Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KCrO2+Br2+KOH=K2CrO4+KBr+H2O2KCrO2 + 3Br2 + 8KOH = 2K2CrO4 + 6KBr + 4H2O
K + N2 = KN2K + N2 = 2KN
K + N = KNK + N = KN
KOH + H3AsO4 = K2HAsO4 + H2O2KOH + H3AsO4 = K2HAsO4 + 2H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KClO3 + H2SO4 = KHSO4 + O2 + ClO2 + H2O4KClO3 + 4H2SO4 = 4KHSO4 + O2 + 4ClO2 + 2H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2CrO7 + FeSO4 + H2SO4 = K2SO4 + Fe2(SO4)3 + Cr2(SO4)3 + H2O2K2CrO7 + 18FeSO4 + 14H2SO4 = 2K2SO4 + 9Fe2(SO4)3 + Cr2(SO4)3 + 14H2O
KClO3= KCl + O2 2KClO3 = 2KCl + 3O2
K3PO4+MgCl2=Mg3(PO4)2+KCl2K3PO4 + 3MgCl2 = Mg3(PO4)2 + 6KCl
K2S2O3 + I2 = K2S4O6 + KI2K2S2O3 + I2 = K2S4O6 + 2KI
K3PO4+MgCl2=Mg3(PO4)2+KCl2K3PO4 + 3MgCl2 = Mg3(PO4)2 + 6KCl
K+F2= KF2K + F2 = 2KF
KOH + Cl2 = ClK + KClO3 + H2060KOH + 30Cl2 = 40ClK + 20KClO3 + 3H20
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
K2SO4+BaCl2=BaSO4+KClK2SO4 + BaCl2 = BaSO4 + 2KCl
KIO3 = KI + O22KIO3 = 2KI + 3O2
K(s) + H2O(l) = KOH(aq) + H2(g) 2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K2Cr2O7 + SnCl2 + HCl = CrCl3 + KCl + H2O + SnCl4K2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 3SnCl4
K2Cr2O7 + FeCl + HCl = CrCl3 + FeCl3 + KCl + H2OK2Cr2O7 + 3FeCl + 14HCl = 2CrCl3 + 3FeCl3 + 2KCl + 7H2O
K2Cr2O7+FeCl2+HCl=CrCl3+FeCl3+KCl+H2OK2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2KCl + 7H2O
K2Cr2O7 + 3FeCl2 + HCl = 2CrCl3 + FeCl3 + 2KCl + H2OK2Cr2O7 + 6FeCl2 + 14HCl = 2CrCl3 + 6FeCl3 + 2KCl + 7H2O
KI+Br2=KBr+I22KI + Br2 = 2KBr + I2
K3PO4+BaCl2=KCl+Ba3(PO4)22K3PO4 + 3BaCl2 = 6KCl + Ba3(PO4)2
KOH + NiCl2 = Ni(OH)2 + KCl2KOH + NiCl2 = Ni(OH)2 + 2KCl
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KClO4= KCl+OKClO4 = KCl + 4O
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KClO3 + HBr = KCl + H2O + Br2KClO3 + 6HBr = KCl + 3H2O + 3Br2
KClO3 + HBr = KCl + H2O + Br2KClO3 + 6HBr = KCl + 3H2O + 3Br2
K3PO4 + MgSO4 = Mg3(PO4)2 + K2SO42K3PO4 + 3MgSO4 = Mg3(PO4)2 + 3K2SO4
KBr + Pb(NO3)2 = KNO3 + PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI + Pb (NO3) 2 = KNO3 +PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K3PO4 + HCl =KCl +H3PO4K3PO4 + 3HCl = 3KCl + H3PO4
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7 + KI + H2SO4 = K2SO4 + Cr2 (SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K4Fe(CN)6 + H2SO4 + H2O = K2SO4 + FeSO4 + (NH4)2SO4 + COK4Fe(CN)6 + 6H2SO4 + 6H2O = 2K2SO4 + FeSO4 + 3(NH4)2SO4 + 6CO
KI+H2SO4=KHSO4+I2+S+H2O6KI + 7H2SO4 = 6KHSO4 + 3I2 + S + 4H2O
KI+H2SO4=KHSO4+I2+S+H2O6KI + 7H2SO4 = 6KHSO4 + 3I2 + S + 4H2O
K2O+H2O=KOHK2O + H2O = 2KOH
KBr+H2SO4=K2SO4+Br2+H2O+SO22KBr + 2H2SO4 = K2SO4 + Br2 + 2H2O + SO2
KBrO3 + 5KBr + 3H2SO4 = 3K2SO4 + 3Br2 +3H2OKBrO3 + 5KBr + 3H2SO4 = 3K2SO4 + 3Br2 + 3H2O
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K3PO4+MgCl2=MgPO4+K3Cl2K3PO4 + MgCl2 = MgPO4 + K3Cl2
K2O2+2K=2K2OK2O2 + 2K = 2K2O
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KOH + MgSO4 = Mg(OH)2 + K2SO42KOH + MgSO4 = Mg(OH)2 + K2SO4
KI + Pb(NO3)2 = KNO3 + PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K2Cr2O7+H2O2+NaOH=KOH+Na2CrO4+H2OK2Cr2O7 + 0H2O2 + 4NaOH = 2KOH + 2Na2CrO4 + H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KCI + H2 = HCI + K2KCI + H2 = 2HCI + 2K
KNO3(s)=KNO2(s)+O2(g)2KNO3(s) = 2KNO2(s) + O2(g)
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7+KI+HNO3 = KNO3+Cr(NO3)3+I2+H2OK2Cr2O7 + 6KI + 14HNO3 = 8KNO3 + 2Cr(NO3)3 + 3I2 + 7H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O+H2O=KOHK2O + H2O = 2KOH
