Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:






Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(PO3)3+NaOH=Fe(OH)3+3NaPO3Fe(PO3)3 + 3NaOH = Fe(OH)3 + 3NaPO3
Fe(PO3)3+NaOH=Fe(OH)3+3NaPO3Fe(PO3)3 + 3NaOH = Fe(OH)3 + 3NaPO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=FeO2Fe + O2 = FeO2
FeCl3 + H2S = FeS + HCl + S2FeCl3 + 3H2S = 2FeS + 6HCl + S
Fe + SCN = FeSCNFe + SCN = FeSCN
Fe + NH3 + H2O = Fe(OH)3 + NH4Fe + 3NH3 + 3H2O = Fe(OH)3 + 3NH4
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + OH = Fe(OH)3Fe + 3OH = Fe(OH)3
FeBr3 + KOH = KBr3 + FeOHFeBr3 + KOH = KBr3 + FeOH
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2+ + Co=Fe + Co2+Fe2+ + 2Co = 2Fe + Co2+
Fe2+ + Co=Fe + Co2+Fe2+ + 2Co = 2Fe + Co2+
Fe(CN)6--- + Re + H2O = Fe(CN)6---- + ReO4- + OH--7Fe(CN)6--- - Re + 4H2O = -7Fe(CN)6---- - ReO4- + 8OH-
F2(g) + LiCl(aq) = LiF(aq) + Cl2(l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
FeCl3+Ca(OH)2=Fe(OH)3+CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe(OH)2 + HCl = FeCl2 + H2O Fe(OH)2 + 2HCl = FeCl2 + 2H2O
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
Fe(OH)3 + H2SO2 = Fe2(SO2)3 + H2O 2Fe(OH)3 + 3H2SO2 = Fe2(SO2)3 + 6H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeO+H2O=Fe(OH)2FeO + H2O = Fe(OH)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=FeO2Fe + O2 = 2FeO
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe3+ +NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+++ + 2S-- = FeS + S2Fe+++ + 3S-- = 2FeS + S
Fe2O3+V=V2O3+FeFe2O3 + 2V = V2O3 + 2Fe
F2 + LiCl = LiF + Cl2F2 + 2LiCl = 2LiF + Cl2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+Ni(OH)2=Ni+Fe(OH)32Fe + 3Ni(OH)2 = 3Ni + 2Fe(OH)3
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe+H2O=Fe3O4+H2015Fe + 20H2O = 5Fe3O4 + 2H20
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2S3 + NO3 = Fe(NO3)3 + NO2 + SFe2S3 + 6NO3 = 2Fe(NO3)3 + 0NO2 + 3S
Fe3+ +NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + KMnO4 +H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
Fe(s) +CuSO4(aq)=Cu(s) +FeSO4(aq)Fe(s) + CuSO4(aq) = Cu(s) + FeSO4(aq)
Fe+++ + I- = FeI++Fe+++ + I- = FeI++
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3+ +NO2- +H2O = Fe2+ + H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeSO4 + Ca(HCO3)2 = Fe(OH)2 + CaSO4 + CO2FeSO4 + Ca(HCO3)2 = Fe(OH)2 + CaSO4 + 2CO2
Fe+CuSO4=CuFe+SO4Fe + CuSO4 = CuFe + SO4
Fe3PO4+NaSO4=Fe3SO4+NaPO4Fe3PO4 + NaSO4 = Fe3SO4 + NaPO4
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe + O2 = Fe2O54Fe + 5O2 = 2Fe2O5
FeCl3 + Ag2S = Fe2S3 + AgCl2FeCl3 + 3Ag2S = Fe2S3 + 6AgCl
FeCl3+NH4OH= Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
