Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe+HNO3=FeNO3+H22Fe + 2HNO3 = 2FeNO3 + H2
Fe+Pb(NO3)2=FeNO3+Pb2Fe + Pb(NO3)2 = 2FeNO3 + Pb
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+++ + I- + H2O = Fe++ + IO3- + H+6Fe+++ + I- + 3H2O = 6Fe++ + IO3- + 6H+
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2(aq) + Ag3PO4(aq)=Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
FeCl2(aq) + Ag3PO4(aq)=Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeCl3 + Ca(OH)2 =Fe(OH)3 + CaCl2 2FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
FeCl2(aq) + KMnO4(aq) + HCl(aq) = FeCl3(aq) +MnCl2(aq) +H2O(l) + KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4+CO2=Fe+CO20Fe3O4 + CO2 = 0Fe + CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H = Fe + H2OFe2O3 + 6H = 2Fe + 3H2O
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCO3 + C6H8O7 = FeC12H10O14 + CO2 + H2O9FeCO3 + 16C6H8O7 = 9FeC12H10O14 - 3CO2 + 19H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(NO3)3(aq) + LiOH(aq)=LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeSO4(aq) + Na3PO4(aq)=Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
Fe2O3+S=Fe+SO22Fe2O3 + 3S = 4Fe + 3SO2
FeCl2(aq) + (NH4)2S(aq) = FeS + NH4ClFeCl2(aq) + (NH4)2S(aq) = FeS + 2NH4Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(NO3)3 +Na3PO4 = FePO4 + 3Na(NO3)Fe(NO3)3 + Na3PO4 = FePO4 + 3Na(NO3)
FeSO4 + K3PO4 = Fe3(PO4)2 + K2SO43FeSO4 + 2K3PO4 = Fe3(PO4)2 + 3K2SO4
FeCO3(s) + HNO3(aq) = Fe(NO3)2 + CO2 + H2OFeCO3(s) + 2HNO3(aq) = Fe(NO3)2 + CO2 + H2O
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe(OH)3(s) + HNO3(aq) = Fe(NO3)3 + H2OFe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3 + 3H2O
Fe2(SO4)3+6KOH = 2Fe(OH)3+3K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
Fe2(SO4)3+6KOH = 2Fe(OH)3+3K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
Fe(NO3)3(aq) + LiOH(aq) = LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe + O2+H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe3O4 + CO = FeO + CO2Fe3O4 + CO = 3FeO + CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g) = Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCO3 + HNO3 = Fe(NO3)2 + CO2 + H2OFeCO3 + 2HNO3 = Fe(NO3)2 + CO2 + H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4
FeSO4 + SCN + H2O2 = FeO2 + SCNH2 + SO4FeSO4 + SCN + H2O2 = FeO2 + SCNH2 + SO4
FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4
Fe2+OH=Fe(OH)2Fe2 + 4OH = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeO(s)+O2(g)=Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeSO4(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
FE+ CL2=FECL2FE + CL2 = FECL2
FeO3H3=Fe2O3+H2O2FeO3H3 = Fe2O3 + 3H2O
Fe+H2O=Fe3O4+4H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+4H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2O=Fe3O4+H2O0Fe + H2O = 0Fe3O4 + H2O
