Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe+HSO4=Fe2(SO4)3+H24Fe + 6HSO4 = 2Fe2(SO4)3 + 3H2
FeCl2 + Na2CO3 = FeCO3 + NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2CO3=Fe2(CO3)3+H2O2Fe(OH)3 + 3H2CO3 = Fe2(CO3)3 + 6H2O
FeSO4+NaOH=Fe(OH)2+Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
Fe+ 3ClO4=Fe(ClO4)3Fe + 3ClO4 = Fe(ClO4)3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3(aq) + Na3PO4(aq) = FePO4(s) + NaClFeCl3(aq) + Na3PO4(aq) = FePO4(s) + 3NaCl
Fe(NO3)2(aq) + NaOH(aq) = Fe(OH)2(s) + NaNO3(aq)Fe(NO3)2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaNO3(aq)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq) Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq)Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
FeCl3(aq) + Na3PO4(aq) = FePO4(s) + NaCl(aq)FeCl3(aq) + Na3PO4(aq) = FePO4(s) + 3NaCl(aq)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(OH)3(aq) + H3PO4(aq) = FePO4 + H2O(l)Fe(OH)3(aq) + H3PO4(aq) = FePO4 + 3H2O(l)
Fe(OH)3(aq) + H3PO4(aq) = FePO4(aq) + H2O(l)Fe(OH)3(aq) + H3PO4(aq) = FePO4(aq) + 3H2O(l)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+ CO = + Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O2 + CO = Fe + CO2Fe3O2 + 2CO = 3Fe + 2CO2
Fe(NO3)2+NaOH=Fe(OH)2+NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
Fe(NO3)2+NaOH=Fe(OH)2+NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO3)3 (aq) + 3 Mg(OH)2(aq) = 2 Fe(OH)3(s) + 3 MgSO3(aq)Fe2(SO3)3(aq) + 3Mg(OH)2(aq) = 2Fe(OH)3(s) + 3MgSO3(aq)
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3(s)+3CO(g)=3CO2(g)+2Fe(s)Fe2O3(s) + 3CO(g) = 3CO2(g) + 2Fe(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2+ = Fe3+ = e--6Fe2+ = -4Fe3+ + e-
FeSO4(aq)+K3PO4(aq)=Fe3(PO4)2+K2SO43FeSO4(aq) + 2K3PO4(aq) = Fe3(PO4)2 + 3K2SO4
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + Ag+ = Fe2+ + Ag2Fe + Ag+ = Fe2+ + Ag
Fe + Ag2+ = Fe2+ + Ag2Fe + Ag2+ = Fe2+ + 2Ag
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
F e 3 O 4 (s)+ O 2 (g)=F e 2 O 3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe+HCl=FeCl3 +H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
F2 + MgCl2 = MgF2 + Cl2F2 + MgCl2 = MgF2 + Cl2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
F e 3 O 4 (s)+ O 2 (g)=F e 2 O 3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH ) 3 (s)+HN O 3 (aq)=Fe(N O 3 ) 3 (aq)+ H 2 O(l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe(OH ) 3 (s)+HN O 3 (aq)=Fe(N O 3 ) 3 (aq)+ H 2 O(l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe + 2OH = Fe(OH)2Fe + 2OH = Fe(OH)2
FeSo4 + Ba(OH)2 = Fe(OH)2 + BaSo4FeSo4 + Ba(OH)2 = Fe(OH)2 + BaSo4
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(NO3)3(aq)+Be(s)=Be(NO3)2(s)+Fe(s)2Fe(NO3)3(aq) + 3Be(s) = 3Be(NO3)2(s) + 2Fe(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl2+Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe(NO3)2+Na3PO4= Fe3(PO4)2+NaNO33Fe(NO3)2 + 2Na3PO4 = Fe3(PO4)2 + 6NaNO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH ) 3 + H 2 S O 4 =F e 2 (S O 4 ) 3 + H 2 O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
FeCO3=FeO+CO2FeCO3 = FeO + CO2
Fe+Al2O3=Fe2O3+Al2Fe + Al2O3 = Fe2O3 + 2Al