FeCl2(aq) + KOH(aq) = Fe(OH)2(s) + KCl(aq)FeCl2(aq) + 2KOH(aq) = Fe(OH)2(s) + 2KCl(aq)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(s)+O2(g)=Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe(s)+O2(g)=Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe3 + HCl = Fe3Cl3 + H22Fe3 + 6HCl = 2Fe3Cl3 + 3H2
Fe(III) + HCl = Fe(III)Cl3 + H22Fe(III) + 6HCl = 2Fe(III)Cl3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3Cl + AgS = Fe3S + AgClFe3Cl + AgS = Fe3S + AgCl
Fe+O2=FeO2Fe + O2 = 2FeO
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + H2(g) = Fe(s) + H2OFe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O
FeBr3 + H2SO4 =Fe2(SO4)3+ HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ C2H5NS = FeS + C2H5NFe + C2H5NS = FeS + C2H5N
Fe2+ C2H5NS = FeS + C2H5NFe2 + 2C2H5NS = 2FeS + 2C2H5N
Fe2+ C2H5NS = FeS + C2H5NFe2 + 2C2H5NS = 2FeS + 2C2H5N
Fe2O3+Zn=Fe+ZnOFe2O3 + 3Zn = 2Fe + 3ZnO
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(NO3) + KSCN = FeSCN + KNO3Fe(NO3) + KSCN = FeSCN + KNO3
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeSO4 + KCN = K4Fe(CN)6 + K2SO4FeSO4 + 6KCN = K4Fe(CN)6 + K2SO4
FeSO4 + NaOH = Fe(OH)2 + Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
FeSO4 + NaOH = Fe(OH)2 + Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
FeSO4 + NaOH = Fe(OH)2 + Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeCL3 + NA2CO3 + H2O = Fe(OH)3 + CO2 + NACL + H2O0FeCL3 + 0NA2CO3 + H2O = 0Fe(OH)3 + 0CO2 + 0NACL + H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+S=FeSFe + S = FeS
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2+O2=Fe2O3+SO44FeS2 + 19O2 = 2Fe2O3 + 8SO4
Fe+S=FeSFe + S = FeS
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe2O3 + ZnCl2 = ZnO + FeCl3Fe2O3 + 3ZnCl2 = 3ZnO + 2FeCl3
Fe2(S2O3)3 + NaOH = Na2S2O3 + Fe(OH)3Fe2(S2O3)3 + 6NaOH = 3Na2S2O3 + 2Fe(OH)3
Fe + FeCl3 = FeCl2Fe + 2FeCl3 = 3FeCl2
Fe(OH)2 =FeO + H2O=Fe(OH)2 = FeO + H2O
Fe(OH)3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l) Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe(s)+Cl2(g)=FeCl3(s) 2Fe(s) + 3Cl2(g) = 2FeCl3(s)
F2+O=F2OF2 + O = F2O
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + 2 H3O = Fe2 + H2S + 2 H2O2FeS + 4H3O = Fe2 + 2H2S + 4H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+Al3=Al2O3+Fe23Fe2O3 + 2Al3 = 3Al2O3 + 3Fe2
Fe2O3+Al3=Al2O3+Fe23Fe2O3 + 2Al3 = 3Al2O3 + 3Fe2
Fe3O4 = FeO + Fe2O20Fe3O4 = -2FeO + Fe2O2
Fe3O4 = FeO + Fe2O20Fe3O4 = -2FeO + Fe2O2
Fe3O4 = FeO + Fe2O20Fe3O4 = -2FeO + Fe2O2
Fe3O4 = FeO + Fe2O20Fe3O4 = -2FeO + Fe2O2
F2 + H2O = 4HF + O22F2 + 2H2O = 4HF + O2
Fe3O4 = FeO + Fe2O20Fe3O4 = -2FeO + Fe2O2
Fe3O4 = FeO + Fe2O20Fe3O4 = -2FeO + Fe2O2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+++ + C2H4O3 + H2O = Fe++ + CO2 + H+6Fe+++ + C2H4O3 + H2O = 6Fe++ + 2CO2 + 6H+
