Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S2(s)2Fe(s) + 2S(l) = Fe2S2(s)
Fe(s) +S(l) = Fe2S2(s)2Fe(s) + 2S(l) = Fe2S2(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3 =Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS(aq) + O2(g) = Fe2O3(aq) + SO2(g)4FeS(aq) + 7O2(g) = 2Fe2O3(aq) + 4SO2(g)
FeCl3(aq) + (NH4)2S(aq) = Fe2S3(aq) + NH4Cl(aq)2FeCl3(aq) + 3(NH4)2S(aq) = Fe2S3(aq) + 6NH4Cl(aq)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
FeS + 3H2O2 = FeO + SO2 + 3H2OFeS + 3H2O2 = FeO + SO2 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + H2O2 = FeO + SO2 + H22FeS + 3H2O2 = 2FeO + 2SO2 + 3H2
Fe2 O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + F2 = FeF32Fe + 3F2 = 2FeF3
FeCl3 + 3NaHCO3 = Fe(OH)3 + 3CO2 + 3NaClFeCl3 + 3NaHCO3 = Fe(OH)3 + 3CO2 + 3NaCl
FeS+H2O2=FeO+SO2+H2OFeS + 3H2O2 = FeO + SO2 + 3H2O
F+HNO3=HFO3+NO+H2O3F + 5HNO3 = 3HFO3 + 5NO + H2O
F+HNO3=HFO3+NO+H2O3F + 5HNO3 = 3HFO3 + 5NO + H2O
Fe(NO3)3 + NaHCO3 = FeHCO3 + Na(NO3)3Fe(NO3)3 + NaHCO3 = FeHCO3 + Na(NO3)3
Fe(NO3)3 + NaHCO3 = FeHCO3 + Na(NO3)3Fe(NO3)3 + NaHCO3 = FeHCO3 + Na(NO3)3
Fe(NO3)3 + NaHCO3 = FeHCO3 + Na(NO3)3Fe(NO3)3 + NaHCO3 = FeHCO3 + Na(NO3)3
Fe(s) + O2(g) + H20(l)= Fe(OH)2(aq)10Fe(s) + 10O2(g) + H20(l) = 10Fe(OH)2(aq)
FeBr3+3AgNO3=2AgBr+Fe(NO3)3FeBr3 + 3AgNO3 = 3AgBr + Fe(NO3)3
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O = FeOFe + O = FeO
Fe+Al2O3=FeO+Al3Fe + Al2O3 = 3FeO + 2Al
Fe+Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O = FeOFe + O = FeO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO4= Fe2+(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2 + (SO4)3 + 6H2O
FeBr3+Cl2=FeCl3+Br22FeBr3 + 3Cl2 = 2FeCl3 + 3Br2
FeCl2+Al2O3=AlCl3+FeO3FeCl2 + Al2O3 = 2AlCl3 + 3FeO
FeCl2+Al2O3= AlCl3+FeO3FeCl2 + Al2O3 = 2AlCl3 + 3FeO
Fe(NO3)3(aq)+3NaOH(aq)=Fe(OH)3(s)+3NaNO3(aq)Fe(NO3)3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaNO3(aq)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3(aq)+Ca(OH)2(aq)=Fe(OH)3(s)+CaCl2(aq)2FeCl3(aq) + 3Ca(OH)2(aq) = 2Fe(OH)3(s) + 3CaCl2(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s) 2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe+H2S=Fe2S3+H22Fe + 3H2S = Fe2S3 + 3H2
Fe+H2S=Fe2S3+H22Fe + 3H2S = Fe2S3 + 3H2
Fe(NO3)2(aq) + Zn(s) = Zn(NO3)2(aq) + Fe(s)Fe(NO3)2(aq) + Zn(s) = Zn(NO3)2(aq) + Fe(s)
Fe2(SO4)3+NaOH=Fe(OH)3+Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
FeCl3(aq) + Zn(s) = Fe + ZnCl3FeCl3(aq) + Zn(s) = Fe + ZnCl3
Fe + Fe3+ = Fe2+-1Fe + Fe3+ = Fe2+
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
FeCl3 + Pb(NO3)2 = Fe(NO3)3 + PbCl22FeCl3 + 3Pb(NO3)2 = 2Fe(NO3)3 + 3PbCl2
Fe(NO3)2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaNO3(aq)3Fe(NO3)2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaNO3(aq)
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl3(aq) + AgNO3 = Fe(NO3)3 + AgClFeCl3(aq) + 3AgNO3 = Fe(NO3)3 + 3AgCl
FeCl3(aq) + Pb(NO3)2 = Fe(NO3)3 + PbCl22FeCl3(aq) + 3Pb(NO3)2 = 2Fe(NO3)3 + 3PbCl2
