Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
K+Fe(OH)3= K(OH)+Fe3K + Fe(OH)3 = 3K(OH) + Fe
K4Fe(CN)6+H2(SO4)+H2O = K2(SO4)+Fe(SO4)+(NH4)2(SO4)+COK4Fe(CN)6 + 6H2(SO4) + 6H2O = 2K2(SO4) + Fe(SO4) + 3(NH4)2(SO4) + 6CO
K4Fe(CN)6+H2(SO4)+H2O = K2(SO4)+Fe(SO4)+(NH4)2+(SO4)+COK4Fe(CN)6 + 6H2(SO4) + 6H2O = 2K2(SO4) + Fe(SO4) + 3(NH4)2 + 3(SO4) + 6CO
KIO4+ KI+ HCl= KCl+ I2+ H2OKIO4 + 7KI + 8HCl = 8KCl + 4I2 + 4H2O
K2Cr2O7 + H2O +S = SO2 + KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 + HCl = KCl+ CrCl3 +H2O + ClK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 6Cl
K2Cr2O7 + H2SO4 = K2SO4 + Cr2(SO4)3 +H2O + O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
K3PO4 + HCI = KCI +H3PO4K3PO4 + 3HCI = 3KCI + H3PO4
KOH+H2SO4=KSO4+H2OHKOH + H2SO4 = KSO4 + H2OH
KI+H2SO4=K2SO4+I2+H2S+H2O8KI + 5H2SO4 = 4K2SO4 + 4I2 + H2S + 4H2O
K2CrO4+Na2SO3+HCl=KCl+Na2SO4+CrCl3+H2O2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
K+O2=K2O4K + O2 = 2K2O
K2Cr2O7+H2SO4+KI=Cr2(SO4)3+I2+KHSO4+H200K2Cr2O7 + 20H2SO4 + 20KI = 0Cr2(SO4)3 + 10I2 + 20KHSO4 + H20
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K3 PO4 + Ca(NO3)2 = Ca3(PO4)2 + KNO32K3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6KNO3
K2Cr2O7+HCl=CrCl3+Cl2+KCl+H2OK2Cr2O7 + 14HCl = 2CrCl3 + 3Cl2 + 2KCl + 7H2O
K3PO4(aq)+Ca(NO3)2(aq)=Ca3(PO4)2(s)+KNO3(aq)2K3PO4(aq) + 3Ca(NO3)2(aq) = Ca3(PO4)2(s) + 6KNO3(aq)
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2S+KNO3+HCL=NO+S+KCL+H2O3K2S + 2KNO3 + 8HCL = 2NO + 3S + 8KCL + 4H2O
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KMnO4 + H2SO4 = K2SO4 + MnSO4 + H2O + O24KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 6H2O + 5O2
K2Cr2O7 + FeSO4 + H2SO4 = K2SO4 + Cr2(SO4)3 + Fe2(SO4)3 + H2OK2Cr2O7 + 6FeSO4 + 7H2SO4 = K2SO4 + Cr2(SO4)3 + 3Fe2(SO4)3 + 7H2O
K2Cr2O7 + H2SO4 = K2SO4 + Cr2(SO4)3 + H2O + O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
K2MnO4 + H2SO4 = MnSO4 + K2SO4 + H2O +O2K2MnO4 + 2H2SO4 = MnSO4 + K2SO4 + 2H2O + O2
KMnO4 + H2O = KOH + MnO2 + O24KMnO4 + 2H2O = 4KOH + 4MnO2 + 3O2
KI+Pb(NO3)2=PbI2+KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
KClO3 + N2H4 + NaOH = NaNO3 + KCl + H2O7KClO3 + 3N2H4 + 6NaOH = 6NaNO3 + 7KCl + 9H2O
KClO3 + NN2H4 + NaOH = NaNO3 + KCl + H2O19KClO3 + 6NN2H4 + 18NaOH = 18NaNO3 + 19KCl + 21H2O
KOH + Co3(PO4)2 = K3PO4 + Co(OH)26KOH + Co3(PO4)2 = 2K3PO4 + 3Co(OH)2
K+MgBr2=KBr+Mg2K + MgBr2 = 2KBr + Mg
K+Cl2=KCl2K + Cl2 = 2KCl
KMnO4+H2C2O4+H2SO4=CO2+MnSO4+K2SO4+H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = 10CO2 + 2MnSO4 + K2SO4 + 8H2O
KMnO4+H2C2O4+H3SO4=CO2+MnSO4+K2SO4+H2O4KMnO4 + 7H2C2O4 + 6H3SO4 = 14CO2 + 4MnSO4 + 2K2SO4 + 16H2O
K2CrO4 + Pb(NO3)2 = 2 KNO3 + PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
K 2 SO 3 +MnCl 2 =MnSO 3+KClK2SO3 + MnCl2 = MnSO3 + 2KCl
K2CrO4 + Pb(NO3)2 = 2 KNO3 + PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KMnO4 + HBr + H2SO4 = Br2 + K2SO4 + MnSO4 + H2O2KMnO4 + 10HBr + 3H2SO4 = 5Br2 + K2SO4 + 2MnSO4 + 8H2O
K2Cr2O7 + HCl = KCl + CrCl3 + H2O + Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KMnO4 + Na2SO3 + H2SO4 = K2SO4 + MnSO4 + Na2SO4 + H2O2KMnO4 + 5Na2SO3 + 3H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 3H2O
K + Cl2 = KCl2K + Cl2 = 2KCl
KMnO4 + Na2SO3 + H2SO4 = K2SO4 + MnSO4 + Na2SO4 + H2O2KMnO4 + 5Na2SO3 + 3H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 3H2O
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7+HCl=KCl+CrCl3+H2O+Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
K + NaOH = KOH + NaK + NaOH = KOH + Na
K2Cr2O7+FeCl2+HCl=CrCl3+KCl+FeCl3+H2OK2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 2KCl + 6FeCl3 + 7H2O
K2CrO4 + HBr = KBr + CrBr3 + Br +H2OK2CrO4 + 8HBr = 2KBr + CrBr3 + 3Br + 4H2O
KI +H2SO4 = K2SO4 + H2O + H2S + I28KI + 5H2SO4 = 4K2SO4 + 4H2O + H2S + 4I2
KClO3+KBr+H2O=KCl+Br2+KOHKClO3 + 6KBr + 3H2O = KCl + 3Br2 + 6KOH
K + N2 = K3N6K + N2 = 2K3N
