Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3+HBr=FeBr3+H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe203+ HNO3 = Fe(NO3)3 + H2020Fe203 + 12180HNO3 = 4060Fe(NO3)3 + 609H20
Fe2O3 +CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4+HNO3+H2SO4=Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe+O2=FeO2Fe + O2 = 2FeO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4 + HCl = FeCl2 + FeCl3 + H2OFe3O4 + 8HCl = FeCl2 + 2FeCl3 + 4H2O
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeO4 + O2 = Fe2O34FeO4 - 5O2 = 2Fe2O3
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO+HNO3=Fe(NO3)2+H2OFeO + 2HNO3 = Fe(NO3)2 + H2O
FeCl3*6H2O=Fe(OH)3+Fe2O3 +HClFeCl3*6H2O = 3Fe(OH)3 - Fe2O3 + 3HCl
FeCl3*6(H2O)=Fe(OH)3+Fe2O3 +HClFeCl3*6(H2O) = 3Fe(OH)3 - Fe2O3 + 3HCl
Fe+HClO3=Fe(ClO3)2+H2Fe + 2HClO3 = Fe(ClO3)2 + H2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeCO3(s)+H2CO3(aq) = Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
FeCO3(s)+H2CO3(aq)=Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
Fe2O3= Fe+O22Fe2O3 = 4Fe + 3O2
Fe+ HCl = FeCl2+ HFe + 2HCl = FeCl2 + 2H
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + 2 HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe3 + CO23Fe2O3 + 9CO = 2Fe3 + 9CO2
Fe +O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+H2O2=FeO+SO2+H2OFeS + 3H2O2 = FeO + SO2 + 3H2O
FeS2 + H2O + O2 = Fe2O3 + H+ + SO4 2-4FeS2 + 4H2O + 169O2 = 2Fe2O3 + 8H+ + 8SO42-
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K3Fe(C2O4)3*3H2O + (NH4)2SO4 + H2SO4 + H2O2Fe(NH4)2(SO4)2*6H2O + 3H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)3*3H2O + 2(NH4)2SO4 + 2H2SO4 + 8H2O
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
FeS3+O2=Fe2O3+SO24FeS3 + 15O2 = 2Fe2O3 + 12SO2
Fe2 (CO3) 3+H2SO4=Fe2 (SO4) 3+H2O+CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 + NH4NO3 Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+HCl=H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeS+H2O2=FeO+SO2+H2OFeS + 3H2O2 = FeO + SO2 + 3H2O
Fe(s) + H2O(g) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS2=FeS4+S2-1FeS2 = -1FeS4 + S2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4 + C = Fe + COFe3O4 + 4C = 3Fe + 4CO
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeS+Na2O2=Fe2O3+Na2SO3+Na2O20FeS + Na2O2 = 0Fe2O3 + 0Na2SO3 + Na2O2
FeS+Na2O2=Fe2O3+Na2SO3+Na2O20FeS + Na2O2 = 0Fe2O3 + 0Na2SO3 + Na2O2
Fe + 2HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeS + O2 = SO2 + FeO2FeS + 3O2 = 2SO2 + 2FeO
Fe3O4 + HCl + H2O2 = FeCl3 + H2O 2Fe3O4 + 18HCl + H2O2 = 6FeCl3 + 10H2O
Fe3O4 + H2SO4 + H2O2 = Fe2(SO4)3 + H2O2Fe3O4 + 9H2SO4 + H2O2 = 3Fe2(SO4)3 + 10H2O
Fe(OH)2(s) + O2 + H2O(l) = Fe(OH)3(s) 4Fe(OH)2(s) + O2 + 2H2O(l) = 4Fe(OH)3(s)
