Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
FeCL2+H2O+HCL=FeCL3+H2O0FeCL2 + H2O + 0HCL = 0FeCL3 + H2O
Fe+AgSO4 = Fe2(SO4)3+Ag2Fe + 3AgSO4 = Fe2(SO4)3 + 3Ag
FeBr3+H2SO4=Fe2(SO4)3 +HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe+AgSO4 = Fe2(SO4)3+Ag2Fe + 3AgSO4 = Fe2(SO4)3 + 3Ag
FeBr3(aq) + LiOH(aq) = Fe(OH)3(aq) + LiBr(s) FeBr3(aq) + 3LiOH(aq) = Fe(OH)3(aq) + 3LiBr(s)
Fe2O3+CO(g)=Fe+CO2Fe2O3 + 3CO(g) = 2Fe + 3CO2
Fe2(SO4)3+2Al(s)=Al2(SO4)3+Fe Fe2(SO4)3 + 2Al(s) = Al2(SO4)3 + 2Fe
Fe2(SO4)3(aq)+Al(s)=Al(SO4)+Fe Fe2(SO4)3(aq) + 3Al(s) = 3Al(SO4) + 2Fe
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeO(l)+Al(l)=Al2O3(l)+Fe(l) 3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g) Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(NO3)3+CaSO4=FeSO4+Ca(NO3)3Fe(NO3)3 + CaSO4 = FeSO4 + Ca(NO3)3
FeO(l)+Al(l)=Al2O3(l)+Fe(l)3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
FeS+ HCl = FeCl2+ H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(CO3)3 (s) + HCl(aq) = FeCl3 (aq)+ H2O (l) + CO2 (g)Fe2(CO3)3(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2O(l) + 3CO2(g)
Fe3 + HNO3 = Fe(NO3) + H22Fe3 + 6HNO3 = 6Fe(NO3) + 3H2
Fe+HNO3=H2+Fe(NO3)2Fe + 2HNO3 = H2 + 2Fe(NO3)
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe2O3 + CO = CO2 + Fe Fe2O3 + 3CO = 3CO2 + 2Fe
FeO+CO2=C+Fe3O46FeO + CO2 = C + 2Fe3O4
Fe3O4(aq)+Al(s)=Al2O3(aq)+Fe(s)3Fe3O4(aq) + 8Al(s) = 4Al2O3(aq) + 9Fe(s)
FeO+CO=Fe+CO2FeO + CO = Fe + CO2
Fe2O2+H2=Fe+H2OFe2O2 + 2H2 = 2Fe + 2H2O
Fe3O4 + FeS2 = FeS + O2Fe3O4 + 3FeS2 = 6FeS + 2O2
Fe2O3 + CO = Fe2 + CO2Fe2O3 + 3CO = Fe2 + 3CO2
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS2+O2+H2O=Fe2O3+H2SO44FeS2 + 15O2 + 8H2O = 2Fe2O3 + 8H2SO4
FeCl3+K2S=Fe2S3+KCl2FeCl3 + 3K2S = Fe2S3 + 6KCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe(NO3)3+KOH=Fe(OH)3+ KNO3Fe(NO3)3 + 3KOH = Fe(OH)3 + 3KNO3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + H2SO4 = Fe2 (SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS(s)+HCl(aq)=FeCl 2 (aq)+ H 2 S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s) + H2O(l)=Fe3O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s)+ O2(g)= Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3(aq) + KOH(aq) = Fe(OH)3(s) + KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(s) + 3KCl(aq)
FeCl2 + KMnO4 + HCl = FeCl3 + KCl + MnCl2 + H2O5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + KCl + MnCl2 + 4H2O
Fe(s) + HCl(aq) =FeCl3(aq) + H2(g) 2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe (s) + H2O (l) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
F e 2 O 3 (s)+CO(g)=Fe(s)+C O 2 (g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl2 + H2S =Fe2S2 + HCl2FeCl2 + 2H2S = Fe2S2 + 4HCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS+O2=2Fe2O3+4SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
FeS+O2=2Fe2O3+4SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(aq) + C(s) =  Fe(s) + CO2(g)2Fe2O3(aq) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe(s) + O2(g) + H2O(l) =  Fe2O3H2O(s)4Fe(s) + 3O2(g) + 2H2O(l) = 2Fe2O3H2O(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe4+O3=Fe3O49Fe4 + 16O3 = 12Fe3O4
