Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl3 + NaOH = NaCl + Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeSO4 + HBrO + HCl = FeCl3 + HBr + H2SO4 + H2O2FeSO4 + HBrO + 6HCl = 2FeCl3 + HBr + 2H2SO4 + H2O
FeSO4 + HBrO + HCl = FeCl3 + HBr + H2SO4 + H2020FeSO4 + 0HBrO + 60HCl = 20FeCl3 + 0HBr + 20H2SO4 + H20
Fe (s) + H2O (l) =Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+O2(g)+H2O= Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(s)
Fe2O3 + 3CO = 2Fe + 3CO0Fe2O3 + CO = 0Fe + CO
Fe2O3 + 3CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe+S=FeSFe + S = FeS
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 + O2 = Fe2O3 + H2O2Fe(OH)3 + 0O2 = Fe2O3 + 3H2O
Fe3O2 + Al = Al2O3 + Fe3Fe3O2 + 4Al = 2Al2O3 + 9Fe
Fe2O3 + H2O = Fe + H2O0Fe2O3 + H2O = 0Fe + H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+S=FeSFe + S = FeS
Fe(OH)3+H3PO4 = FePO4+H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2 =SO2+Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
F2 + Xe= XeF42F2 + Xe = XeF4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3(aq) + (NH4)2S(aq) = Fe2S3(s) + NH4Cl(aq)2FeCl3(aq) + 3(NH4)2S(aq) = Fe2S3(s) + 6NH4Cl(aq)
Fe2O3+ H2 = Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + 2FeCl3 = 3FeCl2Fe + 2FeCl3 = 3FeCl2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(NO3)2 + Na3(PO4) = Fe(PO4) + Na3(NO3)2Fe(NO3)2 + Na3(PO4) = Fe(PO4) + Na3(NO3)2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
FeS2 + Al = Al2S3 + Fe3FeS2 + 4Al = 2Al2S3 + 3Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe (s) + O2 (g) = Fe2O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(OH)3+BaCl2=Ba(OH)2+FeCl32Fe(OH)3 + 3BaCl2 = 3Ba(OH)2 + 2FeCl3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeAsO3 + (NH4)SiO3 = (NH4)AsO3 + FeSiO3FeAsO3 + (NH4)SiO3 = (NH4)AsO3 + FeSiO3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s) + H2O(g) = FeO(s) + H2(g)Fe(s) + H2O(g) = FeO(s) + H2(g)
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2(g)+NaBr(aq)= F2Br+ NaF2(g) + NaBr(aq) = F2Br + Na
FeCl2 +O2 = FeCl3 + Fe2O312FeCl2 + 3O2 = 8FeCl3 + 2Fe2O3
Fe2+ + H2SO4 + KMnO4 = Fe3+ H2SO4 KMnO40Fe2+ + H2SO4 + KMnO4 = 0Fe3 + H2SO4KMnO4
Fe2P + S = P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
FeS + HNO3 = Fe2(SO4)3 + H2SO4 + NO +H2O2FeS + 6HNO3 = Fe2(SO4)3 - H2SO4 + 6NO + 4H2O
FeS + Na2O2 = Fe2O3 + Na2SO4 + Na2O2FeS + 9Na2O2 = Fe2O3 + 2Na2SO4 + 7Na2O
FeS+O2=Fe2O3+SO34FeS + 9O2 = 2Fe2O3 + 4SO3
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe + H2O = H2 + Fe3O43Fe + 4H2O = 4H2 + Fe3O4
Fe(s)+O2(g)+H2O(l)=Fe(OH2)(aq)Fe(s) + 0O2(g) + H2O(l) = Fe(OH2)(aq)
Fe(s)+O2(g)+H2O(l)=Fe(OH2)Fe(s) + 0O2(g) + H2O(l) = Fe(OH2)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + 4O2 = 2Fe2O3 + 8SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)2 + O2 = Fe2O3 + H2O4Fe(OH)2 + O2 = 2Fe2O3 + 4H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe + CO2 = Fe2O3 + CO2Fe + 3CO2 = Fe2O3 + 3CO
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O4 + CO = Fe + CO2Fe2O4 + 4CO = 2Fe + 4CO2
Fe2O4 + CO = Fe + CO2Fe2O4 + 4CO = 2Fe + 4CO2
Fe2O3 + H3PO4 = FePO4 + H2OFe2O3 + 2H3PO4 = 2FePO4 + 3H2O
FeS2 + H2O2 = Fe(OH)3 + H2SO4 + H2O2FeS2 + 15H2O2 = 2Fe(OH)3 + 4H2SO4 + 8H2O