FeCl3 + Mg = MgCl2 + Fe2FeCl3 + 3Mg = 3MgCl2 + 2Fe
FeCl2 + K3PO4 = Fe3(PO4)2 + KCl3FeCl2 + 2K3PO4 = Fe3(PO4)2 + 6KCl
FeSO4+KMnO4+H2SO4=Fe2(SO4)+K2SO4+MnSO4+H2O-10FeSO4 + 2KMnO4 + 8H2SO4 = -5Fe2(SO4) + K2SO4 + 2MnSO4 + 8H2O
Fe + LiCN = FeCN + LiFe + LiCN = FeCN + Li
Fe3O4 + H2S = FeS +S + H2OFe3O4 + 4H2S = 3FeS + S + 4H2O
Fe2O3 + H2S = FeS +S + H2OFe2O3 + 3H2S = 2FeS + S + 3H2O
FeO + H2S = FeS +S + H2OFeO + H2S = FeS + 0S + H2O
FeO + H2S = FeS2 +S + H2OFeO + H2S = FeS2 - S + H2O
Fe2O3 + H2S = FeS2 +S + H2OFe2O3 + 3H2S = 2FeS2 - S + 3H2O
FeO + H2S = FeS2 + S + H2OFeO + H2S = FeS2 - S + H2O
Fe2O3 + H2S = FeS2 + S + H2OFe2O3 + 3H2S = 2FeS2 - S + 3H2O
Fe3O4 + H2S = FeS2 + S + H2OFe3O4 + 4H2S = 3FeS2 - 2S + 4H2O
Fe2O4 + H2S = FeS2 + S + H2OFe2O4 + 4H2S = 2FeS2 + 0S + 4H2O
Fe3O4 + H2S = FeS + S + H2OFe3O4 + 4H2S = 3FeS + S + 4H2O
Fe2O3 + H2S = FeS + S + H2OFe2O3 + 3H2S = 2FeS + S + 3H2O
FeO + H2S = FeS + S + H2OFeO + H2S = FeS + 0S + H2O
FeO + H2S = FeS2 + S + H2OFeO + H2S = FeS2 - S + H2O
Fe3O4 + H2S = FeS2 + S + H2OFe3O4 + 4H2S = 3FeS2 - 2S + 4H2O
Fe2O3 + H2S = FeS2 + S + H2OFe2O3 + 3H2S = 2FeS2 - S + 3H2O
Fe2O3 + H2S = FeS2 + S + H2OFe2O3 + 3H2S = 2FeS2 - S + 3H2O
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+HBr=FeBr3+H22Fe + 6HBr = 2FeBr3 + 3H2
Fe3O4 + NaH = 3Fe + 4NaOHFe3O4 + 4NaH = 3Fe + 4NaOH
Fe (s) + H2O (g) =Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe (s) + H2O (g) =Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3+H2O+CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3+H2O+CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe + AgNO3 = Ag + Fe(NO3)2Fe + 2AgNO3 = 2Ag + Fe(NO3)2
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe + Cl2 = FeCl2Fe + Cl2 = 2FeCl
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(s) + S(l)= Fe2S3(s) 2Fe(s) + 3S(l) = Fe2S3(s)
FeS + O2= Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3= Fe2(s)+ O2(g)2Fe2O3 = 2Fe2(s) + 3O2(g)
Fe + S = FeSFe + S = FeS
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 +H2020FeSO4 + 0KMnO4 + 10H2SO4 = 10Fe2(SO4)3 + 0MnSO4 + 0K2SO4 + H20
FeCO3 + H2SO4 = FeSO4 + H2O + CO2FeCO3 + H2SO4 = FeSO4 + H2O + CO2
FeCl3+HgNO3=Fe(NO3)3+HgClFeCl3 + 3HgNO3 = Fe(NO3)3 + 3HgCl
Fe2 + HNO3 = Fe(NO3)3 + NO2 + H2OFe2 + 12HNO3 = 2Fe(NO3)3 + 6NO2 + 6H2O
Fe(s) + O2(g) + H2O(l) = Fe(OH)2 (aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+Cl2(g)=FeCl2(s)Fe(s) + Cl2(g) = FeCl2(s)
Fe(s)+O2(g) = Fe 2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + C = CO2+ Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe +Ni(NO3)2 =Fe(NO3)3 +Ni2Fe + 3Ni(NO3)2 = 2Fe(NO3)3 + 3Ni
FeCl3+Na2CO3 = Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe3+ + e- = Fe2+4Fe3+ - e- = 6Fe2+