Fe2O3(s)+CO(g)=Fe(s)+CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3(aq) + Na3PO4(aq) = FePO4(s) + NaCl(aq) FeCl3(aq) + Na3PO4(aq) = FePO4(s) + 3NaCl(aq)
Fe(NO3)2(aq) + NaOH(aq) = Fe(OH)2(s) + NaNO3(aq)Fe(NO3)2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaNO3(aq)
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq) Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
FeCl3(aq) + Na3PO4(aq) = FePO4(s) + NaCl(aq) FeCl3(aq) + Na3PO4(aq) = FePO4(s) + 3NaCl(aq)
Fe(NO3)2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaNO3(aq) 3Fe(NO3)2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaNO3(aq)
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + Ca(OH)2 = Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2O3 = Fe3O4 + O26Fe2O3 = 4Fe3O4 + O2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+NH3+H2O=Fe(OH)3+(NH4)2 SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe2(SO4)3+NH3+H2O=Fe(OH)3+(NH4)2 SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
FeSO4(aq)+KMnO4(aq)+H2SO4(aq)=Fe(SO4)3(aq)+MnSO4(aq)+K2SO4(aq)+H2O(l)5FeSO4(aq) + 4KMnO4(aq) + 16H2SO4(aq) = 5Fe(SO4)3(aq) + 4MnSO4(aq) + 2K2SO4(aq) + 16H2O(l)
FeCl3+Zn=Fe+ZnCl22FeCl3 + 3Zn = 2Fe + 3ZnCl2
Fe2(SO4)3 + H2O = Fe(OH)3 + H2SO4Fe2(SO4)3 + 6H2O = 2Fe(OH)3 + 3H2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+Na2Co3=NaCl+Fe2(Co3)32FeCl3 + 3Na2Co3 = 6NaCl + Fe2(Co3)3
FeCl3+Na2Co3=NaCl+Fe2(Co3)32FeCl3 + 3Na2Co3 = 6NaCl + Fe2(Co3)3
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe2(SO4)3 + NaOH = Fe (OH)3 + Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
Fe3+ + NO2- +H2O= Fe2+ +2H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2O3(s)+CO(g)=Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
FeSO4 + H2SO4 + KMnO4 = Fe2(SO4)3 + K2SO + MnSO4 + H2O16FeSO4 + 11H2SO4 + 2KMnO4 = 8Fe2(SO4)3 + K2SO + 2MnSO4 + 11H2O
FeSO4 + H2SO4 + KMnO4 = Fe2(SO4)3 + K2SO + MnSO4 + H2O16FeSO4 + 11H2SO4 + 2KMnO4 = 8Fe2(SO4)3 + K2SO + 2MnSO4 + 11H2O
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O = Fe2O32Fe + 3O = Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS (s)+HCl (aq)=FeCl2 (aq)+H2S (g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 +BaCl2 = FeCl3 + BaOFe2O3 + 3BaCl2 = 2FeCl3 + 3BaO
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3= Fe2O3 + H2O 2Fe(OH)3 = Fe2O3 + 3H2O
Fe + O2 + H2O = Fe(OH)2 2Fe + O2 + 2H2O = 2Fe(OH)2
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe2O3 + C6H8O7 +H2O = FeC6H8O7 +H2O0Fe2O3 + 0C6H8O7 + H2O = 0FeC6H8O7 + H2O
Fe2O3 C6H8O7 +H2O = FeC6H8O7 +H2O0Fe2O3C6H8O7 + H2O = 0FeC6H8O7 + H2O
Fe3+ + SO2 + H2O = Fe2+ + H3O + SO40Fe3+ + SO2 + 6H2O = 0Fe2+ + 4H3O + SO4
Fe+S8 = FeS42Fe + S8 = 2FeS4
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2O4+H2=Fe+H2OFe2O4 + 4H2 = 2Fe + 4H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s) +Al(s) =Fe(s) +Al2O3(s)Fe2O3(s) + 2Al(s) = 2Fe(s) + Al2O3(s)
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+++MnO2+4H+=Fe++++Mn+++2H2O2Fe++ + MnO2 + 4H+ = 2Fe+++ + Mn++ + 2H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s) + 2 CH3COOH(aq) = Fe(CH3COO)2(aq) + H2(g)Fe(s) + 2CH3COOH(aq) = Fe(CH3COO)2(aq) + H2(g)
