Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe(Cl)2 + H2O2 + HCl = Fe(Cl)3 + H2O2Fe(Cl)2 + H2O2 + 2HCl = 2Fe(Cl)3 + 2H2O
Fe(Cl)2 + H2O2 + HCl = Fe(Cl)3 + H2O2Fe(Cl)2 + H2O2 + 2HCl = 2Fe(Cl)3 + 2H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3(aq)+LiOH(aq)=Fe(OH)3(aq)+3LiNO3(aq)Fe(NO3)3(aq) + 3LiOH(aq) = Fe(OH)3(aq) + 3LiNO3(aq)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(ClO4)2 + Na2CO3 = FeCO3 + 2NaClO4Fe(ClO4)2 + Na2CO3 = FeCO3 + 2NaClO4
Fe2O3 + CO=CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl+H2O+HCl=FeCl3+H2O0FeCl + H2O + 0HCl = 0FeCl3 + H2O
FeCO3 + H2SO4 = Fe2(SO4)3 + S + CO2 + H2O6FeCO3 + 10H2SO4 = 3Fe2(SO4)3 + S + 6CO2 + 10H2O
Fe(NO3)3(aq) + H2SO4(aq) = Fe2(SO4)3 +HNO32Fe(NO3)3(aq) + 3H2SO4(aq) = Fe2(SO4)3 + 6HNO3
Fe(NO3)3 + H2SO4 = Fe2(SO4)3 +HNO32Fe(NO3)3 + 3H2SO4 = Fe2(SO4)3 + 6HNO3
Fe + H2SO4= Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2(SO4)3+NaOH=Fe(OH)3+Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
Fe + O2 = Fe2O22Fe + O2 = Fe2O2
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeS2+O2 =Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4+H2SO4+HNO3=Fe2(SO4)3+H2O+NO6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 4H2O + 2NO
Fe2O3 +C= CO2 + Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe + HCl = FeCl + H22Fe + 2HCl = 2FeCl + H2
FeCL2 + H2O + HCL = FeCL3 + H2O0FeCL2 + H2O + 0HCL = 0FeCL3 + H2O
Fe2O3(s) +CO(g) = FeO(s) +CO2(s)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(s)
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe + CuSO4 = Cu + Fe2(SO4)32Fe + 3CuSO4 = 3Cu + Fe2(SO4)3
FeS+HCl=HS+FeClFeS + HCl = HS + FeCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2 + H2SO4 = Fe2(SO4)3 +SO2+H2OFe2 + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe2 + H2SO4 = Fe2(SO4)3 +SO2+H2OFe2 + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeC2O4 * 2H2O + H2C2O4 + H2O2 + K2C2O4 = K3 Fe(C2O4)3 * 3H2O2FeC2O4*2H2O + H2C2O4 + H2O2 + 3K2C2O4 = 2K3Fe(C2O4)3*3H2O
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(O H)3 + H2 S O4 = Fe2 (S O4)3 + H2 O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeBr3+Na2S=Fe2S3+NaBr2FeBr3 + 3Na2S = Fe2S3 + 6NaBr
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe(NO3)2+NaOH=FeOH+Na(NO3)2Fe(NO3)2 + NaOH = FeOH + Na(NO3)2
Fe(NO3)2+NaOH=FeOH+Na(NO3)2Fe(NO3)2 + NaOH = FeOH + Na(NO3)2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeCl3 + H2S= FeCl2 + S +HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe + FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
Fe + FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
FeTiO4 + C + Cl2 = TiCl4 + CO + FeCl32FeTiO4 + 8C + 7Cl2 = 2TiCl4 + 8CO + 2FeCl3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2=Fe2O22Fe + O2 = Fe2O2
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)2 + H2 = Fe + H2OFe(OH)2 + H2 = Fe + 2H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+KHSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + 2KHSO4 + 8H2O
FeCl3 + FeCl2 + NaOH = Fe3O4 + NaCl + H2O2FeCl3 + FeCl2 + 8NaOH = Fe3O4 + 8NaCl + 4H2O
FeCl3 + FeCl2 + NaOH = Fe3O4 + NaCl + H2O2FeCl3 + FeCl2 + 8NaOH = Fe3O4 + 8NaCl + 4H2O
