Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe(OH)3 + H2SO3 = Fe2(SO3)3 + H2O2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ H2SO4= Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(ClO3)3+NaSCN=Fe(SCN)3+NaClO3Fe(ClO3)3 + 3NaSCN = Fe(SCN)3 + 3NaClO3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl2+K(MnO4)+HCl=KCl+MnCl2+FeCl3+H2O5FeCl2 + K(MnO4) + 8HCl = KCl + MnCl2 + 5FeCl3 + 4H2O
FeS+O2=FeO3+SO22FeS + 5O2 = 2FeO3 + 2SO2
Fe(HCO3)3=Fe2(CO3)3+CO2+H2O2Fe(HCO3)3 = Fe2(CO3)3 + 3CO2 + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+S(l)=Fe 2 S 3 (s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O= Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3+ H2SO4= Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + CuCl2 = FeCl2 + CuFe + CuCl2 = FeCl2 + Cu
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
F2+Al2O3=AlF3+O33F2 + Al2O3 = 2AlF3 + O3
FeCl3*6H2O + H2O = Fe(OH)3 + H+ + Cl-FeCl3*6H2O - 3H2O = Fe(OH)3 + 3H+ + 3Cl-
Fe2(C2O4)3=FeC2O4+CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2+Ni2SO4=Fe2SO4+Ni2Fe2 + Ni2SO4 = Fe2SO4 + Ni2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+CuNO3=Fe(NO3)2+CuFe + 2CuNO3 = Fe(NO3)2 + 2Cu
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2= Fe3O43Fe + 2O2 = Fe3O4
Fr+H2O=FrOH+H22Fr + 2H2O = 2FrOH + H2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeOCr2O3+ K2CO3+ O2= K2CrO4+ CO2+ Fe2O34FeOCr2O3 + 8K2CO3 + 7O2 = 8K2CrO4 + 8CO2 + 2Fe2O3
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+ Na2(CO3)= NaCl+ Fe2(CO3)32FeCl3 + 3Na2(CO3) = 6NaCl + Fe2(CO3)3
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)2+K2CO3= FeCO3+2KNO3Fe(NO3)2 + K2CO3 = FeCO3 + 2KNO3
F2 +Al2O3 = AlF3 + O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe + CuSO4 = FeSO4 +CuFe + CuSO4 = FeSO4 + Cu
Fe+F2=FeF32Fe + 3F2 = 2FeF3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + O2 +H20 = Fe2O3 * 3H2O20Fe + 30O2 + 3H20 = 10Fe2O3*3H2O
Fe + O2 +H20 = Fe2O3 * 3H2O20Fe + 30O2 + 3H20 = 10Fe2O3*3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
F2(g)+MgBr2(aq)=F2Br2+MgF2(g) + MgBr2(aq) = F2Br2 + Mg
Fe+HCl= FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeBr3 + (NH4)2S = Fe2S3 + (NH4)Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6(NH4)Br
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + CO2 = Fe2O3 + CO2Fe + 3CO2 = Fe2O3 + 3CO
Fe(C2O4)3=FeC2O4+CO2Fe(C2O4)3 = FeC2O4 + 4CO2
Fe+H2O=H(g)+Fe2O32Fe + 3H2O = 6H(g) + Fe2O3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+ O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe3O3 + O2 = Fe2O34Fe3O3 + 3O2 = 6Fe2O3
