Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe + S = FeSFe + S = FeS
Fe + S = FeSFe + S = FeS
FeSO4+BaCl=BaSO4+FeClFeSO4 + BaCl = BaSO4 + FeCl
F2+A1Cl3=A1F3+Cl23F2 + 2A1Cl3 = 2A1F3 + 3Cl2
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe + H2O=Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
FeS + O2 = Fe2 O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+Al=Al2O3+Fe33Fe2O3 + 6Al = 3Al2O3 + 2Fe3
Fe2(SO4)3 + KOH =Fe(OH)3 + K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
FeCl2 +KMnO4 +HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + 2CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+CUSO4=FeSO4+CUFe + CUSO4 = FeSO4 + CU
Fe+CUSO4=FeSO4+CUFe + CUSO4 = FeSO4 + CU
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeCl2 + MnCl5 = FeCl3 + MnCl4FeCl2 + MnCl5 = 4FeCl3 + MnCl
Fe+O2+H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeBr2 + MnBr7 = FeBr4 + MnBr25FeBr2 + 2MnBr7 = 5FeBr4 + 2MnBr2
Fe2O3(s) +3C(s) = Fe(s) + CO(g) Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeO(s) + O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
Fe(CN)3+Ca(NO3)2=Fe(NO3)3+Ca(CN)22Fe(CN)3 + 3Ca(NO3)2 = 2Fe(NO3)3 + 3Ca(CN)2
FeO3+CO=Fe+3CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe2O3(s)+3CO(g)=2Fe(s)+3CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(SO4)3+NH4OH=(NH4)2SO4+Fe(OH)3Fe2(SO4)3 + 6NH4OH = 3(NH4)2SO4 + 2Fe(OH)3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3 + NaOH = Fe(OH) 3+ NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeS+H2SO4=FeSO4+SH2FeS + H2SO4 = FeSO4 + SH2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s) + CO(g) = FeO(s) + CO2(s)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(s)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + CO(g) = FeO(s) + CO2(s)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(s)
Fe2O3(s) + CO(g) = FeO(s) + CO2(s)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(s)
FeBr3+NaCO3+10H2O+Br2=NaBr+Fe(OH)3+CO24FeBr3 + 6NaCO3 + 6H2O - 3Br2 = 6NaBr + 4Fe(OH)3 + 6CO2
Fe+H2O+Br2=Fe(OH)2+Br0Fe + 0H2O + Br2 = 0Fe(OH)2 + 2Br
Fe2O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe+Br2=FeBr2Fe + Br2 = FeBr2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe (s) + O2 (l) = Fe2O34Fe(s) + 3O2(l) = 2Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3 +KOH= K2SO4 +Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe(NO3)3 + LiF = LiNO3 + FeF3Fe(NO3)3 + 3LiF = 3LiNO3 + FeF3
Fe S2+ O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(NO3)3 + LiF = LiNO3 + FeF3Fe(NO3)3 + 3LiF = 3LiNO3 + FeF3
Fe(NO3)3 + LiF = LiNO3 + FeF3Fe(NO3)3 + 3LiF = 3LiNO3 + FeF3
Fe(NO3)3 + LiF = LiNO3 + FeF3Fe(NO3)3 + 3LiF = 3LiNO3 + FeF3
FeSo4 + K2Cr2O7 + H2So4 = H2O + Fe2(So4)3 + K2So4 + Cr(So4)30FeSo4 + K2Cr2O7 + 7H2So4 = 7H2O + 0Fe2(So4)3 + K2So4 + 2Cr(So4)3
Fe+CuSO4=FeSO4=CuFe + CuSO4 = FeSO4 + Cu
Fe+CuSO4=FeSO4=CuFe + CuSO4 = FeSO4 + Cu
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O4 + SO2 = FeS2 + O2Fe2O4 + 4SO2 = 2FeS2 + 6O2
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