KClO3+KBr+H20=KCl+Br2+KOH20KClO3 + 60KBr + 3H20 = 20KCl + 30Br2 + 60KOH
K3PO4 + Ca(NO3)2 = Ca3(PO4)2 + KNO32K3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6KNO3
KMnO4 + C3H5(OH)3 = K2CO3 + Mn2O3 + CO2 + H2O14KMnO4 + 4C3H5(OH)3 = 7K2CO3 + 7Mn2O3 + 5CO2 + 16H2O
KClO3=KCl+OKClO3 = KCl + 3O
KClO=KCl+OKClO = KCl + O
KClO=KCl+OKClO = KCl + O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KCL+ O2 = KCLO32KCL + 3O2 = 2KCLO3
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KPO4+CrClO3=KClO3+CrPO4KPO4 + CrClO3 = KClO3 + CrPO4
KI=K+I22KI = 2K + I2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + FeSO2 + H2SO2 = K2SO2 + MnSO4 + Fe(SO4)3 + H2O16KMnO4 + FeSO2 + 26H2SO2 = 8K2SO2 + 16MnSO4 + Fe(SO4)3 + 26H2O
K2Cr2O7 + 2FeSO4 + 6H2SO4 = Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H200K2Cr2O7 + 20FeSO4 + 10H2SO4 = 0Cr2(SO4)3 + 10Fe2(SO4)3 + 0K2SO4 + H20
K2Cr2O7 + 2FeSO4 + 6H2SO4 = Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H200K2Cr2O7 + 20FeSO4 + 10H2SO4 = 0Cr2(SO4)3 + 10Fe2(SO4)3 + 0K2SO4 + H20
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO2 + H2SO4 + KClO3 = KCl + K2SO4 + HNO36KNO2 + 3H2SO4 + 2KClO3 = 2KCl + 3K2SO4 + 6HNO3
KNO2 + H2SO4 + KClO3 = H2O + KCl + K2SO4 + HNO36KNO2 + 3H2SO4 + 2KClO3 = 0H2O + 2KCl + 3K2SO4 + 6HNO3
K + O2 = K2O4K + O2 = 2K2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K(SCN) + PbO2 + HCl = KCl + PbCl2 + CO2 +HNO3 + SO2 + H2OK(SCN) + 7PbO2 + 15HCl = KCl + 7PbCl2 + CO2 + HNO3 + SO2 + 7H2O
K(SCN) + PbO2 + HCl = KCl + PbCl2 + CO2 +NO + SO2 + H2O2K(SCN) + 11PbO2 + 24HCl = 2KCl + 11PbCl2 + 2CO2 + 2NO + 2SO2 + 12H2O
KCN + MnO2 + HCl = KCl + MnCl2 + CO2 + NO + H2O2KCN + 7MnO2 + 16HCl = 2KCl + 7MnCl2 + 2CO2 + 2NO + 8H2O
K2CrO4 + Na2S2O3 + HCl = KCl + CrCl3 + NaCl + SO2 + H2O4K2CrO4 + 3Na2S2O3 + 26HCl = 8KCl + 4CrCl3 + 6NaCl + 6SO2 + 13H2O
K2Cr2O7 + H2S + HCl = KCl + CrCl3 + S + H2OK2Cr2O7 + 3H2S + 8HCl = 2KCl + 2CrCl3 + 3S + 7H2O
KMnO4 + FeCl3 + H2SO4 = K2SO4 + MnSO4 + Fe2(SO4)3 +H20 + Cl20KMnO4 + 20FeCl3 + 30H2SO4 = 0K2SO4 + 0MnSO4 + 10Fe2(SO4)3 + 3H20 + 30Cl2
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KMnO4 + AlI3 + H2S = K2S + MnS + Al2S3 +I2 + H2O6KMnO4 + 10AlI3 + 24H2S = 3K2S + 6MnS + 5Al2S3 + 15I2 + 24H2O
KBr + Cl2 = KCl + Br22KBr + Cl2 = 2KCl + Br2
KMnO4+FeSO2+H2SO4=MnSO4+Fe2(SO4)3+K2SO2+H2O10KMnO4 + 14FeSO2 + 22H2SO4 = 10MnSO4 + 7Fe2(SO4)3 + 5K2SO2 + 22H2O
KMnO4+FeSO2+H2SO4=MnSO4+Fe(SO4)3+K2SO2+H2O8KMnO4 + 7FeSO2 + 26H2SO4 = 8MnSO4 + 7Fe(SO4)3 + 4K2SO2 + 26H2O
KNO2 + H2SO4 = HNO2 + K2SO42KNO2 + H2SO4 = 2HNO2 + K2SO4
KNO2 + H2SO4 = HNO2 + K2SO42KNO2 + H2SO4 = 2HNO2 + K2SO4
K3PO4 + Ba(NO3)2 = Ba3(PO4)2 + KNO32K3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6KNO3
K+Mg3(PO4)2=K3PO4+Mg6K + Mg3(PO4)2 = 2K3PO4 + 3Mg
KCn+CaO3=CaCn2+K2O32KCn + CaO3 = CaCn2 + K2O3
K3PO4+Ba(NO3)2=Ba3(PO4)2+KNO32K3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6KNO3
K2Cr2O7 + 3SnCl2+14HCl= 2CrCl3+3SnCl4+7H2O+2KClK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 7H2O + 2KCl
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KClO3 + C = CO2 + KCl2KClO3 + 3C = 3CO2 + 2KCl
KCn+CaO3=CaCn2+K2O32KCn + CaO3 = CaCn2 + K2O3
KI+H2SO4=K2SO4+I2+H2O+H2S8KI + 5H2SO4 = 4K2SO4 + 4I2 + 4H2O + H2S
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KBrO2 + KI + HBr = KBr + I2 + H2OKBrO2 + 4KI + 4HBr = 5KBr + 2I2 + 2H2O
K2Cr2O7 + 6KI + 7H2SO4= Cr2(SO4)3 + 4K2SO4 + 7H2O + 3I2K2Cr2O7 + 6KI + 7H2SO4 = Cr2(SO4)3 + 4K2SO4 + 7H2O + 3I2
KAg(CN)2+KOH=Ag+KCN+O2+H2O4KAg(CN)2 + 4KOH = 4Ag + 8KCN + O2 + 2H2O
K + Cl2= KCl 2K + Cl2 = 2KCl
KOH + H2SO4 = K2SO4 + H2O2KOH + H2SO4 = K2SO4 + 2H2O
KHSO4 + K2CO3 = K2SO4 + KHCO3KHSO4 + K2CO3 = K2SO4 + KHCO3
K(s) + H2O(l) = KOH (aq) + H2 (g) 2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K3PO4 + Ba(NO3)2 = Ba3(PO4)2 + KNO32K3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6KNO3
