204=N2H20255N2H4 - 2N204 = 51N2H20
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2O(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)Na2O(s) + H2SO4(aq) = Na2SO4(aq) + H2O(l)
Na2O(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)Na2O(s) + H2SO4(aq) = Na2SO4(aq) + H2O(l)
Na2O(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)Na2O(s) + H2SO4(aq) = Na2SO4(aq) + H2O(l)
NH3(aq) + HF(aq) = NH4F(aq) NH3(aq) + HF(aq) = NH4F(aq)
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
NaNH2 + NaNO3 = NaN3 +NaOH + NH33NaNH2 + NaNO3 = NaN3 + 3NaOH + NH3
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
N2+ O2= NON2 + O2 = 2NO
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na3N = Na(s) + N2(g)2Na3N = 6Na(s) + N2(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3=N2+O2+H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3(g)+O2(g)+CH4(g)=HCN(aq)+H2O(l)2NH3(g) + 3O2(g) + 2CH4(g) = 2HCN(aq) + 6H2O(l)
NaCl + H20 + NH4OH + CO2 = NH4Cl + NaCO320NaCl - H20 + 20NH4OH + 20CO2 = 20NH4Cl + 20NaCO3
NaCl + H20 + NH4OH + NaHCO3 = NH4Cl + NaCO30NaCl - H20 + 0NH4OH + 20NaHCO3 = 0NH4Cl + 20NaCO3
N+O=NON + O = NO
N2+O2=NON2 + O2 = 2NO
NaClO + KI + 2H+ = Na+ + K+ + Cl- + I2 + H2O NaClO + 2KI + 2H+ = Na+ + 2K+ + Cl- + I2 + H2O
NaNO2 + HNO3 = NaNO3 + HNO2NaNO2 + HNO3 = NaNO3 + HNO2
NaCl + H2O = Cl2 + H2 + NaOH2NaCl + 2H2O = Cl2 + H2 + 2NaOH
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
NH4NO3(s)+O2(g) =NO2(g)+H2O(g)2NH4NO3(s) + 3O2(g) = 4NO2(g) + 4H2O(g)
NO2 + O2 + H2O = HNO34NO2 + O2 + 2H2O = 4HNO3
NO2 + O2 + H2O = HNO4NO2 - 3O2 + 2H2O = 4HNO
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
NaN3 = Na + N2 2NaN3 = 2Na + 3N2
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
NH3(g) + O2(g) =NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaHCO3(aq) + HCl(aq) =NaCl(aq) + CO2(g) + H2O(l) NaHCO3(aq) + HCl(aq) = NaCl(aq) + CO2(g) + H2O(l)
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NO3- + As + H2O = NO +As(O4) 3- + HNO3- + As + 10H2O = NO + As(O4)3- + 20H
NO3- + As + H2O = NO +AsO4 3- + HNO3- + As + 41H2O = NO + AsO43- + 82H
NH4NO3= N2O + H2ONH4NO3 = N2O + 2H2O
NH4NO3(s) + O2(g)= NO2(g) + H20(g)10NH4NO3(s) + 5O2(g) = 20NO2(g) + 2H20(g)
N2+Li=Li3NN2 + 6Li = 2Li3N
NH4Cl+Cl2=HCl+NCl3NH4Cl + 3Cl2 = 4HCl + NCl3
Na2SO4 + Al(OH)3 = Al2(SO4)3 + NaOH3Na2SO4 + 2Al(OH)3 = Al2(SO4)3 + 6NaOH
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na2CO3 + 2H2SO4 = Na2SO4 + 2H2O + CO2 Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5(g)+H2O(l)=HNO3(aq)N2O5(g) + H2O(l) = 2HNO3(aq)
Na+AlCl3=NaCl+Al3Na + AlCl3 = 3NaCl + Al
Na+O2=Na2O4Na + O2 = 2Na2O
Na2CO3+2HCL=NaCL+H2O+2CO2Na2CO3 + 2HCL = 2NaCL + H2O + CO2
NaBr+H2SO4=Na2SO4+HBr2NaBr + H2SO4 = Na2SO4 + 2HBr
NH3(g)+O2(g)=NO(g)+H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