FeS2+ HNO3=Fe2(SO4)3 + NO2+H2O+H2SO42FeS2 + 30HNO3 = Fe2(SO4)3 + 30NO2 + 14H2O + H2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+S8=Fe2S316Fe + 3S8 = 8Fe2S3
FeO(s)+ O2(g)= Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2 + O2 + H2O = Fe(OH)3 + H2SO44FeS2 + 15O2 + 14H2O = 4Fe(OH)3 + 8H2SO4
FeS2 + O2 + H2O = Fe(OH)3 + H2SO44FeS2 + 15O2 + 14H2O = 4Fe(OH)3 + 8H2SO4
FeCl3+Zn=FeCl2+ZnCl22FeCl3 + Zn = 2FeCl2 + ZnCl2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe 2 (CO 3 ) 3 (s)=Fe 2 O 3 (s)+CO 2 (g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO 3 ) 2 (aq)=Fe(NO 3 ) 3 (aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe(s)+Cd(NO 3 ) 2 (aq)=Fe(NO 3 ) 3 (aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe(s)+Cd(NO 3 ) 2 (aq)=Fe(NO 3 ) 3 (aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe(NO3)3 + NaHCO3 = Fe(HCO3)3 + NaNO3Fe(NO3)3 + 3NaHCO3 = Fe(HCO3)3 + 3NaNO3
Fe(NO3)3 + NaHCO3 = Fe(HCO3)3 + NaNO3Fe(NO3)3 + 3NaHCO3 = Fe(HCO3)3 + 3NaNO3
FeBr2 + Cr(C2H3O2)3=CrBr2 + Fe(C2H3O2)3FeBr2 + Cr(C2H3O2)3 = CrBr2 + Fe(C2H3O2)3
FeBr2 + Cr(C2H3O2)=CrBr2 + Fe(C2H3O2)FeBr2 + Cr(C2H3O2) = CrBr2 + Fe(C2H3O2)
FeCl3+H2O+NaOH=HFeO2+NaClFeCl3 - H2O + 3NaOH = HFeO2 + 3NaCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeO(s)+O2(g)=Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeS2 + O = Fe2O3 + SO22FeS2 + 11O = Fe2O3 + 4SO2
FeSO4(aq) + K3PO4(aq) = FePO4 + K3SO4FeSO4(aq) + K3PO4(aq) = FePO4 + K3SO4
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe + 2AgCl= FeCl2 + 2AgFe + 2AgCl = FeCl2 + 2Ag
Fe2(SO4)3+KCLO3+KOH=K2FeO4+K2SO4+KCL+H2OFe2(SO4)3 + KCLO3 + 10KOH = 2K2FeO4 + 3K2SO4 + KCL + 5H2O
Fe(OH)3 + H2SO4= Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe(CO)5 + NaOH = Na2Fe(CO) 4 + Na2CO3 + H2O Fe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
Fe+3O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3+Na2S=Fe2S3+NaBr2FeBr3 + 3Na2S = Fe2S3 + 6NaBr
Fe3O4+HCl=FeCl3+FeCl2+H2OFe3O4 + 8HCl = 2FeCl3 + FeCl2 + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3+HNO3=FeOH(NO3)2+H2OFe(OH)3 + 2HNO3 = FeOH(NO3)2 + 2H2O
Fe(OH)3+HNO3=FeOH(NO3)2+H2OFe(OH)3 + 2HNO3 = FeOH(NO3)2 + 2H2O
FeCl3+NH4OH=NH4Cl+Fe(OH)3FeCl3 + 3NH4OH = 3NH4Cl + Fe(OH)3
FeCl3+NH4OH=NH4Cl+Fe(OH)3FeCl3 + 3NH4OH = 3NH4Cl + Fe(OH)3
Fe (s)+H2O (l)=Fe3O4 (s)+H2O (l)0Fe(s) + H2O(l) = 0Fe3O4(s) + H2O(l)
Fe+O2=FeO2Fe + O2 = 2FeO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO + H2O = Fe2O3 + H2FeO + H2O = Fe2O3 + 2H
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe2S3 + H2 = H2S + FeFe2S3 + 3H2 = 3H2S + 2Fe
Fe(ClO3)3 + Mg = Fe + Mg(ClO3)22Fe(ClO3)3 + 3Mg = 2Fe + 3Mg(ClO3)2
Fe(s) + SnSO4(aq) = FeSO4(aq) + Sn(s)Fe(s) + SnSO4(aq) = FeSO4(aq) + Sn(s)
Fe(s)+HCl(aq)=FeCl2+H2Fe(s) + 2HCl(aq) = FeCl2 + H2
