Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
KAsO2 + HCO3 + I2 = H3AsO4 + KI +CO2 + H2O-2KAsO2 - 2HCO3 - I2 = -2H3AsO4 - 2KI - 2CO2 + 2H2O
KAsO2 + HCO3 + I2 = H3AsO4 + KI +CO2 +O22KAsO2 + 6HCO3 + I2 = 2H3AsO4 + 2KI + 6CO2 + O2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KNO3 + Cr2(SO4)3 + Na2CO3 = KNO2 + Na2CrO4 + Na2SO4 + CO23KNO3 + Cr2(SO4)3 + 5Na2CO3 = 3KNO2 + 2Na2CrO4 + 3Na2SO4 + 5CO2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7+H2SO3+H2SO4=K2SO4+Cr2(SO4)3+H2OK2Cr2O7 + 3H2SO3 + H2SO4 = K2SO4 + Cr2(SO4)3 + 4H2O
K4Fe(CN)6 + Ce(NO3)4 + KOH = Ce(OH)3 + Fe(OH)3 + K2CO3 + KNO3 + H2OK4Fe(CN)6 + 61Ce(NO3)4 + 258KOH = 61Ce(OH)3 + Fe(OH)3 + 6K2CO3 + 250KNO3 + 36H2O
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + H2SO4 + Sb = K2SO4 + MnSO4 + Sb2O3 + H2O6KMnO4 + 9H2SO4 + 10Sb = 3K2SO4 + 6MnSO4 + 5Sb2O3 + 9H2O
KClO3 = KCl + KClO44KClO3 = KCl + 3KClO4
K2Cr2O7 + HCl = KCl + CrCl3 + Cl2 + H2OK2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 3Cl2 + 7H2O
K2MnO4+H2C2O4+H2SO4=CO2+MnSO4+K2SO4+H2OK2MnO4 + 2H2C2O4 + 2H2SO4 = 4CO2 + MnSO4 + K2SO4 + 4H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2CrO4+Na2SO3+HCl=KCl+Na2SO4+CrCl3+H2O2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
K+O2=K2O4K + O2 = 2K2O
KMnO4=K2MnO4+MnO2+O22KMnO4 = K2MnO4 + MnO2 + O2
KMnO4+H2SO4=Mn2O7+K2SO4+H2O2KMnO4 + H2SO4 = Mn2O7 + K2SO4 + H2O
K2Cr2O3 + H2O2 + H2SO4 = K2SO4 + CrSO4 + H2O K2Cr2O3 + 0H2O2 + 3H2SO4 = K2SO4 + 2CrSO4 + 3H2O
KMnO4 + HCl = Cl2 + KCl + MnCl2 + H2O2KMnO4 + 16HCl = 5Cl2 + 2KCl + 2MnCl2 + 8H2O
KClO3 + HCl = KCl + Cl2 + H2OKClO3 + 6HCl = KCl + 3Cl2 + 3H2O
K2Cr2O7 + HI + HClO4 = KClO4 + Cr(ClO4)3 + I2 + H2OK2Cr2O7 + 6HI + 8HClO4 = 2KClO4 + 2Cr(ClO4)3 + 3I2 + 7H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2Cr2O7+2FeSO4+H2O = Fe2(SO4)3+2CrSO4+K2SO4+H2O0K2Cr2O7 + 0FeSO4 + H2O = 0Fe2(SO4)3 + 0CrSO4 + 0K2SO4 + H2O
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KIO4+KI+HCl=KCl+I2+H2OKIO4 + 7KI + 8HCl = 8KCl + 4I2 + 4H2O
KOH +MgSO4 = Mg(OH)2 + K2SO42KOH + MgSO4 = Mg(OH)2 + K2SO4
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
K3PO4+HCI=KCI+H3PO4K3PO4 + 3HCI = 3KCI + H3PO4
KI+Pb(NO3)2=KNO3+PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
KI+CI2=KCI+I2KI + CI2 = KCI + I2
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
K2SO4(aq)+CaI2(aq)=CaSO4(s)+KI(aq)K2SO4(aq) + CaI2(aq) = CaSO4(s) + 2KI(aq)
KClO3+C12H22O11=KCl+CO2+H2O8KClO3 + C12H22O11 = 8KCl + 12CO2 + 11H2O
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2CO3+Al2Cl6=KCl+Al2(CO3)33K2CO3 + Al2Cl6 = 6KCl + Al2(CO3)3
K2SO4+Ba(OH)2 = BaSO4 + K OHK2SO4 + Ba(OH)2 = BaSO4 + 2KOH
KOH + H2CO3 = K2CO3 + H2O2KOH + H2CO3 = K2CO3 + 2H2O
K2Cr2O7 + KOH = K2CrO4 + H2OK2Cr2O7 + 2KOH = 2K2CrO4 + H2O
K + H2O = KOH +HK + H2O = KOH + H
KMnO4 + HCl = Cl2 + KCl + MnCl2 + H2O2KMnO4 + 16HCl = 5Cl2 + 2KCl + 2MnCl2 + 8H2O
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
K2SO4(aq)+CaI2(aq)=CaSO4(s)+KI(aq)K2SO4(aq) + CaI2(aq) = CaSO4(s) + 2KI(aq)
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
K2MnO4+H2O=KMnO4+MnO2+KOH3K2MnO4 + 2H2O = 2KMnO4 + MnO2 + 4KOH
K3PO4+HCL=KCL+H3PO4K3PO4 + 3HCL = 3KCL + H3PO4
K2Cr2O7 + 2FeSO4 + H2O = Fe2(SO4)3 + 2CrSO4 + K2SO4 + H2O0K2Cr2O7 + 0FeSO4 + H2O = 0Fe2(SO4)3 + 0CrSO4 + 0K2SO4 + H2O
KL+CL2=KCL+L2KL + CL2 = KCL + L2
K2Cr2O7+2FeSO4+H2O = Fe2(SO4)3+2CrSO4+K2SO4+H2O0K2Cr2O7 + 0FeSO4 + H2O = 0Fe2(SO4)3 + 0CrSO4 + 0K2SO4 + H2O
K2Cr2O7+2FeSO4+H2O = Fe2(SO4)3+2CrSO4+K2SO4+H2O0K2Cr2O7 + 0FeSO4 + H2O = 0Fe2(SO4)3 + 0CrSO4 + 0K2SO4 + H2O
K2Cr2O7+2FeSO4+H2O = Fe2(SO4)3+2CrSO4+K2SO4+H2O0K2Cr2O7 + 0FeSO4 + H2O = 0Fe2(SO4)3 + 0CrSO4 + 0K2SO4 + H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4 + SnCl2 + HCl = KCl + MnCl2 + SnCl4 + H2O2KMnO4 + 5SnCl2 + 16HCl = 2KCl + 2MnCl2 + 5SnCl4 + 8H2O
KOH+Cu(NO3)2=Cu(OH)2+KNO32KOH + Cu(NO3)2 = Cu(OH)2 + 2KNO3
K2CrO4 + H2S + HCl = CrCl3 + KCl + S + H2O2K2CrO4 + 3H2S + 10HCl = 2CrCl3 + 4KCl + 3S + 8H2O
KMnO4+NaNO2+H2SO4=NaNO3+MnSO4+K2SO4+H2O2KMnO4 + 5NaNO2 + 3H2SO4 = 5NaNO3 + 2MnSO4 + K2SO4 + 3H2O
KMnO4+NaNO2+H2SO4=NaNO3+MnSO4+K2SO4+H2=2KMnO4 + 8NaNO2 + 3H2SO4 = 8NaNO3 + 2MnSO4 + K2SO4 + 3H2