Fe3+ + SO2 + H2O = Fe2+ + SO42- + H+-158Fe3+ + SO2 + 40H2O = -237Fe2+ + SO42- + 80H+
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + K4Fe(CN)6 = KCl + C18Fe7N184FeCl3 + 3K4Fe(CN)6 = 12KCl + C18Fe7N18
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeSO4 + C2O4 = SO4 + FeC2O4FeSO4 + C2O4 = SO4 + FeC2O4
FeSO4 (aq) + C2O42-(aq) = SO42- (aq) + FeC2O4(s)FeSO4(aq) + C2O42-(aq) = SO42-(aq) + FeC2O4(s)
Fe(NO3)2 = Fe2O3 + NO2 + O24Fe(NO3)2 = 2Fe2O3 + 8NO2 + O2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + SnBr2 = FeBr2+ SnFe + SnBr2 = FeBr2 + Sn
Fe + MgO = Mg + FeOFe + MgO = Mg + FeO
Fe (s) + CuO (s) =FeO (s) + Cu (s)Fe(s) + CuO(s) = FeO(s) + Cu(s)
Fe + SCN = Fe(SCN)6 Fe + 6SCN = Fe(SCN)6
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl3 + Ag2SO3 = Fe2(SO3)3 + AgCl2FeCl3 + 3Ag2SO3 = Fe2(SO3)3 + 6AgCl
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + HNO3 =Fe(NO3)3 + NO2 + H2O Fe + 6HNO3 = Fe(NO3)3 + 3NO2 + 3H2O
Fe + HNO3 =Fe(NO3)3 + NO + H2O Fe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe(s)+ H2O(g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(OH)2 + HNO3 = Fe(NO3)2 +H2OFe(OH)2 + 2HNO3 = Fe(NO3)2 + 2H2O
FeCl3(aq) + Ba(NO3)2(aq) = Fe(NO3)3 + BaCl22FeCl3(aq) + 3Ba(NO3)2(aq) = 2Fe(NO3)3 + 3BaCl2
FeCl3+H2O=Fe(OH)3+HClFeCl3 + 3H2O = Fe(OH)3 + 3HCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2(SO4)3 + H2O = Fe(OH)3 + H2SO4Fe2(SO4)3 + 6H2O = 2Fe(OH)3 + 3H2SO4
Fe + 2 CH3OH = Fe(CH3O)2 + H2Fe + 2CH3OH = Fe(CH3O)2 + H2
Fe2 (CO3)3 = Fe2 O3 + CO2Fe2(CO3)3 = Fe2O3 + 3CO2
FeCl2+Ca(PO)2=Fe(PO)2+CaCl2FeCl2 + Ca(PO)2 = Fe(PO)2 + CaCl2
FeCl2+Ca(PO)2=Fe(PO)2+CaCl2FeCl2 + Ca(PO)2 = Fe(PO)2 + CaCl2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO4)3 + Na2CO3 = Fe2(CO3)3 + Na2(SO4)Fe2(SO4)3 + 3Na2CO3 = Fe2(CO3)3 + 3Na2(SO4)
FeCl2(aq) + Ag3PO4(aq) = Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2+O2+H20 =Fe(OH)3+H2SO420FeS2 + 110O2 + 7H20 = 20Fe(OH)3 + 40H2SO4
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe + S = Fe2S3 2Fe + 3S = Fe2S3
Fe + S = FeS Fe + S = FeS
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCO3 + HNO3 = N2O + H2O + CO2 + Fe(NO3)38FeCO3 + 26HNO3 = N2O + 13H2O + 8CO2 + 8Fe(NO3)3
Fe(NO3)3 + KI= 2K(NO3) + Fe(NO3)2 + I22Fe(NO3)3 + 2KI = 2K(NO3) + 2Fe(NO3)2 + I2
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3(s) = Fe2O3(s) + H2O(l)2Fe(OH)3(s) = Fe2O3(s) + 3H2O(l)
FeS(aq) + H3PO4(aq) = Fe3(PO4)2(s) + H2S(g)3FeS(aq) + 2H3PO4(aq) = Fe3(PO4)2(s) + 3H2S(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+S=FeSFe + S = FeS
Fe(s) +AgNO3(g) =Ag(s) +Fe(NO3)3(aq)Fe(s) + 3AgNO3(g) = 3Ag(s) + Fe(NO3)3(aq)
Fe2(SO4)3 + KI = FeSO4 +KI0Fe2(SO4)3 + KI = 0FeSO4 + KI
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe + HCl = H2 + FeCl2Fe + 2HCl = H2 + 2FeCl