Fe+CuSO4=Fe2(SO4)3+Cu2Fe + 3CuSO4 = Fe2(SO4)3 + 3Cu
Fe2O3 + CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
F2(g)+KCl(aq)=KF+Cl2F2(g) + 2KCl(aq) = 2KF + Cl2
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl2 + H2O + HCl = FeCl3 + H2O 0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCr2O4 + C = Fe + Cr + COFeCr2O4 + 4C = Fe + 2Cr + 4CO
Fe(OH)2 + O2 +H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe(s)+O2(g)+H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe + O2 + H2O=Fe2+ + OH-8Fe + O2 + 2H2O = 4Fe2+ + 4OH-
Fe2O3 + CO = Fe2O4 + CO2-1Fe2O3 + CO = -1Fe2O4 + CO2
Fe2O3 + S = Fe +SO22Fe2O3 + 3S = 4Fe + 3SO2
Fe + O2 +H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeS +O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
FeS +O2 =Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+3C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3 + 3H2SO4=Fe2(SO4)3 + 6H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(OH2) + H2O + O2 = Fe(OH)34Fe(OH2) + 2H2O + 3O2 = 4Fe(OH)3
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe2O3+ CO =CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(s)+H2O=Fe3O4(s)+H2(g)3Fe(s) + 4H2O = Fe3O4(s) + 4H2(g)
Fe2O3(s)+Al(s)=Fe(l)+Al2O3 (s)Fe2O3(s) + 2Al(s) = 2Fe(l) + Al2O3(s)
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+C = Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O4+SO2=FeS+O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3+ CO =CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3(aq) + KOH(aq) = Fe(OH)3(aq) + KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(aq) + 3KCl(aq)
Fe(s) + H2O(g) = FeO(s) + H2(g)Fe(s) + H2O(g) = FeO(s) + H2(g)
FeS2 + HCl+ HNO3 = FeCl3 + H2SO4 + NO + H2OFeS2 + 3HCl + 5HNO3 = FeCl3 + 2H2SO4 + 5NO + 2H2O
FeS2+O2=Fe2O3+4SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O2+H2=Fe+H2OFe2O2 + 2H2 = 2Fe + 2H2O
Fe2O2+H2=Fe+H2OFe2O2 + 2H2 = 2Fe + 2H2O
Fe + HOH = Fe(OH)3 + H22Fe + 6HOH = 2Fe(OH)3 + 3H2
Fe + Fe3+ = Fe2+ -1Fe + Fe3+ = Fe2+
Fe3(PO4)2(aq) + NaCl(aq) = FeCl2(aq) + Na3PO4(aq)Fe3(PO4)2(aq) + 6NaCl(aq) = 3FeCl2(aq) + 2Na3PO4(aq)
Fe2O3 + C = 2Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3 + Be3(PO4)2 = BeCl2 + FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe(s) + H2O(l) = Fe3O4(s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2(C2O4)3 = FeC2O4 + CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe2O3(s) + Al(s) = Fe(l) + Al2O3 (s)Fe2O3(s) + 2Al(s) = 2Fe(l) + Al2O3(s)
F2+I2=IF77F2 + I2 = 2IF7
FeCl2+Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
FeCl2+Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
FeI3 + F = Fe3 + FI3FeI3 + 9F = Fe3 + 9FI
FeI3 + F = Fe + FIFeI3 + 3F = Fe + 3FI
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
F + MgCl2 = Cl + MgF22F + MgCl2 = 2Cl + MgF2
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe3O4 + O2 +H2O = Fe(OH)34Fe3O4 + O2 + 18H2O = 12Fe(OH)3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO = CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCr2O7 + K2CO3 + O2 = Fe2O3 + K2CrO4 + CO2 4FeCr2O7 + 8K2CO3 + O2 = 2Fe2O3 + 8K2CrO4 + 8CO2
Fe + H2SO4 = Fe2 (SO4 )3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 = Fe + O22Fe2O3 = 4Fe + 3O2
F2+I2=IF77F2 + I2 = 2IF7
