Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+ NaNO3+ HCl = FeCl3+ N2+ NaCl+ H2O10Fe + 6NaNO3 + 36HCl = 10FeCl3 + 3N2 + 6NaCl + 18H2O
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) + H2O(g)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(g)
Fe+F2=FeF32Fe + 3F2 = 2FeF3
Fe(OH)3+H2SO4=Fe(HSO4)3+H2OFe(OH)3 + 3H2SO4 = Fe(HSO4)3 + 3H2O
Fe2O3+ CO = CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+H2CO3=Fe2(CO3)3+H22Fe + 3H2CO3 = Fe2(CO3)3 + 3H2
Fe+H2CO3=Fe(CO3)3+H2Fe + 3H2CO3 = Fe(CO3)3 + 3H2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O4 + SO2=FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O4 + SO2=FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+HBr=FeBr3+H22Fe + 6HBr = 2FeBr3 + 3H2
Fe+H2O= Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS+2HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+2HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeO3 + CO = CO2 + FeFeO3 + 3CO = 3CO2 + Fe
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3 + Ba(OH)2 = BaBr2 + Fe(OH)32FeBr3 + 3Ba(OH)2 = 3BaBr2 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s)+O2(g)+H2O = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(aq)
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
FeBr3 + Ba(OH)2 = Fe(OH)3 + BaBr22FeBr3 + 3Ba(OH)2 = 2Fe(OH)3 + 3BaBr2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(s) + 3H2SO4(g)=Fe2(SO4) + H2(g)2Fe(s) + H2SO4(g) = Fe2(SO4) + H2(g)
Fe(s) + 3H2SO4=Fe2(SO4) + H22Fe(s) + H2SO4 = Fe2(SO4) + H2
F2+CaI2=FCa+I2F2 + 2CaI2 = 2FCa + 2I2
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FrNO3+S=SO2+Fr2O+NO4FrNO3 + 3S = 3SO2 + 2Fr2O + 4NO
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeO+O2+H20=Fe(OH)320FeO + 20O2 + 3H20 = 20Fe(OH)3
Fe2O3(g)+H2(g)=Fe(s)+H2O(s)Fe2O3(g) + 3H2(g) = 2Fe(s) + 3H2O(s)
Fe + HgS = FeS + HgFe + HgS = FeS + Hg
FeO+O2+6H2O=Fe(OH)34FeO + O2 + 6H2O = 4Fe(OH)3
FeO+O2+H20=Fe(OH)320FeO + 20O2 + 3H20 = 20Fe(OH)3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeO + CO2 = FeCO3FeO + CO2 = FeCO3
FeO + CO2 = Fe2(CO3)22FeO + 2CO2 = Fe2(CO3)2
FeCl2+K2S= K2Cl2+FeSFeCl2 + K2S = K2Cl2 + FeS
Fe(NO3)3 +NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe(NO3)3 +NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe(NO3)3 +NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe(NO3)3 +NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe2O3+SO2=FeS+O22Fe2O3 + 4SO2 = 4FeS + 7O2
FeO + O2 + H2O = Fe(OH)34FeO + O2 + 6H2O = 4Fe(OH)3
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3+NH3+H2O=Fe(OH)3+NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe(NO3)3 = Fe2O3 + NO2 + O24Fe(NO3)3 = 2Fe2O3 + 12NO2 + 3O2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+++ + NO2- + H2O = Fe++ + 2H+ + NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FE+O2=FE3+O40FE + 2O2 = 0FE3 + O4
Fe(OH)3 (s) = Fe2O3 (s) + H2O 2Fe(OH)3(s) = Fe2O3(s) + 3H2O
FeCl3+Na2CO3 = NaCl+Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
FeBr2+ Br2+ Na2CO3 + = NaBr + CO2 + FeO + Fe2O3-1FeBr2 + Br2 + 0Na2CO3+ = 0NaBr + 0CO2 - 3FeO + Fe2O3