K3PO4 + Ba(NO3)2 = Ba3(PO4)2 + KNO32K3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6KNO3
K3PO4 + Ba(NO3)2 = Ba3(PO4)2 + KNO32K3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6KNO3
K3PO4 + Ba(NO3)2= Ba3(PO4)2 + KNO32K3PO4 + 3Ba(NO3)2 = Ba3(PO4)2 + 6KNO3
K2CrO4 + Ag2SO4 = Ag2CrO4 + K2SO4K2CrO4 + Ag2SO4 = Ag2CrO4 + K2SO4
K2S+FeCl3=Fe2S3+KCl3K2S + 2FeCl3 = Fe2S3 + 6KCl
KCl=K+ClKCl = K + Cl
KMnO4= K+Mn+OKMnO4 = K + Mn + 4O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2CrO4 + H2S + HCl = CrCl3 + KCl +S + H2O2K2CrO4 + 3H2S + 10HCl = 2CrCl3 + 4KCl + 3S + 8H2O
KI + H2SO4 + H2O2 = K2SO4 + H2O +I22KI + H2SO4 + H2O2 = K2SO4 + 2H2O + I2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7 + Na2C2O4 + H2SO4 = K2SO4 + Cr2SO4 + Na2SO4 + H2O + CO2K2Cr2O7 + 5Na2C2O4 + 7H2SO4 = K2SO4 + Cr2SO4 + 5Na2SO4 + 7H2O + 10CO2
K Cl=KClKCl = KCl
K2O + H2O= 2KOHK2O + H2O = 2KOH
K2O + H2O = KOHK2O + H2O = 2KOH
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KI+CI=KCI+I22KI + 2CI = 2KCI + I2
K3PO4+HCI=KCI+H3PO4K3PO4 + 3HCI = 3KCI + H3PO4
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O +Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI(aq)+CI2(g) = KCI(aq)+I2KI(aq) + CI2(g) = KCI(aq) + I2
KO2+CO2=K2CO3+O24KO2 + 2CO2 = 2K2CO3 + 3O2
KMnO4 + FeSO4 + H2SO4 = K2SO4 + MnSO4 +Fe(SO4)3 + H2O4KMnO4 + 5FeSO4 + 16H2SO4 = 2K2SO4 + 4MnSO4 + 5Fe(SO4)3 + 16H2O
KClO3 = KClO4 + KCl4KClO3 = 3KClO4 + KCl
KCl + Mg(OH)2 = K(OH)2 + MgClKCl + Mg(OH)2 = K(OH)2 + MgCl
KMnO4+Na2SO3+H2SO4=K2SO4+MnSO4+Na2SO4+HOH2KMnO4 + 5Na2SO3 + 3H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 3HOH
KMnO4 + HCl = MnCl2 + KCl + H2O + Cl22KMnO4 + 16HCl = 2MnCl2 + 2KCl + 8H2O + 5Cl2
K3PO4 + Fe(NO3)2 = Fe3(PO4)2 + KNO32K3PO4 + 3Fe(NO3)2 = Fe3(PO4)2 + 6KNO3
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI+MnO2+H2SO4=I+Mn2(SO4)3+K2SO4+H2O2KI + 2MnO2 + 4H2SO4 = 2I + Mn2(SO4)3 + K2SO4 + 4H2O
KBr+Cl2=KCl+Br22KBr + Cl2 = 2KCl + Br2
KHCO3=K2O+H2O+CO22KHCO3 = K2O + H2O + 2CO2
KClO3 = KClO4 + KCl4KClO3 = 3KClO4 + KCl
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KI+Pb(NO3)2=KNO3+PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K2Cr2O7 + SnCl2 + HCl = CrCl3 + KCl + SnCl4 + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 2KCl + 3SnCl4 + 7H2O
KO2+HI=I2 +K+H2OKO2 + 4HI = 2I2 + K + 2H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K3PO4+3Ca(NO3)2=3KNO3+Ca3(PO4)22K3PO4 + 3Ca(NO3)2 = 6KNO3 + Ca3(PO4)2
K3PO4+3Ca(NO3)2=3KNO3+Ca3(PO4)22K3PO4 + 3Ca(NO3)2 = 6KNO3 + Ca3(PO4)2
K3PO4+3Ca(NO3)2=3KNO3+Ca3(PO4)22K3PO4 + 3Ca(NO3)2 = 6KNO3 + Ca3(PO4)2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KMnO4 + NaNO2 + H2SO4 = K2SO4 + MnSO4 + NaNO3 + H2020KMnO4 + 80NaNO2 + 30H2SO4 = 10K2SO4 + 20MnSO4 + 80NaNO3 + 3H20
KMnO4 + NaNO2 + H2SO4 = K2SO4 + MnSO4 + NaNO3 + H2020KMnO4 + 80NaNO2 + 30H2SO4 = 10K2SO4 + 20MnSO4 + 80NaNO3 + 3H20
KClO6 = KCl + KClO93KClO6 = KCl + 2KClO9
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + Na2SO3 + H2SO4 = MnSO4 + Na2SO4 + K2SO4 + H2O2KMnO4 + 5Na2SO3 + 3H2SO4 = 2MnSO4 + 5Na2SO4 + K2SO4 + 3H2O
K2Cr2O7+H2S = KOH+S+Cr+H2O K2Cr2O7 + 6H2S = 2KOH + 6S + 2Cr + 5H2O
K2Cr2O7+H2S = K+S+Cr+H2O K2Cr2O7 + 7H2S = 2K + 7S + 2Cr + 7H2O
K2Cr2O7+H2S = KOH+S+Cr+H2O K2Cr2O7 + 6H2S = 2KOH + 6S + 2Cr + 5H2O
K2Cr2O7+H2S = KOH+S+Cr203+H2O 203K2Cr2O7 + 1218H2S = 406KOH + 1218S + 2Cr203 + 1015H2O
K2CrO4+Pb(NO3)2 = 2KNO3+PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2Cr2O7 + HCl + H2(So4) = Cl2 + Cr2(So4)3 + K(So4)3 + H2OK2Cr2O7 - 4HCl + 9H2(So4) = -2Cl2 + Cr2(So4)3 + 2K(So4)3 + 7H2O
K2Cr2O7 + HCl + H2(So4) = Cl2 + Cr(So4)3 + K(So4)3 + H2OK2Cr2O7 - 10HCl + 12H2(So4) = -5Cl2 + 2Cr(So4)3 + 2K(So4)3 + 7H2O
KI+Br2=KBr+I22KI + Br2 = 2KBr + I2
KClO3= KCl +O22KClO3 = 2KCl + 3O2
KNO3= KNO2 + O22KNO3 = 2KNO2 + O2
K4FeC6N6+H2SO4+H2O2=K2SO4+Fe2(SO4)3+NO+CO2+H2O2K4FeC6N6 + 7H2SO4 + 43H2O2 = 4K2SO4 + Fe2(SO4)3 + 12NO + 12CO2 + 50H2O
