Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeCl3+SO2+H2O=FeCl2+HCl+H2SO42FeCl3 + SO2 + 2H2O = 2FeCl2 + 2HCl + H2SO4
FeS2+ O2= SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe3O4+HNO3=Fe(NO3)3+NO+H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
FeS+HNO3=Fe(NO3)3+H2SO4+NO+H2OFeS + 6HNO3 = Fe(NO3)3 + H2SO4 + 3NO + 2H2O
Fe(s) + AgNO3(g) = Ag(s) + Fe(NO3)3(aq)Fe(s) + 3AgNO3(g) = 3Ag(s) + Fe(NO3)3(aq)
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+6HCl=2FeCl3+3H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeCl3+ZnSO4=Fe2(SO4)3+ZnCl22FeCl3 + 3ZnSO4 = Fe2(SO4)3 + 3ZnCl2
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
FeCl2 + KMnO4 + H2SO4 = Fe2(SO4)3 + Cl2 + MnSO4 + K2SO4 + H2O10FeCl2 + 6KMnO4 + 24H2SO4 = 5Fe2(SO4)3 + 10Cl2 + 6MnSO4 + 3K2SO4 + 24H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
F2 + Al2O3 = AlF3 + O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe + O2=Fe3O4 3Fe + 2O2 = Fe3O4
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe+N2O=N3+OFe39Fe + 3N2O = 2N3 + 3OFe3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s) + H2SO4 (aq) = Fe3(SO4)2 (aq) + H2 (g)3Fe(s) + 2H2SO4(aq) = Fe3(SO4)2(aq) + 2H2(g)
F + KBr = Br2 + KF2F + 2KBr = Br2 + 2KF
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO =Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+C = Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2SO4 = Fe2 (SO4) + H22Fe + H2SO4 = Fe2(SO4) + H2
Fe(s) + CuSO4(aq) = Cu(s) + FeSO4(aq)Fe(s) + CuSO4(aq) = Cu(s) + FeSO4(aq)
FeCl3(aq) + KSCN(aq) = Fe(SCN)3 + KClFeCl3(aq) + 3KSCN(aq) = Fe(SCN)3 + 3KCl
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe3 + 4H2O = Fe3O4 + 4H2Fe3 + 4H2O = Fe3O4 + 4H2
Fe3 + 4H2O = Fe3O4 + 4H2Fe3 + 4H2O = Fe3O4 + 4H2
Fe3 + 4 H2O = Fe3O4 + 4 H2Fe3 + 4H2O = Fe3O4 + 4H2
FeCl3 + Fe = FeCl22FeCl3 + Fe = 3FeCl2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe2+SO2=FeS+O2Fe2 + 2SO2 = 2FeS + 2O2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
F2+HCl = Cl2+HFF2 + 2HCl = Cl2 + 2HF
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl = FeCl 2 3Fe + 23Cl = FeCl23
Fe2O3 +Cl2 = FeCl2 + O22Fe2O3 + 4Cl2 = 4FeCl2 + 3O2
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 = K3(Fe(C2O4)3)*3H2O + NH4 + SO4 +CO2 +H2O22Fe(NH4)2(SO4)2*6H2O - 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)*3H2O + 4NH4 + 4SO4 - 12CO2 + 3H2O2
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 = K3(Fe(C2O4)3)*3H2O + NH4 + SO4 +CO2 +H2O22Fe(NH4)2(SO4)2*6H2O - 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)*3H2O + 4NH4 + 4SO4 - 12CO2 + 3H2O2
Fe + H2O + O2 = Fe(OH)34Fe + 6H2O + 3O2 = 4Fe(OH)3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+Na2CO3=Fe2(CO3)3+6NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe(OH)2 + O2 + H2O=Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 + NO2 + H2OFeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 15NO2 + 7H2O
FeS + HNO3 = Fe(NO3)3 + H2SO4 + NO2 + H2OFeS + 12HNO3 = Fe(NO3)3 + H2SO4 + 9NO2 + 5H2O