Fe + CuSO4 = Fe3SO4 + Cu26Fe + 2CuSO4 = 2Fe3SO4 + Cu2
Fe + CuSO4 = FeSO4 + Cu22Fe + 2CuSO4 = 2FeSO4 + Cu2
Fe+H2O = Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe3(PO4)2 + H2C2O4 = FeC2O4 +H3PO4Fe3(PO4)2 + 3H2C2O4 = 3FeC2O4 + 2H3PO4
FeS+6O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+6O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+6O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeSO4+H2O2+H2SO4=Fe2(SO4)3+H2O 2FeSO4 + H2O2 + H2SO4 = Fe2(SO4)3 + 2H2O
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(s) + O2 (g) = Fe2O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+Cl2(g)=FeCl3(s) 2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(s) + HCl(aq) = FeCl3(aq) + H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
FeCl3+(NH4)2S=FeS2+NH4Cl+S-2FeCl3 - 3(NH4)2S = -2FeS2 - 6NH4Cl + S
Fe+H3PO4=H3+FePO4Fe + H3PO4 = H3 + FePO4
Fe(s)+F2(g)=FeF3(s)2Fe(s) + 3F2(g) = 2FeF3(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2 + O2 = Fe2O32Fe2 + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+Ca(OH)2=Fe(OH)3+CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O = FeOFe + O = FeO
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + 4H2 = 3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(s) + CuSO4(aq) = FeSO4(aq) + Cu(s)Fe(s) + CuSO4(aq) = FeSO4(aq) + Cu(s)
Fe(s) + CuSO4(aq) = FeSO4(aq) + Cu(s)Fe(s) + CuSO4(aq) = FeSO4(aq) + Cu(s)
Fe(OH)3 + HCl = 3H2O + FeCl3Fe(OH)3 + 3HCl = 3H2O + FeCl3
Fe2P(s) + S(s) =P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe2O3+ CO =CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O4 + SO2 =FeS + OFe2O4 + 2SO2 = 2FeS + 8O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2 +Br = FeBr2 + ClFeCl2 + 2Br = FeBr2 + 2Cl
Fe+3O2=2Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeSO4 + (NH4)2S = FeS + 4(NH4)2SOFeSO4 + 4(NH4)2S = FeS + 4(NH4)2SO
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
FeO + H2SO4 + H2O2 = Fe2(SO4)3 + H2O2FeO + 3H2SO4 + H2O2 = Fe2(SO4)3 + 4H2O
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + CO = 2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = 2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4+H2O2+H2SO4=Fe2(SO4)3+H2O 2FeSO4 + H2O2 + H2SO4 = Fe2(SO4)3 + 2H2O
Fe (OH)3 + C = CO2 + Fe + H2O4Fe(OH)3 + 3C = 3CO2 + 4Fe + 6H2O
Fe (OH)3 + C = CO2 + Fe + H2O4Fe(OH)3 + 3C = 3CO2 + 4Fe + 6H2O
FeCl3 + Na2CO3 = Fe2 (CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe (OH)3 = Fe2O3 +H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3 +NH3 +H2O = Fe(OH)3 +NH4Cl FeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2+KMnO4+HCl=FeCl3+MnCl2+KCl+H2O5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + KCl + 4H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
FeS + O2 =Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+H2O=HCl+Fe(OH)3FeCl3 + 3H2O = 3HCl + Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeBr3+Ba(OH)2=Fe(OH)3+BaBr22FeBr3 + 3Ba(OH)2 = 2Fe(OH)3 + 3BaBr2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe3O4 + 3CO =3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeS + O2 =Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