Fe(s) + HCl(aq) =FeCl3(aq) + H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeO2+H2=Fe+H2OFeO2 + 2H2 = Fe + 2H2O
Fe+I2= FeI32Fe + 3I2 = 2FeI3
Fe+I3 = FeI3Fe + I3 = FeI3
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl2 + NaBr = NaCl + FeBr2FeCl2 + 2NaBr = 2NaCl + FeBr2
FeCl2 + NaBr = NaCl + FeBr2FeCl2 + 2NaBr = 2NaCl + FeBr2
FeSCN+HCl=FeCl+HSCNFeSCN + HCl = FeCl + HSCN
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2(CO3)(s) + H2SO4 = Fe2(SO4)(s) + CO2(g) + H2OFe2(CO3)(s) + H2SO4 = Fe2(SO4)(s) + CO2(g) + H2O
Fe(s)+Cl2 (g)=FeCl3 (g)2Fe(s) + 3Cl2(g) = 2FeCl3(g)
Fe(NO3)3+MgO=Fe2O3+Mg(NO3)22Fe(NO3)3 + 3MgO = Fe2O3 + 3Mg(NO3)2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3+NaOH=Fe(OH)3+Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS2+Na2O2=Fe2O3+Na2(SO3)+Na2O2FeS2 + 11Na2O2 = Fe2O3 + 4Na2(SO3) + 7Na2O
FeS2+H2O+O2=Fe2(SO4)3+H2SO44FeS2 + 2H2O + 15O2 = 2Fe2(SO4)3 + 2H2SO4
FeS2+H2O+O2=Fe2(SO4)+H2SO44FeS2 + 6H2O + 13O2 = 2Fe2(SO4) + 6H2SO4
FeS2+H2O+O2=Fe(SO4)+H2SO42FeS2 + 2H2O + 7O2 = 2Fe(SO4) + 2H2SO4
F2+LiBr = Br2+LiFF2 + 2LiBr = Br2 + 2LiF
FeS2+H2O+O2=Fe(SO4)+H2SO42FeS2 + 2H2O + 7O2 = 2Fe(SO4) + 2H2SO4
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 + 2CO2 + H2O = Fe2CO3 + H2-1Fe2O3 - CO2 + 2H2O = -1Fe2CO3 + 2H2
Fe2O3 + CO2 + H2O = Fe2CO3 + H2-1Fe2O3 - CO2 + 2H2O = -1Fe2CO3 + 2H2
Fe2O3 + H2 =  Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H2 =  Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+2Ag1+=2Ag+Fe2+2Fe + Ag1+ = Ag + Fe2+
FeO+HClO4=Fe(ClO4)2+H2OFeO + 2HClO4 = Fe(ClO4)2 + H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeBr3(aq) + NaOH(aq) = FeOH(s) + NaBr3(aq)FeBr3(aq) + NaOH(aq) = FeOH(s) + NaBr3(aq)
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s) + O2(g) + H20(l) = 1 Fe(OH)2(aq)10Fe(s) + 10O2(g) + H20(l) = 10Fe(OH)2(aq)
Fe(SO4)2+O2 =Fe2O3+SO24Fe(SO4)2 - 5O2 = 2Fe2O3 + 8SO2
Fe(CO)5 + NaOH = Na2Fe(CO)4 +Na2CO3 +H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
FeSO4 +Ba(OH)2 = BaSO4 +Fe(OH)2FeSO4 + Ba(OH)2 = BaSO4 + Fe(OH)2
Fe2O3 + CO= Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+ H2O2 + C6H12O6 =FeC6H12O6 Fe + 0H2O2 + C6H12O6 = FeC6H12O6
Fe3O4 + H2 = Fe + H2O Fe3O4 + 4H2 = 3Fe + 4H2O
Fe + HC2H3O2 = Fe(C2H3O2)3 + H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
Fe2S4 +O2 = Fe2O3 + SO22Fe2S4 + 11O2 = 2Fe2O3 + 8SO2
FeCl2+Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe(CO)5 + NaOH = Na2Fe(CO)4 +Na2CO3 +H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fr + 2H2O = 2FrOH + H22Fr + 2H2O = 2FrOH + H2
Fe2O3 + HCl = 2FeCl3 + 3H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe+H2SO4=Fe2(SO4) H22Fe + H2SO4 = Fe2(SO4)H2
Fe3O4+CO= Fe +CO0Fe3O4 + CO = 0Fe + CO
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe2O3+SOFe24FeS - O2 = -2Fe2O3 + 4SOFe2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=Fe2O3+SO4FeS + 5O2 = 2Fe2O3 + 4SO
