Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
F + H2O = HF + O36F + 3H2O = 6HF + O3
Fe+H2SO4=Fe2(SO4)3 +H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
FeCl3 + H2O + SO2 = FeCl2 + H2SO4 + HCl2FeCl3 + 2H2O + SO2 = 2FeCl2 + H2SO4 + 2HCl
FeSO4 + NaOH + Cl2 = Fe(OH)3 + NaCl + Na2SO42FeSO4 + 6NaOH + Cl2 = 2Fe(OH)3 + 2NaCl + 2Na2SO4
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + O2 + HNO3 = Fe(NO3)2 + H2O2Fe + O2 + 4HNO3 = 2Fe(NO3)2 + 2H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 +NH3 +H2O = Fe(OH)3 +NH4Cl FeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe+H2SO4=Fe2(SO4)3+SO2+H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe+H2SO4=Fe2(SO4)3+SO2+H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe+H2SO4=Fe2(SO4)3+SO2+H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeCl3+(NH4)3PO4=NH4Cl+FePO4FeCl3 + (NH4)3PO4 = 3NH4Cl + FePO4
Fe + HNO3 = Fe(NO3)2 + NO + H2O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS(s)+HCl(aq)=FeCl 2 (aq)+H 2 S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3 + K2CO3 = FeCO3 +K2Cl3FeCl3 + K2CO3 = FeCO3 + K2Cl3
FeCl3 + K2CO3 = FeCO3 +K2Cl3FeCl3 + K2CO3 = FeCO3 + K2Cl3
FeCl3 + K2CO3 = FeCO3 +K2Cl3FeCl3 + K2CO3 = FeCO3 + K2Cl3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeO + H2= Fe + H2OFeO + H2 = Fe + H2O
Fe(OH)3(s) =Fe2O3(s) +H2O(s)2Fe(OH)3(s) = Fe2O3(s) + 3H2O(s)
Fe + CuH10O9S = FeSO4 + Cu +H2OFe + CuH10O9S = FeSO4 + Cu + 5H2O
F2 (g) + AlCl3 (s) = AlF3 (s) (aq)+ Cl2 (g)3F2(g) + 2AlCl3(s) = 2AlF3(s)(aq) + 3Cl2(g)
F2 + AlCl3 = AlF3 + Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
F2(g) + AlCl3 = AlF3(s) (aq) + Cl2 (g)3F2(g) + 2AlCl3 = 2AlF3(s)(aq) + 3Cl2(g)
Fe2O3(s)+C(s) = Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3+6HBr=2FeBr3+3H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe+ AgNO3 = Fe(NO3)2+ AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2(CO3)3 + HCl = FeCl3 + H2O + CO2 Fe2(CO3)3 + 6HCl = 2FeCl3 + 3H2O + 3CO2
Fe2(CO3)3 + HCl = FeCl3 + H2O + CO2 Fe2(CO3)3 + 6HCl = 2FeCl3 + 3H2O + 3CO2
Fe2(CO3)3 + HCl = FeCl3 + H2O + CO2 Fe2(CO3)3 + 6HCl = 2FeCl3 + 3H2O + 3CO2
Fe2(SO4)3+K(OH)=K2(SO4)+Fe(OH)3Fe2(SO4)3 + 6K(OH) = 3K2(SO4) + 2Fe(OH)3
Fe3O4 + C = Fe + CO2Fe3O4 + 2C = 3Fe + 2CO2
Fe+HO4=H+Fe3O43Fe + HO4 = H + Fe3O4
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + H2O = Fe2O3+ H22Fe + 3H2O = Fe2O3 + 3H2
Fe + H2O = Fe2O3+ H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(NO3)3 + 3 NH4SCN = Fe(SCN)3 + 3 NH4NO3Fe(NO3)3 + 3NH4SCN = Fe(SCN)3 + 3NH4NO3
Fe(NO3)3 + 3 NH4SCN = Fe(SCN)3 + 3 NH4NO3Fe(NO3)3 + 3NH4SCN = Fe(SCN)3 + 3NH4NO3