KClO3+H2SO4+FeSO4=Fe2(SO4)3+KCl+H2OKClO3 + 3H2SO4 + 6FeSO4 = 3Fe2(SO4)3 + KCl + 3H2O
KL+CL 2=KCL+L2KL + CL2 = KCL + L2
KL+CL 2=KCL+L2KL + CL2 = KCL + L2
KClO3 + HI + H2SO4 = KHSO4 + HCl + I2 H2OKClO3 + 6HI + H2SO4 = KHSO4 + HCl + 3I2H2O
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
K2CrO4+2NaOCl = Na2CrO4+KCl+O2K2CrO4 + 2NaOCl = Na2CrO4 + 2KCl + O2
K2CrO4+2NaOCl = Na2CrO4+KOClK2CrO4 + 2NaOCl = Na2CrO4 + 2KOCl
K2CrO4+2NaOCl = Na2CrO4+2KOClK2CrO4 + 2NaOCl = Na2CrO4 + 2KOCl
K+N2=K3N6K + N2 = 2K3N
K2Cr2O7 + S8 = K2O + Cr2O7 + SO2-16K2Cr2O7 + S8 = -16K2O - 16Cr2O7 + 8SO2
KNO3+H2CO3=K2CO3+HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KMnO4 + 5KCl + H2SO4 = MnSO4 + K2SO4 + 5Cl2 + H2O2KMnO4 + 10KCl + 8H2SO4 = 2MnSO4 + 6K2SO4 + 5Cl2 + 8H2O
KMnO4 + 5KCl + H2SO4 = MnSO4 + K2SO4 + 5Cl2 + H2O2KMnO4 + 10KCl + 8H2SO4 = 2MnSO4 + 6K2SO4 + 5Cl2 + 8H2O
K2O (s) + H2O (l) = KOH (aq)K2O(s) + H2O(l) = 2KOH(aq)
K + H2O = H2 + KOH2K + 2H2O = H2 + 2KOH
K2CO3 + C = CO + KK2CO3 + 2C = 3CO + 2K
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KClO= KCl + KClO44KClO = 3KCl + KClO4
K2 Cr2 O7 + Fe SO4 + H2 SO4 = Fe (SO4)3 + Cr SO4 + K2 SO4 + H2 OK2Cr2O7 + 2FeSO4 + 7H2SO4 = 2Fe(SO4)3 + 2CrSO4 + K2SO4 + 7H2O
K2 Cr2 O7 + Fe SO4 + H2 SO4 = Fe (SO4)3 + Cr SO4 + K2 SO4 + H2 OK2Cr2O7 + 2FeSO4 + 7H2SO4 = 2Fe(SO4)3 + 2CrSO4 + K2SO4 + 7H2O
K(s)+H2O(l)=KOH(aq)+H22K(s) + 2H2O(l) = 2KOH(aq) + H2
KOH +H2SO4=K2SO4 +H2O2KOH + H2SO4 = K2SO4 + 2H2O
KMnO4+SO2+H2SO4=K2SO4+MnSO4+H2O-2KMnO4 - 5SO2 + 2H2SO4 = -1K2SO4 - 2MnSO4 + 2H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2CrO7+H2So4=KSo4+Cr2(So4)3+H2O+O24K2CrO7 + 14H2So4 = 8KSo4 + 2Cr2(So4)3 + 14H2O + 7O2
K2CrO7+H2So4=KSo4+Cr2(So4)3+H2O+O24K2CrO7 + 14H2So4 = 8KSo4 + 2Cr2(So4)3 + 14H2O + 7O2
KMnO4 + H2SO4 + K2C2O4 = K2SO4 + MnSO4 + H2O + CO22KMnO4 + 8H2SO4 + 5K2C2O4 = 6K2SO4 + 2MnSO4 + 8H2O + 10CO2
K2Cr2O7=K2Cr2O4+Cr2O3+O22K2Cr2O7 = 2K2Cr2O4 + 0Cr2O3 + 3O2
K2Cr2O7=K2Cr2O4+Cr2O3+O22K2Cr2O7 = 2K2Cr2O4 + 0Cr2O3 + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCl+KMnO4+8H2SO4 =MnSO4+K2SO4+H2O+Cl210KCl + 2KMnO4 + 8H2SO4 = 2MnSO4 + 6K2SO4 + 8H2O + 5Cl2
KMnO4 + Na2C2O4 + H2SO4 = K2SO4 + Na2SO4 + MnSO4 + H2O + CO2 2KMnO4 + 5Na2C2O4 + 8H2SO4 = K2SO4 + 5Na2SO4 + 2MnSO4 + 8H2O + 10CO2
KMnO4 + Na2C2O4 + H2SO4 = K2SO4 + Na2SO4 + MnSO4 + H2O + CO2 2KMnO4 + 5Na2C2O4 + 8H2SO4 = K2SO4 + 5Na2SO4 + 2MnSO4 + 8H2O + 10CO2
KMnO4 + Na2C2O4 + H2SO4 = K2SO4 + Na2SO4 + MnSO4 + H2O + CO2 2KMnO4 + 5Na2C2O4 + 8H2SO4 = K2SO4 + 5Na2SO4 + 2MnSO4 + 8H2O + 10CO2
KCN(aq) + KMnO4(aq) + KOH(aq) = KC2H3O2(aq) + MnO2(s) + KCNO(aq) + H2O-3KCN(aq) - 2KMnO4(aq) + 2KOH(aq) = 0KC2H3O2(aq) - 2MnO2(s) - 3KCNO(aq) + H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3 + HI + H2SO4 = KHSO4 + HCl + I2 + H2OKClO3 + 6HI + H2SO4 = KHSO4 + HCl + 3I2 + 3H2O
KCN+ KMnO4+ KOH= KC2H3O2+ MnO2+ KCNO+ H2O-3KCN - 2KMnO4 + 2KOH = 0KC2H3O2 - 2MnO2 - 3KCNO + H2O
KClO3(s) + P4(s) = P4O10(s) + KCl(s)10KClO3(s) + 3P4(s) = 3P4O10(s) + 10KCl(s)
KCN+ KMnO4+ KOH= KC2H3O2+ MnO2+ KCNO+ H2O-3KCN - 2KMnO4 + 2KOH = 0KC2H3O2 - 2MnO2 - 3KCNO + H2O
KCN+ KMnO4+ KOH= KC2H3O2+ MnO2+ KCNO+ H2O-3KCN - 2KMnO4 + 2KOH = 0KC2H3O2 - 2MnO2 - 3KCNO + H2O
KCN(aq) + KMnO4(aq) + KOH(aq)= KC2H3O2(aq) + MnO2(s) + KCNO(aq) + H2O-3KCN(aq) - 2KMnO4(aq) + 2KOH(aq) = 0KC2H3O2(aq) - 2MnO2(s) - 3KCNO(aq) + H2O
KIO3 + SO2 = I2 + K2SO4 + O22KIO3 + SO2 = I2 + K2SO4 + 2O2
KMnO4 + NaCl + H2SO4 = Cl2 +K2SO4 +MnSO4 + H20 +Na2SO40KMnO4 + 20NaCl + 10H2SO4 = 10Cl2 + 0K2SO4 + 0MnSO4 + H20 + 10Na2SO4
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3 = KNO + O2KNO3 = KNO + O2
KMnO4 + H2C2O4 + H2SO4 = CO2 + MnSO4 + K2SO4 + H2O2KMnO4 + 5H2C2O4 + 3H2SO4 = 10CO2 + 2MnSO4 + K2SO4 + 8H2O
KMnO4 + H2SO4 + FeSO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O 2KMnO4 + 8H2SO4 + 10FeSO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
KMnO4 + H2SO4 + FeSO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O 2KMnO4 + 8H2SO4 + 10FeSO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