Fe+Cd(NO3)2 = Fe(NO3)3 + Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe + O2 = Fe2 O34Fe + 3O2 = 2Fe2O3
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe3 + 4 H2O = Fe3O4 + H2Fe3 + 4H2O = Fe3O4 + 4H2
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
Fe(ClO3)3 + Mg = Fe + Mg(ClO3)22Fe(ClO3)3 + 3Mg = 2Fe + 3Mg(ClO3)2
Fe(ClO3)3 + Mg = Fe + Mg(ClO3)22Fe(ClO3)3 + 3Mg = 2Fe + 3Mg(ClO3)2
Fe(ClO3)3 + Mg = Fe + MgClO3Fe(ClO3)3 + 3Mg = Fe + 3MgClO3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+C(s)=Fe(s)+CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeBr3(aq) + K2CO3(aq) =K2Br3+FeCO3FeBr3(aq) + K2CO3(aq) = K2Br3 + FeCO3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeTiO3+H2SO4+H2O=FeSO4*7H2O+TiOSO4FeTiO3 + 2H2SO4 + 5H2O = FeSO4*7H2O + TiOSO4
FeTiO3 + H2SO4 + H2O = FeSO4*7H2O + TiOSO4FeTiO3 + 2H2SO4 + 5H2O = FeSO4*7H2O + TiOSO4
FeTiO3 + H2SO4 + H2O = FeSO4*7H2O + TiOSO4FeTiO3 + 2H2SO4 + 5H2O = FeSO4*7H2O + TiOSO4
Fe+S=FeSFe + S = FeS
Fe+S=FeSFe + S = FeS
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(NO3)3+NH4OH=Fe(OH)3+NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeSO4+K3PO4 = FePO4+K3SO4FeSO4 + K3PO4 = FePO4 + K3SO4
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe + O2 = Fe2O42Fe + 2O2 = Fe2O4
FeCl2 + CuSO4 = FeSO4 + CuCl2FeCl2 + CuSO4 = FeSO4 + CuCl2
Fe2O3 (s) + C(s) = Fe(s) + CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+F2=FeF3+Cl22FeCl3 + 3F2 = 2FeF3 + 3Cl2
Fe + CuCl2 =FeCl3 + Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
FeCl3 + KOH = Fe(OH)3 + KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
FeS+ HCl = FeCl2 +H2SFeS + 2HCl = FeCl2 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4+3CO=Fe+3CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeSo4 + BaCl2 = BaSo4 + FeCl2FeSo4 + BaCl2 = BaSo4 + FeCl2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 (aq)+NH4SCN(aq) =FeSCNCl2(aq)+ NH4Cl(aq)FeCl3(aq) + NH4SCN(aq) = FeSCNCl2(aq) + NH4Cl(aq)
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe2O3(s) + C(s) = Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe+MgCl=Mg+FeClFe + MgCl = Mg + FeCl
Fe+CuCl2=FeCl3+Cu =2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe(NO3)3 +Na2SO4 = NaNO3 + Fe2(SO4)32Fe(NO3)3 + 3Na2SO4 = 6NaNO3 + Fe2(SO4)3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(ClO3)3 + Mg = Fe + Mg(ClO3)Fe(ClO3)3 + 3Mg = Fe + 3Mg(ClO3)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe + S = FeS2Fe + 2S = FeS2
FeS2+O2=SO2+FeFeS2 + 2O2 = 2SO2 + Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
FeCl3(aq)+KSCN(aq)=Fe(SCN)3(aq)+KCl(aq)FeCl3(aq) + 3KSCN(aq) = Fe(SCN)3(aq) + 3KCl(aq)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O = Fe2O32Fe + 3O = Fe2O3