Fe+++ + C2H4O3 = Fe++ + CO2 + H2O + H+6Fe+++ + C2H4O3 = 6Fe++ + 2CO2 - H2O + 6H+
Fe+++ + C2H4O3 + H+ = Fe++ + CO2 + H2O-6Fe+++ - C2H4O3 + 6H+ = -6Fe++ - 2CO2 + H2O
Fe+++ + C2H4O3 + HNO3 = Fe++ + CO2 + N2O + H2O0Fe+++ + 4C2H4O3 + 6HNO3 = 0Fe++ + 8CO2 + 3N2O + 11H2O
Fe+++ + C2H4O3 + HNO3 = Fe++ + CO2 + N2O + H2O0Fe+++ + 4C2H4O3 + 6HNO3 = 0Fe++ + 8CO2 + 3N2O + 11H2O
Fe + V2O3=Fe2O3 + VO2Fe + 3V2O3 = Fe2O3 + 6VO
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe+ 3O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+ 3O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+ 3O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+ O2 = Fe3O43Fe + 2O2 = Fe3O4
FeSO4 + NaOH = Fe(OH)2 + Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
Fe+ HCl = FeCl2 + 2HFe + 2HCl = FeCl2 + 2H
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe(s) +O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) +O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+NH3+H2O=Fe(OH)3+NH4Fe + 3NH3 + 3H2O = Fe(OH)3 + 3NH4
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2 = SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe2O3+C=Fe3O4+CO3Fe2O3 + C = 2Fe3O4 + CO
Fe(C2H3O2)2 + K3PO4 = Fe3(PO4)2 +KC2H3O23Fe(C2H3O2)2 + 2K3PO4 = Fe3(PO4)2 + 6KC2H3O2
FeCl2 + K2Cr2O7 +HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe2O3+C=FeO4+CO-1Fe2O3 + 5C = -2FeO4 + 5CO
Fe+Sn(NO3)4=Fe(NO3)3+Sn4Fe + 3Sn(NO3)4 = 4Fe(NO3)3 + 3Sn
Fe+F=FeF2Fe + 2F = FeF2
Fe(ClO4)3 = FeCl3 + O2Fe(ClO4)3 = FeCl3 + 6O2
FeC2O4=FeO+CO+CO2FeC2O4 = FeO + CO + CO2
FeO+O=FeOFeO + 0O = FeO
Fe2(C2O4)3=Fe2O3+CO+CO2Fe2(C2O4)3 = Fe2O3 + 3CO + 3CO2
Fe2(C2O4)3=Fe+CO+CO2Fe2(C2O4)3 = 2Fe + 0CO + 6CO2
Fe2(C2O4)3=Fe2O3+CO+CO2Fe2(C2O4)3 = Fe2O3 + 3CO + 3CO2
Fe2(C2O4)3=Fe+CO+CO2Fe2(C2O4)3 = 2Fe + 0CO + 6CO2
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe2(CO3)3 (s) + HCl (aq)= FeCl3 (aq) + H2O (l) + CO2 (g)Fe2(CO3)3(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2O(l) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(NO3)3+Li=Li(NO3)+FeFe(NO3)3 + 3Li = 3Li(NO3) + Fe
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+Cl=FeCl2Fe + 2Cl = FeCl2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeSO4 + KMnO4 + H2SO4 = MnSO4 + Fe(SO4)3 + K2SO4 +H2O5FeSO4 + 4KMnO4 + 16H2SO4 = 4MnSO4 + 5Fe(SO4)3 + 2K2SO4 + 16H2O
F + H2O = HF + O24F + 2H2O = 4HF + O2
FeS + O2 = Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeO + O2 + H2O = FeOH34FeO - 3O2 + 6H2O = 4FeOH3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(CO3)3 + HCl = FeCl3 + H2O + CO2 Fe2(CO3)3 + 6HCl = 2FeCl3 + 3H2O + 3CO2
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
F2+S=SF63F2 + S = SF6
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s)+H2O=Fe(OH)3(s)Fe2O3(s) + 3H2O = 2Fe(OH)3(s)
