Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeCl2+H2O=FeO+HClFeCl2 + H2O = FeO + 2HCl
FeSO4 + KMnO4 + H2SO4 =Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeCl3 + Zn = ZnCl2 + Fe2FeCl3 + 3Zn = 3ZnCl2 + 2Fe
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe + H2SO4=FeSO4 +H2Fe + H2SO4 = FeSO4 + H2
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O=Fe2O3*2H2O4Fe + 3O2 + 4H2O = 2Fe2O3*2H2O
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe + O2 +H2O = Fe2O3*2H2O4Fe + 3O2 + 4H2O = 2Fe2O3*2H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 =FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 =FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 + HBrO3 + H2SO4 = Fe2(SO4)3 + HBr + H2O6FeSO4 + HBrO3 + 3H2SO4 = 3Fe2(SO4)3 + HBr + 3H2O
Fe(OH)2= Fe2+ 2OH2Fe(OH)2 = Fe2 + 4OH
FeCl2(aq) + Na3PO4(aq) =Fe3(PO4)2(aq) + NaCl(aq)3FeCl2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(aq) + 6NaCl(aq)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe3+CuSO4=Fe2SO4+Cu2Fe3 + 3CuSO4 = 3Fe2SO4 + 3Cu
Fe3+CuSO4=Fe3SO4+CuFe3 + CuSO4 = Fe3SO4 + Cu
Fe + HNO3 = Fe(NO3)2 + H2O +N2O4Fe + 10HNO3 = 4Fe(NO3)2 + 5H2O + N2O
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 +C=Fe+CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 +C=Fe+CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe + V2O3 = Fe2O3 + VO2Fe + 3V2O3 = Fe2O3 + 6VO
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(OH)3(s)+2H=Fe+H2OFe(OH)3(s) + 3H = Fe + 3H2O
Fe(OH)3(s)+2H+SO4=Fe2(SO4)3+H2O2Fe(OH)3(s) + 6H + 3SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeI3 + K2S = Fe2S3 + 3KI2FeI3 + 3K2S = Fe2S3 + 6KI
Fe3O4 +2H2 = 4H2O + Fe3Fe3O4 + 4H2 = 4H2O + Fe3
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
F2+HBr=Br2+HFF2 + 2HBr = Br2 + 2HF
Fe + O2 = Fe2 O3 4Fe + 3O2 = 2Fe2O3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 +H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(s) + H2CO3(aq) = Fe2(CO3)3(s) + H2(g)2Fe(s) + 3H2CO3(aq) = Fe2(CO3)3(s) + 3H2(g)
Fe(s) + H2CO3(aq) = Fe2(CO3)3(s) + H2(g)2Fe(s) + 3H2CO3(aq) = Fe2(CO3)3(s) + 3H2(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + C= Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C= Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + H2O = FeO + HFe + H2O = FeO + 2H
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = FeO + H2Fe + H2O = FeO + H2
Fe + H2O = FeO + H2Fe + H2O = FeO + H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+3H2=2Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
F2+2KBr=Br2+2KFF2 + 2KBr = Br2 + 2KF
Fe+HCl=H2+FeCl32Fe + 6HCl = 3H2 + 2FeCl3
FeSCN + CuCl2= FeCl2 +CuSCNFeSCN + CuCl2 = FeCl2 + CuSCN
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe+++ + SO2 + H2O = Fe++ + SO4-- + H+2Fe+++ + SO2 + 2H2O = 2Fe++ + SO4-- + 4H+
Fe(s) + O2(g)= Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl2 + KMnO4 +H2SO4 = Fe2(SO4)3 + KCl + MnCl2 + Cl2 + H2O16FeCl2 + 6KMnO4 + 24H2SO4 = 8Fe2(SO4)3 + 6KCl + 6MnCl2 + 7Cl2 + 24H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2CO3=Fe2(CO3)3+H22Fe + 3H2CO3 = Fe2(CO3)3 + 3H2