FeO + H3PO4 = Fe3(PO4)2 + H2O3FeO + 2H3PO4 = Fe3(PO4)2 + 3H2O
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2(aq)+NaOCl(aq)+H2O(l)+NaCl(aq)=FeCl3(aq)+NaOH(aq)2FeCl2(aq) + NaOCl(aq) + H2O(l) + NaCl(aq) = 2FeCl3(aq) + 2NaOH(aq)
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe3O4 + 4 H2 = 3 Fe + 4 H2O Fe3O4 + 4H2 = 3Fe + 4H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2S3 + H2O + O2 = H2SO4 + Fe2O3(H2O)3Fe2S3 + 6H2O + 6O2 = 3H2SO4 + Fe2O3(H2O)3
FeS2+O2=Fe2O3+SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2+NaCl=Cl2+NaFF2 + 2NaCl = Cl2 + 2NaF
Fe(OH)2 + 2H2O = Fe(OH)3 + H22Fe(OH)2 + 2H2O = 2Fe(OH)3 + H2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O4 + Al = Al2O3 + Fe3Fe2O4 + 8Al = 4Al2O3 + 6Fe
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + H2 = FeO + H200Fe2O3 + 10H2 = 0FeO + H20
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+3O2=2Fe2O34Fe + 3O2 = 2Fe2O3
Fe2S3 + H2O + O2 = H2SO4 + Fe2O3(H2O)3Fe2S3 + 6H2O + 6O2 = 3H2SO4 + Fe2O3(H2O)3
Fe(s)+S8(s)=Fe2S3(s)16Fe(s) + 3S8(s) = 8Fe2S3(s)
FeCl3+KSCN=Fe (SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3(s)+CO(g)= Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O4 + SO2 =FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3+CO=CO2+Fe2Fe2O3 + 3CO = 3CO2 + Fe2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O2(s)2Fe(s) + O2(g) = Fe2O2(s)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+H2O=Fe (OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)2+H2=Fe+H2OFe(OH)2 + H2 = Fe + 2H2O
FeS+2HI=FeI2+H2SFeS + 2HI = FeI2 + H2S
FeS(s)+HCl=FeCl2+H2SFeS(s) + 2HCl = FeCl2 + H2S
Fe2O3+H2O= Fe (OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+H2O= Fe (OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe + S= FeSFe + S = FeS
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+H2O=H2+Fe(OH)32Fe + 6H2O = 3H2 + 2Fe(OH)3
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe++ + Ag+ = Fe + Ag+0Fe++ + Ag+ = 0Fe + Ag+
Fe++ + Ag+ = Fe + Ag+0Fe++ + Ag+ = 0Fe + Ag+
Fe(s) + H2O = Fe3O4 (aq) + H2(g)3Fe(s) + 4H2O = Fe3O4(aq) + 4H2(g)
Fe(s) + H2O = Fe3O4 (aq) + H2(g)3Fe(s) + 4H2O = Fe3O4(aq) + 4H2(g)
Fe + O2 = FeO2Fe + O2 = FeO2
Fe++ + Ag+ = Fe + Ag-1Fe++ + 2Ag+ = -1Fe + 2Ag
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + Cu(NO3)2 = Cu + Fe (NO3)2Fe + Cu(NO3)2 = Cu + Fe(NO3)2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 +H2O= HF + O33F2 + 3H2O = 6HF + O3
FeO3(s)+C(s)=Fe(s)+CO(g)FeO3(s) + 3C(s) = Fe(s) + 3CO(g)
Fe2S3+H2O+O2 = H2SO4+Fe2O3(H2O)3Fe2S3 + 6H2O + 6O2 = 3H2SO4 + Fe2O3(H2O)3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + MgSO4 = FeSO4 + MgFe + MgSO4 = FeSO4 + Mg
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2+Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
F2 + KBr = KF +Br2F2 + 2KBr = 2KF + Br2
Fe(s)+O2(g)+H2O(l) = Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe2O4+SO2=FeS+O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3*6H2O+H2=Fe+HCl+H2O2FeCl3*6H2O + 3H2 = 2Fe + 6HCl + 12H2O
