Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeCr2O7 + K2CO3 + O2 = K2Cr2O4 + Fe2O3 + CO24FeCr2O7 + 4K2CO3 - 5O2 = 4K2Cr2O4 + 2Fe2O3 + 4CO2
Fe2(SO4)3 + BaCl2 = FeCl3 + BaSO4Fe2(SO4)3 + 3BaCl2 = 2FeCl3 + 3BaSO4
Fe +O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=FeO2+SO2FeS2 + 3O2 = FeO2 + 2SO2
Fe + O2 + H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(NO3)3 + NH4Cl = FeCl3 + NO3NH4Fe(NO3)3 + 3NH4Cl = FeCl3 + 3NO3NH4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 +HNO3 = Fe(NO3)3 +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS2 + H2O2 = Fe3+ + SO42- + H2O + H+6FeS2 + 499H2O2 = 2Fe3+ + 12SO42- + 494H2O + 10H+
FeS2 + H2O2 = Fe3(aq)+ + SO42- + H2O + H+6FeS2 + 499H2O2 = 2Fe3(aq)+ + 12SO42- + 494H2O + 10H+
FeS2 + H2O2 = Fe3+ + SO42- + H2O + H+6FeS2 + 499H2O2 = 2Fe3+ + 12SO42- + 494H2O + 10H+
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(SO) + NaOH = NaSO + Fe(OH)Fe(SO) + NaOH = NaSO + Fe(OH)
Fe + O = FeOFe + O = FeO
Fe2S3 + H2O + O2 =Fe(OH)3 + S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
FeS2 + O2 = FeO + SO2 2FeS2 + 5O2 = 2FeO + 4SO2
Fe2S3 + H2O + O2 = Fe(OH)3 + S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeCl3 + KMnO4 + HCl = KCl + MnCl2 + H2O + FeCl3FeCl3 + 0KMnO4 + 0HCl = 0KCl + 0MnCl2 + 0H2O + FeCl3
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(NO3)3+ 3KI = K(NO3) + Fe(NO3) + IFe(NO3)3 + 2KI = 2K(NO3) + Fe(NO3) + 2I
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+HNO3=Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO0Fe2O3 + CO = 0Fe + CO
Fe(s) + S(s) = Fe2S3(s)2Fe(s) + 3S(s) = Fe2S3(s)
FeOOH + H = Fe3 + H2O3FeOOH + 9H = Fe3 + 6H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O3 = Fe2O32Fe + O3 = Fe2O3
Fe + NaBr = FeBr3 + NaFe + 3NaBr = FeBr3 + 3Na
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe + ClO3 = Fe2O3 + Cl2 4Fe + 2ClO3 = 2Fe2O3 + Cl2
Fe + H2O + O2 = Fe(OH)34Fe + 6H2O + 3O2 = 4Fe(OH)3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS + H2SO4 = FeSO4 + H2S FeS + H2SO4 = FeSO4 + H2S
Fe + CuSO4 = FeSO4 + Cu Fe + CuSO4 = FeSO4 + Cu
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 = Fe 2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 + H2O = Fe(OH2)Fe + 0O2 + H2O = Fe(OH2)
Fe(OH) 3 (s)+H 2 SO 4 (aq)=Fe 2 (SO 4 ) 3 (aq)+H 2 O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(CH3COO)3 + MgCr2O4 = Mg(CH3COO)2 + Fe2(Cr2O4)32Fe(CH3COO)3 + 3MgCr2O4 = 3Mg(CH3COO)2 + Fe2(Cr2O4)3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
FeSO4 + KClO3 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cl2 + H2O10FeSO4 + 2KClO3 + 6H2SO4 = 5Fe2(SO4)3 + K2SO4 + Cl2 + 6H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s) + C(s) = Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe + H2O = Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2 + Al2O3 = AlF3 + O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS2 + O2 =Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+OH=2Fe(OH)3Fe + 3OH = Fe(OH)3