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 + H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2+ (NO3) = FeNO3Fe2 + 2(NO3) = 2FeNO3
Fe2+ (NO3) = FeNO3Fe2 + 2(NO3) = 2FeNO3
FeS2 + NO3- + Cl- + H+ =FeCl4- + NO2 + SO4-2 +H2OFeS2 + 15NO3- + 4Cl- + 14H+ = FeCl4- + 15NO2 + 2SO4-2 + 7H2O
FeS2 + NO3 + Cl- + H+ =FeCl4- + NO2 + SO4-2 +H2O-2FeS2 - 15NO3 - 8Cl- + 2H+ = -2FeCl4- - 15NO2 - 4SO4-2 + H2O
Fe2O3(s) + H2O(l) = Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeSo4+Sr(OH)2=Fe(OH)2+SrSo4FeSo4 + Sr(OH)2 = Fe(OH)2 + SrSo4
Fe2+OH=Fe(OH)2Fe2 + 4OH = 2Fe(OH)2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+HNO3=Fe (NO3) 3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeCl3 + KNO3 = FeNO3 +KCl3FeCl3 + KNO3 = FeNO3 + KCl3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl 2 (aq)+H 2 S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3(aq) + K2CO3(aq) = KCl(aq) + Fe2(CO3)3(s) 2FeCl3(aq) + 3K2CO3(aq) = 6KCl(aq) + Fe2(CO3)3(s)
FeCl3(aq) + NaOH(aq) = Fe(OH)3(s) + NaCl(aq) FeCl3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaCl(aq)
FeBr3(aq) + Cl2(g) = FeCl3(aq) + Br2(l) 2FeBr3(aq) + 3Cl2(g) = 2FeCl3(aq) + 3Br2(l)
FeBr3(aq) + Cl2(g) = FeCl3(aq) + Br2(l) 2FeBr3(aq) + 3Cl2(g) = 2FeCl3(aq) + 3Br2(l)
Fe2O4 + H2SO4 = Fe2SO4 + SO2 + H2O-1Fe2O4 + 2H2SO4 = -1Fe2SO4 + 3SO2 + 2H2O
Fe+Cu(No2)=Fe(No3)2+CuFe + 3Cu(No2) = Fe(No3)2 + 3Cu
Fe(NO3)2 + KI = FeI2 + KNO3Fe(NO3)2 + 2KI = FeI2 + 2KNO3
FeSO4 + H2O2 = Fe2(SO4)3 + 2H2O + O20FeSO4 + 2H2O2 = 0Fe2(SO4)3 + 2H2O + O2
FeSO4 + H2O2 = Fe2(SO4)3 + 2H2O + O20FeSO4 + 2H2O2 = 0Fe2(SO4)3 + 2H2O + O2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(OH)3 + H3PO4 = FePO4 + 3 H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H=Fe+H2OFe2O3 + 6H = 2Fe + 3H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe + HCl = H2 + FeCl2Fe + 2HCl = H2 + FeCl2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2O=Fe3O4+H3Fe + 4H2O = Fe3O4 + 8H
FeCl3 (aq) + K3PO4(aq) = FePO4 + 3KClFeCl3(aq) + K3PO4(aq) = FePO4 + 3KCl
FeCl3 (l) + K3PO4(l) = FePO4 + 3KClFeCl3(l) + K3PO4(l) = FePO4 + 3KCl
FeCl3 + K3PO4 = FePO4 + 3KClFeCl3 + K3PO4 = FePO4 + 3KCl
Fe(OH)3 = H2O + Fe(OH)3Fe(OH)3 = 0H2O + Fe(OH)3
Fe2S3 + H2 = H2S + FeFe2S3 + 3H2 = 3H2S + 2Fe
Fe2 O3 + CO = Fe3 O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe (SO4)+HNO3+H2SO4=Fe2 (SO4)3+NO+H2O6Fe(SO4) + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe + NaBr = FeBr3 + NaFe + 3NaBr = FeBr3 + 3Na
Fe + S8 = FeS8Fe + S8 = 8FeS
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + H2SO4 + KSCN + H2O2 = Fe(SCN)6 + H2K(SO4)2 + H2OFeSO4 + 11H2SO4 + 6KSCN + 5H2O2 = Fe(SCN)6 + 6H2K(SO4)2 + 10H2O
FeSO4 + H2SO4 + KSCN + H2O2 = Fe(SCN)6 + H2K(SO4)2 + H2OFeSO4 + 11H2SO4 + 6KSCN + 5H2O2 = Fe(SCN)6 + 6H2K(SO4)2 + 10H2O