F2(g) + LiCl (aq) = LiF(aq) + Cl2(l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
Fe2(SO4)3+KOH = K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2(SO4)3+KOH = K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + HCl + O2=FeCl + H2O4Fe + 4HCl + O2 = 4FeCl + 2H2O
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
FeSO4 = Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe +Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+H2 =Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe S + O2 = Fe2 O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeSO4 + H2SO4 +KMnO4 = MnSO4 + K2SO4 + Fe2(SO4)3 +H2O10FeSO4 + 8H2SO4 + 2KMnO4 = 2MnSO4 + K2SO4 + 5Fe2(SO4)3 + 8H2O
FeS+O2= Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO4)3 + NaOH = Na2SO4 + Fe(OH)3Fe2(SO4)3 + 6NaOH = 3Na2SO4 + 2Fe(OH)3
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
FeCl2+K2Cr2O7+HCl=FeCl3+KCl+CrCl3+H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(OH)2 + SiO2 = Fe3Si2(OH)4 + Fe3O4 + H26Fe(OH)2 - 2SiO2 = -1Fe3Si2(OH)4 + 3Fe3O4 + 8H2
Fe(OH)2 + SiO2 = Fe3Si2(OH)4 + Fe3O4 + H26Fe(OH)2 - 2SiO2 = -1Fe3Si2(OH)4 + 3Fe3O4 + 8H2
Fe(OH)2 + SiO2 = Fe3Si2(OH)4 + Fe3O4 + H6Fe(OH)2 - 2SiO2 = -1Fe3Si2(OH)4 + 3Fe3O4 + 16H
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
FeCl2(aq)+2KOH(aq)=Fe(OH)2(s)+2KCl(aq)FeCl2(aq) + 2KOH(aq) = Fe(OH)2(s) + 2KCl(aq)
Fe+H2O= FeO+H2Fe + H2O = FeO + H2
Fe2 O3 (s) + CO (g) = CO2 (g) + Fe (s)Fe2O3(s) + 3CO(g) = 3CO2(g) + 2Fe(s)
FeO + HNO3= Fe(NO)3+N2+H2O10FeO + 8HNO3 = 10Fe(NO)3 - 11N2 + 4H2O
FeSO4+NaOH = Fe(OH)2+Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
F2 + H2O = HF + O22F2 + 2H2O = 4HF + O2
F2 + H2O = HF + O22F2 + 2H2O = 4HF + O2
Fe+SO3=Fe2(SO3)32Fe + 3SO3 = Fe2(SO3)3
Fe(C2O4)3 + H2O2 = Fe(OH)3 + CO22Fe(C2O4)3 + 3H2O2 = 2Fe(OH)3 + 12CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3+ + NO2- +H2O= Fe2+ +2H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3+ + NO2- +H2O= Fe2+ +2H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe2+ + NO2 + H2O = Fe3+ + H+ + NO36Fe2+ + NO2 + H2O = 4Fe3+ + 2H+ + NO3
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3P2 + Li = Li3P + FeFe3P2 + 6Li = 2Li3P + 3Fe
Fe3O+CO= Fe+CO2Fe3O + CO = 3Fe + CO2
Fe3O+CO2= Fe+CO20Fe3O + CO2 = 0Fe + CO2
Fe2S3+O2=Fe3O3+SO23Fe2S3 + 12O2 = 2Fe3O3 + 9SO2
FeBr3+ (NH4)2S=Fe2S3+ NH4Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6NH4Br
Fe2O3+HCl =2FeCl3+3H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3+3CO=Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2C2O4 = Fe(C2O4)3 + H2O +6HFe2O3 + 6H2C2O4 = 2Fe(C2O4)3 + 3H2O + 6H
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+AuPO3=Fe3(PO3)2+Au3Fe + 2AuPO3 = Fe3(PO3)2 + 2Au
Fe2O3+2Al = 2Fe+ Al2O22Fe2O3 + 6Al = 4Fe + 3Al2O2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + F2 = Fe3F6Fe + F2 = 2Fe3F
Fe + F = Fe3F3Fe + F = Fe3F
Fe + F = Fe3F3Fe + F = Fe3F
Fe+AuPO3=Fe3(PO3)2+Au3Fe + 2AuPO3 = Fe3(PO3)2 + 2Au