FeO+CO=Fe+CO2FeO + CO = Fe + CO2
Fe2O3 + Cl2 + KOH = K2FeO4 + KCl + H2OFe2O3 + 3Cl2 + 10KOH = 2K2FeO4 + 6KCl + 5H2O
F2 + 2NaOH = OF2 + 2NaF + H2O2F2 + 2NaOH = OF2 + 2NaF + H2O
Fe + O2 + H2O = Fe(OH2)Fe + 0O2 + H2O = Fe(OH2)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + H2(g) = 3FeO(s) + H2O(g)Fe3O4 + H2(g) = 3FeO(s) + H2O(g)
Fe3O4 + H2(g) = 3FeO(s) + HO(g)2Fe3O4 + H2(g) = 6FeO(s) + 2HO(g)
Fe3O4 + H(g) = 3FeO(s) + HO(g)Fe3O4 + H(g) = 3FeO(s) + HO(g)
Fe3O4 + H2(g) = 3FeO(s) + HO(g)2Fe3O4 + H2(g) = 6FeO(s) + 2HO(g)
Fe3O4 + H2(g) = 3FeO(s) + H2O(g)Fe3O4 + H2(g) = 3FeO(s) + H2O(g)
Fe3O4 + H(g) = 3FeO(s) + H2O(g)Fe3O4 + 2H(g) = 3FeO(s) + H2O(g)
Fe3O4 + H5(g) = 3FeO(s) + H2O(g)5Fe3O4 + 2H5(g) = 15FeO(s) + 5H2O(g)
Fe3O4 + H2 = 3FeO(s) + H2O(g)Fe3O4 + H2 = 3FeO(s) + H2O(g)
Fe3O4 + H2 = 3FeO(s) + H2O(g)Fe3O4 + H2 = 3FeO(s) + H2O(g)
Fe3O4 = 3FeO(s) + O(g)Fe3O4 = 3FeO(s) + O(g)
Fe3O4 + H2(g) = 3FeO(s) + H2O(g)Fe3O4 + H2(g) = 3FeO(s) + H2O(g)
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
Fe2O3 + HCl = FeCl3 +H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2(SO4)3(g) + KSCN(g) = K3Fe(SCN)6(g) + K2SO4(s)Fe2(SO4)3(g) + 12KSCN(g) = 2K3Fe(SCN)6(g) + 3K2SO4(s)
Fe(NO3) + Zn = Zn(NO3) + FeFe(NO3) + Zn = Zn(NO3) + Fe
Fe(NO3) + Zn = Zn(NO3) + FeFe(NO3) + Zn = Zn(NO3) + Fe
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeO(s)+C(s)=Fe(s)+CO(g)FeO(s) + C(s) = Fe(s) + CO(g)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(CO3)3+H2SO4=Fe2(SO4)3+H2O+CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
FeCl3+Na2CO3=Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe + O2= Fe3 O43Fe + 2O2 = Fe3O4
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + 2H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
FeSO4+ H2O=Fe +SO3- +H2O0FeSO4 + H2O = 0Fe + 0SO3- + H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3 O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+H2SO4=18H2O+Fe2(SO4)32Fe(OH)3 + 3H2SO4 = 6H2O + Fe2(SO4)3
Fe(NO3)3+ KSCN =Fe(SCN)3+KNO3Fe(NO3)3 + 3KSCN = Fe(SCN)3 + 3KNO3
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe2O3+ HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3+ HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeO +C +Cl2 =FeCl3+ CO22FeO + C + 3Cl2 = 2FeCl3 + CO2
FeO +C +Cl2 =FeCl2+ CO22FeO + C + 2Cl2 = 2FeCl2 + CO2
FeO +C +Cl2 =FeCl+ CO22FeO + C + Cl2 = 2FeCl + CO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)3+HSO4=Fe(SO4)3+H2OFe(OH)3 + 3HSO4 = Fe(SO4)3 + 3H2O
Fe2(SO4)3 + O2 = Fe2O3 +SO3Fe2(SO4)3 + 0O2 = Fe2O3 + 3SO3
