Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
K+B2O3=K2O+B6K + B2O3 = 3K2O + 2B
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCLO=KCL+O22KCLO = 2KCL + O2
K2SO4(aq)+BaCl2(aq)=KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
K2SO4(aq)+BaCl2(aq)=KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
K2CO3(aq) + Na2SO4(aq)=Na2CO3 + K2SO4K2CO3(aq) + Na2SO4(aq) = Na2CO3 + K2SO4
KBr + C4H6CaO4 = CH3CO2K + CaBr22KBr + C4H6CaO4 = 2CH3CO2K + CaBr2
K2CO3+C=CO+KK2CO3 + 2C = 3CO + 2K
KMnO4 + H2SO4 + H2 = K2SO4 + MnSO4 + H2O 2KMnO4 + 3H2SO4 + 5H2 = K2SO4 + 2MnSO4 + 8H2O
K2Cr2O7 + H2SO4 = K2SO4 + Cr2(SO4)3 +H2O + O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KBr+KMnO4+HCl = KBrO3+MnO2+KCl+H2OKBr + 2KMnO4 + 2HCl = KBrO3 + 2MnO2 + 2KCl + H2O
K4Fe(CN)6 + H2SO4 + H2O = K2SO4 + FeSO4 + (NH4) + SO4 + COK4Fe(CN)6 + 6H2SO4 + 6H2O = 2K2SO4 + FeSO4 + 6(NH4) + 3SO4 + 6CO
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KClO3+Na2SnO2=KCl+Na2SnO3KClO3 + 3Na2SnO2 = KCl + 3Na2SnO3
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO 3 (s) = KCl (s) + O 2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
KClO3(aq) = KCl(aq) + O2(g)2KClO3(aq) = 2KCl(aq) + 3O2(g)
K3PO4+Cu(NO3)2= K3(NO3)2+CuPO4K3PO4 + Cu(NO3)2 = K3(NO3)2 + CuPO4
K2(Cr2O7)+HCl=KCl+CrCl3+Cl2+H2OK2(Cr2O7) + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
K2O + H2O = KOHK2O + H2O = 2KOH
KOH + KH2PO4 = K3PO4 + H2O2KOH + KH2PO4 = K3PO4 + 2H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH + H2SO4 =K2SO4 +H2O2KOH + H2SO4 = K2SO4 + 2H2O
K (s) + H2O (l) = H2 (g) + KOH2K(s) + 2H2O(l) = H2(g) + 2KOH
K2Cr2O7 + H2SO4 + SO2 = K2SO4 + Cr2(SO4)3 + H2OK2Cr2O7 + H2SO4 + 3SO2 = K2SO4 + Cr2(SO4)3 + H2O
K2Cr2O7 + FeSO4 + H2SO4 = Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H20 0K2Cr2O7 + 20FeSO4 + 10H2SO4 = 0Cr2(SO4)3 + 10Fe2(SO4)3 + 0K2SO4 + H20
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
K2SO4+Ca(OH)2+H2O =KOH+CaSO4K2SO4 + Ca(OH)2 + 0H2O = 2KOH + CaSO4
K2SO4+Ca(OH)2+H2O =KOH+CaSO4K2SO4 + Ca(OH)2 + 0H2O = 2KOH + CaSO4
K2 Cr2 O7+FeCl2+HCl=Cr Cl3+KCl+FeCl3+H2O K2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 2KCl + 6FeCl3 + 7H2O
K2 Cr2 O7+FeCl2+HCl=Cr Cl3+KCl+FeCl3+H2O K2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 2KCl + 6FeCl3 + 7H2O
K2 Cr2 O7+FeCl2+HCl=Cr Cl3+KCl+FeCl3+H2O K2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 2KCl + 6FeCl3 + 7H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7 + KI + H2SO4 = Cr2(SO4)3 + K2SO4 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = Cr2(SO4)3 + 4K2SO4 + 3I2 + 7H2O
K2Cr2O2 + KI + H2SO4 = Cr2(SO4)3 + K2SO4 + I2 + H2OK2Cr2O2 - 4KI + 2H2SO4 = Cr2(SO4)3 - K2SO4 - 2I2 + 2H2O
KOH + Cu(NO3)2 = KNO3 + Cu(OH)22KOH + Cu(NO3)2 = 2KNO3 + Cu(OH)2
K + H2O = H2 + KOH2K + 2H2O = H2 + 2KOH
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KMnO4 + C6H12O6 + HCl = CO2 + H20 + MnO2 + KCl12KMnO4 + 4C6H12O6 + 12HCl = 24CO2 + 3H20 + 12MnO2 + 12KCl
KMnO4 + KCl + H2SO4 = MnSO4 + K2SO4 + Cl2 + H2O2KMnO4 + 10KCl + 8H2SO4 = 2MnSO4 + 6K2SO4 + 5Cl2 + 8H2O
K2Cr2O7 + HCl = KCl + CrCl3 + Cl2 + H2O K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KMnO4+KBr+H2SO4=MnSO4+K2SO4+Br2+H2O2KMnO4 + 10KBr + 8H2SO4 = 2MnSO4 + 6K2SO4 + 5Br2 + 8H2O
KMnO4+KI+H2SO4=MnSO4+K2SO4+I2+H2O2KMnO4 + 10KI + 8H2SO4 = 2MnSO4 + 6K2SO4 + 5I2 + 8H2O
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KClO3 + C12H22O11 = KCl + CO2 + H2O8KClO3 + C12H22O11 = 8KCl + 12CO2 + 11H2O
KClO3 + C12H22O11 = KCl + CO2 + H2O8KClO3 + C12H22O11 = 8KCl + 12CO2 + 11H2O
K2S(aq) + CuBr2(aq) = CuS(s) + KBr(aq)K2S(aq) + CuBr2(aq) = CuS(s) + 2KBr(aq)
K(s)+ZnBr2 (aq)=Zn+2KBr 2K(s) + ZnBr2(aq) = Zn + 2KBr
KMnO4 + FeSO4 + H2SO4 = K2SO4 + Fe2(SO4)3 + H2O + FeMnO42KMnO4 + 4FeSO4 + 0H2SO4 = K2SO4 + Fe2(SO4)3 + 0H2O + 2FeMnO4
K(s)+H2O(l)=KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KMnO4 + HBr = MnBr2 + KBr + H2O + Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq) K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq) K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KI + HCl = KCl + HIKI + HCl = KCl + HI
KOH(aq) + CuCl2(aq) = Cu(OH)2(s) + KCl(aq)2KOH(aq) + CuCl2(aq) = Cu(OH)2(s) + 2KCl(aq)
K2MnO4 + CO2 + H2O = KMnO4 + KHCO3 + MnO23K2MnO4 + 4CO2 + 2H2O = 2KMnO4 + 4KHCO3 + MnO2