KMnO4 + H2SO4 + FeSO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O 2KMnO4 + 8H2SO4 + 10FeSO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
KMnO4 + H2SO4 + FeSO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O 2KMnO4 + 8H2SO4 + 10FeSO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
K2O+HCI=KCI+H2OK2O + 2HCI = 2KCI + H2O
K+O2=K2O4K + O2 = 2K2O
KClO = KCl + OKClO = KCl + O
KClO = KCl OKClO = KClO
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KF=F+KKF = F + K
KMnO4+HCl=KCl+MnCl2+Cl2+H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
KMnO4+HCl=MnCl2+KCl+Cl2+H2O2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O
KMnO4+HCl=MnCl+KCl+Cl2+H2OKMnO4 + 8HCl = MnCl + KCl + 3Cl2 + 4H2O
KOH+HCl=H2O+KClKOH + HCl = H2O + KCl
KMnO4 + BiBr2 + H2SO4 = Br2 + MnSO4 + K2SO4 + Bi2(SO4)3 + H2O6KMnO4 + 10BiBr2 + 24H2SO4 = 10Br2 + 6MnSO4 + 3K2SO4 + 5Bi2(SO4)3 + 24H2O
K2Cr2O7+H2SO4=K2SO4 + Cr2SO4+H2O + O22K2Cr2O7 + 4H2SO4 = 2K2SO4 + 2Cr2SO4 + 4H2O + 5O2
KMNO4+HCl=KCl+MNCl+Cl2+H2OKMNO4 + 8HCl = KCl + MNCl + 3Cl2 + 4H2O
K2CO3+H2SO4 = K2SO4+CO2+H2OK2CO3 + H2SO4 = K2SO4 + CO2 + H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KSCN+FeCl3=KCl+Fe(SCN)33KSCN + FeCl3 = 3KCl + Fe(SCN)3
KOH+HNO3=H2O+KNO3KOH + HNO3 = H2O + KNO3
KMnO4 + H2SO4 + Na2S = Na2SO4 + MnO4 + H2O + K2S8KMnO4 + 4H2SO4 + 3Na2S = 3Na2SO4 + 8MnO4 + 4H2O + 4K2S
K2Cr2O7 + KOH = K2CrO4 + H2OK2Cr2O7 + 2KOH = 2K2CrO4 + H2O
KNO3 + Cr2(SO4)3 + Na2CO3 = KNO2 + Na2CrO4 + Na2 SO4 + CO23KNO3 + Cr2(SO4)3 + 5Na2CO3 = 3KNO2 + 2Na2CrO4 + 3Na2SO4 + 5CO2
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4 + H2SO4 + FeSO4 = Fe2(SO4)3 + H2O + K2SO4 +MnSO42KMnO4 + 8H2SO4 + 10FeSO4 = 5Fe2(SO4)3 + 8H2O + K2SO4 + 2MnSO4
KMnO4 + H2SO4 + KI =H2O +5I2 +6K2SO4 + 2MnSO42KMnO4 + 8H2SO4 + 10KI = 8H2O + 5I2 + 6K2SO4 + 2MnSO4
KMnO4 + H2SO4 + KI = I2SO4+ MnSO4 + H2O + K2SO44KMnO4 + 16H2SO4 + 10KI = 5I2SO4 + 4MnSO4 + 16H2O + 7K2SO4
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KMnO4 + H2SO4 +H202 =KMnSO + H2O101KMnO4 + 101H2SO4 + 6H202 = 101KMnSO + 707H2O
KMnO4 + KCl + H2SO4 = MnSO4 + K2SO4 +H2O + Cl22KMnO4 + 10KCl + 8H2SO4 = 2MnSO4 + 6K2SO4 + 8H2O + 5Cl2
KMnO4 + KCl + H2SO4 = MnSO4 + KSO4 +H2O + Cl2KMnO4 + 2KCl + 4H2SO4 = MnSO4 + 3KSO4 + 4H2O + Cl2
KI + H2SO4 = K2SO4 + I2 + H2O + H2S8KI + 5H2SO4 = 4K2SO4 + 4I2 + 4H2O + H2S
KMnO4 + KCl + H2SO4 = MnSO4 + KSO4 + H2O + Cl2KMnO4 + 2KCl + 4H2SO4 = MnSO4 + 3KSO4 + 4H2O + Cl2
K2Cr2O7 + HCl = CrCl3 + KCl +Cl2 +H2OK2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3Cl2 + 7H2O
KOH + CO2 = K2CO3 + H2O2KOH + CO2 = K2CO3 + H2O
KOH + CO2 = K2CO3 + H2O2KOH + CO2 = K2CO3 + H2O
KHCO3 = K2CO3+ H2O + CO22KHCO3 = K2CO3 + H2O + CO2
KOH + Cl2=KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KOH + Cl2=KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
K + MgBr2 = KBr+ Mg2K + MgBr2 = 2KBr + Mg
K2CrO4 +Na2SO3 +HCl = KCl+Na2SO4 +CrCl3 +H2O 2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KOH+HNO2=KNO2+H2OKOH + HNO2 = KNO2 + H2O
KOH(aq) + H2SO4(aq)= K2SO4(aq) + H2O(l)2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l)
K4Fe(CN)6+KMnO4+HCl=KCl+FeCl3+MnCl2+CO2+NO+H2O5K4Fe(CN)6 + 43KMnO4 + 164HCl = 63KCl + 5FeCl3 + 43MnCl2 + 30CO2 + 30NO + 82H2O
K4Fe(CN)6+KMnO4+HCl=KCl+FeCl3+MnCl2+CO2+NO+H2O5K4Fe(CN)6 + 43KMnO4 + 164HCl = 63KCl + 5FeCl3 + 43MnCl2 + 30CO2 + 30NO + 82H2O
K4Fe(CN)6+KMnO4+HCl=KCl+FeCl3+MnCl2+CO2+NO+H2O5K4Fe(CN)6 + 43KMnO4 + 164HCl = 63KCl + 5FeCl3 + 43MnCl2 + 30CO2 + 30NO + 82H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCN + KMnO4 + KOH = KC2H3O2 + MnO2 + KCNO + H2O-3KCN - 2KMnO4 + 2KOH = 0KC2H3O2 - 2MnO2 - 3KCNO + H2O
KCl + Na2SO4 = K2SO4 + NaCl2KCl + Na2SO4 = K2SO4 + 2NaCl
KCl + NaS = KS + NaClKCl + NaS = KS + NaCl
KCl+K2Cr2O7+KOH+As2O3=KAsO4+H2O+CrCl324KCl + 4K2Cr2O7 - 26KOH + 3As2O3 = 6KAsO4 - 13H2O + 8CrCl3
K2MnO4 + HCl = KCl + MnCl2 + H2O + Cl2K2MnO4 + 8HCl = 2KCl + MnCl2 + 4H2O + 2Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KOH + MnO2 + KCLO3 = K3MnO4 + KCL + H2O18KOH + 6MnO2 + KCLO3 = 6K3MnO4 + KCL + 9H2O
KCl+H2SO4+K2CrO4=KSO4+H2O+CrSO4+ClKCl + 4H2SO4 + K2CrO4 = 3KSO4 + 4H2O + CrSO4 + Cl