Fe2P(s) + S(s) =P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe2P(s) + S(s) =P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe(NO3)3(aq)+H2SO3(aq)=Fe2(SO3)3(s)+HNO3(aq)2Fe(NO3)3(aq) + 3H2SO3(aq) = Fe2(SO3)3(s) + 6HNO3(aq)
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=Fe2O3+4SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(SO4)3+Ba(NO3)2=Fe(NO3)3+BaSO4Fe2(SO4)3 + 3Ba(NO3)2 = 2Fe(NO3)3 + 3BaSO4
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3+Al=Fe+Al2OFe2O3 + 6Al = 2Fe + 3Al2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + Al = Fe+ Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + HCl =FeCl3 +H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe + Cl2=FeCl3 2Fe + 3Cl2 = 2FeCl3
FeSO4+BaCl2=FeCl2 + BaSO4FeSO4 + BaCl2 = FeCl2 + BaSO4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
F2 + NaOH = O2 + NaF + H2O2F2 + 4NaOH = O2 + 4NaF + 2H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+CuSO4(aq)=FeSO4(aq)+CuFe(s) + CuSO4(aq) = FeSO4(aq) + Cu
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH)3 + H2SO4 = Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(CO3)3 + 6HCl = FeCl + H2(CO3)3Fe2(CO3)3 + 2HCl = 2FeCl + H2(CO3)3
Fe2S3+ HNO3=2Fe(NO3)3+3S+NO2+6H2OFe2S3 + 12HNO3 = 2Fe(NO3)3 + 3S + 6NO2 + 6H2O
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe (s) + H2O (l) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fr2O(s) + H2O(l) = FrOH(aq)Fr2O(s) + H2O(l) = 2FrOH(aq)
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
F2+ MgCl2= 2FCl +MgF2 + MgCl2 = 2FCl + Mg
Fe3+ 3OH=Fe(OH)3(s)Fe3 + 9OH = 3Fe(OH)3(s)
Fe + MgCl2 = FeCl2 + MgFe + MgCl2 = FeCl2 + Mg
FeTiO3 + H2SO4 = TiO2 + H2O + FeSO4FeTiO3 + H2SO4 = TiO2 + H2O + FeSO4
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeTiO3 + H2SO4 = Ti2O3 + H2O + SO2 + FeO2FeTiO3 - H2SO4 = Ti2O3 - H2O - SO2 + 2FeO
Fe3O4+O2=Fe2O34Fe3O4 + O2 = 6Fe2O3
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
FeSO4 +NaOH=FeOH +NaSO4FeSO4 + NaOH = FeOH + NaSO4
FeC2O4 +Ce(NO3)3 = Fe(NO3)3 + Ce(NO3)2 + CO2FeC2O4 + 3Ce(NO3)3 = Fe(NO3)3 + 3Ce(NO3)2 + 2CO2
FeSO4 + NaOH + NaBrO + H2O = Fe(OH)3 + NaBr + Na2SO42FeSO4 + 4NaOH + NaBrO + H2O = 2Fe(OH)3 + NaBr + 2Na2SO4
Fe(OH)2 + H2O(l) + O2(g) =  Fe(OH)3(s)4Fe(OH)2 + 2H2O(l) + O2(g) = 4Fe(OH)3(s)
FeSO4+HNO3+H2SO4=Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 + 6KOH =3K2SO4 + 2Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe2Cl3+Mg=Fe3+Mg2Cl3Fe2Cl3 + 18Mg = 2Fe3 + 9Mg2Cl
FeCl3+Mg=Fe3+MgCl3FeCl3 + 9Mg = Fe3 + 9MgCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH)2 + H2O2 = Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
Fe2S3+K2CO3=Fe2(CO3)3+K2SFe2S3 + 3K2CO3 = Fe2(CO3)3 + 3K2S
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