KSCN+PbO2+HCl=KCl+PbCl2+CO2+HNO3+SO2+H2OKSCN + 7PbO2 + 15HCl = KCl + 7PbCl2 + CO2 + HNO3 + SO2 + 7H2O
KSCN+PbO2+HCl=KCl+PbCl2+CO2+NO+SO2+H2O2KSCN + 11PbO2 + 24HCl = 2KCl + 11PbCl2 + 2CO2 + 2NO + 2SO2 + 12H2O
KI+Pb(NO3)2=KNO3+PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K3PO4+HCI=KCI+H3PO4K3PO4 + 3HCI = 3KCI + H3PO4
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
KI+CI2=KCI+I2KI + CI2 = KCI + I2
K2CrO4+AgNO3=KNO3+Ag2CrO4K2CrO4 + 2AgNO3 = 2KNO3 + Ag2CrO4
KBr+H2SO4=K2SO4+Br2+SO2+H2O2KBr + 2H2SO4 = K2SO4 + Br2 + SO2 + 2H2O
KMnO4+FeSO4+H2SO4=KSO4+MnSO4+H2O+Fe2(SO4)3 KMnO4 + 4FeSO4 + 4H2SO4 = KSO4 + MnSO4 + 4H2O + 2Fe2(SO4)3
KMnO4+(Fe)SO4+H2SO4=KSO4+MnSO4+H2O+Fe2(SO4)3 KMnO4 + 4(Fe)SO4 + 4H2SO4 = KSO4 + MnSO4 + 4H2O + 2Fe2(SO4)3
KClO3=KCl+KClO44KClO3 = KCl + 3KClO4
K2O+CaCl2=CaO+2 KClK2O + CaCl2 = CaO + 2KCl
K+F2=KF2K + F2 = 2KF
K+F2=KF2K + F2 = 2KF
KI + H2SO4 = KHSO4 + H2O + SO2 + I22KI + 3H2SO4 = 2KHSO4 + 2H2O + SO2 + I2
KOH+CO2=K2CO3+H2O2KOH + CO2 = K2CO3 + H2O
K2SO4(aq)+CaI2(aq)=CaSO4(s)+KI(aq)K2SO4(aq) + CaI2(aq) = CaSO4(s) + 2KI(aq)
KMnO4 + H2SO4 + H2SO3 = K(HSO4) + Mn(HSO4) + H2OKMnO4 - H2SO4 + 3H2SO3 = K(HSO4) + Mn(HSO4) + H2O
K3PO4(aq)+MgSO4 (aq)=K2SO4+Mg3 (PO4) 22K3PO4(aq) + 3MgSO4(aq) = 3K2SO4 + Mg3(PO4)2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K + MgBr2 = KBr2 + MgK + MgBr2 = KBr2 + Mg
K2S + I2 = 2 KI + SK2S + I2 = 2KI + S
K2S + I2 = 2 KI + SK2S + I2 = 2KI + S
K+NH3=KNH2+H22K + 2NH3 = 2KNH2 + H2
K + H2SO4 = K2SO4 + H2O +H2S8K + 5H2SO4 = 4K2SO4 + 4H2O + H2S
KClO3(s)=KCl (s) + O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
KI +Cl=KCl + IKI + Cl = KCl + I
KNO3+C12H22O11=N2+CO2+H2O+K2CO348KNO3 + 5C12H22O11 = 24N2 + 36CO2 + 55H2O + 24K2CO3
KMnO4 + HCN + KI + H2SO4 = MnSO4 + ICN + K2SO4 + H2O4KMnO4 + 10HCN + 10KI + 11H2SO4 = 4MnSO4 + 10ICN + 7K2SO4 + 16H2O
K+F2=KF2K + F2 = 2KF
K4Fe(CN)6 + 4 Pb(NO3)2 = 4 K(NO3)2 + Pb4Fe(CN)6K4Fe(CN)6 + 4Pb(NO3)2 = 4K(NO3)2 + Pb4Fe(CN)6
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KClO3=KCl+ O22KClO3 = 2KCl + 3O2
K4Fe(CN)6 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + CO2 + HNO3 + MnSO4 + H2O10K4Fe(CN)6 + 122KMnO4 + 218H2SO4 = 5Fe2(SO4)3 + 81K2SO4 + 60CO2 + 60HNO3 + 122MnSO4 + 188H2O
K2CrO4+Pb(NO3)2=K2(NO3)2+PbCrO4K2CrO4 + Pb(NO3)2 = K2(NO3)2 + PbCrO4
K2CrO4+Pb(NO3)2=K2(NO3)2+Pb(CrO4)K2CrO4 + Pb(NO3)2 = K2(NO3)2 + Pb(CrO4)
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KNO3 + S = SO2 + K2O + NO4KNO3 + 3S = 3SO2 + 2K2O + 4NO
KMnO4 + HCl = MnCl2 + KCl + Cl2 + H2O2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O
KMnO4 + HBr = MnBr2 + KBr + H2O + Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2Cr2O7 + HCl = CrCl3 + KCl +H2O +Cl2K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 3Cl2
KMnO4 + H2SO4 = Mn2O7 + K2SO4 + H2O2KMnO4 + H2SO4 = Mn2O7 + K2SO4 + H2O
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KOH + HCl = H2O + KClKOH + HCl = H2O + KCl
KMnO4+SO2+H2O=K2SO4+MnSO4+H2SO42KMnO4 + 5SO2 + 2H2O = K2SO4 + 2MnSO4 + 2H2SO4
KMnO4+SO4+H2O=K2SO4+MnSO4+H2SO4-2KMnO4 + 5SO4 + 8H2O = -1K2SO4 - 2MnSO4 + 8H2SO4
K2Cr2O7+HCl=KCl+CrCl3+H2O+Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KI+H2SO4+MnO2=KHSO4+MnSO4+H20+I220KI + 20H2SO4 + 0MnO2 = 20KHSO4 + 0MnSO4 + H20 + 10I2
K3PO4 + HCl = KCl + H3PO4K3PO4 + 3HCl = 3KCl + H3PO4
KIO3+KI+H2SO4=I+K2SO4+H2OKIO3 + 5KI + 3H2SO4 = 6I + 3K2SO4 + 3H2O
KClO2= KClO4 + KCl2KClO2 = KClO4 + KCl
KOH+Cl=KClO3+KCl+H2O6KOH + 6Cl = KClO3 + 5KCl + 3H2O
KOH+Cl2=KClO3+KCl+H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KOH+Cl2=KClO3+KCl+H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KNO3(s) +Na(s) = K2O(s) + Na2O(s) +N2(g)2KNO3(s) + 10Na(s) = K2O(s) + 5Na2O(s) + N2(g)
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KBrO3 = KBr + O22KBrO3 = 2KBr + 3O2
KIO3+Na2SO3+H = I2+K2SO4 +NaH+H200KIO3 + 0Na2SO3 + 20H = 0I2 + 0K2SO4 + 0NaH + H20