Fe+H2O= Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+HCl=FeCl3+H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)2 + Na2SO4=FeSO4 +NaOHFe(OH)2 + Na2SO4 = FeSO4 + 2NaOH
Fe(OH)2 + Na2SO4=FeSO4 +NaOHFe(OH)2 + Na2SO4 = FeSO4 + 2NaOH
FeCl2+H2SO4=FeSO4+HClFeCl2 + H2SO4 = FeSO4 + 2HCl
Fe(So4)+Pb(ClO)2=Fe(ClO)2+PbSo4Fe(So4) + Pb(ClO)2 = Fe(ClO)2 + PbSo4
Fe(s) +O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3+Mg=MgO+FeFe2O3 + 3Mg = 3MgO + 2Fe
FeCl2(aq) + (NH4)2CO3(aq)= FeCO3(s) + 2NH4Cl(aq)FeCl2(aq) + (NH4)2CO3(aq) = FeCO3(s) + 2NH4Cl(aq)
FeCl2(aq) + (NH4)2CO3(aq)= FeCO3(s) + 2NH4Cl(aq)FeCl2(aq) + (NH4)2CO3(aq) = FeCO3(s) + 2NH4Cl(aq)
Fe2S3 + O2 = Fe2O3 + SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe + Pb(NO3)2 = Pb + Fe(NO3)2Fe + Pb(NO3)2 = Pb + Fe(NO3)2
FeCl3 + NH3 + H2O = NH4Cl + Fe(OH)3 FeCl3 + 3NH3 + 3H2O = 3NH4Cl + Fe(OH)3
FeCl3+K3PO4=FePO4+KClFeCl3 + K3PO4 = FePO4 + 3KCl
FeCl3+K2CO3=Fe2(CO3)3+KCl2FeCl3 + 3K2CO3 = Fe2(CO3)3 + 6KCl
FeCl3+K3PO4=FePO4+KClFeCl3 + K3PO4 = FePO4 + 3KCl
FeCl3+K2CO3=Fe2(CO3)3+KCl2FeCl3 + 3K2CO3 = Fe2(CO3)3 + 6KCl
Fe(NO3)3 + NH3 + H2O = (NH4)NO3 + Fe(OH)28Fe(NO3)3 + 26NH3 + 19H2O = 25(NH4)NO3 + 8Fe(OH)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaNO3(aq)3Fe(NO3)2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaNO3(aq)
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq)Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe3+ +NO2- +H2O= Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2S3 + 2CS = 2Fe + CS2Fe2S3 + 3CS = 2Fe + 3CS2
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + 4H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 +Al= Al2O3 +FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O + H2O(l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O + 2H2O(l) + 2HCl(aq)
FeS2 + O2 = Fe2O3 + SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
FeS + 2HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
Fe + 2FeCl3 = FeCl2Fe + 2FeCl3 = 3FeCl2
FeS + HNO3 =Fe(NO3)3 + NO + S + H2OFeS + 4HNO3 = Fe(NO3)3 + NO + S + 2H2O
FeSO4 + K2Cr2O7 + H2SO4 = K2SO4 + Fe2(SO4)3 + Cr2(SO4)3 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = K2SO4 + 3Fe2(SO4)3 + Cr2(SO4)3 + 7H2O
Fe(NO3)3 + K3Fe(CN)6 = Fe(Fe(CN)6) + KNO3Fe(NO3)3 + K3Fe(CN)6 = Fe(Fe(CN)6) + 3KNO3
FeSO4 + K3Fe(CN)6 = Fe3(Fe(CN)6)2 +K2SO43FeSO4 + 2K3Fe(CN)6 = Fe3(Fe(CN)6)2 + 3K2SO4
Fe(NO3)3 + K4Fe(CN)6 = Fe4(Fe(CN)6)3 +KNO34Fe(NO3)3 + 3K4Fe(CN)6 = Fe4(Fe(CN)6)3 + 12KNO3
FeSO4 + K4Fe(CN)6 = Fe4(Fe(CN)6)2 + K2SO44FeSO4 + 2K4Fe(CN)6 = Fe4(Fe(CN)6)2 + 4K2SO4
Fe(OH)2 = FeO + H2OFe(OH)2 = FeO + H2O
FeSo4+H2So4+HNO3=Fe2(So4)3+H2O+NO6FeSo4 + 3H2So4 + 2HNO3 = 3Fe2(So4)3 + 4H2O + 2NO
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3(s)+H2S(g)=Fe2S3(s)+H2O(g)2Fe(OH)3(s) + 3H2S(g) = Fe2S3(s) + 6H2O(g)
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3 =Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe+NO3- + H+ = Fe+2 + NO + H2O3Fe + 2NO3- + 8H+ = 3Fe+2 + 2NO + 4H2O
Fe2O3 = Fe + O22Fe2O3 = 4Fe + 3O2
Fe+S8=Fe2S316Fe + 3S8 = 8Fe2S3
