Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3+CO=FeO+CO2Fe2O3 + CO = 2FeO + CO2
FeSO4(s)+Pb(NO3)2(s)=Fe(NO3)2(aq)+PbSO4(s)FeSO4(s) + Pb(NO3)2(s) = Fe(NO3)2(aq) + PbSO4(s)
Fe2O3+CO=FeO+CO2Fe2O3 + CO = 2FeO + CO2
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
Fe(s) + Al2(SO4)3(aq) = Al(s) + Fe2(SO4)3(aq)2Fe(s) + Al2(SO4)3(aq) = 2Al(s) + Fe2(SO4)3(aq)
Fe(s) + Al2(SO4)3(aq) = Al(s) + Fe2(SO4)3(aq)2Fe(s) + Al2(SO4)3(aq) = 2Al(s) + Fe2(SO4)3(aq)
Fe + CO3 = FeCO3Fe + CO3 = FeCO3
Fe(s)+H2O(g) =Fe3O4(s) +H2(g) 3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe + AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s)+H2SO4(aq)=FeSO4(aq)+H2Fe(s) + H2SO4(aq) = FeSO4(aq) + H2
Fe(s)+H2SO4(aq)=FeSO4(aq)+H2Fe(s) + H2SO4(aq) = FeSO4(aq) + H2
Fe + O2=Fe2 O34Fe + 3O2 = 2Fe2O3
Fe + O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS2(s) + O2(g) = Fe2O3(s) + SO2(g)4FeS2(s) + 11O2(g) = 2Fe2O3(s) + 8SO2(g)
FeSO4+ MgCl2= FeCl2+MgSO4FeSO4 + MgCl2 = FeCl2 + MgSO4
FeS2 + O2 = Fe203 + SO2203FeS2 + 406O2 = Fe203 + 406SO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeO+Mn=Mn2O5 + Fe5FeO + 2Mn = Mn2O5 + 5Fe
FeO(s)+2HClO4(aq)=Fe(ClO4)2(aq)+H2O(l)FeO(s) + 2HClO4(aq) = Fe(ClO4)2(aq) + H2O(l)
Fe(OH)2(s) + 2 HCl(aq) = FeCl2(aq) + 2 H2O(l)Fe(OH)2(s) + 2HCl(aq) = FeCl2(aq) + 2H2O(l)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe (s) + O2 (g) = Fe2O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe2O+C=Fe+CO22Fe2O + C = 4Fe + CO2
Fe2O3 +Al2= Fe + Al2O3Fe2O3 + Al2 = 2Fe + Al2O3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2+KNO3+HCl=FeCl3+NO+H2O+KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
Fe+HNO3=Fe (NO3)3 + NH4NO2+H2O10Fe + 36HNO3 = 10Fe(NO3)3 + 3NH4NO2 + 12H2O
FeCl2 + HNO3 + HCl = FeCl3 + NO2 + H2OFeCl2 + HNO3 + HCl = FeCl3 + NO2 + H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeO(s)+C(s)=Fe(s)+CO(g)FeO(s) + C(s) = Fe(s) + CO(g)
Fe2(SO4)3 + NH3+ H2O = Fe(OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(NO2)2 + 2NaBr = FeBr2 +NaNO2Fe(NO2)2 + 2NaBr = FeBr2 + 2NaNO2
FeOCr2O3+ K2CO3+ O2= K2CrO4+ CO2+ Fe2O34FeOCr2O3 + 8K2CO3 + 7O2 = 8K2CrO4 + 8CO2 + 2Fe2O3
Fe2O3(s) + H2SO4 = Fe2(SO4)3(aq) + H2OFe2O3(s) + 3H2SO4 = Fe2(SO4)3(aq) + 3H2O
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3 CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 + H2O = Fe(OH)2 2Fe + O2 + 2H2O = 2Fe(OH)2
Fe+Cl=Fe2Cl32Fe + 3Cl = Fe2Cl3
Fe2O3 = Fe + O22Fe2O3 = 4Fe + 3O2
Fe+HNO3=Fe (NO3)3 + NH4NO3+H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe2S3 + O2= Fe2O3 + SO2 2Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
FeCl 2 + H 2 O + HCl = FeCl 3 + H 2 O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeCl2 + KMnO4+ HCl= FeCl3 + MnCl2 +H2O + KCl 5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe + H2O= Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
F e 2 O 3 (s)+CO(g)=Fe(s)+C O 2 (g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + 2NaOH = Fe(OH)3 + 3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeO(s)+2HClO4(aq)=Fe(ClO4)2(aq)+H2O(l)FeO(s) + 2HClO4(aq) = Fe(ClO4)2(aq) + H2O(l)
