Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
N2H4 + F2 = N2+ HFN2H4 + 2F2 = N2 + 4HF
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O=N2+O22N2O = 2N2 + O2
Na2CO3 + HCl = NaCl + CO2 + H2O Na2CO3 + 2HCl = 2NaCl + CO2 + H2O
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2O=N2+O2 2N2O = 2N2 + O2
NH3(g)=N2(g)+H2(g)2NH3(g) = N2(g) + 3H2(g)
Na2SO4 + HNO3 = NaNO3 + H2SO4Na2SO4 + 2HNO3 = 2NaNO3 + H2SO4
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
N2+O2=NON2 + O2 = 2NO
N2H4O3=N+H+ON2H4O3 = 2N + 4H + 3O
NH4Cl + Ca(OH)2=CaCl2 + NH3 +H2O 2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
NO + O2 = NO22NO + O2 = 2NO2
NH3(g)+F2(g)=N2F4(g)+HF(g)2NH3(g) + 5F2(g) = N2F4(g) + 6HF(g)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na (s)+H2O = NaOH (aq) + H2 (g)2Na(s) + 2H2O = 2NaOH(aq) + H2(g)
NaHCO3+CH3COOH=CH3(CH2)16COONa+H2O+CO2NaHCO3 + 13CH3COOH = CH3(CH2)16COONa + 9H2O + 9CO2
NH4NO3+NaOH=NH4OH+NaNO3NH4NO3 + NaOH = NH4OH + NaNO3
Na2CO3+CoCl2=NaCl+CoCO3Na2CO3 + CoCl2 = 2NaCl + CoCO3
Na2SO3+HCl=NaCl+H2SO3Na2SO3 + 2HCl = 2NaCl + H2SO3
NaHCO3+HC2H3O2=NaC2H3O2+H2CO3NaHCO3 + HC2H3O2 = NaC2H3O2 + H2CO3
Ni(NO3)2+Na3PO4=Ni3(PO4)2+NaNO33Ni(NO3)2 + 2Na3PO4 = Ni3(PO4)2 + 6NaNO3
NaOH + Ba(NO3)2 = Ba(OH)2 + NaNO32NaOH + Ba(NO3)2 = Ba(OH)2 + 2NaNO3
NaOH + Sr(NO3)2 =Sr(OH)2 +NaNO32NaOH + Sr(NO3)2 = Sr(OH)2 + 2NaNO3
NaCN + H2SO4=Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
NaCN + H2SO4=Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
NaCN + H2SO4= Na2SO4 + HCN2NaCN + H2SO4 = Na2SO4 + 2HCN
NH4Cl + NaOH + AgCl = Ag(NH3)2Cl + NaCl + H2O2NH4Cl + 2NaOH + AgCl = Ag(NH3)2Cl + 2NaCl + 2H2O
Ni2(SO4)3 + NH4OH = (NH4)2SO4 + Ni(OH)3Ni2(SO4)3 + 6NH4OH = 3(NH4)2SO4 + 2Ni(OH)3
N2+O2+H2O=HNO32N2 + 5O2 + 2H2O = 4HNO3
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
N2+H2=NH3N2 + 3H2 = 2NH3
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s) Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
NaCl + H2O = NaOH + Cl2 + H22NaCl + 2H2O = 2NaOH + Cl2 + H2
Na2CO3 + Ba(OH)2 = Na2(OH)2 + BaCO3Na2CO3 + Ba(OH)2 = Na2(OH)2 + BaCO3
Na2CO3 + Ba(OH)2 = Na2(OH)2 + BaCO3Na2CO3 + Ba(OH)2 = Na2(OH)2 + BaCO3
Na2CO3 + Ba(OH)2 = Na2(OH)2 + BaCO3Na2CO3 + Ba(OH)2 = Na2(OH)2 + BaCO3
Na+H2O=NaO+H2Na + H2O = NaO + H2
NaClO +HCN=NaCN +HClONaClO + HCN = NaCN + HClO
Na2O2 + H2O = NaOH + H2-1Na2O2 + 0H2O = -2NaOH + H2
Na2CrO4 + Pb(C2H3O2)2 = Na2(C2H3O2)2 + PbCrO4Na2CrO4 + Pb(C2H3O2)2 = Na2(C2H3O2)2 + PbCrO4
Na2SO4 + BaCl2 = BaSO4 + NaClNa2SO4 + BaCl2 = BaSO4 + 2NaCl
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
Na2S+CaCl2=CaS+NaClNa2S + CaCl2 = CaS + 2NaCl
NaOH + HCl = NaCl + OH2NaOH + HCl = NaCl + OH2
NaBH4 + H2SO4 = B2H6 + H2 + Na2SO4 2NaBH4 + H2SO4 = B2H6 + 2H2 + Na2SO4
NH3 + H2O = NO + H2 2NH3 + 2H2O = 2NO + 5H2
N2 + H2 = NH3N2 + 3H2 = 2NH3
NaBr+H3PO4=Na3PO4+HBr3NaBr + H3PO4 = Na3PO4 + 3HBr
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
N+O2=NO2N + O2 = 2NO
NO2-+ClO3-=NO3-+Cl-3NO2- + ClO3- = 3NO3- + Cl-
NaHCO3 + HCl = H2O + NaCl + CO2NaHCO3 + HCl = H2O + NaCl + CO2
N2+ 2O2= 2NO2N2 + 2O2 = 2NO2
Na2CO3+HNO3=NaNO3+H2O+CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
Na2CO3+HNO3=NaNO3+H2O+CO2Na2CO3 + 2HNO3 = 2NaNO3 + H2O + CO2