Fe2O3 (s)+C(s)=Fe (s)+CO (g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe (s)+O2 (g)=Fe2O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCr2O4+Na2CO3+O2=Na2CrO4+Fe2O3+CO24FeCr2O4 + 8Na2CO3 + 7O2 = 8Na2CrO4 + 2Fe2O3 + 8CO2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+HNO3=Fe(NO3)3+H2SO4+NO2+H2OFeS + 12HNO3 = Fe(NO3)3 + H2SO4 + 9NO2 + 5H2O
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH3 + H2SO4 + H2O +H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH3 + 4H2SO4 + 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH3 + H2SO4 + H2O + H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH3 + 4H2SO4 + 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH3 + H2SO4 + H2O + H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH3 + 4H2SO4 + 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH3 + H2SO4 + H2O + H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH3 + 4H2SO4 + 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH3 + H2SO4 + H2O + H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH3 + 4H2SO4 + 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH4 + H2SO4 + H2O + H-2Fe(NH4)2(SO4)2(H2O)6 - 3H2C2O4 - 3K2C2O4 = -2K3(Fe(C2O4)3)(H2O)2 - 4NH4 - 4H2SO4 - 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH3 + H2SO4 + H2O + H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH3 + 4H2SO4 + 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH4 + H2SO4 + H2O + H-2Fe(NH4)2(SO4)2(H2O)6 - 3H2C2O4 - 3K2C2O4 = -2K3(Fe(C2O4)3)(H2O)2 - 4NH4 - 4H2SO4 - 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH4 + HSO4 + H2O + H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH4 + 4HSO4 + 8H2O + 2H
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + 3K2C2O4 = K3(Fe(C2O4)3)(H2O)2 + NH4 + SO4 + H2O + H2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 = 2K3(Fe(C2O4)3)(H2O)2 + 4NH4 + 4SO4 + 8H2O + 6H
Fe3O4(s)+2H2(g)=3Fe(s)+4H2O(l)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(l)
Fe3O4+2H2=3Fe+4H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4+CO=FeO+CO2Fe3O4 + CO = 3FeO + CO2
Fe2O4+SO2=FeS+O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O82Fe + 4O2 = Fe2O8
FeCl2 + K2S = FeS + KClFeCl2 + K2S = FeS + 2KCl
Fe3O4 + CO = CO2 + FeFe3O4 + 4CO = 4CO2 + 3Fe
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4(s) + H2(g) = Fe(l) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(l) + 4H2O(g)
Fe(s) + H2O(g) = FeO(s) + H2(g)Fe(s) + H2O(g) = FeO(s) + H2(g)
Fe2(CO3)3 + HNO3 = Fe(NO3)3 + H2O + CO2Fe2(CO3)3 + 6HNO3 = 2Fe(NO3)3 + 3H2O + 3CO2
Fe2O3 + H2O= Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+ NaOH= Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(SO4)+BaCl=Ba(SO4)+FeClFe(SO4) + BaCl = Ba(SO4) + FeCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeSO4+Cl2=Fe(SO4)3+FeCl33FeSO4 + 3Cl2 = Fe(SO4)3 + 2FeCl3
Fe2O3(s)+CO(g)=Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe2O3 + H2O= Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe+O2=Fe3O23Fe + O2 = Fe3O2