Fe(OH)2+O2+H2O=Fe(OH)4Fe(OH)2 - O2 - 2H2O = 4Fe(OH)
Fe(OH)2+O2+H2O=Fe(OH)4Fe(OH)2 - O2 - 2H2O = 4Fe(OH)
Fe+HNO3=Fe(NO3)3+N2O3+H2O4Fe + 18HNO3 = 4Fe(NO3)3 + 3N2O3 + 9H2O
Fe+HNO3=Fe(NO3)+N2O3+H2O4Fe + 6HNO3 = 4Fe(NO3) + N2O3 + 3H2O
Fe7S8+S2=FeS2Fe7S8 + 3S2 = 7FeS2
Fe1S+S2=FeS22Fe1S + S2 = 2FeS2
FeS1+S2=FeS22FeS1 + S2 = 2FeS2
Fe2SiO4+S2=FeS2+Fe3O4+SiO22Fe2SiO4 + S2 = FeS2 + Fe3O4 + 2SiO2
FeTiO3+S2=FeS2+Fe3O4+TiO24FeTiO3 + S2 = FeS2 + Fe3O4 + 4TiO2
Fe3O4+ S2= Fe2O3+FeS23Fe3O4 + S2 = 4Fe2O3 + FeS2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe3O4 + C = Fe + COFe3O4 + 4C = 3Fe + 4CO
Fe+O2 =Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe3O4 +C = Fe + COFe3O4 + 4C = 3Fe + 4CO
Fe + KIO4 = Fe2O3 + KIO32Fe + 3KIO4 = Fe2O3 + 3KIO3
Fe(s)+O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe+S=FeSFe + S = FeS
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO3=Fe2(SO3)3+H2O2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3 O4 +H2=Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3+ + NO2- + H2O = Fe2+ NO3- + H+2Fe3+ + NO2- + H2O = 3Fe2 + NO3- + 2H+
Fe3+ + NO2- + H2O = Fe2++H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
FE2+O3+C=FE+CO20FE2 + 2O3 + 3C = 0FE + 3CO2
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl2 H2Fe + 2HCl = FeCl2H2
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
Fe + HCl= H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe2(CO3)3 + HClO3 = Fe(ClO3)3+ CO2 + H2OFe2(CO3)3 + 6HClO3 = 2Fe(ClO3)3 + 3CO2 + 3H2O
Fe3+ +NO2-+H2O=Fe2+ +2H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + 2HNO3=Fe(NO3)2 + H2Fe + 2HNO3 = Fe(NO3)2 + H2
Fe2+ + NO3- + 4H+ = Fe3+ + NO(g) + 2H2O(l)-9Fe2+ + NO3- + 4H+ = -6Fe3+ + NO(g) + 2H2O(l)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+HCl= FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS2 + H2O + 3SO2 = H2SO4 + FeSO4FeS2 - 6H2O - 7SO2 = -6H2SO4 + FeSO4
Fe (s) + H2O (l) =Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe+K2Cr2O7+HCl=FeCl2+KCl+CrCl3+H2O3Fe + K2Cr2O7 + 14HCl = 3FeCl2 + 2KCl + 2CrCl3 + 7H2O
Fe+K2Cr2O7+HCl=FeCl3+KCl+CrCl3+H2O2Fe + K2Cr2O7 + 14HCl = 2FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3(s) + H2O(l) = Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe2O3(s) + H2O(l) = Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeSO4 + (NH4)2S = (NH4)2SO4 + FeSFeSO4 + (NH4)2S = (NH4)2SO4 + FeS
Fe+2CuNO3 = Fe(NO3)2+2CuFe + 2CuNO3 = Fe(NO3)2 + 2Cu
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe2O3 + KClO3 + 4KOH = 2K2FeO4 + KCl + 2H2OFe2O3 + KClO3 + 4KOH = 2K2FeO4 + KCl + 2H2O
Fe(OH)3=Fe+OHFe(OH)3 = Fe + 3OH
Fe(s) + Ni(NO3)2(aq) = Fe(NO3)3(aq) + Ni(s)2Fe(s) + 3Ni(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Ni(s)
Fe2S3 + O2 = Fe2O3 + SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe(s)+O2(g)=Fe2O3(g)4Fe(s) + 3O2(g) = 2Fe2O3(g)