Fe2(SO4)3 + O2 = Fe2O3 +SO3Fe2(SO4)3 + 0O2 = Fe2O3 + 3SO3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+Zn=ZnO+FeFe2O3 + 3Zn = 3ZnO + 2Fe
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2 O-2 + Fe3 O-2= Fe O+ Fe2 O3Fe2O-2 - Fe3O-2 = -3FeO + Fe2O3
FeS2 + H2SO4 + H2O = H2S + FeSO44FeS2 + 3H2SO4 + 4H2O = 7H2S + 4FeSO4
Fe + O = Fe2O32Fe + 3O = Fe2O3
Fe(OH)3+2HNO3 = Fe(NO3)3+2H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+3CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FES+HCl=FECl2+H2SFES + 2HCl = FECl2 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2(SO4)3+Ba(NO3)2=Fe(NO3)3+BaSO4Fe2(SO4)3 + 3Ba(NO3)2 = 2Fe(NO3)3 + 3BaSO4
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
Fe2(SO4)3 + H2O + SO2 = Fe2SO4 + H2SO4Fe2(SO4)3 + 4H2O + 2SO2 = Fe2SO4 + 4H2SO4
Fe2(SO4)3 + H20 + SO2 = Fe2SO4 + H2SO45Fe2(SO4)3 + H20 + 0SO2 = 5Fe2SO4 + 10H2SO4
Fe3O4 + HBr = FeBr2 + FeBr3 + H2OFe3O4 + 8HBr = FeBr2 + 2FeBr3 + 4H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O=2FeOFe + O = FeO
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O4 + H = Fe2O3 + H2O-2Fe3O4 + 2H = -3Fe2O3 + H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HCl = HFe + ClSFeS + HCl = HFe + ClS
FeS + HCl = HFe + ClSFeS + HCl = HFe + ClS
FeS + HCl = FeH + SClFeS + HCl = FeH + SCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl2+K2Cr2O7+HCl=KCl+FeCl3+CrCl3+H2O6FeCl2 + K2Cr2O7 + 14HCl = 2KCl + 6FeCl3 + 2CrCl3 + 7H2O
FeCr2O7 + K2CO3 + O2 = K2CrO4 + Fe2O3 + CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe + NaOH = Na + FeOHFe + NaOH = Na + FeOH
Fe + NaOH = Na + FeOHFe + NaOH = Na + FeOH
Fe+H2SO4=Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K10Fe4(C2O4)11*2H2O + (NH4)2SO4 + H2SO4 + H2O4Fe(NH4)2(SO4)2*6H2O + 6H2C2O4 + 5K2C2O4 + 2H2O2 = K10Fe4(C2O4)11*2H2O + 4(NH4)2SO4 + 4H2SO4 + 26H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 +CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe++ + MnO4- + H+ = Fe+++ + Mn++ + H2O5Fe++ + MnO4- + 8H+ = 5Fe+++ + Mn++ + 4H2O
Fe(s)+O2(g)+H2O(l) = Fe(OH)2(aq) 2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K2Fe(C2O4)3*14H2O + (NH4)2SO4 + H2SO4 + H2O-1Fe(NH4)2(SO4)2*6H2O - 2H2C2O4 - K2C2O4 - H2O2 = -1K2Fe(C2O4)3*14H2O - (NH4)2SO4 - H2SO4 + 6H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe + FeCl3 = FeCl2Fe + 2FeCl3 = 3FeCl2
Fe2 + H3PO4 = FePO4 + H2Fe2 + 2H3PO4 = 2FePO4 + 3H2
Fe + H3PO4 = FePO4 + H22Fe + 2H3PO4 = 2FePO4 + 3H2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4+ NaOH=Fe (OH) 2+Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
FeSO4+ NaOH=Fe (OH) 2+Na2SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2SO4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeO + HCl = FeCl2 + H2OFeO + 2HCl = FeCl2 + H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s) + O2(g) + H2O(l) = Fe2O3(s) + H2SO4(aq)4FeS(s) + 9O2(g) + 4H2O(l) = 2Fe2O3(s) + 4H2SO4(aq)