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 +H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + Sn(NO3)4 = Sn + Fe(NO3)34Fe + 3Sn(NO3)4 = 3Sn + 4Fe(NO3)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
FeCl3 + Na2CO3 = Na Cl + Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
FeCl3 + KOH = Fe(OH)3 + KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + HCl =FeCl2 + H2Fe + 2HCl = FeCl2 + H2
F + H2O = HF + H2O34F + 3H2O = 4HF + H2O3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
F2 + NaBr = NaF2 + BrF2 + NaBr = NaF2 + Br
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2(C2O4)3 = FeC2O4 + CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe+HCl= FeCl+H22Fe + 2HCl = 2FeCl + H2
Fe+HCl= FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+HCl= FeCl+HFe + HCl = FeCl + H
Fe+HCl= FeCl+H22Fe + 2HCl = 2FeCl + H2
Fe+HCl= FeCl+HFe + HCl = FeCl + H
Fe + 3Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + O2 = Fe2O3Fe2O3 + 0O2 = Fe2O3
Fe2O3(s)+CO(g)=Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
F2 + 2H2O = 4HF + O22F2 + 2H2O = 4HF + O2
Fr + H2O = 2FrOH + H22Fr + 2H2O = 2FrOH + H2
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 +O2+ H2O = Fe2(SO4)3 + H2SO44FeS2 + 15O2 + 2H2O = 2Fe2(SO4)3 + 2H2SO4
Fe + (NH4)2S = Fe2S3 + NH42Fe + 3(NH4)2S = Fe2S3 + 6NH4
Fe + NaOH =Fe(OH)3 + NaFe + 3NaOH = Fe(OH)3 + 3Na
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+S=FeSFe + S = FeS
Fe(OH)3=Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(ClO4)2(aq)+K2S(aq)=FeS(s)+2KClO4(aq)Fe(ClO4)2(aq) + K2S(aq) = FeS(s) + 2KClO4(aq)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeO + PdF2 = FeF2 + PdOFeO + PdF2 = FeF2 + PdO
FeCl3 + Al(OH)3 = Fe(OH)3 + AlCl3FeCl3 + Al(OH)3 = Fe(OH)3 + AlCl3
Fe + HNO3 = Fe(NO3)3 + NH4NO3 + H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
Fe+AgC2H3O2=Fe(C2H3O2)2+AgFe + 2AgC2H3O2 = Fe(C2H3O2)2 + 2Ag
FeBr3+(NH4)2S=Fe2S3+NH4Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6NH4Br
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl2 + K2CO3 = FeCO3 + KClFeCl2 + K2CO3 = FeCO3 + 2KCl
Fe2(SO4) + AgNO3 = Fe2NO3 AgSO4Fe2(SO4) + AgNO3 = Fe2NO3AgSO4
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl2+K2CO3=FeCO3+KClFeCl2 + K2CO3 = FeCO3 + 2KCl
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeBr3+ Ba(OH)2=Fe(OH)3+ BaBr22FeBr3 + 3Ba(OH)2 = 2Fe(OH)3 + 3BaBr2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe +CuSO4 = Fe(SO4)3+CuFe + 3CuSO4 = Fe(SO4)3 + 3Cu
Fe+ Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 +KI + KIO3 +H2O = Fe(OH)2 +K2SO4 +I23FeSO4 + 5KI + KIO3 + 3H2O = 3Fe(OH)2 + 3K2SO4 + 3I2
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeS+HBr=FeBr2+H2SFeS + 2HBr = FeBr2 + H2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO2=Fe+CO20Fe2O3 + CO2 = 0Fe + CO2
Fe2O3+CO2=Fe+CO20Fe2O3 + CO2 = 0Fe + CO2
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+Fe=FeCl22FeCl3 + Fe = 3FeCl2
Fe2O3 = Fe + O22Fe2O3 = 4Fe + 3O2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K11Fe7(C2O4)16*17H2O + (NH4)2SO4 + H2SO4 + H2O14Fe(NH4)2(SO4)2*6H2O + 21H2C2O4 + 11K2C2O4 + 7H2O2 = 2K11Fe7(C2O4)16*17H2O + 14(NH4)2SO4 + 14H2SO4 + 64H2O