FeCO3= FeO + CO2FeCO3 = FeO + CO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe2 (SO4)3+6KOH=3K2SO4+2Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3(s) + CO(g) = Fe(s) + CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + NH4OH = Fe(OH)3 + NH4Cl FeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+++ + HBr + H2O + Br2 = FeBr3 + H2O0Fe+++ + 0HBr + H2O + 0Br2 = 0FeBr3 + H2O
Fe(H2O)6+++ + Br2 = Fe+++ + HBr + OHFe(H2O)6+++ + 3Br2 = Fe+++ + 6HBr + 6OH
Fe(H2O)6+++ + Br2 = Fe+++ + HBr + H2OFe(H2O)6+++ + 0Br2 = Fe+++ + 0HBr + 6H2O
Fe(H2O)6+++ + Br2 = Fe+++ + Br- + H2OFe(H2O)6+++ + 0Br2 = Fe+++ + 0Br- + 6H2O
Fe(s) + S(s) = Fe2S3(s) 2Fe(s) + 3S(s) = Fe2S3(s)
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeO3(s)+CO(g)=Fe(l)+CO2(g)FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2(CO3)3 + HNO3 = Fe(NO3)3 + H2CO3Fe2(CO3)3 + 6HNO3 = 2Fe(NO3)3 + 3H2CO3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS+O2=Fe2O2+SO22FeS + 3O2 = Fe2O2 + 2SO2
FeBr3 + F2 = FeF3 + Br22FeBr3 + 3F2 = 2FeF3 + 3Br2
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+S8=Fe2S316Fe + 3S8 = 8Fe2S3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + Pb(NO3)2 = Fe(NO3)3 + Pb2Fe + 3Pb(NO3)2 = 2Fe(NO3)3 + 3Pb
Fe + Pb(NO3)2 = Fe(NO3)3 + Pb24Fe + 6Pb(NO3)2 = 4Fe(NO3)3 + 3Pb2
FeS2+ O= Fe2O3+SO22FeS2 + 11O = Fe2O3 + 4SO2
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe + SO = Fe2O3 + SO2-2Fe + 3SO = -1Fe2O3 + 3SO2
FeBr3 + Ba(OH)2 = Fe(OH)3 + BaBr22FeBr3 + 3Ba(OH)2 = 2Fe(OH)3 + 3BaBr2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe= Fe22Fe = Fe2
Fe(s)= Fe2(aq)2Fe(s) = Fe2(aq)
Fe3C + HNO3 = CO2 + Fe(NO3)3 + NO2 + H2OFe3C + 22HNO3 = CO2 + 3Fe(NO3)3 + 13NO2 + 11H2O
Fe(OH)2+H2O+O2 = Fe(OH)34Fe(OH)2 + 2H2O + O2 = 4Fe(OH)3
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(SO4)3 + K(SCN)=K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12K(SCN) = 2K3Fe(SCN)6 + 3K2SO4
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+3C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe(NO3)3+NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe+S8=8FeS8Fe + S8 = 8FeS
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + C = CO2 + Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeCl3 + H2S = Fe2S3 +HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
F- + Ba2+ = F2+Ba-6F- + 2Ba2+ = 3F2 + 4Ba-
F- + Al3+ = F3+Al-12F- + 3Al3+ = 4F3 + 9Al-
F- + H+ = FHF- + H+ = FH
Fe+S=FeSFe + S = FeS
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Na2CO3+10H2O+Br2=NaBr+CO2+Fe(OH)32Fe + 3Na2CO3 + 3H2O + 3Br2 = 6NaBr + 3CO2 + 2Fe(OH)3
Fe+Na2CO3+10H2O+Br2=NaBr+CO2+Fe(OH)32Fe + 3Na2CO3 + 3H2O + 3Br2 = 6NaBr + 3CO2 + 2Fe(OH)3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeSO4+O2=FeO2+SO2FeSO4 + 0O2 = FeO2 + SO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2(So4)3 + KOH = K2So4 + Fe(OH)3Fe2(So4)3 + 6KOH = 3K2So4 + 2Fe(OH)3
Fe+BaSO4=FeBaSO4Fe + BaSO4 = FeBaSO4
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+KOH=KCl+Fe(OH)3FeCl3 + 3KOH = 3KCl + Fe(OH)3
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS2+Cl2=FeCl3+S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