FeS + Na2O2 = Fe2O3 + Na2SO3 + Na2O2FeS + 7Na2O2 = Fe2O3 + 2Na2SO3 + 5Na2O
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCO3 (s) + H2CO3 (aq) = Fe(HCO3)2 (aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
FeO + NaOH + ClO2 + H2O = Fe(OH)3 + NaCl5FeO + NaOH + ClO2 + 7H2O = 5Fe(OH)3 + NaCl
FeSO4+KMnO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
Fe+NaBr=FeBr3+NaFe + 3NaBr = FeBr3 + 3Na
Fe+NaBr=FeBr3+NaFe + 3NaBr = FeBr3 + 3Na
FeS2+O2 = FeO+SO22FeS2 + 5O2 = 2FeO + 4SO2
Fe+H2SO4 = FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe3O3 + CO = Fe + CO2Fe3O3 + 3CO = 3Fe + 3CO2
Fe(s) +O2(g) +H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3+Ca=Fe+Ca2OFe2O3 + 6Ca = 2Fe + 3Ca2O
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3 + Na2CO3 =Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO + C = CO + FeFeO + C = CO + Fe
Fe2(SO4)3+NH3+H2O=Fe(OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl3*6H2O + 3NaOH = Fe(OH)3 + 3NaCl +6H2OFeCl3*6H2O + 3NaOH = Fe(OH)3 + 3NaCl + 6H2O
FeCl3*6H2O + 3NaOH = Fe(OH)3 + 3NaCl +6H2OFeCl3*6H2O + 3NaOH = Fe(OH)3 + 3NaCl + 6H2O
FeCl3 + 3NaOH = Fe(OH)3 + 3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+H2SO4=Fe (SO4) 3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + 3NaOH = Fe(OH)3 + 3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + Ag(NO3) = Fe(NO3)3 + AgClFeCl3 + 3Ag(NO3) = Fe(NO3)3 + 3AgCl
Fe (s) + H2O (g) = Fe3O4(s) +H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeSO4 + (NH4)2S = FeS + (NH4)2SO4FeSO4 + (NH4)2S = FeS + (NH4)2SO4
Fe(HCO3)3 + H3PO4 = FePO4 + CO2 + H2OFe(HCO3)3 + H3PO4 = FePO4 + 3CO2 + 3H2O
Fe + CuCl2 = FeCl2 + CuFe + CuCl2 = FeCl2 + Cu
Fe(OH)3 + H3PO4 = FePO4 + H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3 =Fe2O3 +H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)2 + HCl = Fe + H2O + HCl0Fe(OH)2 + HCl = 0Fe + 0H2O + HCl
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)2+C2O2(OH)2=Fe+ 2(H2O)+ 2(CO2)Fe(OH)2 + C2O2(OH)2 = Fe + 2(H2O) + 2(CO2)
Fe(OH)2+C2O2(OH)2=Fe+ 2(H2O)+ 2(CO2)Fe(OH)2 + C2O2(OH)2 = Fe + 2(H2O) + 2(CO2)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)2+C2O2(OH)2=Fe+ 2(H2O)+ 2(CO2)Fe(OH)2 + C2O2(OH)2 = Fe + 2(H2O) + 2(CO2)
Fe(OH)2+C2O2(OH)2=Fe+ 2(H2O)+ 2(CO2)Fe(OH)2 + C2O2(OH)2 = Fe + 2(H2O) + 2(CO2)
Fe(OH)2+HCl=Fe+H2O+HCl0Fe(OH)2 + HCl = 0Fe + 0H2O + HCl
FeCl3 + KI =KCl + FeI3FeCl3 + 3KI = 3KCl + FeI3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + CO2 + H2OFe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3CO2 + 3H2O
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeO+SiO2=FeSiO3FeO + SiO2 = FeSiO3