Fe2O3(s)+H2O=Fe(OH)3(s)Fe2O3(s) + 3H2O = 2Fe(OH)3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCO3+H2SO4=Fe2(SO4)3+SO2+H2O+CO22FeCO3 + 4H2SO4 = Fe2(SO4)3 + SO2 + 4H2O + 2CO2
Fe3O4+H2SO4=Fe2(SO4)3+SO2+H2O2Fe3O4 + 10H2SO4 = 3Fe2(SO4)3 + SO2 + 10H2O
Fe3O4+H2SO4=Fe2(SO4)3+SO2+H2O2Fe3O4 + 10H2SO4 = 3Fe2(SO4)3 + SO2 + 10H2O
Fe2O3 +H2=Fe +H2O Fe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 +H2=Fe +H2O Fe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 +H2O=Fe +H2O 0Fe2O3 + H2O = 0Fe + H2O
Fe + H2O =Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+ O2+ H2O = Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe(OH)3 + H2SO4 = Fe(HSO4)3 + H2OFe(OH)3 + 3H2SO4 = Fe(HSO4)3 + 3H2O
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
FeCl2 + K2Cr2O7 +HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2 O3+ H2O= Fe (OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3= Fe+ O22Fe2O3 = 4Fe + 3O2
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2(SO4)3(aq) + 3 K2CO3(aq)= Fe2(CO3)3(s) + 3 K2SO4(aq)Fe2(SO4)3(aq) + 3K2CO3(aq) = Fe2(CO3)3(s) + 3K2SO4(aq)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe(OH)2 + HF = FeF2 + H2OFe(OH)2 + 2HF = FeF2 + 2H2O
Fe+PO4=FePO4Fe + PO4 = FePO4
F2 + O2 + CH4 = HF + CO22F2 + O2 + CH4 = 4HF + CO2
F2 + O2 + CH4 = HF + CO4F2 + O2 + 2CH4 = 8HF + 2CO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + FeCl3=FeCl2 Fe + 2FeCl3 = 3FeCl2
Fe + FeCl3 =FeCl2Fe + 2FeCl3 = 3FeCl2
Fe + FeCl3 =FeCl2Fe + 2FeCl3 = 3FeCl2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+S2 =Fe2S34Fe(s) + 3S2 = 2Fe2S3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+ H2SO4=Fe2(SO4)3 +SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeBr2 + KCl = FeCl2 + 2 KBrFeBr2 + 2KCl = FeCl2 + 2KBr
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + KClO3 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cl2 + H2O 10FeSO4 + 2KClO3 + 6H2SO4 = 5Fe2(SO4)3 + K2SO4 + Cl2 + 6H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+ O2= Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO4)3 + 3 Na2CO3 = Fe2(CO3)3 + 3 Na2SO4Fe2(SO4)3 + 3Na2CO3 = Fe2(CO3)3 + 3Na2SO4
Fe(s) + H2O(g)= Fe2O3(s) + H2(g) 2Fe(s) + 3H2O(g) = Fe2O3(s) + 3H2(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
FeCl3 + KSCN + CuCl2 = FeCl2 + Cu(SCN)2 + KCl0FeCl3 + 2KSCN + CuCl2 = 0FeCl2 + Cu(SCN)2 + 2KCl
FeCl3 + KSCN + ZnCl2 = FeCl2 + Zn(SCN)2 + KCl0FeCl3 + 2KSCN + ZnCl2 = 0FeCl2 + Zn(SCN)2 + 2KCl
FeCl3+KSCN=K3Fe(SCN)6+KClFeCl3 + 6KSCN = K3Fe(SCN)6 + 3KCl
FeCl3 + KSCN + Na2SO4 = Fe2(SO4)3 + NaSCN + KCl2FeCl3 + 6KSCN + 3Na2SO4 = Fe2(SO4)3 + 6NaSCN + 6KCl
FeCl3 + KSCN + H2SO4 = Fe2(SO4)3 + HSCN + KCl2FeCl3 + 6KSCN + 3H2SO4 = Fe2(SO4)3 + 6HSCN + 6KCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