Fe2O3 = Fe + O22Fe2O3 = 4Fe + 3O2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(OH)2 + AlCl3 = Al(OH)3 + FeCl23Fe(OH)2 + 2AlCl3 = 2Al(OH)3 + 3FeCl2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2(CO3)3 = Fe2O3 + CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe S + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeS+HNO3=Fe(NO3)3+NO+S+H2OFeS + 4HNO3 = Fe(NO3)3 + NO + S + 2H2O
Fe(NO3)2 + HNO3 = Fe(NO3)3 + NO + H2O3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO + 2H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe (s)+Cl2(g)=FeCl3 (s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe (s)+Cl (g)=FeCl (s)Fe(s) + Cl(g) = FeCl(s)
Fe (s)+Cl (g)=FeCl (s)Fe(s) + Cl(g) = FeCl(s)
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3(s) + C(s) = Fe(s) + CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH) 3 (s)+H 2 SO 4 (aq)=Fe 2 (SO 4 ) 3 (aq)+H 2 O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+CO2=Fe2O+CO2Fe + CO2 = Fe2O + CO
FeS2 + O2 + H2O = Fe2(SO4)3 + H2SO44FeS2 + 15O2 + 2H2O = 2Fe2(SO4)3 + 2H2SO4
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS2 + O2 + H2O = Fe2(SO4)3 + H2SO44FeS2 + 15O2 + 2H2O = 2Fe2(SO4)3 + 2H2SO4
Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)
Fe + O = Fe2 O32Fe + 3O = Fe2O3
Fe+O2=FeO2Fe + O2 = FeO2
Fe Cl3 + K4 Fe(CN)6 = Fe(Fe(CN)6) + K4Cl3FeCl3 + K4Fe(CN)6 = Fe(Fe(CN)6) + K4Cl3
Fe Cl3 + K4 Fe(CN)6 = Fe4(Fe(CN)6)3 + KCl4FeCl3 + 3K4Fe(CN)6 = Fe4(Fe(CN)6)3 + 12KCl
Fe Cl3 + Na3 PO4 =FePO4 + Na3 Cl3FeCl3 + Na3PO4 = FePO4 + Na3Cl3
Fe Cl3 + Na3 PO4 =Fe3(PO4)3 + Na3 Cl33FeCl3 + 3Na3PO4 = Fe3(PO4)3 + 3Na3Cl3
Fe Cl3 + K2 CrO4 = FeCrO4 + K2 Cl3FeCl3 + K2CrO4 = FeCrO4 + K2Cl3
Fe Cl3 + Ag NO3 = Fe NO3 + AgCl3FeCl3 + AgNO3 = FeNO3 + AgCl3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+Sn(NO3)4=Fe(NO3)3+Sn4Fe + 3Sn(NO3)4 = 4Fe(NO3)3 + 3Sn
FeCl3+O2 = Fe2O3 + Cl24FeCl3 + 3O2 = 2Fe2O3 + 6Cl2
FeS2 + O2= Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe+F2 = FeF32Fe + 3F2 = 2FeF3
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+AgNO3=Fe(NO3)3+AgClFeCl3 + 3AgNO3 = Fe(NO3)3 + 3AgCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2O3+ C= Fe+ COFe2O3 + 3C = 2Fe + 3CO
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+CO=Fe3O4+CO36Fe2O3 + CO = 4Fe3O4 + CO3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + CO2 = Fe2O3 + CO2Fe + 3CO2 = Fe2O3 + 3CO
Fe(OH)3+ C= CO2+ Fe+ H2O4Fe(OH)3 + 3C = 3CO2 + 4Fe + 6H2O
Fe(OH)3+ C= CO2+ Fe+ H2O4Fe(OH)3 + 3C = 3CO2 + 4Fe + 6H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3 + KOH=K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + H2O6Fe3O4 + K2Cr2O7 + 31H2SO4 = 9Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 31H2O
Fe3O4 + K2Cr2O7 + H2SO4 = Fe2(SO4) + Cr2(SO4) + K2SO4 + H2O2Fe3O4 - K2Cr2O7 + H2SO4 = 3Fe2(SO4) - Cr2(SO4) - K2SO4 + H2O
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe+Cu(No3)2=Cu+Fe(No3)32Fe + 3Cu(No3)2 = 3Cu + 2Fe(No3)3
Fe+O2=FeO32Fe + 3O2 = 2FeO3