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NO+O2=NO22NO + O2 = 2NO2
Na2SO3(s)+H2SO4(aq)=Na2SO4(aq)+SO2(g)+H2O(l)Na2SO3(s) + H2SO4(aq) = Na2SO4(aq) + SO2(g) + H2O(l)
NaHCO3(s)+HCl(aq)=NaCl(aq)+CO2(g)+H2O(l)NaHCO3(s) + HCl(aq) = NaCl(aq) + CO2(g) + H2O(l)
Na2CO3+ HClO3=NaClO3+H2O+CO2Na2CO3 + 2HClO3 = 2NaClO3 + H2O + CO2
Na2CO3+ HClO3=NaClO3+H2O+CO2Na2CO3 + 2HClO3 = 2NaClO3 + H2O + CO2
Na2CO3+ HClO3=NaClO3+H2O+CO2Na2CO3 + 2HClO3 = 2NaClO3 + H2O + CO2
Na3PO4+Ba(NO3)2= NaNO3+Ba3(PO4)22Na3PO4 + 3Ba(NO3)2 = 6NaNO3 + Ba3(PO4)2
NaClO4+CaCl2= NaCl+Ca(ClO4)22NaClO4 + CaCl2 = 2NaCl + Ca(ClO4)2
NaClO4+CaCl2= NaCl+Ca(ClO4)22NaClO4 + CaCl2 = 2NaCl + Ca(ClO4)2
N2H4 + H2O2 = N2 + H2ON2H4 + 2H2O2 = N2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2+3H2 = 2NH 3N2 + 3H2 = 2NH3
NaCN + HNO3= NaNO3 + HCNNaCN + HNO3 = NaNO3 + HCN
N2+ O2= NO2N2 + 2O2 = 2NO2
N2+H2=NH3N2 + 3H2 = 2NH3
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
Na2O2+H2SO4=Na2SO4+H2O2Na2O2 + H2SO4 = Na2SO4 + H2O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+O2=Na2O4Na + O2 = 2Na2O
Na+ + Cl- = NaClNa+ + Cl- = NaCl
Na + Cl = NaClNa + Cl = NaCl
Na1 + Cl = NaClNa1 + Cl = NaCl
Na1+ + Cl- = NaClNa1+ + Cl- = NaCl
Na1+ + Cl1- = NaClNa1+ + Cl1- = NaCl
Na1+ + Cl1- = NaClNa1+ + Cl1- = NaCl
Na2SO4+CaCl2=CaSO4+NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NH3+CO2=(NH2)2+CO20NH3 + CO2 = 0(NH2)2 + CO2
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na OH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH4NO2 = N2 + H2ONH4NO2 = N2 + 2H2O
NaCl + H2SO4 = Na2SO4 + HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NH3(g) + O2(g) = NO2(g) + H2O(g)4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(g)
N2+H2=NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2CO3+HNO3=CO2+NaNO3+H2ONa2CO3 + 2HNO3 = CO2 + 2NaNO3 + H2O
Na2S2O3 + KBrO3 + KI + HCl = Na2S4O6 + KBr + I2 +KCl +H2O0Na2S2O3 + KBrO3 + 6KI + 6HCl = 0Na2S4O6 + KBr + 3I2 + 6KCl + 3H2O
NaOH + P4 + H2O = NaH2PO2 + PH33NaOH + P4 + 3H2O = 3NaH2PO2 + PH3
Na2S2O5 + H2O = 2Na + 2HSO3Na2S2O5 + H2O = 2Na + 2HSO3
Na2O2 + H2O = 2NaOH + H2O0Na2O2 + H2O = 0NaOH + H2O
NH4NO3= N2 + O2+ H2O2NH4NO3 = 2N2 + O2 + 4H2O
NaI + H3PO4 = NaH2PO4 + HINaI + H3PO4 = NaH2PO4 + HI
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
N2O=N2+O22N2O = 2N2 + O2
N2O2(g)=NO2(g)+O2(g)-1N2O2(g) = -2NO2(g) + O2(g)
N2O2(g)=NO2(g)+O2(g)-1N2O2(g) = -2NO2(g) + O2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l) 2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NH3(g) + CO2(g) = CO(NH 2 ) 2 (s)+H 2 O(l) 2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NH 3 (g)+CO 2 (g) = CO(NH 2 ) 2 (s)+H 2 O(l) 2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NO + O2 = NO22NO + O2 = 2NO2
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH4NO3 = N2 + O2 + H2O2NH4NO3 = 2N2 + O2 + 4H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
NH4OH = NH4+ + OH-NH4OH = NH4+ + OH-
NO + O2 = 2NO22NO + O2 = 2NO2
NH3+O2+CH4=HCN+H2O2NH3 + 3O2 + 2CH4 = 2HCN + 6H2O
NaOH + FeSO4 = Fe(OH)2 + Na2SO42NaOH + FeSO4 = Fe(OH)2 + Na2SO4
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaIO3+Na2SO3+NaHSO3=I2+Na2SO4+H2O 2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
