Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+H2= Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + 3H2SO4 = Fe2(SO4)3 + 3H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS + O2 = Fe3O + SO26FeS + 7O2 = 2Fe3O + 6SO2
Fe3O + CO = Fe + CO2Fe3O + CO = 3Fe + CO2
F2 + FeCl3 = FeF2 + Cl22F2 + 2FeCl3 = 2FeF2 + 3Cl2
FeCl3 + Na2CO3 = NaCl + Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HNO3 = Fe(NO3)3 + H2SO4 + NO2 + H2OFeS + 12HNO3 = Fe(NO3)3 + H2SO4 + 9NO2 + 5H2O
FeS2 + Fe+++ + H2O = Fe++ + SO4-- + H+FeS2 + 14Fe+++ + 8H2O = 15Fe++ + 2SO4-- + 16H+
Fe3O4 + HNO3 = Fe(NO3)3 + N2O + H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + N2O + 37H2O
Fe3+S4=Fe3S4Fe3 + S4 = Fe3S4
Fe2O3+HNO3=Fe(NO3)3+NO+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO + 3H2O
FeBr3 +H2SO4 = Fe2(SO4)3+ HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
F2+Br2=BrF33F2 + Br2 = 2BrF3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)2 + H3PO4 = Fe3(PO4)2 + H2O 3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3(aq) + Ca(NO3)2(aq)=Fe(NO3)3(aq) + CaCl22FeCl3(aq) + 3Ca(NO3)2(aq) = 2Fe(NO3)3(aq) + 3CaCl2
FeCl3(aq) + (NH4)2SO4(aq)=Fe2(SO4)3 + NH4Cl2FeCl3(aq) + 3(NH4)2SO4(aq) = Fe2(SO4)3 + 6NH4Cl
FeCl3(aq) + K3PO4(aq) =FePO4(s) +3KCl(aq)FeCl3(aq) + K3PO4(aq) = FePO4(s) + 3KCl(aq)
Fe+S=Fe2S2Fe + S = Fe2S
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3 = Fe+3 + O-2 Fe2O3 = 2Fe+3 + 3O-2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeO+CaCO3+H2O=CH4+Fe+CaO-4FeO + CaCO3 + 2H2O = CH4 - 4Fe + CaO
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
F+NaOH=NaF+O2+H2O4F + 4NaOH = 4NaF + O2 + 2H2O
F+NaOH=NaF+OF2+H2O4F + 2NaOH = 2NaF + OF2 + H2O
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+S=FeSFe + S = FeS
Fe + HNO3 = Fe(NO3)2 + NO + H2O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
Fe2O3 +CO =2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 +2CO =2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO(l)+Al(l)=Al2O3(l)+Fe(l)3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
F2 + NH3 = N2F4 + HF5F2 + 2NH3 = N2F4 + 6HF
Fe + HNO3 = Fe(NO3)2 + NO + H2O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
Fe2O3+S=Fe+SO22Fe2O3 + 3S = 4Fe + 3SO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + 3 O2 = 2 Fe2O34Fe + 3O2 = 2Fe2O3
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
FeSO4 + H2O= H2SO4 + FeOFeSO4 + H2O = H2SO4 + FeO
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe(NO3)3 + AgNO3 = FeNO3 + Ag(NO3)3Fe(NO3)3 + AgNO3 = FeNO3 + Ag(NO3)3
Fe(NO3)3 + AgNO3 = FeNO3 + Ag(NO3)3Fe(NO3)3 + AgNO3 = FeNO3 + Ag(NO3)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeO+CO=Fe+CO2FeO + CO = Fe + CO2
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + S = FeSFe + S = FeS
Fe(OH)3 + NH3 = Fe2O3 + N2O + H2O2Fe(OH)3 + 0NH3 = Fe2O3 + 0N2O + 3H2O
Fe(s) + CuNO3(aq) = Cu(s) + Fe(NO3)2(aq )Fe(s) + 2CuNO3(aq) = 2Cu(s) + Fe(NO3)2(aq)
Fe(s)+H2O(l)=Fe2O3(s)+H2(g)2Fe(s) + 3H2O(l) = Fe2O3(s) + 3H2(g)
Fe(s)+H2O(l)=Fe2O3(s)+H2(g)2Fe(s) + 3H2O(l) = Fe2O3(s) + 3H2(g)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3 + NaOH=Fe(OH)3 +NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
F2 + H2O = O3 + HF3F2 + 3H2O = O3 + 6HF