K2Cr2O7 + KI + H2SO4 = K2SO4 + Cr2(SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K2Cr2O7 + KI + H2SO4 =K2SO4 + Cr2(SO4)3 + I2 + H2OK2Cr2O7 + 6KI + 7H2SO4 = 4K2SO4 + Cr2(SO4)3 + 3I2 + 7H2O
K2Cr2O7 + H2SO4 + 6CH3CH2OH = Cr(SO4)3 + H2O + CH3CHO + K2SO4K2Cr2O7 + 7H2SO4 + 0CH3CH2OH = 2Cr(SO4)3 + 7H2O + 0CH3CHO + K2SO4
K+HCI=KCI+H22K + 2HCI = 2KCI + H2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7+ Ba(C2H3O2)2= BaCr2O7+ KC2H3O2K2Cr2O7 + Ba(C2H3O2)2 = BaCr2O7 + 2KC2H3O2
K+2H2O=KOH+H22K + 2H2O = 2KOH + H2
KNO2 + KMnO4 + H2SO4 = KNO3 + K2SO4 + MnSO4 + H2O5KNO2 + 2KMnO4 + 3H2SO4 = 5KNO3 + K2SO4 + 2MnSO4 + 3H2O
K2Cr2O7 + BaCl2 + H2O= BaCrO4 + KCl + HClK2Cr2O7 + 2BaCl2 + H2O = 2BaCrO4 + 2KCl + 2HCl
K + MgBr = KBr + MgK + MgBr = KBr + Mg
K2SO4(aq)+CaI2(aq)=CaSO4(s)+KI(aq)K2SO4(aq) + CaI2(aq) = CaSO4(s) + 2KI(aq)
KMnO4 + H2SO4 = K2SO4 + MnSO4 + O2 + H2O4KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 5O2 + 6H2O
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
KI=K + I22KI = 2K + I2
K 2 O(s)+H 2 O(l)=KOH(aq) K2O(s) + H2O(l) = 2KOH(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KOH+Cl2=KClO3+KCl+H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl + H2O + Cl2KMnO4 + 8HCl = KCl + MnCl + 4H2O + 3Cl2
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
K + H2O = H2 + KOH 2K + 2H2O = H2 + 2KOH
KMnO4 + NaCl + H2SO4 = MnCl2 + Cl2 + K2SO4 + Na2SO4 + H2O2KMnO4 + 14NaCl + 8H2SO4 = 2MnCl2 + 5Cl2 + K2SO4 + 7Na2SO4 + 8H2O
K2Cr2O7 + FeSO4 + KOH =Fe2(SO4)3 + Cr2O7 + H2O + K2SO4K2Cr2O7 - 2FeSO4 + 0KOH = -1Fe2(SO4)3 + Cr2O7 + 0H2O + K2SO4
K2Cr2O7 + FeSO4 + KOH =Fe2(SO4)3 + Cr2O7 + H2O + K2SO4K2Cr2O7 - 2FeSO4 + 0KOH = -1Fe2(SO4)3 + Cr2O7 + 0H2O + K2SO4
K2S(aq) + Pb(NO3)2(aq) = PbS(s) + KNO3(aq)K2S(aq) + Pb(NO3)2(aq) = PbS(s) + 2KNO3(aq)
KMnO4 + KNO2 + HCl = MnCl2 + KCl + KNO3 + H2O2KMnO4 + 5KNO2 + 6HCl = 2MnCl2 + 2KCl + 5KNO3 + 3H2O
KMnO4 + FeSO4+ H2SO4 = MnSO4 + Fe2(SO4)3 + KHSO4 + H2O2KMnO4 + 10FeSO4 + 9H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + 2KHSO4 + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+Na2C2O4+H2SO4=MnSO4+Na2SO4+K2SO4+H2O+CO22KMnO4 + 5Na2C2O4 + 8H2SO4 = 2MnSO4 + 5Na2SO4 + K2SO4 + 8H2O + 10CO2
KI+Cl2=KCl+I22KI + Cl2 = 2KCl + I2
K2MnO4 + H2O = KMnO4 + 2KOH + H22K2MnO4 + 2H2O = 2KMnO4 + 2KOH + H2
K2Cr2O3 + HI + HClO4 = K2ClO4 + Cr(ClO4)3 + I2 + H2O2K2Cr2O3 - 2HI + 14HClO4 = 2K2ClO4 + 4Cr(ClO4)3 - I2 + 6H2O
K2CO3 + HCl = KCl + CO2 + H2OK2CO3 + 2HCl = 2KCl + CO2 + H2O
K+MgBr2=KBr+Mg2K + MgBr2 = 2KBr + Mg
KMnO4=K2Mn4+MnO2+O22KMnO4 = K2Mn4 - 2MnO2 + 6O2
KMnO4=K2Mn4+MnO2+O22KMnO4 = K2Mn4 - 2MnO2 + 6O2
KCIO3=KCI+O22KCIO3 = 2KCI + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O + H2O = K(OH)K2O + H2O = 2K(OH)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCl + HNO3 = KNO3 + HClKCl + HNO3 = KNO3 + HCl
K2SO4+CaI2=CaSO4+KIK2SO4 + CaI2 = CaSO4 + 2KI
KI + H3PO4 = K3PO4 +HI3KI + H3PO4 = K3PO4 + 3HI
K4Fe(CN)6+KMnO4+H2SO4=K3Fe(CN)6+MnSO4+K2SO4+H2O5K4Fe(CN)6 + KMnO4 + 4H2SO4 = 5K3Fe(CN)6 + MnSO4 + 3K2SO4 + 4H2O
KOH + H = KH2OKOH + H = KH2O
K2CrO7+HCl=CrCl3+KCl+Cl2+H2O2K2CrO7 + 28HCl = 2CrCl3 + 4KCl + 9Cl2 + 14H2O
KClO3+H2SO4=O2+KHSO4+Cl2+H2O4KClO3 + 4H2SO4 = 5O2 + 4KHSO4 + 2Cl2 + 2H2O
KMnO4+HCl+H2S=MnCl2+KCl+S+H2O2KMnO4 + 6HCl + 5H2S = 2MnCl2 + 2KCl + 5S + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2CrO7+FeSO4+H2SO4=K2SO4+Cr2(SO4)3+H2O+Fe2(SO4)32K2CrO7 + 18FeSO4 + 14H2SO4 = 2K2SO4 + Cr2(SO4)3 + 14H2O + 9Fe2(SO4)3
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7+HCl=CrCl3+KCl+Cl2+H2OK2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 3Cl2 + 7H2O
K2O+H2O=2K(OH)K2O + H2O = 2K(OH)
K2Cr2O7 = K2O + Cr2O7 + O-1K2Cr2O7 = -1K2O - Cr2O7 + O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KMnO4+H2SO4=K2SO4+MnSO4+O2+H2O4KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 5O2 + 6H2O
KMnO4+H2SO4=K2SO4+MnSO4+O2+H2O4KMnO4 + 6H2SO4 = 2K2SO4 + 4MnSO4 + 5O2 + 6H2O
K 2 CrO 4 +Na2 SO3+HCl=KCl+Na 2 SO 4 +CrCl 3 +H 2 O 2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
KMnO4 + K2SO3 + HCl = MnO2 + K2SO4 + KCl + H2O2KMnO4 + 3K2SO3 + 2HCl = 2MnO2 + 3K2SO4 + 2KCl + H2O
K2Cr2O7 + AlCl3 = Al2(Cr2O7)3 + KCl3K2Cr2O7 + 2AlCl3 = Al2(Cr2O7)3 + 6KCl