FeCl2*4H2O+H2=Fe+HCl+H2OFeCl2*4H2O + H2 = Fe + 2HCl + 4H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe (s) + S (l) = Fe2S3 (s)2Fe(s) + 3S(l) = Fe2S3(s)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(ClO)3+(NH4)2S=Fe2S3+NH4ClO2Fe(ClO)3 + 3(NH4)2S = Fe2S3 + 6NH4ClO
Fe3O4 + 4CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O3 + 4CO = Fe + CO2Fe3O3 + 3CO = 3Fe + 3CO2
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
F2+CuBr=CuF+Br2F2 + 2CuBr = 2CuF + Br2
Fe+S=FeSFe + S = FeS
Fe+S=FeSFe + S = FeS
Fe+S=FeSFe + S = FeS
Fe(s)+PdCl2(aq)=FeCl2(aq)+Pd(s)Fe(s) + PdCl2(aq) = FeCl2(aq) + Pd(s)
Fe + HNO3 = NO2 + Fe(NO3)3 + H2OFe + 6HNO3 = 3NO2 + Fe(NO3)3 + 3H2O
Fe + HNO3 = NO + Fe(NO3)3 + H2OFe + 4HNO3 = NO + Fe(NO3)3 + 2H2O
Fe + HNO3 = NO + Fe(NO3)2 + H2O3Fe + 8HNO3 = 2NO + 3Fe(NO3)2 + 4H2O
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + HNO3 = NO + Fe(NO3)3+ H2OFe + 4HNO3 = NO + Fe(NO3)3 + 2H2O
Fe2O3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2OFe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O
Fe + HNO3 = NO + Fe(NO3)+ H2O3Fe + 4HNO3 = NO + 3Fe(NO3) + 2H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3+ + 5I- = FeI3 + I2-1Fe3+ - I- = -3FeI3 + 4I2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl + NaOH = FeOH + NaClFeCl + NaOH = FeOH + NaCl
FeSO4 + NaOH = FeOH + NaSO4FeSO4 + NaOH = FeOH + NaSO4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + ZnSO4=FeSO4 + ZnSO40Fe + ZnSO4 = 0FeSO4 + ZnSO4
Fe(s) + H2CO3(aq) = Fe2(CO3)3(s) + H2(g)2Fe(s) + 3H2CO3(aq) = Fe2(CO3)3(s) + 3H2(g)
Fe(s) + H2CO3(aq) = Fe2(CO3)3(s) + H2(g)2Fe(s) + 3H2CO3(aq) = Fe2(CO3)3(s) + 3H2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NaOH = Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + AgC2H3O2 = Fe(C2H3O2) + AgFe + AgC2H3O2 = Fe(C2H3O2) + Ag
FeBr3 + (NH4)2S = Fe2S3 + NH4Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6NH4Br
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe(ClO4)2(Aq)+K2S(Aq) = FeS(s)+2KClO4(Aq)Fe(ClO4)2(Aq) + K2S(Aq) = FeS(s) + 2KClO4(Aq)
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+++ +NO2- + H2O = Fe++ + H+ +NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+Al=Fe+ Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe3O4+CO=FeO+CO2Fe3O4 + CO = 3FeO + CO2
FeS2 + Cl2 = FeCl3 + S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
Fe+ O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS2+H2O+O2=FeSO4+H2SO42FeS2 + 2H2O + 7O2 = 2FeSO4 + 2H2SO4
FeSO4(aq)+Sr(OH)2(aq)=FeOH(s)+Sr(SO4)2(aq)2FeSO4(aq) + Sr(OH)2(aq) = 2FeOH(s) + Sr(SO4)2(aq)
Fe(NO3)2(aq)+Na2CO3(aq)=FeCO3(s)+2NaNO3(aq)Fe(NO3)2(aq) + Na2CO3(aq) = FeCO3(s) + 2NaNO3(aq)
FeO(l)+Al(l) = Al2O3(l)+Fe(l)3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeO3+6Al=3Fe+3Al2O3FeO3 + 2Al = Fe + Al2O3
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe(s)+CuNO3(aq)=Cu(s)+Fe(NO3)2(aq)Fe(s) + 2CuNO3(aq) = 2Cu(s) + Fe(NO3)2(aq)
Fe(s)+CuNO3(aq)=Cu(s)+Fe(NO3)2(aq)Fe(s) + 2CuNO3(aq) = 2Cu(s) + Fe(NO3)2(aq)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeSO4 + Ba(OH)2=Fe(OH)2 + BaSO4FeSO4 + Ba(OH)2 = Fe(OH)2 + BaSO4
