Enter Chemical Equation:

Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
IO3- + H2O + SO2 = I2 + SO42- + H+-158IO3- + 74H2O - 10SO2 = -79I2 - 10SO42- + 148H+
I 2 + H Cl O + H2 O= HI O3 + HClI2 + 5HClO + H2O = 2HIO3 + 5HCl
I2 + HNO3= HIO3 +NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I2+Na2S2O3=NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2 + HNO3 = HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3 =HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I- + IO3- + H+ = I2 + H2O 5I- + IO3- + 6H+ = 3I2 + 3H2O
I- + IO3- + H+ = I2 + H2O 5I- + IO3- + 6H+ = 3I2 + 3H2O
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
IO3- + I- + H+ = I3- + H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
IrCl4(s) + H2O(g) = IrO2(s) + HCl(g)IrCl4(s) + 2H2O(g) = IrO2(s) + 4HCl(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
I2O5+CO=CO2+I2I2O5 + 5CO = 5CO2 + I2
I2O5+CO=CO2+I2I2O5 + 5CO = 5CO2 + I2
I2+Co=2I-+Co2+I2 + 4Co = 2I- + 2Co2+
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
In(s) + I2(s) = In2I6(s)2In(s) + 3I2(s) = In2I6(s)
I2O5+BrF3=IF5+O2+Br26I2O5 + 20BrF3 = 12IF5 + 15O2 + 10Br2
IrCl4(s) + H2O(g) = IrO2(s) + HCl(g) IrCl4(s) + 2H2O(g) = IrO2(s) + 4HCl(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g) 2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IBr + NH3 = NI3 + NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
IO3- + 3SO3 2- = I- + 3SO4 2-10IO3- + 3SO32- = 10I- + 3SO42-
IO3- + 3SO3 2- = I- + 3SO4 2-10IO3- + 3SO32- = 10I- + 3SO42-
IO3- + 3SO32- = I- + 3SO42-10IO3- + 3SO32- = 10I- + 3SO42-
I2 + HNO3 = 2HIO3 + 6NO2 + H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I2 + HNO3 = 2HIO3 + 6NO2 + HI2 + 6HNO3 = 2HIO3 + 6NO2 + 4H
IrCl3+NaOH=HCl+Ir2O3+NaCl2IrCl3 + 3NaOH = 3HCl + Ir2O3 + 3NaCl
I2+H2=HII2 + H2 = 2HI
I2+H2=HII2 + H2 = 2HI
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g) 2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
In + I2 = In2I62In + 3I2 = In2I6
IrCl4(s) + H2O(g) = IrO2(s) + HCl(g)IrCl4(s) + 2H2O(g) = IrO2(s) + 4HCl(g)
In(s) + I2 = In2I6(s)2In(s) + 3I2 = In2I6(s)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
In(s) + I2 = In2I6(s)2In(s) + 3I2 = In2I6(s)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
Ir(s) + H2SO4(aq)= Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
Ir + H2SO4 = Ir2(SO4)3 + H22Ir + 3H2SO4 = Ir2(SO4)3 + 3H2
I2+HNO3=HIO3+NO2+H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
IrCl4(s) + H2O(g) = IrO2(s) + HCl(g)IrCl4(s) + 2H2O(g) = IrO2(s) + 4HCl(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2O5+CO=I2+CO2I2O5 + 5CO = I2 + 5CO2
In(s) + H2SO4(aq) = In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
IBr + NH3 = NI3 + NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + CO = CO2 + I2O5I2 - 5CO = -5CO2 + I2O5
ICl+H2O=Cl-+IO3-+I2+H+5ICl + 3H2O = 5Cl- + IO3- + 2I2 + 6H+
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2 + HNO3=HIO3 + NO + H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
I2 + OH- = IO3- + I- + H2030I2 + 60OH- = 20IO3- + 40I- + 3H20
I2+HNO3 = HIO3 + NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2O5 + BrF3 = IF5 + O2 + BrF22I2O5 + 20BrF3 = 4IF5 + 5O2 + 20BrF2
IBr + NH3 = NI3 + NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I- + O2= O2- + I-3I- - 2O2 = -2O2- + I-3
I2+H2O=I2H2OI2 + H2O = I2H2O
I2O5 + CO(OH)3 = CO(IO3)3 + H2O3I2O5 + 2CO(OH)3 = 2CO(IO3)3 + 3H2O
IO3 + HSO3 = I2 + SO4 + H2O2IO3 + 4HSO3 = I2 + 4SO4 + 2H2O
I2 +10HNO3 = HIO3 + NO2 + H205I2 + 30HNO3 = 10HIO3 + 30NO2 + H20