F2+ SrCl2 = SrF2 + Cl2F2 + SrCl2 = SrF2 + Cl2
FeCl2 + K2Cr2O7 + HCl=FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+CuCL2=FeCL2+CuFe + CuCL2 = FeCL2 + Cu
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(OH)3= Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + H2O =Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe3(PO4)2 + KMnO4 = K3(PO4) + Fe(MnO4)2Fe3(PO4)2 + 6KMnO4 = 2K3(PO4) + 3Fe(MnO4)2
Fe2O3+CO=FeO+CO2Fe2O3 + CO = 2FeO + CO2
Fe+HC2H3O2=Fe(C2H3O2)3+H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
FeS+O2= Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe+Cl2=Fe Cl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS+ HNO3 + Na = Fe+ NO3 + H2O + Na2SFeS + 0HNO3 + 2Na = Fe + 0NO3 + 0H2O + Na2S
FeS2 + O2 = Fe2O3 +SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe +O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe +O2 = Fe2O22Fe + O2 = Fe2O2
Fe3O4+H2=Fe(OH)3+Fe2O36Fe3O4 - 3H2 = -2Fe(OH)3 + 10Fe2O3
Fe3O4+H2=Fe(OH)3+Fe2O36Fe3O4 - 3H2 = -2Fe(OH)3 + 10Fe2O3
FeCl2 + HNO3 + HCl = FeCl3 + NO + H2O3FeCl2 + HNO3 + 3HCl = 3FeCl3 + NO + 2H2O
FeSO4 + Na2O = Na2SO4 + FeOFeSO4 + Na2O = Na2SO4 + FeO
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe + S = FeS3Fe + 3S = FeS3
Fe + CuSo4 = FeSo4 + CuFe + CuSo4 = FeSo4 + Cu
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s) +H2O(l) = Fe3O4(s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe + Zn(No3)2 = Fe(No3) + Zn2Fe + Zn(No3)2 = 2Fe(No3) + Zn
FeS2+H2O+O2 = FeSO4 + H2SO42FeS2 + 2H2O + 7O2 = 2FeSO4 + 2H2SO4
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe+HNO3=Fe(NO3)3+NO+H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe+HNO3=FeNO3+NO+H2O3Fe + 4HNO3 = 3FeNO3 + NO + 2H2O
Fe + H2O = H2 + Fe3O43Fe + 4H2O = 4H2 + Fe3O4
Fe+H2S04= Fe2(S04)3+H22Fe + 3H2S04 = Fe2(S04)3 + 3H2
Fe(OH)3 + As2S3 = Fe2S3 + As(OH)32Fe(OH)3 + As2S3 = Fe2S3 + 2As(OH)3
Fe 2O3 + CO2 = 2Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
Fe 2O3 + CO2 = 2Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
Fe 2O3 + CO2 = Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
FeS + HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeCl3+(NH4)2S=Fe2S3+6NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe2(SO4)3+Mg(OH)2=Fe(OH)3+MgSO4Fe2(SO4)3 + 3Mg(OH)2 = 2Fe(OH)3 + 3MgSO4
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
F2 + NaCl = NaF + ClF2 + 2NaCl = 2NaF + 2Cl
F2 + NaCl = FCl + NaF2 + 2NaCl = 2FCl + 2Na
FeCr2O4 + Na2CO3 + O2 = NaCrO4 + 2FeO3 + 8CO2FeCr2O4 + Na2CO3 + 3O2 = 2NaCrO4 + FeO3 + CO2
FeCr2O4 + Na2CO3 + O2 = NaCrO4 + 2FeO3 + 8CO2FeCr2O4 + Na2CO3 + 3O2 = 2NaCrO4 + FeO3 + CO2
FeS + H2SO4 = Fe2(SO4)3 + SO2 + H2O2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O3=Fe2O26Fe + 2O3 = 3Fe2O2