KNO3+P=KNO2+P2O5 5KNO3 + 2P = 5KNO2 + P2O5
KNO2 + BaSO4 = K2SO4 + Ba(NO2)22KNO2 + BaSO4 = K2SO4 + Ba(NO2)2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K3PO4+NiCl2=Ni3(PO4)2+KCl2K3PO4 + 3NiCl2 = Ni3(PO4)2 + 6KCl
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO = KCl+O22KClO = 2KCl + O2
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K2O + H2O =KOHK2O + H2O = 2KOH
K + O2 =K2O4K + O2 = 2K2O
K2Cr2O7+KI+H2SO4=Cr2(SO4)3+I2+K2SO4+H2OK2Cr2O7 + 6KI + 7H2SO4 = Cr2(SO4)3 + 3I2 + 4K2SO4 + 7H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+HCl=KCl+MnCl2+H2O+Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KCO3 + PbNO3 = KNO3 + PbCO3KCO3 + PbNO3 = KNO3 + PbCO3
KCO3 + PbNO3 = KNO3 + PbCO3KCO3 + PbNO3 = KNO3 + PbCO3
KMnO4 +FeSO4 +H2SO4=MnSO4 +Fe(SO4)3+K2SO4+H200KMnO4 + 5FeSO4 + 10H2SO4 = 0MnSO4 + 5Fe(SO4)3 + 0K2SO4 + H20
KMnO4 + FeSO4 + H2SO4 = MnSO4 + Fe(SO4)3 + K2SO4 + H200KMnO4 + 5FeSO4 + 10H2SO4 = 0MnSO4 + 5Fe(SO4)3 + 0K2SO4 + H20
KMnO4 + FeSO4 + H2SO4 = MnSO4 + Fe(SO4)3 + K2SO4 + H200KMnO4 + 5FeSO4 + 10H2SO4 = 0MnSO4 + 5Fe(SO4)3 + 0K2SO4 + H20
KNO3+S=SO2+K2O+NO4KNO3 + 3S = 3SO2 + 2K2O + 4NO
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K2Cr2O7+SnCl2+HCl=CrCl3+SnCl4+KCl+H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KOH+H3PO4=K3PO4=H2O3KOH + H3PO4 = K3PO4 + 3H2O
KOH+H3PO4=K3PO4=H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4+ H2SO4 = Mn2O7+ K2SO4+ H2O2KMnO4 + H2SO4 = Mn2O7 + K2SO4 + H2O
KMnO4 = K2MnO4+MnO2+O2KMnO4 = K2MnO4 + MnO2 + 2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KClO3 + Na2SnO2 = KCl + Na2SnO3KClO3 + 3Na2SnO2 = KCl + 3Na2SnO3
K3PO4+Ca(NO3)2=Ca3(PO4)2+KNO32K3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6KNO3
KAl(SO4)2 + BaCl2 = BaSO4 + K + Al + ClKAl(SO4)2 + 2BaCl2 = 2BaSO4 + K + Al + 4Cl
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
KOH+MgSO4=Mg(OH)2+K2SO42KOH + MgSO4 = Mg(OH)2 + K2SO4
KI+Pb(NO3)2=KNO3+PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
KAl(SO4)2 + KOH = Al(OH)3 + K + SO4KAl(SO4)2 + 3KOH = Al(OH)3 + 4K + 2SO4
KNO3 + KI + H2SO4 = K2SO4 + I2 + NO + H2O2KNO3 + 6KI + 4H2SO4 = 4K2SO4 + 3I2 + 2NO + 4H2O
KF+BaSO4=BaF2+K2SO42KF + BaSO4 = BaF2 + K2SO4
KCl + MnO2 + H2SO4 = K2SO4 + MnSO4 + Cl2 + H2O2KCl + MnO2 + 2H2SO4 = K2SO4 + MnSO4 + Cl2 + 2H2O
K4Fe(CN)6 + O3 + H2O = K3Fe(CN)2 + KOH + O20K4Fe(CN)6 + 2O3 + 0H2O = 0K3Fe(CN)2 + 0KOH + 3O2
K4Fe(CN)6 + O3 + H2O = K3Fe(CN)2 + KOH + O20K4Fe(CN)6 + 2O3 + 0H2O = 0K3Fe(CN)2 + 0KOH + 3O2
K4Fe(CN)6 + O3 + H2O = K3Fe(CN)2 + KOH + O20K4Fe(CN)6 + 2O3 + 0H2O = 0K3Fe(CN)2 + 0KOH + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + H2SO4 + H2C2O4 = K2SO4 + MnSO4 + CO2 + H2O2KMnO4 + 3H2SO4 + 5H2C2O4 = K2SO4 + 2MnSO4 + 10CO2 + 8H2O
K2Cr2O7+ HI+ HCLO4 =KCLO4+ Cr(CLO4) + I2+ H2OK2Cr2O7 + 10HI + 4HCLO4 = 2KCLO4 + 2Cr(CLO4) + 5I2 + 7H2O
KMnO4+ H2SO4+ FeSO4 =K2SO4+ MnSO4+ Fe(SO4)3+ H2O4KMnO4 + 16H2SO4 + 5FeSO4 = 2K2SO4 + 4MnSO4 + 5Fe(SO4)3 + 16H2O
KClO3 + HI + H2SO4 = KHSO4 + HCl + I2 + H200KClO3 + 20HI + 0H2SO4 = 0KHSO4 + 0HCl + 10I2 + H20
KClO3 + Na2SnO2 = KCl + Na2SnO3KClO3 + 3Na2SnO2 = KCl + 3Na2SnO3
KClO3 + HI + H2SO4 = KHSO4 + HCl + I2 + H200KClO3 + 20HI + 0H2SO4 = 0KHSO4 + 0HCl + 10I2 + H20
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KBrO3 + KI + HBr = KBr + I2 + H2OKBrO3 + 6KI + 6HBr = 7KBr + 3I2 + 3H2O
K2Cr2O7+SnCl2+HCl=CrCl3+SnCl4+KCl+H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KMnO4+HBr=MnBr2+KBr+H2O+Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
KMnO4+HBr=MnBr2+KBr+H2O+Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
KClO3 + Na2SnO2 = KCl + Na2SnO3KClO3 + 3Na2SnO2 = KCl + 3Na2SnO3
KI + KMnO4 + H2O = I2 + MnO2 + KOH6KI + 2KMnO4 + 4H2O = 3I2 + 2MnO2 + 8KOH
KOH + HNO3 = KNO3 + H2OKOH + HNO3 = KNO3 + H2O
K + O2 = K2O4K + O2 = 2K2O
KMnO4 + H2SO4 + FeSO4 = K2SO4 + MnSO4 + Fe(SO4)3 + H2O4KMnO4 + 16H2SO4 + 5FeSO4 = 2K2SO4 + 4MnSO4 + 5Fe(SO4)3 + 16H2O
KClO3 + HI + H2SO4 = KHSO4 + HCl + I2 + H200KClO3 + 20HI + 0H2SO4 = 0KHSO4 + 0HCl + 10I2 + H20
KClO3+C=KCl+CO22KClO3 + 3C = 2KCl + 3CO2