FeCl3 + FeSO4 = Fe3O4 + Cl + S2FeCl3 + FeSO4 = Fe3O4 + 6Cl + S
FE+S=FESFE + S = FES
Fe2(SO4)3 + NH4SO4 + H2 = NH4Fe3(SO4)2(OH)6 + H2SO4 + O2-3Fe2(SO4)3 - 2NH4SO4 - 13H2 = -2NH4Fe3(SO4)2(OH)6 - 7H2SO4 + 6O2
Fe2(SO4)3 + NH4SO4 + H2O = NH4Fe3(SO4)2(OH)6 + H2SO4 + O26Fe2(SO4)3 + 4NH4SO4 + 26H2O = 4NH4Fe3(SO4)2(OH)6 + 14H2SO4 + O2
Fe2(SO4)3 + NH4SO4 + H2O = NH4Fe3(SO4)2(OH)6 + H2SO4 + O26Fe2(SO4)3 + 4NH4SO4 + 26H2O = 4NH4Fe3(SO4)2(OH)6 + 14H2SO4 + O2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeCl2 + NH4C2H3O2 = Fe(C2H3O2)2 + NH4ClFeCl2 + 2NH4C2H3O2 = Fe(C2H3O2)2 + 2NH4Cl
Fe S2 + H N O3 = Fe2 (S O4)3 + N O + H2 S O4 +H2 O2FeS2 + 10HNO3 = Fe2(SO4)3 + 10NO + H2SO4 + 4H2O
Fe S + H N O 3 = Fe (S O 4) 3 + N O + H 2 O + H S O 4-3FeS - 10HNO3 = -3Fe(SO4)3 - 10NO - 8H2O + 6HSO4
Fe S + H N O 3 = Fe (S O 4) 3 + N O + H 2 S O 4 + H 2 OFeS + 4HNO3 = Fe(SO4)3 + 4NO - 2H2SO4 + 4H2O
Fe(SCN)3+KMnO4+H2SO4=Fe2(SO4)+SO3+CO2+HNO3+MnSO4+K2SO410Fe(SCN)3 + 92KMnO4 + 15H2SO4 = 5Fe2(SO4) - 98SO3 + 30CO2 + 30HNO3 + 92MnSO4 + 46K2SO4
Fe(SCN)3+KMnO4+H2SO4=Fe2(SO4)3+SO2+CO2+HNO3+MnSO4+K2SO42Fe(SCN)3 + 42KMnO4 + 3H2SO4 = Fe2(SO4)3 - 57SO2 + 6CO2 + 6HNO3 + 42MnSO4 + 21K2SO4
Fe+H2CO3=Fe2(CO3)3+H22Fe + 3H2CO3 = Fe2(CO3)3 + 3H2
Fe(SCN)3+KMnO4+H2SO4=Fe2(SO4)3+SO2+CO2+HNO3+MnSO4+K2SO42Fe(SCN)3 + 42KMnO4 + 3H2SO4 = Fe2(SO4)3 - 57SO2 + 6CO2 + 6HNO3 + 42MnSO4 + 21K2SO4
Fe(SCN)3+KMnO4+H2SO4=Fe2(SO4)3+SO2+CO2+HNO3+MnSO4+K2SO42Fe(SCN)3 + 42KMnO4 + 3H2SO4 = Fe2(SO4)3 - 57SO2 + 6CO2 + 6HNO3 + 42MnSO4 + 21K2SO4
Fe + S = Fe2S22Fe + 2S = Fe2S2
Fe + S = FeSFe + S = FeS
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS + 2HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
FeSO4=Fe2O+SO3+SO2-2FeSO4 = -1Fe2O - 3SO3 + SO2
FeS + HNO3 = Fe(NO3)3 + S + NO2 + H2OFeS + 6HNO3 = Fe(NO3)3 + S + 3NO2 + 3H2O
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 0SO2 + 3H2
Fe + H2SO4 = Fe(SO4)3 + SO2 + H2Fe + 3H2SO4 = Fe(SO4)3 + 0SO2 + 3H2
Fe + H2SO4 = FeSO4 + SO2 + H2Fe + H2SO4 = FeSO4 + 0SO2 + H2
Fe + HNO3 = Fe(NO3)2 + NO + H2Fe + 2HNO3 = Fe(NO3)2 + 0NO + H2
Fe + HNO3 = Fe(NO3)3 + NO2 + H22Fe + 6HNO3 = 2Fe(NO3)3 + 0NO2 + 3H2
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeO2 + 2H2S = FeS2 + 2H2OFeO2 + 2H2S = FeS2 + 2H2O
FeSO4+AgNO3=Ag2SO4+Fe(NO3)2FeSO4 + 2AgNO3 = Ag2SO4 + Fe(NO3)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO + Al=Al2O3 + Fe3FeO + 2Al = Al2O3 + 3Fe
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3+Na2CO3=Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe+2+No -3 = Fe+3+No-3Fe+2 + No-3 = -3Fe+3 + No
Fe2+No-3 = Fe+3 + No-1Fe2 + 2No-3 = -2Fe+3 + 2No
FeSO4+H2SO4+HNO3=Fe2(SO4)3+NO+H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
FeCl2 + KMnO4 + H2SO4 = Fe2(SO4)3 + Cl2 + MnSO4 + K2SO4 + H2O10FeCl2 + 6KMnO4 + 24H2SO4 = 5Fe2(SO4)3 + 10Cl2 + 6MnSO4 + 3K2SO4 + 24H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=FeO(s)+CO2(g)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(g)
Fe2O3(s)+CO(g)=FeO(s)+CO2(g)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(g)
Fe2O3(s)+CO(g)=FeO(s)+CO2(g)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(g)