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3(PO4)2+(NH4)2O=FeO+(NH4)3PO4Fe3(PO4)2 + 3(NH4)2O = 3FeO + 2(NH4)3PO4
Fe(NO3)2 + Sb2(SO4)3 = FeSO4 + Sb(NO3)3 3Fe(NO3)2 + Sb2(SO4)3 = 3FeSO4 + 2Sb(NO3)3
Fe2(SO4)3 + KOH = Fe2O3 + K2SO4 + H2OFe2(SO4)3 + 6KOH = Fe2O3 + 3K2SO4 + 3H2O
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe + Pb(NO3)2 = Fe(NO3)2 + PbFe + Pb(NO3)2 = Fe(NO3)2 + Pb
Fe (OH)2 + H3PO4 = Fe3 (PO4)2 + H2O3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
F2(g)  +  LiCl(aq)  = 2LiF(aq)  + Cl2(g)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(g)
F3+H2=HF2F3 + 3H2 = 6HF
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(C2H3O2)3+K2(CrO4)=Fe2(CrO4)3+K(C2H3O2)2Fe(C2H3O2)3 + 3K2(CrO4) = Fe2(CrO4)3 + 6K(C2H3O2)
Fe2O3 +4H2= 2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+CO2=Fe+CO20Fe2O3 + CO2 = 0Fe + CO2
Fe + NaBr = FeBr3 + NaFe + 3NaBr = FeBr3 + 3Na
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + Mg = MgCl2 +Fe2FeCl3 + 3Mg = 3MgCl2 + 2Fe
Fe2(SO4)3 + LiOH = Fe(OH)3 + Li2(SO4)Fe2(SO4)3 + 6LiOH = 2Fe(OH)3 + 3Li2(SO4)
Fe2(SO4)3 + LiOH = Fe(OH)3 + Li2(SO4)Fe2(SO4)3 + 6LiOH = 2Fe(OH)3 + 3Li2(SO4)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe (NO3)2 + H NO3= Fe (NO3)3 + NO +H2 O3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO + 2H2O
Fe3 O4 +Al= Fe + Al2 O33Fe3O4 + 8Al = 9Fe + 4Al2O3
FeSe(s)+Se2(g)=Fe2Se3(s)4FeSe(s) + Se2(g) = 2Fe2Se3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeCl2+K=KCl+FeFeCl2 + 2K = 2KCl + Fe
Fe(s) + Cu(NO3)2(aq) = Fe(NO3)2(aq) + Cu(s)Fe(s) + Cu(NO3)2(aq) = Fe(NO3)2(aq) + Cu(s)
Fe(s)+S8(s)=Fe2S3(s)16Fe(s) + 3S8(s) = 8Fe2S3(s)
FeCl2(aq) + NaOH(aq) = Fe(OH)2(s) + NaCl(aq)FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe2O3(s)+CO(g)=Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
F2 + NaCl = NaF + Cl2F2 + 2NaCl = 2NaF + Cl2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(OH)2+O2+H2O= Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe(s)+O2(g)+H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) +H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
F2+HCl=Cl2+HFF2 + 2HCl = Cl2 + 2HF
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FE(CUNO2)=FENO2+CUFE(CUNO2) = FENO2 + CU
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS O 4 (aq)+Ba(OH ) 2 (aq)=BaSO4(s)+Fe(OH) 2(s)FeSO4(aq) + Ba(OH)2(aq) = BaSO4(s) + Fe(OH)2(s)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(s)+H2O(l)=Fe3O4(s)+H23Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2
Fe3O4(s)+O2(g)=Fe2O3(s) 4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe + H2O = Fe3O2 + H23Fe + 2H2O = Fe3O2 + 2H2
Fe(s)+Pb(NO3)2(aq)=Pb(s)+Fe(NO3)2(aq)Fe(s) + Pb(NO3)2(aq) = Pb(s) + Fe(NO3)2(aq)
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe(s) + AgNO3(aq) = Fe(NO3)3 (aq) + Ag(s)Fe(s) + 3AgNO3(aq) = Fe(NO3)3(aq) + 3Ag(s)
Fe(s)+H2O(l)+O2(g)=Fe(OH2)(s)Fe(s) + H2O(l) + 0O2(g) = Fe(OH2)(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+Al2O3(aq)=FeO(aq)+Al(s)3Fe(s) + Al2O3(aq) = 3FeO(aq) + 2Al(s)
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+O2=FeO2Fe + O2 = 2FeO
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3 + AgNO3 = Fe(NO3)3 + AgClFeCl3 + 3AgNO3 = Fe(NO3)3 + 3AgCl
Fe(s) + Cu(NO3)2(aq) = Fe(NO3)2(aq) + Cu(s)Fe(s) + Cu(NO3)2(aq) = Fe(NO3)2(aq) + Cu(s)