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO = CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO = CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
F2 + K3P = K + PF33F2 + 2K3P = 6K + 2PF3
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + HCl= FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeO+CO = Fe + CO2FeO + CO = Fe + CO2
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3+3CO= Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe+CL2=FeCL2Fe + CL2 = FeCL2
F2+S=SF63F2 + S = SF6
F2+S=SFF2 + 2S = 2SF
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl2+H2O=Fe3O4+HCl+H23FeCl2 + 4H2O = Fe3O4 + 6HCl + H2
Fe + H2SO4 = Fe2 (SO4 )3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+H2SO4=H2S+FeSO4FeS + H2SO4 = H2S + FeSO4
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3+Na2CO3=Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeTiO3 + H2SO4 = TiO2 + FeSO4 + H2OFeTiO3 + H2SO4 = TiO2 + FeSO4 + H2O
FeS + O2 = Fe2 O3 + S O24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 + H2O = Fe(OH)2(Aq)2Fe + O2 + 2H2O = 2Fe(OH)2(Aq)
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe (OH)3+H3PO4=FePO4+H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fr + H2O = 2FrOH + H22Fr + 2H2O = 2FrOH + H2
Fe2O3 + CO = Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+O2(g) = Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2=SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe3O4 + Al = Al2O3+ Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(CO3) (aq) + Sr (s)= Fe (s) + Sr (CO3)Fe(CO3)(aq) + Sr(s) = Fe(s) + Sr(CO3)
Fe2O3 + 2 H3PO4 = 2 FePO4 + 6 H2OFe2O3 + 2H3PO4 = 2FePO4 + 3H2O
Fe2O3(s) + C(s) = Fe(s) + CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O4(s) + CO(g) = Fe(s) + CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
FeS +O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe +O2 = Fe2O 4Fe + O2 = 2Fe2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS +O2=Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 +CO =Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + C(s) = Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
FeO(s) + C(s) = Fe(l) +CO2(g)2FeO(s) + C(s) = 2Fe(l) + CO2(g)
Fe2S2+O2=Fe2O3+SO22Fe2S2 + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + S = FeSFe + S = FeS
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3+SnCl2=FeCl2+SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + Na2CO3 = NaCl + Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
FeCl3 + Na2CO3 = NaCl + Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
FeCl3 + KOH = Fe (OH)3 + KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
FeO3+CO = Fe+CO2FeO3 + 3CO = Fe + 3CO2
F2+(NH4)3N = N2+NH4F3F2 + 2(NH4)3N = N2 + 6NH4F
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
FeO3+CO =Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s) +O2(g) =Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2P + S = P4S10 + FeS4Fe2P + 18S = P4S10 + 8FeS
Fe2O3 + CO = FeO + CO2Fe2O3 + CO = 2FeO + CO2
FeO3+CO = Fe+CO2FeO3 + 3CO = Fe + 3CO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe (s) + H2O (g) =Fe3O4 (s) + H2 (g) 3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+AgC2H3O2=Fe(CH3COO)2+AgFe + 2AgC2H3O2 = Fe(CH3COO)2 + 2Ag