Fe2O3(s)+CO(g)=FeO(s)+CO2(g)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + Zn = FeZnFe + Zn = FeZn
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe(OH)2 + O2 + H2O = Fe( OH ) 34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe(OH)2 + O2 + HO2 = Fe(OH)32Fe(OH)2 - O2 + 2HO2 = 2Fe(OH)3
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe3O4 + C = Fe + COFe3O4 + 4C = 3Fe + 4CO
FeI3 + K2S = Fe2S3 +KI2FeI3 + 3K2S = Fe2S3 + 6KI
Fe3O4 + H2SO4 = FeSO4 + Fe2(SO4)3 +H2OFe3O4 + 4H2SO4 = FeSO4 + Fe2(SO4)3 + 4H2O
Fe3O4 + H2SO4 = FeSO4 + Fe(SO4)3 +H2O2Fe3O4 + 8H2SO4 = 5FeSO4 + Fe(SO4)3 + 8H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+O=FeO3Fe + 3O = FeO3
Fe+O=FeO3Fe + 3O = FeO3
Fe+O=FeO3Fe + 3O = FeO3
Fe+O=FeO3Fe + 3O = FeO3
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2 + NaCl = NaF + Cl2F2 + 2NaCl = 2NaF + Cl2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
F2 + NaCl = NaF + Cl2F2 + 2NaCl = 2NaF + Cl2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
F + HgCl2 = HgF + Cl2F + HgCl2 = HgF + Cl2
F + Hg Cl2 = HgF + Cl2F + HgCl2 = HgF + Cl2
Fe + H2SO4 = Fe2(SO4)2+ H22Fe + 2H2SO4 = Fe2(SO4)2 + 2H2
Fe + NO3- + H = Fe2+ + NO + H2O -2Fe + NO3- + 4H = -1Fe2+ + NO + 2H2O
Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3 + K2(ClO4)3Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3 + K2(ClO4)3
Fe+H2O =Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+3H2=2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s) + S(l) = Fe2S3(s) 2Fe(s) + 3S(l) = Fe2S3(s)
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe +H2O=FeO3+H2Fe + 3H2O = FeO3 + 3H2
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
FeCO3+HCl=FeCl2+CO2+H2OFeCO3 + 2HCl = FeCl2 + CO2 + H2O
Fe2O3 + C = CO2 + Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe(NO3)3 = Fe2(O2)3 + O2 + NO22Fe(NO3)3 = Fe2(O2)3 + 0O2 + 6NO2
Fe(NO3)3 = Fe2(O2)3 + O2 + NO22Fe(NO3)3 = Fe2(O2)3 + 0O2 + 6NO2
Fe+HNO3=Fe(NO3)3+NH4NO3+H2O 8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe(NO3)3 = Fe2(O2)3 + O2 + NO22Fe(NO3)3 = Fe2(O2)3 + 0O2 + 6NO2
Fe+H2CO3=Fe(HCO3)2+H2Fe + 2H2CO3 = Fe(HCO3)2 + H2
Fe(OH)3+H2SO4=Fe(HSO4)3+H2OFe(OH)3 + 3H2SO4 = Fe(HSO4)3 + 3H2O
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe(NO3) + Na2OH = Na2(NO3) + FeOHFe(NO3) + Na2OH = Na2(NO3) + FeOH
Fe(NO3) + Na2OH = Na2(NO3) + FeOHFe(NO3) + Na2OH = Na2(NO3) + FeOH
Fe3O4+ KHSO4 + KMnO4= Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10Fe3O4 + 96KHSO4 + 2KMnO4 = 15Fe2(SO4)3 + 2MnSO4 + 49K2SO4 + 48H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+NaBr=FeBr3+NaFe + 3NaBr = FeBr3 + 3Na
Fe+O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+CuCl2=FeCl3+Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe+S=Fe2S22Fe + 2S = Fe2S2
Fe+CuCl2=FeCl3+Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe(OH)3 + H3PO4 =FePO4 + H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
FeCl2 + NH4C2H3O2 = Fe(C2H3O2)2 + NH4ClFeCl2 + 2NH4C2H3O2 = Fe(C2H3O2)2 + 2NH4Cl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe(OH)3 + H3PO4 = FePO4 +H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
