Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+Mg(NO3)2=MgCl2+Fe(NO3)32FeCl3 + 3Mg(NO3)2 = 3MgCl2 + 2Fe(NO3)3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS2 + O2 = Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCr2O7+K2CO3+O2 = K2CrO4+Fe2O3+CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq) 2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH) 3 (s)+H 2 SO 4 (aq)=Fe 2 (SO 4 ) 3 (aq)+H 2 O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe3(PO4)2 + H2O = H3PO4 + Fe(OH)2Fe3(PO4)2 + 6H2O = 2H3PO4 + 3Fe(OH)2
Fe3(PO4)2 + H2O = H3PO4 + Fe(OH)2Fe3(PO4)2 + 6H2O = 2H3PO4 + 3Fe(OH)2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS(s)+HCl(aq)=FeCl 2 (aq)+H 2 S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3O4+H2SO4=Fe2(SO4)3+H2O+SO22Fe3O4 + 10H2SO4 = 3Fe2(SO4)3 + 10H2O + SO2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + CO2 = Fe3O4 + CO3Fe + 4CO2 = Fe3O4 + 4CO
Fe + Cu++ = Fe+++ + Cu2Fe + 3Cu++ = 2Fe+++ + 3Cu
Fe + Cu++ = Fe++ + CuFe + Cu++ = Fe++ + Cu
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3 +H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3 +H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4+NaClO3+Na2CO3=Na2FeO4+NaCl+CO23Fe3O4 + 5NaClO3 + 9Na2CO3 = 9Na2FeO4 + 5NaCl + 9CO2
FeCO3+HNO3=CO2+FeNO3+OHFeCO3 + HNO3 = CO2 + FeNO3 + OH
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
FeCl+AgNO3=FeNO3+AgClFeCl + AgNO3 = FeNO3 + AgCl
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + Na2O2 = Fe2O3 + Na2SO4 + Na2O2FeS2 + 15Na2O2 = Fe2O3 + 4Na2SO4 + 11Na2O
Fe +O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 + NaOH = Fe(OH)3 + Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
FeCO3 + H2O + O2 = Fe2O3 + H2CO34FeCO3 + 4H2O + O2 = 2Fe2O3 + 4H2CO3
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
Fe2(SO4)3+BaCl2=FeCl3+BaSO4Fe2(SO4)3 + 3BaCl2 = 2FeCl3 + 3BaSO4
Fe+H2SO4= Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2+ OH =Fe(OH)2Fe2 + 4OH = 2Fe(OH)2
FeCr2O7+K2CO3+O2=K2CrO4+Fe2O3+CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(SCN)3 + H2SO4 = Fe2(SO4)3 + SCN + H2Fe(SCN)3 + 3H2SO4 = Fe2(SO4)3 + 6SCN + 6H
FeCl3 + NaOH= NaCl3 + FeOHFeCl3 + NaOH = NaCl3 + FeOH
FeCl3 + NaOH= NaCl3 + FeOHFeCl3 + NaOH = NaCl3 + FeOH
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
F2 + H2 = HFF2 + H2 = 2HF
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2P + FeS2 = P4S10 + FeS4Fe2P + 18FeS2 = P4S10 + 26FeS
FeSO4+Pb(NO3)2=FeNO3+Pb(SO4)22FeSO4 + Pb(NO3)2 = 2FeNO3 + Pb(SO4)2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2+KMnO4+HCl= FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HBr = Fe Br3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe + S2 = 2FeS2Fe + S2 = 2FeS
FeO4+H2=Fe+H2OFeO4 + 4H2 = Fe + 4H2O
FeO4+H2=Fe+H2OFeO4 + 4H2 = Fe + 4H2O
FeO4+H2=Fe+H2OFeO4 + 4H2 = Fe + 4H2O
FeCl2 + Na3PO4 = Fe3 (PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
FeS2+NO3+H2O=Fe(OH)3+SO4+N212FeS2 + 38NO3 + 18H2O = 12Fe(OH)3 + 24SO4 + 19N2
Fe + CuSO4 = Cu + Fe2(SO4)32Fe + 3CuSO4 = 3Cu + Fe2(SO4)3
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3 + O2 = H2O + Fe2O32Fe(OH)3 + 0O2 = 3H2O + Fe2O3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + 3H2 = 2Fe +3H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeC2O4 * 2H2O = FeCO3 + H2O + COFeC2O4*2H2O = FeCO3 + 2H2O + CO