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4+H2SO4+FeSO4=K2SO4+MnSO4+Fe2(SO4)3+H2O2KMnO4 + 8H2SO4 + 10FeSO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
K2Cr2O7 + HCl + KI = CrCl3 + KCl + I2 + H2OK2Cr2O7 + 14HCl + 6KI = 2CrCl3 + 8KCl + 3I2 + 7H2O
K+I2=KI2K + I2 = 2KI
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KOH + HNO3 = KNO3 + H2OKOH + HNO3 = KNO3 + H2O
KOH + Cl2 = KClO3 + KCl + H2O6KOH + 3Cl2 = KClO3 + 5KCl + 3H2O
KI+Pb(NO3)2=KNO3+PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
KMnO4+ CH3CH2OH=K2CO3+MnO2+H2O4KMnO4 + CH3CH2OH = 2K2CO3 + 4MnO2 + 3H2O
KI+Pb(NO3)2=KNO3+PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + H2SO4 + HNO2 = KHSO4 + MnSO4 + HNO3 + H2O2KMnO4 + 4H2SO4 + 5HNO2 = 2KHSO4 + 2MnSO4 + 5HNO3 + 3H2O
K + H2O = H2 + KOH 2K + 2H2O = H2 + 2KOH
KOH +H3PO4=K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
K(s)+Cl2(g)=KCl(s)2K(s) + Cl2(g) = 2KCl(s)
K(s)+Cl2(g)=KCl(s)2K(s) + Cl2(g) = 2KCl(s)
KMnO4+KCl+H2SO4=MnSO4+K2SO4+H2O+Cl22KMnO4 + 10KCl + 8H2SO4 = 2MnSO4 + 6K2SO4 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O3 + H2SO4 + O2 = KHSO4 + Cr2(SO4)3 + H2O2K2Cr2O3 + 10H2SO4 + O2 = 4KHSO4 + 2Cr2(SO4)3 + 8H2O
K2CrO4+Na2SO3+HCl=KCl+Na2SO4+CrCl3+H2O2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
KMnO4+FeSO4+H2SO4=KHSO4+Fe(SO4)3+MnSO4+H2O4KMnO4 + 5FeSO4 + 18H2SO4 = 4KHSO4 + 5Fe(SO4)3 + 4MnSO4 + 16H2O
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K + H2O = KOH + H22K + 2H2O = 2KOH + H2
K2Cr2O7 + HCl=KCl + CrCl3 + H2O + Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KClO3+CoCl2+H2O+KCl=KOH+CoCl3KClO3 + 6CoCl2 + 3H2O + 5KCl = 6KOH + 6CoCl3
KNO3+Al+KOH=NH3+KAlO2+H2O-3KNO3 - 8Al - 5KOH = -3NH3 - 8KAlO2 + 2H2O
KMnO4+H2SO4+K2C2O4=MnSO4+K2SO4+CO2+H2O2KMnO4 + 8H2SO4 + 5K2C2O4 = 2MnSO4 + 6K2SO4 + 10CO2 + 8H2O
K2Cr2O7+HCl=KCl+CrCl3+H2O+Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
K2Cr2O7+H2SO4=K2SO4+Cr2(SO4)3+H2O+O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
K2Cr2O7+H2SO4=K2SO4+Cr2(SO4)3+H2O+O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
KMnO4+HCl=KCl+MnCl2+Cl2+H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
K + MgBr2 = KBr + Mg2K + MgBr2 = 2KBr + Mg
KMnO4+H2SO4+H=K2SO4+MnSO4+H2O2KMnO4 + 3H2SO4 + 10H = K2SO4 + 2MnSO4 + 8H2O
KClO3 = KCl +O22KClO3 = 2KCl + 3O2
KClO3 = KCl +O22KClO3 = 2KCl + 3O2
K+Br2=KBr2K + Br2 = 2KBr
KMnO4+HCl=KCl+MnCl2+Cl2+H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
K2Cr2O7 + H2S + HCl = CrCl3 + S +KCl + H2O K2Cr2O7 + 3H2S + 8HCl = 2CrCl3 + 3S + 2KCl + 7H2O
K+ H 2 = K H2K + H2 = 2KH
K+ H 2 = K H2K + H2 = 2KH
KClO3(s) = KCl(s) + O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO + HCl = KCl + MnCl2 + H2O + Cl2-2KMnO - 4HCl = -2KCl - 2MnCl2 - 2H2O + Cl2
KMnO + HCl = KCl + MnCl2 + H2O + Cl2-2KMnO - 4HCl = -2KCl - 2MnCl2 - 2H2O + Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KMnO4 + FeSO4 + H2SO4 = K2SO4 + MnSO4 + H2O + Fe2(SO4)32KMnO4 + 10FeSO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 8H2O + 5Fe2(SO4)3
KMnO4 + FeSO4 + H2SO4 = K2SO4 + MnSO4 + H2O + Fe2(SO4)32KMnO4 + 10FeSO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 8H2O + 5Fe2(SO4)3
K2Cr2O7+H2SO4+H=K2SO4+Cr2(SO4)3+H2OK2Cr2O7 + 4H2SO4 + 6H = K2SO4 + Cr2(SO4)3 + 7H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2 2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KHCO3 = K2CO3 + CO2 + H2O2KHCO3 = K2CO3 + CO2 + H2O
KMnO4+H2SO4+(COOH)2=K2SO4+MnSO4+H2O+CO22KMnO4 + 3H2SO4 + 5(COOH)2 = K2SO4 + 2MnSO4 + 8H2O + 10CO2
KCIO3 = KCI + O22KCIO3 = 2KCI + 3O2
KMnO4 + KCl +H2SO4 = MnSO4 +K2SO4 +H2O + Cl22KMnO4 + 10KCl + 8H2SO4 = 2MnSO4 + 6K2SO4 + 8H2O + 5Cl2
K+H2O=KOH+H22K + 2H2O = 2KOH + H2
K+H2O=KOH+H2O0K + H2O = 0KOH + H2O
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KBr(aq) + Cl2(aq) = KCl(aq) + Br22KBr(aq) + Cl2(aq) = 2KCl(aq) + Br2
KMnO4 + KNO2 + HCl = MnCl2 + KCl + KNO3 + H2O2KMnO4 + 5KNO2 + 6HCl = 2MnCl2 + 2KCl + 5KNO3 + 3H2O
K4Fe(CN)6 + H2SO4 + H2O = K2SO4 + FeSO4 + (NH4)2SO4 + COK4Fe(CN)6 + 6H2SO4 + 6H2O = 2K2SO4 + FeSO4 + 3(NH4)2SO4 + 6CO
KMnO4 + Fe(OH)2 + H2O = Fe(OH)3 + MnO2 + KOH KMnO4 + 3Fe(OH)2 + 2H2O = 3Fe(OH)3 + MnO2 + KOH