Fe(s) + SnSO4(aq) = FeSO4(aq) + Sn(s)Fe(s) + SnSO4(aq) = FeSO4(aq) + Sn(s)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3 + FeCl2 + NH3 + H2O = Fe3O4 +NH4Cl2FeCl3 + FeCl2 + 8NH3 + 4H2O = Fe3O4 + 8NH4Cl
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe(s) + HCl=FeCl3(aq) + H22Fe(s) + 6HCl = 2FeCl3(aq) + 3H2
Fe + HCl = FeCl2 + HFe + 2HCl = FeCl2 + 2H
Fe2(CO3)3+HCl= FeCl3+CO2+H2OFe2(CO3)3 + 6HCl = 2FeCl3 + 3CO2 + 3H2O
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3+NH4OH=Fe(OH)3+NH4(NO3)Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeCl2 + KOH = Fe(OH)2 + KClFeCl2 + 2KOH = Fe(OH)2 + 2KCl
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCi3 + NH4OH = Fe(OH)3 + NH4CiFeCi3 + 3NH4OH = Fe(OH)3 + 3NH4Ci
Fe3O+CO=Fe+CO2Fe3O + CO = 3Fe + CO2
Fe(NO3)2 + Na2CO3 = FeCO3 + NaNO3Fe(NO3)2 + Na2CO3 = FeCO3 + 2NaNO3
Fe + O2 = Fe2 O42Fe + 2O2 = Fe2O4
Fe + O2 = Fe2O42Fe + 2O2 = Fe2O4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO=Fe3O4 +CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe3O4 + CO=FeO +CO2Fe3O4 + CO = 3FeO + CO2
FeCl2+KOH+O2+H2O=Fe(OH)3+KCl4FeCl2 + 8KOH + O2 + 2H2O = 4Fe(OH)3 + 8KCl
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 (s) + CO (g) = 2 Fe (s) + CO2 (g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + HI = FeI3 + H22Fe + 6HI = 2FeI3 + 3H2
Fe(NO3)3 (aq) + KI (aq) = FeI + K(NO3)3 (aq)Fe(NO3)3(aq) + KI(aq) = FeI + K(NO3)3(aq)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH) + HO-2 = Fe(OH)3 + OH--1Fe(OH) + 2HO-2 = -1Fe(OH)3 + 4OH-
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + FeCl3 + NH4OH = Fe3O4 + (NH4)2SO4 + NH4Cl + H2025FeSO4 - 10FeCl3 + 20NH4OH = 5Fe3O4 + 25(NH4)2SO4 - 30NH4Cl + H20
FeSO4 + FeCl3 + NH4OH = Fe3O4 + (NH4)2SO4 + NH4Cl + H2025FeSO4 - 10FeCl3 + 20NH4OH = 5Fe3O4 + 25(NH4)2SO4 - 30NH4Cl + H20
Fe2O3(s) + 3 CO(g) = 2Fe(s) + 3 CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeSO4 + FeCl3 + NH4OH = Fe3O4 + NH4SO4 + NH4Cl3-1FeSO4 + FeCl3 + 0NH4OH = 0Fe3O4 - NH4SO4 + NH4Cl3
FeSO4 + FeCl3 + H2O + NH4OH = Fe3O4 + NH4SO4 + NH4Cl3-1FeSO4 + FeCl3 + 0H2O + 0NH4OH = 0Fe3O4 - NH4SO4 + NH4Cl3
FeSO4 + FeCl3 + H2O + NH4OH = Fe3O4 + NH4SO4 + NH4Cl3-1FeSO4 + FeCl3 + 0H2O + 0NH4OH = 0Fe3O4 - NH4SO4 + NH4Cl3
FE + H2O = FE3O4 + H2O0FE + H2O = 0FE3O4 + H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe3O4 +C02-6Fe2O3 + 2CO = -4Fe3O4 + C02
Fe3O4(s)+H2(g)=Fe(l)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(l) + 4H2O(g)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(NO3)3 + Na2SO4 = NaNO3 + Fe2(SO4)32Fe(NO3)3 + 3Na2SO4 = 6NaNO3 + Fe2(SO4)3
Fe2CO3 + CO = Fe + CO2Fe2CO3 + CO = 2Fe + 2CO2
FeSO4 + CuCl = FeCl + CuSO4FeSO4 + CuCl = FeCl + CuSO4
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3+H2SO4=Fe2(SO4)3+HCl2FeCl3 + 3H2SO4 = Fe2(SO4)3 + 6HCl