I2 + NaOH = NaI2 + NaIO3 + H2050I2 + 60NaOH = 40NaI2 + 20NaIO3 + 3H20
IrCl2 + KOH + KClO3 = Ir2O3 + KCl + H2O6IrCl2 + 12KOH + KClO3 = 3Ir2O3 + 13KCl + 6H2O
I2O5 + 5CO = I2 + 5CO2I2O5 + 5CO = I2 + 5CO2
I2O5 + 5CO = I2 + 5CO2I2O5 + 5CO = I2 + 5CO2
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
ICl(s) 1 H2O(l) =HCl(aq) 1 HIO(aq)ICl(s)1H2O(l) = HCl(aq)1HIO(aq)
I2+OH-=IO3-+I-+H2O3I2 + 6OH- = IO3- + 5I- + 3H2O
I2+OH-=IO3-+I-+H2O3I2 + 6OH- = IO3- + 5I- + 3H2O
Ir + F2 = IrF6Ir + 3F2 = IrF6
I2 + NO3- + H+ = IO3- + NO2 + H205I2 + 30NO3- + 20H+ = 10IO3- + 30NO2 + H20
I2+IO3-+H++Cl-=ICl2-+H2O2I2 + IO3- + 6H+ + 10Cl- = 5ICl2- + 3H2O
I2+IO3+HCl=ICl2+H2OI2 + IO3 + 6HCl = 3ICl2 + 3H2O
I2+BaCl2=BaI2+Cl2I2 + BaCl2 = BaI2 + Cl2
IO3-+I-+H+=3I2+H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
IO3-+I-+H+=I2+ H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2O5 + H2S = I2 + SO2 + H2O3I2O5 + 5H2S = 3I2 + 5SO2 + 5H2O
I2+Na2S2O3 = NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 + Na2S2O3 = NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2 (s) + NaBH4 (s) =H2 (g) + NaI (s) +B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
I2 + NaBH4 = H2 + NaI + B2H6 I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2O3+H2O = HIO2I2O3 + H2O = 2HIO2
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + NaBH4 = H2 + NaI + B2H6I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 + NaBH4 = H2 + NaI +B2H6I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 +NaBH4 = H2 + NaI + B2H6I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 + NaBH4 = H2 + NaI + B2H6I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 + HNO3=NO + HIO3 +H2O3I2 + 10HNO3 = 10NO + 6HIO3 + 2H2O
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2+NaBH4=H2+NaI+B2H6I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 + HNO3=NO + HIO3 +H2O3I2 + 10HNO3 = 10NO + 6HIO3 + 2H2O
I2 + NaBH4 = H2 + NaI + B2H6I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2+NaBH=H2+NaI+B2H6I2 + 2NaBH = -2H2 + 2NaI + B2H6
I2 + HNO3 = HIO3 + NO2 + H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I2 + NaBH4 = H2 + NaI + B2H6 I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) + B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2+HNO3=NO+HIO3+H2O3I2 + 10HNO3 = 10NO + 6HIO3 + 2H2O
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2 + Na2S2O3 = NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2 + KIO3 + 6HCl = 5ICl + KCl + 3H2O2I2 + KIO3 + 6HCl = 5ICl + KCl + 3H2O
I2+HNO3=NO+HIO3+H2O3I2 + 10HNO3 = 10NO + 6HIO3 + 2H2O
I2 + NaBH4 = H2 + NaI +B2H6I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 + HNO3 =HIO3 + NO2 + H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I2 (s) + NaBH4 (s) = H2 (g) + NaI (s) +B2H6 (g)I2(s) + 2NaBH4(s) = H2(g) + 2NaI(s) + B2H6(g)
I2 + IO3- + H+ + Cl- = ICl2- + H2O2I2 + IO3- + 6H+ + 10Cl- = 5ICl2- + 3H2O
I+ HNO3 = NO + HIO3 + H2O3I + 5HNO3 = 5NO + 3HIO3 + H2O
I2+Br2=IBrI2 + Br2 = 2IBr
I2 + IO3- + H+ + Cl- = ICl2- + H2O2I2 + IO3- + 6H+ + 10Cl- = 5ICl2- + 3H2O
I2+NaF=F2 +NaII2 + 2NaF = F2 + 2NaI
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + S2- = I- + SI2 + 2S2- = 2I- + 4S
I2 + S2- + H2O = I- + SO4 2- + H+167I2 + 2S2- + 168H2O = 334I- + 4SO42- + 336H+
I2O5+CO=CO2+I2I2O5 + 5CO = 5CO2 + I2
IO3- + HSO4- = I-+ SO4-- + H+0IO3- + HSO4- = 0I- + SO4-- + H+
IK+Pb(NO3)2=PbI2+KNO32IK + Pb(NO3)2 = PbI2 + 2KNO3
I2 + Na2S2O3= NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2 + HNO3 = HIO3 + 6NO2 + H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I2+H2=HII2 + H2 = 2HI
