Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
KOH+HClO4=KClO4+H2OKOH + HClO4 = KClO4 + H2O
KCN + NaHSO4 = KCNH2 + NaSO4KCN + 2NaHSO4 = KCNH2 + 2NaSO4
KCN + NaHSO4 = KCNH + NaSO4KCN + NaHSO4 = KCNH + NaSO4
K2SO4+BaCl2=BaSO4+KClK2SO4 + BaCl2 = BaSO4 + 2KCl
K2C2O4 + Cr(NO3)4 = K2(NO3)4 + CrC2O4K2C2O4 + Cr(NO3)4 = K2(NO3)4 + CrC2O4
K2C2O4 + Cr(NO3)4 = K2(NO3)4 + CrC2O4K2C2O4 + Cr(NO3)4 = K2(NO3)4 + CrC2O4
KClO3 + C7H2O + S = K2S + KCl + CO2 + H2O14KClO3 + 3C7H2O + 0S = 0K2S + 14KCl + 21CO2 + 3H2O
KClO3 + C7H2O + S = K2S + KCl + CO2 + H2O14KClO3 + 3C7H2O + 0S = 0K2S + 14KCl + 21CO2 + 3H2O
KClO3 + C7H2O + S = KCl + K2S + CO2 + H2O14KClO3 + 3C7H2O + 0S = 14KCl + 0K2S + 21CO2 + 3H2O
KClO3 + S + C7H2O = KCl + K2S + CO2 + H2O14KClO3 + 0S + 3C7H2O = 14KCl + 0K2S + 21CO2 + 3H2O
KClO3 + S + C7H2O = KCl + K2S + CO2 + H2O14KClO3 + 0S + 3C7H2O = 14KCl + 0K2S + 21CO2 + 3H2O
KClO3 + S + C7H2O = KCl + +SO4 + CO2 + H2O0KClO3 - 7S + 2C7H2O = 0KCl+ - 7SO4 + 14CO2 + 2H2O
KClO3 + S + C7H2O = KCl + KS + CO2 + H2O14KClO3 + 0S + 3C7H2O = 14KCl + 0KS + 21CO2 + 3H2O
KClO3 + S + C7H2O = KCl + K2S + CO2 + H2O14KClO3 + 0S + 3C7H2O = 14KCl + 0K2S + 21CO2 + 3H2O
K 3 PO 4 + Ca (NO 3 ) 2 = Ca 3 (PO 4 ) 2 + KNO 32K3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6KNO3
KClO3=O2+KCl2KClO3 = 3O2 + 2KCl
KClO3+C=KCl+CO22KClO3 + 3C = 2KCl + 3CO2
K2Cr2O7+ HCl= KCl+ CrCl3+ H2O+ Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KMnO4+ HBr= MnBr2+ Br2+ KBr+ H2O2KMnO4 + 16HBr = 2MnBr2 + 5Br2 + 2KBr + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7+3H2C2O4+H2SO4=Cr2(SO4)3+H2O+6CO2+K2SO4K2Cr2O7 + 3H2C2O4 + 4H2SO4 = Cr2(SO4)3 + 7H2O + 6CO2 + K2SO4
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KBr + MnO2 + H2SO4 = Br2 + K2SO4 + MnSO4 + H2O2KBr + MnO2 + 2H2SO4 = Br2 + K2SO4 + MnSO4 + 2H2O
KBr + MnO2 + H2SO4 = Br2 + K2SO4 + MnSO4 + H2O2KBr + MnO2 + 2H2SO4 = Br2 + K2SO4 + MnSO4 + 2H2O
KClO3 = KCl + 3 O22KClO3 = 2KCl + 3O2
K NO2+K MNO4+ H2 SO4=K NO3+K2 SO4+MN SO4+ H2O5KNO2 + 2KMNO4 + 3H2SO4 = 5KNO3 + K2SO4 + 2MNSO4 + 3H2O
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KF(aq) + HI(aq)=KI(aq)+HF(aq)KF(aq) + HI(aq) = KI(aq) + HF(aq)
K2O(s) + H2O(l) = KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
K2O + H2O = KOHK2O + H2O = 2KOH
KNO 3 + S = SO 2 + K 2 O + NO4KNO3 + 3S = 3SO2 + 2K2O + 4NO
KMnO 4 + HCl = MnCl 2 + KCl+ Cl 2 + H 2 O2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O
KMnO 4 + HBr = MnBr 2 + KBr + H 2 O + Br 22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
KClO 3 = KCl + O 22KClO3 = 2KCl + 3O2
K 2 Cr 2 O 7 + SnCl 2 + HCl = CrCl 3 + SnCl 4 + KCl + H 2 OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K 2 Cr 2 O 7 + HCl = CrCl 3 + KCl + H 2 O + ClK2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 6Cl
KMnO4+FeSO4+H2SO4=Fe2 (SO4)3+ K2SO4+ MnSO4+H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
KClO3 (aq) = KCl (aq) + O2 (g)2KClO3(aq) = 2KCl(aq) + 3O2(g)
KClO3 (aq) = KCl (aq) + O22KClO3(aq) = 2KCl(aq) + 3O2
KOH(aq) + CuCl2(aq) = Cu(OH)2(s) + KCl(aq) 2KOH(aq) + CuCl2(aq) = Cu(OH)2(s) + 2KCl(aq)
K2Cr2O7+KI+H2SO4=I2+K2SO4+Cr2 (SO4)3+H2OK2Cr2O7 + 6KI + 7H2SO4 = 3I2 + 4K2SO4 + Cr2(SO4)3 + 7H2O
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
KHC8H4O4(aq) + NaOH(aq) = KNaC8H4O4(aq) + H2O(l) KHC8H4O4(aq) + NaOH(aq) = KNaC8H4O4(aq) + H2O(l)
K3PO4+Co(CH3CO2)2=K3(CH3CO2)2+CoPO4K3PO4 + Co(CH3CO2)2 = K3(CH3CO2)2 + CoPO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3+C5H10O5=KCl + CO2+ H2O10KClO3 + 3C5H10O5 = 10KCl + 15CO2 + 15H2O
KClO3+C5H5O5=KCl + CO2+ H2O5KClO3 + 2C5H5O5 = 5KCl + 10CO2 + 5H2O
KClO3+C5H5O5=KCl + CO2+ H2O5KClO3 + 2C5H5O5 = 5KCl + 10CO2 + 5H2O
KCH3COO(aq) + HBr(aq)=KBr(aq) + CH3COOH(aq)KCH3COO(aq) + HBr(aq) = KBr(aq) + CH3COOH(aq)