KOH = K+ + OH-KOH = K+ + OH-
KMnO4=K2O+MnO+O24KMnO4 = 2K2O + 4MnO + 5O2
KI + H2SO4= K2SO4 + I2 +H2S +H2020KI + 10H2SO4 = 10K2SO4 + 10I2 + 0H2S + H20
KI + H2SO4= K2SO4 + I2 +H2S +H20 20KI + 10H2SO4 = 10K2SO4 + 10I2 + 0H2S + H20
Kl+Pb(NO3)2=NO3+PbKl22Kl + Pb(NO3)2 = 2NO3 + PbKl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KHSO4 + KOH = K2SO4 + H2OKHSO4 + KOH = K2SO4 + H2O
KCl+AgNO3=KNO3+AgClKCl + AgNO3 = KNO3 + AgCl
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KOH+Cr(NO3)3=Cr(OH)3+KNO33KOH + Cr(NO3)3 = Cr(OH)3 + 3KNO3
KCN(aq) + HBr(aq) = KBr(aq) + HCN(aq)KCN(aq) + HBr(aq) = KBr(aq) + HCN(aq)
KCN(aq) + HBr(aq) = KBr(aq) + HCN(aq)KCN(aq) + HBr(aq) = KBr(aq) + HCN(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2 2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI+F2=KF+I22KI + F2 = 2KF + I2
K2SO3 + KMnO4 + HCl = K2SO4 + MnCl2 + H2O + KCl5K2SO3 + 2KMnO4 + 6HCl = 5K2SO4 + 2MnCl2 + 3H2O + 2KCl
KOH + Cr(NO3)3 = Cr(OH)3 +KNO33KOH + Cr(NO3)3 = Cr(OH)3 + 3KNO3
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s) + H2O(l) = KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K+H2O = KOH + H22K + 2H2O = 2KOH + H2
KOH + 2H3PO4= K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KNO3(s) = KNO2(s) + O2(g)2KNO3(s) = 2KNO2(s) + O2(g)
KClO3+P4=P4O10+KCl10KClO3 + 3P4 = 3P4O10 + 10KCl
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2SO4+Pb(NO3)2=KNO3+PbSO4K2SO4 + Pb(NO3)2 = 2KNO3 + PbSO4
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2SO3 + KMnO4 + HCl = K2SO4 + MnCl2 + H2O + KCl5K2SO3 + 2KMnO4 + 6HCl = 5K2SO4 + 2MnCl2 + 3H2O + 2KCl
KHCO3 + H2O = H2CO3 + KOHKHCO3 + H2O = H2CO3 + KOH
KMnO4 + H2SO4 + NaNO2 = K2SO4 + NaNO +MnSO +H2O2KMnO4 + 3H2SO4 - 11NaNO2 = K2SO4 - 11NaNO + 2MnSO + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7 + HCl = Cl2 + CrCl3 + H2O + KClK2Cr2O7 + 14HCl = 3Cl2 + 2CrCl3 + 7H2O + 2KCl
K2CrO4 + K2SO3 + H20 = Cr(OH)3 + K2SO4+ KOH4K2CrO4 - 4K2SO3 + H20 = 4Cr(OH)3 - 4K2SO4 + 8KOH
KOH(s)+KH2PO4(aq)=K3PO4(aq)+H2O(l)2KOH(s) + KH2PO4(aq) = K3PO4(aq) + 2H2O(l)
K2SO4(aq)+BaCl2(aq)=BaSO4(s)+KCl(aq)K2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2KCl(aq)
K2Cr2O7+H2O+S=SO2+KOH+Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
KO2 + H2O = O2 + KOH4KO2 + 2H2O = 3O2 + 4KOH
K2Cr2OH+H2SO4=K2SO4+Cr2(SO4)3+H2O+O2-4K2Cr2OH - 16H2SO4 = -4K2SO4 - 4Cr2(SO4)3 - 18H2O + 7O2
K2Cr2OH+HCl=KCl+CrCl2+H2O+Cl-1K2Cr2OH - HCl = -2KCl - 2CrCl2 - H2O + 5Cl
KCl+H2O = KOH+HClKCl + H2O = KOH + HCl
KCr2O7 + S = SO4 + Cr + K4KCr2O7 + 7S = 7SO4 + 8Cr + 4K
KOH + MgCl2 = KCl2 + MgOHKOH + MgCl2 = KCl2 + MgOH
KAl(SO4)2 (aq) + NH4OH(aq) = Al(OH)3(s) + (NH4)2SO4(aq) + KOH(aq)KAl(SO4)2(aq) + 4NH4OH(aq) = Al(OH)3(s) + 2(NH4)2SO4(aq) + KOH(aq)
K2SO3 + KMnO4 + HCl = K2SO4 + MnCl2 + H2O + KCl5K2SO3 + 2KMnO4 + 6HCl = 5K2SO4 + 2MnCl2 + 3H2O + 2KCl
K2O + H2O = KOHK2O + H2O = 2KOH
K2SO3 + KMnO4 + HCl = K2SO4 + MnCl2 + H2O + KCl5K2SO3 + 2KMnO4 + 6HCl = 5K2SO4 + 2MnCl2 + 3H2O + 2KCl
K2SO3 + KMnO4 + HCl = K2SO4 + MnCl2 + H2O + KCl5K2SO3 + 2KMnO4 + 6HCl = 5K2SO4 + 2MnCl2 + 3H2O + 2KCl
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K+Cl2=KCl2K + Cl2 = 2KCl
KOH + Fe(NO3)3 = KNO3 + Fe(OH)33KOH + Fe(NO3)3 = 3KNO3 + Fe(OH)3
K2SO3 + KMnO4 + HCl = K2SO4 + MnCl2 + H20 +KCl80K2SO3 + 20KMnO4 + 60HCl = 80K2SO4 + 20MnCl2 + 3H20 + 20KCl
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K(OH)+H3(PO4)=K3(PO4)+H2O3K(OH) + H3(PO4) = K3(PO4) + 3H2O