Fe(NO3)2 + HNO3 = Fe(NO3)3 + NO + H2O3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO + 2H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+HNO3 = Fe(NO3)3+H2O+NO2Fe + 6HNO3 = Fe(NO3)3 + 3H2O + 3NO2
FeSO4 + H2SO4 + HNO3 = Fe2(SO4)3 + H2O+ NO6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 4H2O + 2NO
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)2 + H3PO4 = Fe3(PO4)2 + H2O3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
FePO4 + Na2SO4 = Fe2(SO4)3 + Na3PO42FePO4 + 3Na2SO4 = Fe2(SO4)3 + 2Na3PO4
FeCl3 + NaOH = Fe(OH) 3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS+O2 = Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe+HCl=H2+FeCl2Fe + 2HCl = H2 + FeCl2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4+KNO3+CH3COOH=CH3COOK+H2SO4+Fe(NO3)2FeSO4 + 2KNO3 + 2CH3COOH = 2CH3COOK + H2SO4 + Fe(NO3)2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=FeO2Fe + O2 = 2FeO
FeS+O2=FeO3+SO22FeS + 5O2 = 2FeO3 + 2SO2
Fe(ClO4)2(aq)+Na2CO3(aq)= FeCO3(s) +2NaClO4(aq)Fe(ClO4)2(aq) + Na2CO3(aq) = FeCO3(s) + 2NaClO4(aq)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe++ + Ce++++ = Fe+++ + Ce+++Fe++ + Ce++++ = Fe+++ + Ce+++
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + Cu3PO4 = Cu2SO4 + Fe3(PO4)23FeSO4 + 2Cu3PO4 = 3Cu2SO4 + Fe3(PO4)2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe3+ + NO2- + H2O = Fe2+ + H + NO3-0Fe3+ + NO2- + H2O = 0Fe2+ + 2H + NO3-
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeSO4 = Fe2O3 + SO3 + O2-4FeSO4 = -2Fe2O3 - 4SO3 + O2
FeS2 + O = Fe2O3 + SO22FeS2 + 11O = Fe2O3 + 4SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(ClO)3 + Be(MnO4)2 = Fe(MnO4)3 + Be(ClO)22Fe(ClO)3 + 3Be(MnO4)2 = 2Fe(MnO4)3 + 3Be(ClO)2
FeO3(s)+CO(g)=Fe(s)+CO2(g)FeO3(s) + 3CO(g) = Fe(s) + 3CO2(g)
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe + O2 + H2O = Fe2O3H2O4Fe + 3O2 + 2H2O = 2Fe2O3H2O
FeCl3 + KOH = Fe(OH)3 + KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
FeCl3(aq)+NaOH(aq)=Fe(OH)3(s)+NaCl(aq)FeCl3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaCl(aq)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe203 +3C0= Fe 3 C020Fe203 + C0 = Fe3C02
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe++ +Cl2=Fe+++ +Cl-2Fe++ + Cl2 = 2Fe+++ + 2Cl-
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO3+ CO(g)=Fe+CO2(g)FeO3 + 3CO(g) = Fe + 3CO2(g)
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeTiO3 + C+ Cl2 = FeCl3 + TiCl4 +CO22FeTiO3 + 3C + 7Cl2 = 2FeCl3 + 2TiCl4 + 3CO2
Fe + H2SO4 =FeSO4 +H2 Fe + H2SO4 = FeSO4 + H2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeI3 + Li2O = Fe2O3 = LiI2FeI3 + 3Li2O = Fe2O3 + 6LiI
FeS+O=Fe2O3+SO22FeS + 7O = Fe2O3 + 2SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2O =Fe3O2 +H2 3Fe + 2H2O = Fe3O2 + 2H2