K2CrO4 + KI + H2SO4 = K2SO4 + Cr2(SO4) + I2 + H2O2K2CrO4 + 10KI + 8H2SO4 = 7K2SO4 + Cr2(SO4) + 5I2 + 8H2O
K2Cr2O7 + NO2 + HNO3 = KNO3 + Cr(NO3)3 + H2OK2Cr2O7 + 6NO2 + 2HNO3 = 2KNO3 + 2Cr(NO3)3 + H2O
K2Cr2O7 + C6H12O6 = K2CO3 + Cr2O3 + CO2 + H2O4K2Cr2O7 + C6H12O6 = 4K2CO3 + 4Cr2O3 + 2CO2 + 6H2O
K2Cr2O7 + C6H12O6 = K2CO3 + Cr2O3 + CO2 + H2O4K2Cr2O7 + C6H12O6 = 4K2CO3 + 4Cr2O3 + 2CO2 + 6H2O
K2Cr2O7 + C6H12O6 = K2CO3 + Cr2O3 + CO2 + H2O4K2Cr2O7 + C6H12O6 = 4K2CO3 + 4Cr2O3 + 2CO2 + 6H2O
K2Cr2O7 + C6H12O6 = K2CO3 + Cr2O3 + CO2 + H2O4K2Cr2O7 + C6H12O6 = 4K2CO3 + 4Cr2O3 + 2CO2 + 6H2O
K2Cr2O7 + C6H12O6 = K2CO3 + Cr2O3 + CO2 + H2O4K2Cr2O7 + C6H12O6 = 4K2CO3 + 4Cr2O3 + 2CO2 + 6H2O
KOH + HBr = KBr + H2OKOH + HBr = KBr + H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO3 + HCl = Cl2 + KCl + H2OKClO3 + 6HCl = 3Cl2 + KCl + 3H2O
K2CrO4 + H2SO4 = K2Cr2O7 + K2SO4 + H2O2K2CrO4 + H2SO4 = K2Cr2O7 + K2SO4 + H2O
K2CrO4 + H2SO4 = K2Cr2O7 + K2SO4 + H2O2K2CrO4 + H2SO4 = K2Cr2O7 + K2SO4 + H2O
KOH + S = K2S + K2SO3 + H2O6KOH + 3S = 2K2S + K2SO3 + 3H2O
KI + K2Cr2O7 + H2SO4 = I2 + K2SO4 + Cr2(SO4)3 + H2O6KI + K2Cr2O7 + 7H2SO4 = 3I2 + 4K2SO4 + Cr2(SO4)3 + 7H2O
K2SO3 + KMnO4 + H2O = MnO2 + K2SO4 + KOH3K2SO3 + 2KMnO4 + H2O = 2MnO2 + 3K2SO4 + 2KOH
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI + H2SO4 = K2SO4 + I2 + H2S + H2O8KI + 5H2SO4 = 4K2SO4 + 4I2 + H2S + 4H2O
K2Cr2O7+H2SO3+KOH=KCrO2+K2SO4+H2OK2Cr2O7 + 3H2SO3 + 6KOH = 2KCrO2 + 3K2SO4 + 6H2O
K2Cr2O7+H2SO3+KOH=KCrO4+K2SO4+H2O-1K2Cr2O7 + H2SO3 + 2KOH = -2KCrO4 + K2SO4 + 2H2O
KOH(aq) + HClO(aq) = H2O(aq) + KClO(aq)KOH(aq) + HClO(aq) = H2O(aq) + KClO(aq)
KOH(aq) + HClO(aq) = H2O(aq) + KClO(aq)KOH(aq) + HClO(aq) = H2O(aq) + KClO(aq)
K2O + H3PO4 = K3PO4 + H2O3K2O + 2H3PO4 = 2K3PO4 + 3H2O
KMnO4 = K2O + MnO + O2 4KMnO4 = 2K2O + 4MnO + 5O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2SO4(aq)+CaI2(aq)=CaSO4(s)+KI(aq)K2SO4(aq) + CaI2(aq) = CaSO4(s) + 2KI(aq)
K + HCl = KCl + H22K + 2HCl = 2KCl + H2
KOH+H3ASO4=K2HASO4+H2O2KOH + H3ASO4 = K2HASO4 + 2H2O
K2CrO4+HCl=K2Cr2O7+KCl+H2O2K2CrO4 + 2HCl = K2Cr2O7 + 2KCl + H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KClO3+CO=KCl+CO2KClO3 + 3CO = KCl + 3CO2
KMnO4 + KNO2 + HCl = MnCl2 + KCl + KNO3 + H2O2KMnO4 + 5KNO2 + 6HCl = 2MnCl2 + 2KCl + 5KNO3 + 3H2O
KI(aq)+Cl2(g)=KCl(aq)+I2(aq)2KI(aq) + Cl2(g) = 2KCl(aq) + I2(aq)
KMnO4+Na2SO3+H2SO4=K2SO4+MnSO4+Na2SO4+H2O2KMnO4 + 5Na2SO3 + 3H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 3H2O
KMnO4+Na2SO3+H2SO4=K2SO4+MnSO4+NaSO4+H2O4KMnO4 + 5Na2SO3 + 11H2SO4 = 2K2SO4 + 4MnSO4 + 10NaSO4 + 11H2O
KCIO3=KCI +O22KCIO3 = 2KCI + 3O2
KMnO4+SnCl2+HCl=MnCl2+SnCl4+KCl+H2O2KMnO4 + 5SnCl2 + 16HCl = 2MnCl2 + 5SnCl4 + 2KCl + 8H2O
KMnO4+FeCl3(H2O)6+H2SO4=K2SO4+MnSO4+Fe2(SO4)+Cl2+H2O2KMnO4 + 10FeCl3(H2O)6 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4) + 15Cl2 + 68H2O
KMnO4+FeCl3+H2SO4=K2SO4+MnSO4+Fe2(SO4)+Cl2+H2O2KMnO4 + 10FeCl3 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4) + 15Cl2 + 8H2O
KMnO4+H2C2O4(H2O)2+H2SO4=MnSO4+K2SO4+CO2+H2O2KMnO4 + 5H2C2O4(H2O)2 + 3H2SO4 = 2MnSO4 + K2SO4 + 10CO2 + 18H2O
KMnO4+H2C2O4+H2SO4=MnSO4+K2SO4+CO2+H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = 2MnSO4 + K2SO4 + 10CO2 + 8H2O
KL + H2SO4 = K2SO4 + L2 + H2S + H2O8KL + 5H2SO4 = 4K2SO4 + 4L2 + H2S + 4H2O
K2Cr2O7+FeSO4(H2O)7+H2SO4=K2SO4+Cr2(SO4)3+Fe2(SO4)3+H2OK2Cr2O7 + 6FeSO4(H2O)7 + 7H2SO4 = K2SO4 + Cr2(SO4)3 + 3Fe2(SO4)3 + 49H2O
K2Cr2O7+FeSO4+H2SO4=K2SO4+Cr2(SO4)3+Fe2(SO4)3+H2OK2Cr2O7 + 6FeSO4 + 7H2SO4 = K2SO4 + Cr2(SO4)3 + 3Fe2(SO4)3 + 7H2O
K4(Fe(CN)6)+K2Cr2O7+H2SO4=K2SO4+Fe2(SO4)3+Cr2(SO4)3+CO2+NO2+H2O6K4(Fe(CN)6) + 55K2Cr2O7 + 241H2SO4 = 67K2SO4 + 3Fe2(SO4)3 + 55Cr2(SO4)3 + 36CO2 + 36NO2 + 241H2O
K2Cr2O7+FeSO4+H2SO4=K2SO4+Cr2(SO4)3+Fe2(SO4)3+H2OK2Cr2O7 + 6FeSO4 + 7H2SO4 = K2SO4 + Cr2(SO4)3 + 3Fe2(SO4)3 + 7H2O
KMnO4+H2C2O4+H2SO4=MnSO4+K2SO4+CO2+H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = 2MnSO4 + K2SO4 + 10CO2 + 8H2O
KMnO4+Na2SO3+H2SO4=K2SO4+MnSO4+NaSO4+H2O4KMnO4 + 5Na2SO3 + 11H2SO4 = 2K2SO4 + 4MnSO4 + 10NaSO4 + 11H2O
K4(Fe(CN)6)+MnO2+HCl=KCl+FeCl3+MnCl2+CO2+N2+H2O2K4(Fe(CN)6) + 31MnO2 + 76HCl = 8KCl + 2FeCl3 + 31MnCl2 + 12CO2 + 6N2 + 38H2O
KMnO4+C6H6+H2SO4=K2SO4+MnSO4+CO2+H2O6KMnO4 + C6H6 + 9H2SO4 = 3K2SO4 + 6MnSO4 + 6CO2 + 12H2O