K2SO4(aq)+2AgNO3(aq)=Ag2SO4(s)+KNO3(aq)K2SO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + 2KNO3(aq)
KOH + FeCl3 = KCl + Fe( OH )33KOH + FeCl3 = 3KCl + Fe(OH)3
K2Br + PbNO3 = PbBr + K2NO3K2Br + PbNO3 = PbBr + K2NO3
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KAl(SO4)2 (aq) + NH4OH(aq) = Al(OH)3(s) + (NH4)2SO4(aq) + KOH(aq)KAl(SO4)2(aq) + 4NH4OH(aq) = Al(OH)3(s) + 2(NH4)2SO4(aq) + KOH(aq)
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH + FeCl3 = KCl + Fe( OH )33KOH + FeCl3 = 3KCl + Fe(OH)3
KMnO4 + NaHSO3 = H2O + K2SO4 + MnO2 + Na2SO4 + NaHSO42KMnO4 + 3NaHSO3 = H2O + K2SO4 + 2MnO2 + Na2SO4 + NaHSO4
KMnO4 + NaHSO3 = KHSO3 + NaMnO4KMnO4 + NaHSO3 = KHSO3 + NaMnO4
KMnO4 + NaOH + NaHSO3 = K2SO4 + Na2MnO4+ H2O2KMnO4 + 3NaOH + NaHSO3 = K2SO4 + 2Na2MnO4 + 2H2O
KOH + H3PO4 = H2O + P + K 5KOH - H3PO4 = H2O - P + 5K
KOH + H3PO4 = H2O + P + K 5KOH - H3PO4 = H2O - P + 5K
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq) K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq) K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KOH=K2O+H2O2KOH = K2O + H2O
KO2+CO2=K2CO3+O24KO2 + 2CO2 = 2K2CO3 + 3O2
K+O2=KO2K + O2 = KO2
KOH + NiSO4 = K2SO4 +Ni(OH)22KOH + NiSO4 = K2SO4 + Ni(OH)2
KOH + NiSO4 = K2SO4 +Ni(OH)22KOH + NiSO4 = K2SO4 + Ni(OH)2
KOH + NiSO4 = KSO4 + NiOHKOH + NiSO4 = KSO4 + NiOH
KOH + NiSO4 = KSO4 + NiOHKOH + NiSO4 = KSO4 + NiOH
KOH + NiSO4 = KSO4 + NiOHKOH + NiSO4 = KSO4 + NiOH
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K + S = K2S2K + S = K2S
K2O+H2O=KOHK2O + H2O = 2KOH
KClO3=KClO4+KCl4KClO3 = 3KClO4 + KCl
KMnO4+H2C2O4+H2SO4=MnSO4+CO2+K2SO4+H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = 2MnSO4 + 10CO2 + K2SO4 + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4 + C3H5 (OH)3 = K2CO3 + Mn2O3 + CO2 + H2O 14KMnO4 + 4C3H5(OH)3 = 7K2CO3 + 7Mn2O3 + 5CO2 + 16H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2Cr2O7+AlI3+H2SO4=Cr2(SO4)3+K2SO4+Al2(SO4)3+H2O+I2K2Cr2O7 + 2AlI3 + 7H2SO4 = Cr2(SO4)3 + K2SO4 + Al2(SO4)3 + 7H2O + 3I2
K 2 O(s)+H 2 O(l)=KOH(aq) K2O(s) + H2O(l) = 2KOH(aq)
KMnO4+AlCl3+H2SO4=Al2(SO4)3+K2SO4+MnSO4+H2O+Cl6KMnO4 + 10AlCl3 + 24H2SO4 = 5Al2(SO4)3 + 3K2SO4 + 6MnSO4 + 24H2O + 30Cl
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KNO3 + C = CO2 + NO2 +K2O4KNO3 + C = CO2 + 4NO2 + 2K2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7+KI+HNO3 = KNO3+Cr(NO3)3+I2+H2OK2Cr2O7 + 6KI + 14HNO3 = 8KNO3 + 2Cr(NO3)3 + 3I2 + 7H2O
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KO+H=KOHKO + H = KOH
KMnO4 + NaHSO3 = KHSO3 + NaMnO4KMnO4 + NaHSO3 = KHSO3 + NaMnO4
KMnO4 + H2SO4 + NaHSO3 = MnSO4 + K2SO4 + Na2SO4 + H2O4KMnO4 + H2SO4 + 10NaHSO3 = 4MnSO4 + 2K2SO4 + 5Na2SO4 + 6H2O
KMnO4 + NaHSO3 = KHSO3 + NaMnO4KMnO4 + NaHSO3 = KHSO3 + NaMnO4
KMnO4 + NaOH + NaHSO3 = K2SO4 + Na2MnO4+ H2O2KMnO4 + 3NaOH + NaHSO3 = K2SO4 + 2Na2MnO4 + 2H2O
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2CO3+HCl=KCl+H2O+CO2K2CO3 + 2HCl = 2KCl + H2O + CO2
KOH+Co3(PO4)2=K3PO4+Co(OH)26KOH + Co3(PO4)2 = 2K3PO4 + 3Co(OH)2
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KBr+Fe(OH)3=KOH+FeBr33KBr + Fe(OH)3 = 3KOH + FeBr3
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
K2SO4(aq)+BaCl2(aq)=BaSO4(s)+KCl(aq)K2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2KCl(aq)
K2Cr2O7+H2O+S=SO2+KOH+Cr2O32K2Cr2O7 + 2H2O + 3S = 3SO2 + 4KOH + 2Cr2O3
K+H2O=H2+KOH2K + 2H2O = H2 + 2KOH
K+H2O=H2+K2O2K + H2O = H2 + K2O
KNO3 + Mg = KNO2 + MgO22KNO3 + Mg = 2KNO2 + MgO2
KNO3 + C12H22O11 = KNO2 +CO2 = H20130KNO3 + 10C12H22O11 = 130KNO2 + 120CO2 + 11H20