F2 + H2O = HF + O22F2 + 2H2O = 4HF + O2
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe(II) + O = Fe(II)OFe(II) + O = Fe(II)O
Fe(II) + O = Fe(II)OFe(II) + O = Fe(II)O
Fe(NO3)3(aq)+Na2S(aq)=Fe2S3(s)+NaNO3(aq)2Fe(NO3)3(aq) + 3Na2S(aq) = Fe2S3(s) + 6NaNO3(aq)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+HC2H3O2=Fe(C2H3O2)3 +H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+S=FeSFe + S = FeS
Fe + HC2H3O2 = Fe(C2H3O2)3 + H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
F2(g)+LiCl(aq)=LiF(aq)+Cl2(l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
FeCl3+H2SO4=Fe2(SO4)3+HCl2FeCl3 + 3H2SO4 = Fe2(SO4)3 + 6HCl
Fe+S=FeSFe + S = FeS
Fe2O3+CO=2 Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + H2(g) =Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3+CO=2 Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + H2(g) =Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
FeCl3 + SO3-- + H2O = FeCl2 + SO4-- + HCl2FeCl3 + SO3-- + H2O = 2FeCl2 + SO4-- + 2HCl
FeCl3 + SO32- + H2O = FeCl2 + SO42- + HCl20FeCl3 + SO32- + 10H2O = 20FeCl2 + SO42- + 20HCl
FeCl3 + SO3 + H2O = FeCl2 + SO4 + HCl2FeCl3 + SO3 + H2O = 2FeCl2 + SO4 + 2HCl
FeO + HNO3 = Fe(NO3)3 + NO + H2O3FeO + 10HNO3 = 3Fe(NO3)3 + NO + 5H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
F +O2 =F2O4F + O2 = 2F2O
FeSO4+BaCl2=BaSO4+FeCl2FeSO4 + BaCl2 = BaSO4 + FeCl2
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NH4)2(SO4)2*6H2O + H2C2O4 = FeC2O4+ NH4+ H+ SO4+ H2OFe(NH4)2(SO4)2*6H2O + H2C2O4 = FeC2O4 + 2NH4 + 2H + 2SO4 + 6H2O
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe(OH)2+ HCl= Fe+ HClO3+ H2O3Fe(OH)2 + HCl = 3Fe + HClO3 + 3H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
FeCl2 + NH4C2H3O2 = Fe(C2H3O2)2 + NH4ClFeCl2 + 2NH4C2H3O2 = Fe(C2H3O2)2 + 2NH4Cl
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl3+SnCl=FeCl2+SnCl43FeCl3 + SnCl = 3FeCl2 + SnCl4
Fe2O3(s) + CO(g) = FeO(s) + CO2(s)Fe2O3(s) + CO(g) = 2FeO(s) + CO2(s)
Fe2S3 +O2= Fe2SO3+SO32Fe2S3 + 9O2 = 2Fe2SO3 + 4SO3
FeBr2+K2S = FeS +2 KBrFeBr2 + K2S = FeS + 2KBr
Fe + H2O = Fe3O4 + H2 3Fe + 4H2O = Fe3O4 + 4H2
F2 + HBr = Br2 + HF = F2 + 2HBr = Br2 + 2HF
Fe2O3+H2O=Fe(HO)3Fe2O3 + 3H2O = 2Fe(HO)3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3=2Fe2O3*3H2O2Fe(OH)3 = Fe2O3*3H2O
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K3Fe(C2O4)3*4H2O + (NH4)2SO4 + H2SO4 + H2O2Fe(NH4)2(SO4)2*6H2O + 3H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)3*4H2O + 2(NH4)2SO4 + 2H2SO4 + 6H2O
Fe(NH4)2((SO4)2)6H2O+H2C2O4+K2C2O4+H2O2=K3Fe((C2O4)2)7H2O+(NH4)2SO4+H2SO4+H2O2Fe(NH4)2((SO4)2)6H2O + 25H2C2O4 + 3K2C2O4 + 3H2O2 = 2K3Fe((C2O4)2)7H2O + 2(NH4)2SO4 + 22H2SO4 + 6H2O
Fe(NH4)2((SO4)2)6H2O+H2C2O4+K2C2O4+H2O2=K3Fe((C2O4)2)7H2O+(NH4)2SO4+H2SO4+H2O2Fe(NH4)2((SO4)2)6H2O + 25H2C2O4 + 3K2C2O4 + 3H2O2 = 2K3Fe((C2O4)2)7H2O + 2(NH4)2SO4 + 22H2SO4 + 6H2O
Fe(NH4)2(SO4)26H2O+H2C2O4+K2C2O4+H2O2=K3Fe(C2O4)27H2O+(NH4)2SO4+H2SO4+H2O2Fe(NH4)2(SO4)26H2O + 51H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)27H2O + 2(NH4)2SO4 + 50H2SO4 + 2H2O