F2+AlCl3= Cl2+AlF33F2 + 2AlCl3 = 3Cl2 + 2AlF3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2SO4=FeSO4+H2 Fe + H2SO4 = FeSO4 + H2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3+H3PO4=FePO4+H2OFe2O3 + 2H3PO4 = 2FePO4 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(CO3)3= Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe2O3+H2 =Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2 =Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe + Ci2 = FeCi32Fe + 3Ci2 = 2FeCi3
FeS + O2 =Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe +NaCl=2FeCl +NaFe + NaCl = FeCl + Na
Fe2O3 + CO = Fe + 2CO0Fe2O3 + CO = 0Fe + CO
Fe3O4 + 4H2 =3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO(s)+O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl2 + NaOH = Fe(OH)2 + NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
Fe2O3 + Zn = Fe+ ZnOFe2O3 + 3Zn = 2Fe + 3ZnO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeO + C = CO + FeFeO + C = CO + Fe
FeS + O2 = FeO3 + SO22FeS + 5O2 = 2FeO3 + 2SO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O + CO3 = Fe(OH)3 + CO22Fe + 3H2O + 3CO3 = 2Fe(OH)3 + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2+H2O=HF+O33F2 + 3H2O = 6HF + O3
Fe+H2O=Fe2O3+ H22Fe + 3H2O = Fe2O3 + 3H2
Fe2(SO4)3 + Na(OH) = Fe(OH)3 + Na2SO4Fe2(SO4)3 + 6Na(OH) = 2Fe(OH)3 + 3Na2SO4
Fe2(CO3)3(s) = Fe2O3(s) + CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s) + Cd(NO3)2(aq) = Fe(NO3)3(aq) + Cd(s) 2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe3O4 + CO=FeO + CO2Fe3O4 + CO = 3FeO + CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeO + C = CO + FeFeO + C = CO + Fe
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeO + CO2 = Fe + CO20FeO + CO2 = 0Fe + CO2
Fe + H2O = Fe2O4 + H22Fe + 4H2O = Fe2O4 + 4H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FECO3 + H2CO3 = FE (HCO3)2FECO3 + H2CO3 = FE(HCO3)2
Fe3 +Cl2 = FeCl32Fe3 + 9Cl2 = 6FeCl3
Fe3+ Cl2 = FeCl32Fe3 + 9Cl2 = 6FeCl3
Fe3+ Cl2 = FeCl32Fe3 + 9Cl2 = 6FeCl3
Fe2O3 + Li = Li2O +FeFe2O3 + 6Li = 3Li2O + 2Fe
Fe2O3 + Al = Fe3Al + O26Fe2O3 + 4Al = 4Fe3Al + 9O2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NH3+H2O=Fe(OH)3+NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe2O3+3C=4Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+O2=Fe3O46Fe2O3 - O2 = 4Fe3O4
Fe2O3+Fe3O4=Fe3O40Fe2O3 + Fe3O4 = Fe3O4
Fe2O3+Fe2O=Fe3O45Fe2O3 + Fe2O = 4Fe3O4
Fe2O3+Fe2O4=Fe3O44Fe2O3 - Fe2O4 = 2Fe3O4
Fe2O3+O=Fe3O43Fe2O3 - O = 2Fe3O4
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe + HNO3 = Fe2O3 + H2O + NO22Fe + 6HNO3 = Fe2O3 + 3H2O + 6NO2
Fe2O3+Fe2O=Fe3O45Fe2O3 + Fe2O = 4Fe3O4
Fe2O3+Fe3O2=Fe3O46Fe2O3 + Fe3O2 = 5Fe3O4
Fe2O3+Fe2O2=Fe3O42Fe2O3 + Fe2O2 = 2Fe3O4
Fe2O3+FeO2=Fe3O42Fe2O3 - FeO2 = Fe3O4
Fe2O3+Fe=Fe3O44Fe2O3 + Fe = 3Fe3O4
Fe2O3+Fe2=Fe3O48Fe2O3 + Fe2 = 6Fe3O4
Fe2O3+O2=Fe3O46Fe2O3 - O2 = 4Fe3O4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe3O4 + 4H2 = 3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + 4H2 = 3Fe + 4H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl2 + KMnO4 +HCl = FeCl3 + MnCl2 + H2O +KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