KNO3 +Al = KNO2 AlOKNO3 + Al = KNO2AlO
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K+Cl=KClK + Cl = KCl
K+MgBr2=KBr+Mg2K + MgBr2 = 2KBr + Mg
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KClO3+HI+H2SO4=KHSO4+HCl+I2+H2OKClO3 + 6HI + H2SO4 = KHSO4 + HCl + 3I2 + 3H2O
K2Cr2O7+H2S+HCl=KCl+CrCl3+H2O+SK2Cr2O7 + 3H2S + 8HCl = 2KCl + 2CrCl3 + 7H2O + 3S
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3 = KCl + OKClO3 = KCl + 3O
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4 + H = K + Mn+ H2OKMnO4 + 8H = K + Mn + 4H2O
K2Cr2O7+HCl+Zn = CrCl3+ZnCl2+KCl+H2OK2Cr2O7 + 14HCl + 3Zn = 2CrCl3 + 3ZnCl2 + 2KCl + 7H2O
K2Cr2O7 + FeSO4 + H2SO4 = Cr2(SO4)3 + Fe(SO4)3 + K2SO4 + H2O2K2Cr2O7 + 3FeSO4 + 14H2SO4 = 2Cr2(SO4)3 + 3Fe(SO4)3 + 2K2SO4 + 14H2O
K2Cr2O7 + FeSO4 + H2SO4 = Cr2(SO4)3 + Fe(SO4)3 + K2SO4 + H2O2K2Cr2O7 + 3FeSO4 + 14H2SO4 = 2Cr2(SO4)3 + 3Fe(SO4)3 + 2K2SO4 + 14H2O
K2CO3 + H3PO =K3PO+H2O+CO23K2CO3 + 2H3PO = 2K3PO + 3H2O + 3CO2
K(s) + Br2(g) =KBr(s)2K(s) + Br2(g) = 2KBr(s)
K(s) + Br2(g) =KBr(s)2K(s) + Br2(g) = 2KBr(s)
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KClO3 + C12H22O11 = CO2 + KClO2 +H2O24KClO3 + C12H22O11 = 12CO2 + 24KClO2 + 11H2O
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4+SO2+H2O=K2SO4+MnSO4+H2SO42KMnO4 + 5SO2 + 2H2O = K2SO4 + 2MnSO4 + 2H2SO4
K2Cr2O7+HCl=KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KMnO4+SO2+H2O=K2SO4+MnSO4+H2SO42KMnO4 + 5SO2 + 2H2O = K2SO4 + 2MnSO4 + 2H2SO4
KIO4+KI+HCl = KCl +I2+H2OKIO4 + 7KI + 8HCl = 8KCl + 4I2 + 4H2O
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2CO3+CaCl2=CaCO3+KClK2CO3 + CaCl2 = CaCO3 + 2KCl
K+H2O= KOH+H22K + 2H2O = 2KOH + H2
K(s)+H2O(l) = KOH(aq) + H2(g) 2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
K2O(s) + HI(aq) = H2O(l) + KI(aq)K2O(s) + 2HI(aq) = H2O(l) + 2KI(aq)
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KOH + H2C6H6O6 = KHC6H6O6 + H2OKOH + H2C6H6O6 = KHC6H6O6 + H2O
KClO3 + Mg = KClO +MgOKClO3 + 2Mg = KClO + 2MgO
K2Mn2O7+HCl+KSCN=MnCl2+KCl+CO2+SO2+NO+H2O11K2Mn2O7 + 74HCl + 8KSCN = 22MnCl2 + 30KCl + 8CO2 + 8SO2 + 8NO + 37H2O
KOH+Cl2=KClO3+KCl+H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
K2CrO4 + Ba=BaCrO4+ KK2CrO4 + Ba = BaCrO4 + 2K
KCIO3(s)= KCIO(s) +O2(g)KCIO3(s) = KCIO(s) + O2(g)
KCIO3(s)= KCI(s) +O2(g)2KCIO3(s) = 2KCI(s) + 3O2(g)
KCIO3(s)= KCIO(s) +O2(g)KCIO3(s) = KCIO(s) + O2(g)
KCIO3(s)= KCIO2(s) +O2(g)2KCIO3(s) = 2KCIO2(s) + O2(g)
KCIO3(s)= KCIO2(s) +O2(g)2KCIO3(s) = 2KCIO2(s) + O2(g)
K2MnO4+H2C2O4+H2SO4=MnSO4+K2SO4+CO2+H2OK2MnO4 + 2H2C2O4 + 2H2SO4 = MnSO4 + K2SO4 + 4CO2 + 4H2O
KMnO4+FeSO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
KMnO4+FeSO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
KMnO4+FeSO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
KOH+Ni(NO3)2=KNO3+Ni(OH)22KOH + Ni(NO3)2 = 2KNO3 + Ni(OH)2
KOH+Cl2=KClO3+KCl+H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KOH+Cl2=HClO3+KCl+H2O5KOH + 3Cl2 = HClO3 + 5KCl + 2H2O
KOH+Cl2=HCl3+KCl+H2OKOH - Cl2 = -1HCl3 + KCl + H2O
KClO3-(s) + HBr(aq) = Br2(l) + H2O(aq) + KClO3-(aq)KClO3-(s) + 0HBr(aq) = 0Br2(l) + 0H2O(aq) + KClO3-(aq)
KClO3(s) + HBr(aq) = Br2(l) + H2O(aq) + KClO3(aq)KClO3(s) + 0HBr(aq) = 0Br2(l) + 0H2O(aq) + KClO3(aq)
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O + H2O = KOHK2O + H2O = 2KOH
KI + Cl2 = KCl + I22KI + Cl2 = 2KCl + I2
K2CO3 + H2SO4 =K2SO4 +CO2 +H2OK2CO3 + H2SO4 = K2SO4 + CO2 + H2O
K2CO3 + H2SO4 =K2SO4 +CO2 +H2OK2CO3 + H2SO4 = K2SO4 + CO2 + H2O