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O = K11Fe7(C2O4)16*17H2O + (NH4)2SO4 + H2SO4 + H2O0Fe(NH4)2(SO4)2*6H2O + 0H2C2O4 + 0K2C2O4 + H2O = 0K11Fe7(C2O4)16*17H2O + 0(NH4)2SO4 + 0H2SO4 + H2O
FeCl3 + Ca(OH)2 = Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe +O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO +O2=Fe2O34FeO + O2 = 2Fe2O3
Fe+Cu(NO3)2=Fe(NO3)3+Cu2Fe + 3Cu(NO3)2 = 2Fe(NO3)3 + 3Cu
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
FeCl2 + K2S = FeS + KClFeCl2 + K2S = FeS + 2KCl
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
FeO(l)+Mg(l)=Fe(l)+MgO(s)FeO(l) + Mg(l) = Fe(l) + MgO(s)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl3 + Ag2SO4 = Fe2(SO4)3 + AgCl2FeCl3 + 3Ag2SO4 = Fe2(SO4)3 + 6AgCl
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeSiO3 + AlP = Fe3P2 + Al2(SiO3)33FeSiO3 + 2AlP = Fe3P2 + Al2(SiO3)3
Fe + H2SO4 = Fe2 (SO4) 3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe (s) + S (s) = FeS (s) Fe(s) + S(s) = FeS(s)
Fe2O3(s)+H2O(l)= Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe+Cu(SO4)2=Fe(SO4)3+Cu2Fe + 3Cu(SO4)2 = 2Fe(SO4)3 + 3Cu
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3(aq) +KSCN(aq) = Fe(SCN)3(aq) + KNO3(aq)Fe(NO3)3(aq) + 3KSCN(aq) = Fe(SCN)3(aq) + 3KNO3(aq)
Fe2O3(s) + CO(g) = 2 Fe(s) + CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(aq) +Fe+++ +HCl(g)= Fe++ +FeOH(aq) +Cl-(g)Fe2O3(aq) - 5Fe+++ + 3HCl(g) = -6Fe++ + 3FeOH(aq) + 3Cl-(g)
Fe2O3(aq) +Fe+++ +HCl= Fe++ +FeOH +ClFe2O3(aq) - 2Fe+++ + 3HCl = -3Fe++ + 3FeOH + 3Cl
FeCl3(s) + H2O(aq) = Fe2O3(aq) +HCl(g)2FeCl3(s) + 3H2O(aq) = Fe2O3(aq) + 6HCl(g)
FeCl3(s) + H2O(aq) = Fe2O3 +HCl(g)2FeCl3(s) + 3H2O(aq) = Fe2O3 + 6HCl(g)
FeCl3(s) + H2O(aq) = Fe2O3 +HCl2FeCl3(s) + 3H2O(aq) = Fe2O3 + 6HCl
FeCl3(s) + H2O(aq) = Fe(OH)3 + 3Cl- +3H+FeCl3(s) + 3H2O(aq) = Fe(OH)3 + 3Cl- + 3H+
Fe(III)Cl3(s) + H2O(aq) = Fe(III)(OH)3 + 3Cl- +3H+Fe(III)Cl3(s) + 3H2O(aq) = Fe(III)(OH)3 + 3Cl- + 3H+
Fe(III)Cl3(s) + H2O(aq) = Fe(III)(OH)3(aq) + 3Cl- +3H+Fe(III)Cl3(s) + 3H2O(aq) = Fe(III)(OH)3(aq) + 3Cl- + 3H+
Fe(III)Cl3(s) + H2O(aq) = Fe(III)(OH)3(aq) + 3Cl- +3H+Fe(III)Cl3(s) + 3H2O(aq) = Fe(III)(OH)3(aq) + 3Cl- + 3H+
FeCl3(s) + H2O(aq) = Fe(OH)3 + 3Cl- +3H+FeCl3(s) + 3H2O(aq) = Fe(OH)3 + 3Cl- + 3H+
FeCl3 + H2O = Fe(OH)3 + 3Cl- +3H+FeCl3 + 3H2O = Fe(OH)3 + 3Cl- + 3H+
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2SO4=Fe2 (SO4) 3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3 + KI = FeCl2 + KCl +I2 2FeCl3 + 2KI = 2FeCl2 + 2KCl + I2
Fe + MgCl2 = FeCl2 + MgFe + MgCl2 = FeCl2 + Mg
Fe + CuCl2= FeCl +Cu2Fe + CuCl2 = 2FeCl + Cu
Fe2O3+H2= Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2 O3 + C O = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeS+H2SO4=FeSO4+H2+H2SFeS + H2SO4 = FeSO4 + 0H2 + H2S