KMnO4+CoCl2+HgO+H2O=Co(OH)3+MnO2+HgCl2+KCl2KMnO4 + 6CoCl2 + 5HgO + 9H2O = 6Co(OH)3 + 2MnO2 + 5HgCl2 + 2KCl
K+I2=KI2K + I2 = 2KI
K+I2=KI2K + I2 = 2KI
KMnO4+HCl=KMnCl2+Cl2+H2OKMnO4 + 8HCl = KMnCl2 + 3Cl2 + 4H2O
K4(Fe(CN)6)+KMnO4+HCl=KCl+FeCl3+MnCl2+CO2+NO+H2O5K4(Fe(CN)6) + 43KMnO4 + 164HCl = 63KCl + 5FeCl3 + 43MnCl2 + 30CO2 + 30NO + 82H2O
K4(Fe(CN)6)+KMnO4+HCl=KCl+FeCl3+MnCl2+CO2+NO+H2O5K4(Fe(CN)6) + 43KMnO4 + 164HCl = 63KCl + 5FeCl3 + 43MnCl2 + 30CO2 + 30NO + 82H2O
K4(Fe(CN)6)+K2Cr2O7+H2SO4=K2SO4+Fe2(SO4)3+Cr2(SO4)3+CO2+NO2+H2O6K4(Fe(CN)6) + 55K2Cr2O7 + 241H2SO4 = 67K2SO4 + 3Fe2(SO4)3 + 55Cr2(SO4)3 + 36CO2 + 36NO2 + 241H2O
K4(Fe(CN)6)+KMnO4+H2SO4=K2SO4+MnSO4+Fe2(SO4)3+CO2+HNO3+H2O10K4(Fe(CN)6) + 122KMnO4 + 218H2SO4 = 81K2SO4 + 122MnSO4 + 5Fe2(SO4)3 + 60CO2 + 60HNO3 + 188H2O
K4(Fe(CN)6)+K2Cr2O7+H2SO4=Fe2(SO4)3+K2SO4+Cr2(SO4)3+HNO3+CO2+H2O6K4(Fe(CN)6) + 61K2Cr2O7 + 265H2SO4 = 3Fe2(SO4)3 + 73K2SO4 + 61Cr2(SO4)3 + 36HNO3 + 36CO2 + 247H2O
KMnO4+KNO2+H2SO4=K2SO4+MnSO4+KNO3+H2O2KMnO4 + 5KNO2 + 3H2SO4 = K2SO4 + 2MnSO4 + 5KNO3 + 3H2O
K2MnO4+CO2+H2O=KMnO4+KHCO3+MnO23K2MnO4 + 4CO2 + 2H2O = 2KMnO4 + 4KHCO3 + MnO2
KMnO4+Na2SO3+H2SO4=K2SO4+MnSO4+NaSO4+H2O4KMnO4 + 5Na2SO3 + 11H2SO4 = 2K2SO4 + 4MnSO4 + 10NaSO4 + 11H2O
K2CrO4+KI+H2SO4=K2SO4+Cr2(SO4)3 +I2+H2O2K2CrO4 + 6KI + 8H2SO4 = 5K2SO4 + Cr2(SO4)3 + 3I2 + 8H2O
KHCO3 + H3PO4 = K3PO4 + H2O + CO2 3KHCO3 + H3PO4 = K3PO4 + 3H2O + 3CO2
K2Cr2O7+NO2+HNO3=KNO3+Cr(NO3)3 +H2OK2Cr2O7 + 6NO2 + 2HNO3 = 2KNO3 + 2Cr(NO3)3 + H2O
KMnO4+Na2S2O3+HCl=KCl+MnCl2+NaCl+SO2+H2O4KMnO4 + 5Na2S2O3 + 22HCl = 4KCl + 4MnCl2 + 10NaCl + 10SO2 + 11H2O
K4(Fe(CN)6)+H2SO4+H2O2=K2SO4+Fe2(SO4)3+NO2+CO2+H2O2K4(Fe(CN)6) + 7H2SO4 + 55H2O2 = 4K2SO4 + Fe2(SO4)3 + 12NO2 + 12CO2 + 62H2O
K4(Fe(CN)6)+H2SO4+H2O2=K2SO4+Fe2(SO4)3+NO+CO2+H2O2K4(Fe(CN)6) + 7H2SO4 + 43H2O2 = 4K2SO4 + Fe2(SO4)3 + 12NO + 12CO2 + 50H2O
K4(Fe(CN)6)+PbO2+HCl=KCl+FeCl3+PbCl2+CO2+HNO3+H2O2K4(Fe(CN)6) + 61PbO2 + 136HCl = 8KCl + 2FeCl3 + 61PbCl2 + 12CO2 + 12HNO3 + 62H2O
K4(Fe(CN)6)+MnO2+HCl=KCl+FeCl3+MnCl2+CO2+NO2+H2O2K4(Fe(CN)6) + 55MnO2 + 124HCl = 8KCl + 2FeCl3 + 55MnCl2 + 12CO2 + 12NO2 + 62H2O
K4(Fe(CN)6)+MnO2+HCl=KCl+FeCl3+MnCl2+CO2+NO2+H2O2K4(Fe(CN)6) + 55MnO2 + 124HCl = 8KCl + 2FeCl3 + 55MnCl2 + 12CO2 + 12NO2 + 62H2O
K3(Fe(CN)6)+MnO2+HCl=KCl+FeCl3+MnCl2+CO2+NO2+H2OK3(Fe(CN)6) + 27MnO2 + 60HCl = 3KCl + FeCl3 + 27MnCl2 + 6CO2 + 6NO2 + 30H2O
K4(Fe(CN)6)+MnO2+HCl=KCl+FeCl3+MnCl2+CO2+NO2+H2O2K4(Fe(CN)6) + 55MnO2 + 124HCl = 8KCl + 2FeCl3 + 55MnCl2 + 12CO2 + 12NO2 + 62H2O
K4(Fe(CN)6)+MnO2+HCl=KCl+FeCl3+MnCl2+CO2+NO+H2O20K4(Fe(CN)6) + MnO2 + 2HCl = 0KCl + 0FeCl3 + MnCl2 + 0CO2 + 0NO + H2O2
K4(Fe(CN)6)+MnO2+HCl=KCl+FeCl3+MnCl2+CO2+NO+H2O2K4(Fe(CN)6) + 43MnO2 + 100HCl = 8KCl + 2FeCl3 + 43MnCl2 + 12CO2 + 12NO + 50H2O
K3PO4 + ZnSO4 = K2SO4 + Zn3(PO4)22K3PO4 + 3ZnSO4 = 3K2SO4 + Zn3(PO4)2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KClO4=KCl+O2KClO4 = KCl + 2O2
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2SO4+CuSO4=K2Cu+2SO4K2SO4 + CuSO4 = K2Cu + 2SO4
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KNO3 + (NH2)2CO = NO2 + K2CO3 +H2O+CO2-14KNO3 - (NH2)2CO = -16NO2 - 7K2CO3 - 2H2O + 6CO2
KNO3 + (NH2)2CO + H2O = NO2 + KOH + CO214KNO3 + (NH2)2CO + 5H2O = 16NO2 + 14KOH + CO2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3 = KCl + O2 2KClO3 = 2KCl + 3O2
KClO3 = KCl + O2 2KClO3 = 2KCl + 3O2
KMnO4 + H2SO4 + KI = MnSO4 + I2 + K2SO4 + H2O2KMnO4 + 8H2SO4 + 10KI = 2MnSO4 + 5I2 + 6K2SO4 + 8H2O
KMnO4 + H2SO4 + KI = MnSO4 + I2 + K2SO4 + H2O2KMnO4 + 8H2SO4 + 10KI = 2MnSO4 + 5I2 + 6K2SO4 + 8H2O
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KMnO4+NH3=KNO3+MnO2+KOH+H2O8KMnO4 + 3NH3 = 3KNO3 + 8MnO2 + 5KOH + 2H2O
KMnO4+FeCl2+HCl=MnCl2+FeCl3+KCl+H2OKMnO4 + 5FeCl2 + 8HCl = MnCl2 + 5FeCl3 + KCl + 4H2O
KOH + Cl2=KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
K2Cr2O7+HCl=CrCl3+Cl2+KCl+H2OK2Cr2O7 + 14HCl = 2CrCl3 + 3Cl2 + 2KCl + 7H2O
KHCO3 + H3PO4 =K3PO4 + H2O + CO23KHCO3 + H3PO4 = K3PO4 + 3H2O + 3CO2
KIO3 + KI + H2SO4 = I2 + K2SO4 + H2OKIO3 + 5KI + 3H2SO4 = 3I2 + 3K2SO4 + 3H2O
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4 + SO2 + H2SO4= K2SO4+MnSO4+H2O-2KMnO4 - 5SO2 + 2H2SO4 = -1K2SO4 - 2MnSO4 + 2H2O
KOH+Al(OH)3=K3AlO3+H2O3KOH + Al(OH)3 = K3AlO3 + 3H2O