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KMN04+HCL= KCL+MNCL2+HCL0KMN04 + HCL = 0KCL + 0MNCL2 + HCL
K2SO4 +CaI2=CaSO4+ KIK2SO4 + CaI2 = CaSO4 + 2KI
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
K2SO4 + Pb(NO3)2 = KNO3 + PbSO4K2SO4 + Pb(NO3)2 = 2KNO3 + PbSO4
K2O+H2O=KOHK2O + H2O = 2KOH
KClO3+H2SO4=KHSO4+O2+ClO2+H2O4KClO3 + 4H2SO4 = 4KHSO4 + O2 + 4ClO2 + 2H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KOH+CuSO4= Cu(OH)2+K2SO42KOH + CuSO4 = Cu(OH)2 + K2SO4
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3=KCl + O22KClO3 = 2KCl + 3O2
KI + Pb(NO3)2 = KNO3 + PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
K3PO4 + HCl = KCl + H3PO4K3PO4 + 3HCl = 3KCl + H3PO4
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2SO4+Pb(NO3)2=KNO3+PbSO4K2SO4 + Pb(NO3)2 = 2KNO3 + PbSO4
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3+S=KCl+SO22KClO3 + 3S = 2KCl + 3SO2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K+H2O=K2O+H2K + H2O = K2O + 2H
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KO2(s)+CO2(g)= K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KCLO3 = KCL + O22KCLO3 = 2KCL + 3O2
KClO3 + H2SO4 = KHSO4 + O2 + ClO2 + H2O4KClO3 + 4H2SO4 = 4KHSO4 + O2 + 4ClO2 + 2H2O
KClO3 + H2SO4 = KHSO4 + O2 + ClO2 + H2O4KClO3 + 4H2SO4 = 4KHSO4 + O2 + 4ClO2 + 2H2O
KMnO4 + H2SO4 + FeSO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O2KMnO4 + 8H2SO4 + 10FeSO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KIO3=KI+O22KIO3 = 2KI + 3O2
K2O +P4O10 = K3PO46K2O + P4O10 = 4K3PO4
K2S2O3+I2=K2S4O6+KI2K2S2O3 + I2 = K2S4O6 + 2KI
KOH+Cl2=ClK+KClO3+H2O6KOH + 3Cl2 = 5ClK + KClO3 + 3H2O
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KBrO3=KBr+O22KBrO3 = 2KBr + 3O2
KMnO4 + H2SO4 = K2SO4 + MnSO4 + H2O + O24KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 6H2O + 5O2
KCO3 + H2SO4 = KSO4 + CO2 + H2OKCO3 + H2SO4 = KSO4 + CO2 + H2O
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2Cr2O2 + HCl = KCl + CrCl3 + Cl2 + H2OK2Cr2O2 + 4HCl = 2KCl + 2CrCl3 - 2Cl2 + 2H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4+H2SO4=K2SO4+MnSO4+H2O+O24KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 6H2O + 5O2
KBr + Fe(OH)3 = KOH + FeBr33KBr + Fe(OH)3 = 3KOH + FeBr3
KMnO4 + H2SO4 + Fe(NH4)2(SO4) = K2SO4 + Fe2(SO4)3 + (NH4)2SO4 + MnSO4 + H2O6KMnO4 + 24H2SO4 + 10Fe(NH4)2(SO4) = 3K2SO4 + 5Fe2(SO4)3 + 10(NH4)2SO4 + 6MnSO4 + 24H2O
KMnO4 + 3SO2 + 2H2O = MnSO4 + KHSO4 + H2SO42KMnO4 + 5SO2 + 2H2O = 2MnSO4 + 2KHSO4 + H2SO4
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O+H2O=KOHK2O + H2O = 2KOH
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KCl + MnO2 + H2SO4 = K2SO4 + MnSO4 + H2O + Cl22KCl + MnO2 + 2H2SO4 = K2SO4 + MnSO4 + 2H2O + Cl2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K+Cl2=KCl2K + Cl2 = KCl2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KBrO3(s)=KBr(s)+O2(g)2KBrO3(s) = 2KBr(s) + 3O2(g)
KClO3=KCl+KClO44KClO3 = KCl + 3KClO4
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4 + H2SO4 + Na3AsO3 = K2SO4 + MnSO4 + Na3AsO4 + H2O2KMnO4 + 3H2SO4 + 5Na3AsO3 = K2SO4 + 2MnSO4 + 5Na3AsO4 + 3H2O
K+NaOH=KOH+NaK + NaOH = KOH + Na
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KOH+H3PO4 =K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3=KCl+OKClO3 = KCl + 3O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KO2(s)+CO2(g)=K2CO3(s)+O2(g) 4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
K+Cl2=KCl2K + Cl2 = 2KCl