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3+ + Ag = Fe + Ag+Fe3+ + Ag = 3Fe + Ag+
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeS2 (s) + H2O (l) + O2 (g)= FeSO4 (aq) + H2SO4 (aq)2FeS2(s) + 2H2O(l) + 7O2(g) = 2FeSO4(aq) + 2H2SO4(aq)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe+S8=FeS8Fe + S8 = 8FeS
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO =Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe(s)+O2(g)=Fe2O34Fe(s) + 3O2(g) = 2Fe2O3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS+ O2= Fe2O3+SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe3O4 + CO = Fe + CO 2Fe3O4 + 4CO = 3Fe + 4CO2
Fe 2+ + MnO4- + H + =Fe 3+ + Mn 2+ + H 2 O(l)-39Fe2+ + 2MnO4- + 16H+ = -26Fe3+ + Mn2+ + 8H2O(l)
Fe+++ + NO2- + H2O = Fe++ + H+ + NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
Fe(NO2)3+Mg3(PO3)2 =FePO3 + Mg (NO2)22Fe(NO2)3 + Mg3(PO3)2 = 2FePO3 + 3Mg(NO2)2
FeO3(s) + CO(g) = Fe + CO2(g)FeO3(s) + 3CO(g) = Fe + 3CO2(g)
FeO3(s) + CO(g) = Fe + CO2(g)FeO3(s) + 3CO(g) = Fe + 3CO2(g)
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3(s) + H2O(l) =Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeCl3(aq)+NaOH(aq)=Fe(OH)3+NaCl(aq)FeCl3(aq) + 3NaOH(aq) = Fe(OH)3 + 3NaCl(aq)
FEO+C=FE+CO22FEO + C = 2FE + CO2
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4(s)+O2(g)=Fe2O3(s) 4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 =Fe2Cl34Fe + 3Cl2 = 2Fe2Cl3
Fe(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2(g) 2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
Fe(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2(g) 2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s) + H2O(g) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe + Cu2SO4 = Fe2SO4 + Cu2Fe + Cu2SO4 = Fe2SO4 + 2Cu
F + Fe = FeF66F + Fe = FeF6
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe + 2 NaCl = FeCl2 + 2 NaFe + 2NaCl = FeCl2 + 2Na
Fe(s) + H2SO4(aq) = FeSO4(aq) + H2(g)Fe(s) + H2SO4(aq) = FeSO4(aq) + H2(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H2 2Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
FEO+C=FE+CO22FEO + C = 2FE + CO2
FeL2 + CaS = FeS + CaL2FeL2 + CaS = FeS + CaL2
FeL2 + CaS = FeS + CaL2FeL2 + CaS = FeS + CaL2
Fe2 (SO4)3+KOH=K2SO4+Fe (OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3(l) + CO(g) = Fe(l) + CO2(g)Fe2O3(l) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe(s) + HCl(aq) = FeCl3(aq) + H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH) 3+HCl+K4Fe(CN)6=KFe(Fe(CN) 6)+KCl +H2OFe(OH)3 + 3HCl + K4Fe(CN)6 = KFe(Fe(CN)6) + 3KCl + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+CO(g)=Fe+CO2Fe2O3 + 3CO(g) = 2Fe + 3CO2
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH)3(s) = Fe2O3(s) + H2O(g)2Fe(OH)3(s) = Fe2O3(s) + 3H2O(g)
Fe(s) + H2O(l) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO32Fe2O3 + 3CO = 4Fe + 3CO3