F2+LiI = LiF+I2F2 + 2LiI = 2LiF + I2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2S3 + HCl = FeCl2 + S + H2Fe2S3 + 4HCl = 2FeCl2 + 3S + 2H2
Fe2S3 + HCl = FeCl2 + S + H2SFe2S3 + 4HCl = 2FeCl2 + S + 2H2S
FeSO+KMnO4+H2SO4=Fe(SO4)3+MnSO4+K2SO4+H2OFeSO + 2KMnO4 + 5H2SO4 = Fe(SO4)3 + 2MnSO4 + K2SO4 + 5H2O
Fe(NO3)3*9H2O+NH3=Fe(OH)3+NH4NO3+H2OFe(NO3)3*9H2O + 3NH3 = Fe(OH)3 + 3NH4NO3 + 6H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + C = FeCFe + C = FeC
Fe + C = Fe3C3Fe + C = Fe3C
Fe2O3+2C=2Fe+2CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+2C=2Fe+2CO22Fe2O3 + 3C = 4Fe + 3CO2
FeO3 + CO = Fe + CO2 FeO3 + 3CO = Fe + 3CO2
Fe(OH)3+H2S=Fe2S3+H2O2Fe(OH)3 + 3H2S = Fe2S3 + 6H2O
Fe+AgC2H3O2=Fe(C2H3O2)2+AgFe + 2AgC2H3O2 = Fe(C2H3O2)2 + 2Ag
FeCl2+Na3PO3=NaCl+Fe3(PO3)23FeCl2 + 2Na3PO3 = 6NaCl + Fe3(PO3)2
FeBr3+(NH4)2S=Fe2S3+NH4Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6NH4Br
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe+S=FeSFe + S = FeS
Fe(NO3)3 + 3HCl = FeCl3 + HNO3Fe(NO3)3 + 3HCl = FeCl3 + 3HNO3
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe +S =FeSFe + S = FeS
Fe2O3 + H2 = Fe3O4 + H2O 3Fe2O3 + H2 = 2Fe3O4 + H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2=Fe2O34Fe(s) + 3O2 = 2Fe2O3
Fe3O4+CO=FeO+CO2Fe3O4 + CO = 3FeO + CO2
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+CO=FeO+CO2Fe2O3 + CO = 2FeO + CO2
Fe2O3+CO=FeO+CO2Fe2O3 + CO = 2FeO + CO2
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(s) + Cl2(g) =FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe3O4(s) + H2(g)= Fe(s) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + NHO3 = Fe(NO3)2 + NO2 +H2OFe + 4NHO3 = Fe(NO3)2 + 2NO2 + 2H2O
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCr2O4 + K2CO3 + O2 = K2CrO4 +Fe2O3 +CO24FeCr2O4 + 8K2CO3 + 7O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeO+H2=Fe+H2OFeO + H2 = Fe + H2O
Fe(SO)4 + 2NaBr = Fe(Br)2 + Na2(SO)4Fe(SO)4 + 2NaBr = Fe(Br)2 + Na2(SO)4
FeCl2 + K2S = FeS + KClFeCl2 + K2S = FeS + 2KCl
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe + 2CuSO4 = 2FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3 + H2SO4 = Br + Fe(H2SO4)3FeBr3 + 3H2SO4 = 3Br + Fe(H2SO4)3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(OH)2+ O2 + H2O=Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
FeOH+H2O2=FeO3+H2O2FeOH + 5H2O2 = 2FeO3 + 6H2O
FE3+H2O=FE3O4+H2FE3 + 4H2O = FE3O4 + 4H2
Fe204+SO4 = FeS+O2Fe204 + 204SO4 = 204FeS + 408O2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeSo4+CdSo4=FeCd+So8FeSo4 + CdSo4 = FeCd + So8
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2+GaI3=GaF3+I33F2 + 2GaI3 = 2GaF3 + 2I3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS+O2=SO2+Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe(OH)2 + H2O2 = Fe2O3 + H2040Fe(OH)2 - 10H2O2 = 20Fe2O3 + 3H20
FeS2 + O2= Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2= Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + Na2CO3= Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2(SO4)3 + Na2SO3=Fe2(SO3)3+Na2SO4Fe2(SO4)3 + 3Na2SO3 = Fe2(SO3)3 + 3Na2SO4
Fe2(SO4)3 + Na2SO3=Fe2(SO3)3+Na2SO4Fe2(SO4)3 + 3Na2SO3 = Fe2(SO3)3 + 3Na2SO4
Fe3+ +N2H4 + 4OH= Fe2+ +N2+H2O0Fe3+ + N2H4 + 4OH = 0Fe2+ + N2 + 4H2O