FeSO4+K2CO3=FeCO3+K2SO4FeSO4 + K2CO3 = FeCO3 + K2SO4
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4+HNO3+H2SO4=Fe(SO4)3+NO+H2O3FeSO4 + 4HNO3 + 6H2SO4 = 3Fe(SO4)3 + 4NO + 8H2O
Fe+++ + NO2- + H2O = Fe++ + H+ + NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
Fe2(SO4)3 + Sr(NO3)2 =Fe(NO3)3 + SrSO4Fe2(SO4)3 + 3Sr(NO3)2 = 2Fe(NO3)3 + 3SrSO4
Fe2O3 + H+ + e- = H2O + FeFe2O3 + 6H+ + 3e- = 3H2O + 2Fe
Fe+SO3=Fe2(SO3)32Fe + 3SO3 = Fe2(SO3)3
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2(SO4)3+BaCl2=BaSO4+FeCl3Fe2(SO4)3 + 3BaCl2 = 3BaSO4 + 2FeCl3
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe2+CuCl2=Cu+FeCl2Fe2 + 2CuCl2 = 2Cu + 2FeCl2
Fe+CuCl2=Cu+FeCl2Fe + CuCl2 = Cu + FeCl2
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2S3 + O2 = Fe2O3 + SO2 2Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 +H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 +H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3 + Zn (C2H3O2)2 = Fe (C2H3O2)2 + ZnCl3FeCl3 + Zn(C2H3O2)2 = Fe(C2H3O2)2 + ZnCl3
FeCl3 + Zn (C2H3O2)2 = Fe (C2H3O2)2 + ZnCl3FeCl3 + Zn(C2H3O2)2 = Fe(C2H3O2)2 + ZnCl3
FeCl3 + Zn (C2H3O2)2 = Fe (C2H3O2)2 + ZnCl3FeCl3 + Zn(C2H3O2)2 = Fe(C2H3O2)2 + ZnCl3
FeO + 2HNO3 = Fe(NO3)2 + H2OFeO + 2HNO3 = Fe(NO3)2 + H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3+ + H2 + OH- = Fe2+ + H2O-4Fe3+ + H2 + 2OH- = -6Fe2+ + 2H2O
Fe(OH)2 + H2O2 = Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
FeBr3(aq) + AgNO3(aq) = Fe(NO3)3(aq) + AgBr(s)FeBr3(aq) + 3AgNO3(aq) = Fe(NO3)3(aq) + 3AgBr(s)
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe(NO3)3+K2SO4=Fe2(SO4)3+KNO32Fe(NO3)3 + 3K2SO4 = Fe2(SO4)3 + 6KNO3
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s) + H2O(g)= Fe3O4(s) + H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe(s)+S8(s)=FeS(s)8Fe(s) + S8(s) = 8FeS(s)
Fe + Cl2 = FeCl2Fe + Cl2 = 2FeCl
Fe + Cl2 = FeCl2Fe + Cl2 = 2FeCl
Fe2(SO4)3+NH3+H2O = Fe(OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe + HC2H3O2 =Fe(C2H3O2)3 + H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
FeCl3 + MgO =Fe2O3 + MgCl22FeCl3 + 3MgO = Fe2O3 + 3MgCl2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3 + H2S = FeS + H2O + S88Fe2O3 + 24H2S = 16FeS + 24H2O + S8
Fe3O4 + HNO3 = Fe(NO3)3 + N2O5 + H2O0Fe3O4 + 2HNO3 = 0Fe(NO3)3 + N2O5 + H2O
Fe3O4 + HNO3 = Fe(NO3)3 + NH3 +H2O8Fe3O4 + 73HNO3 = 24Fe(NO3)3 + NH3 + 35H2O
Fe3O4 + HNO3 = Fe(NO3)3 + NH3 +H2012Fe3O4 + 92HNO3 = 36Fe(NO3)3 - 16NH3 + 7H20
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(CO3)3+H2SO4=Fe2(SO4)3+H2O+CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3+Na2CO3=Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2(SO4)+KMnO4+H2SO4=KHSO4+MnSO4+Fe2(SO4)3+H2O5Fe2(SO4) + 4KMnO4 + 18H2SO4 = 4KHSO4 + 4MnSO4 + 5Fe2(SO4)3 + 16H2O
Fe2SO4+KMnO4+H2SO4=KHSO4+MnSO4+Fe2(SO4)3+H2O5Fe2SO4 + 4KMnO4 + 18H2SO4 = 4KHSO4 + 4MnSO4 + 5Fe2(SO4)3 + 16H2O
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
FeS+HCl=H2S+FeCl2FeS + 2HCl = H2S + FeCl2
Fe3(PO4)2+Li2S = Li3PO4+FeSFe3(PO4)2 + 3Li2S = 2Li3PO4 + 3FeS