Fe(NO3)3 + CrBr2 = FeBr3 + Cr(NO3)22Fe(NO3)3 + 3CrBr2 = 2FeBr3 + 3Cr(NO3)2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O2+H2O=Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe(NH4)2(SO4)2*6H2O + H2C2O4 +K2C2O4 + H2O2 = K3Fe(C2O4)3*4H2O + (NH4)2SO4 + H2SO4 + H2O2Fe(NH4)2(SO4)2*6H2O + 3H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)3*4H2O + 2(NH4)2SO4 + 2H2SO4 + 6H2O
FeS + O2 = Fe2O3 = SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+HCl=FeCl+HFe + HCl = FeCl + H
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3*6H2O + (NH4)2HPO4 = FePO4 + HCl + NH4OH + H2OFeCl3*6H2O + (NH4)2HPO4 = FePO4 + 3HCl + 2NH4OH + 4H2O
Fe+ Cl=FeCl3Fe + 3Cl = FeCl3
Fe3O2(s) + C(s) = Fe=CO(g)Fe3O2(s) + 2C(s) = 3Fe + 2CO(g)
Fe(NH4)2(SO4)(H2O)6 + H2C2O4 + K2C2O4 + H2O2 = K3Fe(C2O4)(H2O)3 + (NH4)2SO4 + H2SO4 + H2O2Fe(NH4)2(SO4)(H2O)6 - H2C2O4 + 3K2C2O4 - H2O2 = 2K3Fe(C2O4)(H2O)3 + 2(NH4)2SO4 + 0H2SO4 + 4H2O
Fe 2 O 3 + 3H 2 = 2Fe + 3H 2 OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4(s) + H2(g) = Fe(l) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(l) + 4H2O(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4(s) + H2(g) = Fe(l) + H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(l) + 4H2O(g)
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe3O23Fe + O2 = Fe3O2
Fe2O3 = Fe + O22Fe2O3 = 4Fe + 3O2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + H2O = Fe(OH) + H3OFe + 2H2O = Fe(OH) + H3O
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NH4)2(SO4)2(H2O)6 + H2C2O4 + K2C2O4 + H2O2 = K3Fe(C2O4)3(H2O)4 + (NH4)2SO4 + H2SO4 + H2O2Fe(NH4)2(SO4)2(H2O)6 + 3H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)3(H2O)4 + 2(NH4)2SO4 + 2H2SO4 + 6H2O
Fe+HNO3=Fe(NO3)2+NH4NO3+H2O4Fe + 10HNO3 = 4Fe(NO3)2 + NH4NO3 + 3H2O
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2+H2O=H2SO4+FeSO42FeS2 + 7O2 + 2H2O = 2H2SO4 + 2FeSO4
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe(ClO4)2 + Na2CO3= FeCO3 + 2NaClO4Fe(ClO4)2 + Na2CO3 = FeCO3 + 2NaClO4
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS + HCl = FeCl2 +H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O = FeO + H2Fe + H2O = FeO + H2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+ H2= Fe+ H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeBr2+2NaOH=Fe(OH)2+2NaBrFeBr2 + 2NaOH = Fe(OH)2 + 2NaBr
FeBr2+2NaOH=Fe(OH)2+2NaBrFeBr2 + 2NaOH = Fe(OH)2 + 2NaBr
FeCl2 +Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe +H2C2O4+H2O=Fe(C2O4)3*3H2O+HFe + 3H2C2O4 + 3H2O = Fe(C2O4)3*3H2O + 6H
FeCl2 + KMnO4 = KCl + FeCl3 + MnCl2 + Fe2O315FeCl2 + 3KMnO4 = 3KCl + 7FeCl3 + 3MnCl2 + 4Fe2O3
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
Fe + O2 = Fe3O6Fe + O2 = 2Fe3O
Fe2O2+Al=Al2O3+Fe3Fe2O2 + 4Al = 2Al2O3 + 6Fe
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeSO4 + KI + KIO3 + H2O = Fe (OH)2 + K2SO4 + I23FeSO4 + 5KI + KIO3 + 3H2O = 3Fe(OH)2 + 3K2SO4 + 3I2
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeCl3 + CoCl2 = FeCl2 + CoCl3FeCl3 + CoCl2 = FeCl2 + CoCl3
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O + Al= Fe + Al2O33Fe2O + 2Al = 6Fe + Al2O3