NaIO3+Na2SO3+NaHSO3=I2+Na2SO4+H2O 2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
NaIO3+Na2SO3+NaHSO3=I2+Na2SO4+H2O 2NaIO3 + 3Na2SO3 + 2NaHSO3 = I2 + 5Na2SO4 + H2O
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na + H2O = NaOH + H2 2Na + 2H2O = 2NaOH + H2
NaCl+AgNO3=AgCl+NaNO3NaCl + AgNO3 = AgCl + NaNO3
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
NaBr(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuBr2(s)2NaBr(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuBr2(s)
NH4I+CI2 = NH4CI+I2NH4I + CI2 = NH4CI + I2
NaClO4 + CaCl2 = NaCl + Ca(ClO4)22NaClO4 + CaCl2 = 2NaCl + Ca(ClO4)2
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
Na3N + Na2CO3 = Na5(CN) + O3Na3N + Na2CO3 = Na5(CN) + O3
NH4NO3 = N2O + 2 H2ONH4NO3 = N2O + 2H2O
NaOH + NH4Cl = NaCl + NH4OHNaOH + NH4Cl = NaCl + NH4OH
Na2CO3 + Al2Cl6 = Al2(CO3)3 + NaCl3Na2CO3 + Al2Cl6 = Al2(CO3)3 + 6NaCl
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaBr = Na + BrNaBr = Na + Br
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
N2 + O2 = 2NON2 + O2 = 2NO
NaNO3 + KCl = NaCl + KNO3NaNO3 + KCl = NaCl + KNO3
NaCl = Na + Cl22NaCl = 2Na + Cl2
Na3PO5 + AgNO3 = Ag3PO5 + NaNO3Na3PO5 + 3AgNO3 = Ag3PO5 + 3NaNO3
NaI + Cl2 = NaCl + I22NaI + Cl2 = 2NaCl + I2
NH4Cl + AgNO3 = NH4NO3 + AgClNH4Cl + AgNO3 = NH4NO3 + AgCl
Ni + 2HCl = NiCl2 + H2Ni + 2HCl = NiCl2 + H2
NH3 + O2 = NO2 + H2O4NH3 + 7O2 = 4NO2 + 6H2O
NaOH+H2SO4=H20+Na+SO40NaOH + 10H2SO4 = H20 + 0Na + 10SO4
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NaBr+Pb(C2H3O2)2 = PbBr2 + NaC2H3O22NaBr + Pb(C2H3O2)2 = PbBr2 + 2NaC2H3O2
Na3PO4 + Sr(ClO3)2 = Sr3(PO4)2 + NaClO32Na3PO4 + 3Sr(ClO3)2 = Sr3(PO4)2 + 6NaClO3
NaOH+HCl=NaCl+NaClO3+H2ONaOH + HCl = NaCl + 0NaClO3 + H2O
NH4OH + Ni(NO3)2=NH4(NO3) +Ni(OH)22NH4OH + Ni(NO3)2 = 2NH4(NO3) + Ni(OH)2
NH4OH + Cu(NO3)2 = NH4(NO3) + Cu(OH)22NH4OH + Cu(NO3)2 = 2NH4(NO3) + Cu(OH)2
NH4OH + SnCl4=NH4Cl +Sn(OH)44NH4OH + SnCl4 = 4NH4Cl + Sn(OH)4
N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
NH4OH + SnCl4=NH4Cl +Sn(OH)44NH4OH + SnCl4 = 4NH4Cl + Sn(OH)4
NH4OH + H3PO4 = H2O + (NH4)3PO43NH4OH + H3PO4 = 3H2O + (NH4)3PO4
Na2CrO4 + Pb(C2H3O2)2 = PbCrO4 + 2 NaC2H3O2 Na2CrO4 + Pb(C2H3O2)2 = PbCrO4 + 2NaC2H3O2
Ni+S8=NiS8Ni + S8 = 8NiS
NaI+Cl2 = NaCl+I22NaI + Cl2 = 2NaCl + I2
NaHCO3 + HCl = NaCl + H2O + CO2NaHCO3 + HCl = NaCl + H2O + CO2
Ni(NO3)2 + NaOH = NaNO3 + Ni(OH)2Ni(NO3)2 + 2NaOH = 2NaNO3 + Ni(OH)2
NaHCO3 + SO2 = Na2SO3 + H2O + CO22NaHCO3 + SO2 = Na2SO3 + H2O + 2CO2
NaHCO3 + SO2 = Na2SO3 + H2O + CO22NaHCO3 + SO2 = Na2SO3 + H2O + 2CO2
NaHCO3 + SO3 = Na2SO4 + H2O +CO22NaHCO3 + SO3 = Na2SO4 + H2O + 2CO2
Na2HCO3 + SO2 +O2 = NaSO4 + H2O + CO24Na2HCO3 + 8SO2 + 7O2 = 8NaSO4 + 2H2O + 4CO2
NaBr+Pb(C2H3O2)2=PbBr2+NaC2H3O22NaBr + Pb(C2H3O2)2 = PbBr2 + 2NaC2H3O2
Na3PO4+Sr(ClO3)2=Sr3(PO4)2+NaClO32Na3PO4 + 3Sr(ClO3)2 = Sr3(PO4)2 + 6NaClO3
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2O(s)+HCl(aq)=NaCl(aq)+H2O(l)Na2O(s) + 2HCl(aq) = 2NaCl(aq) + H2O(l)
NaOH(aq)+HCl(aq)=4NaCl(aq)+H2O(l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
N2+O2=NON2 + O2 = 2NO
N2+O2=NON2 + O2 = 2NO
N2H4+N2O4=N+H2O2N2H4 + N2O4 = 6N + 4H2O