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + NaCO3 + C = Na2S + Fe + COFeS + 2NaCO3 + 4C = Na2S + Fe + 6CO
FeS + NaCO3 + C = Na2S + Fe + COFeS + 2NaCO3 + 4C = Na2S + Fe + 6CO
FeS + H2SO4= Fe(SO4)3+SO2+H2OFeS + 8H2SO4 = Fe(SO4)3 + 6SO2 + 8H2O
FeS2+O2=FeO+SO22FeS2 + 5O2 = 2FeO + 4SO2
FeCr2O7 + K2CO3 + O2 = K2CrO4 + Fe2O3 + CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeCl3+KSCN=KCl3+FeSCNFeCl3 + KSCN = KCl3 + FeSCN
Fe+HNO=Fe(NO3)2+NO2+H2O-3Fe + 4HNO = -3Fe(NO3)2 + 10NO2 + 2H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
F2+NaOH=NaF+O2+H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
F2+NaOH=NaF+O2+H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
F2+NaOH=NaF+O2+H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
FeCl3+H2SO4=Fe2(SO4)3+HCl2FeCl3 + 3H2SO4 = Fe2(SO4)3 + 6HCl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeS+O2=Fe2O3+SO34FeS + 9O2 = 2Fe2O3 + 4SO3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe3O4+SO36FeS + 13O2 = 2Fe3O4 + 6SO3
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS+O2=Fe3O4+SO23FeS + 5O2 = Fe3O4 + 3SO2
FeS+O2=Fe3O4+SO23FeS + 5O2 = Fe3O4 + 3SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeO + CO = Fe + CO2FeO + CO = Fe + CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + Pb2O4 = PbCl4 + Fe2O38FeCl3 + 3Pb2O4 = 6PbCl4 + 4Fe2O3
Fe2O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeBr2+Bq=Fe+BqBr2FeBr2 + Bq = Fe + BqBr2
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe(OH)2 = FeO + H2OFe(OH)2 = FeO + H2O
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl3+Be3(PO4)2=BeCl2+FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(NO3)3+(NH4)2SO3=Fe2(SO3)3+(NH4)(NO3)2Fe(NO3)3 + 3(NH4)2SO3 = Fe2(SO3)3 + 6(NH4)(NO3)
FeO + Mo + H2O = FeMoO2 + H2FeO + Mo + H2O = FeMoO2 + H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
FeSO4 + H2O + KMnO4 = MnO2 + KOH + Fe(OH)3 + Fe2(SO4)3 3FeSO4 + 2H2O + KMnO4 = MnO2 + KOH + Fe(OH)3 + Fe2(SO4)3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(SO4)+Ba(OH)2=Ba(SO4)+Fe(OH)2Fe(SO4) + Ba(OH)2 = Ba(SO4) + Fe(OH)2
Fe2S4+O2=Fe2O3+SO22Fe2S4 + 11O2 = 2Fe2O3 + 8SO2
Fe2S4 + O2 = Fe2O3 + SO22Fe2S4 + 11O2 = 2Fe2O3 + 8SO2
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(CO)5+NaOH=Na2Fe(CO)4+Na2CO3+H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
Fe2(SO4)3 + BaCl2 = BaSO4 + FeCl3Fe2(SO4)3 + 3BaCl2 = 3BaSO4 + 2FeCl3
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3 Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3 Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(ClO3)2+AlP=FeP2 + AlClO3Fe(ClO3)2 + 2AlP = FeP2 + 2AlClO3
Fe+CuCl2=FeCl3+Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe+CuCl2=FeCl+Cu2Fe + CuCl2 = 2FeCl + Cu