K2(CO2)+Cr(OH)4=K2(OH)4+Cr(CO2)K2(CO2) + Cr(OH)4 = K2(OH)4 + Cr(CO2)
KAl(OH)4 + H2SO4 = KAl(SO4)2 + H2OKAl(OH)4 + 2H2SO4 = KAl(SO4)2 + 4H2O
K2O+H2O=KOHK2O + H2O = 2KOH
KOH + HCl = H2O + KClKOH + HCl = H2O + KCl
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K+Br2=KBr2K + Br2 = 2KBr
K(s)+H2O(l) = KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KI+K2Cr2O7+H2SO4=I2+K2SO4+Cr2(SO4)3+H2O6KI + K2Cr2O7 + 7H2SO4 = 3I2 + 4K2SO4 + Cr2(SO4)3 + 7H2O
K2CrO7+HCl=CrCl3+KCl+Cl2+H2O2K2CrO7 + 28HCl = 2CrCl3 + 4KCl + 9Cl2 + 14H2O
K2Cr2O7+FeCl2+HCl=CrCl3+KCl+FeCl3+H2OK2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 2KCl + 6FeCl3 + 7H2O
KOH (aq) + MgI2 = Mg(OH)2 (s) + KI (aq)2KOH(aq) + MgI2 = Mg(OH)2(s) + 2KI(aq)
K2C2O4+H2SO4+K2Cr2O7=K3Cr(C2O4)3+H2O+CO2+K2SO49K2C2O4 + 7H2SO4 + K2Cr2O7 = 2K3Cr(C2O4)3 + 7H2O + 6CO2 + 7K2SO4
K (s) + H2O (l) = KOH (aq) + H2 (g)=2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K3(PO4) +Al(Cl3) = Al(PO4) + KClK3(PO4) + Al(Cl3) = Al(PO4) + 3KCl
K2S2O8 + 4 NaI = 4 Na + 2 SO4 + 2 KI2K2S2O8 + 4NaI = 4Na + 2SO4 + 2KI2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCH3COO(aq) + HNO3(aq) =KNO3(aq) + CH3COOH(aq)KCH3COO(aq) + HNO3(aq) = KNO3(aq) + CH3COOH(aq)
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2CO3 + FeCl3 = KCl + Fe2 (CO3)33K2CO3 + 2FeCl3 = 6KCl + Fe2(CO3)3
KOH + ZnSO4 = K2SO4 + Zn(OH)22KOH + ZnSO4 = K2SO4 + Zn(OH)2
KAl(SO4)2(aq) + 4 NH4OH(aq) = Al(OH)3(s) + 2 (NH4)2SO4(aq) + KOH(aq)KAl(SO4)2(aq) + 4NH4OH(aq) = Al(OH)3(s) + 2(NH4)2SO4(aq) + KOH(aq)
KOH(aq) + H2SO4(aq) = K2SO4(aq) + H2O(l)2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l)
K3PO4(aq) + BaCl2(aq) = KCl(aq) + Ba3(PO4)2(s) 2K3PO4(aq) + 3BaCl2(aq) = 6KCl(aq) + Ba3(PO4)2(s)
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K+O2=K2O22K + O2 = K2O2
K+O2=K2O22K + O2 = K2O2
K 2 SO 3 (aq)+ MnCl 2 (aq)=MnSO 3 (s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K+Cl2=KCl2K + Cl2 = 2KCl
K+Cl2=KCl2K + Cl2 = 2KCl
KClO3(aq) = KCl(aq) + O2(g)2KClO3(aq) = 2KCl(aq) + 3O2(g)
KBr= K+BrKBr = K + Br
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K+Al+2SO4+12H2O=KAl(SO4)2*12H2OK + Al + 2SO4 + 12H2O = KAl(SO4)2*12H2O
KHCO3 + H3PO4=K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KMnO4 + NO + H2SO4 = HNO3 + K2SO4 + MnSO4 + H2O6KMnO4 + 10NO + 9H2SO4 = 10HNO3 + 3K2SO4 + 6MnSO4 + 4H2O
K3VO4 + FeCl2 + HCl = VOCl2 + FeCl3 + KCl + H2OK3VO4 + FeCl2 + 6HCl = VOCl2 + FeCl3 + 3KCl + 3H2O
K3VO4 + FeCl2 + HCl = VOCl2 + FeCl3 +KCl + H2OK3VO4 + FeCl2 + 6HCl = VOCl2 + FeCl3 + 3KCl + 3H2O
KMnO4+ZnO=K2O+Zn(MnO4)22KMnO4 + ZnO = K2O + Zn(MnO4)2
K + O2 = KO2K + O2 = KO2
KClO + ZnCl2 = KCl + Zn(ClO)22KClO + ZnCl2 = 2KCl + Zn(ClO)2
K3PO4+BaCl2=KCl+Ba3(PO4)22K3PO4 + 3BaCl2 = 6KCl + Ba3(PO4)2
KI+Br2=KBr2+I22KI + 2Br2 = 2KBr2 + I2
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KMNO4+C2H5OH+HCL=MNO2+CH3COOH+KCL+H2O4KMNO4 + 3C2H5OH + 4HCL = 4MNO2 + 3CH3COOH + 4KCL + 5H2O
KCIO3=KCI+KCIO44KCIO3 = KCI + 3KCIO4
K(s)  +  Cl2(g)  = KCl2K(s) + Cl2(g) = KCl2
KOH + H2O = H3O + K2O2KOH - H2O = 0H3O + K2O
KOH + H2O = H3O + K2O2KOH - H2O = 0H3O + K2O
KOH + H2O = H3O + K2O2KOH - H2O = 0H3O + K2O
KOH + H2O = H3O + K2O2KOH - H2O = 0H3O + K2O
KOH + H2O = H3O + K2O2KOH - H2O = 0H3O + K2O
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KClO3 =KCl + KClO44KClO3 = KCl + 3KClO4
K+O2 = K2O22K + O2 = K2O2
KClO3 (s)= KCl (s) + O2 (g)=2KClO3(s) = 2KCl(s) + 3O2(g)
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
K3PO4+BaCl2 = Ba3(PO4)2+KCl2K3PO4 + 3BaCl2 = Ba3(PO4)2 + 6KCl
KHCO3 + H3PO4=K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KCLO3+C12H22O11=KCL=CO2+H20130KCLO3 + 30C12H22O11 = 130KCL + 360CO2 + 33H20