Fe 2 (CO3) 3 + Hg (NO2)2 =Fe2 (NO2)2+Hg(CO3)3Fe2(CO3)3 + Hg(NO2)2 = Fe2(NO2)2 + Hg(CO3)3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe3O4 + HNO3 = Fe(NO3)3 + NO +H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe(OH)3 = Fe2O3 + H2O 2Fe(OH)3 = Fe2O3 + 3H2O
F2 + HBr=Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + HCl = HFeCl4 + H22Fe + 8HCl = 2HFeCl4 + 3H2
FeS2 + Cu2S + HNO3 = CuSO4 + Fe2(SO4)3 + NO2 + H2O2FeS2 + Cu2S + 40HNO3 = 2CuSO4 + Fe2(SO4)3 + 40NO2 + 20H2O
FeS + Cu2S + HNO3 = CuSO4 + Fe2(SO4)3 + NO2 + H2O2FeS - Cu2S + 8HNO3 = -2CuSO4 + Fe2(SO4)3 + 8NO2 + 4H2O
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3 + C = CO2 + Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe2O3 + H2 = Fe3O4 + H2O 3Fe2O3 + H2 = 2Fe3O4 + H2O
Fe2O3+CO = CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe + Sn(NO3)3=Fe(NO3)3 + Sn Fe + Sn(NO3)3 = Fe(NO3)3 + Sn
FeS2 + O2 = Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2 + FeI3 = FI + Fe3F2 + 2FeI3 = 6FI + 2Fe
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+AgNO3=Fe(NO3)+AgFe + AgNO3 = Fe(NO3) + Ag
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe+ O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2S = FeS + H2Fe + H2S = FeS + H2
FeOH + BaNO2 = BaOH + FeNO2FeOH + BaNO2 = BaOH + FeNO2
Fe(OH)3+H2SO4=Fe2(SO4)3+FeSO4+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 0FeSO4 + 6H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + Na2CO3=Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2O3+KNO3+KOH=K2FeO4+KNO2+H2OFe2O3 + 3KNO3 + 4KOH = 2K2FeO4 + 3KNO2 + 2H2O
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
FeO(s) + C(s) = Fe(l) + CO2(g) 2FeO(s) + C(s) = 2Fe(l) + CO2(g)
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(NO3)3 + MgO = Fe2O3 + Mg(NO3)22Fe(NO3)3 + 3MgO = Fe2O3 + 3Mg(NO3)2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+H2O=FeO4+H2Fe + 4H2O = FeO4 + 4H2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
FeS + HNO3 + H2O = Fe(NO3)3 + Fe2(SO4)3 + NH4NO324FeS + 78HNO3 + 15H2O = 8Fe(NO3)3 + 8Fe2(SO4)3 + 27NH4NO3
FeI2+KMnO4+H2SO4=Fe2(SO4)3+I2+MnSO4+K2SO4+H2O10FeI2 + 6KMnO4 + 24H2SO4 = 5Fe2(SO4)3 + 10I2 + 6MnSO4 + 3K2SO4 + 24H2O
FeI2+KMnO4+H2SO4=Fe2(SO4)3+I2+MnSO4+K2SO4+H2S2FeI2 - 2KMnO4 + 2H2SO4 = Fe2(SO4)3 + 2I2 - 2MnSO4 - K2SO4 + 2H2S
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeO+HNO3=Fe(NO3)3+NO2+H2OFeO + 4HNO3 = Fe(NO3)3 + NO2 + 2H2O
FeO+HNO3=Fe(NO3)3+NO3+H2OFeO + 2HNO3 = Fe(NO3)3 - NO3 + H2O
F2 + H2O = HF + O22F2 + 2H2O = 4HF + O2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe(OH)2 + H2O2 = FeO3 + H2OFe(OH)2 + 2H2O2 = FeO3 + 3H2O
Fe(OH)3 = Fe2O3 +H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + CuSO4 = Fe2 (SO4)3 + Cu2Fe + 3CuSO4 = Fe2(SO4)3 + 3Cu
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+H2O= Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)3 + Na3(PO4) = Fe(PO4) + Na(NO3)Fe(NO3)3 + Na3(PO4) = Fe(PO4) + 3Na(NO3)
FeS2 + O2 = Fe2+SO22FeS2 + 4O2 = Fe2 + 4SO2
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2(C2O4)3 = FeC2O4 + CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe2O3+ H2O= Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + CO=Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + S2 = FeS 2Fe + S2 = 2FeS
Fe2 + O2 = Fe2O32Fe2 + 3O2 = 2Fe2O3