FeS2 + O2 +H2O = Fe(OH)3 + H2SO44FeS2 + 15O2 + 14H2O = 4Fe(OH)3 + 8H2SO4
Fe(NO3)2 + Na3PO4 = FePO4 + Na3(NO3)2Fe(NO3)2 + Na3PO4 = FePO4 + Na3(NO3)2
Fe2(CO3)3 + Ca(OH)2 =Fe(OH)3 + CaCO3Fe2(CO3)3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCO3
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2(s) + O2(g) + H2O(l) = Fe(OH)3(s) + 2 H2SO4(aq)4FeS2(s) + 15O2(g) + 14H2O(l) = 4Fe(OH)3(s) + 8H2SO4(aq)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(CO3)3+HI=FeI3+CO2+H2OFe2(CO3)3 + 6HI = 2FeI3 + 3CO2 + 3H2O
Fe(NO3)3 + Na2CO3 = Fe2(CO3)3+ NaNO32Fe(NO3)3 + 3Na2CO3 = Fe2(CO3)3 + 6NaNO3
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe(OH)3 + O2 = Fe2O3 + H2O2Fe(OH)3 + 0O2 = Fe2O3 + 3H2O
FeCl3 + K2Cr2O7 = KCl + Fe2(Cr2O7)32FeCl3 + 3K2Cr2O7 = 6KCl + Fe2(Cr2O7)3
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe2(CO3)3 + Ca(OH)2 = Fe(OH)3 + CaCO3Fe2(CO3)3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCO3
Fe2(CO3)3 + Ca(OH)2 =Fe(OH)3 + CaCO3 Fe2(CO3)3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCO3
Fe+H2O=Fe3 O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
Fe(OH)3 + O2 = Fe2O3 + H2O2Fe(OH)3 + 0O2 = Fe2O3 + 3H2O
Fe2(CO3)3 + Ca(OH)2 = Fe(OH)3 + CaCO3Fe2(CO3)3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCO3
Fe(NO3)3 + Ag2SO4 =Fe2(SO4)3 + AgNO32Fe(NO3)3 + 3Ag2SO4 = Fe2(SO4)3 + 6AgNO3
Fe+H2SO4=H2+Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe(NO3)3 + Ag2SO4 = Fe2(SO4)3 + AgNO32Fe(NO3)3 + 3Ag2SO4 = Fe2(SO4)3 + 6AgNO3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+CI2=FeCI2Fe + CI2 = FeCI2
Fe2O3+SnO2 = Fe+SnO3Fe2O3 + 3SnO2 = 2Fe + 3SnO3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3 + 3 C7H6O3 = Fe(C7H6O3)3 + Cl3FeCl3 + 3C7H6O3 = Fe(C7H6O3)3 + Cl3
FeCl3 + 3 C7H6O3 = 4Fe + 12HCl + 14C + 3O24FeCl3 + 2C7H6O3 = 4Fe + 12HCl + 14C + 3O2
FeCl3 + 3 C7H6O3 = Fe(C7H6O3)3 + Cl3FeCl3 + 3C7H6O3 = Fe(C7H6O3)3 + Cl3
FeS2 + O2 = Fe2O3 + SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeS2+O2 = Fe2O3+SO4FeS2 + 7O2 = 2Fe2O3 + 8SO
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = FeO4 + H2Fe + 4H2O = FeO4 + 4H2
Fe+H2SO4 = Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 + Cl2 + KOH = K2FeO4 + KCl + H2OFe2O3 + 3Cl2 + 10KOH = 2K2FeO4 + 6KCl + 5H2O
Fe2O3+ H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O = Fe2O3 + SO22FeS2 + 11O = Fe2O3 + 4SO2
Fe(OH)3 + CaI2 = FeI3 + Ca(OH)22Fe(OH)3 + 3CaI2 = 2FeI3 + 3Ca(OH)2
Fe3+ + Sn2+ = Fe2+ + Sn4+2Fe3+ + 2Sn2+ = 3Fe2+ + Sn4+
Fe(s) + HC2H3O2(aq) = Fe(C2H3O2)3(aq) + H2(g) 2Fe(s) + 6HC2H3O2(aq) = 2Fe(C2H3O2)3(aq) + 3H2(g)
Fe + H2CO3 = Fe2 (CO3)3 + H22Fe + 3H2CO3 = Fe2(CO3)3 + 3H2
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+HNO3 = Fe(NO3)3 + NO +H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe+HNO3 = Fe(NO3)3 + NO +H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