Fe(s) + O2 (g) + H2O = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(aq)
Fe2O3(s)+H2=Fe(s)+H2O(g)Fe2O3(s) + 3H2 = 2Fe(s) + 3H2O(g)
FeS+HNO3=Fe2(SO4)2+NO+H4SO4+H2O6FeS + 16HNO3 = 3Fe2(SO4)2 + 16NO + 0H4SO4 + 8H2O
Fe2 (SO4)3+NH3+H2O=Fe (OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe2O3 + Na2S2O3 = FeO + FeSO4 + Na2SO44Fe2O3 + Na2S2O3 = 7FeO + FeSO4 + Na2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2+ + Cr2O72- + H+ = Fe3+ + Cr3+ + H2O-1281Fe2+ + 3Cr2O72- + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Fe(s) + Br2(l) = FeBr3(s)2Fe(s) + 3Br2(l) = 2FeBr3(s)
Fe(s) + Br2(l) = FeBr3(s)2Fe(s) + 3Br2(l) = 2FeBr3(s)
Fe(s)+O2(g)=FeO(s)2Fe(s) + O2(g) = 2FeO(s)
FeS + H2SO4 = FeSO4 + H2SFeS + H2SO4 = FeSO4 + H2S
Fe(OH)3 + 6 NH3 = 6 (Fe(OH)6)3 + 3NH4NO3 + 3H2O-24Fe(OH)3 + 18NH3 = -8(Fe(OH)6)3 + 9NH4NO3 + 45H2O
Fe(NO)3 + 3NH3 = Fe(OH)3 + 3NH4NO3 + 3H2O-2Fe(NO)3 + 0NH3 = -2Fe(OH)3 - 3NH4NO3 + 9H2O
FeCl3(aq)+MgCO3(aq)= FeCO3 + MgCl3FeCl3(aq) + MgCO3(aq) = FeCO3 + MgCl3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS2 + HNO3 = Fe(NO3)3 + NO + H2SO4 + H2OFeS2 + 8HNO3 = Fe(NO3)3 + 5NO + 2H2SO4 + 2H2O
FeO = Fe + O22FeO = 2Fe + O2
Fe2O3 + NH4OH = 2Fe(OH)3 + NH4 + H2O-1Fe2O3 + 0NH4OH = -2Fe(OH)3 + 0NH4 + 3H2O
FeSO4+H2O=Fe(OH)2+H2SO4FeSO4 + 2H2O = Fe(OH)2 + H2SO4
FeS2+H2=Fe+H2SFeS2 + 2H2 = Fe + 2H2S
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + C = Fe +CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeI2 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + K2SO4+ KIO310FeI2 + 26KMnO4 + 44H2SO4 = 5Fe2(SO4)3 + 26MnSO4 + 44H2O + 3K2SO4 + 20KIO3
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + K2SO410FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + 8H2O + K2SO4
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3(s) + C(s) = Fe(s) + CO(g) Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+HNO3=Fe(NO3)2+NO2+H2OFe + 4HNO3 = Fe(NO3)2 + 2NO2 + 2H2O
Fe + MgCl = Mg + FeCl3Fe + 3MgCl = 3Mg + FeCl3
Fe (s) + O2 (g) + H2O (g) = Fe(OH)2 (aq)2Fe(s) + O2(g) + 2H2O(g) = 2Fe(OH)2(aq)
FeCl2 +Na2CO3 = FeCO3 +2NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe+ O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe ++ + H2O2 + H + = Fe +++ + H2O2Fe++ + H2O2 + 2H+ = 2Fe+++ + 2H2O
Fe + CuCl2 = FeCl2 + CuFe + CuCl2 = FeCl2 + Cu
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS2 + H2O + O2 = Fe(SO4)3 + H2SO4-2FeS2 + 2H2O - 9O2 = -2Fe(SO4)3 + 2H2SO4
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
FeO(s) + O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe2(SO4)3 + Ba(NO3)2 = BaSO4 + Fe(NO3)3Fe2(SO4)3 + 3Ba(NO3)2 = 3BaSO4 + 2Fe(NO3)3
Fe(OH)3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3O4(s)+CO(g)=Fe(s)+CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe2 (SO4)3(aq) + NH3(g) + H2O(l) = Fe(OH)3 (s) + (NH4)2 SO4 (aq)Fe2(SO4)3(aq) + 6NH3(g) + 6H2O(l) = 2Fe(OH)3(s) + 3(NH4)2SO4(aq)