FeCl3(aq)+NaOH(aq)= Fe(OH)3(s)+NaCl(aq) FeCl3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaCl(aq)
Fe+O2 =Fe2 O34Fe + 3O2 = 2Fe2O3
Fe2O3 + H2O = Fe (OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + HClO4 = Fe(ClO4)3 + H2OFe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
FeS2 + O2 = SO2 +Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO= Fe+ CO0Fe2O3 + CO = 0Fe + CO
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe(NO3)3(aq)+3LiOH(aq)=Fe(OH)3(s)+3LiNO3(aq)Fe(NO3)3(aq) + 3LiOH(aq) = Fe(OH)3(s) + 3LiNO3(aq)
Fe + NH3 + H2O = Fe(OH)3 + NH4Fe + 3NH3 + 3H2O = Fe(OH)3 + 3NH4
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe + NH3 = Fe(NH3)3Fe + 3NH3 = Fe(NH3)3
Fe2O3(s) + H2SO4(aq)= Fe2(SO4)3(aq) + H2OFe2O3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2O
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe(NO3)2 + Li3PO4 = Fe3(PO4)2 + LiNO33Fe(NO3)2 + 2Li3PO4 = Fe3(PO4)2 + 6LiNO3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3(s) + H2SO4(aq)= Fe2(SO4)3(aq) + H2OFe2O3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2O
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe2O3(s) + H2SO4(aq)= Fe2(SO4)3(aq) + H2OFe2O3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2O
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+CO2 = Fe2(CO3)3Fe2O3 + 3CO2 = Fe2(CO3)3
FeCl3 + (NH4)3PO4 = FePO4 + NH4ClFeCl3 + (NH4)3PO4 = FePO4 + 3NH4Cl
FeSO4(s)=Fe2O3(s) + SO2(g) + O2(g)4FeSO4(s) = 2Fe2O3(s) + 4SO2(g) + O2(g)
F e 3 O 4 (s)+ O 2 (g)=F e 2 O 3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeO3 + 2CO = Fe + 2CO2FeO3 + 3CO = Fe + 3CO2
FeS2+O2+H2O=Fe2O3+(SO4)--+(H)+4FeS2 + 15O2 + 8H2O = 2Fe2O3 + 8(SO4)-- + 16(H)+
FeS2+O2+H2O=Fe2O3+(SO4)2-+(H)+2FeS2 + 9O2 + H2O = Fe2O3 + 2(SO4)2- + 2(H)+
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe + H2O=Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s)+O2(g)=Fe2O34Fe(s) + 3O2(g) = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2 (g) + LiCl (aq) = LiF (aq) + Cl2F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2
FeCuS2+HNO3=Fe (NO3)3+Cu (NO3)2+H2SO4+NO+H204FeCuS2 + 36HNO3 = 4Fe(NO3)3 + 4Cu(NO3)2 + 8H2SO4 + 16NO + H20
Fe + CO3= Fe2(CO3)32Fe + 3CO3 = Fe2(CO3)3
FeS2+K2S2O8+KOH=K2FeO4+K2SO4+H2OFeS2 + 9K2S2O8 + 24KOH = K2FeO4 + 20K2SO4 + 12H2O
Fe (CrO2)2+O2+Na2CO3=Fe2O3+Na2CrO4+CO24Fe(CrO2)2 + 7O2 + 8Na2CO3 = 2Fe2O3 + 8Na2CrO4 + 8CO2
Fe2+ HNO3= Fe(NO3)3+HFe2 + 6HNO3 = 2Fe(NO3)3 + 6H
FeOCrO3+K2CO3+O2=K2CrO4+CO2+Fe2O34FeOCrO3 + 4K2CO3 + O2 = 4K2CrO4 + 4CO2 + 2Fe2O3
FeCl2(aq) + Ag3PO4(aq) =Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe(NO3)3(aq) +Na2SO4(aq) = Fe2(SO4)3 + NaNO32Fe(NO3)3(aq) + 3Na2SO4(aq) = Fe2(SO4)3 + 6NaNO3
Fe(NO3)3(aq) + Na2S2O3(aq) = Fe(S2O3)3 + Na2NO3Fe(NO3)3(aq) + 3Na2S2O3(aq) = Fe(S2O3)3 + 3Na2NO3
Fe(NO3)3(aq) + NaCl(aq) = FeCl3 + NaNO3Fe(NO3)3(aq) + 3NaCl(aq) = FeCl3 + 3NaNO3
Fe(NO3)3(aq) + NaOH(aq) = Fe(OH)3 + NaNO3Fe(NO3)3(aq) + 3NaOH(aq) = Fe(OH)3 + 3NaNO3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + 2H3PO4 = 2FePO4 + 3H2OFe2O3 + 2H3PO4 = 2FePO4 + 3H2O