K4Fe(CN)6 + MnO2 + HCl = KCl + FeCl3 + MnCl2 + CO2 + NO + H2O2K4Fe(CN)6 + 43MnO2 + 100HCl = 8KCl + 2FeCl3 + 43MnCl2 + 12CO2 + 12NO + 50H2O
KMnO4 + KClO3 + H2O = MnO2 + KClO4 + KOH2KMnO4 + 3KClO3 + H2O = 2MnO2 + 3KClO4 + 2KOH
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
K2Cr2O7+SnCl2+HCl===CrCl3+SnCl4+KCl+H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K + KNO3 = N2 + K2O10K + 2KNO3 = N2 + 6K2O
KMnO4 + HCl = MnCl2 + Cl2 + KCl + H2O2KMnO4 + 16HCl = 2MnCl2 + 5Cl2 + 2KCl + 8H2O
KCLO3(s) = KCL(s)+O2(g)2KCLO3(s) = 2KCL(s) + 3O2(g)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2SO4 + KMnO4 = MnO2 + K2SO4K2SO4 + 0KMnO4 = 0MnO2 + K2SO4
K2SO4 + KMnO4 = MnO2 + K2SO4K2SO4 + 0KMnO4 = 0MnO2 + K2SO4
K2CO3 + AlCl3 = Al2(CO3)3 + KCl3K2CO3 + 2AlCl3 = Al2(CO3)3 + 6KCl
KMnO4 + H2SO4 + SnSO4 = MnSO4 + H2O + Sn(SO4)2 + K2SO42KMnO4 + 8H2SO4 + 5SnSO4 = 2MnSO4 + 8H2O + 5Sn(SO4)2 + K2SO4
KBr + H2SO4 = K2SO4 + Br2 + SO2 + H2O2KBr + 2H2SO4 = K2SO4 + Br2 + SO2 + 2H2O
KBr + H2SO4 = K2SO4 + Br2 + SO2 + H2O2KBr + 2H2SO4 = K2SO4 + Br2 + SO2 + 2H2O
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
K2Cr2O7+HCl=KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KOH+Cl2=ClK+KClO3+H2O6KOH + 3Cl2 = 5ClK + KClO3 + 3H2O
KMnO4 + H2SO4 = MnSO4 + K2SO4 + O2 + 2 H2O4KMnO4 + 6H2SO4 = 4MnSO4 + 2K2SO4 + 5O2 + 6H2O
K2S+KClO4+KOH=K2SO4+Cl2+4H2O-7K2S - 8KClO4 + 8KOH = -7K2SO4 - 4Cl2 + 4H2O
K2S+KClO4+KOH=K2SO4+Cl2+H2O-7K2S - 8KClO4 + 8KOH = -7K2SO4 - 4Cl2 + 4H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+H2O2C2=KMn + H2O + CO23KMnO4 + 4H2O2C2 = 3KMn + 4H2O + 8CO2
KNO3 + C12H22O11 = N2 + CO2 + H2O + K2CO348KNO3 + 5C12H22O11 = 24N2 + 36CO2 + 55H2O + 24K2CO3
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
K+O2=K2O22K + O2 = K2O2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KI+AgC 2 H 3 O 2= AgI+KC 2H 3O 2KI + AgC2H3O2 = AgI + KC2H3O2
KI+AgC2H3O2= AgI+KC2H3O2KI + AgC2H3O2 = AgI + KC2H3O2
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
K2CO3+C=CO+KK2CO3 + 2C = 3CO + 2K
K2SO4 (aq) + BaCl2 (aq) = KCl (aq) + BaSO4 (s) K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
KMnO4+KCl+H2SO4=MnO4+K2SO4+H2O+Cl2-2KMnO4 + 2KCl + 0H2SO4 = -2MnO4 + 0K2SO4 + 0H2O + Cl2
KMnO4+KCl+H2SO4=MnO4+K2SO4+H2O+Cl2-2KMnO4 + 2KCl + 0H2SO4 = -2MnO4 + 0K2SO4 + 0H2O + Cl2
KMnO4+KCl+H2SO4=MnO4+K2SO4+H2O+Cl2-2KMnO4 + 2KCl + 0H2SO4 = -2MnO4 + 0K2SO4 + 0H2O + Cl2
KMnO4+KCl+H2SO4=MnO4+K2SO4+H2O+Cl2-2KMnO4 + 2KCl + 0H2SO4 = -2MnO4 + 0K2SO4 + 0H2O + Cl2
K2Cr2O7+S+H2O=SO2+KOH+Cr2O32K2Cr2O7 + 3S + 2H2O = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7+S+H2O=SO2+KOH+Cr2O32K2Cr2O7 + 3S + 2H2O = 3SO2 + 4KOH + 2Cr2O3
KClO3+KI+H2O=KCl+I2+KOHKClO3 + 6KI + 3H2O = KCl + 3I2 + 6KOH
KMnO4+K2S+H2O=MnO2+KOH+S2KMnO4 + 3K2S + 4H2O = 2MnO2 + 8KOH + 3S
KMnO4 + HCl =KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2SO4 (aq) + BaCl2 (aq)= KCl (aq) + BaSO4 (s) K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7+HCl=CrCl3+KCl+H2O+Cl2K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 3Cl2
K2Cr2O7 + HCl = CrCl3 + KCl + Cl2 + H2O K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3Cl2 + 7H2O
K(ClO3) + H2SO4 = ClO2 + K2(SO4) + H2O + O24K(ClO3) + 2H2SO4 = 4ClO2 + 2K2(SO4) + 2H2O + O2
KBr (aq) + KMnO4 + H2SO4=Br2 + MnSO4 + K2SO4 + H2O10KBr(aq) + 2KMnO4 + 8H2SO4 = 5Br2 + 2MnSO4 + 6K2SO4 + 8H2O
KBr + Cl2 = 2KCl + Br22KBr + Cl2 = 2KCl + Br2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KH2PO4 + AlI3 = AlH2PO4 + KI3KH2PO4 + AlI3 = AlH2PO4 + KI3
KH2PO4 + AlI3 = KH2PO4AlI3KH2PO4 + AlI3 = KH2PO4AlI3
K2SO3+KCl+HI=S+Cl2+KI+H2OK2SO3 + 4KCl + 6HI = S + 2Cl2 + 6KI + 3H2O
K2SO3+KCl+HI=S+Cl2+KI+H2OK2SO3 + 4KCl + 6HI = S + 2Cl2 + 6KI + 3H2O
KOH + H2O = K+ + OH-KOH + 0H2O = K+ + OH-
KCIO3 = KCI+O22KCIO3 = 2KCI + 3O2
K2Cr2O7 + HNO3 + Fe(NO3)2 = Fe(NO3)3 + Cr(NO3)3 + KNO3 + H2OK2Cr2O7 + 14HNO3 + 6Fe(NO3)2 = 6Fe(NO3)3 + 2Cr(NO3)3 + 2KNO3 + 7H2O
K2Cr2O7 +CH3CH2OH +HCL = C2H4O + KCL + CrCL3 + H2OK2Cr2O7 + 5CH3CH2OH + 8HCL = 7C2H4O + 2KCL + 2CrCL3 + 5H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+NaNO2= MnO2+NaNO3+K2O2KMnO4 + 3NaNO2 = 2MnO2 + 3NaNO3 + K2O
K2CO3 + Sr(NO3)2 = KNO3 + SrCO3K2CO3 + Sr(NO3)2 = 2KNO3 + SrCO3
K+O2=K2O4K + O2 = 2K2O
KCr2O7+ HCl = KCl + CrCl3 + H2O + Cl22KCr2O7 + 28HCl = 2KCl + 4CrCl3 + 14H2O + 7Cl2
KI=I2+K2KI = I2 + 2K