KIO3+H2SO3=I2+K2SO4+H2O+H2SO42KIO3 + 5H2SO3 = I2 + K2SO4 + H2O + 4H2SO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KOH + Co3(PO4)2=K3PO4+Co(OH)26KOH + Co3(PO4)2 = 2K3PO4 + 3Co(OH)2
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KBr+Fe(OH)3=KOH+FeBr33KBr + Fe(OH)3 = 3KOH + FeBr3
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
K2Cr2O7 + HCl = KCl + CrCl3 + Cl2 + H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
KH2F3=KF+H2+F2KH2F3 = KF + H2 + F2
KH2F3=KF+H2+F2KH2F3 = KF + H2 + F2
K+O2=K2O4K + O2 = 2K2O
KClO3(s) = KCl(s) + O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
K2Cr2O7+KOH=K2CrO4+H2OK2Cr2O7 + 2KOH = 2K2CrO4 + H2O
K2CO3 + BaCl2 = KCl + BaCO3K2CO3 + BaCl2 = 2KCl + BaCO3
K2O + H2O = KOHK2O + H2O = 2KOH
K+MgBr2=KBr+Mg2K + MgBr2 = 2KBr + Mg
KOH + AlI3 = KI3 + AlOHKOH + AlI3 = KI3 + AlOH
KCLO3=KCL+KCLO44KCLO3 = KCL + 3KCLO4
KCLO3=KCLO +O2KCLO3 = KCLO + O2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
K+H2O=H2+KOH2K + 2H2O = H2 + 2KOH
KI+Pb(NO3)2=PbI2+KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
KO2(s)+CO2(g)=K2CO3(s)+O2(g)4KO2(s) + 2CO2(g) = 2K2CO3(s) + 3O2(g)
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KCl=K+Cl22KCl = 2K + Cl2
KClO3(s)=KCl(s)+O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
KMnO4 + H2SO4 + Fe( NH4)2(SO4)2 = Fe2(SO4)3 + K2SO4+ (NH4)2SO4 + MnSO4 + H2O2KMnO4 + 8H2SO4 + 10Fe(NH4)2(SO4)2 = 5Fe2(SO4)3 + K2SO4 + 10(NH4)2SO4 + 2MnSO4 + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + H2SO4 + Fe( NH4)2(SO4)2 = Fe2(SO4)3 + K2SO4+ (NH4)2SO4 + MnSO4 + H2O2KMnO4 + 8H2SO4 + 10Fe(NH4)2(SO4)2 = 5Fe2(SO4)3 + K2SO4 + 10(NH4)2SO4 + 2MnSO4 + 8H2O
KMnO4 + H2SO4 + Na3AsO3 = K2SO4 + MnSO4 + Na3AsO4 + H2O2KMnO4 + 3H2SO4 + 5Na3AsO3 = K2SO4 + 2MnSO4 + 5Na3AsO4 + 3H2O
KMnO4 + H2SO4 + HNO2 = MnSO4 + K2SO4 + HNO3 + H2O2KMnO4 + 3H2SO4 + 5HNO2 = 2MnSO4 + K2SO4 + 5HNO3 + 3H2O
KMnO4 + H2SO4 + HNO2 = MnSO4 + K2SO4 + HNO3 + H2O2KMnO4 + 3H2SO4 + 5HNO2 = 2MnSO4 + K2SO4 + 5HNO3 + 3H2O
K2SO4(aq)+CaI2(aq)=CaSO4(s)+2KI(s)K2SO4(aq) + CaI2(aq) = CaSO4(s) + 2KI(s)
KO2 + H2O = KOH + O24KO2 + 2H2O = 4KOH + 3O2
K2O+H2O=KOHK2O + H2O = 2KOH
K+H2O=H2+KOH2K + 2H2O = H2 + 2KOH
KOH + CH4O = H2O + CH3OKKOH + CH4O = H2O + CH3OK
KOH + CH4O = H2O + CH3O + KKOH + CH4O = H2O + CH3O + K
KOH + CH4O = H2O + CH3O = KKOH + CH4O = H2O + CH3O + K
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KOH + Pb(NO3)2 = KNO3 + Pb(OH)22KOH + Pb(NO3)2 = 2KNO3 + Pb(OH)2
K2Cr2O7 + HI = CrI3 + KI + I2 + H2OK2Cr2O7 + 14HI = 2CrI3 + 2KI + 3I2 + 7H2O
KMnO4 + H2SO3 = K2SO4 + MnSO4 + H2SO4 + H2O2KMnO4 + 5H2SO3 = K2SO4 + 2MnSO4 + 2H2SO4 + 3H2O
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
KHSO4=K2S2O7+H2O2KHSO4 = K2S2O7 + H2O
KClO3 + P4 =P4O10 +KCl10KClO3 + 3P4 = 3P4O10 + 10KCl
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4+H2S+HCl=MnCl2+S+KCl+H2O2KMnO4 + 5H2S + 6HCl = 2MnCl2 + 5S + 2KCl + 8H2O
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3 = KNO2 + O2 2KNO3 = 2KNO2 + O2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO3=KClO+O2KClO3 = KClO + O2
KClO3=KClO2+O22KClO3 = 2KClO2 + O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3 + P4 = P4O10 + KCl10KClO3 + 3P4 = 3P4O10 + 10KCl
K+ H2O = KOH+ H22K + 2H2O = 2KOH + H2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KMnO4+H2SO4+NaCl=K2SO4+MnSO4+Na2SO4+Cl2+H2O2KMnO4 + 8H2SO4 + 10NaCl = K2SO4 + 2MnSO4 + 5Na2SO4 + 5Cl2 + 8H2O
KMnO4+CaC2O4+H2SO4=MnSO4+K2SO4+CaSO4+CO2+H2O2KMnO4 + 5CaC2O4 + 8H2SO4 = 2MnSO4 + K2SO4 + 5CaSO4 + 10CO2 + 8H2O
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