Fe(CH3COO)3 + CuCl2 = Cu(CH3COO)2 +FeCl32Fe(CH3COO)3 + 3CuCl2 = 3Cu(CH3COO)2 + 2FeCl3
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe2 + AgC2H3O2 = Fe(C2H3O2)2 + AgFe2 + 4AgC2H3O2 = 2Fe(C2H3O2)2 + 4Ag
Fe (s) + HNO3 (aq) = Fe2O3 (s) + H2 (g) + NO2 (g)4Fe(s) + 6HNO3(aq) = 2Fe2O3(s) + 3H2(g) + 6NO2(g)
FeS+HNO3=Fe(NO3)3 +NO+S+H2OFeS + 4HNO3 = Fe(NO3)3 + NO + S + 2H2O
FeS2 + O2 + H = Fe(OH)3 + SO42FeS2 + 11O2 + 6H = 2Fe(OH)3 + 4SO4
FeS2 + O2 + H= Fe(OH)3 + SO42FeS2 + 11O2 + 6H = 2Fe(OH)3 + 4SO4
Fe(OH)3 + CH2O = Fe + CO2 + H2O 4Fe(OH)3 + 3CH2O = 4Fe + 3CO2 + 9H2O
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(CO)5 (s) + 2 PF3 (s) + 2 H2 (g) = Fe(CO)2(PF3)2(H2)2 (s) + 3 CO (g)Fe(CO)5(s) + 2PF3(s) + 2H2(g) = Fe(CO)2(PF3)2(H2)2(s) + 3CO(g)
FeO(s)+O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + 2CO0Fe2O3 + CO = 0Fe + CO
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe(OH ) 3 (s)+ H 2 S O 4 (aq)=F e 2 (S O 4 ) 3 (aq)+ H 2 O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe (s) + HNO3 (aq) = Fe2O3 (s) + H2 (g) + NO2 (g)4Fe(s) + 6HNO3(aq) = 2Fe2O3(s) + 3H2(g) + 6NO2(g)
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
F2 + AlCl3 = AlF3 + Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeCl2 + Na2SiO3 = NaCl + FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe(C2H3O2)3 + (NH4)2CO3 = Fe2(CO3)3 + NH4C2H3O22Fe(C2H3O2)3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4C2H3O2
Fe +O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4 + 4H2 = 3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeSO4 = Fe2O3 + SO2 + O24FeSO4 = 2Fe2O3 + 4SO2 + O2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeCl 2 + Na 2 SiO 3 =NaCl+ FeSiO 3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
FeCl3 + N2H4 + KOH = FeCl2 + N2 + KCl + H2O4FeCl3 + N2H4 + 4KOH = 4FeCl2 + N2 + 4KCl + 4H2O
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
FeCl3 + N2H4 + KOH = FeCl2 + N2 + KCl + H2O4FeCl3 + N2H4 + 4KOH = 4FeCl2 + N2 + 4KCl + 4H2O
Fe + HCl = FeCl2 +H2Fe + 2HCl = FeCl2 + H2
FeCl3 (aq) + H2S (g) =Fe2S3 (s) + HCl (aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe(OH)2+O2+H2O=Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeSO4 + Kf = FeKf SO4FeSO4 + Kf = FeKfSO4
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeS=Fe+S22FeS = 2Fe + S2
Fe+O2=FeO2Fe + O2 = 2FeO
F + 2Xe = F4 Xe4F + Xe = F4Xe
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 + H20 = Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe(OH)3(s)+H2SO4(aq) = Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + CO = Fe + CO0Fe2O3 + CO = 0Fe + CO
FeCl3 (aq) + H2S (g) = Fe2S3 (s) + HCl (aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO2 = Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
F2(g) + NaBr(aq)= Br2 + NaF(aq)F2(g) + 2NaBr(aq) = Br2 + 2NaF(aq)
Fe(OH)3+H2SO4= Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl 2 + H 2 O + HCl = FeCl 3 + H 2 O 0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2+ + Cl2 = Fe3+ + 2Cl0Fe2+ + Cl2 = 0Fe3+ + 2Cl