Fe2O3 + H2C2O4 = Fe(C2O4)3 + H2O + HFe2O3 + 6H2C2O4 = 2Fe(C2O4)3 + 3H2O + 6H
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3Si2O5(OH)4+CO2+H2O=FeCO3+H4SiO4Fe3Si2O5(OH)4 + 3CO2 + 2H2O = 3FeCO3 + 2H4SiO4
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2SiO4+CO2+H2O=FeCO3+H4SiO4Fe2SiO4 + 2CO2 + 2H2O = 2FeCO3 + H4SiO4
FeSiO3+H2O=Fe3Si2O5(OH)4+H4SiO43FeSiO3 + 4H2O = Fe3Si2O5(OH)4 + H4SiO4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2(aq) + KMnO4(aq) + HCl(aq) = FeCl3(aq) + MnCl2(aq) + H2O(l) + KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
FeO+H3PO4=Fe3(PO4)2+H2O3FeO + 2H3PO4 = Fe3(PO4)2 + 3H2O
Fe2O3+H2C2O4= Fe(C2O4)3+H2O+HFe2O3 + 6H2C2O4 = 2Fe(C2O4)3 + 3H2O + 6H
Fe2O3+H2C2O4= Fe(C2O4)3+H2O+HFe2O3 + 6H2C2O4 = 2Fe(C2O4)3 + 3H2O + 6H
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2+KBr=KF=Br2F2 + 2KBr = 2KF + Br2
F2+KBr=KF=Br2F2 + 2KBr = 2KF + Br2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl2 + Na2SiO3 = NaCl + FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
FeCl2 + Na2SiO3 = NaCl + FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe+O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe (s) + O2 (g)= Fe2O3 (s) 4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2(SO4)3+H2O+NH3 = Fe(OH)3 + (NH4)2SO4Fe2(SO4)3 + 6H2O + 6NH3 = 2Fe(OH)3 + 3(NH4)2SO4
Fe +H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeC6N6K4 + H2SO4 + H2O = N2H8SO4 + FeSO4 + K2SO4 + COFeC6N6K4 + 6H2SO4 + 6H2O = 3N2H8SO4 + FeSO4 + 2K2SO4 + 6CO
FeC2O4*2H2O + O2 = FeO + H2O + CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
FeSO4+Pb(NO3)2=PbSO4+Fe(NO3)2FeSO4 + Pb(NO3)2 = PbSO4 + Fe(NO3)2
FeCl3 + KI = FeI3 + KClFeCl3 + 3KI = FeI3 + 3KCl
FeC2O4*2H2O + O2 = Fe2O3 + H2O + CO24FeC2O4*2H2O + 3O2 = 2Fe2O3 + 8H2O + 8CO2
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
Fe+H2SO3=H2+Fe2(SO3)32Fe + 3H2SO3 = 3H2 + Fe2(SO3)3
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
FeCl2*4H2O+H2C2O4=FeC2O4*2H2O+H2O+HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2*4H2O+H2C2O4=FeC2O4*2H2O+H2O+HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeBr+H2SO4=Fe2(SO4)+HBr2FeBr + H2SO4 = Fe2(SO4) + 2HBr
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + HNO3 = Fe(NO3)3 +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeC2O4*2H2O (s) + O2 (g)= FeO (s) + H2O (g) + CO2 (g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeC2O4*2H2O (s) + O2 (g)= FeO (s) + H2O (g) + CO2 (g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeCl3+H2S=Fe2S3+HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe2O3 + CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2CO3 + CO= Fe + CO2Fe2CO3 + CO = 2Fe + 2CO2
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3(s)+CO(g)=Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe2O3 +HNO3 = Fe(NO3)3 +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3 +HNO3 = Fe(NO3)3 +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeO + H2O = Fe(OH)2FeO + H2O = Fe(OH)2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe3O4 + Al = Fe + Al2O33Fe3O4 + 8Al = 9Fe + 4Al2O3
Fe2 (SO4)3 +KOH = K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(s) + S8(s) = FeS(s) 8Fe(s) + S8(s) = 8FeS(s)
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + HCl = FeCl2 + HFe + 2HCl = FeCl2 + 2H