Fe(NO3)2 + Na3PO4 = Fe3(PO4)2 + NaNO33Fe(NO3)2 + 2Na3PO4 = Fe3(PO4)2 + 6NaNO3
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3+Na2CO3=NaCl+Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe3O4(s) + H2(g) = Fe(s) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + CuCl2 = FeCl2 + CuFe + CuCl2 = FeCl2 + Cu
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeSO4 + H2SO4 + H2O2 = Fe2(SO4)3+ H2O2FeSO4 + H2SO4 + H2O2 = Fe2(SO4)3 + 2H2O
FeS + H2SO4 = FeSO4 + H2SFeS + H2SO4 = FeSO4 + H2S
Fe2O3 + 6H2= 2Fe + 6H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(NO3)2 + Na3PO4 = Fe3(PO4)2 + NaNO33Fe(NO3)2 + 2Na3PO4 = Fe3(PO4)2 + 6NaNO3
FeC2O4 = FeO + CO2 + COFeC2O4 = FeO + CO2 + CO
Fe2 (SO4)3 + Ba (NO3)2 = Fe ( NO3)3 + BaSO4 Fe2(SO4)3 + 3Ba(NO3)2 = 2Fe(NO3)3 + 3BaSO4
Fe3O4 + HNO3 = Fe(NO3)3 + NO +H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe(SCN)3 + Na2CO3 = Fe2(CO3)3 + NaSCN2Fe(SCN)3 + 3Na2CO3 = Fe2(CO3)3 + 6NaSCN
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+O=FeOFe + O = FeO
Fe(s)+CuNO3(aq)=Cu(s)+Fe(NO3)2(aq)Fe(s) + 2CuNO3(aq) = 2Cu(s) + Fe(NO3)2(aq)
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
F2+BI3=I2+BF33F2 + 2BI3 = 3I2 + 2BF3
FeCl3+K2O=Fe2O3+6KCl2FeCl3 + 3K2O = Fe2O3 + 6KCl
Fe(OH)3 = Fe2O3 +H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3+ NaOH= Fe(OH)3+ NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe+AgNO3=Ag+Fe(NO3)3Fe + 3AgNO3 = 3Ag + Fe(NO3)3
Fe(NO3)2 (aq)+ 2Cu(s)= 2CuNO3(aq)+Fe(s)Fe(NO3)2(aq) + 2Cu(s) = 2CuNO3(aq) + Fe(s)
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe+O=FeOFe + O = FeO
Fe+H2O=FeO+H2Fe + H2O = FeO + H2
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe(NO3)3(aq) + NaOH(aq) = Fe(OH)3(s) + NaNO3(aq)Fe(NO3)3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaNO3(aq)
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeS + O = Fe2O3 + SO22FeS + 7O = Fe2O3 + 2SO2
Fe3O2 = Fe + OFe3O2 = 3Fe + 2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3Al2Si3O12 + SiO2 = Fe2Al4Si5O18 + Al2SiO5-2Fe3Al2Si3O12 - 5SiO2 = -3Fe2Al4Si5O18 + 4Al2SiO5
Fe2O3+C=2Fe3O4+CO3Fe2O3 + C = 2Fe3O4 + CO
FeCl2+ H2O2+HCl = FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3+SnCl2= FeCl2 +SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe+H2O=Fe(OH)3+H22Fe + 6H2O = 2Fe(OH)3 + 3H2
FeS2 +O2 = Fe2O3 +SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe +O2 +H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 =Fe2O3 4Fe + 3O2 = 2Fe2O3
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3(aq)+FeCl2(aq)+NH3(aq)+H2O(l)=Fe3O4(s)+NH4Cl(aq)2FeCl3(aq) + FeCl2(aq) + 8NH3(aq) + 4H2O(l) = Fe3O4(s) + 8NH4Cl(aq)
Fe2O3 + NH4OH = Fe(OH)3 + NH3Fe2O3 + 3NH4OH = 2Fe(OH)3 + 3NH3
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe +CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe +CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe +CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe +CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe2P + FeS2 = Fe2S3 + PSFe2P + 8FeS2 = 5Fe2S3 + PS
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2 = FeO2Fe + O2 = 2FeO
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCO3(s)+H2CO3(aq)= Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe + Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+HNO3=H2O+Fe(NO3)3Fe2O3 + 6HNO3 = 3H2O + 2Fe(NO3)3