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaBr (aq) + Cl2 (g) =NaCl (aq) + Br2 (g)2NaBr(aq) + Cl2(g) = 2NaCl(aq) + Br2(g)
Na (s) + H2O (l)= NaOH (aq) + H2 (g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
Ni (ClO3)2=NiCl2+O2Ni(ClO3)2 = NiCl2 + 3O2
NaOH+Cu(NO3)2=CuOH+Na(NO3)2NaOH + Cu(NO3)2 = CuOH + Na(NO3)2
Na3PO4+Cu(NO3)2=Na(NO3)+Cu3(PO4)22Na3PO4 + 3Cu(NO3)2 = 6Na(NO3) + Cu3(PO4)2
NH3 + O2 = 4NO + 6H2O4NH3 + 5O2 = 4NO + 6H2O
NO + 2CO = CO2 + N22NO + 2CO = 2CO2 + N2
Ni(NO3)+ 6NH3=NO3+Ni(NH3)Ni(NO3) + NH3 = NO3 + Ni(NH3)
Ni(NO3)+ 6NH3=NO3+Ni(NH3)Ni(NO3) + NH3 = NO3 + Ni(NH3)
Ni(NO3)+ 6NH3=NO3+Ni(NH3)Ni(NO3) + NH3 = NO3 + Ni(NH3)
Ni(NO3)+ 6NH3=6NO3+Ni(NH3)Ni(NO3) + NH3 = NO3 + Ni(NH3)
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
Na2SO4 + Ca(NO3)2 = CaSO4 + NaNO3Na2SO4 + Ca(NO3)2 = CaSO4 + 2NaNO3
N2O=N2+O22N2O = 2N2 + O2
N2 + H2 = NH3N2 + 3H2 = 2NH3
N2 + H2 = NH3N2 + 3H2 = 2NH3
NI3=N2+I22NI3 = N2 + 3I2
NH3+HCl=NH4ClNH3 + HCl = NH4Cl
NH4Cl+NaNO2 = N2+NaCl+H2ONH4Cl + NaNO2 = N2 + NaCl + 2H2O
NS2=S8+N24NS2 = S8 + 2N2
NaN3+HCl=NaCl+HN3NaN3 + HCl = NaCl + HN3
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
NaOH+CO2=Na2CO3+H2O2NaOH + CO2 = Na2CO3 + H2O
NaCl + H2SO4 + MnO2 = Na2SO4 + MnSO4 + H2O + Cl22NaCl + 2H2SO4 + MnO2 = Na2SO4 + MnSO4 + 2H2O + Cl2
NH4SO4+BaNO3=NH4NO3+BaSO4NH4SO4 + BaNO3 = NH4NO3 + BaSO4
Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2 Na2CO3 + H2SO4 = Na2SO4 + H2O + CO2
NaHO3+HCl+CO=CO2+H2O+NaClNaHO3 + HCl + 2CO = 2CO2 + H2O + NaCl
NaCl + H2SO4=HCl + Na2SO42NaCl + H2SO4 = 2HCl + Na2SO4
Na + H2O =NaOH +H22Na + 2H2O = 2NaOH + H2
NH4ClO4=N2+Cl2+O2+H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na + Cl = NaClNa + Cl = NaCl
NH4NO3 = N2O + 2 H2O NH4NO3 = N2O + 2H2O
NH3(g) + O2(g) = NH4NO2(s) +H2O(g)4NH3(g) + 3O2(g) = 2NH4NO2(s) + 2H2O(g)
N2H4=NH3+N23N2H4 = 4NH3 + N2
Na3PO4(aq) + H2SO4(aq) = Na2SO4(aq) + H3PO4(aq)2Na3PO4(aq) + 3H2SO4(aq) = 3Na2SO4(aq) + 2H3PO4(aq)
NH3(g) + CuO(s) = N2(g) + Cu(s) + H2O(g)2NH3(g) + 3CuO(s) = N2(g) + 3Cu(s) + 3H2O(g)
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na+H2O=H2+NaOH2Na + 2H2O = H2 + 2NaOH
N2(g)+H2(g)=NH3N2(g) + 3H2(g) = 2NH3
N2+H2=NH3N2 + 3H2 = 2NH3
NH4CN + Sr(OH)2 = SrCN + NH4(OH)2NH4CN + Sr(OH)2 = SrCN + NH4(OH)2
Na+Cl2=NaCl2Na + Cl2 = 2NaCl
N2+H2=NH3N2 + 3H2 = 2NH3
NaCN+CuCO3=Na2CO3+Cu(CN)22NaCN + CuCO3 = Na2CO3 + Cu(CN)2
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Ni(s)+HCl(aq)=NiCl2(aq)+H2(g)Ni(s) + 2HCl(aq) = NiCl2(aq) + H2(g)
Na2C2O4 +CaCl2 =CaC2O4 +NaClNa2C2O4 + CaCl2 = CaC2O4 + 2NaCl
NO3- + Sn2+ + H+ = NO2 + H2O + Sn4+-1NO3- + 2Sn2+ - 2H+ = -1NO2 - H2O + Sn4+
N2O5 + H2O = HNO3N2O5 + H2O = 2HNO3
Na2CO3 + HCl = NaCl + H2CO3Na2CO3 + 2HCl = 2NaCl + H2CO3
Na2SO4 + CaCl2 = CaSO4 + NaClNa2SO4 + CaCl2 = CaSO4 + 2NaCl
NaOH + H = Na+ H2ONaOH + H = Na + H2O
NH4OH = NH3 + H2ONH4OH = NH3 + H2O
NaNO3 = NaNO2 +O22NaNO3 = 2NaNO2 + O2
N2O=N2+O22N2O = 2N2 + O2
N2O=N2+O22N2O = 2N2 + O2
N2O=N2+O22N2O = 2N2 + O2
NaOH (aq) + HCl (aq) = NaCl (aq) + H2O (l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
Na2SO4(aq)+BaCl2(aq)=BaSO4(s)+NaCl(aq)Na2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2NaCl(aq)