Fe2O3 + 3C = 2Fe + 3COFe2O3 + 3C = 2Fe + 3CO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe (s) + O2 (g) = Fe2O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3(S)+C(S)=Fe(S)+CO3(g)Fe2O3(S) + C(S) = 2Fe(S) + CO3(g)
Fe2O3(S)+C(S)=Fe(S)+CO3(g)Fe2O3(S) + C(S) = 2Fe(S) + CO3(g)
Fe3O4(s)+H2(g)=Fe(l)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(l) + 4H2O(g)
Fe + H2O= Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
F2 + AlCl3= AlF3 +Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
F2 + AlCl3= AlF3 +Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeBr3 + Li2SO4= Fe2(SO4)3 + LiBr2FeBr3 + 3Li2SO4 = Fe2(SO4)3 + 6LiBr
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O=FeO+SO2FeS + 3O = FeO + SO2
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
FeS2 + HNO3 = H2SO4 + Fe(NO3)3 + NO + H2OFeS2 + 8HNO3 = 2H2SO4 + Fe(NO3)3 + 5NO + 2H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + S = Fe2S32Fe + 3S = Fe2S3
FeCl2*4H2O + 2 FeCl3*6H2O + 8 NH4OH = Fe3O4 + 8 NH4Cl + 20 H2OFeCl2*4H2O + 2FeCl3*6H2O + 8NH4OH = Fe3O4 + 8NH4Cl + 20H2O
FeCl2*4H2O + 2 FeCl3*6H2O + 8 NH4OH = Fe3O4 + 8 NH4Cl + 20 H2OFeCl2*4H2O + 2FeCl3*6H2O + 8NH4OH = Fe3O4 + 8NH4Cl + 20H2O
Fe2O3 + 3H2O = 2Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + 3 H2O = 2Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3 + H2SO4 = H2O + Fe2(SO4)32Fe(OH)3 + 3H2SO4 = 6H2O + Fe2(SO4)3
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr 2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr 2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe(s)+O2=Fe2O3(s)4Fe(s) + 3O2 = 2Fe2O3(s)
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
F2 + 2 HBr = Br2 + 2 HF F2 + 2HBr = Br2 + 2HF
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + O= Fe2O32Fe + 3O = Fe2O3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe (OH)3 + HBr= FeBr3 + H2OFe(OH)3 + 3HBr = FeBr3 + 3H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
Fe(s) + H2O(l) + O2(g) = Fe(OH)2(s)2Fe(s) + 2H2O(l) + O2(g) = 2Fe(OH)2(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 (aq) + Na3AsO4 (aq) = FeAsO4 + 3NaClFeCl3(aq) + Na3AsO4(aq) = FeAsO4 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 +CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
FeCl3 + 3KSCN = Fe (SCN)3 + 3KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+HNO3=Fe(NO3)3+NH4NO3+H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe+H2O=Fe3O4+H2O0Fe + H2O = 0Fe3O4 + H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + S = FeSFe + S = FeS
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 + 3C = 2Fe + 3COFe2O3 + 3C = 2Fe + 3CO
Fe2O3 + 3C = 2Fe + 3COFe2O3 + 3C = 2Fe + 3CO
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2S3(s)=Fe(s)+S(s)Fe2S3(s) = 2Fe(s) + 3S(s)
Fe+HNO3=Fe(NO3)2+NO+H2O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
Fe+HNO3=Fe(NO3)2+NO+H2O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
FeSO4+SR(OH)2=Fe(OH)2+SRSO4FeSO4 + SR(OH)2 = Fe(OH)2 + SRSO4