Fe2(SO4)3 + SO2 + H2O =FeSO4 + H2SO4Fe2(SO4)3 + SO2 + 2H2O = 2FeSO4 + 2H2SO4
Fe3O4 + CO = FeO + CO2Fe3O4 + CO = 3FeO + CO2
Fe + H2 SO4 = Fe2 (SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe3 O4 + H2= Fe + H2 OFe3O4 + 4H2 = 3Fe + 4H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2 O3 + CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
F2+Al3O3=AlF3+O29F2 + 2Al3O3 = 6AlF3 + 3O2
F2+Al3O3=AlF4+O212F2 + 2Al3O3 = 6AlF4 + 3O2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2 O3+ C= Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe (OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe++ + MnO4- + H+ = Fe+++ + Mn++ + H2O5Fe++ + MnO4- + 8H+ = 5Fe+++ + Mn++ + 4H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2 = FeO32Fe + 3O2 = 2FeO3
Fe+O2 = FeO2Fe + O2 = FeO2
Fe2OH+H2O=FeO+H22Fe2OH + 2H2O = 4FeO + 3H2
Fe2(CO3)3 (s) + HCl (aq) = FeCl3 (aq) + H2O (l) + CO2 (g)Fe2(CO3)3(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2O(l) + 3CO2(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + H2S = FeS + H2SO4FeSO4 + H2S = FeS + H2SO4
Fe(ClO3)2=FeCl2+O2Fe(ClO3)2 = FeCl2 + 3O2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2 +S2= FeSFe2 + S2 = 2FeS
Fe(OH)3 + H2SO4 = Fe(HSO4)3 + H2OFe(OH)3 + 3H2SO4 = Fe(HSO4)3 + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+H2 =Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2 =Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + S8 = FeS8Fe + S8 = 8FeS
Fe2O3+Mg=MgO+FeFe2O3 + 3Mg = 3MgO + 2Fe
Fe(SCN)4+F=FeF4+4SCNFe(SCN)4 + 4F = FeF4 + 4SCN
Fe+SCN=Fe(SCN)4Fe + 4SCN = Fe(SCN)4
Fe2(CO3)3 = Fe2O3 + CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeSe+HCl=FeCl2+H2SeFeSe + 2HCl = FeCl2 + H2Se
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe2O3 = 2Fe + 3O2 2Fe2O3 = 4Fe + 3O2
Fe3O4 +CO = Fe+ CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+S=8FeSFe + S = FeS
FeO2 + O2 = FeO32FeO2 + O2 = 2FeO3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + 6 HCl = 2 FeCl3 + 3 H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeCl3+Na2 (CO3)= NaCl+Fe 2(CO3) 32FeCl3 + 3Na2(CO3) = 6NaCl + Fe2(CO3)3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
F2 + AlCl3 = F2Al + Cl3F2 + AlCl3 = F2Al + Cl3
F2 + AlCl3 = F2Cl3 + AlF2 + AlCl3 = F2Cl3 + Al
F2 + AlCl3 = F2Al + Cl3F2 + AlCl3 = F2Al + Cl3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
F+HCl = Cl+HFF + HCl = Cl + HF
F+HCl = Cl+HFF + HCl = Cl + HF
Fe(NO3)3(aq)+NaI(aq)=FeI3+NaNO3Fe(NO3)3(aq) + 3NaI(aq) = FeI3 + 3NaNO3
FeI3 + O2= I2 + Fe2O34FeI3 + 3O2 = 6I2 + 2Fe2O3
Fe2O3 + H2= Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
F + W + S + P = FW3SP2F + 3W + S + 2P = FW3SP2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2+ + K2Cr2O7 + H+ = Fe3+ + K+ + Cr3+ + H2O-102Fe2+ + 3K2Cr2O7 + 42H+ = -68Fe3+ + 6K+ + 2Cr3+ + 21H2O