Fe + Br2 = Fe3+ + Br-6Fe + Br2 = 2Fe3+ + 2Br-
Fe(OH)3(s) + H2S(g) = Fe2S3(s) + H2O(g)2Fe(OH)3(s) + 3H2S(g) = Fe2S3(s) + 6H2O(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+C=Fe3C3Fe + C = Fe3C
Fe+C=FeCFe + C = FeC
FeSO4 + KMnO4 + KOH = K2MnO4 + Fe(OH)3 + K2SO4FeSO4 + KMnO4 + 3KOH = K2MnO4 + Fe(OH)3 + K2SO4
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
F + Br2 = Br- + F22F + 0Br2 = 0Br- + F2
Fe2SiO4 + 5Mg2SiO4 + 9H2O= 3MgSiO4 + Mg(OH)2 + 2Fe(OH)2Fe2SiO4 - Mg2SiO4 + 0H2O = 0MgSiO4 - 2Mg(OH)2 + 2Fe(OH)2
FeO + Mg = Fe + MgOFeO + Mg = Fe + MgO
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O = Fe2O3+H2Fe + 3H2O = Fe2O3 + 6H
Fe2(SO4)3+KOH = K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO= FeO+CO2Fe2O3 + CO = 2FeO + CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3+ + NO2- + H2O=Fe2+ + H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2O3 + 3 CO = 3 FeO2 + 2CFe2O3 + CO = 2FeO2 + C
Fe2O3 + 3 CO = 2 Fe + 3 C2O-1Fe2O3 + 6CO = -2Fe + 3C2O
Fe2(SO4)3+BaCl2 = BaSO4+FeCl3Fe2(SO4)3 + 3BaCl2 = 3BaSO4 + 2FeCl3
Fe(NO3)3 + LiOH = Fe(OH) + Li(NO3)3Fe(NO3)3 + LiOH = Fe(OH) + Li(NO3)3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2+H2O = Fe2O3H2O4Fe + 3O2 + 2H2O = 2Fe2O3H2O
Fe3+ + NO2- +H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3O4(s)+H2(g)=Fe(s)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fr(s)+F2(g)= FrF(s)2Fr(s) + F2(g) = 2FrF(s)
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + S = Fe2S32Fe + 3S = Fe2S3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2S3 + SO2-2FeS + O2 = -1Fe2S3 + SO2
Fe3+ + H2NOH = N2O + H2O + H+ + Fe2+8Fe3+ - 2H2NOH = -1N2O - H2O - 4H+ + 12Fe2+
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+CN=Fe(CN)6+SFeS + 6CN = Fe(CN)6 + S
FeS+CN=Fe(CN)4+SFeS + 4CN = Fe(CN)4 + S
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe2 + O2 = 2FeOFe2 + O2 = 2FeO
Fe(OH)3+H3O=H2O+FeFe(OH)3 + 3H3O = 6H2O + Fe
FeOH3+H3O=H2O+FeFeOH3 - H3O = 0H2O + Fe
Fe3++NO2-+H2O=Fe2++H++NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+3H=2Fe+3H2OFe2O3 + 6H = 2Fe + 3H2O
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3 + NH4OH =Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3 + HCl = FeCl3 + H2O Fe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 + HCl = FeCl3 + H2O Fe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe CrO4 + Na CO3 + O2 = Na2CrO4 + Fe2O3 + CO24FeCrO4 + 8NaCO3 - O2 = 4Na2CrO4 + 2Fe2O3 + 8CO2
Fe2(SO3)3 + HClO4 = Fe(ClO4)3 + SO2 + H2OFe2(SO3)3 + 6HClO4 = 2Fe(ClO4)3 + 3SO2 + 3H2O
FeCl3 + NaOH = NaCl + Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeSO4 + O2 + H2O = FeOOH + H2SO44FeSO4 + O2 + 6H2O = 4FeOOH + 4H2SO4
FeSO4 + O2 + H2O = FeOHSO4 4FeSO4 + O2 + 2H2O = 4FeOHSO4
FeSO4 + H2SO4 + KMnO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 8H2SO4 + 2KMnO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
FeSO4 + H2SO4 + KMnO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 8H2SO4 + 2KMnO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