KClO3(aq) = KCl(aq) + O2(g)2KClO3(aq) = 2KCl(aq) + 3O2(g)
KClO3 (s) = KClO4 (s) + KCl(s) 4KClO3(s) = 3KClO4(s) + KCl(s)
KClO3(aq) = KCl(aq) + O2(g)2KClO3(aq) = 2KCl(aq) + 3O2(g)
KCN + KMnO4 + H2O = MnO2 + KCNO + KOH3KCN + 2KMnO4 + H2O = 2MnO2 + 3KCNO + 2KOH
K+Cl2=KCl2K + Cl2 = 2KCl
KCN + KMnO4 + H2O = MnO2 + KCNO + KOH3KCN + 2KMnO4 + H2O = 2MnO2 + 3KCNO + 2KOH
K3VO4 + FeCl2 + HCl = VOCl2 + FeCl3 + KCl + H2OK3VO4 + FeCl2 + 6HCl = VOCl2 + FeCl3 + 3KCl + 3H2O
KMnO4 + KI + HCl = KCl + MnCl2 + I2 + H2O2KMnO4 + 10KI + 16HCl = 12KCl + 2MnCl2 + 5I2 + 8H2O
K + H2O = KOH +H22K + 2H2O = 2KOH + H2
K3VO4 + FeCl2 + HCl = VOCl2 + FeCl3 + KCl +H2OK3VO4 + FeCl2 + 6HCl = VOCl2 + FeCl3 + 3KCl + 3H2O
KCN + KMnO4 + H2O = MnO2 + KCNO + KOH3KCN + 2KMnO4 + H2O = 2MnO2 + 3KCNO + 2KOH
K+MgBr= KBr+ MgK + MgBr = KBr + Mg
K (s) + H2O (l) =KOH (aq) + H2 (g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KOH +HNO3 = KNO3 + H2OKOH + HNO3 = KNO3 + H2O
K3VO4+FeCl2+HCl=VOCl2+FeCl3+KCl+H2OK3VO4 + FeCl2 + 6HCl = VOCl2 + FeCl3 + 3KCl + 3H2O
K (s) + H2O (l) = KOH (aq) + H2 (g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KO2+CO2=K2CO3+O24KO2 + 2CO2 = 2K2CO3 + 3O2
KClO3 + C5H10O5 = KCl + H2O + CO210KClO3 + 3C5H10O5 = 10KCl + 15H2O + 15CO2
KOH + CuCl2 = Cu(OH)2 + KCl 2KOH + CuCl2 = Cu(OH)2 + 2KCl
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KCL+O2=KCLO32KCL + 3O2 = 2KCLO3
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K+H2O=KO2+H2K + 2H2O = KO2 + 2H2
K+Cl2=KCl2K + Cl2 = 2KCl
KMnO4 + Na2S2O3 + H2SO4 = K2SO4 + Na2S4O6 + MnO2 + H2O-2KMnO4 + Na2S2O3 + H2SO4 = -1K2SO4 + Na2S4O6 - 2MnO2 + H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
Kl + Pb(NO3)2= KlNO3 + Pb2Kl + Pb(NO3)2 = 2KlNO3 + Pb
K2SO4(aq)+Ba(OH)2(aq)=BaSO4(s)+KOH(aq)K2SO4(aq) + Ba(OH)2(aq) = BaSO4(s) + 2KOH(aq)
KC+LO4=KCL+O2KC + LO4 = KCL + 2O2
KMnO4 + C2H6O + H2SO4 = Mn(SO4)4 + K2SO4 + C2H4O2 + H2O4KMnO4 - C2H6O + 18H2SO4 = 4Mn(SO4)4 + 2K2SO4 - C2H4O2 + 17H2O
K2CrO4 + AgNO3 =Ag2CrO4 + KNO3K2CrO4 + 2AgNO3 = Ag2CrO4 + 2KNO3
K2CO3 + HBr = H2O + CO2 + KBrK2CO3 + 2HBr = H2O + CO2 + 2KBr
KNO3+H2O=KNO4+H2KNO3 + H2O = KNO4 + H2
KMg(SO4)ClH2O+AgNO3H2O=AgCl+KNO3+MgSO4+H2OKMg(SO4)ClH2O + AgNO3H2O = AgCl + KNO3 + MgSO4 + 2H2O
KMg(SO4)Cl+AgNO3=AgCl+KNO3+MgSO4KMg(SO4)Cl + AgNO3 = AgCl + KNO3 + MgSO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KHF2=KF+H2+F2KHF2 = 2KF + H2 + 2F
K2SO4 + BaCl2 = BaSO4 + KClK2SO4 + BaCl2 = BaSO4 + 2KCl
KF + HNO3 = KNO3 + HFKF + HNO3 = KNO3 + HF
K+O2=K2O4K + O2 = 2K2O
KI+Pb(NO3)2=K(NO3)2+PbIKI + Pb(NO3)2 = K(NO3)2 + PbI
KI+Pb(NO3)2=K(NO3)2+PbIKI + Pb(NO3)2 = K(NO3)2 + PbI
K2O + 2O2 = K2O42K2O + 3O2 = 2K2O4
K2O + O2 = K2O42K2O + 3O2 = 2K2O4
K + O2 = K2O 4K + O2 = 2K2O
K + O2 = K2O4K + O2 = 2K2O
KClO3 = O2 + KCl2KClO3 = 3O2 + 2KCl
KClO3 = O2 + KClO3KClO3 = 0O2 + KClO3
K2Cr2O7+H2SO4=K2SO4+Cr2(SO4)3+H2O+O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
K3PO4 + H2O = H3PO4 + KOH K3PO4 + 3H2O = H3PO4 + 3KOH
K3PO4(aq) + CaCl2(aq) = KCl(aq) + Ca3(PO4)2(s)2K3PO4(aq) + 3CaCl2(aq) = 6KCl(aq) + Ca3(PO4)2(s)
KBr(aq)+Cl2(aq)=KCl(aq)+Br2(l)2KBr(aq) + Cl2(aq) = 2KCl(aq) + Br2(l)
KClO3 + C5H10O5 = KCl + CO2 + H2O10KClO3 + 3C5H10O5 = 10KCl + 15CO2 + 15H2O
KOH + HI = KI + H2OKOH + HI = KI + H2O
K2SO4 + Pb(NO3)2 = KNO3 =PbSO4K2SO4 + Pb(NO3)2 = 2KNO3 + PbSO4
K2O+H2O=KOHK2O + H2O = 2KOH
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O(s) + H2O(l) = KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KClO3 = O2 +KCl2KClO3 = 3O2 + 2KCl
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KMnO4 + HBr = MnBr2 + KBr + H2O + Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
K2Cr2O7 + HCl = CrCl3 + KCl + H2O + Cl2K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 3Cl2