Fe3PO4+NaSO4=Fe3SO4+NaPO4Fe3PO4 + NaSO4 = Fe3SO4 + NaPO4
Fe2O3(s) + CO(g) = CO2(g) + Fe(s)Fe2O3(s) + 3CO(g) = 3CO2(g) + 2Fe(s)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 + H2O = FeOOH + H2SO44FeS2 + 15O2 + 10H2O = 4FeOOH + 8H2SO4
FeS2 + O2 + H2O = FeOOH + H2SO44FeS2 + 15O2 + 10H2O = 4FeOOH + 8H2SO4
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3+MgO=MgCl2+Fe2O32FeCl3 + 3MgO = 3MgCl2 + Fe2O3
Fe(NO3)2 = FeO + NO2 + O22Fe(NO3)2 = 2FeO + 4NO2 + O2
FeS+HCl=H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeTiO3 + C+ Cl2 = FeCl3 + TiCl4 +CO22FeTiO3 + 3C + 7Cl2 = 2FeCl3 + 2TiCl4 + 3CO2
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe+S=FeSFe + S = FeS
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+AgC2H3O2=Fe(C2H3O2)2+AgFe + 2AgC2H3O2 = Fe(C2H3O2)2 + 2Ag
FeAs2+H2O=2HAsO3--+Fe2O3+H+ +e2FeAs2 + 15H2O = 4HAsO3-- + Fe2O3 + 26H+ + 18e
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+KMnO4=Fe2O4+MnO3+KFe2O3 + KMnO4 = Fe2O4 + MnO3 + K
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeBr2+Br2=FeBr32FeBr2 + Br2 = 2FeBr3
FeBr2+Br2=FeBr32FeBr2 + Br2 = 2FeBr3
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(SO4)3 +KClO3 = Fe(ClO3)3 + K2SO4Fe2(SO4)3 + 6KClO3 = 2Fe(ClO3)3 + 3K2SO4
FeS+HNO3=Fe (NO3)3+NO+S+H2OFeS + 4HNO3 = Fe(NO3)3 + NO + S + 2H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O = Fe2O32Fe + 3O = Fe2O3
Fe3 + O2= Fe3O2Fe3 + O2 = Fe3O2
Fe+O2=FeO32Fe + 3O2 = 2FeO3
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe + S= Fe SFe + S = FeS
Fe + O2= FeO2Fe + O2 = 2FeO
FeCl2 + NaBr = NaCl + FeBr2FeCl2 + 2NaBr = 2NaCl + FeBr2
FeCl3+NaOH=Fe (OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+KSCN=FeK+Cl3SCNFeCl3 + KSCN = FeK + Cl3SCN
Fe + O2 = Fe 2O 3 4Fe + 3O2 = 2Fe2O3
Fe(OH)3 + H2 S O4 = Fe2 (SO4) 3 + H2 O 2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O+3CO=2Fe+CO2Fe2O + CO = 2Fe + CO2
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe(s) + Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(s) + S(s)=Fe2S3(s)2Fe(s) + 3S(s) = Fe2S3(s)
Fe(s) + Br2(l)=FeBr3(s)2Fe(s) + 3Br2(l) = 2FeBr3(s)
FeSO4 + KMnO4 = Fe(MnO4)2 +K2SO4FeSO4 + 2KMnO4 = Fe(MnO4)2 + K2SO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+HCl = FeCl3+HFe + 3HCl = FeCl3 + 3H
Fe+HCl = FeCl+HFe + HCl = FeCl + H
Fe2 O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + CuCl2 = FeCl2 + CuFe + CuCl2 = FeCl2 + Cu
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3+NO3-=Fe3NO3-Fe3 + NO3- = Fe3NO3-
FeTiO3 + H2SO4 = TiO2 + FeSO4 + H2OFeTiO3 + H2SO4 = TiO2 + FeSO4 + H2O
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3(s) + C(s) = Fe(s) + CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3 (aq) + KI(aq) = FeCl2(aq) + KCl(aq) + I2(aq)2FeCl3(aq) + 2KI(aq) = 2FeCl2(aq) + 2KCl(aq) + I2(aq)