Fe3(PO4)3 + Na2SO4 = Fe2(SO4)3 + Na3PO42Fe3(PO4)3 + 9Na2SO4 = 3Fe2(SO4)3 + 6Na3PO4
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
FeS + H2SO4 = H2S + FeSO4FeS + H2SO4 = H2S + FeSO4
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeI2 + Ca(OH)2 = CaI2 +Fe(OH)2FeI2 + Ca(OH)2 = CaI2 + Fe(OH)2
FeCl2 + KOH = Fe (OH)2 +KClFeCl2 + 2KOH = Fe(OH)2 + 2KCl
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3+K3PO4=FePO4+3KClFeCl3 + K3PO4 = FePO4 + 3KCl
FeCl3 + AgNO3 = AgCl + Fe(NO3)3FeCl3 + 3AgNO3 = 3AgCl + Fe(NO3)3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS + HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO4)3+3K(SCN)=2Fe(SCN)3+3K2SO4Fe2(SO4)3 + 6K(SCN) = 2Fe(SCN)3 + 3K2SO4
Fe2O3(s)+ CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+ CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fr + H2O = 2FrOH + H22Fr + 2H2O = 2FrOH + H2
F2 + H2O = FO + H2F2 + 2H2O = 2FO + 2H2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2 (CO3) 3= Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
F2 + NaBr = NaF + Br2F2 + 2NaBr = 2NaF + Br2
FeO + HI = FeI3 + H2 + H2O2FeO + 6HI = 2FeI3 + H2 + 2H2O
FeSO4 = Fe2O3 + SO2 +SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3(aq) + Mg (s) = 3MgCl2 (aq) + 2Fe (s)2FeCl3(aq) + 3Mg(s) = 3MgCl2(aq) + 2Fe(s)
FeCl3(aq) + Mg (s) = 3MgCl2 (aq) + Fe (s)2FeCl3(aq) + 3Mg(s) = 3MgCl2(aq) + 2Fe(s)
FeCl3(aq) + Mg (s) = 3MgCl2 (aq) + 2Fe (s)2FeCl3(aq) + 3Mg(s) = 3MgCl2(aq) + 2Fe(s)
FeCl3 + Mg = 3MgCl2 + 2Fe (s)2FeCl3 + 3Mg = 3MgCl2 + 2Fe(s)
FeCl3 + Mg = 3MgCl2 + 2Fe2FeCl3 + 3Mg = 3MgCl2 + 2Fe
Fe + O = Fe2O32Fe + 3O = Fe2O3
FeCl3 + NH4OH = Fe(OH)3 +NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2+NO+2H2O=FeO+N2H2OFe2 + 2NO + H2O = 2FeO + N2H2O
Fe(s) + Br2(l) = FeBr3(s)2Fe(s) + 3Br2(l) = 2FeBr3(s)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2+ + H+ + MnO4- = Fe3+ + Mn2+ + H2O-39Fe2+ + 16H+ + 2MnO4- = -26Fe3+ + Mn2+ + 8H2O
FeCr2O4 + NaCO3 + O2 = NaCrO4 + Fe2O3 + CO24FeCr2O4 + 8NaCO3 + 7O2 = 8NaCrO4 + 2Fe2O3 + 8CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO =CO2 +FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe3O4 + 4H2 = 3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe2+NO+2H2O=FeO+N2H2OFe2 + 2NO + H2O = 2FeO + N2H2O
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(OH)3 + H2SO4 = Fe(HSO4)3 + H2OFe(OH)3 + 3H2SO4 = Fe(HSO4)3 + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g) = 2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + Co = FeO4 + Co20Fe2O3 + 2Co = 0FeO4 + Co2
Fe2O3 + Co = 2FeO4 + Co20Fe2O3 + 2Co = 0FeO4 + Co2
Fe2O3+CO2=Fe+CO20Fe2O3 + CO2 = 0Fe + CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.