F2 + HBr=Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + H2SO4=Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + CO3 = Fe2(CO3)22Fe + 2CO3 = Fe2(CO3)2
FeCl3 + K2SO4 = Fe2(SO4)3 + KCl2FeCl3 + 3K2SO4 = Fe2(SO4)3 + 6KCl
Fe + H2O = Fe(OH)3+H22Fe + 6H2O = 2Fe(OH)3 + 3H2
Fe2O3 + 3H2O = 4 Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+NH4 OH=Fe(OH)3+NH4 ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3+NH4 OH=Fe(OH)3+NH4 ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH)2 + H2O2 = Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
FeCl3 + NaHCO3 = FeHCO3 + NaCl3FeCl3 + NaHCO3 = FeHCO3 + NaCl3
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe(NO3)3+NH3+H20=Fe(OH)3+NH4NO35Fe(NO3)3 + 5NH3 + 2H20 = 5Fe(OH)3 + 10NH4NO3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + H2O = 4Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(s)+S(l) = FeS3(s) Fe(s) + 3S(l) = FeS3(s)
Fe+CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe+CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Pb2So32 = Fe2So32 + Pb2Fe + Pb2So32 = Fe2So32 + 2Pb
Fe + S2 = Fe2S3 4Fe + 3S2 = 2Fe2S3
Fe + O2= Fe3O43Fe + 2O2 = Fe3O4
Fe3O4 + H = Fe + H2OFe3O4 + 8H = 3Fe + 4H2O
Fe+S=FeSFe + S = FeS
Fe+LiCO3=Fe(CO3)3+LiFe + 3LiCO3 = Fe(CO3)3 + 3Li
Fe+LiCO3=Fe(CO3)3+LiFe + 3LiCO3 = Fe(CO3)3 + 3Li
FeCl3*6H2O + H2O2 = Fe2O3 + HCl + H2O2FeCl3*6H2O + 0H2O2 = Fe2O3 + 6HCl + 9H2O
FeCl3*6H2O + H2O2 = Fe2O3 + HCl + H2O2FeCl3*6H2O + 0H2O2 = Fe2O3 + 6HCl + 9H2O
FeCl3*6H2O + H2O + H2O2 = Fe2O3 + HCl2FeCl3*6H2O - 9H2O + 0H2O2 = Fe2O3 + 6HCl
FeCl3*6H2O + H2O + H2O2 = Fe2O3 + 6HCl2FeCl3*6H2O - 9H2O + 0H2O2 = Fe2O3 + 6HCl
FeSO4 +PO4 = FePO4 + SO4FeSO4 + PO4 = FePO4 + SO4
FeSO4 +PO4 = FePO4 + SO4FeSO4 + PO4 = FePO4 + SO4
Fe + O2 + H2O = Fe (OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 + H2O = Fe (OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 = FeO2Fe + O2 = 2FeO
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2S3 + SO22FeS2 + O2 = Fe2S3 + SO2
Fe+ H2O= Fe3O4+ H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+Zn=Fe+ZnOFe3O4 + 4Zn = 3Fe + 4ZnO
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe(s)+HCl=H2+FeCl2Fe(s) + 2HCl = H2 + FeCl2
Fe(s)+HCl=H2+FeCl2Fe(s) + 2HCl = H2 + 2FeCl
FeSO4+KMnO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
FeO(s) + HNO3(aq) = Fe(NO3)2(aq) + H2O(l)FeO(s) + 2HNO3(aq) = Fe(NO3)2(aq) + H2O(l)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2=Fe2O34Fe(s) + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + Cu(NO3)2 = Cu + Fe(NO3)2Fe + Cu(NO3)2 = Cu + Fe(NO3)2
Fe3+ + NH3OH+ = Fe2+ + N2O + H2O + H+-8Fe3+ + 2NH3OH+ = -12Fe2+ + N2O + H2O + 6H+