K2Cr2O7 (aq) + H2SO4(aq) + C2H6O(g) = Cr2(SO4)3(aq) + H2O(l) + C2H4O(g) + K2SO4(aq)K2Cr2O7(aq) + 4H2SO4(aq) + 3C2H6O(g) = Cr2(SO4)3(aq) + 7H2O(l) + 3C2H4O(g) + K2SO4(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI + Pb(NO3)2 = KNO3 + PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K (s) + H2O (l) = KOH (aq) + H2 (g) 2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K2SO4(aq)+BaCl2(aq)=BaSO4(s)+KCl(aq)K2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2KCl(aq)
K+F=KFK + F = KF
KOH+NiSO4=Ni(OH)2+K2SO42KOH + NiSO4 = Ni(OH)2 + K2SO4
KCLO4 = KCL + O2KCLO4 = KCL + 2O2
KCLO = KCL + O22KCLO = 2KCL + O2
K2SO4(aq)+BaCl2(aq)=KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
KBr(aq)+Cl2(aq)=KCl(aq)+Br2(l)2KBr(aq) + Cl2(aq) = 2KCl(aq) + Br2(l)
K2CO3 + Mn(NO3)2 = KNO3 + MnCO3K2CO3 + Mn(NO3)2 = 2KNO3 + MnCO3
K(s)+H2O(l)=KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KBr(aq)+Cl2(aq)=KCl(aq)+Br2(l)2KBr(aq) + Cl2(aq) = 2KCl(aq) + Br2(l)
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3 (aq) = KCl (aq) + O2 (g)2KClO3(aq) = 2KCl(aq) + 3O2(g)
KI(s) = K(s) + I(g)KI(s) = K(s) + I(g)
K2SO3 (aq) + MnCl2 (aq) = MnSO3 + KCl (aq)K2SO3(aq) + MnCl2(aq) = MnSO3 + 2KCl(aq)
K2SO3 (aq) + MnCl2 (aq) = MnSO3 + KCl (aq)K2SO3(aq) + MnCl2(aq) = MnSO3 + 2KCl(aq)
K2SO3 (aq) + MnCl2 (aq) = MnSO3 + KCl (aq)K2SO3(aq) + MnCl2(aq) = MnSO3 + 2KCl(aq)
K2CrO4 + Cu(NO3)2 = CuCrO4+ K2(NO3)2K2CrO4 + Cu(NO3)2 = CuCrO4 + K2(NO3)2
KOH+Co3(PO4)2=K3PO4+Co(OH)26KOH + Co3(PO4)2 = 2K3PO4 + 3Co(OH)2
KBr+Fe(OH)3=KOH+FeBr33KBr + Fe(OH)3 = 3KOH + FeBr3
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH + K4Fe(CN)6 + Ce(NO3)4 = Fe(OH)3 + Ce(OH)3 + K2CO3 + KNO3 + H2O258KOH + K4Fe(CN)6 + 61Ce(NO3)4 = Fe(OH)3 + 61Ce(OH)3 + 6K2CO3 + 250KNO3 + 36H2O
KCIO4=KCI+O2KCIO4 = KCI + 2O2
KAlSi3O8+CO2+H2O=Al2Si2O5(OH)4+H4SiO4+KHCO32KAlSi3O8 + 2CO2 + 11H2O = Al2Si2O5(OH)4 + 4H4SiO4 + 2KHCO3
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7+H20+S=SO2+KOH+Cr2O310K2Cr2O7 + H20 + 10S = 10SO2 + 20KOH + 10Cr2O3
KMnO4 + HCl = MnCl2 + Cl2 + H2O + KCl2KMnO4 + 16HCl = 2MnCl2 + 5Cl2 + 8H2O + 2KCl
KMnO4 + HCl = MnCl2 + Cl3 + H2O + KCl3KMnO4 + 24HCl = 3MnCl2 + 5Cl3 + 12H2O + 3KCl
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3(s)=KCl(s)+O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
KClO3(s)=KCl(s)+O(g)KClO3(s) = KCl(s) + 3O(g)
K2Cr2O7+KI+H2SO4=K2SO4+Cr2(SO4)3+I2+H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KCLO3 + C5H10O2 = KCL + CO2 + H2O13KCLO3 + 3C5H10O2 = 13KCL + 15CO2 + 15H2O
KI+Cl2=KCl+I22KI + Cl2 = 2KCl + I2
K 2O + H 2O = KOH K2O + H2O = 2KOH
K 2S 2O 3 + I 2 = K 2S 4O 6 + KI2K2S2O3 + I2 = K2S4O6 + 2KI
K4Fe(CN)6 + KMnO4 + H2SO4 = KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O 10K4Fe(CN)6 + 122KMnO4 + 299H2SO4 = 162KHSO4 + 5Fe2(SO4)3 + 122MnSO4 + 60HNO3 + 60CO2 + 188H2O
K4Fe(CN)6 + KMnO4 + H2SO4 = KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O 10K4Fe(CN)6 + 122KMnO4 + 299H2SO4 = 162KHSO4 + 5Fe2(SO4)3 + 122MnSO4 + 60HNO3 + 60CO2 + 188H2O
KIO3 + KI + H2SO4 = I2 + K2SO4 + H2OKIO3 + 5KI + 3H2SO4 = 3I2 + 3K2SO4 + 3H2O
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
K2SO4(aq)+BaCl2(aq)=KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2SO4 + MgCl2 = KCl + MgSO4K2SO4 + MgCl2 = 2KCl + MgSO4
KI + Cl2= KCl +I22KI + Cl2 = 2KCl + I2
KOH+Al(OH)3 = K3AlO3 + H2O3KOH + Al(OH)3 = K3AlO3 + 3H2O
KClO3+HBr=Br2+H2O+KClKClO3 + 6HBr = 3Br2 + 3H2O + KCl
KMnO4+H2SO3=MnSO4+K2SO4+H2SO4+H2O2KMnO4 + 5H2SO3 = 2MnSO4 + K2SO4 + 2H2SO4 + 3H2O
KMnO4+H2SO3=MnSO4+K2SO4+H2SO4+H2O2KMnO4 + 5H2SO3 = 2MnSO4 + K2SO4 + 2H2SO4 + 3H2O
K2MnO4+H2CO3= KMnO4+O2+H2O+K2CO34K2MnO4 + 2H2CO3 = 4KMnO4 - O2 + 2H2O + 2K2CO3