FeCl2 + NaBr = NaCl + FeBr2FeCl2 + 2NaBr = 2NaCl + FeBr2
FeCl3 + Na2CO3=Fe2(CO3)3 + NaCl 2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe(OH)3(s) + H2SO4(aq)= Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
FeS + O2 = FeO3 + SO22FeS + 5O2 = 2FeO3 + 2SO2
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CuCl2=FeCl3+Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl2 + KMnO4 +HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2PO4=Fe(H2PO4)3Fe + 3H2PO4 = Fe(H2PO4)3
Fe(OH) = FeO + H2020Fe(OH) = 20FeO + H20
FeCl+NH4S=FeS+NH4ClFeCl + NH4S = FeS + NH4Cl
F+Al3=AlF39F + Al3 = 3AlF3
FeCl3 + C2H3NaO2 = NaCl3 + Fe + C2 + H3 + O2FeCl3 + C2H3NaO2 = NaCl3 + Fe + C2 + H3 + O2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O22Fe + O2 = Fe2O2
FeS2+O2=SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
FePO4=FePO3+O22FePO4 = 2FePO3 + O2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO4 + H+= SO2 + H2O + Fe+++2Fe + 3H2SO4 + 6H+ = 3SO2 + 6H2O + 2Fe+++
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2 O3 + H2 SO4 = Fe2 (SO4)3 + H2 OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe + O2 =FeO2Fe + O2 = 2FeO
Fe(s)+ZnCl2(aq) = Zn(s) + FeCl2(aq)Fe(s) + ZnCl2(aq) = Zn(s) + FeCl2(aq)
Fe(s)+ZnCl2(aq) = Zn(s) + FeCl2(aq)Fe(s) + ZnCl2(aq) = Zn(s) + FeCl2(aq)
Fe(s)+ZnCl2(aq) = Zn(s) + FeCl2(aq)Fe(s) + ZnCl2(aq) = Zn(s) + FeCl2(aq)
Fe(OH)3+HMnO4=Fe(MnO4)3+H2OFe(OH)3 + 3HMnO4 = Fe(MnO4)3 + 3H2O
Fe2(CO3)3 + Cu = FeCO3 + CuCO3Fe2(CO3)3 + Cu = 2FeCO3 + CuCO3
Fe (s) + O2 (g) + H2O (l) = Fe (OH) 2 (aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO+CO =Fe+CO2FeO + CO = Fe + CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+++ + e2S = FeS + S2Fe+++ + 3e2S = 2FeS + S
Fe + HCL = FeCL + H22Fe + 2HCL = 2FeCL + H2
Fe + H2O = Fe2 O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe+HCl = FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeCl3=Fe+Cl3FeCl3 = Fe + Cl3
FeCl3=Fe+Cl3FeCl3 = Fe + Cl3
Fe + O2 = Fe2 O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2 O34Fe + 3O2 = 2Fe2O3
Fe + H2 S = Fe2 S3 + H22Fe + 3H2S = Fe2S3 + 3H2
Fe + H S = Fe S + HFe + HS = FeS + H
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe3O4 + CO = FeO +CO2Fe3O4 + CO = 3FeO + CO2
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
FeS2+ O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe(NO3)2+ Cl2 = FeCl3 + Fe(NO3)36Fe(NO3)2 + 3Cl2 = 2FeCl3 + 4Fe(NO3)3
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe+ O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe+ Cd2+ = Fe2+ + Cd(s)2Fe + Cd2+ = Fe2+ + 2Cd(s)
Fe+ Cd2+ = Fe2+ + Cd(s)2Fe + Cd2+ = Fe2+ + 2Cd(s)
Fe+ Cd2+ = Fe2+ + Cd(s)2Fe + Cd2+ = Fe2+ + 2Cd(s)
Fe+ Cd2+ = 4Fe2+ + Cd(s)2Fe + Cd2+ = Fe2+ + 2Cd(s)