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
NH3 + O2 = NO + H2O 4NH3 + 5O2 = 4NO + 6H2O
NH2NH2+ H2O2= N2+ H2ONH2NH2 + 2H2O2 = N2 + 4H2O
Na(s) + H2O(l)=NaOH(aq) + H2(g) 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NiS(s)+O2(g)=NiO(s)+SO2(g)2NiS(s) + 3O2(g) = 2NiO(s) + 2SO2(g)
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
Na2S(aq)+Cu(NO3)2(aq)=NaNO3(aq)+CuS(s)Na2S(aq) + Cu(NO3)2(aq) = 2NaNO3(aq) + CuS(s)
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na+H2O = NaOH+H22Na + 2H2O = 2NaOH + H2
Na(s) + H2O(l)=NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
NaOH(aq)+CuCl2(aq)=NaCl(aq)+Cu(OH)2(s)2NaOH(aq) + CuCl2(aq) = 2NaCl(aq) + Cu(OH)2(s)
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
Ni+S8=NiS8Ni + S8 = 8NiS
Ni+S=NiSNi + S = NiS
Na+H2O=NaOH+HNa + H2O = NaOH + H
Na2CO3+CoCl2=CoCO3+NaClNa2CO3 + CoCl2 = CoCO3 + 2NaCl
NH3(g)+O2(g)=N2(g)+H2O(l)4NH3(g) + 3O2(g) = 2N2(g) + 6H2O(l)
NaHCO3+HCl=H2O+NaCl+CO2NaHCO3 + HCl = H2O + NaCl + CO2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
N2(g) + H2(g) = NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NO + Cl2 = NO Cl2NO + Cl2 = 2NOCl
NO + Cl2 = NOCl2NO + Cl2 = 2NOCl
N2+3H2=2NH3N2 + 3H2 = 2NH3
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO4 + AgNO3 = Ag2SO4 + NaNO3Na2SO4 + 2AgNO3 = Ag2SO4 + 2NaNO3
NH3 + O2 = N2 + H2O 4NH3 + 3O2 = 2N2 + 6H2O
NH3 + O2 = N2 + H2O 4NH3 + 3O2 = 2N2 + 6H2O
NaHCO3+H2SO4=Na2SO4+H2O+CO22NaHCO3 + H2SO4 = Na2SO4 + 2H2O + 2CO2
NaI + Na2HPO3 + H2O = PI3 + Na(OH)3NaI + Na2HPO3 + 2H2O = PI3 + 5Na(OH)
Na2C2O4+KMnO4+H2SO4 = MnSO4+CO2 + H2O+K2SO4+Na2SO45Na2C2O4 + 2KMnO4 + 8H2SO4 = 2MnSO4 + 10CO2 + 8H2O + K2SO4 + 5Na2SO4
NO + O2 = NO22NO + O2 = 2NO2
NH3(g)+CO2(g)=CO(NH2)2(s)+H2O(l)2NH3(g) + CO2(g) = CO(NH2)2(s) + H2O(l)
NaCl=NaClNaCl = NaCl
NH4+H2So4=H2+NH(So)42NH4 + 2H2So4 = 5H2 + 2NH(So)4
NH4+H2So4=H2+NH4 So4NH4 + H2So4 = H2 + NH4So4
NH3 + CuO = Cu + N2 + H2O2NH3 + 3CuO = 3Cu + N2 + 3H2O
NaOH + H2SO4 = H2O + Na2SO42NaOH + H2SO4 = 2H2O + Na2SO4
Na + H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
NaOH+AgNO3=NaNO3+AgOHNaOH + AgNO3 = NaNO3 + AgOH
NH3(g)+O2(g)=NO2(g)+H2O(l) 4NH3(g) + 7O2(g) = 4NO2(g) + 6H2O(l)
NaOH+ NiSO4 =Na2SO4 + Ni(OH)22NaOH + NiSO4 = Na2SO4 + Ni(OH)2
N2O4 = N2O+O22N2O4 = 2N2O + 3O2
NaNO3 +2FeSO4+ 6CH3COOH = NaNO2 + 2(CH3COO)3Fe + 2SO3+ 3H2ONaNO3 + 2FeSO4 + 6CH3COOH = NaNO2 + 2(CH3COO)3Fe + 2SO3 + 3H2O
NaNO3 +2FeSO4+ 6CH3COOH = NaNO2 + 2(CH3COO)3Fe + 2SO3+ 3H2ONaNO3 + 2FeSO4 + 6CH3COOH = NaNO2 + 2(CH3COO)3Fe + 2SO3 + 3H2O
Na+Cl=NaClNa + Cl = NaCl
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2CO3(aq)+HCl(aq)=NaCl(aq)+H2O(l)+CO2(g)Na2CO3(aq) + 2HCl(aq) = 2NaCl(aq) + H2O(l) + CO2(g)
N2O + O2 = NO22N2O + 3O2 = 4NO2
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NaHSO3(s)=Na2SO3(s)+SO2(g)+H2O(l)2NaHSO3(s) = Na2SO3(s) + SO2(g) + H2O(l)
Na2CO3 = CO2 + Na2ONa2CO3 = CO2 + Na2O
NH4OH + HBr = H2O + NH4BrNH4OH + HBr = H2O + NH4Br
NH3+O2=NO2+H2O4NH3 + 7O2 = 4NO2 + 6H2O
N2H4(l)+O2(g)=NO2(g)+H2O(g)N2H4(l) + 3O2(g) = 2NO2(g) + 2H2O(g)
Na2CO3+CoCl2=NaCl+CoCO3Na2CO3 + CoCl2 = 2NaCl + CoCO3
N2H4=NH3+N23N2H4 = 4NH3 + N2
NaBH4 + H2O = NaOH + H3BO3 + H2NaBH4 + 4H2O = NaOH + H3BO3 + 4H2