K2MnO4+H2CO3= KMnO4+O2+H2O+K2CO34K2MnO4 + 2H2CO3 = 4KMnO4 - O2 + 2H2O + 2K2CO3
KClO4=KCl+O2KClO4 = KCl + 2O2
KClO4=KCl+O2KClO4 = KCl + 2O2
K2CO3 +HCl=KCl +H2O + CO2K2CO3 + 2HCl = 2KCl + H2O + CO2
KOH+Mg(NO3)2=K(NO3)2+OHMgKOH + Mg(NO3)2 = K(NO3)2 + OHMg
KOH+Mg(NO3)2=K(NO3)2+OHMgKOH + Mg(NO3)2 = K(NO3)2 + OHMg
K+H2O=KOH+HK + H2O = KOH + H
K2SO4(aq)+BaCl2(aq)=KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KOH+CrCl3+Cl2=K2CrO4+KCl+H2O16KOH + 2CrCl3 + 3Cl2 = 2K2CrO4 + 12KCl + 8H2O
KBr(aq)+Cl2(aq)=KCl(aq)+Br2(l)2KBr(aq) + Cl2(aq) = 2KCl(aq) + Br2(l)
KOH + Al2O3 + H2O = KAl(OH)42KOH + Al2O3 + 3H2O = 2KAl(OH)4
KOH(aq) + ZnCl2(aq) = Zn(OH)2(s) + KCl(aq)2KOH(aq) + ZnCl2(aq) = Zn(OH)2(s) + 2KCl(aq)
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
KOH + Cl2= KCl + KClO3 + H2O6KOH + 3Cl2 = 5KCl + KClO3 + 3H2O
KI + Cl2 = KCl + I22KI + Cl2 = 2KCl + I2
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KHCO3 + H3PO4=K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
K2SO4 + BaSO4 = K2Ba + SO4SO4K2SO4 + BaSO4 = K2Ba + SO4SO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K 2 O(s)+ H 2 O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + C2H4 = KOH + MnO2 + CH4COOH + H2O-1KMnO4 - C2H4 = -1KOH - MnO2 - CH4COOH + H2O
K2Cr2O7 + H2SO4 + CH3CH2OH = K2SO4 + Cr2(SO4)3 + CH3COOH + H2O2K2Cr2O7 + 8H2SO4 + 3CH3CH2OH = 2K2SO4 + 2Cr2(SO4)3 + 3CH3COOH + 11H2O
K2CR2O7+H2O+S=KOH+CR2O3+SO22K2CR2O7 + 2H2O + 3S = 4KOH + 2CR2O3 + 3SO2
KMNO4+H2SO4+NA2SO3=K2SO4+MNSO4+NA2SO4+H2O2KMNO4 + 3H2SO4 + 5NA2SO3 = K2SO4 + 2MNSO4 + 5NA2SO4 + 3H2O
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KMnO4 + HCl = MnCl2 + Cl2 + KCl + H2O2KMnO4 + 16HCl = 2MnCl2 + 5Cl2 + 2KCl + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K 2 O(s)+ H 2 O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K 2 SO 3 (aq)+ MnCl 2 (aq) = MnSO 3 (s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KOH+Cl2=KClO3+KCl+H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KHF2= KF+H2+F22KHF2 = 2KF + H2 + F2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KHF2=2KF+H2+F22KHF2 = 2KF + H2 + F2
KOH + P2O5 = K3PO4 + H2O6KOH + P2O5 = 2K3PO4 + 3H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2CO3+C=CO+KK2CO3 + 2C = 3CO + 2K
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K + Br2 = KBr2K + Br2 = 2KBr
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KClO3 + H2SO4 = KHSO4 + O2 + ClO2 + H2O4KClO3 + 4H2SO4 = 4KHSO4 + O2 + 4ClO2 + 2H2O
K2SO4(aq) + Ba(NO3)2(aq) =BaSO4(s) + KNO3(aq) K2SO4(aq) + Ba(NO3)2(aq) = BaSO4(s) + 2KNO3(aq)
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KClO3+ HCl = KCl + H2O + Cl2KClO3 + 6HCl = KCl + 3H2O + 3Cl2
KClO3 + H2SO4 = KHSO4 + O2 + ClO2 + H2O4KClO3 + 4H2SO4 = 4KHSO4 + O2 + 4ClO2 + 2H2O
K(s)+H2O(l)=KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K2O(s)+H2O(l)=KOH(aq)(g)K2O(s) + H2O(l) = 2KOH(aq)(g)
KMnO4 + H2SO3 = K2SO4 + MnSO4 + H2SO4 + H2O2KMnO4 + 5H2SO3 = K2SO4 + 2MnSO4 + 2H2SO4 + 3H2O
KOH + SO2 = K2SO3 + H2O2KOH + SO2 = K2SO3 + H2O
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KO2 + H2O= KOH + O24KO2 + 2H2O = 4KOH + 3O2
KCl=K+Cl22KCl = 2K + Cl2
KClO3+HBr=KCl + H2O + Br2KClO3 + 6HBr = KCl + 3H2O + 3Br2
KMnO4+HCl=KCl+MnCl2+Cl2+H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
KMnO4+HCl=KCl+MnCl2+Cl2+H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
KI+H2SO4 = H2S+H2O+I2+K2SO48KI + 5H2SO4 = H2S + 4H2O + 4I2 + 4K2SO4
K3Fe(SCN)6 + Na2Cr2O7 + H2SO4 = Fe(NO3)3 + Cr2(SO4)3 + (Na2SO)4 + KNO3 + CO2 + H2OK3Fe(SCN)6 + 8Na2Cr2O7 + 26H2SO4 = Fe(NO3)3 + 8Cr2(SO4)3 + 2(Na2SO)4 + 3KNO3 + 6CO2 + 26H2O
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
K+MgBr=KBr+MgK + MgBr = KBr + Mg