F2 +MgCl2 = MgF + Cl2F2 + 2MgCl2 = 2MgF + 2Cl2
FeS+H2SO4=Fe2(SO4)3+SO2+H2O2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O
FeS2+HNO3+HCl=FeCl3+H2SO4+NO+H2OFeS2 + 5HNO3 + 3HCl = FeCl3 + 2H2SO4 + 5NO + 2H2O
Fe+HNO3=Fe(NO3)2+NH4NO3+H2010Fe + 20HNO3 = 10Fe(NO3)2 + 0NH4NO3 + H20
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeS+O3=Fe2O3+SO32FeS + 3O3 = Fe2O3 + 2SO3
Fe(OH)3 + H2SO3 = Fe2(SO3)3 + H2O2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
Fe(OH)3 + H2SO3 = Fe2(SO3)3 + H2O2Fe(OH)3 + 3H2SO3 = Fe2(SO3)3 + 6H2O
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3+3C=2Fe+3COFe2O3 + 3C = 2Fe + 3CO
Fe2(CO3)3 + HBr = FeBr3 + H2O + CO2Fe2(CO3)3 + 6HBr = 2FeBr3 + 3H2O + 3CO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe(OH)3 + H2So4 = Fe2(So4)3 + H2O2Fe(OH)3 + 3H2So4 = Fe2(So4)3 + 6H2O
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+NH3=FeO+N2+H2O3Fe2O3 + 2NH3 = 6FeO + N2 + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + S = Fe2S32Fe + 3S = Fe2S3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeBr3 + K2S = Fe2S3 + KBr2FeBr3 + 3K2S = Fe2S3 + 6KBr
Fe(C2H3O2)2+Li2S=FeS+LiC2H3O2Fe(C2H3O2)2 + Li2S = FeS + 2LiC2H3O2
Fe2O3+CO=Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2+H2O=HF+O33F2 + 3H2O = 6HF + O3
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeCl3 + HBr = FeBr3 + HClFeCl3 + 3HBr = FeBr3 + 3HCl
Fe2O3 + 3CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + K3PO4 = FePO4 + KClFeCl3 + K3PO4 = FePO4 + 3KCl
Fe3O4(s)+O2(g)=Fe2O3(s) 4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(ClO4)2(aq)+K2S(aq)=FeS(s)+2KClO4(aq)Fe(ClO4)2(aq) + K2S(aq) = FeS(s) + 2KClO4(aq)
Fe2O3 +CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS +O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2(SO4)3 + NH4(SCN) = Fe(SCN)3 + (NH4)2SO4Fe2(SO4)3 + 6NH4(SCN) = 2Fe(SCN)3 + 3(NH4)2SO4
FeCl2+NaClO4+H2SO4=Fe(ClO3)3+Na2SO4+NaClO3+H2O2FeCl2 + 13NaClO4 + H2SO4 = 2Fe(ClO3)3 + Na2SO4 + 11NaClO3 + H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe+H2SO4 = Fe3S4 + H2 +H2O3Fe + 4H2SO4 = Fe3S4 - 12H2 + 16H2O
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+O=FeOFe + O = FeO
FeCl3+Mg(OH)2=Fe(OH)3+MgCl22FeCl3 + 3Mg(OH)2 = 2Fe(OH)3 + 3MgCl2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeNO3(aq) + KOH(aq) = FeOH(s) + KNO3(aq) FeNO3(aq) + KOH(aq) = FeOH(s) + KNO3(aq)
Fe(s) + O2(g) = Fe2O3(s) 4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + C =CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe + HNO3 = Fe(NO3)3 + NO2 + H2OFe + 6HNO3 = Fe(NO3)3 + 3NO2 + 3H2O
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
FeSO4+K2Cr2O7+H2SO4=Fe2(SO4)3+K2SO4+Cr2(SO4)3+H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
Fe(s) +H2SO4(aq) = Fe2(SO4)3(aq) +H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
FeSO4(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
Fe + HCl = FeCl + HFe + HCl = FeCl + H