FeS2+Cl2=FeCl3+S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
Fe(OH)2+H2O2= Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe+AgC2H3O2=Ag+FeC2H3O2Fe + AgC2H3O2 = Ag + FeC2H3O2
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe+Pb(NO3)2=Pb+Fe(NO3)2Fe + Pb(NO3)2 = Pb + Fe(NO3)2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe + Pb(IO3)2= Fe(IO3)2 + PbFe + Pb(IO3)2 = Fe(IO3)2 + Pb
FeCl2 + Na2CO3 = FeCO3 +NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeO(s) + O2(g) =Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeO + PbF2 = FeF2 + PbOFeO + PbF2 = FeF2 + PbO
Fe +Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
Fe + AgC2H3O2 = Fe(C2H3O2)2 + AgFe + 2AgC2H3O2 = Fe(C2H3O2)2 + 2Ag
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3 + (NH4)2S = Fe2S3 + NH4Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6NH4Br
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO + CO = Fe + CO2FeO + CO = Fe + CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(NO3)2+Na2S=FeS+2NaNO3Fe(NO3)2 + Na2S = FeS + 2NaNO3
FeCl2+KNO3+HCl=FeCl3+NO+H2O+KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2 + KCl = FeCl + KFe2 + 2KCl = 2FeCl + 2K
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+S=FeSFe + S = FeS
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeWO4 + C = Fe6W6C + CO6FeWO4 + 25C = Fe6W6C + 24CO
Fe+PbSO4=FeSO4+PbFe + PbSO4 = FeSO4 + Pb
Fe2O3 + HCl = FeCl2 +Cl2 + H2OFe2O3 + 6HCl = 2FeCl2 + Cl2 + 3H2O
Fe2(SO4)3+Na3PO4=Na2(SO4)+Fe (PO4)Fe2(SO4)3 + 2Na3PO4 = 3Na2(SO4) + 2Fe(PO4)
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+S=Fe+2 + S-2Fe + S = Fe+2 + S-2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+CO = CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO = CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O4 + SO2=FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O4+SO2=FeS+O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+S2=FeS2Fe + S2 = FeS2
Fe+CO2+O2=FeCO32Fe + 2CO2 + O2 = 2FeCO3
Fe+CO2+O2=FeCO32Fe + 2CO2 + O2 = 2FeCO3
Fe+Ti+O2=FeTiO32Fe + 2Ti + 3O2 = 2FeTiO3
Fe+O2+H2O=Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe3Cl3 + KI = I2 + KCl + Fe2Cl22Fe3Cl3 + 0KI = 0I2 + 0KCl + 3Fe2Cl2
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
Fe(OH)3(s)=Fe2O3(s)+H2O(g)2Fe(OH)3(s) = Fe2O3(s) + 3H2O(g)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
F2+NaOH=NaF+O2+H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeO3(s) + CO(g) = Fe(l) + CO2(g) FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS + HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
Fe2O3 + CO = FeO + CO2Fe2O3 + CO = 2FeO + CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeBr3 + F2 = FeF3 + Br22FeBr3 + 3F2 = 2FeF3 + 3Br2
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + 3 CO = Fe + 3 CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeBr2 + HgNo3 = FeNo3 + HgBr2FeBr2 + HgNo3 = FeNo3 + HgBr2
Fe+H2O=Fe2O3+H2Fe + 3H2O = Fe2O3 + 6H
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + HCl = H2S + Cl2FeFeS + 2HCl = H2S + Cl2Fe