Fe2O3+C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeO(l)+Al(l)=A l 2 O 3 (l)+Fe(l)3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
FeO(l)+Al(l)=A l 2 O 3 (l)+Fe(l)3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3 (s) + HNO3 (aq) = Fe(NO3)3 (aq) + H2O (l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(NO3)2+KOH=Fe(OH)2+K(NO3)Fe(NO3)2 + 2KOH = Fe(OH)2 + 2K(NO3)
Fe(NO3)2+KOH=Fe(OH)2+K(NO3)Fe(NO3)2 + 2KOH = Fe(OH)2 + 2K(NO3)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
F2 + MgCl2 = Cl2 + MgF2F2 + MgCl2 = Cl2 + MgF2
Fe+++ +NH3 +H2O =Fe(OH)3 +NH4+Fe+++ + 3NH3 + 3H2O = Fe(OH)3 + 3NH4+
FeS(s)+HCl(aq)= FeCl 2 (aq)+ H 2 S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2(SO4)3(aq)+NH3(aq)+H2O(l)=Fe(OH)3(aq)+(NH4)2SO4(aq)Fe2(SO4)3(aq) + 6NH3(aq) + 6H2O(l) = 2Fe(OH)3(aq) + 3(NH4)2SO4(aq)
FeCl2 + O2 = FeCl3 + Fe2O3 12FeCl2 + 3O2 = 8FeCl3 + 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2S3 + H2O + O2 = H2SO4 + Fe2O3(H2O)3Fe2S3 + 6H2O + 6O2 = 3H2SO4 + Fe2O3(H2O)3
FeCl3(s)+H2O=HCl(aq)+Fe(OH)3(s)FeCl3(s) + 3H2O = 3HCl(aq) + Fe(OH)3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2S3+O2=Fe2O3 +SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe + CuCl2 = FeCl3 + Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
Fe2O3(l) + CO(g) = Fe(l) + CO2(g)Fe2O3(l) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe(s) + Cl2(g) =FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe3O2 + CO = 3Fe + CO2Fe3O2 + 2CO = 3Fe + 2CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(SO4)3+ KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s)+Cl2=FeCl3(s)2Fe(s) + 3Cl2 = 2FeCl3(s)
Fe(s)+Cl2=FeCl3(s)2Fe(s) + 3Cl2 = 2FeCl3(s)
Fe(s)+H2O(l)=Fe3O4(s)+ H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe3O4(s) + CO(g) = Fe(s) + CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe3O4(s) + H2(g) = Fe(s) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
FeS2(s) + O2(g) = Fe2O3(s) + SO2(g)4FeS2(s) + 11O2(g) = 2Fe2O3(s) + 8SO2(g)
FeSO4(aq)+Ba(OH)2(aq)=Fe(OH)2(s)+BaSO4(s)FeSO4(aq) + Ba(OH)2(aq) = Fe(OH)2(s) + BaSO4(s)
FeSO4(aq)+Ba(OH)2(aq)=Fe(OH)2+BaSO4FeSO4(aq) + Ba(OH)2(aq) = Fe(OH)2 + BaSO4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + Mg = MgCl2 + Fe2FeCl3 + 3Mg = 3MgCl2 + 2Fe
Fe(OH)2 =FeO + H2OFe(OH)2 = FeO + H2O
Fe(OH)2 =FeO + H2OFe(OH)2 = FeO + H2O
FeS(s)+HCl(aq)= FeCl2(aq)+ H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 +H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(s)+S8(s)=Fe2S3(s)16Fe(s) + 3S8(s) = 8Fe2S3(s)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2+Na2CO3=FeCO3+2NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2 O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4(s) + CO(g) = Fe(s) + CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe3O4(s) + H2(g) = Fe(s) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe3O4(s) + H2(g) = Fe(s) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
FeS2(s) + O2(g) = Fe2O3(s) + SO2(g)4FeS2(s) + 11O2(g) = 2Fe2O3(s) + 8SO2(g)
FeCl2 (aq) + 2NaOH (aq) = Fe(OH)2 (s) + 2NaCl (aq)FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)