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2SO4+BaCl2=KCl+BaSO4K2SO4 + BaCl2 = 2KCl + BaSO4
KBr (aq) + KMnO4 + H2SO4 = Br2 + MnSO4 + K2SO4 + H2O10KBr(aq) + 2KMnO4 + 8H2SO4 = 5Br2 + 2MnSO4 + 6K2SO4 + 8H2O
K + H2O = H2 + KOH2K + 2H2O = H2 + 2KOH
KOH + Cu(NO3)2 = KNO3 + Cu(OH)22KOH + Cu(NO3)2 = 2KNO3 + Cu(OH)2
KI + Pb(NO3)2 = PbI2 + KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
K2CO3 + C = CO + KK2CO3 + 2C = 3CO + 2K
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4 + MnSO4 + H2O = MnO2 + K2SO4 + H2SO4 2KMnO4 + 3MnSO4 + 2H2O = 5MnO2 + K2SO4 + 2H2SO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KBiO3+Mn(NO3)2+HNO3=Bi(NO3)3+KMnO4+KNO3+H2O5KBiO3 + 2Mn(NO3)2 + 14HNO3 = 5Bi(NO3)3 + 2KMnO4 + 3KNO3 + 7H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KClO4 + C2H6O = KCl + CO2 + H2O3KClO4 + 2C2H6O = 3KCl + 4CO2 + 6H2O
KMnO4+HCl+ H2S=KCl+MnCl2+S+H2O2KMnO4 + 6HCl + 5H2S = 2KCl + 2MnCl2 + 5S + 8H2O
KI+HNO3= I2+NO+KNO3+H2O6KI + 8HNO3 = 3I2 + 2NO + 6KNO3 + 4H2O
KMnO4+HCl+ H2S=KCl+MnCl2+S+H2O2KMnO4 + 6HCl + 5H2S = 2KCl + 2MnCl2 + 5S + 8H2O
K2Cr2O7+FeCl2+HCl=CrCl3+KCl+FeCl3+H2OK2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 2KCl + 6FeCl3 + 7H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
K + H2O = KOH + H2 2K + 2H2O = 2KOH + H2
K2SO4 + I2 + H2SO4 + K2Cr2O7 = KI + Cr2(SO4)3 + H2O-4K2SO4 - 3I2 + 7H2SO4 + K2Cr2O7 = -6KI + Cr2(SO4)3 + 7H2O
KBr + KMnO4 + H2SO4 = Br2 + MnSO4 + K2SO4 + H2O10KBr + 2KMnO4 + 8H2SO4 = 5Br2 + 2MnSO4 + 6K2SO4 + 8H2O
KOH + H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KMnO4(aq) + HCl(aq) + Al(s) = AlCl3(aq) + MnCl2(aq) + KCl(aq) + H2O(l)3KMnO4(aq) + 24HCl(aq) + 5Al(s) = 5AlCl3(aq) + 3MnCl2(aq) + 3KCl(aq) + 12H2O(l)
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4+H2SO4=K2SO4+MnSO4+O2+H2O4KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 5O2 + 6H2O
KMnO4+NaNO2=MnO2+NaNO3+K2O2KMnO4 + 3NaNO2 = 2MnO2 + 3NaNO3 + K2O
KMnO4 + H2C2O4 + H2SO4 = K2SO4 + MnSO4 + H2O + CO2 2KMnO4 + 5H2C2O4 + 3H2SO4 = K2SO4 + 2MnSO4 + 8H2O + 10CO2
KNO3 + MgCl2 = KCl + Mg(NO3)22KNO3 + MgCl2 = 2KCl + Mg(NO3)2
KBrO3 + KI + HBr = KBr + I2 + H2OKBrO3 + 6KI + 6HBr = 7KBr + 3I2 + 3H2O
K2Cr2O7 + KOH = K2CrO4 + H2OK2Cr2O7 + 2KOH = 2K2CrO4 + H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KOH+HCl=KCl+H2OKOH + HCl = KCl + H2O
K2Cr2O7 + HCl = KCl + CrCl3 + H2O + Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KOH+HCl=KCl+H2OKOH + HCl = KCl + H2O
KOH+HCl=KCl+H2OKOH + HCl = KCl + H2O
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
K3PO4 + ZnSO4 = K2SO4 + Zn3 (PO4)22K3PO4 + 3ZnSO4 = 3K2SO4 + Zn3(PO4)2
KMnO4+Zn+H2O=MnO2+Zn(OH)2+KOH2KMnO4 + 3Zn + 4H2O = 2MnO2 + 3Zn(OH)2 + 2KOH
K + Cl = KCl K + Cl = KCl
KMnO4+KI+H2O=MnO2+KIO3+KOH2KMnO4 + KI + H2O = 2MnO2 + KIO3 + 2KOH
KBr+K2Cr2O7+H2SO4=Br2+K2SO4+Cr2(SO4)3+H2O6KBr + K2Cr2O7 + 7H2SO4 = 3Br2 + 4K2SO4 + Cr2(SO4)3 + 7H2O
KClO3= KCl + O22KClO3 = 2KCl + 3O2
KMnO4+H2O=KOH+MnO2+O24KMnO4 + 2H2O = 4KOH + 4MnO2 + 3O2
KI + Pb(NO3)2 = PbI2 + KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
K2CrO4 + AgNO3 = Ag2CrO4 + KNO3K2CrO4 + 2AgNO3 = Ag2CrO4 + 2KNO3
K2Cr2O7+SnCl2+HCl=CrCl3+SnCl4+KCl+H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2Cr2O7+HCl=KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KClO4 + C2H5OH = KCl + CO2 + H2O3KClO4 + 2C2H5OH = 3KCl + 4CO2 + 6H2O
K2CO3 + FeCl3 = KCl + Fe2 (CO3)33K2CO3 + 2FeCl3 = 6KCl + Fe2(CO3)3
KHCrO4+HCl=KCl+CrCl3+Cl2+H2O2KHCrO4 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 8H2O
K2Cr2O7+HCl=KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KMnO4+H2SO4+FeSO4=K2SO4+MnSO4+Fe2(SO4)3+H2O2KMnO4 + 8H2SO4 + 10FeSO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2Cr2O7+SnCl2+HCl=CrCl3+SnCl4+KCl+H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2CO3+C=CO+KK2CO3 + 2C = 3CO + 2K
K2CO3+C=CO+KK2CO3 + 2C = 3CO + 2K
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KI + HNO3 = KIO3 + NO2 + H2OKI + 6HNO3 = KIO3 + 6NO2 + 3H2O
KMnO4 + FeSO4 + H2SO4 =Fe2(SO4)3 + K2SO4 + MnSO4 + H2O 2KMnO4 + 10FeSO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
KHCrO4+HCl=KCl+CrCl3+Cl2+H2O2KHCrO4 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 8H2O
K2Cr2O7+HCl=KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