Fe(NO3)2 + NaHSO4 = Fe2(SO4)3 + Fe(NO3)3 + Na2SO4 + NO + H2O9Fe(NO3)2 + 12NaHSO4 = 2Fe2(SO4)3 + 5Fe(NO3)3 + 6Na2SO4 + 3NO + 6H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NaOH=Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeCl2 = 2Fe + Cl2FeCl2 = Fe + Cl2
Fe(NO3)3 + Na2CO3 = FeCO3 + Na2(NO3)3Fe(NO3)3 + Na2CO3 = FeCO3 + Na2(NO3)3
Fe(NO3)3 + Na2(CO3) = Fe(CO3) + Na2(NO3)3Fe(NO3)3 + Na2(CO3) = Fe(CO3) + Na2(NO3)3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+MgO=Fe2O3+Mg2Fe + 3MgO = Fe2O3 + 3Mg
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2(g)+NaBr(aq)=Br2(l)+NaF(aq)F2(g) + 2NaBr(aq) = Br2(l) + 2NaF(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + MgO = Fe2O3 + Mg2Fe + 3MgO = Fe2O3 + 3Mg
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2+ HBr= Br2 +HFF2 + 2HBr = Br2 + 2HF
FeCl2 + AgNO3 = AgCl + Fe(NO3)2FeCl2 + 2AgNO3 = 2AgCl + Fe(NO3)2
FeBr3 + H2(SO4) = Fe2(SO4)3 + HBr2FeBr3 + 3H2(SO4) = Fe2(SO4)3 + 6HBr
FeBr3 + H2(SO4) = Fe2(SO4)3 + HBr2FeBr3 + 3H2(SO4) = Fe2(SO4)3 + 6HBr
FeBr3 + H2(SO4) = Fe2(SO4)3 + HBr2FeBr3 + 3H2(SO4) = Fe2(SO4)3 + 6HBr
Fe3O4 +HNO3 = Fe(NO3)3 + NO +H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
FeS2 + HSO4 = Fe2(SO4)3 + SO2 + H2O6FeS2 + 28HSO4 = 3Fe2(SO4)3 + 31SO2 + 14H2O
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 +NO2 + H2OFeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 15NO2 + 7H2O
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 +NO2 + H2OFeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 15NO2 + 7H2O
Fe(NO3)2 +2NaOH = Fe(OH)2 + 2NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Al2O3=Fe2O3+Al=2Fe + Al2O3 = Fe2O3 + 2Al
Fe + H2O = Fe2 O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe3O4(s) + CO(g) = CO2(g) + Fe(s)Fe3O4(s) + 4CO(g) = 4CO2(g) + 3Fe(s)
Fe2O3(s) + CO(g) = 2 Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
F2(g)+NaBr(aq)=Br2(l)+NaF(aq)F2(g) + 2NaBr(aq) = Br2(l) + 2NaF(aq)
Fe + SCN = FeSCNFe + SCN = FeSCN
Fe + SCN = FeSCNFe + SCN = FeSCN
Fe2O3+ H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS2+ O2 = Fe2O3+ SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + Na2CO3 = FeCO3 + Na2Cl3FeCl3 + Na2CO3 = FeCO3 + Na2Cl3
Fe + LiCN = FeCN+ LiFe + LiCN = FeCN + Li
Fe + LiCl = FeCl + LiFe + LiCl = FeCl + Li
FeS + H2O = FeS2 + Fe3O4 + H2S2FeS + 4H2O = -1FeS2 + Fe3O4 + 4H2S
FeS + H2O = FeS2 + Fe3O4 + H2S2FeS + 4H2O = -1FeS2 + Fe3O4 + 4H2S
Fe3(PO4)2 + MgCl2 = FeCl2 + Mg3(PO4)2Fe3(PO4)2 + 3MgCl2 = 3FeCl2 + Mg3(PO4)2
Fe2(SO3)3 = Fe2O3 + SO2 Fe2(SO3)3 = Fe2O3 + 3SO2
FeS + H2O = FeS2 + Fe3O4 + H26FeS + 4H2O = 3FeS2 + Fe3O4 + 4H2
Fe2 C + O3=Fe+CO23Fe2C + 2O3 = 6Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + Al = Al2O + FeFe2O3 + 6Al = 3Al2O + 2Fe