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH ) 3 + H 2 S O 4 =F e 2 (S O 4 ) 3 + H 2 O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + NaBr = FeBr3 + NaFe + 3NaBr = FeBr3 + 3Na
Fe2O3 + 3CO=3CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe (s) + H2O (l) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeO+C=Fe+CO22FeO + C = 2Fe + CO2
Fe2((S(O4))3)+KOH=(K2)S(O4)+Fe((OH)3)Fe2((S(O4))3) + 6KOH = 3(K2)S(O4) + 2Fe((OH)3)
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(ClO4)2(aq) + K2S(aq) = FeS(s) + 2KClO4(aq)Fe(ClO4)2(aq) + K2S(aq) = FeS(s) + 2KClO4(aq)
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe(s) + PbSO3(aq) = Pb(s) + Fe2(SO3)3(aq)2Fe(s) + 3PbSO3(aq) = 3Pb(s) + Fe2(SO3)3(aq)
FeS2+HNO3=Fe(SO4)3+NO+H2SO4+H2OFeS2 + 6HNO3 = Fe(SO4)3 + 6NO - H2SO4 + 4H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(s)+H2O(g)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(s)+H2O(g)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(s)+H2O(g)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe2O3(s)+HCl(aq)=FeCl3(aq)+H2O(l)Fe2O3(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2O(l)
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + S = Fe2S32Fe + 3S = Fe2S3
FeCl3(aq) + NaOH(aq) = Fe(OH)3(s)+ NaCl(aq)FeCl3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaCl(aq)
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
F2+H2O= OF2+HF2F2 + H2O = OF2 + 2HF
FeCl3+(NH4)3PO4 = FePO4+3NH4ClFeCl3 + (NH4)3PO4 = FePO4 + 3NH4Cl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeO + C = Fe + CO22FeO + C = 2Fe + CO2
FeBr2+ K2CO3= FeCO3+KBrFeBr2 + K2CO3 = FeCO3 + 2KBr
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe +F=FeF3Fe + 3F = FeF3
Fe 3+F=FeF3Fe3 + 9F = 3FeF3
FeSO4+HNO3+H2SO4=Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe2(SO4)3+KOH=Fe(OH)3+K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
FeCO3+H2O =-Fe2O3+H3CO3+H+e-2FeCO3 - 3H2O = -1-Fe2O3 - 2H3CO3 + 0H + e
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
FeCO3+H2O =-Fe2CO3+H3CO3+H+e-2FeCO3 + 0H2O = -1-Fe2CO3 - H3CO3 + 3H + e
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3(s)+H2(g)=Fe(s)+H2O(g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3(aq)+KSCN(aq)=Fe(SCN)3(aq)+KCl(aq)FeCl3(aq) + 3KSCN(aq) = Fe(SCN)3(aq) + 3KCl(aq)
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+Br2= FeBr2Fe + Br2 = 2FeBr
FeO + O2= Fe2O34FeO + O2 = 2Fe2O3
F2 + NaCl (aq) = NaF(aq) + Cl(aq)F2 + 2NaCl(aq) = 2NaF(aq) + 2Cl(aq)
F2 + NaCl (aq) = NaF(aq) + Cl(aq)F2 + 2NaCl(aq) = 2NaF(aq) + 2Cl(aq)
Fe2(SO4)3+Ba(NO3)2=Fe(NO3)3+BaSO4Fe2(SO4)3 + 3Ba(NO3)2 = 2Fe(NO3)3 + 3BaSO4
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + HCl = 2FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe(NO3)3 + NaOH = Fe(OH)3 + NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
FrHSO3 + HClO4 = FrClO4 + H2O + SO2FrHSO3 + HClO4 = FrClO4 + H2O + SO2
FeS2+H2O+O2=FeSO4+H2S048FeS2 + 2H2O + 15O2 = 8FeSO4 + 2H2S04
FeSo4 + Cl2 = Fe3(So2)2 + FeCl3-1FeSo4 + 3Cl2 = -1Fe3(So2)2 + 2FeCl3
Fe+HNO3 =Fe(NO3)2+H2Fe + 2HNO3 = Fe(NO3)2 + H2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(SO4)3 + NaPO4 = Fe(PO4)3 + NaSO4Fe(SO4)3 + 3NaPO4 = Fe(PO4)3 + 3NaSO4