K2Cr2O7+HCl=KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
K2Cr2O7+HCl=KClCrCl3+H2O+Cl2K2Cr2O7 + 14HCl = 2KClCrCl3 + 7H2O + 3Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI+K2Cr2O7+H2SO4=Cr2(SO4)3+I2+K25O4+H2O46KI + 2K2Cr2O7 + 6H2SO4 = 2Cr2(SO4)3 + 23I2 + 2K25O4 + 6H2O
KClO3+S+H20=Cl2K2SO4+H2SO440KClO3 + 30S + H20 = 20Cl2K2SO4 + 10H2SO4
KClO+S=KCl+SO22KClO + S = 2KCl + SO2
KMn04+H2SO4=K2SO4+MnSO4+H2O+O-2KMn04 - 9H2SO4 = -1K2SO4 - 8MnSO4 - 9H2O + 9O
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KIO3+KI+H2SO4=KI3+K2SO4+H2OKIO3 + 8KI + 3H2SO4 = 3KI3 + 3K2SO4 + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + FeSO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O 2KMnO4 + 10FeSO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
KMnO4 + H2SO4 = K2SO4 + MnSO4 + H2O + O2KMnO4 + 3H2SO4 = K2SO4 + 2MnSO4 + 3H2O + 5O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI+Ba(NO3)2=K(NO3)2+BaIKI + Ba(NO3)2 = K(NO3)2 + BaI
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K + MgBr2 = KBr + Mg2K + MgBr2 = 2KBr + Mg
K2Cr2O7 + MnCl2 + HCl = CrCl3 + KMn04 + KOH + H2O3K2Cr2O7 - 8MnCl2 + 34HCl = 6CrCl3 - 2KMn04 + 8KOH + 13H2O
K2Cr2O7 + MnCl2 + HCl = CrCl3 + KMn04 + KOH + H2O3K2Cr2O7 - 8MnCl2 + 34HCl = 6CrCl3 - 2KMn04 + 8KOH + 13H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KHCO3+H3PO4=K2HPO4+H2O+CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KBrO3 + MnO2= KBrO + MnO20KBrO3 + MnO2 = 0KBrO + MnO2
KMnO4 + HBr=Br2 + MnBr2 + KBr + H2O2KMnO4 + 16HBr = 5Br2 + 2MnBr2 + 2KBr + 8H2O
K2Cr2O7 + HCl=KCl + CrCl3 + Cl2 + H2 OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KI + H2SO=K2SO4 + I2 + H2S + H2O2KI + 5H2SO = K2SO4 + I2 + 4H2S + H2O
KMnO4 + HNO2 + H2SO4=K2SO4 + MnSO4 + HNO3 + H2O2KMnO4 + 5HNO2 + 3H2SO4 = K2SO4 + 2MnSO4 + 5HNO3 + 3H2O
KMnO4 + HNO2 + H2SO4 = K2SO4 + MnSO4 + HNO3 + H2O2KMnO4 + 5HNO2 + 3H2SO4 = K2SO4 + 2MnSO4 + 5HNO3 + 3H2O
KCl+ KMnO4 + H2SO4=KHSO4 + MnSO4 + H2O + Cl210KCl + 2KMnO4 + 14H2SO4 = 12KHSO4 + 2MnSO4 + 8H2O + 5Cl2
K2Cr2O7 + KI + H2SO4 = K2SO4 + Cr2 (SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K2Cr2O7 + KOH = 2 K2CrO4 + H2OK2Cr2O7 + 2KOH = 2K2CrO4 + H2O
K2 + Br3 = K2Br3K2 + Br3 = K2Br3
KCLO3=O2+KCL2KCLO3 = 3O2 + 2KCL
KCLO3=O2+KCL2KCLO3 = 3O2 + 2KCL
KClO3=KCl+O3KClO3 = KCl + O3
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO3=KCl+O3KClO3 = KCl + O3
KClO3=KCl+O3KClO3 = KCl + O3
K2Cr2O7+H2O+S=KOH+Cr2O3+SO22K2Cr2O7 + 2H2O + 3S = 4KOH + 2Cr2O3 + 3SO2
K+O2=K2O4K + O2 = 2K2O
KBr+Cl2=KCl+Br22KBr + Cl2 = 2KCl + Br2
KBr+Cl2=KCl2+Br22KBr + 2Cl2 = 2KCl2 + Br2
KBr+Cl2=KCl2+Br22KBr + 2Cl2 = 2KCl2 + Br2
KBr+Cl2=KCl2+Br22KBr + 2Cl2 = 2KCl2 + Br2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
K2Cr2O7+KI+H2SO4=Cr(SO4)3+K2SO4+I2+H2OK2Cr2O7 + 0KI + 7H2SO4 = 2Cr(SO4)3 + K2SO4 + 0I2 + 7H2O
K2Cr2O7+KI+H2SO4=Cr(SO4)+K2SO4+I2+H2OK2Cr2O7 + 8KI + 7H2SO4 = 2Cr(SO4) + 5K2SO4 + 4I2 + 7H2O
KI + F2O + H2O = KF + KOH + I24KI + F2O + H2O = 2KF + 2KOH + 2I2
KMnO4 + H2SO4 + FeSO4 = MnSO4 + Fe2(SO4)3 + H2O + K2SO42KMnO4 + 8H2SO4 + 10FeSO4 = 2MnSO4 + 5Fe2(SO4)3 + 8H2O + K2SO4
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KCl+NaCrO+H2SO4 = Cl3+Cr2(SO4)3+K2SO4+NaSO4+H2O-6KCl + 2NaCrO + 2H2SO4 = -2Cl3 + Cr2(SO4)3 - 3K2SO4 + 2NaSO4 + 2H2O
K2Cr2O7+HCl=CrCl3+KCl+H2O+O3K2Cr2O7 + 8HCl = 2CrCl3 + 2KCl + 4H2O + O3
KBrO3+6KI+6HCl=KBr+6KCl+3I2+3H2OKBrO3 + 6KI + 6HCl = KBr + 6KCl + 3I2 + 3H2O
KMnO4 + KClO3 + H2O= MnO2 + KClO4 +KOH2KMnO4 + 3KClO3 + H2O = 2MnO2 + 3KClO4 + 2KOH
K+H2O =KOH+H22K + 2H2O = 2KOH + H2
K+AgNO3 = KNO3 + AgK + AgNO3 = KNO3 + Ag
K2SO4 = 2K + S +4OK2SO4 = 2K + S + 4O
KMnO4+NH3+H2O=MnO2+N2+KOH2KMnO4 + 2NH3 - 2H2O = 2MnO2 + N2 + 2KOH
KMnO4+NH3+H2O=MnO2+N2+KOH2KMnO4 + 2NH3 - 2H2O = 2MnO2 + N2 + 2KOH
KMnO4+NH3+H2O=MnO2+N2+KOH2KMnO4 + 2NH3 - 2H2O = 2MnO2 + N2 + 2KOH
KMnO4+NH3+H2O=MnO2+N2+KOH2KMnO4 + 2NH3 - 2H2O = 2MnO2 + N2 + 2KOH
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2O + H2O = 2KOHK2O + H2O = 2KOH
K2O + H2O = KOHK2O + H2O = 2KOH
KNO2 + NH4Cl = N2 + KCl + H2OKNO2 + NH4Cl = N2 + KCl + 2H2O
K4Fe(CN)6 + H2SO4 + H2O = K2SO4 + FeSO4 + (NH4)2SO4 + COK4Fe(CN)6 + 6H2SO4 + 6H2O = 2K2SO4 + FeSO4 + 3(NH4)2SO4 + 6CO
K4Fe(CN)6 + H2SO4 + H2O = K2SO4 + FeSO4 + (NH4)2SO4 + COK4Fe(CN)6 + 6H2SO4 + 6H2O = 2K2SO4 + FeSO4 + 3(NH4)2SO4 + 6CO