KMnO4+FeSO4+H2SO4=Fe(SO4)3+K2SO4+MnSO4+H2O4KMnO4 + 5FeSO4 + 16H2SO4 = 5Fe(SO4)3 + 2K2SO4 + 4MnSO4 + 16H2O
KMnO4 + KCl + H2SO4 = K2SO4 + MnSO4 +Cl2 +H2O2KMnO4 + 10KCl + 8H2SO4 = 6K2SO4 + 2MnSO4 + 5Cl2 + 8H2O
KMnO4 + KCl + H2SO4 = K2SO4 + MnSO4 +Cl2 +H2O2KMnO4 + 10KCl + 8H2SO4 = 6K2SO4 + 2MnSO4 + 5Cl2 + 8H2O
K2SO3+Mn(OH)2=K2(OH)2+MnSO3K2SO3 + Mn(OH)2 = K2(OH)2 + MnSO3
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KMnO4 + FeSO4 + H2SO4 = K2SO4 + MnSO4 + H20 + Fe2(S04)3 -60KMnO4 + 10FeSO4 - 40H2SO4 = -30K2SO4 - 60MnSO4 - 4H20 + 5Fe2(S04)3
KNO2+H2S+HCl=NO+S+KCl+H2O2KNO2 + H2S + 2HCl = 2NO + S + 2KCl + 2H2O
KCl+KMnO4+H2SO4=MnSO4+K2SO4+Cl2+H2O10KCl + 2KMnO4 + 8H2SO4 = 2MnSO4 + 6K2SO4 + 5Cl2 + 8H2O
KI+H2SO4=K2SO2+I2+H2S+H2O8KI + 3H2SO4 = 4K2SO2 + 4I2 - H2S + 4H2O
KIO4 + KI + HCL = KCL + I2 + H2OKIO4 + 7KI + 8HCL = 8KCL + 4I2 + 4H2O
KNO3+C12H22O11=N2+CO2+H2O+K2CO348KNO3 + 5C12H22O11 = 24N2 + 36CO2 + 55H2O + 24K2CO3
K+MgBr2=KBr+Mg2K + MgBr2 = 2KBr + Mg
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KOH+Co3(PO4)2=K3PO4+Co(OH)26KOH + Co3(PO4)2 = 2K3PO4 + 3Co(OH)2
KClO3+FeSO4+H2SO4=KCl+Fe2(SO4)3+H2OKClO3 + 6FeSO4 + 3H2SO4 = KCl + 3Fe2(SO4)3 + 3H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K+KNO3=K2O+N210K + 2KNO3 = 6K2O + N2
K2Cr2O7+SnCl2+HCl = CrCl2+SnCl4+KCl+HO24K2Cr2O7 - 5SnCl2 + 14HCl = 8CrCl2 - 5SnCl4 + 8KCl + 14HO2
K2Cr2O7+SnCl2+HCl = CrCl2+SnCl4+KCl+H2OK2Cr2O7 + 4SnCl2 + 14HCl = 2CrCl2 + 4SnCl4 + 2KCl + 7H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K+Cl2=KCl2K + Cl2 = 2KCl
KCl+F2=KF+Cl22KCl + F2 = 2KF + Cl2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KBr + ClF = KF + BrClKBr + ClF = KF + BrCl
KBr + ClF = KF + Cl2 + Br22KBr + 2ClF = 2KF + Cl2 + Br2
K(OH)+H3(PO4)=K3(PO4)+H(OH)3K(OH) + H3(PO4) = K3(PO4) + 3H(OH)
K+MgBr2=KBr+Mg2K + MgBr2 = 2KBr + Mg
KMnO4+H2SO4=K2SO4+MnSO4+H2O+O24KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 6H2O + 5O2
KMnO4+H2SO4=K2SO4+MnSO4+H2O+O24KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 6H2O + 5O2
KMnO4+H2SO4=K2SO4+MnSO4+H2O+O24KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 6H2O + 5O2
KOH (aq) + 4H3PO4 (aq) = K3PO4 (aq) +H2O (l) 3KOH(aq) + H3PO4(aq) = K3PO4(aq) + 3H2O(l)
K3PO4 + BaCl2 = Ba3(PO4)2 + KCl2K3PO4 + 3BaCl2 = Ba3(PO4)2 + 6KCl
KClO3 + FeSO4 + H2SO4 = KCl + Fe2(SO4)3 + H2OKClO3 + 6FeSO4 + 3H2SO4 = KCl + 3Fe2(SO4)3 + 3H2O
KMnO4+Fe+HCl=FeCl2+MnCl2+KCl+H2O2KMnO4 + 5Fe + 16HCl = 5FeCl2 + 2MnCl2 + 2KCl + 8H2O
KClO3 + C12H22O11 = KCl + H2O + CO28KClO3 + C12H22O11 = 8KCl + 11H2O + 12CO2
KClO3 + C12H22O11 = KCl + H2O + CO4KClO3 + C12H22O11 = 4KCl + 11H2O + 12CO
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KMnO4 + NaCl + H2SO4 = Cl2 + K2SO4 + MnSO4 + H2O + Na2SO42KMnO4 + 10NaCl + 8H2SO4 = 5Cl2 + K2SO4 + 2MnSO4 + 8H2O + 5Na2SO4
KOH + H2SO4 = H2O + K2(SO4)2KOH + H2SO4 = 2H2O + K2(SO4)
KMnO4 + NaCl + H2SO4 = Cl2 + K2SO4 + MnSO4 + H2O + Na2SO42KMnO4 + 10NaCl + 8H2SO4 = 5Cl2 + K2SO4 + 2MnSO4 + 8H2O + 5Na2SO4
KNO3 + S = SO2 + K2O + NO4KNO3 + 3S = 3SO2 + 2K2O + 4NO
K + Br2 = KBr2K + Br2 = 2KBr
KIO3+As+H2O+KCl=I2+KAsO2+HCl6KIO3 + 10As + 2H2O + 4KCl = 3I2 + 10KAsO2 + 4HCl
KClO3 + H2SO4 = HClO4 + ClO2 + K2SO4 + H2O6KClO3 + 3H2SO4 = 2HClO4 + 4ClO2 + 3K2SO4 + 2H2O
K2O(s) + H2O(l) = KOH(aq) K2O(s) + H2O(l) = 2KOH(aq)
K2O(s) + H2O(l) = KOH(aq) K2O(s) + H2O(l) = 2KOH(aq)
K4Fe(CN)6+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+CO2+HNO3+H2O10K4Fe(CN)6 + 122KMnO4 + 218H2SO4 = 5Fe2(SO4)3 + 122MnSO4 + 81K2SO4 + 60CO2 + 60HNO3 + 188H2O
K4Fe(CN)6+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+CO2+HNO3+H2O10K4Fe(CN)6 + 122KMnO4 + 218H2SO4 = 5Fe2(SO4)3 + 122MnSO4 + 81K2SO4 + 60CO2 + 60HNO3 + 188H2O
K2SO4 + FeSO4 + SnCl4 = Fe2(SO4)3 + SnCl2 + KClK2SO4 + 2FeSO4 + SnCl4 = Fe2(SO4)3 + SnCl2 + 2KCl
KF=K+F22KF = 2K + F2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2CrO4+Na2SO3+HCl=KCl+Na2SO4+CrCl3+H2O2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