FeS + HCl = H2S + Cl2FeFeS + 2HCl = H2S + Cl2Fe
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+Cu2(NO3)2=Fe2(NO3)2+Cu2Fe + Cu2(NO3)2 = Fe2(NO3)2 + 2Cu
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)2= FeO + H2O Fe(OH)2 = FeO + H2O
FeMnO4 + SO2 = FeSO4 + MnO2FeMnO4 + SO2 = FeSO4 + MnO2
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
FeCl2+KNO3+HCl=FeCl3+NO+H2O+KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3+CO =CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+H2O=Fe2O3+H2Fe + 3H2O = Fe2O3 + 6H
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+ CO= CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+H2O=Fe2O3+H2Fe + 3H2O = Fe2O3 + 6H
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2 + S = SF63F2 + S = SF6
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+CuSO4*5H2O=FeSO4+Cu+H2OFe + CuSO4*5H2O = FeSO4 + Cu + 5H2O
Fe+CuSO4*5H2O=FeSO4+Cu+H2OFe + CuSO4*5H2O = FeSO4 + Cu + 5H2O
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O4 + SO2 =FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe + CuSO4 = Cu + Fe2(SO4)32Fe + 3CuSO4 = 3Cu + Fe2(SO4)3
Fe + AgNO3 = Fe(NO3)3 + AgFe + 3AgNO3 = Fe(NO3)3 + 3Ag
FeCl3=Fe+++ + Cl-1FeCl3 = Fe+++ + 3Cl-1
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+S=Fe2S32Fe + 3S = Fe2S3
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
Fe2O3 + 2Al = 2Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + 3Al = 3Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeCl3(aq)+(NH4)2S(aq)=Fe2S3(s)+NH4Cl(aq)2FeCl3(aq) + 3(NH4)2S(aq) = Fe2S3(s) + 6NH4Cl(aq)
FeCl3(aq) + (NH4)2S(aq) = Fe2S3(s) + NH4Cl(aq)2FeCl3(aq) + 3(NH4)2S(aq) = Fe2S3(s) + 6NH4Cl(aq)
Fe2O3 + 2Al = 2Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2(C2O4)3=FeC2O4+CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
FeS2 + O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
FeBr3+(NH4)2S=Fe2S3+NH4Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6NH4Br
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl2 + KMnO4 + HCl = FeCl3 + KCl + MnCl2 + H2O5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + KCl + MnCl2 + 4H2O
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl4+(NH4)2S=NH4Cl+FeS2FeCl4 + 2(NH4)2S = 4NH4Cl + FeS2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2 + NaOH = Fe(OH)2 + NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)2 + H3PO4 = HOH + Fe3(PO4)23Fe(OH)2 + 2H3PO4 = 6HOH + Fe3(PO4)2
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe2(SO4)3 + BaCl2 = FeCl3 + BaSO4Fe2(SO4)3 + 3BaCl2 = 2FeCl3 + 3BaSO4
Fe+Pb(IO3)2=Fe(IO3)2+PbFe + Pb(IO3)2 = Fe(IO3)2 + Pb
Fe2(SO4)3 + BaCl2 = FeCl3 + BaSO4Fe2(SO4)3 + 3BaCl2 = 2FeCl3 + 3BaSO4
Fe+CuNO3=Cu+Fe(NO3)2Fe + 2CuNO3 = 2Cu + Fe(NO3)2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + F2 = FeF3 + O22Fe2O3 + 6F2 = 4FeF3 + 3O2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
Fe+CuSO4*5H2O=FeSO4+Cu+H2OFe + CuSO4*5H2O = FeSO4 + Cu + 5H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
FeCl2(aq)+K2S(aq)=K2Cl2+FeSFeCl2(aq) + K2S(aq) = K2Cl2 + FeS