FeSO4 + KMnO4 + H2SO = Fe2 (SO4) 3 + MnSO4 + K2SO4 + H2-2FeSO4 + 6KMnO4 + 8H2SO = -1Fe2(SO4)3 + 6MnSO4 + 3K2SO4 + 8H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3+NH4OH=Fe(OH)3+NH4(NO3)Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3+NH4OH=Fe(OH)3+NH4(NO3)Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)
Fe(NO3)3+NH4OH=Fe(OH)3+NH4(NO3)Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)
Fe(NO3)3+NH4OH=Fe(OH)3+NH4(NO3)Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + Na2SO4 = Fe2(SO4)3 + Na2OFe2O3 + 3Na2SO4 = Fe2(SO4)3 + 3Na2O
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3+KOH=Fe(OH)3+KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl2 + KOH + O2 + H2O = Fe(OH)3 + KCl4FeCl2 + 8KOH + O2 + 2H2O = 4Fe(OH)3 + 8KCl
Fe2O2+H2SO4=Fe2(SO4)2+H2OFe2O2 + 2H2SO4 = Fe2(SO4)2 + 2H2O
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe(No3)3 + H2So4 = Fe2(So4)3 + HNo32Fe(No3)3 + 3H2So4 = Fe2(So4)3 + 6HNo3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeI3 + Pb(NO3)2 = PbI2 + Fe(NO3)32FeI3 + 3Pb(NO3)2 = 3PbI2 + 2Fe(NO3)3
Fe2O3(s) + H2O(l) = Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeCl3(aq) + KSCN(aq) = Fe(SCN)3(aq) + KCl(aq) FeCl3(aq) + 3KSCN(aq) = Fe(SCN)3(aq) + 3KCl(aq)
FeCl3(aq) + KSCN = Fe(SCN)3(aq) + KCl(aq) FeCl3(aq) + 3KSCN = Fe(SCN)3(aq) + 3KCl(aq)
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3(s)+CO(g)= Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
F2 + AlCl3 = AlF3 + Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeCl2 + Na2SiO3 = NaCl + FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+Na+=Fe++ +NaFe + 2Na+ = Fe++ + 2Na
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
FeNO3 = FeO + O2 + NO2 FeNO3 = FeO + 0O2 + NO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeO3+H2=Fe+H2OFeO3 + 3H2 = Fe + 3H2O
Fe3+Cl=FeClFe3 + 3Cl = 3FeCl
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=3Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=3Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=3Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl + NaOh = FeOh + NaClFeCl + NaOh = FeOh + NaCl
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl+NaOH=FeOH+NaClFeCl + NaOH = FeOH + NaCl
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(OH)2 + Cl = Fe + ClO3 + H2O3Fe(OH)2 + Cl = 3Fe + ClO3 + 3H2O
Fe+SCN = FeSCNFe + SCN = FeSCN
Fe(s) + Br2(l) = FeBr3(s)2Fe(s) + 3Br2(l) = 2FeBr3(s)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(NO3)3 + NH4OH = Fe(NH4)3 + 3NO3OHFe(NO3)3 + 3NH4OH = Fe(NH4)3 + 3NO3OH
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe3SO4+ H2SO4 + H2O2 = FeSO4 + H2OFe3SO4 + 2H2SO4 + 2H2O2 = 3FeSO4 + 4H2O
FeSO4 + H2SO4 + H2O2 = Fe3SO4 + H2O-3FeSO4 + 2H2SO4 + 2H2O2 = -1Fe3SO4 + 4H2O
Fe2SO4 + H2SO4 + H2O2 = Fe3SO4 + H2O-3Fe2SO4 + H2SO4 + H2O2 = -2Fe3SO4 + 2H2O
FeSO4 + H2SO4 + H2O2 = Fe3SO4 + H2O-3FeSO4 + 2H2SO4 + 2H2O2 = -1Fe3SO4 + 4H2O