I2+H2=HII2 + H2 = 2HI
IO3- + SO2 + H2O = I2 + H+ SO40IO3- + SO2 + 2H2O = 0I2 + 4H + SO4
I2+HNO3 = HIO3 (aq) + NO2 + H2OI2 + 10HNO3 = 2HIO3(aq) + 10NO2 + 4H2O
IO3- = I- + OIO3- = I- + 3O
I + Cl2 = ICl2I + Cl2 = ICl2
IsO5+H2S=Is+SO2+H2O3IsO5 + 5H2S = 3Is + 5SO2 + 5H2O
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2O5+H2O=2HIO3I2O5 + H2O = 2HIO3
I2 + HNO3=HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3=HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3=HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3=HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3=HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3=HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3=HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + NaBH4 = H2 + NaI + B2H6 I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2 + NaBH4 = H2 + NaI + B2H6 I2 + 2NaBH4 = H2 + 2NaI + B2H6
I2+Cr(OH)3+KCl O3 = KI + K2CrO4 +H2O+Cl2-7I2 + 12Cr(OH)3 + 10KClO3 = -14KI + 12K2CrO4 + 18H2O + 5Cl2
I2 + H+ + NO--- = IO--- + NO2 + H20-5I2 + 60H+ + 10NO--- = -10IO--- + 10NO2 + 3H20
I2 + H+ + NO3- = IO3- + NO2 + H205I2 + 20H+ + 30NO3- = 10IO3- + 30NO2 + H20
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2+HNO3=NO+HIO3+H2O3I2 + 10HNO3 = 10NO + 6HIO3 + 2H2O
I2+HNO3=HIO3+6NO2+2H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
IO3- + I- + H + = I3- + H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2 + 5Cl2 + 6H2O = 2HIO3 + 10HClI2 + 5Cl2 + 6H2O = 2HIO3 + 10HCl
I2 + 5Cl2 + 6H2O = 2HIO3 + 10HClI2 + 5Cl2 + 6H2O = 2HIO3 + 10HCl
I2 + NO3- + H+ = IO3- + NO + H2O3I2 + 10NO3- + 4H+ = 6IO3- + 10NO + 2H2O
IO3 + I- + H2SO4 = I2 + H2O + SO2-2IO3 + 0I- + 6H2SO4 = -1I2 + 6H2O + 6SO2
IO3- + I- + OH- = I2 + H2O-1IO3- - 5I- + 6OH- = -3I2 + 3H2O
I + O3 + H = HIO3I + O3 + H = HIO3
I2O5+CO=I2+CO2I2O5 + 5CO = I2 + 5CO2
Ir+3 + H-1 = IrH3Ir+3 + 3H-1 = IrH3
I2 + Na2S2O3 = NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
IBr + (BrO3)- + H+ = (IO3)- + Br- + H2O-3IBr - 2(BrO3)- + 6H+ = -3(IO3)- - 5Br- + 3H2O
I- + (H3O)+ + (MnO4)- = H2O + I2 + Mn++10I- + 16(H3O)+ + 2(MnO4)- = 24H2O + 5I2 + 2Mn++
IO3- + I- + OH- = I2 + H2O-1IO3- - 5I- + 6OH- = -3I2 + 3H2O
I2+F2 = IFI2 + F2 = 2IF
I2+SO2+H2O+CH3OH+B=BH++I-+CH3OSO3-I2 + SO2 + H2O + CH3OH + 3B = 3BH+ + 2I- + CH3OSO3-
I2+SO2+H2O+CH3OH+B=BH-+I-+CH3OSO3--2I2 + SO2 + H2O + CH3OH + 3B = 3BH- - 4I- + CH3OSO3-
I2+SO2+H2O+CH3OH+B=BH-+I-+CH3OSO-3-1I2 + SO2 - H2O + CH3OH - B = -1BH- - 2I- + CH3OSO-3
I2+Na2S=NaI+S22I2 + 2Na2S = 4NaI + S2
I2O5(s)+CO(g)=I2(g)+CO2(g)I2O5(s) + 5CO(g) = I2(g) + 5CO2(g)
I2 + HSO3- + H2O = I- + SO4-- + H+ I2 + HSO3- + H2O = 2I- + SO4-- + 3H+
I2 + NaOH = NaI + NaIO3 + H2O3I2 + 6NaOH = 5NaI + NaIO3 + 3H2O
I2+Na2S2O3=NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + OCl- + H2O = IO3- + Cl- + H+I2 + 5OCl- + H2O = 2IO3- + 5Cl- + 2H+
I + 5 HNO3 = 2 H2O + HIO3 + 5 NO2I + 5HNO3 = 2H2O + HIO3 + 5NO2
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IrCl3+NaOH=Ir2O3+HCl+NaCl2IrCl3 + 3NaOH = Ir2O3 + 3HCl + 3NaCl
IO3+H=I2+H2O2IO3 + 12H = I2 + 6H2O
I2 + Na2S2O3 =NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2O5+C=I2+CO22I2O5 + 5C = 2I2 + 5CO2
I2O5+C=I2+CO22I2O5 + 5C = 2I2 + 5CO2
I2O5+C=I2+CO22I2O5 + 5C = 2I2 + 5CO2
IO3-+2H+e-=IO2+H2O2IO3- + 4H - e- = 2IO2 + 2H2O
IO3+2H+e-=IO2+H2OIO3 + 2H + 0e- = IO2 + H2O
IO3 + I- + H2SO4 = I2 + H2O + SO2-2IO3 + 0I- + 6H2SO4 = -1I2 + 6H2O + 6SO2
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IO3-+Sn2+ +H+ =I-+Sn4+H2OIO3- - 6Sn2+ + 6H+ = I- - 3Sn4 + 3H2O
IO3-+Sn2+=I-+Sn4+OIO3- + 0Sn2+ = I- + 0Sn4 + 3O