FeCl3 + 3NaOH = Fe (OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + HCl = FeCl2 + HFe + 2HCl = FeCl2 + 2H
FeS+O2 =Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(NO3)3 + KSCN = FeSCN + K(NO3)3Fe(NO3)3 + KSCN = FeSCN + K(NO3)3
Fe + H2O = Fe(OH)2 +H2Fe + 2H2O = Fe(OH)2 + H2
Fe + H2O = Fe(OH) +H22Fe + 2H2O = 2Fe(OH) + H2
Fe + H2O = FeOH +H22Fe + 2H2O = 2FeOH + H2
Fe2O3 + Li = Li2O + FeFe2O3 + 6Li = 3Li2O + 2Fe
Fe2O3+ CO = CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2 + NO3- + H+ = Fe3+ + SO42- + NO2 + H2O3FeS2 + 499NO3- + 494H+ = Fe3+ + 6SO42- + 499NO2 + 247H2O
FeS2 + O2 + H2O = FeSO4 + H2SO4 2FeS2 + 7O2 + 2H2O = 2FeSO4 + 2H2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2+Al=Al2S3+Fe3FeS2 + 4Al = 2Al2S3 + 3Fe
Fe + Br2 = FeBr3 2Fe + 3Br2 = 2FeBr3
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe2O3 + 3CO = 3CO2 + 2FeFe2O3 + 3CO = 3CO2 + 2Fe
FeO(s) + C(s) = Fe(l) + CO2(g)2FeO(s) + C(s) = 2Fe(l) + CO2(g)
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + H2O(l) = Fe3O4 (s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3 (s) + Al(s) = Fe(l) + Al2O3 (s)Fe2O3(s) + 2Al(s) = 2Fe(l) + Al2O3(s)
Fe2O3 (s) + Al(s) = Fe(l) + Al2O3 (s)Fe2O3(s) + 2Al(s) = 2Fe(l) + Al2O3(s)
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe(OH)2+HCl=FeCl2+2H2OFe(OH)2 + 2HCl = FeCl2 + 2H2O
Fe2O3 + C =Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2 + O2 + H2O = FeSO4 + H2SO4 2FeS2 + 7O2 + 2H2O = 2FeSO4 + 2H2SO4
Fe2(SO4)3 + AgNO3 = Fe(NO3)3 + Ag2SO4Fe2(SO4)3 + 6AgNO3 = 2Fe(NO3)3 + 3Ag2SO4
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe    +    FeCl3  =     FeCl2Fe + 2FeCl3 = 3FeCl2
Fe(OH)3 =Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+ HCl= FeCl2+ H2SFeS + 2HCl = FeCl2 + H2S
Fe3O4 + H2= Fe+ H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO4)3 + AgNO3 = Fe(NO3)3 + Ag2SO4Fe2(SO4)3 + 6AgNO3 = 2Fe(NO3)3 + 3Ag2SO4
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + H2 =Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3 + KOH =K2SO4 + Fe(OH)3 Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2(SO4)3 + KOH =K2SO4 + Fe(OH)3 Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10Fe3O4 + 2KMnO4 + 48H2SO4 = 15Fe2(SO4)3 + K2SO4 + 2MnSO4 + 48H2O
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2O3+3CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2 O3+C O= Fe+C O0Fe2O3 + CO = 0Fe + CO
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+ Al= Fe +Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeCl2 + KOH = Fe(OH)2 + KClFeCl2 + 2KOH = Fe(OH)2 + 2KCl
Fe+CuCl2=FeCl2+Cu Fe + CuCl2 = FeCl2 + Cu
Fe+CuCl2=FeCl2+Cu Fe + CuCl2 = FeCl2 + Cu
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + O2 +H20 = Fe (OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe2(So4)3 + 6 NH3 + 6 H2O = 2 Fe(OH)3 + 3 (NH4)2So4Fe2(So4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2So4
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s) + H2(g)=Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3 +3C = 4Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2 + O2 + H2O = FeSO4 + H2SO4 2FeS2 + 7O2 + 2H2O = 2FeSO4 + 2H2SO4
FeS2 + O2 + H2O = FeSO4 + H2SO4 2FeS2 + 7O2 + 2H2O = 2FeSO4 + 2H2SO4