Fe2O3 + H2O = Fe2O + HO35Fe2O3 + 2H2O = 5Fe2O + 4HO3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2S3+O2=Fe+SO2Fe2S3 + 3O2 = 2Fe + 3SO2
Fe2O3 + H2= Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe3O4 (s) + 4H2(g) = 3Fe(s) + 4H2O(l)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(l)
Fe3O4 + 4H2 = 3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeBr3 + 3AgNO3 = Fe(NO3)3 + 3AgBrFeBr3 + 3AgNO3 = Fe(NO3)3 + 3AgBr
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(HCO3)3 + CaO = Fe2O3 + Ca(HCO3)22Fe(HCO3)3 + 3CaO = Fe2O3 + 3Ca(HCO3)2
Fe(HCO3)3 + CaO = Fe2O3 + Ca(HCO3)22Fe(HCO3)3 + 3CaO = Fe2O3 + 3Ca(HCO3)2
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + 3H2 = 3H2O +2FeFe2O3 + 3H2 = 3H2O + 2Fe
Fe2O3 + CO = FeO + CO2Fe2O3 + CO = 2FeO + CO2
FeCl2+H2O=FeO+2HClFeCl2 + H2O = FeO + 2HCl
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
Fe2O3 + 3H2 = 3H2O + 2FeFe2O3 + 3H2 = 3H2O + 2Fe
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3(s) + Al(s) = Fe(s) + Al2O3(s)Fe2O3(s) + 2Al(s) = 2Fe(s) + Al2O3(s)
FeO+C=Fe+CO22FeO + C = 2Fe + CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2+H2O=FeO+HClFeCl2 + H2O = FeO + 2HCl
FeSO4 + KMnO4 + H2SO4 =Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeCl3 + Zn = ZnCl2 + Fe2FeCl3 + 3Zn = 3ZnCl2 + 2Fe
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe + H2SO4=FeSO4 +H2Fe + H2SO4 = FeSO4 + H2
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O=Fe2O3*2H2O4Fe + 3O2 + 4H2O = 2Fe2O3*2H2O
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe + O2 +H2O = Fe2O3*2H2O4Fe + 3O2 + 4H2O = 2Fe2O3*2H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 =FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 =FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 + HBrO3 + H2SO4 = Fe2(SO4)3 + HBr + H2O6FeSO4 + HBrO3 + 3H2SO4 = 3Fe2(SO4)3 + HBr + 3H2O
Fe(OH)2= Fe2+ 2OH2Fe(OH)2 = Fe2 + 4OH
FeCl2(aq) + Na3PO4(aq) =Fe3(PO4)2(aq) + NaCl(aq)3FeCl2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(aq) + 6NaCl(aq)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe3+CuSO4=Fe2SO4+Cu2Fe3 + 3CuSO4 = 3Fe2SO4 + 3Cu
Fe3+CuSO4=Fe3SO4+CuFe3 + CuSO4 = Fe3SO4 + Cu
Fe + HNO3 = Fe(NO3)2 + H2O +N2O4Fe + 10HNO3 = 4Fe(NO3)2 + 5H2O + N2O
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 +C=Fe+CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 +C=Fe+CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe + V2O3 = Fe2O3 + VO2Fe + 3V2O3 = Fe2O3 + 6VO
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(OH)3(s)+2H=Fe+H2OFe(OH)3(s) + 3H = Fe + 3H2O
Fe(OH)3(s)+2H+SO4=Fe2(SO4)3+H2O2Fe(OH)3(s) + 6H + 3SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeI3 + K2S = Fe2S3 + 3KI2FeI3 + 3K2S = Fe2S3 + 6KI