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
IO3- + I- + H2So4 = I2 + H2O + So4 2-7IO3- - 5I- + 21H2So4 = I2 + 21H2O + 2So42-
IO3- + I- + H2So4 = I2 + H2O + So4IO3- - I- + 3H2So4 = 0I2 + 3H2O + 3So4
IO3- + H2SO3 = I2 + H2O + SO42- + H+-158IO3- - 10H2SO3 = -79I2 - 84H2O - 10SO42- + 148H+
IO3- + H2SO3 = I2 + H2O + SO42- + H+-158IO3- - 10H2SO3 = -79I2 - 84H2O - 10SO42- + 148H+
IO3- + H2SO4 = I2 + H2O + SO42- + H+-154IO3- - 10H2SO4 = -77I2 - 82H2O - 10SO42- + 144H+
IO3 + I- + H2SO4 = I2 + H2O + SO2-2IO3 + 0I- + 6H2SO4 = -1I2 + 6H2O + 6SO2
I2 + Na2S2O3 = Na2S4O6 + NaI I2 + 2Na2S2O3 = Na2S4O6 + 2NaI
IO3+H3AsO3=I+H3AsO4IO3 + 3H3AsO3 = I + 3H3AsO4
IO3 + I- + H2SO4 = I2 + H2O + SO2-2IO3 + 0I- + 6H2SO4 = -1I2 + 6H2O + 6SO2
IO3- + I- + H2SO4 = I2 + H2O + SO2-1IO3- + I- + 3H2SO4 = 0I2 + 3H2O + 3SO2
I2 + CABr2 = CAI2 + Br2I2 + CABr2 = CAI2 + Br2
I2 + HNO3 = HIO3 + NO2 + H205I2 + 30HNO3 = 10HIO3 + 30NO2 + H20
I2 + HNO3 = HIO3 + 6NO2 + 2H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I- + IO3- + H2SO4 = I2 + SO4-- + H2O5I- + IO3- + 3H2SO4 = 3I2 + 3SO4-- + 3H2O
I- + IO3- + H2SO4 = I2 SO4-- + H2O5I- + IO3- + 3H2SO4 = 3I2SO4-- + 3H2O
I2+CI2+H2O=HIO3+HCI-2I2 + 5CI2 + 3H2O = HIO3 + 5HCI
I2 + H2 = HII2 + H2 = 2HI
I2 +HNO3 = HIO3 +NO2+ H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
IO4- + I- + H+ = I3- + H2OIO4- + 11I- + 8H+ = 4I3- + 4H2O
In(s) + SbO2-(aq) + 2 H2O(l) = In(OH)3(s) + Sb(s) + OH-(aq)In(s) + SbO2-(aq) + 2H2O(l) = In(OH)3(s) + Sb(s) + OH-(aq)
IO3 + I- + H+ = I+ + H2O2IO3 + 5I- + 12H+ = 7I+ + 6H2O
I2O5 + BrF3 = IF5 + O2 + BrF22I2O5 + 20BrF3 = 4IF5 + 5O2 + 20BrF2
I + O3 + H = HIO3I + O3 + H = HIO3
IO3- + I- + OH- = I2 + H2O-1IO3- - 5I- + 6OH- = -3I2 + 3H2O
I2 + KOH = KI + KIO3 + H2O3I2 + 6KOH = 5KI + KIO3 + 3H2O
I- +O3 +H+ = HIO3I- + O3 + H+ = HIO3
IO3-(aq) + I-(aq) + OH-(aq) = I2 + H2O-1IO3-(aq) - 5I-(aq) + 6OH-(aq) = -3I2 + 3H2O
I2O5 + H2S= I2+ S2O+H2O3I2O5 + 10H2S = 3I2 + 5S2O + 10H2O
IO3 + H2O = H5IO6 + H+ + e-2IO3 + 6H2O = 2H5IO6 + 2H+ + e-
IO3- + SO2 +H2O = I2+ SO42- + H+-158IO3- - 10SO2 + 74H2O = -79I2 - 10SO42- + 148H+
I03 + H3AsO3 + HCl = ICl2 + H3AsO4 +H2010I03 + 0H3AsO3 + 60HCl = 30ICl2 + 0H3AsO4 + 3H20
I03 + H3AsO3 + HCl = ICl2 + H3AsO4 +H2010I03 + 0H3AsO3 + 60HCl = 30ICl2 + 0H3AsO4 + 3H20
I2+Na=NaII2 + 2Na = 2NaI
I2 + 5Cl2 = 2ICl5 I2 + 5Cl2 = 2ICl5
IBr+NH3=NI3+NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
ICl3+H2O =ICl+HIO3+HCl2ICl3 + 3H2O = ICl + HIO3 + 5HCl
I2+Na2S2O3=NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2+Na2S2O3=NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2(s) + Na2S2O3(aq) = Na2S4O6(aq) + NaI(aq) I2(s) + 2Na2S2O3(aq) = Na2S4O6(aq) + 2NaI(aq)
I + F = I3F3I + F = I3F
IO3- + I- + OH- = I2 + H2O-1IO3- - 5I- + 6OH- = -3I2 + 3H2O
I- + O3 + H+ = HIO3I- + O3 + H+ = HIO3
I-+ O2+ H2O= I2+OH-4I- + O2 + 2H2O = 2I2 + 4OH-
I-+ O2+ H2O= I2+OH-4I- + O2 + 2H2O = 2I2 + 4OH-
In2S3 + SrBr2= InBr3 + SrSIn2S3 + 3SrBr2 = 2InBr3 + 3SrS
IO3+S2=O3S+I2IO3 + S2 = 2O3S + 2I
IO3+S2=O3S+I2IO3 + S2 = 2O3S + 2I
IO3- + H3AsO3 = I- + H3AsO4IO3- + 3H3AsO3 = I- + 3H3AsO4
IO3- + H3AsO3 = I- + H3AsO4IO3- + 3H3AsO3 = I- + 3H3AsO4
I2+CI2+H2O=HIO3+HCI-2I2 + 5CI2 + 3H2O = HIO3 + 5HCI
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
I + Cl2 = I3Cl6I + Cl2 = 2I3Cl
In(s) + H2SO4(aq) =In2(SO4)3(s) + H2(g)2In(s) + 3H2SO4(aq) = In2(SO4)3(s) + 3H2(g)
I2(s) + O2(g) = IOI2(s) + O2(g) = 2IO
I- + SO42-+H+ = H2SO3+I2+H2O158I- + 2SO42- + 160H+ = 2H2SO3 + 79I2 + 78H2O
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