K+Cl2=KCl2K + Cl2 = KCl2
KCLO=KCL + KCLO33KCLO = 2KCL + KCLO3
KMnO4 + FeCl2 + HCl =MnCl2 + FeCl3 + KCl + H2OKMnO4 + 5FeCl2 + 8HCl = MnCl2 + 5FeCl3 + KCl + 4H2O
KMnO4 + FeSO4 +H2SO4=MnSO4 + Fe2 (SO4)3 + K2SO4 + H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
K(s) + H2O(l) = KOH(aq) + H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KMnO4 + HBr = MnBr2 + KBr + H2O + Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
KCIO3 = KCI + O22KCIO3 = 2KCI + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCIO3 = KCI + O22KCIO3 = 2KCI + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCl + Cu = CuCl + KKCl + Cu = CuCl + K
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K + O2= K2O4K + O2 = 2K2O
KMnO4+H2SO4=K2SO4+MnSO4+O2+H2O4KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 5O2 + 6H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2O+H2O=O2+KOHK2O + H2O = 0O2 + 2KOH
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4+FeSO4+H2SO4=K2SO4+MnSO4+Fe2(SO4)3=H2O2KMnO4 + 10FeSO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
K2Cr2O7+KI+H2SO4=K2SO4+Cr2(SO4)3+H2O+I2K2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 7H2O + 3I2
K2Cr2O7+KI+H2SO4=K2SO4+Cr2(SO4)3+H2O+I2K2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 7H2O + 3I2
KNO3 + S = SO2+ K2O + NO4KNO3 + 3S = 3SO2 + 2K2O + 4NO
K+Cl2=2KCl2K + Cl2 = 2KCl
KMnO4+ HCl = MnCl2+ KCl+ Cl2+ H2O2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O
K2Cr2O7+HCl+H2S=KCl+CrCl3+H2O+SK2Cr2O7 + 8HCl + 3H2S = 2KCl + 2CrCl3 + 7H2O + 3S
KMnO4 + HBr = MnBr2 + KBr + H2O + Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2Cr2O7 + HCl = CrCl3 + KCl + H2O + Cl2K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 3Cl2
KOH + H3PO4 = K3PO4 + H2O 3KOH + H3PO4 = K3PO4 + 3H2O
K2CO3 + H2SO4 = K2SO4 + H2O + CO2 K2CO3 + H2SO4 = K2SO4 + H2O + CO2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KNO3+Fe=Fe(NO3)2+K2KNO3 + Fe = Fe(NO3)2 + 2K
KCIO3 = KCIO4 + KCI4KCIO3 = 3KCIO4 + KCI
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2SO4 + Ba(C2H3O2)2 = BaSO4 + 2 KC2H3O2K2SO4 + Ba(C2H3O2)2 = BaSO4 + 2KC2H3O2
K3P+Ca(NO3)2=KNO3+Ca3P22K3P + 3Ca(NO3)2 = 6KNO3 + Ca3P2
K3P+(NH4)2SO4=K2SO4+(NH4)3P2K3P + 3(NH4)2SO4 = 3K2SO4 + 2(NH4)3P
K3P+(NH4)2SO4=K2SO4+(NH4)3P2K3P + 3(NH4)2SO4 = 3K2SO4 + 2(NH4)3P
K3P+AgNO3=Ag3P+KNO3K3P + 3AgNO3 = Ag3P + 3KNO3
K + NHO3 = KNO3 + H22K + 2NHO3 = 2KNO3 + H2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KHC8H4O4 + NaOH = KNaC8H4O4 +H2OKHC8H4O4 + NaOH = KNaC8H4O4 + H2O
KMnO4 + FeCl2 + HCl = MnCl2+FeCl3 + KCl + H2OKMnO4 + 5FeCl2 + 8HCl = MnCl2 + 5FeCl3 + KCl + 4H2O
K2O2 + CO2 = K2CO3 + O22K2O2 + 2CO2 = 2K2CO3 + O2
K3PO4 + BaCl2 = KCl + Ba3(PO4)22K3PO4 + 3BaCl2 = 6KCl + Ba3(PO4)2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KBr+Cl2=KCl+Br22KBr + Cl2 = 2KCl + Br2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4 + FeSO4 + H2SO4 = MnSO4 + Fe2(SO4)3 +K2S04 + H2O2KMnO4 + 36FeSO4 + 24H2SO4 = 2MnSO4 + 18Fe2(SO4)3 + K2S04 + 24H2O
KMnO4 + FeSO4 + H2SO4 = MnO4 + Fe2(SO4)3 +K2S04 + H2O2KMnO4 + 24FeSO4 + 16H2SO4 = 2MnO4 + 12Fe2(SO4)3 + K2S04 + 16H2O
KCl + F2 = KF + Cl22KCl + F2 = 2KF + Cl2
KCl + H2SO4 = K2SO4 + HCl2KCl + H2SO4 = K2SO4 + 2HCl
K3PO4+Al(NO3)3=KNO3+AlPO4K3PO4 + Al(NO3)3 = 3KNO3 + AlPO4
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3 + C12H22O11 = KCl + CO2 + H2O8KClO3 + C12H22O11 = 8KCl + 12CO2 + 11H2O
KO2 + H2O = KOH + O24KO2 + 2H2O = 4KOH + 3O2
K + KNO3 = K2O + N210K + 2KNO3 = 6K2O + N2
K2CO3 + AlCl3 = Al2(CO3)3 + KCl3K2CO3 + 2AlCl3 = Al2(CO3)3 + 6KCl
KIO3+KI+H2SO4= I2+K2SO4+ H2OKIO3 + 5KI + 3H2SO4 = 3I2 + 3K2SO4 + 3H2O
KMnO4+FeCl2+HCl= MnCl2+FeCl3+KCl+H2OKMnO4 + 5FeCl2 + 8HCl = MnCl2 + 5FeCl3 + KCl + 4H2O
KOH + AgNO3 = KNO3 + AgOHKOH + AgNO3 = KNO3 + AgOH
K2CO3 + H2SO4 = K2SO4 + CO2 + H2OK2CO3 + H2SO4 = K2SO4 + CO2 + H2O
K+O2=K2O4K + O2 = 2K2O
KI= K+I22KI = 2K + I2
K + Br2 = KBr2K + Br2 = 2KBr