Fe(NH4)2(SO4)26H2O+H2C2O4+K2C2O4+H2O2=K3Fe(C2O4)27H2O+(NH4)2SO4+H2SO4+H2O2Fe(NH4)2(SO4)26H2O + 51H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)27H2O + 2(NH4)2SO4 + 50H2SO4 + 2H2O
Fe2O3+3H2=2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeSO4(aq) + K2Cr2O7(aq) + H2SO4(aq)=Cr2(SO4)3(aq) + Fe2(SO4)3(aq) + K2SO4(aq) + H2O(l)6FeSO4(aq) + K2Cr2O7(aq) + 7H2SO4(aq) = Cr2(SO4)3(aq) + 3Fe2(SO4)3(aq) + K2SO4(aq) + 7H2O(l)
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe(NO3)3 + Mg=MgNO3 + FeFe(NO3)3 + 3Mg = 3MgNO3 + Fe
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeBr 3 (aq) +AgNO 3 (aq) = Fe(NO 3 ) 3 (aq) + AgBr(s)FeBr3(aq) + 3AgNO3(aq) = Fe(NO3)3(aq) + 3AgBr(s)
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + H2SO4 = Fe2(SO4) + H22Fe + H2SO4 = Fe2(SO4) + H2
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K3Fe(C2O4)3*4H2O + (NH4)2SO4 + H2SO4 + H2O2Fe(NH4)2(SO4)2*6H2O + 3H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)3*4H2O + 2(NH4)2SO4 + 2H2SO4 + 6H2O
Fe(NO3)3 + NH4OH = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH4OH = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH4OH = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
FeCl3(aq) +NH4OH(aq) = FeOH(s) + NH4Cl3 (aq)FeCl3(aq) + NH4OH(aq) = FeOH(s) + NH4Cl3(aq)
Fe2 O3(s) + C(s) = Fe(s) + CO (g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeSO4+2HNO3+3H2SO4=Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
FeSO4+2HNO3+3H2SO4=Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+S8=FeS8Fe + S8 = 8FeS
Fe + 2S = FeSFe + S = FeS
Fe + 2S = FeSFe + S = FeS
Fe + S2 = FeS2Fe + S2 = 2FeS
Fe + S = FeSFe + S = FeS
FeNO3(aq) + Na2CO3(aq)= FeCO3(s) + Na2NO3FeNO3(aq) + Na2CO3(aq) = FeCO3(s) + Na2NO3
FeSO4 + H2O2 + H2SO4 = Fe2(SO4)3 + H2O2FeSO4 + H2O2 + H2SO4 = Fe2(SO4)3 + 2H2O
Fe(OH) + HN = FeN + H2OFe(OH) + HN = FeN + H2O
Fe3+ Cu(NO3) 2= Cu2+Fe(NO3)34Fe3 + 18Cu(NO3)2 = 9Cu2 + 12Fe(NO3)3
Fe2 (SO4)3 + BaCl2 = BaSO4+ FeCl3Fe2(SO4)3 + 3BaCl2 = 3BaSO4 + 2FeCl3
Fe2(SO4)3+NaOH = Fe(OH)3+Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
F2 + HBr = Br2 + HF F2 + 2HBr = Br2 + 2HF
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe 2O3+C=CO +FeFe2O3 + 3C = 3CO + 2Fe
Fe(s)+H2O(l)=Fe3O4(s)+3H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS + HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
F2+LiCl=LiF+Cl2F2 + 2LiCl = 2LiF + Cl2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + H2SO4 = Fe2(SO4)3 + H2 2Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(NO3)3+NH4VO3+N2H4CO=Fe3V2O9+H2O+N2+CO218Fe(NO3)3 + 12NH4VO3 + 40N2H4CO = 6Fe3V2O9 + 104H2O + 73N2 + 40CO2
Fe(NO3)3+NH4VO3+N2H4CO=Fe2V2O8+H2O+N2+CO22Fe(NO3)3 + 2NH4VO3 + 4N2H4CO = Fe2V2O8 + 12H2O + 8N2 + 4CO2
Fe(NO3)3+N2H4CO=Fe2O3+H2O+N2+CO22Fe(NO3)3 + 5N2H4CO = Fe2O3 + 10H2O + 8N2 + 5CO2
Fe+HNO3=FeNO3+NO2+H2OFe + 2HNO3 = FeNO3 + NO2 + H2O
Fe3O4+ HCl= FeCl2+ FeCl3+ H2OFe3O4 + 8HCl = FeCl2 + 2FeCl3 + 4H2O
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeO4+CO =FeO + CO2FeO4 + 3CO = FeO + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeSO4(NH4)2SO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + (NH4)2SO4 + H2O10FeSO4(NH4)2SO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 10(NH4)2SO4 + 8H2O