Fe2+ + Ag+ = Fe3+ + Ag-3Fe2+ + Ag+ = -2Fe3+ + Ag
FeS2(s) + O2(g) = Fe2O3(s) + SO2(g)4FeS2(s) + 11O2(g) = 2Fe2O3(s) + 8SO2(g)
Fe(II)SO4 + AgNO3 = Fe(II)NO3 + AgSO4Fe(II)SO4 + AgNO3 = Fe(II)NO3 + AgSO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+6C = Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS + O2 =Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(CIO4)2(aq) +K2CO3(aq)= FeCO3(s) +2KCIO4(aq)Fe(CIO4)2(aq) + K2CO3(aq) = FeCO3(s) + 2KCIO4(aq)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS+O2=Fe2O3+2SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(CO3)3(s) = Fe2O3(s) + CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 +3CO = 2Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + 2HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(ClO4)3+Pb(OH)2=FeCl3+Pb3O4+H2OFe(ClO4)3 + 36Pb(OH)2 = FeCl3 + 12Pb3O4 + 36H2O
FeC2O4*2H2O(s)=FeCO3(s)+H2O(g)+CO(g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeC2O4*2H2O(s)+O2(g)=Fe2O3(s)+H2O(g)+CO2(g)4FeC2O4*2H2O(s) + 3O2(g) = 2Fe2O3(s) + 8H2O(g) + 8CO2(g)
FeC2O4*2H2O(s)+O2(g)=FeO(s)+H2O(g)+CO2(g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
FeCl3+SnCl2=FeCl2+SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3O4(s)+H2(g)=Fe(s)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s) + CuCl(aq) = FeCl2(aq) + Cu(s)Fe(s) + 2CuCl(aq) = FeCl2(aq) + 2Cu(s)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe (OH) 3 (s)+ H 2 SO 4 (aq)=Fe 2 ( SO 4 ) 3 (aq)+ H 2 O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe2O3 (s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+HNO3=Fe(NO3)2+NO2+H2OFe + 4HNO3 = Fe(NO3)2 + 2NO2 + 2H2O
FeO(s) + HNO3(aq) = Fe(NO3)2(aq) + H2O(l)FeO(s) + 2HNO3(aq) = Fe(NO3)2(aq) + H2O(l)
FeO(s) + HNO3(aq) = Fe(NO3)2(aq) + H2O(l)FeO(s) + 2HNO3(aq) = Fe(NO3)2(aq) + H2O(l)
FeC2O4*2H2O + O2 = FeO + H2O + CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + HCl + H2OFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2HCl + 2H2O
FeS2 +O2 =Fe2O3 +SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(ClO4)2+K2S=FeS+2KClO4Fe(ClO4)2 + K2S = FeS + 2KClO4
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2 + OH = Fe(OH)2Fe2 + 4OH = 2Fe(OH)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS + HNO3 = Fe(NO3)3 + NO + S8 + H2O 8FeS + 32HNO3 = 8Fe(NO3)3 + 8NO + S8 + 16H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeC2O4*2H2O(s) + O2(g) = FeO(s) + H2O(g) + CO2(g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeC2O4*2H2O = FeCO3 + H2O + COFeC2O4*2H2O = FeCO3 + 2H2O + CO
FeC2O4 2H2O+O2=Fe2O3+H2O+CO24FeC2O42H2O - 73O2 = 2Fe2O3 + 4H2O + 8CO2
FeC2O4 2H2O+O2=FeO+H2O+CO22FeC2O42H2O - 37O2 = 2FeO + 2H2O + 4CO2
FeC2O4 2H2O+O2=FeO+H2O+CO22FeC2O42H2O - 37O2 = 2FeO + 2H2O + 4CO2
FeC2O4 2H2O+O2=FeO+H2O+CO22FeC2O42H2O - 37O2 = 2FeO + 2H2O + 4CO2
Fe(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
Fe3O4(s)+Al(s)=Fe(s)+Al2O3(s)3Fe3O4(s) + 8Al(s) = 9Fe(s) + 4Al2O3(s)
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