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7+HCl = KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
KClO=KCl+KClO33KClO = 2KCl + KClO3
K2SO3+MnCl2=MnSO3+KClK2SO3 + MnCl2 = MnSO3 + 2KCl
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KI + Pb(NO3)2 = KNO3 +PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K3PO4 + HCl = KCl +H3PO4K3PO4 + 3HCl = 3KCl + H3PO4
KCIO3 = KCI + O22KCIO3 = 2KCI + 3O2
K2S + MgSO4 = K2SO4 + MgSK2S + MgSO4 = K2SO4 + MgS
KMnO4 + H2SO4 + NaHSO3 = H2O + K2SO4 + MnSO4 + Na2SO44KMnO4 + H2SO4 + 10NaHSO3 = 6H2O + 2K2SO4 + 4MnSO4 + 5Na2SO4
K2Cr2O2 + H2S +H3PO4 = K3PO4 + CrPO4 + S + H2O3K2Cr2O2 - 6H2S + 8H3PO4 = 2K3PO4 + 6CrPO4 - 6S + 6H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KHF2 = KF + H2 + F22KHF2 = 2KF + H2 + F2
KClO3 (s) = KCl (s) + O2 (g)2KClO3(s) = 2KCl(s) + 3O2(g)
K2CrO4 + NaNo2 = Na2CrO4 + KNo2K2CrO4 + 2NaNo2 = Na2CrO4 + 2KNo2
K2CrO4 + NaNo2 = Na2CrO4 + KNo2K2CrO4 + 2NaNo2 = Na2CrO4 + 2KNo2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KBr + KMnO4 + H2SO4 = Br2 + MnSO4 + K2SO4 + H2O10KBr + 2KMnO4 + 8H2SO4 = 5Br2 + 2MnSO4 + 6K2SO4 + 8H2O
K (s) + H2O (l) =KOH (aq) + H2 (g) 2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KClO3 + C = KCl + CO22KClO3 + 3C = 2KCl + 3CO2
KHCO3 + H3PO4 =K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KBr+Al(CIO4)3 = AlBr3 + KCIO43KBr + Al(CIO4)3 = AlBr3 + 3KCIO4
K2O + H2O = KOH K2O + H2O = 2KOH
K2CrO4 + Ba(NO3)2 = KNO3 + BaCrO4K2CrO4 + Ba(NO3)2 = 2KNO3 + BaCrO4
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K2Cr2O7 + H2SO3 + HCl = CrCl3 + KCl + H2SO4 + H2OK2Cr2O7 + 3H2SO3 + 8HCl = 2CrCl3 + 2KCl + 3H2SO4 + 4H2O
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KBr+Cl2=KCl+Br22KBr + Cl2 = 2KCl + Br2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KClO3 (s) =KClO (s) + O2 (g)KClO3(s) = KClO(s) + O2(g)
KMnO4 + H2SO4 = KHSO4 + MnSO4 + H2O + O24KMnO4 + 8H2SO4 = 4KHSO4 + 4MnSO4 + 6H2O + 5O2
KHF2 = KF+H2+F22KHF2 = 2KF + H2 + F2
KMnO4 + H2SO3 = K2SO4 + MnSO4 + H2SO4 + H2O2KMnO4 + 5H2SO3 = K2SO4 + 2MnSO4 + 2H2SO4 + 3H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2MnO4 + HCl = MnCl2 + Cl2 + KCl + H2OK2MnO4 + 8HCl = MnCl2 + 2Cl2 + 2KCl + 4H2O
KMnO4 + HCl = MnCl2 + Cl2 + KCl + H2O2KMnO4 + 16HCl = 2MnCl2 + 5Cl2 + 2KCl + 8H2O
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
K2Cr2O7+Sn+HCl=SnCl4+KCl+CrCl3+H2O2K2Cr2O7 + 3Sn + 28HCl = 3SnCl4 + 4KCl + 4CrCl3 + 14H2O
KF + KFO3 + H2O = F2 + KOH5KF + KFO3 + 3H2O = 3F2 + 6KOH
KMnO4+ H2C2O4+ H2S = K2S + MnS + CO2 + H2O2KMnO4 + 5H2C2O4 + 3H2S = K2S + 2MnS + 10CO2 + 8H2O
KOH+Cl2=KCl+KClO3+H2O6KOH + 3Cl2 = 5KCl + KClO3 + 3H2O
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2CO3(aq)+Al2Cl6(s)=Al2(CO3)3(aq)+KCl(aq)3K2CO3(aq) + Al2Cl6(s) = Al2(CO3)3(aq) + 6KCl(aq)
KI+Cl2=KCl+I22KI + Cl2 = 2KCl + I2
KMNO4+KNO2+KOH = K2MNO4+KNO3+H2O2KMNO4 + KNO2 + 2KOH = 2K2MNO4 + KNO3 + H2O
K2Cr2O7 + KBr + H2SO4 = Cr2(SO4)3 + Br2 + K2SO4 + H2OK2Cr2O7 + 6KBr + 7H2SO4 = Cr2(SO4)3 + 3Br2 + 4K2SO4 + 7H2O
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7 + H2C2O4 + HCl = CrCl3 + KCl + CO2 + H2OK2Cr2O7 + 3H2C2O4 + 8HCl = 2CrCl3 + 2KCl + 6CO2 + 7H2O
K+Cl=KClK + Cl = KCl
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KHCO3= KOH + CO2KHCO3 = KOH + CO2
KHCO3= KCHO2 + O22KHCO3 = 2KCHO2 + O2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2Cr2O7 + H2C2O4 + HCl = CrCl3 + KCl + CO2 + H2OK2Cr2O7 + 3H2C2O4 + 8HCl = 2CrCl3 + 2KCl + 6CO2 + 7H2O
K2Cr2O7 + HCl = CrCl3 + KCl + Cl2 + H2OK2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3Cl2 + 7H2O
K2SO4(aq)+BaCl2(aq) = KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
KMnO4=K2MnO4+MnO2+O22KMnO4 = K2MnO4 + MnO2 + O2
KI+H2O2=KOH + I22KI + H2O2 = 2KOH + I2
K2S+Cu2Br=K2Br+Cu2SK2S + Cu2Br = K2Br + Cu2S