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2(SO4)3 + NH3 + H2O = Fe(OH)3 + (NH4)2(SO4)Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2(SO4)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HCl FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeC2O4*2H2O = FeCO3 + H2O + COFeC2O4*2H2O = FeCO3 + 2H2O + CO
FeC2O4*2H2O + O2 = FeO + H2O + CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeC2O4*2H2O + O2 = Fe2O3 + H2O + CO24FeC2O4*2H2O + 3O2 = 2Fe2O3 + 8H2O + 8CO2
Fe2O3+CO=Fe+CO0Fe2O3 + CO = 0Fe + CO
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
Fe+Br2=FeBr2Fe + Br2 = FeBr2
FeCl2+Cl2 =FeCl32FeCl2 + Cl2 = 2FeCl3
Fe(ClO3)3(s)= FeCl3(s)+O2(g)2Fe(ClO3)3(s) = 2FeCl3(s) + 9O2(g)
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe + Cu(NO3)2 = Fe(NO3)3 + Cu2Fe + 3Cu(NO3)2 = 2Fe(NO3)3 + 3Cu
Fe+H2O=H2+Fe3O43Fe + 4H2O = 4H2 + Fe3O4
Fe+H2SO4=H2+Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeF2 + FeBr3 =FeBr2 + FeF33FeF2 + 2FeBr3 = 3FeBr2 + 2FeF3
FeI3 =FeI2 + I22FeI3 = 2FeI2 + I2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + 3CO= 2Fe + 3CO0Fe2O3 + CO = 0Fe + CO
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + S8 = FeS24Fe + S8 = 4FeS2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+++ + H2C2O4 = Fe++ + CO2 + H+2Fe+++ + H2C2O4 = 2Fe++ + 2CO2 + 2H+
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + Na3PO4 = FePO4 + Na3SO4FeSO4 + Na3PO4 = FePO4 + Na3SO4
Fe(NO3)3(aq) + 3NH3(aq) + H2O(l) = 3NH4NO3 + Fe(OH)3Fe(NO3)3(aq) + 3NH3(aq) + 3H2O(l) = 3NH4NO3 + Fe(OH)3
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS + HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3=FeO3+OH+HFe(OH)3 = FeO3 + 0OH + 3H
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS(s)+HCl(aq)=FeCl 2 (aq)+H 2 S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeC2O4*2H2O+O2=FeO+H2O+CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
FeC2O4*2H2O+O2=FeO+H2O+CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
Fe2O3 + HBr = FeBr3 + H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HNO3+H2SO4=Fe2(SO4)3+NO+H2O2FeS + 6HNO3 + H2SO4 = Fe2(SO4)3 + 6NO + 4H2O
Fe2+OH = FeO +H2OFe2 + 4OH = 2FeO + 2H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(NO3)3+NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4+CO=FeO+CO2Fe3O4 + CO = 3FeO + CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe + Cu(NO3)2 = Fe(NO3)2 + CuFe + Cu(NO3)2 = Fe(NO3)2 + Cu
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 (s) + Al(s) = Fe + Al2O3Fe2O3(s) + 2Al(s) = 2Fe + Al2O3
Fe2O3 (s) + Al(s) = Fe + Al2O3Fe2O3(s) + 2Al(s) = 2Fe + Al2O3
FeCl2 + AgNO3 = Fe(NO3)2 + AgClFeCl2 + 2AgNO3 = Fe(NO3)2 + 2AgCl
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+H2 SO4+O2=FeSO4+H2 O2Fe + 2H2SO4 + O2 = 2FeSO4 + 2H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+O=FeOFe + O = FeO
FeCl2(aq) + KMnO4(aq) + HCl(aq) = FeCl3(aq) + MnCl2(aq) + H2O(l) + KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2+ + NH4Cl = Fe2+(Cl) + NH40Fe2+ + NH4Cl = 0Fe2 + (Cl) + NH4
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeC2O4*2H2O (s) = FeCO3 (s) + H2O (g) + CO (g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeC2O4*2H2O (s) + O2 (g) = Fe2O3 (s) + H2O (g) + CO2 (g)4FeC2O4*2H2O(s) + 3O2(g) = 2Fe2O3(s) + 8H2O(g) + 8CO2(g)