K2MnO4+H2CO3=K2CO3+MnO2+KMnO4+H2O3K2MnO4 + 2H2CO3 = 2K2CO3 + MnO2 + 2KMnO4 + 2H2O
K2Cr2O7+HCl=Cl2+CrCl3+KCl+H2OK2Cr2O7 + 14HCl = 3Cl2 + 2CrCl3 + 2KCl + 7H2O
KMnO4+HCl=Cl2+MnCl2+KCl+H2O2KMnO4 + 16HCl = 5Cl2 + 2MnCl2 + 2KCl + 8H2O
K2Cr2O7+HCl=CrCl3+Cl2+KCl+H2OK2Cr2O7 + 14HCl = 2CrCl3 + 3Cl2 + 2KCl + 7H2O
KMnO4+Na2SO3+H2SO4=K2SO4+MnSO4+Na2SO4+H2O2KMnO4 + 5Na2SO3 + 3H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 3H2O
KMnO4+Na2SO3+H2SO4=K2SO4+MnSO4+Na2SO4+H2O2KMnO4 + 5Na2SO3 + 3H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 3H2O
K2Cr2O7+HCl=CrCl3+Cl2+KCl+H2OK2Cr2O7 + 14HCl = 2CrCl3 + 3Cl2 + 2KCl + 7H2O
KMnO4 + H2SO4 + HCl = KHSO3 + MnSO4 + H2O + Cl22KMnO4 + 4H2SO4 + 14HCl = 2KHSO3 + 2MnSO4 + 10H2O + 7Cl2
K2Cr2O7+KOH=K2CrO4+H2OK2Cr2O7 + 2KOH = 2K2CrO4 + H2O
KClO3 + FeSO4 + H2SO4 = KCl + Fe2(SO4)3 + H2OKClO3 + 6FeSO4 + 3H2SO4 = KCl + 3Fe2(SO4)3 + 3H2O
K2CrO4+Na2SO3+HCl=KCl+Na2SO4+CrCl3+H2O2K2CrO4 + 3Na2SO3 + 10HCl = 4KCl + 3Na2SO4 + 2CrCl3 + 5H2O
KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
K3PO4 + CuSO4 = K3SO4 + CuPO4K3PO4 + CuSO4 = K3SO4 + CuPO4
KCIO3=KCI+OKCIO3 = KCI + 3O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K+Cl2=KCl2K + Cl2 = 2KCl
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KF + BaBr = BaF + KBrKF + BaBr = BaF + KBr
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2O + Cl2 = KCl + O22K2O + 2Cl2 = 4KCl + O2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4 + HCl = KCl + MnCl2 + Cl2 + H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K3Fe(CN)6(aq) + Cr2O3(s) + KOH (aq) = K4Fe(CN)6 (aq) + K2CrO4 (aq) + H2O(l)6K3Fe(CN)6(aq) + Cr2O3(s) + 10KOH(aq) = 6K4Fe(CN)6(aq) + 2K2CrO4(aq) + 5H2O(l)
KMnO4(aq) + KCN(aq) + H2O (l) = MnO2(s) + KCNO (aq) + KOH(aq)2KMnO4(aq) + 3KCN(aq) + H2O(l) = 2MnO2(s) + 3KCNO(aq) + 2KOH(aq)
K2C4H4O6 (aq) + KClO3(aq) + KOH(aq) = K2CO3(aq) + KCl (aq) + H2O(l)3K2C4H4O6(aq) + 5KClO3(aq) + 18KOH(aq) = 12K2CO3(aq) + 5KCl(aq) + 15H2O(l)
KMnO4 (aq) + KIO (aq) + H2O(l) = MnO2(s) + KIO4(aq) + KOH(aq)2KMnO4(aq) + KIO(aq) + H2O(l) = 2MnO2(s) + KIO4(aq) + 2KOH(aq)
KMnO4(aq) + K2C2O4 (aq) + KOH(aq) = MnO2(s) + K2CO3 (aq) + H2O(l)2KMnO4(aq) + 3K2C2O4(aq) + 4KOH(aq) = 2MnO2(s) + 6K2CO3(aq) + 2H2O(l)
KMnO4 (aq) + K2C2O4(aq) + KOH (aq) = MnO2(s) + K2CO3 (aq) + H2O(l)2KMnO4(aq) + 3K2C2O4(aq) + 4KOH(aq) = 2MnO2(s) + 6K2CO3(aq) + 2H2O(l)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2S+O2=K2SO32K2S + 3O2 = 2K2SO3
KI+MnO2+H2SO4=I2+KHSO4+MnSO4+H2O2KI + MnO2 + 3H2SO4 = I2 + 2KHSO4 + MnSO4 + 2H2O
K2Cr2O7+HCl=KCl+CrCl3+H2O+Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
K3AsO4 + H2S = As2S5 + KOH + H2O2K3AsO4 + 5H2S = As2S5 + 6KOH + 2H2O
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
K2SO3(aq)+MnCl2(aq)=MnSO3(s)+KCl(aq)K2SO3(aq) + MnCl2(aq) = MnSO3(s) + 2KCl(aq)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
K(OH) + HCL = KCL + H2OK(OH) + HCL = KCL + H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+HCl = KCl+MnCl2+H2O+Cl2 2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4+HCl = K+MnCl2+H2O+Cl2KMnO4 + 8HCl = K + MnCl2 + 4H2O + 3Cl2
KOH + Cl2 = KClO3 + KCl + H2060KOH + 30Cl2 = 20KClO3 + 40KCl + 3H20
K2Cr2O7 + H2O + S = KOH + Cr2O3 + SO22K2Cr2O7 + 2H2O + 3S = 4KOH + 2Cr2O3 + 3SO2
KClO + H2O = H3O + KClKClO - 3H2O = -2H3O + KCl
K2SO4+BaBr2=K2Br2+SO4BaK2SO4 + BaBr2 = K2Br2 + SO4Ba
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2 2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2SO4(aq)+Ba(NO3)2(aq)=BaSO4(s)+KNO3(aq)K2SO4(aq) + Ba(NO3)2(aq) = BaSO4(s) + 2KNO3(aq)
KClO3 (s) = KCl (s) + O2 (g)2KClO3(s) = 2KCl(s) + 3O2(g)
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2 2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
K2Cr2O7 + HCl = KCl + CrCl3 + H2O + Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
K2Cr2O7 + HCl = KCl + CrCl3 + H2O + Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
KCN + Co(CN)2 + HCN = K3Co(CN)6 + H26KCN + 2Co(CN)2 + 2HCN = 2K3Co(CN)6 + H2
K2Cr2O7 + H2SO4 = K2SO4 + Cr2(SO4)3 + H2O +O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
K2Cr2O7 + HCl = KCl + CrCl3 + H2O +Cl2K2Cr2O7 + 14HCl = 2KCl + 2CrCl3 + 7H2O + 3Cl2