KOH+Mg(NO3)2=K(NO3)+Mg(OH)22KOH + Mg(NO3)2 = 2K(NO3) + Mg(OH)2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KO2+FeCl2=Fe2O3+K+Cl23KO2 + 4FeCl2 = 2Fe2O3 + 3K + 4Cl2
KO2+FeCl2=Fe2O3+K+Cl3KO2 + 4FeCl2 = 2Fe2O3 + 3K + 8Cl
K2Cr2O7+KI+HCl=KCl+CrCl3+I2+H2OK2Cr2O7 + 6KI + 14HCl = 8KCl + 2CrCl3 + 3I2 + 7H2O
KOH(aq) + H2 SO4(aq) = K2 SO4(aq) +H2 O(l)2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l)
K + KNO3 = N2 + K2O10K + 2KNO3 = N2 + 6K2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O+H2O=KOHK2O + H2O = 2KOH
KOH(aq) + MgCl2(aq) = KCl(aq) + Mg(OH)2 (s)2KOH(aq) + MgCl2(aq) = 2KCl(aq) + Mg(OH)2(s)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KIO3+ KI+ HCl= I2+ KCl+ H2OKIO3 + 5KI + 6HCl = 3I2 + 6KCl + 3H2O
KCl + AgNO3 = KNO3 + AgClKCl + AgNO3 = KNO3 + AgCl
K2SO4(aq)+BaCl2(aq)=KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
K2O+H2O=KOHK2O + H2O = 2KOH
K2Cr2O7 + FeSO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + H2O K2Cr2O7 + 6FeSO4 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
K2SO4(aq)+BaCl2(aq)=KCl(aq)+BaSO4(s)K2SO4(aq) + BaCl2(aq) = 2KCl(aq) + BaSO4(s)
K2Cr2O7 + H2C2O4 + H2SO4 = K2SO4 + Cr2SO4 + CO2 + H2OK2Cr2O7 + 5H2C2O4 + 2H2SO4 = K2SO4 + Cr2SO4 + 10CO2 + 7H2O
KOH+H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2Cr2O7+H2SO4+SO4=K2SO4+Cr2(SO4)3+H2OK2Cr2O7 + 7H2SO4 - 3SO4 = K2SO4 + Cr2(SO4)3 + 7H2O
KOH + H2SO4=K2SO4 + H2O 2KOH + H2SO4 = K2SO4 + 2H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7 + Na2C2O4 + H2SO4 = K2SO4 + Cr2(SO4)3 + Na2SO4 + H2O + CO2 K2Cr2O7 + 3Na2C2O4 + 7H2SO4 = K2SO4 + Cr2(SO4)3 + 3Na2SO4 + 7H2O + 6CO2
K2Cr2O7+H2O2 +HCl=KCl+CrCl3+H2OK2Cr2O7 - 3H2O2 + 8HCl = 2KCl + 2CrCl3 + H2O
KO2+FeO=Fe2O3+K2O2KO2 + 6FeO = 3Fe2O3 + K2O
KO2+FeO=Fe2O3+KKO2 + 4FeO = 2Fe2O3 + K
KO2+FeO=Fe2O3+KOKO2 + 2FeO = Fe2O3 + KO
KO2+FeO=Fe2O3+KOKO2 + 2FeO = Fe2O3 + KO
K2PtCl4+2NH3=2KCl+Pt(NH3)2Cl2K2PtCl4 + 2NH3 = 2KCl + Pt(NH3)2Cl2
K + S = 2KSK + S = KS
K + S = KSK + S = KS
KBr + H3PO4 = KH2PO4 + HBr KBr + H3PO4 = KH2PO4 + HBr
KClO3(s) = KCl(s) + O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
K (s) + H2O (l) = KOH (aq) + H2 (g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2SO3=K2=SO3K2SO3 = K2 + SO3
KMnO4 + BiBr2 + H2SO4 = Br2 + MnSO4 + K2SO4 + Bi2(SO4)3 + H2O6KMnO4 + 10BiBr2 + 24H2SO4 = 10Br2 + 6MnSO4 + 3K2SO4 + 5Bi2(SO4)3 + 24H2O
K+H2O=KOH+H2O0K + H2O = 0KOH + H2O
KOH+MgSO4=Mg(OH)2+K2SO42KOH + MgSO4 = Mg(OH)2 + K2SO4
KI + Pb(NO3)2 = KNO3 + PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K2Cr2O7+C2H6O+H2SO4=Cr2(SO4)3+C2H4O+K2SO4+H2OK2Cr2O7 + 3C2H6O + 4H2SO4 = Cr2(SO4)3 + 3C2H4O + K2SO4 + 7H2O
KOH+HBr=KBr+H2OKOH + HBr = KBr + H2O
KBr+H2SO4+MnO2=KHSO4+MnSO4+H2O+Br2KBr + 3H2SO4 + MnO2 = 2KHSO4 + MnSO4 + 2H2O + 2Br
K2CO3 + C = CO + KK2CO3 + 2C = 3CO + 2K
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KIO3 + HCl + NaI = ICl + H2O + NaCl + KClKIO3 + 6HCl + 2NaI = 3ICl + 3H2O + 2NaCl + KCl
KHCO3 + H3PO4 = K2HPO4 + H2O + CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
KMnO4 + KClO2 + H2O = MnO2 + KClO4 + KOH4KMnO4 + 3KClO2 + 2H2O = 4MnO2 + 3KClO4 + 4KOH
K+O2+S=K2SO34K + 3O2 + 2S = 2K2SO3
K2CO3 + H3PO4 = H2O + CO2 + K3PO43K2CO3 + 2H3PO4 = 3H2O + 3CO2 + 2K3PO4
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KHF2 = KF + H2 + F22KHF2 = 2KF + H2 + F2
K2Cr2O7+H2SO4+C = Cr2(SO4)3+CO2+H2O+K2SO42K2Cr2O7 + 8H2SO4 + 3C = 2Cr2(SO4)3 + 3CO2 + 8H2O + 2K2SO4
K(MnO4)+H2S+HCl=Mn(Cl)+S+K(Cl)+H2OK(MnO4) + 3H2S + 2HCl = Mn(Cl) + 3S + K(Cl) + 4H2O
K2Cr2O7+SnCl2+HCl=CrCl3+SnCl4+KCl+H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KMnO4+FeO=K2O+MnO+Fe2O32KMnO4 + 10FeO = K2O + 2MnO + 5Fe2O3
KMnO4+FeO=K2O+MnO+Fe2O32KMnO4 + 10FeO = K2O + 2MnO + 5Fe2O3