FeC2O4*2H2O (s) + O2 (g) = FeO (s) + H2O (g) + CO2 (g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
Fe2O3(aq)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l)Fe2O3(aq) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + Sb2S3 = FeSb2S3Fe + Sb2S3 = FeSb2S3
FeC2O4*2H2O (s) = FeCO3 (s) + H2O (g) + CO (g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeC2O4*2H2O (s) = FeCO3 (s) + H2O (g) + CO (g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeC2O4*2H2O (s) = FeCO3 (s) + H2O (g) + CO (g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl3 + Be3(PO4)2 = BeCl2 + FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + HNO3 = Fe(NO3)3 + NO +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO + 3H2O
Fe2O3 + HNO3 = Fe(NO3)3 + NO +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO + 3H2O
Fe (OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3+H2(SO4)=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2(SO4) = Fe2(SO4)3 + 6H2O
FeC2O4*2H2O (s) + O2 (g) = FeO (s) + H2O (g) + CO22FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2
FeC2O4*2H2O (s) + O2 (g) = Fe2O3 (s) + H2O (g) + CO2 (g)4FeC2O4*2H2O(s) + 3O2(g) = 2Fe2O3(s) + 8H2O(g) + 8CO2(g)
FeC2O4*2H2O (s) + O2 (g) = FeO (s) + H2O (g) + CO22FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
FeC2O4*2H2O (s)= FeCO3 (s) + H2O (g) + CO (g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe + HCl = H2 + FeCl2Fe + 2HCl = H2 + FeCl2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe (s) + O2 (g) = FeO (s)2Fe(s) + O2(g) = 2FeO(s)
Fe2O3 (s) + Al (s) = Al2O3 (s) + Fe (s)Fe2O3(s) + 2Al(s) = Al2O3(s) + 2Fe(s)
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeC2O4*2H2O = FeCO3 + H2O + CO FeC2O4*2H2O = FeCO3 + 2H2O + CO
FeC2O4*2H2O + O2 = FeO + H2O + CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
FeC2O4*2H2O (s) = FeCO3 (s) + H2O (g) + CO (g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeC2O4*2H2O = FeCO3 + H2O + COFeC2O4*2H2O = FeCO3 + 2H2O + CO
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2 O34Fe + 3O2 = 2Fe2O3
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe2S3 + HCl = FeCl3 + H2SFe2S3 + 6HCl = 2FeCl3 + 3H2S
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeC2O4*2H2O + O2 = FeO + H2O + CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
FeCl2*4H2O+H2C2O4=FeC2O4*2H2O+H2O+HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeC2O4*2H2O + O2 = Fe2O3 + H2O + CO24FeC2O4*2H2O + 3O2 = 2Fe2O3 + 8H2O + 8CO2
FeC2O4*2H2O + O2 = FeO + H2O + CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeC2O4*2H2O+O2=Fe2O3+H2O+CO24FeC2O4*2H2O + 3O2 = 2Fe2O3 + 8H2O + 8CO2
FeC2O4*2H2O=FeCO3+H2O+COFeC2O4*2H2O = FeCO3 + 2H2O + CO
Fe+S8=FeS8Fe + S8 = 8FeS
Fe2O3+Cu2SO4=Fe2(SO4)3+Cu2OFe2O3 + 3Cu2SO4 = Fe2(SO4)3 + 3Cu2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCr2O4+K2CO3+O2=Fe2O3+CO2+K2CrO44FeCr2O4 + 8K2CO3 + 7O2 = 2Fe2O3 + 8CO2 + 8K2CrO4
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
Fe+H2O=H2+FeO4Fe + 4H2O = 4H2 + FeO4