FeSO4+KMnO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2020FeSO4 + 0KMnO4 + 10H2SO4 = 0MnSO4 + 10Fe2(SO4)3 + 0K2SO4 + H20
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3 (aq) + H2S (g) =Fe2S3 (s) + HCl (aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe3O2+ CO2= Fe+CO20Fe3O2 + CO2 = 0Fe + CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 +H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4 + H2=Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeSO4+H2SO4+2HNO3=Fe2(SO4)3+2NO+H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe2+ + H+ +NO3-=Fe3+ +NO +H2O-9Fe2+ + 4H+ + NO3- = -6Fe3+ + NO + 2H2O
Fe+O2=FeO32Fe + 3O2 = 2FeO3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+HNO3=Fe (NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe(s) +HNO3(aq) = Fe(NO3)3 (aq) + H2 (g)2Fe(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2(g)
Fe(s)+O2(g)=Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe2(CO3)3 (aq) + 6HCl(aq) = 2FeCl3 (aq) + 3H2O (l) +3CO2 (g)Fe2(CO3)3(aq) + 6HCl(aq) = 2FeCl3(aq) + 3H2O(l) + 3CO2(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS(s)+HCl(aq) = FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeC2O4*2H2O=FeCO3+H2O+COFeC2O4*2H2O = FeCO3 + 2H2O + CO
FeC2O4*2H2O+O2 = FeO+H2O+CO22FeC2O4*2H2O + O2 = 2FeO + 4H2O + 4CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
F e 2 O 3 + H 2 S O 4 = F e 2 (S O 4 ) 3 + H 2 OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3+HBr=FeBr3+H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
FePO4 + NH4SCN = Fe(SCN)2 + (NH4)2PO4FePO4 + 2NH4SCN = Fe(SCN)2 + (NH4)2PO4
Fe(s)+AlSO4(aq)=FeSO4(aq)+Al(s)Fe(s) + AlSO4(aq) = FeSO4(aq) + Al(s)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)= Fe2(SO4)3(aq)+H2O2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe( s) + Cl 2( g) = FeCl 3( s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeC2O4*2H2O(s) = FeCO3(s) + H2O(g) + CO(g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeS2 + O2 + H20 = Fe(OH)3 + H2SO420FeS2 + 110O2 + 7H20 = 20Fe(OH)3 + 40H2SO4
Fe(s)+ HCl(aq) = FeCl2(aq)+H2(g) Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
Fe(s) + HCl(aq) = FeCl2(aq) +H2(g) Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
FeSCN + 6HCl = FeCl + H + SCNFeSCN + HCl = FeCl + H + SCN
Fe(OH)3 +H2SO4= Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe+H2SO4 =FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe2O3 + HNO3 = Fe(NO3)3 +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3 + HNO3 = Fe(NO3)3 +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe+S2=Fe2S34Fe + 3S2 = 2Fe2S3
FeCO3(s)+H2CO3(aq)=Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe2O3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe3O4 + Al = Fe + Al2O33Fe3O4 + 8Al = 9Fe + 4Al2O3
Fe(s)+ O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCrO4 + K2CO3 + O2 = Fe2O3 + K2CrO4+CO24FeCrO4 + 4K2CO3 + O2 = 2Fe2O3 + 4K2CrO4 + 4CO2
Fe (OH) 3 (s)+ H 2 SO 4 (aq)= Fe 2 ( SO 4 ) 3 (aq)+ H 2 O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe (SCN)3 + NaOH = Fe(OH)3 + NaSCNFe(SCN)3 + 3NaOH = Fe(OH)3 + 3NaSCN