FeCl2(aq)+K2S(aq)=K2Cl2+FeSFeCl2(aq) + K2S(aq) = K2Cl2 + FeS
Fe+Pb(IO3)2=Fe(IO3)2+PbFe + Pb(IO3)2 = Fe(IO3)2 + Pb
Fe+Pb(IO3)2=Fe(IO3)2+PbFe + Pb(IO3)2 = Fe(IO3)2 + Pb
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(s) + O2(g) = FeO3(s)2Fe(s) + 3O2(g) = 2FeO3(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe3O4 + 2H2 = 3Fe + 2H2OFe3O4 + 4H2 = 3Fe + 4H2O
F2+S=SF63F2 + S = SF6
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(s)+O2(g) =Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + C =Fe +CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + HBr = FeBr3 + H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
Fe2O3 + HBr = FeBr3 + H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe+Cu(NO3)2=Fe(NO3)2+CuFe + Cu(NO3)2 = Fe(NO3)2 + Cu
Fe2P(s) + S(s)=P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
FeS + O2 = Fe2O3 + S4FeS + 3O2 = 2Fe2O3 + 4S
Fe(OH)3 = Fe2 O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3 + Ca(OH)2 = Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3+Mg=Fe+MgCl22FeCl3 + 3Mg = 2Fe + 3MgCl2
FeO + PdF2 = FeF2 + PdOFeO + PdF2 = FeF2 + PdO
Fe(NO3)3+Na2(CO3)=Na(NO3)+Fe2(CO3)32Fe(NO3)3 + 3Na2(CO3) = 6Na(NO3) + Fe2(CO3)3
Fe + H2O= Fe3O4 +H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3+NaOH=FeOH+NaCl3FeCl3 + NaOH = FeOH + NaCl3
Fe + H2(SO4) = Fe2(SO4)3 + H22Fe + 3H2(SO4) = Fe2(SO4)3 + 3H2
FeO +H2 = Fe + H2OFeO + H2 = Fe + H2O
FeO(s) +H2(g) = Fe(s) + H2O(l)FeO(s) + H2(g) = Fe(s) + H2O(l)
Fe + NaOH = Na + Fe(OH)3Fe + 3NaOH = 3Na + Fe(OH)3
Fe +O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe +O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe +O2 =Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + 2SCN = Fe(SCN)2Fe + 2SCN = Fe(SCN)2
Fe+H2SO4=Fe2(SO4)+H22Fe + H2SO4 = Fe2(SO4) + H2
Fe + CuSO4 =Cu + Fe2SO42Fe + CuSO4 = Cu + Fe2SO4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + CuSO4 = Fe2SO4 + Cu2Fe + CuSO4 = Fe2SO4 + Cu
Fe + CuSO4 = Fe2SO4 + Cu2Fe + CuSO4 = Fe2SO4 + Cu
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + 2H2SO4 = FeSO4 + 2H2O + 5O2-2Fe - 2H2SO4 = -2FeSO4 - 2H2O + O2
Fe + H2SO4 = FeSO4 + H2O + O2-2Fe - 2H2SO4 = -2FeSO4 - 2H2O + O2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeAsS+CaO+H2O2=FeS+AsO4+Ca(OH)2FeAsS + 4CaO + 4H2O2 = FeS + AsO4 + 4Ca(OH)2
FeAsS+CaO+H2O2=FeS+AsO4+CaOHFeAsS + 4CaO + 2H2O2 = FeS + AsO4 + 4CaOH
FeAsS+CaO+H2O2=FeS+AsO4+CaOHFeAsS + 4CaO + 2H2O2 = FeS + AsO4 + 4CaOH
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO3 + H2O = FeOH +H2SO4-2Fe + H2SO3 - H2O = -2FeOH + H2SO4
Fe2O2 +4SO2 + H2O = Fe + H2SO30Fe2O2 + SO2 + H2O = 0Fe + H2SO3
Fe2O2 +4SO2 + H2O = Fe + H2SO30Fe2O2 + SO2 + H2O = 0Fe + H2SO3
Fe+ O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
F2(g)+CaBr2(g)= CaF2(g)+Br2(g)F2(g) + CaBr2(g) = CaF2(g) + Br2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+Al=Al3O3+FeFe2O3 + 3Al = Al3O3 + 2Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s) + S8(s) = FeS(s)8Fe(s) + S8(s) = 8FeS(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH)3= Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3Cl3 + H2S = Fe2S + HCl2Fe3Cl3 + 3H2S = 3Fe2S + 6HCl