NH3 + CO2 + H2 +H2O =C6H13O5NNH3 + 6CO2 + 12H2 - 7H2O = C6H13O5N
NO2C6H4COOC2H5(aq)+OH-(aq)=NO2C6H4COO-(aq)+C2H5OH(aq)NO2C6H4COOC2H5(aq) + OH-(aq) = NO2C6H4COO-(aq) + C2H5OH(aq)
NO2+H2=NH3+H2O2NO2 + 7H2 = 2NH3 + 4H2O
NO2+H2O=NH3+H2O0NO2 + H2O = 0NH3 + H2O
N2+H2=NH3N2 + 3H2 = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
N2H3CH3 (g) + N2O4 (g) = N2 (g) + H2O (g) + CO2 (g)4N2H3CH3(g) + 5N2O4(g) = 9N2(g) + 12H2O(g) + 4CO2(g)
NaOH + BaCl2 = Ba(OH)2 + NaCl2NaOH + BaCl2 = Ba(OH)2 + 2NaCl
N2O5 + 2 NaHCO3 = 2 NaNO3 + 2 CO2 + H2ON2O5 + 2NaHCO3 = 2NaNO3 + 2CO2 + H2O
NaOH(aq)+HCl(aq)=NaCl(aq)+H2O(l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
NaOH(aq)+HCl(aq)=NaCl(aq)+H2O(l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NO + 4H2 = N2 + H2O2NO + 2H2 = N2 + 2H2O
Na+S=Na2S2Na + S = Na2S
Na2S2O3(aq) + 4Cl2(g) + 5H2O =2NaHSO4(aq) + 8HCl(aq)Na2S2O3(aq) + 4Cl2(g) + 5H2O = 2NaHSO4(aq) + 8HCl(aq)
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
Na+O2=Na2O22Na + O2 = Na2O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3+ Cl2=N2H4+NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4 H2O(l) + 2 HNO3(aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NaCl + NH4NO3 = NH4Cl + NaNO3NaCl + NH4NO3 = NH4Cl + NaNO3
Na2SO4 + Al(OH)3 = Al2(SO4)3 + NaOH3Na2SO4 + 2Al(OH)3 = Al2(SO4)3 + 6NaOH
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4(g)+4N2O4(g)=N2(g)+H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
NO2 + O2 + H2O = HNO34NO2 + O2 + 2H2O = 4HNO3
N2+O2=2NON2 + O2 = 2NO
NH4ClO4+Al=Al2O3+N2+Cl2+H2O6NH4ClO4 + 8Al = 4Al2O3 + 3N2 + 3Cl2 + 12H2O
NH4NO2(s)=N2(g)+H2O(g)NH4NO2(s) = N2(g) + 2H2O(g)
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH3 + O2 + CH4 = HCN +H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4NO2(s)=N2(g)+H2O(l)NH4NO2(s) = N2(g) + 2H2O(l)
NaNO3(s)=NaNO2(s)+O2(g)2NaNO3(s) = 2NaNO2(s) + O2(g)
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + H2O(l) + HNO3(aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NaOH + HCLO4 = NaCLO4 + H2ONaOH + HCLO4 = NaCLO4 + H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2CO3(aq) + BaCl2(aq) = BaCO3(s) + NaCl(aq)Na2CO3(aq) + BaCl2(aq) = BaCO3(s) + 2NaCl(aq)
Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + H2O(l) + HNO3(aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + H2O(l) + HNO3(aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
Na (s) + H2O (l) = NaOH (aq) + H2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NH4NO3 + O2 = NO2 + H2010NH4NO3 + 5O2 = 20NO2 + 2H20
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O+ H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
Ni(NO3)2*6H2O+ H2C2O4 = NiC2O4*2H2O+ H2O(l) +HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O(l) + 2HNO3
NH4F + Ca(NO3)2 = CaF2 + N2O + H2O2NH4F + Ca(NO3)2 = CaF2 + 2N2O + 4H2O