IO3- + I- + H+ = I2 + H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
IO3- + I- + H+ = I2 + H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2(s)+NH3(aq) = NI3(s)+HI(aq)3I2(s) + NH3(aq) = NI3(s) + 3HI(aq)
IO3- + I- +HCl=(ICl2)- +H2O IO3- + 2I- + 6HCl = 3(ICl2)- + 3H2O
IO3- + I- +HCl=ICl2- +H2O IO3- + 2I- + 6HCl = 3ICl2- + 3H2O
IO3- + I- +HCl=ICl2-- +H2O +I22IO3- + 10I- + 12HCl = 6ICl2-- + 6H2O + 3I2
I2+F2=IF3I2 + 3F2 = 2IF3
I2 + C6H8O6 = C6H6O6 + H+ + I-I2 + C6H8O6 = C6H6O6 + 2H+ + 2I-
IO3- + I- + H+ = I2 +H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
IO3- + I- + H+ = I2 +H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2 + HNO3 = NO + HIO3 + H2O3I2 + 10HNO3 = 10NO + 6HIO3 + 2H2O
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
IO3-(aq) +H2SO3(aq) + H+ = I2(aq) + SO4--(aq) +H2O(l)2IO3-(aq) + 5H2SO3(aq) - 8H+ = I2(aq) + 5SO4--(aq) + H2O(l)
I2 + C6H8O6 = C6H6O6 + H+ + I-I2 + C6H8O6 = C6H6O6 + 2H+ + 2I-
I2 + C6H8O6 = C6H6O6 + 2H+ + 2I-I2 + C6H8O6 = C6H6O6 + 2H+ + 2I-
I2+2e-=2I-I2 + e- = 2I-
I2 + 10HNO = HIO3 + NO2+ H2O-3I2 + 10HNO = -6HIO3 + 10NO2 + 8H2O
Ir(s) + H2SO4(aq) = Ir2(SO4)3(s) + H2(g)2Ir(s) + 3H2SO4(aq) = Ir2(SO4)3(s) + 3H2(g)
I2 + HNO3 = HIO3 + NO2 + H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
IO3-+I-+H+=I2+H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2 + Na2S2O3 = Na2S4O6 + NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I2(s) + Na2S2O3(aq) = Na2S4O6(aq) + NaI(aq)I2(s) + 2Na2S2O3(aq) = Na2S4O6(aq) + 2NaI(aq)
I2+Cu2+ + OH= IO3+ Cu+ + H2OI2 + 0Cu2+ + 12OH = 2IO3 + 0Cu+ + 6H2O
I2(s) + Na2S2O3(aq) = Na2S4O6(aq) + NaI(aq)I2(s) + 2Na2S2O3(aq) = Na2S4O6(aq) + 2NaI(aq)
I2(s) +Na2S2O3(aq) =Na2S4O6(aq) +NaI(aq)I2(s) + 2Na2S2O3(aq) = Na2S4O6(aq) + 2NaI(aq)
I2 + Na2S2O3 = Na2S4O6 + NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I2 + H2O = I- + IO3- + H3O+3I2 + 9H2O = 5I- + IO3- + 6H3O+
I2+Na2S2O3=Na2S4O6+NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I2(s) + Na2S2O3(aq) = Na2S4O6(aq) + NaI(aq)I2(s) + 2Na2S2O3(aq) = Na2S4O6(aq) + 2NaI(aq)
IO3- + I- + 6 H+ = I2 + 3 H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I2(s) + 6H2O(l) = 2IO3(aq) + 12H(aq)I2(s) + 6H2O(l) = 2IO3(aq) + 12H(aq)
I2(s) + 6H2O(l) = 2IO3 + 12HI2(s) + 6H2O(l) = 2IO3 + 12H
IO3- + 8I- + 6H+ = 3I3- + 3H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
I2+Li=LiII2 + 2Li = 2LiI
IO3- + I- + 6 H+ = I2 + 3 H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I2(s)+Cl2(g)=ICl5(s) I2(s) + 5Cl2(g) = 2ICl5(s)
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
IBr + NH3 = NH4Br + NI33IBr + 4NH3 = 3NH4Br + NI3
IO- + SeO3 2- = I- + SeO4 2-10IO- + SeO32- = 10I- + SeO42-
IO- + SeO3 -2 = I- + SeO4 -2IO- + SeO3-2 = I- + SeO4-2
IO- + SeO32- = I- + SeO42-10IO- + SeO32- = 10I- + SeO42-
I2 + 6 H2O = 12 H + 2 IO3I2 + 6H2O = 12H + 2IO3
I2+NaHSO3+H2O=NaHSO4+HII2 + NaHSO3 + H2O = NaHSO4 + 2HI
I2+Cl2=IClI2 + Cl2 = 2ICl
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I2+2HNO3=2HIO3+NO2+H2613I2 + 78HNO3 = 26HIO3 + 78NO2 + 2H26
I2+2HNO3=2HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
ICl3 + HNO3 = NOCl + HIO3 + H2O + Cl23ICl3 + 5HNO3 = 5NOCl + 3HIO3 + H2O + 2Cl2
I2O5 + BrF3 = IF5 + O2 + BrF22I2O5 + 20BrF3 = 4IF5 + 5O2 + 20BrF2
IO3- + I- + H+ = I2 + H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
I2+KOH=KIO3+KI+H2O3I2 + 6KOH = KIO3 + 5KI + 3H2O
IO3-+I-+H+=I2+H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2O5 + H2S = I2 +SO2 +H2O3I2O5 + 5H2S = 3I2 + 5SO2 + 5H2O