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
FeCl3 + Na2CO3 = Fe2C3O9 + NaCl 2FeCl3 + 3Na2CO3 = Fe2C3O9 + 6NaCl
Fe+O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe2P(s) + S(s) =P4S10(s) + FeS(s) 4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
FeS + H2SO4 = Fe(SO4)3 + SO2 + H2OFeS + 8H2SO4 = Fe(SO4)3 + 6SO2 + 8H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeO2=Fe+O2FeO2 = Fe + O2
FeO2=Fe+O2FeO2 = Fe + O2
Fe(s) + H2O(l) + O2(g) = Fe(OH)3(s) 4Fe(s) + 6H2O(l) + 3O2(g) = 4Fe(OH)3(s)
Fe + CuCl2 = FeCl2 + Cu Fe + CuCl2 = FeCl2 + Cu
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeCl3+C2H8N2O4+C2H2O4=(NH4)3 (Fe (C2O4)3)+HCl2FeCl3 + 3C2H8N2O4 + 3C2H2O4 = 2(NH4)3(Fe(C2O4)3) + 6HCl
FeS2+O2=SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
FeCl3 + CO+ O2 = FeCO3+ Cl22FeCl3 + 2CO + 2O2 = 2FeCO3 + 3Cl2
FeCl3 + CO2+ O2 = FeCO3+ Cl22FeCl3 + 2CO2 + O2 = 2FeCO3 + 3Cl2
FeCl3 + CO+ O2 = FeCO3+ Cl22FeCl3 + 2CO + 2O2 = 2FeCO3 + 3Cl2
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeTiO3+H2SO4=TiO2+FeSO4+H2OFeTiO3 + H2SO4 = TiO2 + FeSO4 + H2O
Fe2O3 + 6HF = 2FeF3 + 3H2OFe2O3 + 6HF = 2FeF3 + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
F2 + H2O = OF2 + HF2F2 + H2O = OF2 + 2HF
F2 + H2O = OF2 + HF2F2 + H2O = OF2 + 2HF
Fe(s) + O2 (g) + 2H2O (l) = Fe(OH)2 (aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
F2(g)+Ca(s)=CaF2(s)F2(g) + Ca(s) = CaF2(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+3KOH=Fe(OH)3+2KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
F2 + BaCl2 = FCl + BaF2 + BaCl2 = 2FCl + Ba
F2 + BaCl2 = BaF + Cl2F2 + 2BaCl2 = 2BaF + 2Cl2
FeCl2+NaOH+H2O2=FeOH3+NaCl+H2O-2FeCl2 - 4NaOH + 3H2O2 = -2FeOH3 - 4NaCl + 4H2O
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HNO3 = Fe(NO3)3 + H22Fe + 6HNO3 = 2Fe(NO3)3 + 3H2
Fe3O4 + CO = Fe +CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe(s)+S8(s)=Fe2S3(s) 16Fe(s) + 3S8(s) = 8Fe2S3(s)
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe+H2O=FeO2+H2Fe + 2H2O = FeO2 + 2H2
Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
Fe+H2=FeH32Fe + 3H2 = 2FeH3
F2+O2=F2O2F2 + O2 = 2F2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=FeO2Fe + O2 = 2FeO
FeCl2 + O2 = FeO + Cl22FeCl2 + O2 = 2FeO + 2Cl2
FeCl2 + O2 = FeO + Cl22FeCl2 + O2 = 2FeO + 2Cl2
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + NH4OH = Fe (OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3+K4Fe(CN)6=KFe2(CN)6+KClFeCl3 + K4Fe(CN)6 = KFe2(CN)6 + 3KCl
FeCl3+H2O=Fe(OH)3+HClFeCl3 + 3H2O = Fe(OH)3 + 3HCl
Fe(OH)2=Fe+OHFe(OH)2 = Fe + 2OH
Fe(OH)2=Fe+OHFe(OH)2 = Fe + 2OH
Fe2O3 + HNO3 = Fe(NO3)3 + NO + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO + 3H2O
FeS+HNO3=Fe(NO3)3+Fe2(SO4)3+NO+H2O3FeS + 12HNO3 = Fe(NO3)3 + Fe2(SO4)3 + 9NO + 6H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeS+HNO3=Fe(NO3)3+NO2+S+H2OFeS + 6HNO3 = Fe(NO3)3 + 3NO2 + S + 3H2O
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
Fe2(SO4)3 + Ag(ClO4) = Fe(ClO4)3 + Ag2(SO4)Fe2(SO4)3 + 6Ag(ClO4) = 2Fe(ClO4)3 + 3Ag2(SO4)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 2CO = 2Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(HCO3)3 + CaO = Fe2O3 + Ca(HCO3)22Fe(HCO3)3 + 3CaO = Fe2O3 + 3Ca(HCO3)2