KOH+CuSO4=K2SO4+Cu(OH)22KOH + CuSO4 = K2SO4 + Cu(OH)2
K+S=KSK + S = KS
KOH+Cr(NO3)3=Cr(OH)3+KNO33KOH + Cr(NO3)3 = Cr(OH)3 + 3KNO3
K2O+H2O=KOHK2O + H2O = 2KOH
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KCl + NaOH = NaCl + KOHKCl + NaOH = NaCl + KOH
KMnO4 + C2H2O4 = K2CO3 + MnO2 + H2O + CO22KMnO4 + 3C2H2O4 = K2CO3 + 2MnO2 + 3H2O + 5CO2
KMnO4 + C2H2O4 = KCO3 + MnO2 + H2O + CO2KMnO4 + C2H2O4 = KCO3 + MnO2 + H2O + CO2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KOH + Cl2 = KCl + KClO + H2O2KOH + Cl2 = KCl + KClO + H2O
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KI +Pb(NO3)2 = KNO3 + PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
KBr+CaI2=CaBr2+KI2KBr + CaI2 = CaBr2 + 2KI
KClO3=KCl + O22KClO3 = 2KCl + 3O2
K+HCL=KCL+H22K + 2HCL = 2KCL + H2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4+C2H2O4 = K2CO3+ MnO2 + H2O +CO22KMnO4 + 3C2H2O4 = K2CO3 + 2MnO2 + 3H2O + 5CO2
KMnO4+2C2H2O4 = 2K2CO3+ 4MnO2 + 2H2O +CO22KMnO4 + 3C2H2O4 = K2CO3 + 2MnO2 + 3H2O + 5CO2
KNO3 + H2CO3 = K2CO3 + HNO3 2KNO3 + H2CO3 = K2CO3 + 2HNO3
KMnO4 + H2O2 + H2SO4 = MnSO4 + H2O + K2O2KMnO4 - 5H2O2 + 2H2SO4 = 2MnSO4 - 3H2O + K2O
K2CrO4 + Mg + HCl = CrCl3 + KCl + MgCl2 + H2O2K2CrO4 + 3Mg + 16HCl = 2CrCl3 + 4KCl + 3MgCl2 + 8H2O
K2CrO4 + Mg + HCl = CrCl3 + KCl + MgCl2 + H2O2K2CrO4 + 3Mg + 16HCl = 2CrCl3 + 4KCl + 3MgCl2 + 8H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4 + Zn + HCl = MnCl2 + KCl + ZnCl2 + H2O2KMnO4 + 5Zn + 16HCl = 2MnCl2 + 2KCl + 5ZnCl2 + 8H2O
KOH + Ni(NO3)2 = KNO3+Ni(OH)22KOH + Ni(NO3)2 = 2KNO3 + Ni(OH)2
KOH+HBr=KBr+H2OKOH + HBr = KBr + H2O
K2CO3+HI=K2I+HCO3K2CO3 + HI = K2I + HCO3
KI+Br2=KBr+I22KI + Br2 = 2KBr + I2
K+HCl=KCl+H22K + 2HCl = 2KCl + H2
K3PO4+MgCl2=K3Cl2+MgPO4K3PO4 + MgCl2 = K3Cl2 + MgPO4
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
K2Cr2O7 + SnCl2 + HCl = CrCl + SnCl4 + KCl + H2OK2Cr2O7 + 5SnCl2 + 14HCl = 2CrCl + 5SnCl4 + 2KCl + 7H2O
KI + H2SO4 = K2SO4 + H2S + I2 + H2O8KI + 5H2SO4 = 4K2SO4 + H2S + 4I2 + 4H2O
KBrO3=KBr+O22KBrO3 = 2KBr + 3O2
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH + H3PO4 = KH2PO4 + H2OKOH + H3PO4 = KH2PO4 + H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KO2+H2O=KOH+O24KO2 + 2H2O = 4KOH + 3O2
K2CrO7+HCl=KCl+CrCl+H2O+Cl22K2CrO7 + 28HCl = 4KCl + 2CrCl + 14H2O + 11Cl2
KBr + BaCl2 = KCl + BaBr22KBr + BaCl2 = 2KCl + BaBr2
KHF2=KF+H2+F22KHF2 = 2KF + H2 + F2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH+Ba(OH)2=BaOH+K(OH)2KOH + Ba(OH)2 = BaOH + K(OH)2
KMnO4+C2H2O4=K2CO3+MnO2+H2O+CO22KMnO4 + 3C2H2O4 = K2CO3 + 2MnO2 + 3H2O + 5CO2
K2SO4+BaCl2=KCl+BaSO4K2SO4 + BaCl2 = 2KCl + BaSO4
KI+ KIO3 + HCl = KCl + I2 + H2O5KI + KIO3 + 6HCl = 6KCl + 3I2 + 3H2O
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
KMnO4+H2SO4+K2C204=MnS04+K2SO4+CO2+H2O818KMnO4 + 3712H2SO4 + 31K2C204 = 818MnS04 + 440K2SO4 + 6324CO2 + 3712H2O
KOH(aq) + FeCl2(aq) = Fe(OH)2(s) + KCl(aq)2KOH(aq) + FeCl2(aq) = Fe(OH)2(s) + 2KCl(aq)
KOH(aq)+FeCl2(aq)=Fe(OH)2(s)+KCl(aq)2KOH(aq) + FeCl2(aq) = Fe(OH)2(s) + 2KCl(aq)
K2SO4(aq)+BaCl2(aq)=BaSO4(s)+KCl(aq)K2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2KCl(aq)
K2SO3(aq) = K2(aq) + SO3(l)K2SO3(aq) = K2(aq) + SO3(l)
K2SO3(aq) = K2(aq) + SO3(aq)K2SO3(aq) = K2(aq) + SO3(aq)
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
K+MgBr=KBr+MgK + MgBr = KBr + Mg
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
KI + Cu(NO3)2 = CuI + I2 + KNO34KI + 2Cu(NO3)2 = 2CuI + I2 + 4KNO3
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2C2O4+Ca3(AsO4)2=K3AsO4+CaC2O43K2C2O4 + Ca3(AsO4)2 = 2K3AsO4 + 3CaC2O4