FeCl2 + Na2CO3 =FeCO3 + NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe3 O4 (aq) + Al(s) =Al2 O3 (aq) + Fe(s)3Fe3O4(aq) + 8Al(s) = 4Al2O3(aq) + 9Fe(s)
Fe2O3(s) + CO(g) = Fe(l) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
F2 + WCl4 = FW + ClF2 + 2WCl4 = 2FW + 8Cl
F2 + WCl4 = FCl + W2F2 + WCl4 = 4FCl + W
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2S3 + O2= Fe2O3 + SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2(SO4)3+ KOH= K2SO4+ Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3 + NH3 + H2O = Fe(OH)3 + NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
FeCl3 + Ca(OH)2 = Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
FeCl3 (s) + NaOH (aq) = Fe(OH)3 + NaCl (s)FeCl3(s) + 3NaOH(aq) = Fe(OH)3 + 3NaCl(s)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+H20O=Fe3O4+H23Fe + 4H20O = Fe3O4 + 40H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeO(s)+C(s)=Fe(l)+CO2(g)2FeO(s) + C(s) = 2Fe(l) + CO2(g)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe + O2 =FeO2Fe + O2 = 2FeO
FeCl3 + H2O = 2HCl + Cl + FeO FeCl3 + H2O = 2HCl + Cl + FeO
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + H2O = Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 +Mn =MnCl3 + Fe FeCl3 + Mn = MnCl3 + Fe
FeCl3 +Mg = MgCl3 + FeFeCl3 + Mg = MgCl3 + Fe
FeCl3 +H2S =Fe2S3 +HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe+H2O2=Fe0+H2O0Fe + 0H2O2 = -1Fe0 + H2O
FeS2 + KMnO4 + H2SO4 = Fe(SO4) + MnSO4 + K2SO4 + H2O5FeS2 + 14KMnO4 + 16H2SO4 = 5Fe(SO4) + 14MnSO4 + 7K2SO4 + 16H2O
Fe2+ + O2 + H20 + H2CO3 = Fe(OH)3 + CO20Fe2+ - 5O2 - H20 + 10H2CO3 = 0Fe(OH)3 + 10CO2
FeTiO3+H2SO4=TiO2+FeSO4+H2OFeTiO3 + H2SO4 = TiO2 + FeSO4 + H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2+NaOH=NaF+H2O+O22F2 + 4NaOH = 4NaF + 2H2O + O2
FeCrO4+NaCO3+O2=Na2CrO4+Fe2O3+CO24FeCrO4 + 8NaCO3 - O2 = 4Na2CrO4 + 2Fe2O3 + 8CO2
Fe2O3 + 2Al = Al2O3 + 2FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3 + 2Al = Al2O3 + 2FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+O2+H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 (s) + C (s) =Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
F2+H2=HF22F2 + H2 = 2HF2
Fe(OH)3 + NO3 = Fe2 + NO2 +3H2Fe(OH)3 - 6NO3 = Fe2 - 6NO2 + 6H
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
FeCl+NH4OH= FeOH+NH4ClFeCl + NH4OH = FeOH + NH4Cl
FeCl+NaOH= FeOH+NaClFeCl + NaOH = FeOH + NaCl
FeSO4=Fe+S8+O28FeSO4 = 8Fe + S8 + 16O2
Fe+S8+O2=FeSO48Fe + S8 + 16O2 = 8FeSO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2+FeI3=I2+FeF33F2 + 2FeI3 = 3I2 + 2FeF3
F2+FeI3=I2+FeF33F2 + 2FeI3 = 3I2 + 2FeF3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3(aq)+KOH(aq)=Fe(OH)3(s)+KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(s) + 3KCl(aq)
FeCl3+Na2CO3=NaCl+Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
Fe(NO3)3+LiOH=3 LiNO3+Fe(OH)3 Fe(NO3)3 + 3LiOH = 3LiNO3 + Fe(OH)3
Fe(NO3)3+LiOH=3 LiNO3+Fe(OH)3 Fe(NO3)3 + 3LiOH = 3LiNO3 + Fe(OH)3
Fe + O 2 = Fe 2 O 34Fe + 3O2 = 2Fe2O3