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe2O3(s) + H2(g) = Fe(s) +H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe(OH)3(s)= Fe2O3(s)+H2O(s)2Fe(OH)3(s) = Fe2O3(s) + 3H2O(s)
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3(s) + CO(g) = Fe(l) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe2O3+2CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeO + O3 = Fe2O36FeO + O3 = 3Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeBr3+Na2S=Fe2S3+NaBr2FeBr3 + 3Na2S = Fe2S3 + 6NaBr
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe+ O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + 3O2(g) + 2H2O(l) = 4FeO(OH)(s) 4Fe(s) + 3O2(g) + 2H2O(l) = 4FeO(OH)(s)
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeO3 + H2 = Fe + H2OFeO3 + 3H2 = Fe + 3H2O
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeSO4+H2SO4+KMnO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10FeSO4 + 8H2SO4 + 2KMnO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
FeSO +HSO +KMnO=Fe2(SO4)3 + K2SO4 + MnSO4 + H2O-34FeSO + 40HSO + 38KMnO = -17Fe2(SO4)3 + 19K2SO4 + 38MnSO4 + 20H2O
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeO+PdF2=FeF2=PdOFeO + PdF2 = FeF2 + PdO
FeO+PdF2=FeF2=PdOFeO + PdF2 = FeF2 + PdO
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
F2(g) + H2O(Aq) = HF(g) + O2(g)2F2(g) + 2H2O(Aq) = 4HF(g) + O2(g)
Fe3+ +SO2 + H2O = Fe2+ +H3O+ + SO4 ---4Fe3+ + SO2 + 6H2O = -6Fe2+ + 4H3O+ + SO4--
Fe3+ +SO2 + H2O = Fe2+ +H3O+ + SO4 2--158Fe3+ + SO2 + 120H2O = -237Fe2+ + 80H3O+ + SO42-
Fe3+ +SO2 + H2O = Fe2+ +H3O+ + SO4---4Fe3+ + SO2 + 6H2O = -6Fe2+ + 4H3O+ + SO4--
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + H2O2 = FeO + HCl + O22FeCl3 + 3H2O2 = 2FeO + 6HCl + 2O2
FeCl3 + H2O2 = Fe2O2 + HCl + O22FeCl3 + 3H2O2 = Fe2O2 + 6HCl + 2O2
Fe(HO)3=Fe2O3+H2O2Fe(HO)3 = Fe2O3 + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3+KOH= K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2 O3 + CO=CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe2(SO4)3 + KI = FeI2 + I2 + K2SO4Fe2(SO4)3 + 6KI = 2FeI2 + I2 + 3K2SO4
FeSO4 + KMnO4+KHSO4= Fe2(SO4)3+MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 16KHSO4 = 5Fe2(SO4)3 + 2MnSO4 + 9K2SO4 + 8H2O
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
F + W + S + P = FW3SP2F + 3W + S + 2P = FW3SP2
Fe(s)+CuSO4 = FeSO4+Cu(s)Fe(s) + CuSO4 = FeSO4 + Cu(s)
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K2Fe(C2O4)3*6H2O + (NH4)2(SO4)2 + H2SO4 + H2OFe(NH4)2(SO4)2*6H2O + 2H2C2O4 + K2C2O4 + 2H2O2 = K2Fe(C2O4)3*6H2O + (NH4)2(SO4)2 + 0H2SO4 + 4H2O
Fe(s) + O2(g) = Fe3O4(s) 3Fe(s) + 2O2(g) = Fe3O4(s)
Fe5O2 = Fe2O2+O-2Fe5O2 = -5Fe2O2 + 6O
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeI2 + NH4OH = FeOH + NH4I2 FeI2 + NH4OH = FeOH + NH4I2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2(SO3)3 + Na3PO4 = FePO4 + Na2SO3Fe2(SO3)3 + 2Na3PO4 = 2FePO4 + 3Na2SO3
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
Fe+3Cl2=Fe2Cl34Fe + 3Cl2 = 2Fe2Cl3
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
FeO + Al = Fe + Al2O33FeO + 2Al = 3Fe + Al2O3