Fe3+ + 2NH3OH+ = 3Fe2+ + 4N2O + 5H2O + 6H+-8Fe3+ + 2NH3OH+ = -12Fe2+ + N2O + H2O + 6H+
Fe3+ + NH3OH+ = Fe2+ + N2O+H2O+H+-8Fe3+ + 2NH3OH+ = -12Fe2+ + N2O + H2O + 6H+
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2+Ca=CaF2F2 + Ca = CaF2
Fe2O3 + C=Fe + CO2 2Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe+3Cl=2FeClFe + Cl = FeCl
Fe+2O2=6FeO2Fe + O2 = FeO2
Fe+2O2=6FeO2Fe + O2 = FeO2
Fe+3Cl=2FeClFe + Cl = FeCl
Fe+2O2=6FeO2Fe + O2 = FeO2
Fe+2O2 = 6FeO2Fe + O2 = FeO2
Fe+2O2=6FeO2Fe + O2 = FeO2
Fe+2O2=6FeO2Fe + O2 = FeO2
F2 + Al2O3 = AlF3 + O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe(OH)3= Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl2 + AgNO3 = Fe(NO3)2 + AgClFeCl2 + 2AgNO3 = Fe(NO3)2 + 2AgCl
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
F + H2O = HF + O24F + 2H2O = 4HF + O2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+AgNO3 = Fe(NO3)3+AgFe + 3AgNO3 = Fe(NO3)3 + 3Ag
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g) Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s) 2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeBr3+Na2S=Fe2S3+NaBr2FeBr3 + 3Na2S = Fe2S3 + 6NaBr
FeBr3+Na2S=Fe2S3+NaBr2FeBr3 + 3Na2S = Fe2S3 + 6NaBr
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4 = Fe(SO4)3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
FeSO4+K3PO4=FePO4+K3SO4FeSO4 + K3PO4 = FePO4 + K3SO4
FeS2+O2=Fe2O3+SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + H2O = Fe(OH)3 + H22Fe + 6H2O = 2Fe(OH)3 + 3H2
Fe + HNO3 = Fe(NO3)3 + NO +H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe + HNO3 = Fe(NO3)3 + NO +H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3=Fe+Cl22FeCl3 = 2Fe + 3Cl2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+S=FeSFe + S = FeS
Fe+S=FeS2Fe + 2S = FeS2
Fe+S=Fe2S2Fe + S = Fe2S
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3 + Be3(PO4)2 = BeCl2 + FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe2SO4*7H2O = H2O + SO3 + SO2 + Fe2O3Fe2SO4*7H2O = 7H2O - SO3 + 2SO2 + Fe2O3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+++ + Cu = Cu+++ + FeFe+++ + Cu = Cu+++ + Fe
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+HC2H3O2=Fe(C2H3O2)+H22Fe + 2HC2H3O2 = 2Fe(C2H3O2) + H2
Fe + CuSo4 = FeSo4 +2CuFe + CuSo4 = FeSo4 + Cu
Fe + CuSo4 = FeSo4 + CuFe + CuSo4 = FeSo4 + Cu
Fe + CuSo4 = FeSo4 + CuFe + CuSo4 = FeSo4 + Cu
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe + C2H4O2= FeH4O2 + C2Fe + C2H4O2 = FeH4O2 + C2
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+F2=FeF3+Cl22FeCl3 + 3F2 = 2FeF3 + 3Cl2
FeCi3+NH4OH=Fe(OH)3+NH4CiFeCi3 + 3NH4OH = Fe(OH)3 + 3NH4Ci