Fe + H2SO4 = Fe(SO4)3 + H2 Fe + 3H2SO4 = Fe(SO4)3 + 3H2
Fe + H2SO4 = Fe(SO4)3 + H2 Fe + 3H2SO4 = Fe(SO4)3 + 3H2
FeSO4+HNO3+H2SO4=Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3O4 + 4 H2 = 3 Fe + 4 H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + 4 H2 = 3 Fe + 4 H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl3+NaOH= Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+HNO3= FeNO3+H22Fe + 2HNO3 = 2FeNO3 + H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g)=Fe3O4(s)+CO2(g)3Fe2O3(s) + CO(g) = 2Fe3O4(s) + CO2(g)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+HCl=FeCl3+HFe + 3HCl = FeCl3 + 3H
FeS+O2=2Fe2O3+4SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O4 + 4C = 3Fe + 4 COFe3O4 + 4C = 3Fe + 4CO
Fe3O4 + 4CO = 3Fe + 4CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe(NO3)3+ NH4+ OH- = Fe2O3(H2O)+ NO3-+ NH40Fe(NO3)3 + NH4 + 0OH- = 0Fe2O3(H2O) + 0NO3- + NH4
Fe2O3+3CO2=2Fe+3CO20Fe2O3 + CO2 = 0Fe + CO2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeO+Mn=Mn2O5+Fe5FeO + 2Mn = Mn2O5 + 5Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(HCO3)2 + HCl = FeCl2 + CO2 + H2OFe(HCO3)2 + 2HCl = FeCl2 + 2CO2 + 2H2O
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe(NO3)3+K2CO3=Fe2(CO3)3+KNO32Fe(NO3)3 + 3K2CO3 = Fe2(CO3)3 + 6KNO3
Fe + HCl = FeCl3 + HFe + 3HCl = FeCl3 + 3H
Fe2(SO4)3(aq) + KOH(aq)=Fe(OH)3(s) + K2SO4(aq)Fe2(SO4)3(aq) + 6KOH(aq) = 2Fe(OH)3(s) + 3K2SO4(aq)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+HCl=FeCl2+HFe + 2HCl = FeCl2 + 2H
Fe2O3+Al=Al2O3+ FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(CO3)3 + HI = FeI3 + H2O +CO2Fe2(CO3)3 + 6HI = 2FeI3 + 3H2O + 3CO2
Fe2(SO4)3 + NH4OH = (NH4)2SO4 + Fe(OH)3Fe2(SO4)3 + 6NH4OH = 3(NH4)2SO4 + 2Fe(OH)3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO4 = Fe + CO2-2Fe2O3 + 3CO4 = -4Fe + 3CO2
FeCl3(aq) + KSCN(aq) = Fe(SCN)3(aq) + KCl(aq)FeCl3(aq) + 3KSCN(aq) = Fe(SCN)3(aq) + 3KCl(aq)
Fe2O2+C=Fe + CO2Fe2O2 + C = 2Fe + CO2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(HCO3)3+CaO=Fe2O3+Ca(HCO3)22Fe(HCO3)3 + 3CaO = Fe2O3 + 3Ca(HCO3)2
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe(OH)3 + H2(SO4) = Fe2(SO4)3 + H2O 2Fe(OH)3 + 3H2(SO4) = Fe2(SO4)3 + 6H2O
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2+Ag3PO4=Fe3(PO4)2+AgCl3FeCl2 + 2Ag3PO4 = Fe3(PO4)2 + 6AgCl
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3 O4 + CO=FeO+CO2Fe3O4 + CO = 3FeO + CO2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeO2O3(s)+3CO(g)=2Fe(s)+3CO2(g)FeO2O3(s) + 5CO(g) = Fe(s) + 5CO2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+3H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeO3 + H2O = FeO3H2OFeO3 + H2O = FeO3H2O
FeCl3 + Cl2 = FeCl5FeCl3 + Cl2 = FeCl5
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
Fe2O3 + C = Fe +CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(C2O4)3=FeC2O4+CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2O = Fe (OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2S3 + HCl = FeCl3 + H2SFe2S3 + 6HCl = 2FeCl3 + 3H2S
Fe(NO3)3(aq)+LiOH(aq)=FeOH(aq)+Li(NO3)3(s)Fe(NO3)3(aq) + LiOH(aq) = FeOH(aq) + Li(NO3)3(s)
Fe+2FeCl3=3 FeCl2Fe + 2FeCl3 = 3FeCl2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3 (aq) + H2S (g)= Fe2S3 (s) + HCl (aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