K2Cr2O7=K2CrO4+Cr2O3+O24K2Cr2O7 = 4K2CrO4 + 2Cr2O3 + 3O2
KO2+H2O=KOH+O24KO2 + 2H2O = 4KOH + 3O2
KNO2 + KClO3 = KCl + KNO33KNO2 + KClO3 = KCl + 3KNO3
KClO3 + S = KCl + SO22KClO3 + 3S = 2KCl + 3SO2
KNO3 + C = CO2 + NO2 + K2O4KNO3 + C = CO2 + 4NO2 + 2K2O
K2O2+K=K2OK2O2 + 2K = 2K2O
KMnO4+FeSO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4(aq) + H2SO4(aq) = MnO4 + K2SO3 + H2O2KMnO4(aq) + H2SO4(aq) = 2MnO4 + K2SO3 + H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4+SO2+H2O=K2SO4+MnSO4+H2SO42KMnO4 + 5SO2 + 2H2O = K2SO4 + 2MnSO4 + 2H2SO4
K2CO3 + Sr(NO3)2 = KNO3 + SrCO3K2CO3 + Sr(NO3)2 = 2KNO3 + SrCO3
KClO3 + KI+ H2O = KCl+ I2 + KOHKClO3 + 6KI + 3H2O = KCl + 3I2 + 6KOH
KMnO4 + FeSO4 + H2SO4 = MnSO4 + Fe2(SO4)3 + K2SO4 + H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
K2SO4(aq)+Ca(OH)2(aq)=KOH+CaSO4K2SO4(aq) + Ca(OH)2(aq) = 2KOH + CaSO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K + H2O = KOH +H22K + 2H2O = 2KOH + H2
KI+H2SO4=H2S+H2O+I+K2SO48KI + 5H2SO4 = H2S + 4H2O + 8I + 4K2SO4
KNO3 + H2CO3 = K2CO3 + HNO3 2KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2SO4(aq)+Co(NO3)2(aq)=CoSO4(aq)+2KNO3(aq)K2SO4(aq) + Co(NO3)2(aq) = CoSO4(aq) + 2KNO3(aq)
KBrO3(s)=KBr(s)+O2(s)2KBrO3(s) = 2KBr(s) + 3O2(s)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+FeSO4+H2SO4 = Fe2(SO4)3+MnSO4+K2SO4+H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
KI+Pb(NO3)2=PbI2+KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
K2O + H2O = KOHK2O + H2O = 2KOH
KO2+CO2=K2CO3+O24KO2 + 2CO2 = 2K2CO3 + 3O2
KMnO4 + H2SO4=MnO2 + K2SO4 + H + SO2-2KMnO4 + H2SO4 = -2MnO2 - K2SO4 + 2H + 2SO2
KIO3+H2SO3=KI+H2SO4KIO3 + 3H2SO3 = KI + 3H2SO4
KIO3+H2SO3=KI+H2SO4KIO3 + 3H2SO3 = KI + 3H2SO4
KIO3+H2SO3=KI+H2SO4KIO3 + 3H2SO3 = KI + 3H2SO4
K4Fe(SCN)6+K2Cr2O7+H2SO4 = Fe2(SO4)3+Cr2(SO4)3+CO2+H2O+K2SO4+KNO3 6K4Fe(SCN)6 + 97K2Cr2O7 + 355H2SO4 = 3Fe2(SO4)3 + 97Cr2(SO4)3 + 36CO2 + 355H2O + 91K2SO4 + 36KNO3
KOH(aq) +HCl(aq) = KCl(aq) +H2O(l) KOH(aq) + HCl(aq) = KCl(aq) + H2O(l)
K2Cr2O7 + KBr + H2SO4 = KHSO3 + Cr (SO4)3 + Br2 + H2OK2Cr2O7 - 4KBr + 4H2SO4 = -2KHSO3 + 2Cr(SO4)3 - 2Br2 + 5H2O
K2Cr2O7 + KBr + H2SO4 = KHSO3 + Cr (SO4)3 + Br2 + H2OK2Cr2O7 - 4KBr + 4H2SO4 = -2KHSO3 + 2Cr(SO4)3 - 2Br2 + 5H2O
KCl + F2 = KF + Cl22KCl + F2 = 2KF + Cl2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KMnO4=K+MnO4KMnO4 = K + MnO4
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO4=KCl+O2KClO4 = KCl + 2O2
K+MgBr=KBr+MgK + MgBr = KBr + Mg
KNO3= KNO2+O22KNO3 = 2KNO2 + O2
K2SO4(aq) + BaCl2(aq) = BaSO4(s) + KCl(aq)K2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2KCl(aq)
K + Al(NO3)3 = Al + K(NO3)3K + Al(NO3)3 = Al + K(NO3)3
K + H2SO4=K2SO4 + H22K + H2SO4 = K2SO4 + H2
K + H2O =KOH +H22K + 2H2O = 2KOH + H2
KI +H2SO4+KIO3 = I2 +K2SO4 +H2O5KI + 3H2SO4 + KIO3 = 3I2 + 3K2SO4 + 3H2O
K2SO4 + FeSO4 + SnCl4 = Fe2(SO4)3 +SnCl2 + KClK2SO4 + 2FeSO4 + SnCl4 = Fe2(SO4)3 + SnCl2 + 2KCl
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2S +CoCl2 =KCl + CoSK2S + CoCl2 = 2KCl + CoS
KMnO4(aq) + H2SO4(aq) = MnO4 + K2SO3+ H2O2KMnO4(aq) + H2SO4(aq) = 2MnO4 + K2SO3 + H2O
KMnO4(aq) + H2SO4(aq) = MnO4 + K2SO3 + H2O2KMnO4(aq) + H2SO4(aq) = 2MnO4 + K2SO3 + H2O
KBiO3 + Mn(NO3)2 + HNO3 = Bi(NO3)3 + KMnO4 + KNO3 + H2O5KBiO3 + 2Mn(NO3)2 + 14HNO3 = 5Bi(NO3)3 + 2KMnO4 + 3KNO3 + 7H2O
K2CO3 + Fe(C2H3O2)3 = KC2H3O2 + Fe2(CO3)33K2CO3 + 2Fe(C2H3O2)3 = 6KC2H3O2 + Fe2(CO3)3
K2CO3 + Fe(C2H3O2)3 = KC2H3O2 + Fe2(CO3)33K2CO3 + 2Fe(C2H3O2)3 = 6KC2H3O2 + Fe2(CO3)3
K2Cr2O + FeCl2 + HCI = CrCl3 + FeCl3 + KCI + H2OK2Cr2O - 6FeCl2 + 2HCI = 2CrCl3 - 6FeCl3 + 2KCI + H2O
KNO3 + K2SO3 + H2O = N2O + K2SO4 + KOH2KNO3 + 4K2SO3 + H2O = N2O + 4K2SO4 + 2KOH
KBrO + Sn + Ba(OH)2 = KBr + Ba(HSnO2)2 2KBrO + 2Sn + Ba(OH)2 = 2KBr + Ba(HSnO2)2
K+H2O=H2+KOH2K + 2H2O = H2 + 2KOH
KMnO4 +H2SO4 +KBr=MnSO4 +Br2 +H2O +K2SO42KMnO4 + 8H2SO4 + 10KBr = 2MnSO4 + 5Br2 + 8H2O + 6K2SO4