I2+HNO3 = HIO3+NO2+H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I2 + NO3 = NO2 + IO2I2 + 4NO3 = 4NO2 + 2IO2
I2 + NO3 = NO2 + IO2I2 + 4NO3 = 4NO2 + 2IO2
I2(s)+Cl2(g)=ICl5(s)I2(s) + 5Cl2(g) = 2ICl5(s)
I2O5+CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IO - + 2 I- + 6 H+ + 3 Cl- = + 3 ICl + 3 H O2IO- - I- + 2H+ + Cl- = ICl + 2HO
I2+KClO3+H2O=KIO3+HI+HCl0I2 + KClO3 + 0H2O = KIO3 - HI + HCl
I2 + Cl2 + H2O = HIO3 + HClI2 + 5Cl2 + 6H2O = 2HIO3 + 10HCl
I2 + HNO3 = HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3 =HIO3 +NO2 +H2O I2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2O5+CO = 6CO2+I2I2O5 + 5CO = 5CO2 + I2
I2+HNO3 = HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IF5+H2O=HF+I2O52IF5 + 5H2O = 10HF + I2O5
IF5+H2O=HIO3+HFIF5 + 3H2O = HIO3 + 5HF
I2O5 + H2S = I2 + SO2 + H2O3I2O5 + 5H2S = 3I2 + 5SO2 + 5H2O
I2 + OH- = I3- + IO3- + H2O8I2 + 6OH- = 5I3- + IO3- + 3H2O
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2+Cl2+H2O=HIO2+HClI2 + 3Cl2 + 4H2O = 2HIO2 + 6HCl
I2+Cl2+H2O=HIO2+HClI2 + 3Cl2 + 4H2O = 2HIO2 + 6HCl
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
IO3- + N2O4 +HCl = N2 +ICl2- +H2O2IO3- - N2O4 + 4HCl = -1N2 + 2ICl2- + 2H2O
IO3- + N2O4 +HCl = N2 +ICl2- +H2O2IO3- - N2O4 + 4HCl = -1N2 + 2ICl2- + 2H2O
InCl3 + AgNO3 = AgCl + In(NO3)3InCl3 + 3AgNO3 = 3AgCl + In(NO3)3
I2+Na2S2O3=NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
IO3- + SO2 + H2O = I- + H2SO4IO3- + 3SO2 + 3H2O = I- + 3H2SO4
I2+F2=I3F3I2 + F2 = 2I3F
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2+NaBr=NaI+Br2I2 + 2NaBr = 2NaI + Br2
I2 + HNO3=HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2+KIO3+HCl=ICl+KCl+H2O2I2 + KIO3 + 6HCl = 5ICl + KCl + 3H2O
I2 + OH- = I- + IO3- + H2O3I2 + 6OH- = 5I- + IO3- + 3H2O
I2O4= I2O5 + I2 5I2O4 = 4I2O5 + I2
I2 + OH- = IO3- + I- + H2O3I2 + 6OH- = IO3- + 5I- + 3H2O
IO3- + I- + H+ + =I2 + H2OIO3- + 11I- + 6H++ = 6I2 + 3H2O
I2 + Xe + OH(-) = I(-) + HXeO4(-) + H2O3I2 + Xe + 7OH(-) = 6I(-) + HXeO4(-) + 3H2O
I2 + CI2 = ICI52I2 + CI2 = ICI5
I2+IO3- + H+ + Cl-=ICl2- + H2O2I2 + IO3- + 6H+ + 10Cl- = 5ICl2- + 3H2O
I2 + OH- = IO3- + I- + H2O3I2 + 6OH- = IO3- + 5I- + 3H2O
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2+HNO3=HIO3+NO2+H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
IO3+HSO3=I+HSO4IO3 + 3HSO3 = I + 3HSO4
I2 (aq) + 2NaS2O3 (aq) = 2NaI (aq) + NaS4O6I2(aq) + 4NaS2O3(aq) = 2NaI(aq) + 2NaS4O6
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IO3- + Cl- + FeI2 + H+ = Fe3+ + ICl + H2O7IO3- + 31Cl- + 12FeI2 + 42H+ = 4Fe3+ + 31ICl + 21H2O
I2 + K2SO3 + H2O = K2SO4 + 2 HII2 + K2SO3 + H2O = K2SO4 + 2HI
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I+K2SO4+H2O+Cr2(SO4)3= H2SO4+K2Cr2O7+KI6I + 4K2SO4 + 7H2O + Cr2(SO4)3 = 7H2SO4 + K2Cr2O7 + 6KI
I+K2SO4+H2O+Cr2(SO4)3= H2SO4+K2Cr2O7+KI6I + 4K2SO4 + 7H2O + Cr2(SO4)3 = 7H2SO4 + K2Cr2O7 + 6KI
IO- + SO2 = I2 + SO4--2IO- + SO2 = I2 + SO4--
I2+HNO3=NO+HIO3+H2020I2 + 60HNO3 = 60NO + 40HIO3 + H20
I2 + OH= HI + IO32I2 + 3OH = 3HI + IO3
I2+HNO3=HIO3+NO2+H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I2O5+BrF3=IF5+O2+BrF22I2O5 + 20BrF3 = 4IF5 + 5O2 + 20BrF2
I2 + NaHSO3 + CH3COOH = CH3COONa + SO2 + HOI + HII2 + NaHSO3 + CH3COOH = CH3COONa + SO2 + HOI + HI
I2 + NaHSO3 + CH3COOH = CH3COONa + SO2 + HOI + HII2 + NaHSO3 + CH3COOH = CH3COONa + SO2 + HOI + HI
I2 + NaOH = NaI + NaIO3 + H2030I2 + 60NaOH = 40NaI + 20NaIO3 + 3H20
I2 + HNO3= HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2 + HNO3= HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IO3+H2SO3=I + SO3 +H2OIO3 + 3H2SO3 = I + 3SO3 + 3H2O