Fe2O3+CO= Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 + 3I- = I3- + F2F2 + 0I- = 0I3- + F2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3 + Na(OH) = Fe(OH)3 + Na2(SO4)Fe2(SO4)3 + 6Na(OH) = 2Fe(OH)3 + 3Na2(SO4)
FeS+NaNO3+NaHSO4=Fe2(SO4)3+Na2SO4+NO+H2O2FeS + 6NaNO3 + 8NaHSO4 = Fe2(SO4)3 + 7Na2SO4 + 6NO + 4H2O
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe(NO3)2=Fe2O3+NO+O24Fe(NO3)2 = 2Fe2O3 + 8NO + 5O2
Fe(NO3)2=Fe2O3+NO+O24Fe(NO3)2 = 2Fe2O3 + 8NO + 5O2
Fe(NO3)2 + Al = Fe + AlNO3Fe(NO3)2 + 2Al = Fe + 2AlNO3
FeCl3 + H2SO4 + CH2O = FeCH2O + H2SO3 + 3 Cl22FeCl3 + 0H2SO4 + 2CH2O = 2FeCH2O + 0H2SO3 + 3Cl2
Fe(NO3)2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaNO3(aq)3Fe(NO3)2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaNO3(aq)
Fe2O3+2CO=2Fe+2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+2CO=2Fe+2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe++ + NO = FeNO++Fe++ + NO = FeNO++
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + HCl = FeCl2 + HFe + 2HCl = FeCl2 + 2H
Fe + HCl = FeCl2 + HFe + 2HCl = FeCl2 + 2H
Fe + HCl = FeCl2 + HFe + 2HCl = FeCl2 + 2H
FeCl2+Ag3PO4=Fe3(PO4)2+AgCl3FeCl2 + 2Ag3PO4 = Fe3(PO4)2 + 6AgCl
Fe(OH)2 = FeO + H2OFe(OH)2 = FeO + H2O
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + Pb(NO3)2 = Fe(NO3)3 + PbCl22FeCl3 + 3Pb(NO3)2 = 2Fe(NO3)3 + 3PbCl2
FeCl3 + AgNO3 = AgCl + Fe(NO3)3FeCl3 + 3AgNO3 = 3AgCl + Fe(NO3)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
FeCl3+K(OH)=KCl+Fe(OH)3FeCl3 + 3K(OH) = 3KCl + Fe(OH)3
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(s)+CuSO4(aq)=FeSO4(aq)+Cu(s)Fe(s) + CuSO4(aq) = FeSO4(aq) + Cu(s)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O = Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+Mg = MgCl2+Fe2FeCl3 + 3Mg = 3MgCl2 + 2Fe
Fe+H2O=H+Fe2O32Fe + 3H2O = 6H + Fe2O3
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe(NH4)2(SO4)2 + H2C2O4 + K2C2O4 + H2O2 = K6Fe2(C2O4) + (NH4)2SO4 + H2O20Fe(NH4)2(SO4)2 + 0H2C2O4 + 0K2C2O4 + H2O2 = 0K6Fe2(C2O4) + 0(NH4)2SO4 + H2O2
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe+Cd(NO3)2=Fe(NO3)3+Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2 O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe(NO3)3+KOH= Fe(OH)3+KNO3Fe(NO3)3 + 3KOH = Fe(OH)3 + 3KNO3
Fe +H2SO4=Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2+H2O+HCl = FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe(ClO4)3 = FeCl3+O2Fe(ClO4)3 = FeCl3 + 6O2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe+H2CO3=Fe2(CO3)3+H2020Fe + 30H2CO3 = 10Fe2(CO3)3 + 3H20
Fe0=Fe2+Fe0 = Fe2+
FeO2 + HCl = FeCl2 + Cl2 + H2OFeO2 + 4HCl = FeCl2 + Cl2 + 2H2O
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + H2O= Fe + OHFe2O3 + 3H2O = 2Fe + 6OH
Fe(OH)3 + H2CO3 = Fe2(CO3)3 + H2O2Fe(OH)3 + 3H2CO3 = Fe2(CO3)3 + 6H2O
FeCr2O4+Na2CO3+O2=Na2CrO4+Fe2O3+CO24FeCr2O4 + 8Na2CO3 + 7O2 = 8Na2CrO4 + 2Fe2O3 + 8CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS2+HNO3+HCl=FeCl3+H2SO4+NO+H2OFeS2 + 5HNO3 + 3HCl = FeCl3 + 2H2SO4 + 5NO + 2H2O
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS +O2 = SO2 + Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