FeS + O2 =Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2(SO4)3 + KOH =K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeS + O2 =Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + Al2O3 = AlCl3 + Fe2O32FeCl3 + Al2O3 = 2AlCl3 + Fe2O3
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe+H2SO4=Fe(SO4)3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
Fe2 O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2O + CO3 = Fe(OH)3 + CO22Fe + 3H2O + 3CO3 = 2Fe(OH)3 + 3CO2
Fe + H2O + Na2CO3 = Fe(OH)3 + Na + CO22Fe + 3H2O + 3Na2CO3 = 2Fe(OH)3 + 6Na + 3CO2
Fe+HNO3=Fe(NO3)3+NH4NO3+H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe2O3(s) + CO(g) = CO2(g) + Fe(s)Fe2O3(s) + 3CO(g) = 3CO2(g) + 2Fe(s)
FeCl3 + AgNO3 = AgCl + Fe(NO3)3FeCl3 + 3AgNO3 = 3AgCl + Fe(NO3)3
FeS+O2= Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2= Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3 (s) + C (s) =Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe2O3 (s) + C (s) =Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe3O4 + Al = Al2O3 + Fe 3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe3O4 + Al = Al2O3 + Fe 3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe(OH)2 = FeO + H2O Fe(OH)2 = FeO + H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl 2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe(OH)2 = FeO + H2OFe(OH)2 = FeO + H2O
Fe(OH)2 =FeO + H2OFe(OH)2 = FeO + H2O
Fe(OH)2 =FeO + H2OFe(OH)2 = FeO + H2O
Fe Cl3 + Na O H = Fe (OH)3 = Na ClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
F2+H2=FHF2 + H2 = 2FH
F+H=FHF + H = FH
FeS2+ O2 = Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3 +NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3(s)+H2(g)=Fe(s)+H2O1Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O1
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
F+Xe=XeF66F + Xe = XeF6
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)2 + H2O + O2 = Fe (OH)34Fe(OH)2 + 2H2O + O2 = 4Fe(OH)3
FeS2 + O2 + H2O = FeO(OH) + H2SO4 4FeS2 + 15O2 + 10H2O = 4FeO(OH) + 8H2SO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe+O2=FeO2Fe + O2 = 2FeO
Fe+O2=FeO2Fe + O2 = 2FeO
Fe(NO3)2+NaOH=FeOH+Na(NO3)2Fe(NO3)2 + NaOH = FeOH + Na(NO3)2
Fe(NO3)2+NaOH=FeOH+Na(NO3)2Fe(NO3)2 + NaOH = FeOH + Na(NO3)2
FeSO4 + K2S = K2(Fe) + SO4(S)FeSO4 + K2S = K2(Fe) + SO4(S)
FeBr2 + Sr(OH)2 = Br2(Sr) + Fe(OH)2FeBr2 + Sr(OH)2 = Br2(Sr) + Fe(OH)2
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4(s) + CO(g) = Fe(s) + CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe + O 2 = Fe 2 O 34Fe + 3O2 = 2Fe2O3
Fe+ H 2 O = Fe 2 O 3 + H 22Fe + 3H2O = Fe2O3 + 3H2
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq)Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
Fe(NO 3 ) 3 + NH 3 + H 2 O = Fe(OH) 3 + NH 4 NO 3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
FeCl3(aq) + Na3PO4(aq) = FePO4(s) + NaCl(aq)FeCl3(aq) + Na3PO4(aq) = FePO4(s) + 3NaCl(aq)