IO3+H2SO4=I + SO3 +H2O0IO3 + H2SO4 = 0I + SO3 + H2O
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2+HNO3=HIO3+NO2+H205I2 + 30HNO3 = 10HIO3 + 30NO2 + H20
IBr + BrO3- + H+ = IO3- + Br- + H2O-3IBr - 2BrO3- + 6H+ = -3IO3- - 5Br- + 3H2O
I2+2Na2S2O3=Na2S4O6+NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I2+2Na2S2O3=Na2S4O6+NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I2+Na2S2O3=NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
IO3- + H3AsO3 = I- + H3AsO4IO3- + 3H3AsO3 = I- + 3H3AsO4
I2 + NaOH = NaI + NaIO3 + H2O3I2 + 6NaOH = 5NaI + NaIO3 + 3H2O
I2+NO3-+H+=IO3-+NO2+H2OI2 + 10NO3- + 8H+ = 2IO3- + 10NO2 + 4H2O
I2O4+NaOH = NaIO3+NaI+H2O3I2O4 + 6NaOH = 5NaIO3 + NaI + 3H2O
I2O5+BrF3=IF5+O2+BrF22I2O5 + 20BrF3 = 4IF5 + 5O2 + 20BrF2
I2 + OH- = IO3- + I- + H2O3I2 + 6OH- = IO3- + 5I- + 3H2O
I2+KCLO3+H2O=KIO3+HIO3+HCLO2I2 + 5KCLO3 + 2H2O = 5KIO3 - HIO3 + 5HCLO
I2+4HNO3=2HIO3+4NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
IO2 +H2O=IO3- +H+ +eIO2 + H2O = IO3- + 2H+ + e
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2O5 + BrF3 = IF5 + O2 + Br26I2O5 + 20BrF3 = 12IF5 + 15O2 + 10Br2
I2+Na2S2O3=NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2+Na2S2O3 = NaI+Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2 + Na2S2O3 = NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2 + Na2S2O3 = NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2+HNO3=HIO3+NO2+H2I2 + 6HNO3 = 2HIO3 + 6NO2 + 2H2
I2+HNO2=HIO3+NO2+H20I2 + 2HNO2 = 0HIO3 + 2NO2 + H2
I2+Na2S2O3=Na2S4O6+NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I + KClO3 + NaOH = KClI + Na + H2O-1I - KClO3 + 6NaOH = -1KClI + 6Na + 3H2O
I2+VO2+=I- +VO2+0I2 + VO2+ = 0I- + VO2+
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
I- + SO4 2- + H+ = I2 + H2S +H2O170I- + 2SO42- + 172H+ = 85I2 + 2H2S + 84H2O
I- + SO4 2- + H+ = I2 + H2S +H2O170I- + 2SO42- + 172H+ = 85I2 + 2H2S + 84H2O
I- + SO42- + H+ = I2 + H2S +H2O170I- + 2SO42- + 172H+ = 85I2 + 2H2S + 84H2O
I- + SO4- + H+ = I2 + H2S +H2O18I- + 2SO4- + 20H+ = 9I2 + 2H2S + 8H2O
IO3- +OH- +I-=I2+ H2O-1IO3- + 6OH- - 5I- = -3I2 + 3H2O
I2 + KOH = KI + KIO3 + H2O3I2 + 6KOH = 5KI + KIO3 + 3H2O
I2 + KOH = KI + KIO3 + H2O3I2 + 6KOH = 5KI + KIO3 + 3H2O
I2+Cl2=ICl2I2 + 2Cl2 = 2ICl2
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
I2 + Cl2 + H2O = HIO3 + HClI2 + 5Cl2 + 6H2O = 2HIO3 + 10HCl
I2+Cl2+H2O = HIO3+HClI2 + 5Cl2 + 6H2O = 2HIO3 + 10HCl
ICl5 = Cl2 + I22ICl5 = 5Cl2 + I2
I2(s)+Cl2(g)=ICl5(s) I2(s) + 5Cl2(g) = 2ICl5(s)
I2(aq) + KClO3(aq) + NaOH(aq) = KI + NaClO2 + IO2HI2(aq) + KClO3(aq) + NaOH(aq) = KI + NaClO2 + IO2H
I2 + Cl2 + H2O = HIO3 + HClI2 + 5Cl2 + 6H2O = 2HIO3 + 10HCl
I2 + HNO3 = HIO4 + NO + H2O3I2 + 14HNO3 = 6HIO4 + 14NO + 4H2O
I2 + Na2S2O3 = Na2S4O6 + NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I2 + HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IBr + 2 OH- = Br- + OI- + H2OIBr + 2OH- = Br- + OI- + H2O
I- + Cr2O72- + H+ = IO- + Cr3+ + H2O427I- + 6Cr2O72- + 10H+ = 427IO- + 4Cr3+ + 5H2O
IO3- + I- + H+ = I2 + H2OIO3- + 5I- + 6H+ = 3I2 + 3H2O
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
IBr + NH3 = NH4Br + NI33IBr + 4NH3 = 3NH4Br + NI3
I2+OH- = I- + IO3- + H2O3I2 + 6OH- = 5I- + IO3- + 3H2O
I- + OCl- + H2O = I2 + Cl- + OH-2I- + OCl- + H2O = I2 + Cl- + 2OH-
I2O5 + H2S=I2+SO2+H2O3I2O5 + 5H2S = 3I2 + 5SO2 + 5H2O
I2+HNO3=N2O+HIO3+H2O4I2 + 10HNO3 = 5N2O + 8HIO3 + H2O
I2+HNO3=N2O+HIO3+H2050I2 + 120HNO3 = 60N2O + 100HIO3 + H20
I2+HNO3=NO+HIO3+H2020I2 + 60HNO3 = 60NO + 40HIO3 + H20
ICl3 + H2O = ICl + HIO3 + HCl2ICl3 + 3H2O = ICl + HIO3 + 5HCl