Fe3O4 +2H2 = 4H2O + Fe3Fe3O4 + 4H2 = 4H2O + Fe3
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
F2+HBr=Br2+HFF2 + 2HBr = Br2 + 2HF
Fe + O2 = Fe2 O3 4Fe + 3O2 = 2Fe2O3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 +H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(s) + H2CO3(aq) = Fe2(CO3)3(s) + H2(g)2Fe(s) + 3H2CO3(aq) = Fe2(CO3)3(s) + 3H2(g)
Fe(s) + H2CO3(aq) = Fe2(CO3)3(s) + H2(g)2Fe(s) + 3H2CO3(aq) = Fe2(CO3)3(s) + 3H2(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + C= Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C= Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + H2O = FeO + HFe + H2O = FeO + 2H
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = FeO + H2Fe + H2O = FeO + H2
Fe + H2O = FeO + H2Fe + H2O = FeO + H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+3H2=2Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
F2+2KBr=Br2+2KFF2 + 2KBr = Br2 + 2KF
Fe+HCl=H2+FeCl32Fe + 6HCl = 3H2 + 2FeCl3
FeSCN + CuCl2= FeCl2 +CuSCNFeSCN + CuCl2 = FeCl2 + CuSCN
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe+++ + SO2 + H2O = Fe++ + SO4-- + H+2Fe+++ + SO2 + 2H2O = 2Fe++ + SO4-- + 4H+
Fe(s) + O2(g)= Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl2 + KMnO4 +H2SO4 = Fe2(SO4)3 + KCl + MnCl2 + Cl2 + H2O16FeCl2 + 6KMnO4 + 24H2SO4 = 8Fe2(SO4)3 + 6KCl + 6MnCl2 + 7Cl2 + 24H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2CO3=Fe2(CO3)3+H22Fe + 3H2CO3 = Fe2(CO3)3 + 3H2
Fe(OH)2+O2+H2O=Fe(OH)4Fe(OH)2 - O2 - 2H2O = 4Fe(OH)
Fe(OH)2+O2+H2O=Fe(OH)4Fe(OH)2 - O2 - 2H2O = 4Fe(OH)
Fe+HNO3=Fe(NO3)3+N2O3+H2O4Fe + 18HNO3 = 4Fe(NO3)3 + 3N2O3 + 9H2O
Fe+HNO3=Fe(NO3)+N2O3+H2O4Fe + 6HNO3 = 4Fe(NO3) + N2O3 + 3H2O
Fe7S8+S2=FeS2Fe7S8 + 3S2 = 7FeS2
Fe1S+S2=FeS22Fe1S + S2 = 2FeS2
FeS1+S2=FeS22FeS1 + S2 = 2FeS2
Fe2SiO4+S2=FeS2+Fe3O4+SiO22Fe2SiO4 + S2 = FeS2 + Fe3O4 + 2SiO2
FeTiO3+S2=FeS2+Fe3O4+TiO24FeTiO3 + S2 = FeS2 + Fe3O4 + 4TiO2
Fe3O4+ S2= Fe2O3+FeS23Fe3O4 + S2 = 4Fe2O3 + FeS2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe3O4 + C = Fe + COFe3O4 + 4C = 3Fe + 4CO
Fe+O2 =Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe3O4 +C = Fe + COFe3O4 + 4C = 3Fe + 4CO
Fe + KIO4 = Fe2O3 + KIO32Fe + 3KIO4 = Fe2O3 + 3KIO3
Fe(s)+O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe+S=FeSFe + S = FeS
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO3=Fe2(SO3)3+H2O2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3 O4 +H2=Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3+ + NO2- + H2O = Fe2+ NO3- + H+2Fe3+ + NO2- + H2O = 3Fe2 + NO3- + 2H+
Fe3+ + NO2- + H2O = Fe2++H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
FE2+O3+C=FE+CO20FE2 + 2O3 + 3C = 0FE + 3CO2
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl2 H2Fe + 2HCl = FeCl2H2
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