FeO(s) + O3(g) = Fe2O3(s)6FeO(s) + O3(g) = 3Fe2O3(s)
Fe(s)+O2(g)+H2O=Fe(OH)2 (aq)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(aq)
Fe3+ + NO2- + H2O = Fe2+ + H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe + H2O = Fe3O4 +H23Fe + 4H2O = Fe3O4 + 4H2
Fe3O4+KMnO4+H2SO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10Fe3O4 + 2KMnO4 + 48H2SO4 = 15Fe2(SO4)3 + K2SO4 + 2MnSO4 + 48H2O
FeCl3 + H3PO4 = Fe3PO4 + HCl33FeCl3 + H3PO4 = Fe3PO4 + 3HCl3
Fe(s) + S8(s) = FeS(s)8Fe(s) + S8(s) = 8FeS(s)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS2 + O2 = Fe2O3 + SO44FeS2 + 19O2 = 2Fe2O3 + 8SO4
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(OH)3 (s) + HNO3 (aq) = Fe(NO3)3 (aq) + H2O (l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
FeS(s) + HCl(aq)=FeCl2(aq) + H2S( g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3+Na(OH)=Fe(OH)3+NaClFeCl3 + 3Na(OH) = Fe(OH)3 + 3NaCl
FeSO4(aq)+Ba(OH)2(aq)=Fe(OH)2(s)+BaSO4(aq)FeSO4(aq) + Ba(OH)2(aq) = Fe(OH)2(s) + BaSO4(aq)
FeSO4(aq)+Ba(OH)2(aq)=Fe(OH)2(s)+BaSO4(aq)FeSO4(aq) + Ba(OH)2(aq) = Fe(OH)2(s) + BaSO4(aq)
Fe + H Br = Fe Br3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe(s) + CuSO4(aq) = FeSO4(aq) + Cu(s)Fe(s) + CuSO4(aq) = FeSO4(aq) + Cu(s)
FeCl3(aq) + KOH(aq) = Fe(OH)3(s) + KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(s) + 3KCl(aq)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HCl=H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + HNO3 = Fe2O3 + NO2 + H2O2Fe + 6HNO3 = Fe2O3 + 6NO2 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+HBr = Fe3Br+H26Fe + 2HBr = 2Fe3Br + H2
Fe + HgSO4 = FeSO4 +HgFe + HgSO4 = FeSO4 + Hg
Fe2 + F2 = FeF3Fe2 + 3F2 = 2FeF3
Fe + Cd(NO3)2 = Fe(NO3)3 +Cd 2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe2(CO3)3 = Fe2O3 +CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2SO4=Fe2(SO4)3+SO2+H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+AgC2H3O2=Ag+Fe(C2H3O2)2Fe + 2AgC2H3O2 = 2Ag + Fe(C2H3O2)2
Fe2O3 = O2 + Fe2Fe2O3 = 3O2 + 4Fe
Fe(s) + H2 O(l) = Fe3 O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe + 3O2 +2H2O = 2Fe2O3H2O4Fe + 3O2 + 2H2O = 2Fe2O3H2O
Fe3O4(s)+Al(s)=Fe(s)+Al2O3(s)3Fe3O4(s) + 8Al(s) = 9Fe(s) + 4Al2O3(s)
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
FeOH2O+O2+H2O=Fe2O3*3H2O4FeOH2O + O2 + 2H2O = 2Fe2O3*3H2O
F2+NaOH=O2+NaF+H2O2F2 + 4NaOH = O2 + 4NaF + 2H2O
FeBr3 + CuSO4 = FeSO4 + CuBr3FeBr3 + CuSO4 = FeSO4 + CuBr3
FeBr3 + CuSO4 = 3FeSO4 + CuBr3FeBr3 + CuSO4 = FeSO4 + CuBr3
Fe2O3+HBr=FeBr3+HOHFe2O3 + 6HBr = 2FeBr3 + 3HOH
Fe+HNO3=Fe(NO3)3+NO2+H2OFe + 6HNO3 = Fe(NO3)3 + 3NO2 + 3H2O
Fe+H2SO4=Fe2(SO4)3+SO2+4H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe+H2SO4=Fe2(SO4)3+SO2+4H22Fe + 3H2SO4 = Fe2(SO4)3 + 0SO2 + 3H2
Fe+H2SO4=Fe(SO4)3+SO2+4H2OFe + 6H2SO4 = Fe(SO4)3 + 3SO2 + 6H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + Cu(NO3)2 = Cu + Fe(NO3)32Fe + 3Cu(NO3)2 = 3Cu + 2Fe(NO3)3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS2 + O2= Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnO2 + H2O6FeSO4 + 2KMnO4 + 4H2SO4 = 3Fe2(SO4)3 + K2SO4 + 2MnO2 + 4H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + KMnO2 + H2O4FeSO4 + KMnO4 + 2H2SO4 = 2Fe2(SO4)3 + KMnO2 + 2H2O