Fe2(SO4)3 + KOH = 3K2SO4 + 2Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2 O3 +C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2 O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 (s) + CO (g) = + Fe (s) + CO2 (g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe (s) + S = Fe2S3 (s)2Fe(s) + 3S = Fe2S3(s)
Fe2S3+HNO3+HCl=FeCl3+H2SO4+NO+H2OFe2S3 + 8HNO3 + 6HCl = 2FeCl3 + 3H2SO4 + 8NO + 4H2O
Fe2O3(s)+H2(g)=Fe(s)+H2O(g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
F2+Na3N=NaF+N23F2 + 2Na3N = 6NaF + N2
Fe + HNO3 = Fe(NO3)3 + NH4(NO3) + H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4(NO3) + 9H2O
Fe + HNO3 = Fe(NO3)3 + NH4NO3 + H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe3O4(s) + 4CO(g) = 4CO2(g) + 3Fe(s)Fe3O4(s) + 4CO(g) = 4CO2(g) + 3Fe(s)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3*6H2O + 3 NH4OH = 3 (NH4)Cl + Fe(OH)3 + 6 H2OFeCl3*6H2O + 3NH4OH = 3(NH4)Cl + Fe(OH)3 + 6H2O
Fe++ +SO4-- =FeS+2O2 Fe++ + SO4-- = FeS + 2O2
F2 + BiCl3=Cl2 + BiF33F2 + 2BiCl3 = 3Cl2 + 2BiF3
Fe2O+Al=Fe+Al2O33Fe2O + 2Al = 6Fe + Al2O3
Fe2O+Al=Fe+Al2O33Fe2O + 2Al = 6Fe + Al2O3
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe(OH)2+O2+H2O=Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+Cu2(SO4)2=Fe2(SO4)2+Cu2Fe + Cu2(SO4)2 = Fe2(SO4)2 + 2Cu
Fe2O3 + CO = 2Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO+HSO+KMnO= 4244 Fe2(SO4)3 + K2SO4 + MnSO4 + H2O -34FeSO + 40HSO + 38KMnO = -17Fe2(SO4)3 + 19K2SO4 + 38MnSO4 + 20H2O
Fe(NO3)3+Li=Li(NO3)+Fe33Fe(NO3)3 + 9Li = 9Li(NO3) + Fe3
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + H2SO4 + KMnO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 8H2SO4 + 2KMnO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
FEO3+CO=FE+CO2FEO3 + 3CO = FE + 3CO2
Fe(Cl)3 + Mg(NO3)2 = Mg(Cl)2 + Fe(NO3)32Fe(Cl)3 + 3Mg(NO3)2 = 3Mg(Cl)2 + 2Fe(NO3)3
FeCl2 + KNO3 + HCl = FeCl3 + NO + H2O + KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
Fe + Cu2SO4 = Fe2SO4 + Cu2Fe + Cu2SO4 = Fe2SO4 + 2Cu
Fe + Cu2SO4 = Fe3SO4 + Cu3Fe + Cu2SO4 = Fe3SO4 + 2Cu
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeO(s) + O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe (s) + F (g)= Fe3F (s)3Fe(s) + F(g) = Fe3F(s)
F2+NH4Cl=F(NH4)+Cl2F2 + 2NH4Cl = 2F(NH4) + Cl2
Fe(OH)3(s) + 3HClO4(aq) = Fe(ClO4)3(aq) + 3H2O(l)Fe(OH)3(s) + 3HClO4(aq) = Fe(ClO4)3(aq) + 3H2O(l)
Fe(OH)3(s) + 3HClO4(aq) = Fe(ClO4)3(aq) + 3H2O(l)Fe(OH)3(s) + 3HClO4(aq) = Fe(ClO4)3(aq) + 3H2O(l)
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe(OH)3+HNO3=Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe + S = Fe2S32Fe + 3S = Fe2S3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+CuNO3=Cu+Fe(NO3)2Fe + 2CuNO3 = 2Cu + Fe(NO3)2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe + Sn (NO3)4 = Fe(NO3)3 + Sn4Fe + 3Sn(NO3)4 = 4Fe(NO3)3 + 3Sn
Fe + Sn (NO3)4 = Fe(NO3)3 + Sn4Fe + 3Sn(NO3)4 = 4Fe(NO3)3 + 3Sn
Fe(NO3)3 + MgO = Fe2O3 + Mg(NO3)22Fe(NO3)3 + 3MgO = Fe2O3 + 3Mg(NO3)2
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
FeCl+NaCO3=NaCl+FeCO3FeCl + NaCO3 = NaCl + FeCO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)3 + Na2CO3=NaNO3+Fe2(CO3)32Fe(NO3)3 + 3Na2CO3 = 6NaNO3 + Fe2(CO3)3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FE3C+HCL=FE3CHCLFE3C + HCL = FE3CHCL

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.