Fe+O2+H2O=Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe + CuCl2 = FeCl3 + Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe2+Cl=FeClFe2 + 2Cl = 2FeCl
Fe2+Cl=Fe3Cl3Fe2 + 2Cl = 2Fe3Cl
Fe2Cl+Cl=Fe3Cl3Fe2Cl - Cl = 2Fe3Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = FeO + CO2Fe2O3 + CO = 2FeO + CO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(NO3)3(aq) + Na2(CO3)(aq) = Fe2(CO3)3(s) + NaNO3(aq)2Fe(NO3)3(aq) + 3Na2(CO3)(aq) = Fe2(CO3)3(s) + 6NaNO3(aq)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + HI = FeCl2 + HCl + I22FeCl3 + 2HI = 2FeCl2 + 2HCl + I2
FE+C6H3O7=H2O+CO2+FEC6H3O7FE + C6H3O7 = 0H2O + 0CO2 + FEC6H3O7
Fe(s) + HCl(aq) = FeCl2(aq) = H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3+ K2O =Fe2O3+ KCl2FeCl3 + 3K2O = Fe2O3 + 6KCl
Fe(NO3)2 +Na2CO3= FeCO3+ NaNO3Fe(NO3)2 + Na2CO3 = FeCO3 + 2NaNO3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s)+H2O(l)=Fe3O4+H2(g)3Fe(s) + 4H2O(l) = Fe3O4 + 4H2(g)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + NO = FeNOFe + NO = FeNO
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+N2H4 = Fe3O4+N2+H2O6Fe2O3 + N2H4 = 4Fe3O4 + N2 + 2H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(OH)3= Fe2 O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+HNO3=Fe(NO3)3+Fe2(SO4)3+NO+H2O3FeS + 12HNO3 = Fe(NO3)3 + Fe2(SO4)3 + 9NO + 6H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K3Fe(C2O4)3*4H2O + (NH4)2SO4 + H2SO4 + H2O2Fe(NH4)2(SO4)2*6H2O + 3H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)3*4H2O + 2(NH4)2SO4 + 2H2SO4 + 6H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4 + Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe+O=Fe3O23Fe + 2O = Fe3O2
Fe2Cl+Cl=Fe3Cl3Fe2Cl - Cl = 2Fe3Cl
Fe2+Cl=Fe3Cl3Fe2 + 2Cl = 2Fe3Cl
Fe2+Cl=FeClFe2 + 2Cl = 2FeCl
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
FeCl3 + Pb(NO3)2 = Fe(NO3)3 + PbCl22FeCl3 + 3Pb(NO3)2 = 2Fe(NO3)3 + 3PbCl2
FeSO4 + KI + KIO3 + H2O = Fe (OH)2 + K2SO4 + I23FeSO4 + 5KI + KIO3 + 3H2O = 3Fe(OH)2 + 3K2SO4 + 3I2
Fe(NO3)2 + Na3PO4 = Fe3(PO4)2 + NaNO33Fe(NO3)2 + 2Na3PO4 = Fe3(PO4)2 + 6NaNO3
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeCl3+AgI=FeI3+AgClFeCl3 + 3AgI = FeI3 + 3AgCl
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
F2 + H2O = OF2 + HF2F2 + H2O = OF2 + 2HF
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
F2 + LiBr=LiF + Br2F2 + 2LiBr = 2LiF + Br2
Fe + H2O=Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O=Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
F2 + LiBr=LiF + Br2F2 + 2LiBr = 2LiF + Br2
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
F2 + KBr = KF + Br2F2 + 2KBr = 2KF + Br2
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
Fe2 + HSo4 = Fe2(So4)3 + HFe2 + 3HSo4 = Fe2(So4)3 + 3H
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+C2O-1Fe2O3 + 6CO = -2Fe + 3C2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 = Fe3 + O26Fe2O3 = 4Fe3 + 9O2
FeBr3 + NaOH = FeOH + NaBr3FeBr3 + NaOH = FeOH + NaBr3