Fe + 2 HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + 2 HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl + HFe + HCl = FeCl + H
Fe + 3HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(aq)+ H2SO4(aq) =Fe2(SO4)3(aq)+ H2(aq)2Fe(aq) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(aq)
Fe(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeSO4(Aq)+AgNO3(Aq)=Ag2SO4(s)+Fe(NO3)2(Aq)FeSO4(Aq) + 2AgNO3(Aq) = Ag2SO4(s) + Fe(NO3)2(Aq)
Fe2O3 + CO2 = Fe2(CO3)3Fe2O3 + 3CO2 = Fe2(CO3)3
Fe + Cd(NO3)2 = Fe(NO3)3 + Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe + 2 HCl= FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe1S2 + O2 = Fe2O3 + SO24Fe1S2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+Cl2=FeCl3+S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3 = Fe2O3 + H2O 2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS + 2 HCl = FeCl2 + 2 H2SFeS + 2HCl = FeCl2 + H2S
Fe(NO3)=Fe2O3+NO2+O2-4Fe(NO3) = -2Fe2O3 - 4NO2 + O2
FeO(s) + HNO3(aq) = Fe(NO3)2(aq) + H2O(l)FeO(s) + 2HNO3(aq) = Fe(NO3)2(aq) + H2O(l)
F2+KIO3+H2O=KIO4+HFF2 + KIO3 + H2O = KIO4 + 2HF
FeO + HNO3 = Fe(NO3)3 + N2 + H2O10FeO + 32HNO3 = 10Fe(NO3)3 + N2 + 16H2O
Fe + HCl = FeCl 3+ H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeS2+O2=Fe2O3+SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + H2O = Fe(OH)3 + HClFeCl3 + 3H2O = Fe(OH)3 + 3HCl
Fe(s)+HCl(aq)=FeCl3(aq)+H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe3+ + SO2 + H2O = Fe2+ + H+ + SO42--158Fe3+ + SO2 + 40H2O = -237Fe2+ + 80H+ + SO42-
Fe3+ + SO2 + H2O = Fe2+ + H+ + SO4 2--158Fe3+ + SO2 + 40H2O = -237Fe2+ + 80H+ + SO42-
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2+O2=Fe2O32Fe2 + 3O2 = 2Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(s) + CuCl2(aq) = FeCl2(aq) + Cu(s)Fe(s) + CuCl2(aq) = FeCl2(aq) + Cu(s)
Fe (s) + O2 (g) = Fe2O3 (s) 4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2(SO4)3 + NH4OH = Fe(OH)3 + (NH4)2SO4Fe2(SO4)3 + 6NH4OH = 2Fe(OH)3 + 3(NH4)2SO4
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeSO4 + H2SO4 + HNO3 = Fe2(SO4)3 + NO + H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe3O4 + 3 CO = 3 Fe + 3 CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeCl3+3 NH4OH=Fe(OH)3+ 3NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
FeS2+H2O+O2=Fe2S3+H2O0FeS2 + H2O + 0O2 = 0Fe2S3 + H2O
FeS2+O2=Fe2S3+SO42FeS2 + 2O2 = Fe2S3 + SO4
Fe2SO3+K2O2=Fe2O3+K2(SO4)+K2OFe2SO3 + 3K2O2 = Fe2O3 + K2(SO4) + 2K2O
Fr+HNO3=Fr(NO3)+NH4(NO3)+H2O8Fr + 10HNO3 = 8Fr(NO3) + NH4(NO3) + 3H2O
Fe3O4(s) + 2 CO(g) = 3 Fe(s) + 2 CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe3O4(s) + H2(g) = Fe(s) + H2OFe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O
FeTiO3 + Cl2 + C = TiCl4 + FeCl3 + CO2FeTiO3 + 7Cl2 + 6C = 2TiCl4 + 2FeCl3 + 6CO
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(s)+H2O(l) = Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