FeCl2+K2Cr2O7+HCl=FeCl3+CrCl3+KCl+H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2CrCl3 + 2KCl + 7H2O
Fe + FeCl3 = FeCl30Fe + FeCl3 = FeCl3
Fe + FeCl3 = FeCl30Fe + FeCl3 = FeCl3
Fe(s) + S8(s) = FeS(s)8Fe(s) + S8(s) = 8FeS(s)
FeCl2 + KNO3 + HCl = FeCl3 + NO + H2O + KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
FeO + C = Fe + CO2 =2FeO + C = 2Fe + CO2
FeO2 + C = Fe + CO2 =FeO2 + C = Fe + CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+3C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2+ + MnO4- +H+ = Fe3+ + Mn2+ + H2O-39Fe2+ + 2MnO4- + 16H+ = -26Fe3+ + Mn2+ + 8H2O
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(NO3)3 + 3 NH4OH = Fe(OH)3 + 3 NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
FeCl2 + 4HNO3 = Fe(NO3)3 + NO2 + 2HCl + H2OFeCl2 + 4HNO3 = Fe(NO3)3 + NO2 + 2HCl + H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCrO4+K2CO3+O2=Fe2O3+K2CrO4+CO24FeCrO4 + 4K2CO3 + O2 = 2Fe2O3 + 4K2CrO4 + 4CO2
Fe+SO3=FeSO3Fe + SO3 = FeSO3
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe3O4 + Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe + H2O = H2 + Fe3O43Fe + 4H2O = 4H2 + Fe3O4
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+H2(g)= Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4(aq)+ Ca(OH)2(aq)=Fe(OH)2+CaSO4FeSO4(aq) + Ca(OH)2(aq) = Fe(OH)2 + CaSO4
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe(OH)2 + O2 = Fe2O3 + H2O4Fe(OH)2 + O2 = 2Fe2O3 + 4H2O
Fe(OH)2 + O2 = FeO3 + H2OFe(OH)2 + O2 = FeO3 + H2O
Fe(OH)2 + O2 = FeO3 + H2OFe(OH)2 + O2 = FeO3 + H2O
Fe(OH)2 + O2 = 2FeO3 + 4H2OFe(OH)2 + O2 = FeO3 + H2O
Fe2(CO3)3 (s) + HCl (aq) = FeCl3 (aq) + H2O (l) + CO2 (g)Fe2(CO3)3(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2O(l) + 3CO2(g)
Fe(s) + HCl(aq) = FeCl2(aq) + H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
Fe(s) + HCl(aq) = FeCl2(aq) + H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
FeCl3 + Na2CO3=Fe3+(CO3)2 + NaCl12FeCl3 + 18Na2CO3 = 4Fe3 + 9(CO3)2 + 36NaCl
FeCl2(aq) + K2SO3(aq) = FeSO3(s) + KCl(aq) FeCl2(aq) + K2SO3(aq) = FeSO3(s) + 2KCl(aq)
Fe2O3+CO= CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3+NH4NO3=Fe(NO3)3+3NH4ClFeCl3 + 3NH4NO3 = Fe(NO3)3 + 3NH4Cl
Fe + Cu++=Fe++Cu2Fe + Cu++ = 2Fe+ + Cu
Fe + Cu++=Fe+++CuFe + Cu++ = Fe++ + Cu
Fe2O3+CO=Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
FeCl3+NH4OH=FeOH+NH4Cl3FeCl3 + NH4OH = FeOH + NH4Cl3
Fe(s) +S(s)=FeS(s)Fe(s) + S(s) = FeS(s)
Fe(s) +S(s)=FeS(s)Fe(s) + S(s) = FeS(s)
Fe3++NO2-+H2O=Fe2++H++NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3++NO2-+H2O=Fe2++H++NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3+CO=Fe=CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS+O2=SO2+Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
FeBr2+K2S=FeS+2KBrFeBr2 + K2S = FeS + 2KBr
FeS+O2=SO2+Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.