Fe+H2O= Fe3 O4 +H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=FeO32Fe + 3O2 = 2FeO3
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe+O2=FeO2Fe + O2 = 2FeO
Fe+O=FeOFe + O = FeO
FeCl2+KMnO4+HCl= FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + Na2S = FeS + NaClFeCl2 + Na2S = FeS + 2NaCl
FeO + C = Fe + CO22FeO + C = 2Fe + CO2
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
Fe(NO3)3 + Na3PO4 = FePO4 + NaNO3Fe(NO3)3 + Na3PO4 = FePO4 + 3NaNO3
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
FeS2 + HNO3 + HCl = FeCl3 + H2SO4 + NO + H2OFeS2 + 5HNO3 + 3HCl = FeCl3 + 2H2SO4 + 5NO + 2H2O
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K15Fe5(C2O4)15*19H2O + (NH4)2SO4 + H2SO4 + H2O10Fe(NH4)2(SO4)2*6H2O + 15H2C2O4 + 15K2C2O4 + 5H2O2 = 2K15Fe5(C2O4)15*19H2O + 10(NH4)2SO4 + 10H2SO4 + 32H2O
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K15Fe5(C2O4)15*15H2O + (NH4)2SO4 + H2SO4 + H2O10Fe(NH4)2(SO4)2*6H2O + 15H2C2O4 + 15K2C2O4 + 5H2O2 = 2K15Fe5(C2O4)15*15H2O + 10(NH4)2SO4 + 10H2SO4 + 40H2O
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K15Fe4(C2O4)12*15H2O + (NH4)2SO4 + H2SO4 + H255408Fe(NH4)2(SO4)2*6H2O + 459H2C2O4 + 765K2C2O4 - 459H2O2 = 102K15Fe4(C2O4)12*15H2O + 408(NH4)2SO4 + 408H2SO4 + 4H255
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K15Fe5(C2O4)15*15H2O + (NH4)2SO4 + H2SO4 + H255510Fe(NH4)2(SO4)2*6H2O + 765H2C2O4 + 765K2C2O4 - 765H2O2 = 102K15Fe5(C2O4)15*15H2O + 510(NH4)2SO4 + 510H2SO4 + 8H255
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K15Fe4(C2O4)12*15H2O + (NH4)2SO4 + H2SO4 + H2O8Fe(NH4)2(SO4)2*6H2O + 9H2C2O4 + 15K2C2O4 + H2O2 = 2K15Fe4(C2O4)12*15H2O + 8(NH4)2SO4 + 8H2SO4 + 20H2O
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K15Fe4(C2O4)12*15H2O + (NH4)2SO4 + H2SO4 + H2540Fe(NH4)2(SO4)2*6H2O + 45H2C2O4 + 75K2C2O4 - 45H2O2 = 10K15Fe4(C2O4)12*15H2O + 40(NH4)2SO4 + 40H2SO4 + 4H25
Fe(NH4)2(SO4)2*6H2O + H2C2O4 + K2C2O4 + H2O2 = K16Fe4(C2O4)12*15H2O + (NH4)2SO4 + H2SO4 + H2O 4Fe(NH4)2(SO4)2*6H2O + 4H2C2O4 + 8K2C2O4 + 0H2O2 = K16Fe4(C2O4)12*15H2O + 4(NH4)2SO4 + 4H2SO4 + 9H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2 + Cl2 = FeCl32FeCl2 + Cl2 = 2FeCl3
FeS2+O2= Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2 + K2S = FeS + 2KClFeCl2 + K2S = FeS + 2KCl
Fe(NO3)2(aq)+K2S(aq)=FeS(s)+2KNO3(aq)Fe(NO3)2(aq) + K2S(aq) = FeS(s) + 2KNO3(aq)
Fe(NO3)2(aq)+K2S(aq)=FeS(s)+2KNO3(aq)Fe(NO3)2(aq) + K2S(aq) = FeS(s) + 2KNO3(aq)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(s) +Cl2(g) = FeCl3(s) 2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3 + KOH = Fe(OH)3 + KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe(CO)5 + Ca = Ca(CO)5 + FeFe(CO)5 + Ca = Ca(CO)5 + Fe
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe(s)+Cl2(g)=FeCl32Fe(s) + 3Cl2(g) = 2FeCl3
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe + HNO3 = Fe(NO3)3 + NO + H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
FeS +H+ + NO3-=NO +SO4-2+Fe+3 +H2O FeS + 4H+ + 3NO3- = 3NO + SO4-2 + Fe+3 + 2H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.