FeSO4(NH4)2SO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + (NH4)2SO4 + H2O10FeSO4(NH4)2SO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 10(NH4)2SO4 + 8H2O
Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3(s) + K2(ClO4)3(aq)Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3(s) + K2(ClO4)3(aq)
Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3(s) + K2(ClO4)3(aq)Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3(s) + K2(ClO4)3(aq)
Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3 + K2(ClO4)3Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3 + K2(ClO4)3
FeCl2 + Cl2 = FeCl32FeCl2 + Cl2 = 2FeCl3
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 =Fe2(SO4)3 + H2Fe + 3H2SO4 = Fe2(SO4)3 + 6H
Fe +H2O =H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe+S=FeSFe + S = FeS
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + Oh = Fe++ + Oh-Fe + 2Oh = Fe++ + 2Oh-
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+ Br2 = Fe+++ + Br-2Fe + 3Br2 = 2Fe+++ + 6Br-
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeCl3+Zn = FeCl2+ZnCl22FeCl3 + Zn = 2FeCl2 + ZnCl2
FeCl3+H2S = FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe2O3+CO = Fe+CO0Fe2O3 + CO = 0Fe + CO
FeCl3+Na2CO3=Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe(CO)5 + 2PF3 + H2 = Fe(CO)2(PF3)2(H)2 + 3COFe(CO)5 + 2PF3 + H2 = Fe(CO)2(PF3)2(H)2 + 3CO
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeCl3 = FeCl2 + Cl22FeCl3 = 2FeCl2 + Cl2
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe 3 O 4 + 3CO = 3Fe + 3CO 2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(ClO4)3+K2CO3=FeCO3+K2(ClO4)3Fe(ClO4)3 + K2CO3 = FeCO3 + K2(ClO4)3
Fe(ClO4)3 + K2CO3 = FeCO3 + K2(ClO4)3Fe(ClO4)3 + K2CO3 = FeCO3 + K2(ClO4)3
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(NO3)3 + KSCN = Fe(SCN)(NO3)2 + KNO3Fe(NO3)3 + KSCN = Fe(SCN)(NO3)2 + KNO3
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeF2 + O2 =FeO + F22FeF2 + O2 = 2FeO + 2F2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeSO4 = Fe2O3 + SO2 +SO32FeSO4 = Fe2O3 + SO2 + SO3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe+HC2H3O2=Fe(C2H3O2)3+H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeS2 + H2O + O2 = FeSO4 + H2SO42FeS2 + 2H2O + 7O2 = 2FeSO4 + 2H2SO4
Fe(ClO4)3 + K2CO3 =FeCO3 + K2(ClO4)3Fe(ClO4)3 + K2CO3 = FeCO3 + K2(ClO4)3
Fe(ClO4)3 + K2CO3 =FeCO3 + K2(ClO4)3 Fe(ClO4)3 + K2CO3 = FeCO3 + K2(ClO4)3
Fe(ClO4)3 (aq) + K2CO3 (aq) =FeCO3 + K2(ClO4)3 Fe(ClO4)3(aq) + K2CO3(aq) = FeCO3 + K2(ClO4)3
Fe + H2O = Fe3O2 + H23Fe + 2H2O = Fe3O2 + 2H2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(CO)5 + 2PF3 + H2 =Fe(CO)2(PF3)2(H)2 + 3COFe(CO)5 + 2PF3 + H2 = Fe(CO)2(PF3)2(H)2 + 3CO
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl2 (aq) + Ag3PO4 (aq) = Fe3(PO4)2 (aq) + AgCl (s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
FeS2 + Na2O2 = Fe2O3 + Na2SO4 + Na2O2FeS2 + 15Na2O2 = Fe2O3 + 4Na2SO4 + 11Na2O
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe3O4 + H2 = Fe +H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe2 + O2 = Fe2O32Fe2 + 3O2 = 2Fe2O3