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeSO4 + KMnO4 + H2SO4 = Fe(SO4)3 + MnSO4 + K2SO4 + H2O5FeSO4 + 4KMnO4 + 16H2SO4 = 5Fe(SO4)3 + 4MnSO4 + 2K2SO4 + 16H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2*4H2O + H2C2O4 =FeC2O4*2H2O + H2O + HCl FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeC2O4*2H2O + O2 = Fe2O3 + H2O + CO24FeC2O4*2H2O + 3O2 = 2Fe2O3 + 8H2O + 8CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe + H2O= Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS2 + O2 + H2O = Fe2+ + (SO4)2- + H+8FeS2 + 31O2 + 2H2O = 4Fe2+ + 8(SO4)2- + 4H+
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3+FeCl2+NH3+H2O=FeO+NH4Cl0FeCl3 + FeCl2 + 2NH3 + H2O = FeO + 2NH4Cl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3O2 + CO = Fe3O4 + CO2-1Fe3O2 + 2CO = -1Fe3O4 + 2CO2
Fe3O2 + CO2 = Fe3O4 + CO20Fe3O2 + CO2 = 0Fe3O4 + CO2
FeS2 + O2 = Fe3O4 + SO23FeS2 + 8O2 = Fe3O4 + 6SO2
FeS2 + O2 = FeO4 + SO2FeS2 + 4O2 = FeO4 + 2SO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O2+CO=Fe+CO2Fe2O2 + 2CO = 2Fe + 2CO2
FeCl3 + KOH = Fe(OH)3 + KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe(NO3)3+ Na2CO3=FeCO3+ Na2(NO3)3Fe(NO3)3 + Na2CO3 = FeCO3 + Na2(NO3)3
Fe(NO3)3+ Na2CO3=FeCO3+ Na2(NO3)3Fe(NO3)3 + Na2CO3 = FeCO3 + Na2(NO3)3
Fe(OH)3+3H2SO4=H2O+Fe2(SO4)32Fe(OH)3 + 3H2SO4 = 6H2O + Fe2(SO4)3
Fe++ + NO3- + OH-=Fe3O4 + NO2- + H2O3Fe++ + NO3- + 6OH- = Fe3O4 + NO2- + 3H2O
Fe++ + H2O2 + H2O=FeOOH + H+2Fe++ + H2O2 + 2H2O = 2FeOOH + 4H+
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3 + KOH = Fe(OH)3 + KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=FeO2Fe + O2 = 2FeO
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+O2=FeO2Fe + O2 = FeO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS2 + O2 + H2O = Fe2+ + (SO4)2- + H+8FeS2 + 31O2 + 2H2O = 4Fe2+ + 8(SO4)2- + 4H+
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+C = Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3 (s)+ H2So4(aq)=Fe2(So4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2So4(aq) = Fe2(So4)3(aq) + 6H2O(l)
FeCl2*4H2O (aq) + H2C2O4 (aq)= FeC2O4*2H2O (s) + H2O (l) + HCl (aq)==FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeC2O4*2H2O (s) + O2 (g) = FeO (s) + H2O (g) + CO2 (g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeC2O4*2H2O (s) + O2 (g)= Fe2O3 (s) + H2O (g) + CO2 (g)4FeC2O4*2H2O(s) + 3O2(g) = 2Fe2O3(s) + 8H2O(g) + 8CO2(g)
FeC2O4*2H2O (s) + O2 (g)= Fe2O3 (s) + H2O (g) + CO2 (g)4FeC2O4*2H2O(s) + 3O2(g) = 2Fe2O3(s) + 8H2O(g) + 8CO2(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeC2O4*2H2O (s) + O2 (g) = FeO (s) + H2O (g) + CO2 (g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3(s) + HNO3(aq)= Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl2+KMnO4+HCl=FeCl3+MnCl3+H2O+KCl4FeCl2 + KMnO4 + 8HCl = 4FeCl3 + MnCl3 + 4H2O + KCl
FeCl2+KMnO4+HCl=FeCl3+MnCl3+H2O+KCl4FeCl2 + KMnO4 + 8HCl = 4FeCl3 + MnCl3 + 4H2O + KCl
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl3(aq)+H2O(l)+KCl(aq)4FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 4FeCl3(aq) + MnCl3(aq) + 4H2O(l) + KCl(aq)
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + H2O = Fe3 O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + KCl + H2O5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + KCl + 4H2O
Fe3+HCl=FeCl3+HFe3 + 9HCl = 3FeCl3 + 9H
FeS + O2= Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+HCl=FeCl3+HFe + 3HCl = FeCl3 + 3H
Fe + HCl = FeCl + HFe + HCl = FeCl + H