FeCl2 + Ag3PO4 = Fe3(PO4)2 + AgCl3FeCl2 + 2Ag3PO4 = Fe3(PO4)2 + 6AgCl
Fe(s) + H2O(l) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s) + H2O(l) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
FeO(s) + CO(g) = Fe(s) + CO2(g)FeO(s) + CO(g) = Fe(s) + CO2(g)
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe(NO3)2(aq) + H2SO4(aq) = FeSO4(s) + 2 HNO3(aq)Fe(NO3)2(aq) + H2SO4(aq) = FeSO4(s) + 2HNO3(aq)
FeS+H2SO4=FeSO4+H2SFeS + H2SO4 = FeSO4 + H2S
FeS+HBr=FeBr2+H2SFeS + 2HBr = FeBr2 + H2S
Fe(s) + H2O(g) = H2(g) + Fe3O4 3Fe(s) + 4H2O(g) = 4H2(g) + Fe3O4
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
F2+O2=F2O2F2 + O2 = 2F2O
F2+O2=F2O2F2 + O2 = 2F2O
F2+O2=F2O2F2 + O2 = 2F2O
Fe2O3 + C = FeO + CO22Fe2O3 + C = 4FeO + CO2
Fe2O2+C=Fe+COFe2O2 + 2C = 2Fe + 2CO
Fe(OH ) 3 (s)+ H 2 S O 4 (aq)=F e 2 (S O 4 ) 3 (aq)+ H 2 O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3+H2SO4=Fe2(SO4)3+4H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2+O3+CO2=Fe2(CO3)3Fe2 + O3 + 3CO2 = Fe2(CO3)3
Fe2+O3+CO2=Fe2(CO3)3Fe2 + O3 + 3CO2 = Fe2(CO3)3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+OH=Fe(OH)2Fe + 2OH = Fe(OH)2
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe (s) + H2O (l) = Fe2O3 (s) + H2 (g)2Fe(s) + 3H2O(l) = Fe2O3(s) + 3H2(g)
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe+O=FeOFe + O = FeO
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS +O2 =Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3= Fe2O3+ H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3O4+CO=Fe+CO3Fe3O4 + 2CO = 3Fe + 2CO3
Fe2O3 + 3CO = Fe + CO0Fe2O3 + CO = 0Fe + CO
Fe2O3 + 3CO = Fe + CO0Fe2O3 + CO = 0Fe + CO
FeO3+Mg=MgO+FeFeO3 + 3Mg = 3MgO + Fe
Fe (NO3)3=Fe2O3+NO2+O24Fe(NO3)3 = 2Fe2O3 + 12NO2 + 3O2
Fe2O3(s)+CO(g)=Fe3O4(s)+CO2(g)3Fe2O3(s) + CO(g) = 2Fe3O4(s) + CO2(g)
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(NO3)3+CaSO4=Ca(NO3)2+Fe2(SO4)32Fe(NO3)3 + 3CaSO4 = 3Ca(NO3)2 + Fe2(SO4)3
FeS+4HNO3=Fe(NO3)3+S+NO+H2OFeS + 4HNO3 = Fe(NO3)3 + S + NO + 2H2O
FeI3+NH4OH=NH4I+Fe(OH)3FeI3 + 3NH4OH = 3NH4I + Fe(OH)3
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=FeO2Fe + O2 = 2FeO
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2(SO4)3 + KOH = K2SO4+ Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeS+O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 +NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 +NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 +NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 +NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 +NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
FeS2+O2 = Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(CO3)3+H2SO4 = Fe2(SO4)3+H2O+CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe(NO3)2(aq) + H2SO4(aq) =FeSO4(s) + 2 HNO3(aq)Fe(NO3)2(aq) + H2SO4(aq) = FeSO4(s) + 2HNO3(aq)
FeS + O2=Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(s) + H2 O(l) = Fe3 O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+ Cl3=FeCl3Fe + Cl3 = FeCl3
Fe(ClO3)3 + KOH = Fe(OH)3 + K(ClO3)Fe(ClO3)3 + 3KOH = Fe(OH)3 + 3K(ClO3)