Fe3O4(s) + H2(g) = Fe(s) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
FeCl3(aq) + KI(aq) = I2(s) + FeCl2(aq) + KCl(aq)2FeCl3(aq) + 2KI(aq) = I2(s) + 2FeCl2(aq) + 2KCl(aq)
Fe + FeCl3 = FeCl2Fe + 2FeCl3 = 3FeCl2
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS2+O2= SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
FeO(s) + O3(g) = Fe2O3(g)6FeO(s) + O3(g) = 3Fe2O3(g)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO0Fe2O3 + CO = 0Fe + CO
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3(l) + CO(g) = Fe(l) + CO2(g)Fe2O3(l) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+ H2= Fe+ H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeSO4(aq)+(NH4)2S(aq)= FeS+(NH4)2SO4FeSO4(aq) + (NH4)2S(aq) = FeS + (NH4)2SO4
Fe(s)+S8(s)=Fe2S3(s) 16Fe(s) + 3S8(s) = 8Fe2S3(s)
F2+O2=F2O2F2 + O2 = 2F2O
Fe2O3(l) + CO(g) = Fe(l) + CO2(g)Fe2O3(l) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(CNS)3 + Cl2 + H2O = HCl + H2SO4 + FeCl3 + CO2 + N22Fe(CNS)3 + 33Cl2 + 36H2O = 60HCl + 6H2SO4 + 2FeCl3 + 6CO2 + 3N2
FeS2+O2=Fe2O3+S024FeS2 + 3O2 = 2Fe2O3 + 4S02
Fe(CNS)3 + Cl2 + H2O = HCl + H2SO4 + FeCl3 + CO2 + N22Fe(CNS)3 + 33Cl2 + 36H2O = 60HCl + 6H2SO4 + 2FeCl3 + 6CO2 + 3N2
FeSO4+AgNO3=Ag2SO4+Fe(NO3)2FeSO4 + 2AgNO3 = Ag2SO4 + Fe(NO3)2
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3+HCl=FeCl3+H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
Fe + O2 = Fe2 O34Fe + 3O2 = 2Fe2O3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3Cl + O2 = Fe2O3 + Cl24Fe3Cl + 9O2 = 6Fe2O3 + 2Cl2
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
FeO+O=Fe3O43FeO + O = Fe3O4
Fe(NO3)2(aq) + H2S(g) = FeS(s) + HNO3(aq)Fe(NO3)2(aq) + H2S(g) = FeS(s) + 2HNO3(aq)
FeBr3+Pb(CO3)2=PbBr3+Fe(CO3)2FeBr3 + Pb(CO3)2 = PbBr3 + Fe(CO3)2
FeBr3+Pb(CO3)2=PbBr3+Fe(CO3)2FeBr3 + Pb(CO3)2 = PbBr3 + Fe(CO3)2
Fe(OH)2+LiO2=FeO2+Li(OH)2Fe(OH)2 + LiO2 = FeO2 + Li(OH)2
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2(SO4)3 + NH3 + H2O = Fe(OH)3 + (NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F e 2 O 3 (s)+CO(g)=Fe(s)+C O 2 (g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(ClO4)2(aq)+K2CO3(aq) = FeCO3(s)+2KClO4(aq)Fe(ClO4)2(aq) + K2CO3(aq) = FeCO3(s) + 2KClO4(aq)
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 + 2 Ca(OH)2 = Fe2(OH)3 + Ca(SO4)22Fe2(SO4)3 + 3Ca(OH)2 = 2Fe2(OH)3 + 3Ca(SO4)2
Fe2(SO4)3 + 2 Ca(OH)2 + H2O = Fe2(OH)3 + Ca(SO4)22Fe2(SO4)3 + 3Ca(OH)2 + 0H2O = 2Fe2(OH)3 + 3Ca(SO4)2
Fe2(SO4)3 + 2 Ca(OH)2 + H2O = Fe2(OH)3 + Ca(SO4)22Fe2(SO4)3 + 3Ca(OH)2 + 0H2O = 2Fe2(OH)3 + 3Ca(SO4)2
Fe2(SO4)3 + 2 Ca(OH)2 = Fe2(OH)3 + Ca(SO4)22Fe2(SO4)3 + 3Ca(OH)2 = 2Fe2(OH)3 + 3Ca(SO4)2
Fe2(SO4)3 + Ca(OH)2 + 6H2O = Fe(OH)3 + Ca(SO)4 + H-4Fe2(SO4)3 - 3Ca(OH)2 + 18H2O = -8Fe(OH)3 - 3Ca(SO)4 + 54H
Fe2(SO4)3 + Ca(OH)2 + H2O = Fe(OH)3 + Ca(SO)4 + H-4Fe2(SO4)3 - 3Ca(OH)2 + 18H2O = -8Fe(OH)3 - 3Ca(SO)4 + 54H
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2(SO4)3+NH3+H2O=Fe(OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.