Fe2O3(s)+3CO(g)=2Fe(s)+3CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+3CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl(aq)+MnCl2(aq)+H2O(l)+KCl(aq)-5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = -5FeCl(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe + H3PO4 = Fe(H2PO4)2 + H2Fe + 2H3PO4 = Fe(H2PO4)2 + H2
Fe2O3 + C = Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCr2O7+K2CO3+O2=K2CrO4+Fe2O3+CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + C =Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O=FeOFe + O = FeO
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + H2O + 3O2 = Fe(OH)34Fe + 6H2O + 3O2 = 4Fe(OH)3
Fe2 + H2O + 3O2 = Fe(OH)32Fe2 + 6H2O + 3O2 = 4Fe(OH)3
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + HCl + K2Cr2O7 = FeCl3 +KCl + CrCl3 + H2O6FeCl2 + 14HCl + K2Cr2O7 = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe2O3+H3PO4=FePO4+H2OFe2O3 + 2H3PO4 = 2FePO4 + 3H2O
FeS2 + O2 + H2O = FeSO4 + H2SO42FeS2 + 7O2 + 2H2O = 2FeSO4 + 2H2SO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4+O2=Fe2O3+SO34FeSO4 + O2 = 2Fe2O3 + 4SO3
FeSO4+O2=FeO3+SO3FeSO4 + O2 = FeO3 + SO3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = 2FeCl2Fe + Cl2 = 2FeCl
FeCl2+NaOH = Fe(OH)2 + NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
FeSO4+KOH=FeOH+KSO4FeSO4 + KOH = FeOH + KSO4
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl2+H2O(l)+KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2 + 4H2O(l) + KCl(aq)
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2(C2O4)3=FeC2O4+CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe2O3+S=Fe+SO22Fe2O3 + 3S = 4Fe + 3SO2
FeO +H2O2 = Fe2O3 + H2O2FeO + H2O2 = Fe2O3 + H2O
FeO +H2O2 = Fe2O3 + H2O2FeO + H2O2 = Fe2O3 + H2O
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe(No3)2 + Na2S = FeS + Na(No3)Fe(No3)2 + Na2S = FeS + 2Na(No3)
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(HO)3+ e = Fe2 O3 + H2O2Fe(HO)3 + 0e = Fe2O3 + 3H2O
Fe(HO)3 = Fe2 O3 + H2O2Fe(HO)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
FeO+CO=Fe+CO2FeO + CO = Fe + CO2
Fe2O3 + C = 2Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO44FeS2 + 19O2 = 2Fe2O3 + 8SO4
Fe(OH) 3 (s)+H 2 SO 4 (aq)=Fe 2 (SO 4 ) 3 (aq)+H 2 O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeSiO3 + H2O = Fe3Si2O5(OH)4 + H4SiO43FeSiO3 + 4H2O = Fe3Si2O5(OH)4 + H4SiO4
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)2 = FeO+H2OFe(OH)2 = FeO + H2O
Fe(OH)2 = FeO+H2OFe(OH)2 = FeO + H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe(SO4)3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O = Fe2O32Fe + 3O = Fe2O3
FeCrO4+K2CO3+O2=Fe2O3+K2CrO4+CO24FeCrO4 + 4K2CO3 + O2 = 2Fe2O3 + 4K2CrO4 + 4CO2
Fe3O4 + H2 = Fe + H2O Fe3O4 + 4H2 = 3Fe + 4H2O
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3 + Cl2 + KOH = K2FeO4 + KCl + H2OFe2O3 + 3Cl2 + 10KOH = 2K2FeO4 + 6KCl + 5H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 +PbI4 = Pb2F4 +I2F2 + 2PbI4 = Pb2F4 + 8I
Fe(OH)3(s) + H2S(g) = Fe2S3(s) + H2O(g)2Fe(OH)3(s) + 3H2S(g) = Fe2S3(s) + 6H2O(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3+O2=Fe2O34Fe3 + 9O2 = 6Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3 + H2SO4 = Fe2(SO4)3+ H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH) 3 (s)+H 2 SO 4 (aq)=Fe 2 (SO 4 ) 3 (aq)+H 2 O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.