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2Cr2O7+HCl=KCl+Cr2Cl3+H2O+Cl22K2Cr2O7 + 28HCl = 4KCl + 2Cr2Cl3 + 14H2O + 9Cl2
K2Cr2O7+H2SO4=K2SO4+Cr2(SO4) 3+H2O+O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
K2Cr2O7+H2O+S=SO2+KOH+Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
KMnO4 + H2O2 = MnO2 + H2O +KOH2KMnO4 - 3H2O2 = 2MnO2 - 4H2O + 2KOH
KMnO4 + H2O2 = MnO2 + H2O +KOH2KMnO4 - 3H2O2 = 2MnO2 - 4H2O + 2KOH
K2Cr2O7 + HI + H2SO4 = K2SO4 + Cr2(SO4)3 + I2 + H2OK2Cr2O7 + 6HI + 4H2SO4 = K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KIO3+KI+H2SO4= I2+ H2O+ K2SO4KIO3 + 5KI + 3H2SO4 = 3I2 + 3H2O + 3K2SO4
KIO3+KI+H2SO4= I2+ H2O+ K2SO4KIO3 + 5KI + 3H2SO4 = 3I2 + 3H2O + 3K2SO4
KO2+H2O+CO2=KHCO3+O24KO2 + 2H2O + 4CO2 = 4KHCO3 + 3O2
KI+Pb(NO3)2=PbI2+KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
KI+Pb(C2H3O2)4=PbI4+4KC2H3O24KI + Pb(C2H3O2)4 = PbI4 + 4KC2H3O2
KOH(aq)+HNO3(aq)=KNO3(Aq)+H2O(l)KOH(aq) + HNO3(aq) = KNO3(Aq) + H2O(l)
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH(aq)+HNO3(aq)=KNO3(Aq)+H2O(l)KOH(aq) + HNO3(aq) = KNO3(Aq) + H2O(l)
KMnO4+K2S+H2SO4=MnSO4+K2SO4+H2O8KMnO4 + 5K2S + 12H2SO4 = 8MnSO4 + 9K2SO4 + 12H2O
K2Cr2O7 + KI + H2SO4 = K2SO4 + Cr2 (SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K2Cr2O7 + KI + H2SO4 = K2SO4 + Cr2 (SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K2Cr2O7 + KI + H2SO4 = K2SO4 + Cr2 (SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K2Cr2O7 + KI + H2SO4 = K2SO4 + Cr2 (SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K2O+H2O=KOHK2O + H2O = 2KOH
K2Cr2O7 + KI + 4 H2SO4 = Cr2(SO4)3 + KIO3 + K2SO4 + 4 H2OK2Cr2O7 + KI + 4H2SO4 = Cr2(SO4)3 + KIO3 + K2SO4 + 4H2O
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KClO=KCl+O22KClO = 2KCl + O2
KOH+FeCl3=KCl+Fe(OH)33KOH + FeCl3 = 3KCl + Fe(OH)3
KBr+Cl = KCl+Br22KBr + 2Cl = 2KCl + Br2
KBr+Cl =KCl+Br22KBr + 2Cl = 2KCl + Br2
KOH+FeCl3=KCl+Fe(OH)33KOH + FeCl3 = 3KCl + Fe(OH)3
KOH+FeCl3=KCl+Fe(OH)33KOH + FeCl3 = 3KCl + Fe(OH)3
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KOH+FeCl3=KCl+Fe(OH)33KOH + FeCl3 = 3KCl + Fe(OH)3
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KI + Pb(NO3)2 = PbI2 + KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
K2CR2O7 + H2SO4 = K2SO4 + CR2(SO4)3 + H2O + O22K2CR2O7 + 8H2SO4 = 2K2SO4 + 2CR2(SO4)3 + 8H2O + 3O2
KMnO4 + HCl + FeCl2 =FeCl3 + KCl + H2O + MnOKMnO4 + 6HCl + 5FeCl2 = 5FeCl3 + KCl + 3H2O + MnO
K2CrO7+HCl=KCl+CrCl3+H2O+Cl22K2CrO7 + 28HCl = 4KCl + 2CrCl3 + 14H2O + 9Cl2
KI+MnO2+H2SO4=I2+HKSO4+MnSO4+H2O2KI + MnO2 + 3H2SO4 = I2 + 2HKSO4 + MnSO4 + 2H2O
KMnO4+HCl=KCl+MnCl2+Cl2+H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
KHCO3+H2SO4=K2SO4+H2O+CO22KHCO3 + H2SO4 = K2SO4 + 2H2O + 2CO2
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KMnO4 + H2C2O4 + HClO4 = KClO4 + Mn(ClO4)2 + CO2 + H2O2KMnO4 + 5H2C2O4 + 6HClO4 = 2KClO4 + 2Mn(ClO4)2 + 10CO2 + 8H2O
K2CO3 + C = CO + K K2CO3 + 2C = 3CO + 2K
KClO3 = KCl + O2 2KClO3 = 2KCl + 3O2
KOH+Cl2=KCl+KClO+H2O2KOH + Cl2 = KCl + KClO + H2O
KOH+Cl2=KCl+KClOH2O2KOH + Cl2 = KCl + KClOH2O
K2Cr2O7 + H2C2O4 + H+ = Cr3+ CO2 + H2O + K+3K2Cr2O7 + 18H2C2O4 + 6H+ = 2Cr3 + 36CO2 + 21H2O + 6K+
K(s)+H2O(l)=KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KMnO4 + MnSO4 + KOH = K2SO4 + MnO2 + H2O2KMnO4 + 3MnSO4 + 4KOH = 3K2SO4 + 5MnO2 + 2H2O
K2Cr2O7+H2O+S=KOH+Cr2O3+SO22K2Cr2O7 + 2H2O + 3S = 4KOH + 2Cr2O3 + 3SO2
K2Cr2O7 + H2C2O4 + H+ = Cr3+ +CO2 + H2O +K+3K2Cr2O7 + 17H2C2O4 + 8H+ = 2Cr3+ + 34CO2 + 21H2O + 6K+
KMnO4+FeSO4+H2SO4=MnSO4+Fe(SO4)3+K2SO4+H2O4KMnO4 + 5FeSO4 + 16H2SO4 = 4MnSO4 + 5Fe(SO4)3 + 2K2SO4 + 16H2O
K2Cr2O7 + HCl = KCl + CrCl3 +Cl2 + H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KMnO4+ MnSO4 + 4KOH = K2SO4 +MnO2 + H2O2KMnO4 + 3MnSO4 + 4KOH = 3K2SO4 + 5MnO2 + 2H2O
K2Cr2O7 + HCl = Cl2 + CrCl3 + KCl + H2OK2Cr2O7 + 14HCl = 3Cl2 + 2CrCl3 + 2KCl + 7H2O
KMnO4 + FeSO4 + H2SO4 = MnSO4 + Fe(SO4)3 + K2SO4 + H2O4KMnO4 + 5FeSO4 + 16H2SO4 = 4MnSO4 + 5Fe(SO4)3 + 2K2SO4 + 16H2O
K2Cr2O7 + HCl = KCl + CrCl3 + Cl2 + H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KMnO4 + MnSO4 + KOH = K2SO4 + MnO2 + H2O2KMnO4 + 3MnSO4 + 4KOH = 3K2SO4 + 5MnO2 + 2H2O
KI+H2SO4=I2+H2S+K2SO4+H2O8KI + 5H2SO4 = 4I2 + H2S + 4K2SO4 + 4H2O