Fe(NO3)2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaNO3(aq)3Fe(NO3)2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaNO3(aq)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2 O3+3H2=2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe3O4(s) + CO(g) = Fe(s) + CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(OH)2 + H2O + O2 = Fe(OH)34Fe(OH)2 + 2H2O + O2 = 4Fe(OH)3
FeS2 + Cl2 = FeCl3 + S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
FeCl3 + MgO = Fe2O3 + MgCl22FeCl3 + 3MgO = Fe2O3 + 3MgCl2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 +Cl2 =FeCl3 +S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
F2 + KBr = KF + Br2F2 + 2KBr = 2KF + Br2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 +Cl2 = FeCl3 +S2Cl2 2FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
Fe O3 + H2== Fe + H2 OFeO3 + 3H2 = Fe + 3H2O
Fe = Fe2 2Fe = Fe2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3 + CO = Fe + CO0Fe2O3 + CO = 0Fe + CO
Fe2O3+Cu=CuO2+Fe2Fe2O3 + 3Cu = 3CuO2 + 4Fe
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl2+AgNO3=Fe(NO3)2+AgClFeCl2 + 2AgNO3 = Fe(NO3)2 + 2AgCl
Fe2(SO4)3 + NaOH = Fe(OH)3 + Na2SO4 Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + H2O + Br2 + Na2CO3 = Fe(OH)3 + NaBr + CO22Fe + 3H2O + 3Br2 + 3Na2CO3 = 2Fe(OH)3 + 6NaBr + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + Cl2 = Fe3Cl6Fe + Cl2 = 2Fe3Cl
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2CO3+HNO3=H2O+CO2+FeNO3Fe2CO3 + 2HNO3 = H2O + CO2 + 2FeNO3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO + C = Fe + CO22FeO + C = 2Fe + CO2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+2Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
FeCl3+H2O2=FeO+O2+Cl-+H2O0FeCl3 + 2H2O2 = 0FeO + O2 + 0Cl- + 2H2O
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(s)+O2=Fe2O3(s)4Fe(s) + 3O2 = 2Fe2O3(s)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe S + O2 = Fe2 O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3(aq) + 3K2S (aq) = Fe2S3 (s) + 3K2SO4 (aq)Fe2(SO4)3(aq) + 3K2S(aq) = Fe2S3(s) + 3K2SO4(aq)
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2 + O2 = Fe2O2 + SO22FeS2 + 5O2 = Fe2O2 + 4SO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + H2O + O2 = Fe(OH)22Fe + 2H2O + O2 = 2Fe(OH)2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeSO4 7 H2O + Ca(OH)2 + O2 =Fe(OH)3 + CaSO4 + H2O4FeSO47H2O + 4Ca(OH)2 - 85O2 = 4Fe(OH)3 + 4CaSO4 + 2H2O
Fe2O3 + C=Fe + COFe2O3 + 3C = 2Fe + 3CO
FeBr2(aq)+Cl2(aq)=FeCl3(aq)+Br2(aq)2FeBr2(aq) + 3Cl2(aq) = 2FeCl3(aq) + 2Br2(aq)
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeO + C = Fe + CO22FeO + C = 2Fe + CO2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3(aq) +KOH(aq) = Fe(OH)3(s) + KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(s) + 3KCl(aq)
Fe+S=FeSFe + S = FeS
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeO+HNO3=Fe(NO3)3+NO+H2O3FeO + 10HNO3 = 3Fe(NO3)3 + NO + 5H2O
FeSO4+K2Cr2O7+H2SO4=Fe2(SO4)3+K2SO4+Cr2(SO4)3+H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2 + NaOH = NaF + O2 + H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
Fe + Cu3(PO4)2 = FePO4 + Cu2Fe + Cu3(PO4)2 = 2FePO4 + 3Cu

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.