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH + NiCl2 = Ni(OH)2 + KCl2KOH + NiCl2 = Ni(OH)2 + 2KCl
KI + H2SO4 = H2S + I2 + K2SO4 + H2O8KI + 5H2SO4 = H2S + 4I2 + 4K2SO4 + 4H2O
KI + Cu(NO3)2 = CuI + I2 + KNO34KI + 2Cu(NO3)2 = 2CuI + I2 + 4KNO3
KI + Cu(NO3)2 = CuI + I + KNO32KI + Cu(NO3)2 = CuI + I + 2KNO3
KClO3+P4=P4O10+KCl10KClO3 + 3P4 = 3P4O10 + 10KCl
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
K+Cl2=KCl2K + Cl2 = 2KCl
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7 + HCl = KCl + CrCl3 + H2O + Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KMnO4 + C2H2O4 = K2CO3 + MnO2 + H2O + CO22KMnO4 + 3C2H2O4 = K2CO3 + 2MnO2 + 3H2O + 5CO2
KMnO4 + H2C2O4 + HCl = MnCl2 + CO2 + KCl + H2O2KMnO4 + 5H2C2O4 + 6HCl = 2MnCl2 + 10CO2 + 2KCl + 8H2O
KO2 + H2O = KOH + O24KO2 + 2H2O = 4KOH + 3O2
KMnO4 + C2H2O4 = K2CO3 + MnO2 + H2O + CO22KMnO4 + 3C2H2O4 = K2CO3 + 2MnO2 + 3H2O + 5CO2
K2Cr2O7+HCl=KCl+CrCl3+Cl2+H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
K2SO4 = K2 + SO4K2SO4 = K2 + SO4
KMnO4+KCl+H2SO4=MnSO4+K2SO4+H2O+Cl22KMnO4 + 10KCl + 8H2SO4 = 2MnSO4 + 6K2SO4 + 8H2O + 5Cl2
KMnO4+Na2C2O4+H2SO4=K2SO4+Na2SO4+MnSO4+CO2+H2O2KMnO4 + 5Na2C2O4 + 8H2SO4 = K2SO4 + 5Na2SO4 + 2MnSO4 + 10CO2 + 8H2O
KMnO4+Na2C2O4+H2SO4=K2SO4+Na2SO4+MnSO4+CO2+H2O2KMnO4 + 5Na2C2O4 + 8H2SO4 = K2SO4 + 5Na2SO4 + 2MnSO4 + 10CO2 + 8H2O
KOH + H2SO4 = K2SO4 + 2H2O2KOH + H2SO4 = K2SO4 + 2H2O
KMnO4 + H2SO4 + NaHSO3 = MnSO4 + K2SO4 + NaHSO4 + H2O2KMnO4 + 3H2SO4 + 5NaHSO3 = 2MnSO4 + K2SO4 + 5NaHSO4 + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCl + O2 = KClO4KCl + 2O2 = KClO4
KClO4 = KCl + O2KClO4 = KCl + 2O2
K 2 CrO 4 +Na 2 SO 3 +HCl=KCl+Na 2 SO 4 +CrCl 3 +H 2 O2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2S2O3 + HBr = KBr + S + SO2 + H2OK2S2O3 + 2HBr = 2KBr + S + SO2 + H2O
K2CO3 + HCl= KCl + H2O + CO2K2CO3 + 2HCl = 2KCl + H2O + CO2
K2CO3 + HCl= KCl + H2O + CO2K2CO3 + 2HCl = 2KCl + H2O + CO2
K2CO3 + HCl= KCl + H2O + CO2K2CO3 + 2HCl = 2KCl + H2O + CO2
KOH + FeCl3 = Fe(OH)3 + KCl3KOH + FeCl3 = Fe(OH)3 + 3KCl
KOH+ HNO3=H2O + KNO3KOH + HNO3 = H2O + KNO3
KOH(aq)+FeCl2(aq)=Fe(OH)2+2KCl(aq)2KOH(aq) + FeCl2(aq) = Fe(OH)2 + 2KCl(aq)
KMnO4 + NaOH + NaHSO3 =Na2MnO4 + K2SO4 + H2O2KMnO4 + 3NaOH + NaHSO3 = 2Na2MnO4 + K2SO4 + 2H2O
KMnO4 + NaHSO3=MnO2 + Na2SO4 + K2SO4 + H2O + NaHSO42KMnO4 + 3NaHSO3 = 2MnO2 + Na2SO4 + K2SO4 + H2O + NaHSO4
K2CrO4 + NaCH3COO =KCH3COO + Na2CrO4K2CrO4 + 2NaCH3COO = 2KCH3COO + Na2CrO4
KMnO4 + H2SO4 + NaHSO3 = MnSO4 + K2SO4 + H2O + Na2SO44KMnO4 + H2SO4 + 10NaHSO3 = 4MnSO4 + 2K2SO4 + 6H2O + 5Na2SO4
KOH + H2O= OH + KKOH + 0H2O = OH + K
KOH + H2O= OH + KKOH + 0H2O = OH + K
K2O(s)+H2O(l)=KOH(aq)K2O(s) + H2O(l) = 2KOH(aq)
K2Cr2O7 + H2SO4 + KNO2 = K2SO4 + Cr2(SO4)3 + H2O + KNO3K2Cr2O7 + 4H2SO4 + 3KNO2 = K2SO4 + Cr2(SO4)3 + 4H2O + 3KNO3
K2SO4(aq)+BaCl2(aq)=BaSO4(s)+KCl(aq)K2SO4(aq) + BaCl2(aq) = BaSO4(s) + 2KCl(aq)
KBr + H2SO4 = K2SO4 + Br2 + SO2 + H2O2KBr + 2H2SO4 = K2SO4 + Br2 + SO2 + 2H2O
KMnO4 + Na2C2O4 + H2SO4 = K2SO4 + MnSO4 + Na2SO4 + H2O + CO22KMnO4 + 5Na2C2O4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 8H2O + 10CO2
KMnO4 + H2C2O4 + H2SO4 = K2SO4 + MnSO4 + H2O + CO22KMnO4 + 5H2C2O4 + 3H2SO4 = K2SO4 + 2MnSO4 + 8H2O + 10CO2
KMnO4 + FeSO4 + H2SO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O2KMnO4 + 10FeSO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
KHF2 = KF+H2+F22KHF2 = 2KF + H2 + F2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.