KNO3 + FeSO4 + KOH = Fe3O4 + KNO2 +K2SO4 + H2OKNO3 + 3FeSO4 + 6KOH = Fe3O4 + KNO2 + 3K2SO4 + 3H2O
KNO3 + FeSO4 + KOH = Fe3O4 + KNO32 +K2SO4 + H2O-1KNO3 + 87FeSO4 + 174KOH = 29Fe3O4 - KNO32 + 87K2SO4 + 87H2O
KOH + HCl = KCl + H2OKOH + HCl = KCl + H2O
KI + Br2 = KBr + I22KI + Br2 = 2KBr + I2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KBrO3 = KBr + O22KBrO3 = 2KBr + 3O2
KMnO4+2HCl=MnCl2+KCl+Cl2+H2O2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O
KMnO4+Zn+H2O=MnO2+Zn(OH)2+KOH2KMnO4 + 3Zn + 4H2O = 2MnO2 + 3Zn(OH)2 + 2KOH
KOH+NO2= KNO3+HKOH + NO2 = KNO3 + H
KOH+NO2= KNO2+OHKOH + NO2 = KNO2 + OH
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KI + F2O + H2O = KF + KOH + I24KI + F2O + H2O = 2KF + 2KOH + 2I2
KS + H2O = SH + HKOKS + H2O = SH + HKO
KClO2 + H2PO4- = K2PO4- + HClO2 2KClO2 + H2PO4- = K2PO4- + 2HClO2
K+H2O = K++H2+OH-2K + 2H2O = 2K+ + H2 + 2OH-
KSCN+H2Cr2O7+K2Cr2O7=CO2+NO2+Cr2O3+K2SO4+H2O2KSCN + 4H2Cr2O7 + K2Cr2O7 = 2CO2 + 2NO2 + 5Cr2O3 + 2K2SO4 + 4H2O
KSCN+H2Cr2O7+K2Cr2O7=CO2+NO2+Cr2O3+K2SO4+H2O2KSCN + 4H2Cr2O7 + K2Cr2O7 = 2CO2 + 2NO2 + 5Cr2O3 + 2K2SO4 + 4H2O
K2Cr2O7 + HCl = CrCl3 + KCl + H2O + Cl2K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 3Cl2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3+MnO2+KOH=K2MnO4+KCl+H2OKClO3 + 3MnO2 + 6KOH = 3K2MnO4 + KCl + 3H2O
K2Cr2O7+HI+HCLO4=I2+Cr(CLO4)3+KCLO4+H200K2Cr2O7 + 20HI + 0HCLO4 = 10I2 + 0Cr(CLO4)3 + 0KCLO4 + H20
KMnO4+K2SO3+H2O=K2SO4+MnO2+KOH2KMnO4 + 3K2SO3 + H2O = 3K2SO4 + 2MnO2 + 2KOH
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI+H2SO4=K2SO4+I2+H2S+H2O8KI + 5H2SO4 = 4K2SO4 + 4I2 + H2S + 4H2O
KClO3=O2+KCl2KClO3 = 3O2 + 2KCl
KBr+H2SO4=K2SO4+SO2+Br2+H2O2KBr + 2H2SO4 = K2SO4 + SO2 + Br2 + 2H2O
KCIO3+H2SO4=KHSO4+O2+CIO2+H2O4KCIO3 + 4H2SO4 = 4KHSO4 + O2 + 4CIO2 + 2H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2CR2O7 + NA2SO3 + H2SO4 = CR2(SO4)3 + NA2SO4 + K2SO4 + H2OK2CR2O7 + 3NA2SO3 + 4H2SO4 = CR2(SO4)3 + 3NA2SO4 + K2SO4 + 4H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3=2KCl+3O22KClO3 = 2KCl + 3O2
KI+Cl2=KCl+I22KI + Cl2 = 2KCl + I2
KI+Cl2=KCl+I22KI + Cl2 = 2KCl + I2
K2S+HBr=KBr+H2SK2S + 2HBr = 2KBr + H2S
KCl+O2=KClO32KCl + 3O2 = 2KClO3
KIBr +Ba2 = KI + BaBr 2KIBr + Ba2 = 2KI + 2BaBr
KIBr +Ba = KI + BaBr KIBr + Ba = KI + BaBr
KOH +H2 SO4 = K2 SO4 + H2O2KOH + H2SO4 = K2SO4 + 2H2O
KI + K2CrO4 + H2SO4 = I2 + Cr2(SO4)3 + K2SO4 + H2O6KI + 2K2CrO4 + 8H2SO4 = 3I2 + Cr2(SO4)3 + 5K2SO4 + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + Na2C2O4 + H2SO4=MnSO4 + CO2 + K2SO4 + Na2SO4 + H2O2KMnO4 + 5Na2C2O4 + 8H2SO4 = 2MnSO4 + 10CO2 + K2SO4 + 5Na2SO4 + 8H2O
K + HOH = H + KOHK + HOH = H + KOH
K + Al(NO3)3 = K(NO3)3 + AlK + Al(NO3)3 = K(NO3)3 + Al
KnO2 + O2 = KnO32KnO2 + O2 = 2KnO3
K(s)+H2O(l)=KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KMNO4+ KI+ H2SO4=MNSO4+I2+K2SO4+H2O2KMNO4 + 10KI + 8H2SO4 = 2MNSO4 + 5I2 + 6K2SO4 + 8H2O
KCNS+FeCl3=KCl+Fe(CNS)33KCNS + FeCl3 = 3KCl + Fe(CNS)3
KMnO4 + H2SO4 + H2C2O4 = K2SO4 + H2O + MnSO4 + CO22KMnO4 + 3H2SO4 + 5H2C2O4 = K2SO4 + 8H2O + 2MnSO4 + 10CO2
K+Cl2=KCl2K + Cl2 = 2KCl
K2CO3 + C = CO + KK2CO3 + 2C = 3CO + 2K
KClO3 =KCl +OKClO3 = KCl + 3O
KIO2 + KHSO3 = I2 + K2SO4 + KHSO4 + H2O2KIO2 + 3KHSO3 = I2 + 2K2SO4 + KHSO4 + H2O
K + H2O = K+ + H2+ OH-2K + 2H2O = 2K+ + H2 + 2OH-
K(s) + Br2(l) = KBr(s)2K(s) + Br2(l) = 2KBr(s)
KOH+Cl2=KClO3+KCl+H2060KOH + 30Cl2 = 20KClO3 + 40KCl + 3H20
KOH+Cl2=KClO3+KCl+3H2060KOH + 30Cl2 = 20KClO3 + 40KCl + 3H20
KClO3 + H2SO4 = HClO4 + ClO2 + K2SO4 + H2O6KClO3 + 3H2SO4 = 2HClO4 + 4ClO2 + 3K2SO4 + 2H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KOH+Cl2=KClO3+KCl+H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
K2Cr2O7 + FeSO4 + H2SO4 = Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H2OK2Cr2O7 + 6FeSO4 + 7H2SO4 = Cr2(SO4)3 + 3Fe2(SO4)3 + K2SO4 + 7H2O
KMnO4 + FeSO4 + H2SO4 = MnSO4 + Fe2(SO4)3 + K2SO4 + H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
KMnO4+H2O2 = KOH+MnO2+H2O20KMnO4 + H2O2 = 0KOH + 0MnO2 + H2O2
KMnO4+H2C2O4+H2SO4=CO2+K2SO4+MnSO4+H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = 10CO2 + K2SO4 + 2MnSO4 + 8H2O
KMnO4+H2C2O4+H2SO4=CO2+K2SO4+MnSO4+H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = 10CO2 + K2SO4 + 2MnSO4 + 8H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.