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3 = KCl+O22KClO3 = 2KCl + 3O2
KI+5H2SO4=K2SO4+H2S+I2+H2020KI + 10H2SO4 = 10K2SO4 + 0H2S + 10I2 + H20
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+HCl=MnCl2+KCl+Cl2+H2O2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O
KCIO4=KCI+O2KCIO4 = KCI + 2O2
KI + H2SO4 = K2SO4 + H2S + I2 + H2O8KI + 5H2SO4 = 4K2SO4 + H2S + 4I2 + 4H2O
KHCO3=K2CO3+H2O+CO22KHCO3 = K2CO3 + H2O + CO2
KHCO3+H3PO4=K2HPO4+H2O+CO22KHCO3 + H3PO4 = K2HPO4 + 2H2O + 2CO2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7 + H2SO4 + KNO2 = K2SO4 + Cr2(SO4)3 + H2O + KNO3K2Cr2O7 + 4H2SO4 + 3KNO2 = K2SO4 + Cr2(SO4)3 + 4H2O + 3KNO3
K2O+H2O=KOHK2O + H2O = 2KOH
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KCl + Fe2(SO4)3 = K2SO4 + FeCl36KCl + Fe2(SO4)3 = 3K2SO4 + 2FeCl3
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KI + KMnO4 + H2SO4 = K2SO4 + MnSO4 + I2 + H2O10KI + 2KMnO4 + 8H2SO4 = 6K2SO4 + 2MnSO4 + 5I2 + 8H2O
KI+KMnO4+H2SO4=K2SO4+MnSO4+I2+H2O10KI + 2KMnO4 + 8H2SO4 = 6K2SO4 + 2MnSO4 + 5I2 + 8H2O
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
K3AsO4 + CaCO3 = Ca3(AsO4)2 + K2CO32K3AsO4 + 3CaCO3 = Ca3(AsO4)2 + 3K2CO3
K2Cr2O7 +S8 = Cr2O3 + SO2 + K2O16K2Cr2O7 + 3S8 = 16Cr2O3 + 24SO2 + 16K2O
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KMnO4 + H2C2O4 +H2SO4 = K2SO4 + MnSO4 + CO2 + H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = K2SO4 + 2MnSO4 + 10CO2 + 8H2O
KBrO3 + Fe(NO3)2 + HNO3 = KBr + Fe(NO3)3 + H2OKBrO3 + 6Fe(NO3)2 + 6HNO3 = KBr + 6Fe(NO3)3 + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + H2C2O4 +H2SO4 = K2SO4 + MnSO4 + CO2 + H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = K2SO4 + 2MnSO4 + 10CO2 + 8H2O
KI + KClO3 + H2SO4 = K2SO4 + I2 + KCl + H2O6KI + KClO3 + 3H2SO4 = 3K2SO4 + 3I2 + KCl + 3H2O
K2Cr2O7 + KI + H2SO4 = Cr2(SO4) 3 + I2 + K2SO4 + H2OK2Cr2O7 + 6KI + 7H2SO4 = Cr2(SO4)3 + 3I2 + 4K2SO4 + 7H2O
KOH + Cl2 = KCl + KClO3 + H2O6KOH + 3Cl2 = 5KCl + KClO3 + 3H2O
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KClO3 + C = KCl + CO22KClO3 + 3C = 2KCl + 3CO2
K3PO4+HC1=KC1+H3PO4K3PO4 + 3HC1 = 3KC1 + H3PO4
KC1O3=KC1+O22KC1O3 = 2KC1 + 3O2
KI+C1=KC1+I22KI + 2C1 = 2KC1 + I2
K2Cr2O7(aq) + 3SnCl2(aq) + 14HCl(aq)=2CrCl3 (aq) + 3SnCl4(aq) +7H2O (l) + 2KCl (aq)K2Cr2O7(aq) + 3SnCl2(aq) + 14HCl(aq) = 2CrCl3(aq) + 3SnCl4(aq) + 7H2O(l) + 2KCl(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
K2SO3 + KMnO4 + KHSO4 = K2SO4 + MnSO4 + H2O5K2SO3 + 2KMnO4 + 6KHSO4 = 9K2SO4 + 2MnSO4 + 3H2O
K2Cr2O7 + NaNO2 +H2SO4 = Cr2(SO4)3 + K2SO4 + NaNO3 + H2OK2Cr2O7 + 3NaNO2 + 4H2SO4 = Cr2(SO4)3 + K2SO4 + 3NaNO3 + 4H2O
KMnO4 + HNO2 + H2SO4 = K2SO4 + MnSO4 + HNO3 +H2O2KMnO4 + 5HNO2 + 3H2SO4 = K2SO4 + 2MnSO4 + 5HNO3 + 3H2O
K (s) + H2O (l) = KOH (aq) + H2 (g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KMnO4 + H2C2O4 + H2SO4 = K2SO4 + MnSO4 + CO2 + H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = K2SO4 + 2MnSO4 + 10CO2 + 8H2O
K (s) + H2O (l) = KOH (aq) + H2 (g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K (s) + H2O (l) = KOH (aq) + H2 (g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K4Fe(CN)6 + KMnO4 + H2SO4 = KHSO4 + Fe2(SO4)3 + MnSO4 + HNO3 + CO2 + H2O10K4Fe(CN)6 + 122KMnO4 + 299H2SO4 = 162KHSO4 + 5Fe2(SO4)3 + 122MnSO4 + 60HNO3 + 60CO2 + 188H2O
K3Fe(SCN)6 + Na2Cr2O7 + H2SO4 = Fe(NO3)3 + Cr2(SO4)3 + CO2 + H2O + Na2SO4 + KNO3K3Fe(SCN)6 + 16Na2Cr2O7 + 58H2SO4 = Fe(NO3)3 + 16Cr2(SO4)3 + 6CO2 + 58H2O + 16Na2SO4 + 3KNO3
K + N2 = K3N6K + N2 = 2K3N
KClO4 = KCl +O2KClO4 = KCl + 2O2
K2O+H2O=KOHK2O + H2O = 2KOH
KMnO4+SnCl2+H2O+KCl=SnCl4+MnO2+KOH2KMnO4 + 3SnCl2 + 4H2O + 6KCl = 3SnCl4 + 2MnO2 + 8KOH

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.