Fe + HCl= H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe2(CO3)3 + HClO3 = Fe(ClO3)3+ CO2 + H2OFe2(CO3)3 + 6HClO3 = 2Fe(ClO3)3 + 3CO2 + 3H2O
Fe3+ +NO2-+H2O=Fe2+ +2H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + 2HNO3=Fe(NO3)2 + H2Fe + 2HNO3 = Fe(NO3)2 + H2
Fe2+ + NO3- + 4H+ = Fe3+ + NO(g) + 2H2O(l)-9Fe2+ + NO3- + 4H+ = -6Fe3+ + NO(g) + 2H2O(l)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+HCl= FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS2 + H2O + 3SO2 = H2SO4 + FeSO4FeS2 - 6H2O - 7SO2 = -6H2SO4 + FeSO4
Fe (s) + H2O (l) =Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe+K2Cr2O7+HCl=FeCl2+KCl+CrCl3+H2O3Fe + K2Cr2O7 + 14HCl = 3FeCl2 + 2KCl + 2CrCl3 + 7H2O
Fe+K2Cr2O7+HCl=FeCl3+KCl+CrCl3+H2O2Fe + K2Cr2O7 + 14HCl = 2FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3(s) + H2O(l) = Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe2O3(s) + H2O(l) = Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeSO4 + (NH4)2S = (NH4)2SO4 + FeSFeSO4 + (NH4)2S = (NH4)2SO4 + FeS
Fe+2CuNO3 = Fe(NO3)2+2CuFe + 2CuNO3 = Fe(NO3)2 + 2Cu
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe2O3 + KClO3 + 4KOH = 2K2FeO4 + KCl + 2H2OFe2O3 + KClO3 + 4KOH = 2K2FeO4 + KCl + 2H2O
Fe(OH)3=Fe+OHFe(OH)3 = Fe + 3OH
Fe(s) + Ni(NO3)2(aq) = Fe(NO3)3(aq) + Ni(s)2Fe(s) + 3Ni(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Ni(s)
Fe2S3 + O2 = Fe2O3 + SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe(s)+O2(g)=Fe2O3(g)4Fe(s) + 3O2(g) = 2Fe2O3(g)
Fe(s) + O2 (g) + H2O = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(aq)
Fe2O3(s)+H2=Fe(s)+H2O(g)Fe2O3(s) + 3H2 = 2Fe(s) + 3H2O(g)
FeS+HNO3=Fe2(SO4)2+NO+H4SO4+H2O6FeS + 16HNO3 = 3Fe2(SO4)2 + 16NO + 0H4SO4 + 8H2O
Fe2 (SO4)3+NH3+H2O=Fe (OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe2O3 + Na2S2O3 = FeO + FeSO4 + Na2SO44Fe2O3 + Na2S2O3 = 7FeO + FeSO4 + Na2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2+ + Cr2O72- + H+ = Fe3+ + Cr3+ + H2O-1281Fe2+ + 3Cr2O72- + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Fe(s) + Br2(l) = FeBr3(s)2Fe(s) + 3Br2(l) = 2FeBr3(s)
Fe(s) + Br2(l) = FeBr3(s)2Fe(s) + 3Br2(l) = 2FeBr3(s)
Fe(s)+O2(g)=FeO(s)2Fe(s) + O2(g) = 2FeO(s)
FeS + H2SO4 = FeSO4 + H2SFeS + H2SO4 = FeSO4 + H2S
Fe(OH)3 + 6 NH3 = 6 (Fe(OH)6)3 + 3NH4NO3 + 3H2O-24Fe(OH)3 + 18NH3 = -8(Fe(OH)6)3 + 9NH4NO3 + 45H2O
Fe(NO)3 + 3NH3 = Fe(OH)3 + 3NH4NO3 + 3H2O-2Fe(NO)3 + 0NH3 = -2Fe(OH)3 - 3NH4NO3 + 9H2O
FeCl3(aq)+MgCO3(aq)= FeCO3 + MgCl3FeCl3(aq) + MgCO3(aq) = FeCO3 + MgCl3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS2 + HNO3 = Fe(NO3)3 + NO + H2SO4 + H2OFeS2 + 8HNO3 = Fe(NO3)3 + 5NO + 2H2SO4 + 2H2O
FeO = Fe + O22FeO = 2Fe + O2
Fe2O3 + NH4OH = 2Fe(OH)3 + NH4 + H2O-1Fe2O3 + 0NH4OH = -2Fe(OH)3 + 0NH4 + 3H2O