FeS+ 6HCl= H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeS+ 6HCl= H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeS+ 6HCl= HS+FeClFeS + HCl = HS + FeCl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(HCO3)3+H2SO4=Fe2(SO4)3+H2O+CO22Fe(HCO3)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O + 6CO2
Fe2O3(s) + 3 H2(g) = 2 Fe(s) + 3 H2O(g) Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
FeSO4 + H2SO4 + Cl2 = Fe2 (SO4)3 + HCl2FeSO4 + H2SO4 + Cl2 = Fe2(SO4)3 + 2HCl
FeO + Cl2 =Fe2O +Cl0FeO + Cl2 = 0Fe2O + 2Cl
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe+++ + NO2- +H2O = Fe++ + H+ +NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
Fe3+ + NO2- +H2O = Fe2+ + H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe +O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + KMnO4 = FeMnO4 + KSO4FeSO4 + KMnO4 = FeMnO4 + KSO4
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe(OH)3+HMnO4=Fe(MnO4)3+H2OFe(OH)3 + 3HMnO4 = Fe(MnO4)3 + 3H2O
Fe2(SO4)3+Ba=BaSO4+FeFe2(SO4)3 + 3Ba = 3BaSO4 + 2Fe
Fe(s) + Cl2(g) = FeCl32Fe(s) + 3Cl2(g) = 2FeCl3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+HC2H3O2=Fe(C2H3O2)3+H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
Fe + HCl = H+ FeClFe + HCl = H + FeCl
Fe+O2+H2O=2Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe(s) + H2SO4(aq) = H2(g) + Fe2(SO4)3 (aq)2Fe(s) + 3H2SO4(aq) = 3H2(g) + Fe2(SO4)3(aq)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe +H2SO4 = Fe2(SO4)3 +H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeSO4 = Fe2O3+ O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeSO4 = Fe2O3 + O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeSO4 = Fe2O3 + O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeSO4 = Fe2O3 + O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeS + NO3- + H+ = SO4-- + N2 + Fe++ + H2O5FeS + 8NO3- + 8H+ = 5SO4-- + 4N2 + 5Fe++ + 4H2O
FeS2 + NO3- + H+ = SO4-- + N2 + Fe++ + H2O5FeS2 + 14NO3- + 4H+ = 10SO4-- + 7N2 + 5Fe++ + 2H2O
FeO(s)+O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeO4+HBr = FeBr2+FeBr3+H2OFeO4 + 8HBr = -5FeBr2 + 6FeBr3 + 4H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + HNO3 = Fe(NO3) + NH4NO3 + H2O8Fe + 10HNO3 = 8Fe(NO3) + NH4NO3 + 3H2O
Fe + SbS3 = FeS3 + SbFe + SbS3 = FeS3 + Sb
FeS2 + HNO3 = Fe2(SO4)3 + H2SO4 + NO + H2O2FeS2 + 10HNO3 = Fe2(SO4)3 + H2SO4 + 10NO + 4H2O
Fe2O3 + H2S = FeS2 + S + H2OFe2O3 + 3H2S = 2FeS2 - S + 3H2O
FeS2 + Na2O2 = Fe2O3 + Na2SO4 + Na2O2FeS2 + 15Na2O2 = Fe2O3 + 4Na2SO4 + 11Na2O
FeS+HBr=FeBr2+H2SFeS + 2HBr = FeBr2 + H2S
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe(NO3)2 = Fe2O3 + NO2 + O24Fe(NO3)2 = 2Fe2O3 + 8NO2 + O2
FeS2+Na2O2=Fe2O3+Na2SO4+NaO2-4FeS2 + 3Na2O2 = -2Fe2O3 - 8Na2SO4 + 22NaO2
FeS2+Na2O2=Fe2O3+Na2SO4+NaO2-4FeS2 + 3Na2O2 = -2Fe2O3 - 8Na2SO4 + 22NaO2
Fe2(SO4)3+Ba(OH)2=BaSO4+Fe(OH)3Fe2(SO4)3 + 3Ba(OH)2 = 3BaSO4 + 2Fe(OH)3
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(OH)2 + HCl = FeCl2 + H2OFe(OH)2 + 2HCl = FeCl2 + 2H2O
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + HI = FeI2 + I2 + H2OFe2O3 + 6HI = 2FeI2 + I2 + 3H2O