NH4I(aq) + NaOH(aq) = NaI(aq) + NH4OH(g)NH4I(aq) + NaOH(aq) = NaI(aq) + NH4OH(g)
NiC2O4*2H2O(s)=NiCO3(s) + H2O(g) + CO(g)NiC2O4*2H2O(s) = NiCO3(s) + 2H2O(g) + CO(g)
Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + H2O(l) + HNO3(aq)Ni(NO3)2*6H2O(aq) + H2C2O4(aq) = NiC2O4*2H2O(s) + 4H2O(l) + 2HNO3(aq)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4HCO3 = NH3 + CO2 + H2ONH4HCO3 = NH3 + CO2 + H2O
NH4HCO3 + O2 = NH3 + CO2 + H2ONH4HCO3 + 0O2 = NH3 + CO2 + H2O
NH4NO3=N2O+H2ONH4NO3 = N2O + 2H2O
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O + HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
NO + H2O = NH3 + O24NO + 6H2O = 4NH3 + 5O2
Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + H2O +HNO3Ni(NO3)2*6H2O + H2C2O4 = NiC2O4*2H2O + 4H2O + 2HNO3
Ni(NO3)2(aq)+Na2S(aq)=NiS(s)+NaNO3(aq)Ni(NO3)2(aq) + Na2S(aq) = NiS(s) + 2NaNO3(aq)
N2 + O2 = 2NON2 + O2 = 2NO
NH3 + O2 + CH4 = HCN + H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NH4 + NO3 = N2O + H2ONH4 + NO3 = N2O + 2H2O
NaClO + KI = KIO3 + NaCl3NaClO + KI = KIO3 + 3NaCl
NH4NO3 + O2 = NO2 + H2O2NH4NO3 + 3O2 = 4NO2 + 4H2O
NaHCO3+CH3COOH=CH3COONa+CO2+H2ONaHCO3 + CH3COOH = CH3COONa + CO2 + H2O
NaHCO3+CH3COOH=CH3COONa+CO2+H2ONaHCO3 + CH3COOH = CH3COONa + CO2 + H2O
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NO2(g)+H2(g) = NH3(g) +H2O(g) 2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(g)
NaCl + CH3OH + SnCl2+ = 1Sn + NaOH + CH3Cl NaCl + CH3OH + 0SnCl2+ = 0Sn + NaOH + CH3Cl
NaCl + CH3OH + SnCl2+ = 1Sn + NaOH + CH3Cl NaCl + CH3OH + 0SnCl2+ = 0Sn + NaOH + CH3Cl
NaCl + CH3OH + SnCl2+ = 1Sn + NaOH + CH3Cl NaCl + CH3OH + 0SnCl2+ = 0Sn + NaOH + CH3Cl
NaCl + CH3OH + SnCl2+ = Sn + NaOH + CH3Cl NaCl + CH3OH + 0SnCl2+ = 0Sn + NaOH + CH3Cl
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH 4 NO 3 (s)=N 2 O(g)+ H 2 O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH3+O2=NO+H2020NH3 + 10O2 = 20NO + 3H20
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH3+ Cl2= N2H4+ NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
NO2- + 2Fe+3 + OH = NO3- + 2Fe+2 + HNO2- + 0Fe+3 + OH = NO3- + 0Fe+2 + H
NO2- + 2Fe+3 + 2OH = NO3- + 2Fe+2 + 2HNO2- + 0Fe+3 + OH = NO3- + 0Fe+2 + H
NO2- + 2Fe+3 + H2O = NO3- + 2Fe+2 + 2OH-1NO2- + 0Fe+3 + H2O = -1NO3- + 0Fe+2 + 2OH
NO2- + 2Fe+3 + H2O = NO3- + 2Fe+2 + 2HNO2- + 0Fe+3 + H2O = NO3- + 0Fe+2 + 2H
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO2+H2=NH3+H2O2NO2 + 7H2 = 2NH3 + 4H2O
NH4NO3 = N2O + 2 H2ONH4NO3 = N2O + 2H2O
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaOH(aq) + CO2(g) = Na2CO3(aq) + H2O(l)2NaOH(aq) + CO2(g) = Na2CO3(aq) + H2O(l)
NaOH(aq)+NaNO2(aq)+Al(s)+H20(l)=NH3(aq)+NaAlO2(aq)0NaOH(aq) + 20NaNO2(aq) + 20Al(s) + 3H20(l) = 20NH3(aq) + 20NaAlO2(aq)
Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4Na2SO4 + Ba(NO3)2 = 2NaNO3 + BaSO4