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O
Fe(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
FeCl2*4H2O (aq) + H2C2O4 (aq)   = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
Fe(s) +Cl2(g) =FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeBr2(aq) + (NH4)2CO3(aq) = FeCO3(s) + 2NH4Br(aq)FeBr2(aq) + (NH4)2CO3(aq) = FeCO3(s) + 2NH4Br(aq)
FeC2O4*2H2O(s) = FeCO3(s) + H2O(g) + CO(g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeCl3 + 3 KSCN = Fe(SCN)3 + 3 KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl3 + 3 KSCN = Fe(SCN)3 + 3 KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl2*4H2O (aq) + H2C2O4 (aq) = FeC2O4*2H2O (s) + H2O (l) + HCl (aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeCl2*4H2O+ H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl2*4H2O + H2C2O4 =FeC2O4*2H2O + H2O+ HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeC2O4*2H2O(s) + O2(g)=FeO(s) + H2O(g) + CO2(g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeCl2 * 4H2O(aq) + H2C2O4(aq) = FeC2O4 * 2H2O(s) + H2O(l) + HCl(aq)FeCl2*4H2O(aq) + H2C2O4(aq) = FeC2O4*2H2O(s) + 2H2O(l) + 2HCl(aq)
FeC2O4 * 2H2O(s) + O2(g) =FeO(s) + H2O(g) + CO2(g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeC2O4*2H2O(s) = FeCO3(s) + H2O(g) + CO(g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeC2O4*2H2O(s) = FeCO3(s) + H2O(g) + CO(g)FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
Fe +O= Fe2O32Fe + 3O = Fe2O3
FeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + H2O + HClFeCl2*4H2O + H2C2O4 = FeC2O4*2H2O + 2H2O + 2HCl
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeC2O4*2H2O = FeCO3 + H2O + COFeC2O4*2H2O = FeCO3 + 2H2O + CO
Fe(OH)3 +H2SO4 = Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeCl3+H2S=FeCl+S+HClFeCl3 + H2S = FeCl + S + 2HCl
Fe3O4 + HNO3 = Fe(NO3)3 +NH4NO3 + H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + NH4NO3 + 35H2O
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeCl3+H2S=FeCl+S+HClFeCl3 + H2S = FeCl + S + 2HCl
FeCl3+H2S=FeCl+S+HClFeCl3 + H2S = FeCl + S + 2HCl
Fe3O4 + HNO3 = Fe(NO3)3 +N2 + H2O10Fe3O4 + 92HNO3 = 30Fe(NO3)3 + N2 + 46H2O
Fe3O4 + HNO3 = Fe(NO3)3 +NH4NO3 + H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + NH4NO3 + 35H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(NO3)3+K3PO4=FePO4+K3(NO3)3Fe(NO3)3 + K3PO4 = FePO4 + K3(NO3)3
Fe(NO3)3+K3PO4=FePO4+K3(NO3)3Fe(NO3)3 + K3PO4 = FePO4 + K3(NO3)3
Fe + KOH + NO3 = FeOH + NH3 + KFe + KOH + 0NO3 = FeOH + 0NH3 + K
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3 + H2SO3 =Fe2(SO3)3 + H2O 2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H2 2Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(s) + Cl2(g) = FeCl2(s)Fe(s) + Cl2(g) = FeCl2(s)
Fe(s) + Cl(g) = FeCl(s)Fe(s) + Cl(g) = FeCl(s)
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + HClO4 = Fe(ClO4)3 + H2O Fe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
FeCl2(aq)+KMnO4(aq)+HCl3(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)21FeCl2(aq) + KMnO4(aq) + 8HCl3(aq) = 21FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