K2Cr2O7 + H2SO4 = K2SO4 + Cr2(SO4)3 + H2O +O22K2Cr2O7 + 8H2SO4 = 2K2SO4 + 2Cr2(SO4)3 + 8H2O + 3O2
KMnO4 + H2SO4 + Sb = K2SO4 + MnSO4 + Sb2O3 + H2O6KMnO4 + 9H2SO4 + 10Sb = 3K2SO4 + 6MnSO4 + 5Sb2O3 + 9H2O
KMnO4 + HCl = KCl + MnCl2 + Cl2 + H2O2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 5Cl2 + 8H2O
K3PO4+BaCl2=KCl+Ba3(PO4)22K3PO4 + 3BaCl2 = 6KCl + Ba3(PO4)2
K+O2=K2O4K + O2 = 2K2O
KNO3=KNO2+O22KNO3 = 2KNO2 + O2
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
KCIO3 = KCI + O22KCIO3 = 2KCI + 3O2
KMnO4 + H2SO4 = KMnSO7 + H2OKMnO4 + H2SO4 = KMnSO7 + H2O
K2SO4 + AlCl3 = KCl + Al2(SO4)33K2SO4 + 2AlCl3 = 6KCl + Al2(SO4)3
KNO3+S=SO2+K2O+NO4KNO3 + 3S = 3SO2 + 2K2O + 4NO
KNO3+S=SO2+KO2+NOKNO3 + 0S = 0SO2 + KO2 + NO
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KOH+H3PO4=K3PO4+H2O3KOH + H3PO4 = K3PO4 + 3H2O
KClO3=KCl+O22KClO3 = 2KCl + 3O2
K3AsO4+H2S = As2S5 + KOH +H2O2K3AsO4 + 5H2S = As2S5 + 6KOH + 2H2O
K3AsO4 + H2S = As2S5 + KOH + H2O 2K3AsO4 + 5H2S = As2S5 + 6KOH + 2H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KI + Pb(NO3)2 = PbI2 + KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
K + H2O = H2 + KOH2K + 2H2O = H2 + 2KOH
KOH + Cu(NO3)2 = KNO3 + Cu(OH)22KOH + Cu(NO3)2 = 2KNO3 + Cu(OH)2
KNO3 = KNO2 + O22KNO3 = 2KNO2 + O2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KHF2 = KF + H2 + F22KHF2 = 2KF + H2 + F2
KClO3 = KCl + O22KClO3 = 2KCl + 3O2
KI + KClO3 + HCl = I2 +H2O + KCl 6KI + KClO3 + 6HCl = 3I2 + 3H2O + 7KCl
KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
K2Co3+ZnCl2=ZnCo3+KClK2Co3 + ZnCl2 = ZnCo3 + 2KCl
K+ Mn + O2 = KMnO4K + Mn + 2O2 = KMnO4
K2O + MnO + O2 = KMnO42K2O + 4MnO + 5O2 = 4KMnO4
K+N2 = K3N6K + N2 = 2K3N
KMnO4 + K2SO3 + H20 = MnO2 + K2SO4 + KOH20KMnO4 + 20K2SO3 + H20 = 20MnO2 + 20K2SO4 + 20KOH
KMnO4 + K2SO3 + H20 = MnO2 + K2SO4 + KOH20KMnO4 + 20K2SO3 + H20 = 20MnO2 + 20K2SO4 + 20KOH
KOH+H2SO4=KSO4+HOH2KOH + H2SO4 = KSO4 + HOH2
KMnO4 + K2SO3 + H20 = MnO2 + K2SO4 + KOH20KMnO4 + 20K2SO3 + H20 = 20MnO2 + 20K2SO4 + 20KOH
K + N2 = K3N6K + N2 = 2K3N
K2PtCl6 + N2H4 = Pt + HCl + KCl+N2K2PtCl6 + N2H4 = Pt + 4HCl + 2KCl + N2
K2PtCl6 + N2H4 = Pt + NH3 + KCl+N20K2PtCl6 + 3N2H4 = 0Pt + 4NH3 + 0KCl + N2
K2PtCl6 + N2H4 = Pt + NH3 + KCl+N20K2PtCl6 + 3N2H4 = 0Pt + 4NH3 + 0KCl + N2
K+N2=KN2K + N2 = 2KN
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO 3 = KCl + O 2 2KClO3 = 2KCl + 3O2
KNO2 + O2 = KNO32KNO2 + O2 = 2KNO3
KCLO3=KCL+O22KCLO3 = 2KCL + 3O2
KCN+H2SO4 = K2SO4+HCN2KCN + H2SO4 = K2SO4 + 2HCN
K + N2= KN2K + N2 = KN2
KO2 + H2O = KOH + O24KO2 + 2H2O = 4KOH + 3O2
KNO3 + H2CO3 = K2CO3 + HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + FeSO4 + H2SO4 = MnSO4 + Fe2(SO4)3 + K2SO4 + H2O2KMnO4 + 10FeSO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
K2Cr2O7 + SnCl2 + HCl = CrCl3 + SnCl4 + KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
KMnO4 + HBr = MnBr2 + KBr + H2O + Br22KMnO4 + 16HBr = 2MnBr2 + 2KBr + 8H2O + 5Br2
K2Cr2O7 + HCl = CrCl3 + KCl + H2O + Cl2K2Cr2O7 + 14HCl = 2CrCl3 + 2KCl + 7H2O + 3Cl2
KClO3=KCl+O22KClO3 = 2KCl + 3O2
KOH+FeCl3=KCl+Fe(OH)33KOH + FeCl3 = 3KCl + Fe(OH)3
KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2KMnO4 + 3(HO2C)2 = 6CO2 + 2H2O + KMn(OH)2
K3PO4 + Ca(NO3)2 = Ca3(PO4)2 + KNO32K3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6KNO3
K(s) + H2O(l) = KOH(aq) + H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
K2Cr2O7 + KI + H3PO4 = I2 + CrPO4 + K3PO4 + H2O3K2Cr2O7 + 18KI + 14H3PO4 = 9I2 + 6CrPO4 + 8K3PO4 + 21H2O
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KMnO4 + HCl = KCl + MnCl2 + H2O + Cl22KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
KClO3 + KI + H2O = KCl + KOH + I2KClO3 + 6KI + 3H2O = KCl + 6KOH + 3I2
K(s) + H2O(l) = KOH(aq) + H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
KMnO4 + H2SO4 + FeSO4 = K2SO4+ MnSO4 + Fe2 (SO4)3 +H2O2KMnO4 + 8H2SO4 + 10FeSO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
KMnO4 + H2SO4 =K2SO4 + MnSO4 + H2O +O36KMnO4 + 9H2SO4 = 3K2SO4 + 6MnSO4 + 9H2O + 5O3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.