Na + 2Cl = 2NaClNa + Cl = NaCl
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaCl+AlCl3+Bi(NO3)3=BiCl3+AlCl+Na(NO3)3NaCl + 0AlCl3 + Bi(NO3)3 = BiCl3 + 0AlCl + 3Na(NO3)
N2 + H2 =NH3N2 + 3H2 = 2NH3
Na(s)+Cl2(g)=NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
NaHCO3 =Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
NH3(g) +O2(g) =NO(g) + H2O(g)4NH3(g) + 5O2(g) = 4NO(g) + 6H2O(g)
N2 + 3H2 =2NH3N2 + 3H2 = 2NH3
N 2 (g)+ H 2 (g)= NH 3 (g)N2(g) + 3H2(g) = 2NH3(g)
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
Na2SO4 +Al(OH)3=Al2(SO4)3 +NaOH3Na2SO4 + 2Al(OH)3 = Al2(SO4)3 + 6NaOH
NH 4 NO 3 (s)= N 2 O(g)+ H 2 O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N 2 O 5 (g)+ H 2 O(l)=HN O 3 (aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N 2 O 5 (g)+ H 2 O(l)=HN O 3 (aq)N2O5(g) + H2O(l) = 2HNO3(aq)
N 2 O 5 (g)+ H 2 O(l)=HN O 3 (aq)N2O5(g) + H2O(l) = 2HNO3(aq)
Na3PO4 + HCl = NaCl + H3PO4Na3PO4 + 3HCl = 3NaCl + H3PO4
NO2(g) + H2(g) = NH3(g) + H2O(g) 2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(g)
NH3(g)+O2(g)=N2(g)+H2O(l)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(l)
NiI2 + Rb2S = NiS + RbINiI2 + Rb2S = NiS + 2RbI
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
Na + Cl2 =NaCl2Na + Cl2 = 2NaCl
Na + Cl2 =NaCl2Na + Cl2 = 2NaCl
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
Na2O +H2O = NaOHNa2O + H2O = 2NaOH
Na2 + SO4 + BaOH2 = Na2OH2 + BaSO4Na2 + SO4 + BaOH2 = Na2OH2 + BaSO4
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
Na3PO4+KOH=NaOH+K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
NH3+ Cl2=N2H4+ NH4Cl4NH3 + Cl2 = N2H4 + 2NH4Cl
NH4NO3(aq)=N2O(g)+H2O(l)NH4NO3(aq) = N2O(g) + 2H2O(l)
N2 + 3 H2 = 2NH3N2 + 3H2 = 2NH3
N2 + 3 H2 = 2NH3N2 + 3H2 = 2NH3
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
Na2S(aq)+Cu(NO3)2=NaNO3+CuSNa2S(aq) + Cu(NO3)2 = 2NaNO3 + CuS
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaH+H2O= NaOH+H2NaH + H2O = NaOH + H2
Na3PO4(aq) + CoCl2(aq) = Co3(PO4)2(s) + NaCl(aq)2Na3PO4(aq) + 3CoCl2(aq) = Co3(PO4)2(s) + 6NaCl(aq)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)=2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NO2(g) + H2(g) =NH3(g) +H2O(g) 2NO2(g) + 7H2(g) = 2NH3(g) + 4H2O(g)
Nb2O5 + Na2CO3 = NaNbO3 + CO2Nb2O5 + Na2CO3 = 2NaNbO3 + CO2
N2O5(g)+H2O(l)=HNO3(aq) N2O5(g) + H2O(l) = 2HNO3(aq)
N2O5(g)+H2O(l)=HNO3(aq) N2O5(g) + H2O(l) = 2HNO3(aq)
N2(g)+ H2(g)= NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO3- + 2H+ + H2O = NH4+ +2O2NO3- + 2H+ + H2O = NH4+ + 2O2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
N2 + H2 =2 NH3N2 + 3H2 = 2NH3
Na3PO4(aq) + CoCl2(aq) = Co3(PO4)2(s) + NaCl(aq)2Na3PO4(aq) + 3CoCl2(aq) = Co3(PO4)2(s) + 6NaCl(aq)
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.