FeSO4+H2O=Fe(OH)2+H2SO4FeSO4 + 2H2O = Fe(OH)2 + H2SO4
FeS2+H2=Fe+H2SFeS2 + 2H2 = Fe + 2H2S
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + C = Fe +CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeI2 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + K2SO4+ KIO310FeI2 + 26KMnO4 + 44H2SO4 = 5Fe2(SO4)3 + 26MnSO4 + 44H2O + 3K2SO4 + 20KIO3
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + K2SO410FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + 8H2O + K2SO4
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3(s) + C(s) = Fe(s) + CO(g) Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+HNO3=Fe(NO3)2+NO2+H2OFe + 4HNO3 = Fe(NO3)2 + 2NO2 + 2H2O
Fe + MgCl = Mg + FeCl3Fe + 3MgCl = 3Mg + FeCl3
Fe (s) + O2 (g) + H2O (g) = Fe(OH)2 (aq)2Fe(s) + O2(g) + 2H2O(g) = 2Fe(OH)2(aq)
FeCl2 +Na2CO3 = FeCO3 +2NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe+ O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe ++ + H2O2 + H + = Fe +++ + H2O2Fe++ + H2O2 + 2H+ = 2Fe+++ + 2H2O
Fe + CuCl2 = FeCl2 + CuFe + CuCl2 = FeCl2 + Cu
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS2 + H2O + O2 = Fe(SO4)3 + H2SO4-2FeS2 + 2H2O - 9O2 = -2Fe(SO4)3 + 2H2SO4
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
FeO(s) + O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2(SO4)3 + Ba(NO3)2 = BaSO4 + Fe(NO3)3Fe2(SO4)3 + 3Ba(NO3)2 = 3BaSO4 + 2Fe(NO3)3
Fe(OH)3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3O4(s)+CO(g)=Fe(s)+CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe2 (SO4)3(aq) + NH3(g) + H2O(l) = Fe(OH)3 (s) + (NH4)2 SO4 (aq)Fe2(SO4)3(aq) + 6NH3(g) + 6H2O(l) = 2Fe(OH)3(s) + 3(NH4)2SO4(aq)
Fe2O3 + 3C = 2Fe + 3COFe2O3 + 3C = 2Fe + 3CO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe (s) + O2 (g) = Fe2O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3(S)+C(S)=Fe(S)+CO3(g)Fe2O3(S) + C(S) = 2Fe(S) + CO3(g)
Fe2O3(S)+C(S)=Fe(S)+CO3(g)Fe2O3(S) + C(S) = 2Fe(S) + CO3(g)
Fe3O4(s)+H2(g)=Fe(l)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(l) + 4H2O(g)
Fe + H2O= Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
F2 + AlCl3= AlF3 +Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
F2 + AlCl3= AlF3 +Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeBr3 + Li2SO4= Fe2(SO4)3 + LiBr2FeBr3 + 3Li2SO4 = Fe2(SO4)3 + 6LiBr
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O=FeO+SO2FeS + 3O = FeO + SO2
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
FeS2 + HNO3 = H2SO4 + Fe(NO3)3 + NO + H2OFeS2 + 8HNO3 = 2H2SO4 + Fe(NO3)3 + 5NO + 2H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + S = Fe2S32Fe + 3S = Fe2S3
FeCl2*4H2O + 2 FeCl3*6H2O + 8 NH4OH = Fe3O4 + 8 NH4Cl + 20 H2OFeCl2*4H2O + 2FeCl3*6H2O + 8NH4OH = Fe3O4 + 8NH4Cl + 20H2O