FeCl2 + 2NaCHO3 = NaCl + CO2 + Fe(OH)2FeCl2 + 2NaCHO3 = 2NaCl + 2CO2 + Fe(OH)2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeSO4+BaCl2=FeCl2+BaSO4FeSO4 + BaCl2 = FeCl2 + BaSO4
FeCl3 + Cu = FeCl2 + CuClFeCl3 + Cu = FeCl2 + CuCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe3++NaOH=Fe3+OH-Na-1Fe3+ + NaOH = -1Fe3 + OH-Na
Fe2O3(s)+CO(g)=Fe(s)+CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS+O2 +H2O = Fe(OH)3 +SO42- + H+2FeS + 43O2 + 4H2O = 2Fe(OH)3 + 2SO42- + 2H+
Fe3 +NaOH=Fe3NaOHFe3 + NaOH = Fe3NaOH
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3*6H2O + O2 = HCl + H2O + FeO4FeCl3*6H2O - O2 = 12HCl + 18H2O + 4FeO
Fe + H2SO4 = Fe2(SO4)3 + H2 2Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl2 + Cl2= FeCl32FeCl2 + Cl2 = 2FeCl3
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe+H2SO4=Fe(SO4)3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
Fe2O3+SO3= Fe2(SO4)3Fe2O3 + 3SO3 = Fe2(SO4)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO(l)+Mg(l)=Fe(l)+MgO(s) FeO(l) + Mg(l) = Fe(l) + MgO(s)
Fe(NO3)2+Na3PO4= FePO4+Na3(NO3)2Fe(NO3)2 + Na3PO4 = FePO4 + Na3(NO3)2
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(No3)3 + NaBr=FeBr3 +NaNo3Fe(No3)3 + 3NaBr = FeBr3 + 3NaNo3
FeS2 + H2SO4 = Fe2(SO4)3 + SO2 + H2O2FeS2 + 14H2SO4 = Fe2(SO4)3 + 15SO2 + 14H2O
Fe+CuSO4=Fe2(SO4)3+Cu2Fe + 3CuSO4 = Fe2(SO4)3 + 3Cu
Fe2O3 + Pb(NO3)2 = Fe(NO3)3 + PbOFe2O3 + 3Pb(NO3)2 = 2Fe(NO3)3 + 3PbO
Fe2O3 + HMnO2 = Fe(MnO2)3 + H2OFe2O3 + 6HMnO2 = 2Fe(MnO2)3 + 3H2O
Fe2O4 + H2 = Fe + H2OFe2O4 + 4H2 = 2Fe + 4H2O
Fe2O3(s) + CO(g) = Fe(l) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe + HCl = Fe Cl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + H Br = Fe Br3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+H2O=Fe2O4+H22Fe + 4H2O = Fe2O4 + 4H2
Fe+Br2=2FeBr2Fe + Br2 = FeBr2
Fe(OH)3+HNO3=Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
FeCl2(aq) + Ag3PO4(aq) = Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe2O3 + CO= 2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS + HNO3 + H2O = Fe(NO3)3 + Fe2(SO4)3 + NH4NO324FeS + 78HNO3 + 15H2O = 8Fe(NO3)3 + 8Fe2(SO4)3 + 27NH4NO3
FeS + HNO3 + H2O = Fe(NO3)3 + Fe2(SO4)3 + NH4NO324FeS + 78HNO3 + 15H2O = 8Fe(NO3)3 + 8Fe2(SO4)3 + 27NH4NO3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(NO3)2 + KHSO4 = Fe2(SO4)3 + NO + H2O + K2SO4 + Fe(NO3)39Fe(NO3)2 + 12KHSO4 = 2Fe2(SO4)3 + 3NO + 6H2O + 6K2SO4 + 5Fe(NO3)3
Fe2S3 + H2O + O2 = Fe(OH)3 + S 2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + S = FeSFe + S = FeS
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + MnO2 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + Cl22FeCl3 + 3MnO2 + 6H2SO4 = Fe2(SO4)3 + 3MnSO4 + 6H2O + 3Cl2
FeCl3 + MnO2 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + Cl22FeCl3 + 3MnO2 + 6H2SO4 = Fe2(SO4)3 + 3MnSO4 + 6H2O + 3Cl2
FeCl3 + Zn = Fe + ZnCl22FeCl3 + 3Zn = 2Fe + 3ZnCl2
Fe +H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+ Cl =FeCl2Fe + 2Cl = FeCl2
Fe+ HCl =FeCl2+ H2Fe + 2HCl = FeCl2 + H2
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + Br2(l) = FeBr3(s) 2Fe(s) + 3Br2(l) = 2FeBr3(s)