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2Cr2O7+FeCl2+HCl=CrCl3+FeCl3+H2O+KClK2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 7H2O + 2KCl
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KMnO4+H2SO4+C4H10O=K2SO4+H2MnO3+C4H8O2+H22KMnO4 + H2SO4 + 2C4H10O = K2SO4 + 2H2MnO3 + 2C4H8O2 + H2
K + Cl2 = KCl2K + Cl2 = 2KCl
K+Br2=KBr2K + Br2 = 2KBr
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KI + H2O = KOH + I + H22KI + 2H2O = 2KOH + 2I + H2
K2CrO4 + NaNO2 + H2SO4 = Cr2(SO4)3 + K2SO4 + NaNO3 + H2O 2K2CrO4 + 3NaNO2 + 5H2SO4 = Cr2(SO4)3 + 2K2SO4 + 3NaNO3 + 5H2O
KHCO3+H2C2O4=H2O+CO2+K2KHCO3 + H2C2O4 = 2H2O + 4CO2 + 2K
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCIO3 = KCI + O22KCIO3 = 2KCI + 3O2
KClO3 = KCl+O22KClO3 = 2KCl + 3O2
KBr + Cl2 = Br + KCl2KBr + Cl2 = 2Br + 2KCl
KBr + H2SO4 = K2SO4 + HBr2KBr + H2SO4 = K2SO4 + 2HBr
KBr + H2O2 + H2SO4 = Br + K2SO4 +H2O2KBr + H2O2 + H2SO4 = 2Br + K2SO4 + 2H2O
K2Cr2O7+C+H2SO4=Cr2(SO4)3+K2SO4+CO2+H2O2K2Cr2O7 + 3C + 8H2SO4 = 2Cr2(SO4)3 + 2K2SO4 + 3CO2 + 8H2O
KI + Cl2 = KCl + I22KI + Cl2 = 2KCl + I2
KNO3+H2SO4=K2SO4+HNO32KNO3 + H2SO4 = K2SO4 + 2HNO3
KOH+H3PO4=H2O+K3PO43KOH + H3PO4 = 3H2O + K3PO4
KI(s)+Cl2=2KCl(aq)+I22KI(s) + Cl2 = 2KCl(aq) + I2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7 + HCl=Cl2+ Cr2O3+ H2O+ KClK2Cr2O7 + 8HCl = 3Cl2 + Cr2O3 + 4H2O + 2KCl
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K2Cr2O7 +H2O + S = SO2 +KOH + Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
KMnO4 + H2SO4 + K2 Na(Co(NO2)6) = K2 SO4 + Na2SO4 +Co2(SO4)3 + MnSO4 + KNO3 + H2O24KMnO4 + 36H2SO4 + 10K2Na(Co(NO2)6) = -8K2SO4 + 5Na2SO4 + 5Co2(SO4)3 + 24MnSO4 + 60KNO3 + 36H2O
K + Br2 = KBr2K + Br2 = 2KBr
KOH + H2SO4 = K2SO4 + H2O2KOH + H2SO4 = K2SO4 + 2H2O
K2Cr2O7+SnCl2+HCl=CrCl3+SnCl4+KCl+H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2Cr2O7 + SnCl2 + HCl=CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2SO4 + Li3N = K3N + Li2SO43K2SO4 + 2Li3N = 2K3N + 3Li2SO4
KIO3 +Cl2 + KOH = KIO4 +KCl + H2020KIO3 + 10Cl2 + 20KOH = 20KIO4 + 20KCl + H20
K2CrO4 + Pb(NO3)2 = PbCrO4 + KNO3K2CrO4 + Pb(NO3)2 = PbCrO4 + 2KNO3
KNO3(s) + K(s) = K2O(s) + N2(g)2KNO3(s) + 10K(s) = 6K2O(s) + N2(g)
KNO3(s)+K(s)=K2O(s)+N2(g)2KNO3(s) + 10K(s) = 6K2O(s) + N2(g)
KCl + SO2 + H2O = KClS + H2O2KCl + SO2 + 2H2O = KClS + 2H2O2
K+O2 = K2O4K + O2 = 2K2O
KClO3 + PCl3 = PCl3O + KClKClO3 + 3PCl3 = 3PCl3O + KCl
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KI + Pb(C2H3O2)2 = PbI2 + CH3CO2K2KI + Pb(C2H3O2)2 = PbI2 + 2CH3CO2K
KClO3 + PCl3 = PCl3O + KClKClO3 + 3PCl3 = 3PCl3O + KCl
KClO3 + PCl3 = PCl3O + KClKClO3 + 3PCl3 = 3PCl3O + KCl
K2O(s) + H2O(l) = KOH(aq) K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3 = KCl + O2 2KClO3 = 2KCl + 3O2
KO2(s) + HNO3(aq) =KNO3 (aq) + O2(g) + H2O2(aq)2KO2(s) + 2HNO3(aq) = 2KNO3(aq) + O2(g) + H2O2(aq)
KOH+HC1=KC1+H2O=KOH + HC1 = KC1 + H2O
K3PO4+BaCl2=KCl+Ba3(PO4)22K3PO4 + 3BaCl2 = 6KCl + Ba3(PO4)2
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
K+O2=K2O4K + O2 = 2K2O
KMnO4 + H2SO4 = K2SO4 + MnSO4 + O + H2O2KMnO4 + 3H2SO4 = K2SO4 + 2MnSO4 + 5O + 3H2O
KMnSO4 + H2SO4 = K2SO4 + MnSO4 + O + H2O2KMnSO4 + H2SO4 = K2SO4 + 2MnSO4 - O + H2O
KMnO4 + H2SO4 = MnO2 + SO2 + H2O +K2SO42KMnO4 - 2H2SO4 = 2MnO2 - 3SO2 - 2H2O + K2SO4
KI + H2SO4 + H2O2 = I2 + H2O + K2SO42KI + H2SO4 + H2O2 = I2 + 2H2O + K2SO4
K(s)+H2O(l)=KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KMnO4+HCl=KCl+MnCl2+Cl2+H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
KMnO4+FeSO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
K+O2=K2O4K + O2 = 2K2O
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
K(s)+H2O(l)=KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KI + H2O2 +H2SO4 = I2 + K2SO4 + H2O2KI + H2O2 + H2SO4 = I2 + K2SO4 + 2H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7 + HCl = KCl + CrCl3 + Cl2 + H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.