ICl2 + H2O = ICl + HIO3 + HCl4ICl2 + 3H2O = 3ICl + HIO3 + 5HCl
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IO3- + 8I- + 6H+ = 3I3- + 3H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
IBr+NH3=NI3+NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
I + O2=IO32I + 3O2 = 2IO3
I2 + NaOH = NaI + NaIO3 + H2O3I2 + 6NaOH = 5NaI + NaIO3 + 3H2O
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
I2+H2=HII2 + H2 = 2HI
IBr + NH3 = NI3 + NH4Br 3IBr + 4NH3 = NI3 + 3NH4Br
I2(s) + Fe(NO3)2(aq) + KNO3(aq) = KI(aq) + Fe(NO3)3(aq)I2(s) + 2Fe(NO3)2(aq) + 2KNO3(aq) = 2KI(aq) + 2Fe(NO3)3(aq)
I2O5 + BrF3 = IF5 + O2 + BrF22I2O5 + 20BrF3 = 4IF5 + 5O2 + 20BrF2
I2+HNO3=NO+HIO3+H2O3I2 + 10HNO3 = 10NO + 6HIO3 + 2H2O
I2 + HNO3 = HIO3 + NO +H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
I2 + F2 = IF5I2 + 5F2 = 2IF5
InCl3 + SnS2 = In2S3 + SnCl44InCl3 + 3SnS2 = 2In2S3 + 3SnCl4
I2+KOH = KIO3+KI+H2O3I2 + 6KOH = KIO3 + 5KI + 3H2O
I2 + Na2S2O3 = NaI + Na2S4O6I2 + 2Na2S2O3 = 2NaI + Na2S4O6
I2+ HNO3 = HIO3 + NO2 + H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
IK+(NO3)2+Pb = PbI2+KNO32IK + (NO3)2 + Pb = PbI2 + 2KNO3
IO3- + 4H2O + SO2 = I2 + SO2- + 8H+-2IO3- + 6H2O + 10SO2 = -1I2 + 10SO2- + 12H+
IO3- + 4H2O + SO2 = I2 + SO2- + 8H+-2IO3- + 6H2O + 10SO2 = -1I2 + 10SO2- + 12H+
IO3- + I- + H+ = I3- + H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
IO3- + I- + H+ = I3- + H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
IO3- + I- + H+ = I3- + H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
IO3- + I- + H+ = I3- + H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
I2 + H = HII2 + 2H = 2HI
IO3-+H2S+H+=I2+S+H2O2IO3- + 5H2S + 2H+ = I2 + 5S + 6H2O
I2+HNO3=NO2+HIO3+H2OI2 + 10HNO3 = 10NO2 + 2HIO3 + 4H2O
I2+HNO3=HIO3+NO+H2O3I2 + 10HNO3 = 6HIO3 + 10NO + 2H2O
IO3- + HSO3- = I2 + SO4 -2 + H+ + H2O2IO3- + 5HSO3- = I2 + 5SO4-2 + 3H+ + H2O
I2+ClO= IO3+ ClI2 + 6ClO = 2IO3 + 6Cl
I2+NaCO3=NaI+NaIO3+CO23I2 + 6NaCO3 = 4NaI + 2NaIO3 + 6CO2
I2+NaCO3=NaI+NaIO3+CO23I2 + 6NaCO3 = 4NaI + 2NaIO3 + 6CO2
I2+NaCO3=NaI+NaIO3+CO23I2 + 6NaCO3 = 4NaI + 2NaIO3 + 6CO2
I2+NaCO3=NaI+NaIO3+CO23I2 + 6NaCO3 = 4NaI + 2NaIO3 + 6CO2
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I2 +H2O2 = HIO3 + H2OI2 + 5H2O2 = 2HIO3 + 4H2O
I2O5+CO = I2+CO2I2O5 + 5CO = I2 + 5CO2
I2O5+CO=I2+CO2I2O5 + 5CO = I2 + 5CO2
I2 + S2O3-- = I- + S4O6--I2 + 2S2O3-- = 2I- + S4O6--
I2- + S2O3-- = I- + S4O6--2I2- + 2S2O3-- = 4I- + S4O6--
IO3- + I- + H+ = I3- + H2OIO3- + 8I- + 6H+ = 3I3- + 3H2O
I2 + S2O3-- = I- + S4O6--I2 + 2S2O3-- = 2I- + S4O6--
I2 + H2SO3 + H2O = I- + HSO4 + H+3I2 + 2H2SO3 + 2H2O = 6I- + 2HSO4 + 6H+
I2 + Na2S2O3 = Na2S4O6 + NaII2 + 2Na2S2O3 = Na2S4O6 + 2NaI
I2+HCLO+H20=HIO3+HCL10I2 + 60HCLO + H20 = 20HIO3 + 60HCL
I2O5+H2S=I2+SO2+H2O3I2O5 + 5H2S = 3I2 + 5SO2 + 5H2O
IO2F+BrF3=IF5+Br2+O2 3IO2F + 4BrF3 = 3IF5 + 2Br2 + 3O2
I2O5(s)+CO(g)=I2(s)+CO2(g)I2O5(s) + 5CO(g) = I2(s) + 5CO2(g)
I2+HNO3=HIO3+NO2+H2OI2 + 10HNO3 = 2HIO3 + 10NO2 + 4H2O
I2O5 + CO = I2 + CO2I2O5 + 5CO = I2 + 5CO2
I+O2=I2O34I + 3O2 = 2I2O3
I2+HNO3=HIO4+NO+H2O3I2 + 14HNO3 = 6HIO4 + 14NO + 4H2O
I2+HNO3=HIO3+NO2+H205I2 + 30HNO3 = 10HIO3 + 30NO2 + H20
IBr+NH3=NI3+NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
I2 + KNO3 + HCl = KIO3 + NO + KCl + H2O3I2 + 10KNO3 + 4HCl = 6KIO3 + 10NO + 4KCl + 2H2O
I2+KOH=KI+KIO3+H2O3I2 + 6KOH = 5KI + KIO3 + 3H2O

This program was created with a lot of help from:

Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer

Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.