Fe+ 32Cd2+ = 4Fe2+ + Cd(s)2Fe + Cd2+ = Fe2+ + 2Cd(s)
Fe+ Cd2+ = Fe2+ + Cd(s)2Fe + Cd2+ = Fe2+ + 2Cd(s)
Fe+ Cd++ = Fe++ + Cd(s)Fe + Cd++ = Fe++ + Cd(s)
FeCl2 + Ag3PO4 = Fe3(PO4)2 + AgCl3FeCl2 + 2Ag3PO4 = Fe3(PO4)2 + 6AgCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + HNO3= Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2+CO= Fe3O4+CO2-3Fe2 + 8CO = -2Fe3O4 + 8CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2 + Cl2 = FeCl32FeCl2 + Cl2 = 2FeCl3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeO+C=Fe+CO22FeO + C = 2Fe + CO2
FeCl2 + H2O + NH3 = Fe(OH)2 + NH4ClFeCl2 + 2H2O + 2NH3 = Fe(OH)2 + 2NH4Cl
Fe + HNO3 = Fe(NO3)3 + 2NO2 + 3H2OFe + 6HNO3 = Fe(NO3)3 + 3NO2 + 3H2O
Fe + HNO3 = Fe (NO3) 3 + NO2 + H2OFe + 6HNO3 = Fe(NO3)3 + 3NO2 + 3H2O
Fe + HNO3 = Fe (NO3) 2 + NO2 + H2OFe + 4HNO3 = Fe(NO3)2 + 2NO2 + 2H2O
Fe(CNS)3+K2Cr2O7+H2SO4=Fe2(SO4)3+Cr2(SO4)3+K2SO4+HNO3+CO2+H2O2Fe(CNS)3 + 16K2Cr2O7 + 61H2SO4 = Fe2(SO4)3 + 16Cr2(SO4)3 + 16K2SO4 + 6HNO3 + 6CO2 + 58H2O
Fe(CNS)3+K2Cr2O7+H2SO4=Fe2(SO4)3+Cr2(SO4)3+K2SO4+HNO3+CO2+H2O2Fe(CNS)3 + 16K2Cr2O7 + 61H2SO4 = Fe2(SO4)3 + 16Cr2(SO4)3 + 16K2SO4 + 6HNO3 + 6CO2 + 58H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 + HCl= FeCl3+ H2O + SO3Fe2(SO4)3 + 6HCl = 2FeCl3 + 3H2O + 3SO3
Fe + O2 + H2O = Fe (OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2(SO4)3 + HCl= FeCl3+ H2O + SO3Fe2(SO4)3 + 6HCl = 2FeCl3 + 3H2O + 3SO3
FeS2 + HCl = FeCl2 + H2S + SFeS2 + 2HCl = FeCl2 + H2S + S
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeSO4+HCl=FeCl2+H2SO4FeSO4 + 2HCl = FeCl2 + H2SO4
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=FeO32Fe + 3O2 = 2FeO3
FeCl3 +Be3(PO4)2 =BeCl2 + FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2= Fe2O22Fe + O2 = Fe2O2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+H2CO3=Fe(HCO3)2+H2Fe + 2H2CO3 = Fe(HCO3)2 + H2
Fe(OH)3+H2SO4=Fe(HSO4)3+H2OFe(OH)3 + 3H2SO4 = Fe(HSO4)3 + 3H2O
Fe2O3+CO2=Fe2(CO3)3Fe2O3 + 3CO2 = Fe2(CO3)3
FeCl3+KCN=Fe(CN)3+KClFeCl3 + 3KCN = Fe(CN)3 + 3KCl
FeO(s) + O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FECl3 + SNCl2 = FECl2 + SNCl42FECl3 + SNCl2 = 2FECl2 + SNCl4
Fe+HgS = FeS+ HgFe + HgS = FeS + Hg
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeCl2 +H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeI2 + Li2CO3 = LiI + FeCO3FeI2 + Li2CO3 = 2LiI + FeCO3
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + H2SO4 = H2 + Fe2SO42Fe + H2SO4 = H2 + Fe2SO4
Fe3O4 (s) +H2 (g) = Fe(aq) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(aq) + 4H2O(g)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + H2SO4 = Fe2S3O12 + H22Fe + 3H2SO4 = Fe2S3O12 + 3H2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+HNO3 = Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe2 (SO4)3 + Pb(NO3)4 = Fe(NO3)3 + Pb(SO4)22Fe2(SO4)3 + 3Pb(NO3)4 = 4Fe(NO3)3 + 3Pb(SO4)2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe(OH)2 + O2 +H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe + HNO3 = Fe(NO3)2 + NH4NO3 + H2O4Fe + 10HNO3 = 4Fe(NO3)2 + NH4NO3 + 3H2O