FeCl2(aq)+KMnO4(aq)+HCl3(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)21FeCl2(aq) + KMnO4(aq) + 8HCl3(aq) = 21FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe(s) + HCl(aq) = FeCl3(aq) + H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(s)+O2(g)+H2O(g)=Fe(OH)3(s)4Fe(s) + 3O2(g) + 6H2O(g) = 4Fe(OH)3(s)
Fe3O4 + 4H2 = 3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O 10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FE(NO3)2 + H2SO3 = FESO3 + 2HNO3FE(NO3)2 + H2SO3 = FESO3 + 2HNO3
Fe2SO4 = Fe2O3+SO2+SO3-1Fe2SO4 = -1Fe2O3 - 2SO2 + SO3
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl2(aq) + KMnO4(aq) + HCl(aq) = FeCl3(aq) + MnCl2(aq) + H2O(l) + KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
FeO(s) + O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
FeCl3 + MgO = Fe2O3 + MgCl22FeCl3 + 3MgO = Fe2O3 + 3MgCl2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe3O4(s)+Al(s)=Fe(s)+Al2O3(s)3Fe3O4(s) + 8Al(s) = 9Fe(s) + 4Al2O3(s)
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe S2 + O2 = Fe2 O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2=Fe2S3+SO22FeS2 + O2 = Fe2S3 + SO2
Fe (OH) 2 + HNO3 = Fe (NO3)2 + H2OFe(OH)2 + 2HNO3 = Fe(NO3)2 + 2H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HNO3 =Fe(NO3)3 +S+NO2 + H2OFeS + 6HNO3 = Fe(NO3)3 + S + 3NO2 + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeO(s)+C(s)=Fe(s)+CO(g)FeO(s) + C(s) = Fe(s) + CO(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2
Fe2S3+HNO3=Fe(NO3)3+S+NO2+H2OFe2S3 + 12HNO3 = 2Fe(NO3)3 + 3S + 6NO2 + 6H2O
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe++ + Cr2O7-- = Fe+++ + 2Cr+++ O-6Fe++ + Cr2O7-- = -6Fe+++ + 2Cr++ + 7O
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe2+ + O2 + H2SO4 = Fe3+ +H2O +SO42--6Fe2+ + 39O2 + 2H2SO4 = -4Fe3+ + 2H2O + 2SO42-
Fe2+ + O2 + H2SO4 = Fe3+ +H2O +SO42--6Fe2+ + 39O2 + 2H2SO4 = -4Fe3+ + 2H2O + 2SO42-
Fe2+ + O2 + H2SO4 = Fe3+ +H2O +SO40Fe2+ + O2 + 2H2SO4 = 0Fe3+ + 2H2O + 2SO4
FeO (s) + O2 (g) = Fe2O3 (s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe (s) + O2 (g) = Fe2O3 (g)4Fe(s) + 3O2(g) = 2Fe2O3(g)
FeCO3 (s) + H2CO3 (aq) = Fe(HCO3)2 (aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 (s) + HNO3 (aq) = Fe(NO3)3 (aq) + H2O (l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe+O=FeOFe + O = FeO
FeCl2 + Cl2 = FeCl32FeCl2 + Cl2 = 2FeCl3
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl 5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
FeSO4 + KCl = FeCl2 + K2SO4FeSO4 + 2KCl = FeCl2 + K2SO4
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+Cl3=FeCl3Fe + Cl3 = FeCl3
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
FeCl3+H2S = FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe + H2 = FeH32Fe + 3H2 = 2FeH3
F2 + O2 = F2O2F2 + O2 = 2F2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(OH)2 = Fe2 + OH2Fe(OH)2 = Fe2 + 4OH
Fe(NH4)2(SO4)2*6H2O + H2C2O4 = (NH4)2SO4 + FeC2O4*2H2O + 4 H2O + H2SO4Fe(NH4)2(SO4)2*6H2O + H2C2O4 = (NH4)2SO4 + FeC2O4*2H2O + 4H2O + H2SO4