N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
NaPO4+Ca(NO3)=Na(NO3)+Ca(PO4)NaPO4 + Ca(NO3) = Na(NO3) + Ca(PO4)
NaNO3 + H2SO4 = Na2SO4 + HNO3 2NaNO3 + H2SO4 = Na2SO4 + 2HNO3
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
NaOH + HCl = NaCl + H2ONaOH + HCl = NaCl + H2O
Na3PO4 + CuN2O6 = Cu3P2O8 + NaNO32Na3PO4 + 3CuN2O6 = Cu3P2O8 + 6NaNO3
NO+O2=NO22NO + O2 = 2NO2
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
N2 + O2 = NON2 + O2 = 2NO
N2 + O2 = NON2 + O2 = 2NO
NO2+H2O+O2=HNO34NO2 + 2H2O + O2 = 4HNO3
NH4CO3+CaC4H6CaO4=NH4C2H3O2+CaCO32NH4CO3 + CaC4H6CaO4 = 2NH4C2H3O2 + 2CaCO3
Na3 PO4 + MgBr2 = NaBr + Mg3 (PO4)22Na3PO4 + 3MgBr2 = 6NaBr + Mg3(PO4)2
NH4NO3(s)=N2(g)+O2(g)+H2O(g)2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
N2(g) + O2(g) = N2O32N2(g) + 3O2(g) = 2N2O3
NO2 + H2O = HNO3 + NO3NO2 + H2O = 2HNO3 + NO
Na2S2O3 + I2 = NaI + Na2S4O62Na2S2O3 + I2 = 2NaI + Na2S4O6
NBr3 + NaOH = N2 + NaBr + HOBr2NBr3 + 3NaOH = N2 + 3NaBr + 3HOBr
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4CO3+Ca2C2H3O2=NH4C2H3O2+Ca2CO3NH4CO3 + Ca2C2H3O2 = NH4C2H3O2 + Ca2CO3
NH4 + NO = N2 + H2O2NH4 + 4NO = 3N2 + 4H2O
NH4CO3+CaC2H3O2=NH4C2H3O2+CaCO3NH4CO3 + CaC2H3O2 = NH4C2H3O2 + CaCO3
NaH2PO4 = NaPO3 + H2ONaH2PO4 = NaPO3 + H2O
NO + CH4 = HCN + H2O + H22NO + 2CH4 = 2HCN + 2H2O + H2
NO + CH4 = HCN + H2O + H22NO + 2CH4 = 2HCN + 2H2O + H2
NH3+O2=N2+H2O4NH3 + 3O2 = 2N2 + 6H2O
NH 3+F 2= N 2 F 4+HF2NH3 + 5F2 = N2F4 + 6HF
NaClO3=NaCl+O22NaClO3 = 2NaCl + 3O2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
NaHCO3=NaOH+CO2NaHCO3 = NaOH + CO2
Na(AlO2) + 4HCl = AlCl3 + NaCl + 2H2ONa(AlO2) + 4HCl = AlCl3 + NaCl + 2H2O
N + O = N2O52N + 5O = N2O5
Na + S=Na2S2Na + S = Na2S
NH3 + NO = N2 + H2O4NH3 + 6NO = 5N2 + 6H2O
Na2CO3 + C + N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
Na2CO3 + C + N2 = NaCN + CONa2CO3 + 4C + N2 = 2NaCN + 3CO
NiCl2 + H2O2 + HCl =NiCl3 +H2O2NiCl2 + H2O2 + 2HCl = 2NiCl3 + 2H2O
Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
NaSO3 + KMnO4 + H2SO4 = MnSO4 + K2SO4 + Na2SO4 + H2O-10NaSO3 - 2KMnO4 + 2H2SO4 = -2MnSO4 - K2SO4 - 5Na2SO4 + 2H2O
NH4Cl + NaNO2 = NaCl + H2O + N2NH4Cl + NaNO2 = NaCl + 2H2O + N2
NaNO2+NaI+H2(SO4)=NO+I+Na(SO4)+H2ONaNO2 + 0NaI + H2(SO4) = NO + 0I + Na(SO4) + H2O
NaNO2+NaI+H2(SO4)=NO+I+Na(SO4)+H2ONaNO2 + 0NaI + H2(SO4) = NO + 0I + Na(SO4) + H2O
NaNO2+NaI+H2(SO4)=NO+I+Na(SO4)+H2ONaNO2 + 0NaI + H2(SO4) = NO + 0I + Na(SO4) + H2O
Na2SO4(aq)+CaI2(aq)=CaSO4(s)+2NaI(aq) Na2SO4(aq) + CaI2(aq) = CaSO4(s) + 2NaI(aq)
NH4NO3+Ba(OH)2=Ba(NO3)2+H2O+NH32NH4NO3 + Ba(OH)2 = Ba(NO3)2 + 2H2O + 2NH3
NaHCO3(s) = H2O(g) + CO2(g) + Na2CO3(s)2NaHCO3(s) = H2O(g) + CO2(g) + Na2CO3(s)
N2H4= NH3 +N23N2H4 = 4NH3 + N2
Na(C2O4)+CaCl=NaCl+Ca(C2O4)Na(C2O4) + CaCl = NaCl + Ca(C2O4)
N2(g)+I2(g)=NI3(g)N2(g) + 3I2(g) = 2NI3(g)
NH3 +O2= NO +H22NH3 + O2 = 2NO + 3H2
NH4(OH)=NH4=(OH)NH4(OH) = NH4 + (OH)
N+H=NH3N + 3H = NH3
NaN3 = Na + N22NaN3 = 2Na + 3N2
Na3PO4 + NiCl2 = Ni3(PO4)2 + NaCl2Na3PO4 + 3NiCl2 = Ni3(PO4)2 + 6NaCl
Na2S + CuSO = Na2SO4 + CuSNa2S + 4CuSO = Na2SO4 + 4CuS
Na2CO3 + CrBr2 = NaBr + Cr2(CO3)22Na2CO3 + 2CrBr2 = 4NaBr + Cr2(CO3)2
Na2CO3 + CrBr2 = NaBr + Cr2(CO3)22Na2CO3 + 2CrBr2 = 4NaBr + Cr2(CO3)2