Fe + NaBr = FeBr3 + NaFe + 3NaBr = FeBr3 + 3Na
Fe + S8 = FeS8Fe + S8 = 8FeS
Fe + SnCl4= FeCl + Sn4Fe + SnCl4 = 4FeCl + Sn
Fe + ZnCl2= FeCl + Zn2Fe + ZnCl2 = 2FeCl + Zn
Fe + Ca(NO3)2= Fe(NO3) + Ca2Fe + Ca(NO3)2 = 2Fe(NO3) + Ca
Fe2O3 + H2 = H2O + FeFe2O3 + 3H2 = 3H2O + 2Fe
FeOH3+H2=FeH2O2FeOH3 - H2 = 2FeH2O
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3O4 + CN- = FeCN + Fe2O3 + O2-4Fe3O4 + 0CN- = 0FeCN - 6Fe2O3 + O2
Fe3O4 + CN- = FeCN + Fe2O3 + O2-4Fe3O4 + 0CN- = 0FeCN - 6Fe2O3 + O2
FeO + O3 = Fe2O36FeO + O3 = 3Fe2O3
Fe3O4 + CN- = FeCN + Fe2O3+O2-4Fe3O4 + 0CN- = 0FeCN - 6Fe2O3 + O2
Fe3O4 + CN- = FeCN + Fe2O3+O2-4Fe3O4 + 0CN- = 0FeCN - 6Fe2O3 + O2
Fe3O4 + CN- = FeCN + Fe2O3+O2-4Fe3O4 + 0CN- = 0FeCN - 6Fe2O3 + O2
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe(OH)2(s) + O2(g) + H2O(l) = Fe(OH)3(s) 4Fe(OH)2(s) + O2(g) + 2H2O(l) = 4Fe(OH)3(s)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe2(SO4)2+H22Fe + 2H2SO4 = Fe2(SO4)2 + 2H2
Fe+H2SO4=Fe2(SO4)2+H22Fe + 2H2SO4 = Fe2(SO4)2 + 2H2
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeO(s)+O3(g)=Fe2O3(s)6FeO(s) + O3(g) = 3Fe2O3(s)
FeS + O2 =FeO2 + SO2FeS + 2O2 = FeO2 + SO2
FeS + O2 =FeO2 + SO2FeS + 2O2 = FeO2 + SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeO(s) + O3(g) = Fe2O3(s)6FeO(s) + O3(g) = 3Fe2O3(s)
FeO + O3 = Fe2O36FeO + O3 = 3Fe2O3
FeO + O3 = Fe2O36FeO + O3 = 3Fe2O3
Fe2O3 + H2 = H2O + Fe4O32Fe2O3 + 3H2 = 3H2O + Fe4O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe3O4+4H2=3Fe+4H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeO3H3 + H2SO4 = Fe2S3O12 + H2O2FeO3H3 + 3H2SO4 = Fe2S3O12 + 6H2O
FeO+O3=Fe2O36FeO + O3 = 3Fe2O3
FeS2 + HNO3 = Fe2(SO4)3 + H2SO4 +NO +H2020FeS2 + 80HNO3 = 10Fe2(SO4)3 + 10H2SO4 + 80NO + 3H20
FeCl3 + Na2(CO3) = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2(CO3) = Fe2(CO3)3 + 6NaCl
FeCl3 + Ag(NO3) = Fe(NO3)3 + AgClFeCl3 + 3Ag(NO3) = Fe(NO3)3 + 3AgCl
FeCl3 + KI = FeI3 + KClFeCl3 + 3KI = FeI3 + 3KCl
F2 + LiCl = LiF + Cl2F2 + 2LiCl = 2LiF + Cl2
FeCl3 + Cu(SO4) = Fe2(SO4)3 + CuCl22FeCl3 + 3Cu(SO4) = Fe2(SO4)3 + 3CuCl2
FeCl3 + Pb(NO3)2 = Fe(NO3)3 + PbCl22FeCl3 + 3Pb(NO3)2 = 2Fe(NO3)3 + 3PbCl2
FeCl3 + Cu(SO4) = Fe2(SO4)3 + CuCl22FeCl3 + 3Cu(SO4) = Fe2(SO4)3 + 3CuCl2
Fe(NO3)3 + PbCl2 = FeCl3 + Pb (NO3)22Fe(NO3)3 + 3PbCl2 = 2FeCl3 + 3Pb(NO3)2
FeO+O3=Fe2O36FeO + O3 = 3Fe2O3
FeO + O3 = Fe2O36FeO + O3 = 3Fe2O3
FeO(s) + O3(g) = Fe2O3(s)6FeO(s) + O3(g) = 3Fe2O3(s)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.