FeCl3+NaOH=NaCl+Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3(aq)+KSCN(aq)=Fe(SCN)3(aq)+KCl(aq)FeCl3(aq) + 3KSCN(aq) = Fe(SCN)3(aq) + 3KCl(aq)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)3 + K2O =Fe2O3 + KNO32Fe(NO3)3 + 3K2O = Fe2O3 + 6KNO3
Fe(NO3)3 + K2O =Fe2O3 + KNO32Fe(NO3)3 + 3K2O = Fe2O3 + 6KNO3
FeCl3+(NH4)2S=Fe2S3+ NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe+O2(g)=Fe3O23Fe + O2(g) = Fe3O2
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2(CO3)3 + HI = FeI3 + CO2 + H2OFe2(CO3)3 + 6HI = 2FeI3 + 3CO2 + 3H2O
Fe2O3(s)+H2O=Fe(OH)3(s)Fe2O3(s) + 3H2O = 2Fe(OH)3(s)
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe2O3 + 3H2 = 3H2O + 2FeFe2O3 + 3H2 = 3H2O + 2Fe
Fe3(PO4)2(aq) + (NH4)2S(aq) = FeS(s) +(NH4)3PO4(aq)Fe3(PO4)2(aq) + 3(NH4)2S(aq) = 3FeS(s) + 2(NH4)3PO4(aq)
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+3C=2Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
FeI3+Cl2=I2+FeCl32FeI3 + 3Cl2 = 3I2 + 2FeCl3
FeI3+Br2=I2+FeBr32FeI3 + 3Br2 = 3I2 + 2FeBr3
FeO3+3CO=2 Fe+ 3CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
FeCl3 + Ca(OH)2 = 2Fe(OH)3 + 3CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe+H2SO4 = Fe2(SO4)3+ SO2+ H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe+H2SO4 = Fe(SO4)3+ SO2+ H2OFe + 6H2SO4 = Fe(SO4)3 + 3SO2 + 6H2O
Fe2O3(s) + 3 CO(g) = 2 Fe(s) + 3CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeBr3 + F2 = Br2 +FeF32FeBr3 + 3F2 = 3Br2 + 2FeF3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3=Fe(s)+O2(g)2Fe2O3 = 4Fe(s) + 3O2(g)
Fe(s)+O2(g) =Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2S(g)=Fe2S3(s)+H2O(g)2Fe(OH)3(s) + 3H2S(g) = Fe2S3(s) + 6H2O(g)
Fe(s)+O2(g) =Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) + H2 O(l) =Fe3 O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 +H2O =Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + 3H2 = 3Fe +3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(OH)2 + NaNO3 + H2O = Fe(OH)3 + NH3 + NaOH8Fe(OH)2 + NaNO3 + 6H2O = 8Fe(OH)3 + NH3 + NaOH
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(PO4)+Na(SO4)=Fe(SO4)+Na(PO4)Fe(PO4) + Na(SO4) = Fe(SO4) + Na(PO4)
Fe(NO3)3+3Li(OH)=Fe(OH)3+3Li(NO3)Fe(NO3)3 + 3Li(OH) = Fe(OH)3 + 3Li(NO3)
FeSO4 = Fe2O3 + SO2 + O24FeSO4 = 2Fe2O3 + 4SO2 + O2
FeCl3 + Na = Fe + NaClFeCl3 + 3Na = Fe + 3NaCl
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2 +KCl = FeCl2 +KFe2 + 4KCl = 2FeCl2 + 4K
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeBr2 + Na2SO4 = FeSO4 + Na2Br2FeBr2 + Na2SO4 = FeSO4 + Na2Br2
FeBr2 (aq) + Na2SO4 (aq) = FeSO4 + Na2Br2FeBr2(aq) + Na2SO4(aq) = FeSO4 + Na2Br2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe3+H2O=Fe3O4+HFe3 + 4H2O = Fe3O4 + 8H
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2(SO4)3 + K2CO3 = Fe2(CO3)3 + K2SO4Fe2(SO4)3 + 3K2CO3 = Fe2(CO3)3 + 3K2SO4
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe+O2= Fe3O43Fe + 2O2 = Fe3O4
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe2S3(l) = Fe(s) + 3 S(s)Fe2S3(l) = 2Fe(s) + 3S(s)
FeS2+5O2 = Fe2O3+4SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2+ H2CO3 = HF + CO3F2 + H2CO3 = 2HF + CO3
Fe + H2SO4=H2 + FeSO4Fe + H2SO4 = H2 + FeSO4
Fe + CH3COOH = CH3COOFe + H22Fe + 2CH3COOH = 2CH3COOFe + H2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.