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
FeO + O2 + H2O = Fe(OH)34FeO + O2 + 6H2O = 4Fe(OH)3
FeSO3+HBr=FeBr2+H2O+SO2FeSO3 + 2HBr = FeBr2 + H2O + SO2
FeAsS + O2 = Fe2O3 + As4O6+ SO24FeAsS + 10O2 = 2Fe2O3 + As4O6 + 4SO2
FeAsS + O2 = Fe2O3 + As4O5 + SO28FeAsS + 19O2 = 4Fe2O3 + 2As4O5 + 8SO2
FeAsS + O2 = Fe2O3 + As4O5 + SO28FeAsS + 19O2 = 4Fe2O3 + 2As4O5 + 8SO2
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + CO2 =Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
FeO + O2 + H2O = Fe(OH)34FeO + O2 + 6H2O = 4Fe(OH)3
FeO + O2 + H2 = Fe(OH)32FeO + 2O2 + 3H2 = 2Fe(OH)3
Fe(SCN)3+KCl+AgNO3=AgSCN+FeCl3+KNO3Fe(SCN)3 + 3KCl + 3AgNO3 = 3AgSCN + FeCl3 + 3KNO3
Fe(SCN)3+KCl+AgNO3=AgSCN+FeNO3+KCl0Fe(SCN)3 + KCl + 0AgNO3 = 0AgSCN + 0FeNO3 + KCl
Fe(SCN)3+3KCl+AgNO3=AgSCN+FeNO3+KCl0Fe(SCN)3 + KCl + 0AgNO3 = 0AgSCN + 0FeNO3 + KCl
Fe(SCN)3+3KCl+AgNO3=AgSCN+FeNO3+KCl0Fe(SCN)3 + KCl + 0AgNO3 = 0AgSCN + 0FeNO3 + KCl
Fe(SCN)3+3KCl+NaOH=Fe(OH)3+ KSCN+NaClFe(SCN)3 + 3KCl + 3NaOH = Fe(OH)3 + 3KSCN + 3NaCl
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3(s)+C(s) = Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe S2 + O2= Fe2 O3 +S O24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+CuSO4= Cu+ FeSO4Fe + CuSO4 = Cu + FeSO4
Fe+S=FeSFe + S = FeS
Fe+S=FeSFe + S = FeS
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4+HNO3+H2SO4=Fe(SO4)2+H2O+NO3FeSO4 + 2HNO3 + 3H2SO4 = 3Fe(SO4)2 + 4H2O + 2NO
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O4+H2= Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+H2SO4=Fe2(SO4)3+SO2+H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(HCO3)2=FeCO3+H2CO3Fe(HCO3)2 = FeCO3 + H2CO3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)3+HIO2=Fe(IO2)3+H2OFe(OH)3 + 3HIO2 = Fe(IO2)3 + 3H2O
Fe(OH)3+HBr=FeBr3+H2OFe(OH)3 + 3HBr = FeBr3 + 3H2O
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 + NaOH = Fe(OH)3 + NaCl FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeSO4+Zn=Fe+Zn(SO4)22FeSO4 + Zn = 2Fe + Zn(SO4)2
Fe+HI=FeI3+H22Fe + 6HI = 2FeI3 + 3H2
Fe+MgO=Fe2O3+Mg2Fe + 3MgO = Fe2O3 + 3Mg
FeCl3+H2S=FeCl2+HCl+S2FeCl3 + H2S = 2FeCl2 + 2HCl + S
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe2O3(s) + C(s) = Fe(s) + CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + MnO4 = Fe2O3 + Mn8Fe + 3MnO4 = 4Fe2O3 + 3Mn
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + H2SO4=Fe2(SO4)3 + H2 2Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeBr3(aq)+AgNo3(aq)=Fe(No3)3(aq)+AgBr(s)FeBr3(aq) + 3AgNo3(aq) = Fe(No3)3(aq) + 3AgBr(s)
Fe2O3 (s) + CO (g) = 2 Fe (s) + CO2 (g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS (s) + HCl (aq) = FeCl2 (aq) + H2S (g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe (s) + O2 (g) = Fe2O3 4Fe(s) + 3O2(g) = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + HNO3= H4N2O3 + Fe(NO3)2 + H20 10Fe + 20HNO3 = 0H4N2O3 + 10Fe(NO3)2 + H20
Fe + HNO3= NH4NO3 + Fe(NO3)2 + H20 10Fe + 20HNO3 = 0NH4NO3 + 10Fe(NO3)2 + H20
Fe + HNO3= NHNO3 + Fe(NO3)2 + H20 10Fe + 20HNO3 = 0NHNO3 + 10Fe(NO3)2 + H20

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.