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe(OH)2 + H2O2 = Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeS2 + HNO3 = Fe2(SO4)3 + NO2 + H2O + Fe(NO3)3-3FeS2 - 42HNO3 = -2Fe2(SO4)3 - 45NO2 - 21H2O + Fe(NO3)3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O4(s) + H2(g) = Fe(s) + H2O(l)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(l)
Fe2 (SO4 )3 +SO2+ H2O = FeSO4 + H2SO4Fe2(SO4)3 + SO2 + 2H2O = 2FeSO4 + 2H2SO4
FeCr2O4(s) + 8K2CO3(aq) + 7O2(g) = 2Fe2O3(s) + 8K2CrO4(aq) + 8CO2(g)4FeCr2O4(s) + 8K2CO3(aq) + 7O2(g) = 2Fe2O3(s) + 8K2CrO4(aq) + 8CO2(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2 = FeO2 Fe + O2 = FeO2
Fe + H2O(g) = FeO2 + H2(g)Fe + 2H2O(g) = FeO2 + 2H2(g)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
FeO+ CO2 = Fe3O4 + CO3FeO + CO2 = Fe3O4 + CO
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2+KMnO4+HCl = FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeS2+BaCl2+O2=BaSO4+FeCl2+SO2FeS2 + BaCl2 + 3O2 = BaSO4 + FeCl2 + SO2
Fe3O4(s) + H2(g) =Fe(s) + H2O (l)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(l)
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FrClS3+Fr2SnS2 = FrCl + Fr2SnS3FrClS3 + 3Fr2SnS2 = FrCl + 3Fr2SnS3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe +O2 +H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+CuNO3=Cu+Fe(NO3)2Fe + 2CuNO3 = 2Cu + Fe(NO3)2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS+ HCl =FeCl2+ H2SFeS + 2HCl = FeCl2 + H2S
Fe + (NO3)2 + 2K OH = Fe(OH)2 + 2KNO3Fe + (NO3)2 + 2KOH = Fe(OH)2 + 2KNO3
Fe(NO3)2 + 2KOH = Fe(OH)2 + 2KNO3Fe(NO3)2 + 2KOH = Fe(OH)2 + 2KNO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+ HNO3+ H2SO4= Fe(SO4)+ NO+ H2O3FeS + 8HNO3 + 0H2SO4 = 3Fe(SO4) + 8NO + 4H2O
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + HNO3 = Fe(NO3)3 +H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe3O2+H=H2O+FeFe3O2 + 4H = 2H2O + 3Fe
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(ClO3)3+NiO=Fe2O3+Ni(ClO3)22Fe(ClO3)3 + 3NiO = Fe2O3 + 3Ni(ClO3)2
Fe(OH)3 + 3HCl = 3H2O + FeCl3Fe(OH)3 + 3HCl = 3H2O + FeCl3
Fe(OH)3(aq) + 3HCl(aq) = 3H2O + FeCl3Fe(OH)3(aq) + 3HCl(aq) = 3H2O + FeCl3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe3O2+H=H2O+FeFe3O2 + 4H = 2H2O + 3Fe
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 + H2O= HF + O33F2 + 3H2O = 6HF + O3
Fe2O3 + 6HCl = 2FeCl3 + 3H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+C= Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + MgCl2 (aq) + H2O= FeCl2 + Mg(OH)2 + H2Fe + MgCl2(aq) + 2H2O = FeCl2 + Mg(OH)2 + H2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(NO3)3+NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe(s) +O2(g) + H2 O(g) = Fe(OH)3(s)4Fe(s) + 3O2(g) + 6H2O(g) = 4Fe(OH)3(s)
Fe2O3 + S = Fe + SO22Fe2O3 + 3S = 4Fe + 3SO2
FeCl3+NaOH =Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeBr3+ KOH=Fe(OH)3 + KBrFeBr3 + 3KOH = Fe(OH)3 + 3KBr
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe+O+H2O=Fe(OH)2Fe + O + H2O = Fe(OH)2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.