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2=NO+H2O4NH3 + 5O2 = 4NO + 6H2O
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NH4NO3(s)=N2O(g)+H2O(l)NH4NO3(s) = N2O(g) + 2H2O(l)
NaHCO3 + CH3COOH = NaH2CCOOH + H2O + CO2NaHCO3 + CH3COOH = NaH2CCOOH + H2O + CO2
NaClO3=NaCl+ONaClO3 = NaCl + 3O
NaBr+CaF2=NaF+CaBr22NaBr + CaF2 = 2NaF + CaBr2
Ni(NO3)2 + 6H2O(s) = Ni(NO2)2 + H2-1Ni(NO3)2 + 2H2O(s) = -1Ni(NO2)2 + 2H2
Ni(NO3)2 + 6H2O(s) = Ni(NO2)2 + H2O0Ni(NO3)2 + H2O(s) = 0Ni(NO2)2 + H2O
NH3 + H2SO4 = (NH4)2 SO42NH3 + H2SO4 = (NH4)2SO4
Ni(NO3)2 + 6H2O(s) = Ni(NO2)2 + H2O0Ni(NO3)2 + H2O(s) = 0Ni(NO2)2 + H2O
Ni(NO3)2 + 6H2O(s) = Ni(NO2)2 + H2-1Ni(NO3)2 + 2H2O(s) = -1Ni(NO2)2 + 2H2
NaSO3+H2O2=NaSO4+H2ONaSO3 + H2O2 = NaSO4 + H2O
NaSO3+H2O2=NaSO4+H2ONaSO3 + H2O2 = NaSO4 + H2O
NaSO3+H2O2=NaSO4+H2ONaSO3 + H2O2 = NaSO4 + H2O
NaHCO3+HCl=NaCl+H2CO3NaHCO3 + HCl = NaCl + H2CO3
Na(s) + Cl2(g) = NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
N2+O2=NON2 + O2 = 2NO
NH3 + Mg = Mg3N2 + H22NH3 + 3Mg = Mg3N2 + 3H2
NH3 + Mg2 = Mg3N2 + H24NH3 + 3Mg2 = 2Mg3N2 + 6H2
Na2TeO3 + NaI +HCl = NaCl + H2O + Te + I2Na2TeO3 + 4NaI + 6HCl = 6NaCl + 3H2O + Te + 2I2
N2 + O2 = N2O32N2 + 3O2 = 2N2O3
N2 + O2 = 2NON2 + O2 = 2NO
NH4ClO4 = N2 +Cl2 +O2 +H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
N2 + O2 = 2NON2 + O2 = 2NO
N2(g)+CO2(l)=NO2+CN2(g) + 2CO2(l) = 2NO2 + 2C
N2+O2=NON2 + O2 = 2NO
N2+CO2=NO2+CN2 + 2CO2 = 2NO2 + 2C
Na + KNO3 = Na2O + K2O + N210Na + 2KNO3 = 5Na2O + K2O + N2
Ni(CO)4 = Ni + CONi(CO)4 = Ni + 4CO
N2O+C3H8=N2+CO2+H2O10N2O + C3H8 = 10N2 + 3CO2 + 4H2O
N2O+C3H8=N2+CO2+H2O10N2O + C3H8 = 10N2 + 3CO2 + 4H2O
NH4ClO4 = N2 +Cl2 +O2 +H2O2NH4ClO4 = N2 + Cl2 + 2O2 + 4H2O
N2 + O2 = N2O32N2 + 3O2 = 2N2O3
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
Na2SO3 + HCl = H2SO3 + NaClNa2SO3 + 2HCl = H2SO3 + 2NaCl
N2H2 + C3H4 = C3H8 + N22N2H2 + C3H4 = C3H8 + 2N2
NH3 +O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O5+H2O=HNO3N2O5 + H2O = 2HNO3
NaOCl + NH3 = NaONH3 + Cl22NaOCl + 2NH3 = 2NaONH3 + Cl2
NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
NaOH(aq)+HCl(aq)=NaCl(aq)+H2O(l)NaOH(aq) + HCl(aq) = NaCl(aq) + H2O(l)
Na+S=NaSNa + S = NaS
N+O=NON + O = NO
Na2O + H2O=NaOHNa2O + H2O = 2NaOH
NH4+Cl2=N2H4+NH4Cl2NH4 + Cl2 = 0N2H4 + 2NH4Cl
NaOH + Na2SO4=Na2OH + NaSO4NaOH + Na2SO4 = Na2OH + NaSO4
NaCl+F2=2NaF+1Cl22NaCl + F2 = 2NaF + Cl2
Na + KNO3 = Na2O + K2O + N210Na + 2KNO3 = 5Na2O + K2O + N2
Na2CO3 + H3PO4 = Na3PO4 + H2O + CO23Na2CO3 + 2H3PO4 = 2Na3PO4 + 3H2O + 3CO2
NH4NO3(s)=N2(g)+O2(g)+H2O(g) 2NH4NO3(s) = 2N2(g) + O2(g) + 4H2O(g)
Na2O + (NH4)SO4 = NaSO4 + H2O + NH3Na2O + 2(NH4)SO4 = 2NaSO4 + H2O + 2NH3
NH4Cl + Ba(OH)2 = BaCl2 + NH3 + H2O2NH4Cl + Ba(OH)2 = BaCl2 + 2NH3 + 2H2O
Na2CO3 + HCl = NaCl + H2O + CO2Na2CO3 + 2HCl = 2NaCl + H2O + CO2
NaOH + H3PO4 = H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NaOH + H3PO4 = H2O + Na3PO43NaOH + H3PO4 = 3H2O + Na3PO4
NaBr+Pb(NO3)2=PbBr2+NaNO32NaBr + Pb(NO3)2 = PbBr2 + 2NaNO3
NaOH+H2CO3=H2O+Na2CO32NaOH + H2CO3 = 2H2O + Na2CO3
N2 + H2 = NH3N2 + 3H2 = 2NH3
Na2O + H2O = NaOHNa2O + H2O = 2NaOH
NH3 + O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2O + N2H4 = N2 + H2O2N2O + N2H4 = 3N2 + 2H2O