FeCl + HS = FeS + HClFeCl + HS = FeS + HCl
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe(NO3)3+ NH3+ H2O = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS+ O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2S3+HCl=FeCl3+3H2SFe2S3 + 6HCl = 2FeCl3 + 3H2S
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeCl3 +NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(NO3)3+NH4(OH) = Fe(OH)3+NH4NO3Fe(NO3)3 + 3NH4(OH) = Fe(OH)3 + 3NH4NO3
Fe + Sn(NO3)4 = Sn + Fe(NO3)34Fe + 3Sn(NO3)4 = 3Sn + 4Fe(NO3)3
F2 + AlBr3 = Br2 + AlF33F2 + 2AlBr3 = 3Br2 + 2AlF3
Fe + H2O = Fe2O3 +H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe(CO)5+NaOH=Na2Fe(CO)4+Na2CO3+H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
Fe(C2H3O2)+ Ca(OH)2= Ca(C2H3O2)2 + Fe(OH)2Fe(C2H3O2) + Ca(OH)2 = Ca(C2H3O2)2 + 2Fe(OH)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 + CO = 4Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Zn(NO3)2=Fe(NO3)3+Zn2Fe + 3Zn(NO3)2 = 2Fe(NO3)3 + 3Zn
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+Al2=Al2O3+FeFe2O3 + Al2 = Al2O3 + 2Fe
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + C = 3CO + FeFe2O3 + 3C = 3CO + 2Fe
FeS + H2O2 = S + Fe(OH)2FeS + H2O2 = S + Fe(OH)2
FeS + H2O2 = S0 + Fe(OH)20FeS + 0H2O2 = -1S0 + Fe(OH)2
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
F+NaCl=NaF+ClF + NaCl = NaF + Cl
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeS+ O2= Fe2O3+ SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe30 + U2 = FeU5Fe30 + 75U2 = 30FeU5
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS2 + O2 = Fe2 + SO32FeS2 + 6O2 = Fe2 + 4SO3
Fe2(SO4)3 + Zn(OH)2 = Fe(OH)3 + ZnSO4Fe2(SO4)3 + 3Zn(OH)2 = 2Fe(OH)3 + 3ZnSO4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeO(s)+C(s)=Fe(l)+CO2(g)2FeO(s) + C(s) = 2Fe(l) + CO2(g)
F2 + NH3 = N2F4 + HF5F2 + 2NH3 = N2F4 + 6HF
Fe + AgNo3 = Fe(No3)2 + AgFe + 2AgNo3 = Fe(No3)2 + 2Ag
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS2+O2=Fe2O3+S4FeS2 + 3O2 = 2Fe2O3 + 8S
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
F2 + NaI= Na + F2IF2 + NaI = Na + F2I
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3+KI=FeCl2+KCl+I22FeCl3 + 2KI = 2FeCl2 + 2KCl + I2
Fe(CO)5 + NaOH= Na2Fe(CO)4 + Na2CO3 + H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
Fe(CO)5 + NaOH= Na2Fe(CO)4 + Na2CO3 + H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
FeCl3+3NaOH=Fe(OH)3+3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
F2+ O2= F2O52F2 + 5O2 = 2F2O5
FeCl 4H2O + 4KOH + 2K + 2(C5H5) = Fe(C5H5)2 + 4KOH H2O + 2KClFeCl4H2O + KOH + 4K + 2(C5H5) = Fe(C5H5)2 + KOHH2O + 4KCl
FeCl3+Zn=Fe2+ZnCl22FeCl3 + 3Zn = Fe2 + 3ZnCl2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2= Fe3O43Fe + 2O2 = Fe3O4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3+Ga=Ga2O3+FeFe2O3 + 2Ga = Ga2O3 + 2Fe
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4+C=Fe3+CO2Fe3O4 + 2C = Fe3 + 2CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.