FeCl2*4H2O + 2 FeCl3*6H2O + 8 NH4OH = Fe3O4 + 8 NH4Cl + 20 H2OFeCl2*4H2O + 2FeCl3*6H2O + 8NH4OH = Fe3O4 + 8NH4Cl + 20H2O
Fe2O3 + 3H2O = 2Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + 3 H2O = 2Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3 + H2SO4 = H2O + Fe2(SO4)32Fe(OH)3 + 3H2SO4 = 6H2O + Fe2(SO4)3
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr 2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr 2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe(s)+O2=Fe2O3(s)4Fe(s) + 3O2 = 2Fe2O3(s)
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
F2 + 2 HBr = Br2 + 2 HF F2 + 2HBr = Br2 + 2HF
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + O= Fe2O32Fe + 3O = Fe2O3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe (OH)3 + HBr= FeBr3 + H2OFe(OH)3 + 3HBr = FeBr3 + 3H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
Fe(s) + H2O(l) + O2(g) = Fe(OH)2(s)2Fe(s) + 2H2O(l) + O2(g) = 2Fe(OH)2(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 (aq) + Na3AsO4 (aq) = FeAsO4 + 3NaClFeCl3(aq) + Na3AsO4(aq) = FeAsO4 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 +CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
FeCl3 + 3KSCN = Fe (SCN)3 + 3KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+HNO3=Fe(NO3)3+NH4NO3+H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe+H2O=Fe3O4+H2O0Fe + H2O = 0Fe3O4 + H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + S = FeSFe + S = FeS
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 + 3C = 2Fe + 3COFe2O3 + 3C = 2Fe + 3CO
Fe2O3 + 3C = 2Fe + 3COFe2O3 + 3C = 2Fe + 3CO
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2S3(s)=Fe(s)+S(s)Fe2S3(s) = 2Fe(s) + 3S(s)
Fe+HNO3=Fe(NO3)2+NO+H2O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
Fe+HNO3=Fe(NO3)2+NO+H2O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
FeSO4+SR(OH)2=Fe(OH)2+SRSO4FeSO4 + SR(OH)2 = Fe(OH)2 + SRSO4
F2 +MgCl2 = MgF + Cl2F2 + 2MgCl2 = 2MgF + 2Cl2
FeS+H2SO4=Fe2(SO4)3+SO2+H2O2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O
FeS2+HNO3+HCl=FeCl3+H2SO4+NO+H2OFeS2 + 5HNO3 + 3HCl = FeCl3 + 2H2SO4 + 5NO + 2H2O
Fe+HNO3=Fe(NO3)2+NH4NO3+H2010Fe + 20HNO3 = 10Fe(NO3)2 + 0NH4NO3 + H20
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeS+O3=Fe2O3+SO32FeS + 3O3 = Fe2O3 + 2SO3
Fe(OH)3 + H2SO3 = Fe2(SO3)3 + H2O2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
Fe(OH)3 + H2SO3 = Fe2(SO3)3 + H2O2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3+3C=2Fe+3COFe2O3 + 3C = 2Fe + 3CO
Fe2(CO3)3 + HBr = FeBr3 + H2O + CO2Fe2(CO3)3 + 6HBr = 2FeBr3 + 3H2O + 3CO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe(OH)3 + H2So4 = Fe2(So4)3 + H2O2Fe(OH)3 + 3H2So4 = Fe2(So4)3 + 6H2O
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.