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+HCl=H2+FeCl2Fe + 2HCl = H2 + FeCl2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3+NH4(OH)= Fe(OH)3+NH4(Cl)FeCl3 + 3NH4(OH) = Fe(OH)3 + 3NH4(Cl)
Fe2(SO4)3+ KOH= K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3=Fe+Cl3FeCl3 = Fe + Cl3
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl3+NaOH=Fe(OH)3=NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + NH3 + H2O = Fe(OH)3 + NH4Fe + 3NH3 + 3H2O = Fe(OH)3 + 3NH4
F2(g)+NaBr(aq)=Br2(l)+NaF(aq)F2(g) + 2NaBr(aq) = Br2(l) + 2NaF(aq)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2S3 + SO34FeS2 + 3O2 = 2Fe2S3 + 2SO3
Fe(OH)3 + HCl = FeCl3 + H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl3 2Fe + 3Cl2 = 2FeCl3
Fe2O3(s) + C(s) = Fe(s) + CO2(g) 2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe + Br = FeBr3Fe + 3Br = FeBr3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 + NaBr = Br2 + NaFF2 + 2NaBr = Br2 + 2NaF
Fe2O3 + Al = Fe + AlO3Fe2O3 + Al = 2Fe + AlO3
F2+Xe=XeF84F2 + Xe = XeF8
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl2+HCl+H2O2=FeCl3+H2O2FeCl2 + 2HCl + H2O2 = 2FeCl3 + 2H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + C(s) = Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + O2 = Fe3O23Fe + O2 = Fe3O2
Fe+S=FeSFe + S = FeS
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
FeS2 +O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
FeCl3+Ca(OH)2=Fe(OH)3+CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2+AgC2H3O2=Ag+FeC2H3O2Fe2 + 2AgC2H3O2 = 2Ag + 2FeC2H3O2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+S8=FeS8Fe + S8 = 8FeS
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe2O3 + H2 = Fe + H2O Fe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
FeCi3+NaOH=Fe(OH)3+NaCiFeCi3 + 3NaOH = Fe(OH)3 + 3NaCi
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+AgNO3= Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+3H2SO4 = Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3 + Na2CO3 = NaCl + Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+O2=SO2+Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe+CuCl2=FeCl+Cu2Fe + CuCl2 = 2FeCl + Cu
Fe+CuCl2=Fe2Cl3+Cu4Fe + 3CuCl2 = 2Fe2Cl3 + 3Cu
Fe(OH)2+H2O2=Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
FeCl2 + (NH4)3PO3 = Fe3 (PO3)2 + NH4Cl3FeCl2 + 2(NH4)3PO3 = Fe3(PO3)2 + 6NH4Cl
Fe2O3 + HNO3 = Fe (NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe3 + SO2 = FeS + O2Fe3 + 3SO2 = 3FeS + 3O2
Fe + SO2 = FeS + O2Fe + SO2 = FeS + O2
Fe3 + SO2 = 2FeS + O2Fe3 + 3SO2 = 3FeS + 3O2
Fe+H3PO4=FePO4+H3Fe + H3PO4 = FePO4 + H3
Fe+CuSO4 = FeSO4+CuFe + CuSO4 = FeSO4 + Cu
FeCl3+3(NH4)2S = Fe2S3+6NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + H2O = Fe(OH)2 + HFe + 2H2O = Fe(OH)2 + 2H

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.