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
FeSO4 + KMnO4 + H2SO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
Fe+++ + NO2- + H2O = Fe++ + H+ + NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
Fe3+ + NO2- + H2O =Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe++ + HCO3- + O2 + H2O = Fe(OH)3 + CO2 4Fe++ + 8HCO3- + O2 + 2H2O = 4Fe(OH)3 + 8CO2
Fe2+ + HCO3 + O2 + H2O = Fe(OH)3 + CO2 0Fe2+ + 4HCO3 - O2 - 2H2O = 0Fe(OH)3 + 4CO2
FeTiO3+Cl2+C=TiCl4+FeCl3+CO2FeTiO3 + 7Cl2 + 6C = 2TiCl4 + 2FeCl3 + 6CO
Fe3O4+CO=FeO+CO2Fe3O4 + CO = 3FeO + CO2
Fe2O3+6HCl=FeCl2+Cl2+H2OFe2O3 + 6HCl = 2FeCl2 + Cl2 + 3H2O
FeS2(s) + O2(g) = Fe2O3(s) + SO2(g)4FeS2(s) + 11O2(g) = 2Fe2O3(s) + 8SO2(g)
Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3
Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3
Fe(NO3)2 + H2O = Fe(OH)2 + HNO3Fe(NO3)2 + 2H2O = Fe(OH)2 + 2HNO3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + 2 O2=3 Fe2O3 +4 SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(s)+H2=Fe(l)+H2O(g)Fe2O3(s) + 3H2 = 2Fe(l) + 3H2O(g)
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe(SCN)3+K2Cr2O7+HCl=FeCl3+CrCl3+KCl+CO2+SO2+HNO2+H2OFe(SCN)3 + 6K2Cr2O7 + 51HCl = FeCl3 + 12CrCl3 + 12KCl + 3CO2 + 3SO2 + 3HNO2 + 24H2O
Fe+Na2S2O3+HCl=FeCl3+NaCl+H2S+H2O8Fe + 3Na2S2O3 + 30HCl = 8FeCl3 + 6NaCl + 6H2S + 9H2O
FeFe2O4+KMnO4+H2SO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10FeFe2O4 + 2KMnO4 + 48H2SO4 = 15Fe2(SO4)3 + K2SO4 + 2MnSO4 + 48H2O
Fe3O4+KMnO4+H2SO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10Fe3O4 + 2KMnO4 + 48H2SO4 = 15Fe2(SO4)3 + K2SO4 + 2MnSO4 + 48H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3+ + NO2- + H2O =Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + HSO4 = Fe2O3 + S8 +OH16Fe + 8HSO4 = 8Fe2O3 + S8 + 8OH
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaCl=FeCl+NaCl3FeCl3 + NaCl = FeCl + NaCl3
Fe(SCN)3+K2Cr2O7+HCl=FeCl3+CrCl3+KCl+CO2+SO2+N2+H2O2Fe(SCN)3 + 9K2Cr2O7 + 78HCl = 2FeCl3 + 18CrCl3 + 18KCl + 6CO2 + 6SO2 + 3N2 + 39H2O
FeS2+HNO3=Fe2(SO4)3+H2SO4+NO+H2O2FeS2 + 10HNO3 = Fe2(SO4)3 + H2SO4 + 10NO + 4H2O
FeS2+Na2O2=Fe2O3+Na2SO4+NaO0FeS2 + Na2O2 = 0Fe2O3 + 0Na2SO4 + 2NaO
FeS2+Na2O2=Fe2(SO4)3+Na2SO4+NaO0FeS2 + Na2O2 = 0Fe2(SO4)3 + 0Na2SO4 + 2NaO
FeS2+Na2O2=Fe2O3+Na2SO4+NaO0FeS2 + Na2O2 = 0Fe2O3 + 0Na2SO4 + 2NaO
Fe2S3+HCl=FeCl3+H2SFe2S3 + 6HCl = 2FeCl3 + 3H2S
Fe2S3 + O2 = Fe2O3 + SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
F2O+Na(OH)=NaF+O2+H2OF2O + 2Na(OH) = 2NaF + O2 + H2O
FeS(s)+HCl(aq) =FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + H2SO4 = H2 + Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
Fe + H2O = Fe2O3 + H2Fe + 3H2O = Fe2O3 + 6H
Fe + H2O = Fe2O3 + H2Fe + 3H2O = Fe2O3 + 6H
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2 O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO2=Fe+CO20Fe2O3 + CO2 = 0Fe + CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.