Fe + CuCl2 = FeCl2 + CuFe + CuCl2 = FeCl2 + Cu
FeS2+O2=SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe +O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3 = Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s)+H2(g)= Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
FeS+O2=FeO3+SO22FeS + 5O2 = 2FeO3 + 2SO2
FeO3 + CO = Fe + CO2 FeO3 + 3CO = Fe + 3CO2
F2 + NaOH = O2 + H2O + NaF2F2 + 4NaOH = O2 + 2H2O + 4NaF
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(So4)3(Aq) + Nh4Oh(Aq) = Fe(Oh)3(s) + (Nh4)2So4(Aq)Fe2(So4)3(Aq) + 6Nh4Oh(Aq) = 2Fe(Oh)3(s) + 3(Nh4)2So4(Aq)
Fe(NO3)3 + Mg = Fe + Mg(NO3)2 2Fe(NO3)3 + 3Mg = 2Fe + 3Mg(NO3)2
Fe3O4 + CO = Fe +CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeO + Br2 = FeBr2 + O22FeO + 2Br2 = 2FeBr2 + O2
Fe2O + N2 = Fe3N + O26Fe2O + 2N2 = 4Fe3N + 3O2
FeSO4+H2SO4=H2S+Fe2O3+H2O-8FeSO4 + 7H2SO4 = -1H2S - 4Fe2O3 + 8H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + S8 = FeS8Fe + S8 = 8FeS
FeS + O2 = 2Fe2O3 + 4SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 +3CO = 2Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3(s) + CO(g) = Fe(l) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
FeO(s) = Fe(s) = O2(g)2FeO(s) = 2Fe(s) + O2(g)
FEO+H2=FE+H2OFEO + H2 = FE + H2O
FEO+H2=FE+H2OFEO + H2 = FE + H2O
Fe(OH)2 + NO2+ H2O = Fe(OH)3 + NH2 6Fe(OH)2 + NO2 + 4H2O = 6Fe(OH)3 + NH2
Fe(OH)2 + NO2+ H2O = Fe(OH)3 + NH26Fe(OH)2 + NO2 + 4H2O = 6Fe(OH)3 + NH2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2+Na2CO3 = FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
FeSO4 +H2SO4+K2Cr2O7=Fe2(SO4)3+Cr2(SO4)3+H2O+K2SO46FeSO4 + 7H2SO4 + K2Cr2O7 = 3Fe2(SO4)3 + Cr2(SO4)3 + 7H2O + K2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3 +H2 =Fe3O4 +H2O3Fe2O3 + H2 = 2Fe3O4 + H2O
F2+GaI3=GaF3+I33F2 + 2GaI3 = 2GaF3 + 2I3
FeCl3+NH4OH = Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(HCO3)3+CaO=Fe2O3+Ca(HCO3)22Fe(HCO3)3 + 3CaO = Fe2O3 + 3Ca(HCO3)2
FeI3(s)+O2(g)=I2(g)+Fe2O3(s)4FeI3(s) + 3O2(g) = 6I2(g) + 2Fe2O3(s)
FeI3(s)+O2(g)=I2(g)+Fe2O3(s)4FeI3(s) + 3O2(g) = 6I2(g) + 2Fe2O3(s)
Fe2O3+ CO = Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe +2HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeO3+H2=Fe+H2OFeO3 + 3H2 = Fe + 3H2O
F2 + NH3 = N2F4 + HF5F2 + 2NH3 = N2F4 + 6HF
Fe + O2 = Fe2O14Fe + O2 = 2Fe2O1
Fe + O2 = Fe2O14Fe + O2 = 2Fe2O1
Fe + O2 = Fe2O14Fe + O2 = 2Fe2O1
Fe + O2 = FeO12Fe + O2 = 2FeO1
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
FeCi3+NaOH=Fe (OH)3+NaCiFeCi3 + 3NaOH = Fe(OH)3 + 3NaCi
Fe(OH)3 + H2SeO4 = Fe2(SeO4)3 + H2O2Fe(OH)3 + 3H2SeO4 = Fe2(SeO4)3 + 6H2O
Fe(OH)3 + H2SeO4 = Fe2(SeO4)3 + H2O2Fe(OH)3 + 3H2SeO4 = Fe2(SeO4)3 + 6H2O
FeCl3 + AgNO3 = FeNO3 + AgCl3FeCl3 + AgNO3 = FeNO3 + AgCl3
Fe+S=FeSFe + S = FeS
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe +Br2=FeBr32Fe + 3Br2 = 2FeBr3
FeO3(s)+CO(g)=Fe(s)+CO2(g)FeO3(s) + 3CO(g) = Fe(s) + 3CO2(g)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+CO=Fe+CO0Fe2O3 + CO = 0Fe + CO
Fe3 + OH = Fe(OH) Fe3 + 3OH = 3Fe(OH)
Fe(OH)2 = FeO + H2OFe(OH)2 = FeO + H2O
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4= Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+C=Fe+CO3Fe2O3 + C = 2Fe + CO3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.