FeSO4 + H2SO4 + H2O2 = Fe3(SO4)2 + H2O-3FeSO4 + H2SO4 + H2O2 = -1Fe3(SO4)2 + 2H2O
FeSO4 + H2SO4 + H2O2 = Fe3SO4 + H2O-3FeSO4 + 2H2SO4 + 2H2O2 = -1Fe3SO4 + 4H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3SO4 + H2SO4 + H2O2 = FeSO4 + H2OFe3SO4 + 2H2SO4 + 2H2O2 = 3FeSO4 + 4H2O
Fe(OH)3 =Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3(SO4)2 + H2SO4 + H2O2 = FeSO4 + H2OFe3(SO4)2 + H2SO4 + H2O2 = 3FeSO4 + 2H2O
Fe(SO4)2 + H2SO4 + H2O2 = FeSO4 + H2O-1Fe(SO4)2 + H2SO4 + H2O2 = -1FeSO4 + 2H2O
Fe3(SO4)2 + H2SO4 + H2O2 = FeSO4 + H2OFe3(SO4)2 + H2SO4 + H2O2 = 3FeSO4 + 2H2O
Fe + 2F= FeFFe + F = FeF
Fe(SO4)2 + H2SO4 + H2O2 = Fe3SO4 + H2O-3Fe(SO4)2 + 5H2SO4 + 5H2O2 = -1Fe3SO4 + 10H2O
Fe(SO4) + H2SO4 + H2O2 = Fe3SO4 + H2O-3Fe(SO4) + 2H2SO4 + 2H2O2 = -1Fe3SO4 + 4H2O
Fe + F= FeFFe + F = FeF
FeSO4 + H2SO4 + H2O2 = Fe3SO4 + H2O-3FeSO4 + 2H2SO4 + 2H2O2 = -1Fe3SO4 + 4H2O
FeSO4 + H2SO4 + H2O2 = Fe3(SO4)2 + H2O-3FeSO4 + H2SO4 + H2O2 = -1Fe3(SO4)2 + 2H2O
FeSO4 + KMnO4 + H2SO4 = Fe2 (SO4) 3 + MnSO4 + K2SO4 + H22FeSO4 + 0KMnO4 + H2SO4 = Fe2(SO4)3 + 0MnSO4 + 0K2SO4 + H2
FeCl3(aq) + KOH(aq) = Fe(OH)3(s) + KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(s) + 3KCl(aq)
FeCl3 + NH4OH = NH4Cl + Fe(OH)3FeCl3 + 3NH4OH = 3NH4Cl + Fe(OH)3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s)+S(l) = Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(ClO4)2 + K2S = FeS + KClO4Fe(ClO4)2 + K2S = FeS + 2KClO4
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3 + 3 CO = Fe + 3 CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2S3(s)+O2(g)=Fe2O3(s)+SO2(g)2Fe2S3(s) + 9O2(g) = 2Fe2O3(s) + 6SO2(g)
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3(aq)+SnCl2(aq)=2FeCl2(aq)+SnCl4(aq)2FeCl3(aq) + SnCl2(aq) = 2FeCl2(aq) + SnCl4(aq)
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl2 +HCl +KMnO4 =FeCl3 + MnCl2 +KCl + H2O5FeCl2 + 8HCl + KMnO4 = 5FeCl3 + MnCl2 + KCl + 4H2O
FeO3+H20 = Fe(OH)320FeO3 + 3H20 = 20Fe(OH)3
FeO3+H20 = Fe(OH)320FeO3 + 3H20 = 20Fe(OH)3
FeCl2 +HCl +KMnO4 =FeCl3 + MnCl2 +KCl + H2O5FeCl2 + 8HCl + KMnO4 = 5FeCl3 + MnCl2 + KCl + 4H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe3 + S = Fe2S3 2Fe3 + 9S = 3Fe2S3
Fe2O3 = Fe + O22Fe2O3 = 4Fe + 3O2
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe + Ag(NO3) = Fe(NO3)2 + AgFe + 2Ag(NO3) = Fe(NO3)2 + 2Ag
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq) FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe + HCl = FeCl2 = H2Fe + 2HCl = FeCl2 + H2
Fe +H2O =H2 +Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe2O3 +C=Fe +CO  Fe2O3 + 3C = 2Fe + 3CO
Fe2O3 +Al = Al2O3 +FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3+C=Fe=COFe2O3 + 3C = 2Fe + 3CO
FeCl3 + NH4OH =NH4Cl + Fe(OH)3FeCl3 + 3NH4OH = 3NH4Cl + Fe(OH)3