NiS + O2 = Ni2O3 + SO24NiS + 7O2 = 2Ni2O3 + 4SO2
NA2O + H2O = 2 NA + H2O0NA2O + H2O = 0NA + H2O
NaCrO2 + NaClO + H2O = Na2CrO4 + NaOH + Cl2 2NaCrO2 + 6NaClO + 2H2O = 2Na2CrO4 + 4NaOH + 3Cl2
NH3 + Ag2O = N2 + Ag + H2O2NH3 + 3Ag2O = N2 + 6Ag + 3H2O
N2 + O2 = 2 NON2 + O2 = 2NO
NaHCO3 + KI = NaI + KHCO3NaHCO3 + KI = NaI + KHCO3
NaOH+HCl=NaCl+H2ONaOH + HCl = NaCl + H2O
NaHCO3 = CO2+NaOHNaHCO3 = CO2 + NaOH
NaHCO3 = H2O + CO2 + Na2O2NaHCO3 = H2O + 2CO2 + Na2O
NaHCO3 = H2O + CO2 + Na2O2NaHCO3 = H2O + 2CO2 + Na2O
NaHCO3 = H2O + CO2 + Na2CO32NaHCO3 = H2O + CO2 + Na2CO3
Na(s) + Cl2(g) =NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
Na2O+CO2=Na2CO3Na2O + CO2 = Na2CO3
NO2(g)+H2O(l)=HNO3(aq)+NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
NaBr + Ca3(PO4)2 = CaBr2 + Na3PO46NaBr + Ca3(PO4)2 = 3CaBr2 + 2Na3PO4
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaH+H2O=NaOH+H2NaH + H2O = NaOH + H2
NH3+O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
NH3+O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NaCH3COO+KOH=KCH3COO+NaOHNaCH3COO + KOH = KCH3COO + NaOH
NH3+O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
Ni(NO3)2 + NaOH = Ni(OH)2 + NaNO3Ni(NO3)2 + 2NaOH = Ni(OH)2 + 2NaNO3
Na2O+CO2=Na2CO3Na2O + CO2 = Na2CO3
Na+CO3=Na2CO32Na + CO3 = Na2CO3
Na+CO3=Na2CO32Na + CO3 = Na2CO3
NH4NO3 = N2O + H2ONH4NO3 = N2O + 2H2O
Na3PO4(s) = 3Na (aq)+ PO4(aq)Na3PO4(s) = 3Na(aq) + PO4(aq)
NaNO2+HBr=NaBr+HNO2NaNO2 + HBr = NaBr + HNO2
Na2CO3+FeI2=NaI+FeCO3Na2CO3 + FeI2 = 2NaI + FeCO3
NaCN+HNO3=NaNO3+HCNNaCN + HNO3 = NaNO3 + HCN
Na3PO4+MgSO4=Na2SO4+Mg3(PO4)22Na3PO4 + 3MgSO4 = 3Na2SO4 + Mg3(PO4)2
Ni2O3 +Fe +H2O = Ni(OH)2 +Fe(OH)2Ni2O3 + Fe + 3H2O = 2Ni(OH)2 + Fe(OH)2
Ni2O3 +Fe +H2O = Ni(OH)2 +Fe(OH)2Ni2O3 + Fe + 3H2O = 2Ni(OH)2 + Fe(OH)2
N2(g)+H2(g)=NH3(g)N2(g) + 3H2(g) = 2NH3(g)
NaOH + H2SO4 = Na2SO4 + H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na + S = Na2S2Na + S = Na2S
N2 + H2 = NH3N2 + 3H2 = 2NH3
NH3+HClO=NH4ClONH3 + HClO = NH4ClO
N2 + O2 = NO2N2 + 2O2 = 2NO2
N2 + O2 = NON2 + O2 = 2NO
NiCl2 (aq) + Ba(OH)2 (aq) = BaCl2 (aq)+ Ni(OH)2 (s)NiCl2(aq) + Ba(OH)2(aq) = BaCl2(aq) + Ni(OH)2(s)
NiCl2 (aq) + Ba(OH)2 (aq) = BaCl2 (s)+ Ni(OH)2 (s)NiCl2(aq) + Ba(OH)2(aq) = BaCl2(s) + Ni(OH)2(s)
NiCl2 (aq) + Ba(OH)2 (aq) = BaCl2 (s)+ Ni(OH)2 (aq)NiCl2(aq) + Ba(OH)2(aq) = BaCl2(s) + Ni(OH)2(aq)
NiCl2 (aq) + Ba(OH)2 (aq) = BaCl2 (s)+ Ni(OH)2NiCl2(aq) + Ba(OH)2(aq) = BaCl2(s) + Ni(OH)2
NiCl2 (aq) + Ba(OH)2 (aq) = BaCl2 + Ni(OH)2NiCl2(aq) + Ba(OH)2(aq) = BaCl2 + Ni(OH)2
NiCl2 (aq) + Ba(OH)2 (aq) = BaCl2 + Ni(OH)2NiCl2(aq) + Ba(OH)2(aq) = BaCl2 + Ni(OH)2
NaOH+H2SO4=Na2SO4 +H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
Na2SO4 (aq) + AgNO3 (aq) = Ag2SO4 (s) + NaNO3 (aq)Na2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2NaNO3(aq)
Ni+F2=NiF2Ni + F2 = NiF2
N2H4(l)=NH3(g)+N2(g)3N2H4(l) = 4NH3(g) + N2(g)
NO(g)+CO(g)=N2(g)+CO22NO(g) + 2CO(g) = N2(g) + 2CO2
Na2CO3+HCl=CO2+H2O+NaClNa2CO3 + 2HCl = CO2 + H2O + 2NaCl
NO2 + H2O + O2 = H3O+ +NO3-4NO2 + 6H2O + O2 = 4H3O+ + 4NO3-
N2O3+H2O=H2N2O4N2O3 + H2O = H2N2O4
N2O3+H2O=H2N2O4N2O3 + H2O = H2N2O4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.