FeCl3 + NaOH = NaCl + Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
FeSO4 + NaOH = Na2SO4 + Fe(OH)2FeSO4 + 2NaOH = Na2SO4 + Fe(OH)2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
F2 + H2O = HF + O22F2 + 2H2O = 4HF + O2
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+Cu(NO3)2 = Fe(NO3)3+Cu2Fe + 3Cu(NO3)2 = 2Fe(NO3)3 + 3Cu
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
FeCl3 + CuSO4 = CuCl3 + Fe(SO4)FeCl3 + CuSO4 = CuCl3 + Fe(SO4)
FeCl3+H2S=FeCl2+HCl+S2FeCl3 + H2S = 2FeCl2 + 2HCl + S
FeCl3*6H2O + NH3 = Fe(OH)3 + NH4Cl + H2OFeCl3*6H2O + 3NH3 = Fe(OH)3 + 3NH4Cl + 3H2O
FeCl3*6H2O + NH3 = Fe(OH)3 + NH4Cl +H2OFeCl3*6H2O + 3NH3 = Fe(OH)3 + 3NH4Cl + 3H2O
Fe(s)+H2SO4(l) =FeSO4+ SO2+H2Fe(s) + H2SO4(l) = FeSO4 + 0SO2 + H2
Fe2O3 + CO= 2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g)=Fe(s)+CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe2(SO4)3+KNO3=Fe(NO3)3+K2(SO4)Fe2(SO4)3 + 6KNO3 = 2Fe(NO3)3 + 3K2(SO4)
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe3O4+Ca=CaO+FeFe3O4 + 4Ca = 4CaO + 3Fe
Fe2(CO3)3+H2SO4=Fe2(SO4)3+CO2+H2OFe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3CO2 + 3H2O
Fe2S3 + 2O2 = Fe + 3SO2Fe2S3 + 3O2 = 2Fe + 3SO2
Fe(ClO2)2 + AlPO4 = Fe3 (PO4)2 +Al (ClO2)3 3Fe(ClO2)2 + 2AlPO4 = Fe3(PO4)2 + 2Al(ClO2)3
Fe2O3+Mg=MgO+FeFe2O3 + 3Mg = 3MgO + 2Fe
FeO+Fe(NO3)2=Fe(NO3)+FeO22FeO + Fe(NO3)2 = 2Fe(NO3) + FeO2
Fe+NiCl2=2Ni+FeCl2Fe + NiCl2 = Ni + FeCl2
Fe+NiCl2=2Ni+FeCl2Fe + NiCl2 = Ni + FeCl2
Fe+NiCl2=2Ni+FeCl2Fe + NiCl2 = Ni + FeCl2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(s)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(s) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(s)+H2O2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(s) + 6H2O
Fe2P+FeS2=FeS+P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe + S = Fe2S32Fe + 3S = Fe2S3
Fe+HNO3=FeNO3+H2O+NO2Fe + 2HNO3 = FeNO3 + H2O + NO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
FeO4+H2=Fe+H2OFeO4 + 4H2 = Fe + 4H2O
Fe2P+FeS2=FeS+P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe2P+FeS2=FeS+P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
Fe + Br2 = Fe3+ + Br-6Fe + Br2 = 2Fe3+ + 2Br-
Fe + Cl2 = Fe2+ + Cl-4Fe + Cl2 = 2Fe2+ + 2Cl-
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe + HCl=FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + KSCN + H2O2 = FeO2 + KSCNH2Fe + KSCN + H2O2 = FeO2 + KSCNH2
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4 + 4 H2 = 3 Fe + 4 H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl3+H2S = Fe2S3+HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
FeSO4+P(CO3)2= FeCO3+P(SO4)22FeSO4 + P(CO3)2 = 2FeCO3 + P(SO4)2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeBr3 + K2S = Fe2S3 + KBr2FeBr3 + 3K2S = Fe2S3 + 6KBr

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.