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(NO3)2 + H2O = HNO3 + NO + FeO23Fe(NO3)2 + 2H2O = 4HNO3 + 2NO + 3FeO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=FeO4Fe + 2O2 = FeO4
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+ CO= CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+ CO= CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3 + Na2CO3=Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeBr3(aq)+Na2S(aq)=Fe2S3(s)+NaBr(aq)2FeBr3(aq) + 3Na2S(aq) = Fe2S3(s) + 6NaBr(aq)
Fe(s)+O2(g) = Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3+Na3P=FeP+NaClFeCl3 + Na3P = FeP + 3NaCl
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
F2+KBr=KF+Br2F2 + 2KBr = 2KF + Br2
Fe2O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FePO4 + CaSO4 = Fe2(SO4)3 + Ca3(PO4)22FePO4 + 3CaSO4 = Fe2(SO4)3 + Ca3(PO4)2
FePO4 + CaSO4 = Fe2(SO4)3 + Ca3(PO4)22FePO4 + 3CaSO4 = Fe2(SO4)3 + Ca3(PO4)2
FePO4 + CaSO4 = Fe2(SO4)3 + Ca3(PO4)22FePO4 + 3CaSO4 = Fe2(SO4)3 + Ca3(PO4)2
FePO4 + CaSO4 = Fe2(SO4)3 + Ca3(PO4)22FePO4 + 3CaSO4 = Fe2(SO4)3 + Ca3(PO4)2
Fe3+ NO3 + Na OH = Fe(OH)3 + NaNO3Fe3 + 9NO3 + 9NaOH = 3Fe(OH)3 + 9NaNO3
Fe2O2(s)+C(s)=Fe(s)+CO(g)Fe2O2(s) + 2C(s) = 2Fe(s) + 2CO(g)
FeCl3 (aq) + NH4OH (aq) =Fe(OH)3 (s) + NH4Cl (aq)FeCl3(aq) + 3NH4OH(aq) = Fe(OH)3(s) + 3NH4Cl(aq)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeS2+O2=SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
FeS2+O2=SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe3+ + NH3OH+ = Fe2+ + N2O + H20 + H+ -40Fe3+ + 0NH3OH+ = -60Fe2+ + 0N2O - H20 + 20H+
Fe2P(s) + S(s) =P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe + Cl2 = FeCl3 2Fe + 3Cl2 = 2FeCl3
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe +Fe(NO3)3=2 Fe3NO38Fe + Fe(NO3)3 = 3Fe3NO3
Fe +Fe(NO3)2=2 Fe2NO33Fe + Fe(NO3)2 = 2Fe2NO3
Fe +Fe(NO3)2= Fe2NO33Fe + Fe(NO3)2 = 2Fe2NO3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=3CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3+SO34FeS + 9O2 = 2Fe2O3 + 4SO3
Fe + SO4H = SO4Fe3 +H3Fe + SO4H = SO4Fe3 + H
Fe + SO4H = SO4Fe +HFe + SO4H = SO4Fe + H
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(SO4)+KCrO7+H2SO4=Fe2(SO4)4+Cr2(SO4)3+K2SO4+H2O10Fe(SO4) + 2KCrO7 + 14H2SO4 = 5Fe2(SO4)4 + Cr2(SO4)3 + K2SO4 + 14H2O
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe3O4+C=Fe+COFe3O4 + 4C = 3Fe + 4CO
Fe2(SO4)3(aq)+3Na2S(aq)=Fe2S3(s)+3Na2SO4(aq)Fe2(SO4)3(aq) + 3Na2S(aq) = Fe2S3(s) + 3Na2SO4(aq)
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe(NO3)3 +KSCN= FeSCN (SCN)2 + KNO3Fe(NO3)3 + 3KSCN = FeSCN(SCN)2 + 3KNO3
Fe(SO4)+KCrO7+H2SO4=Fe2(SO4)4+Cr2(SO4)3+K2SO4+H2O10Fe(SO4) + 2KCrO7 + 14H2SO4 = 5Fe2(SO4)4 + Cr2(SO4)3 + K2SO4 + 14H2O
Fe(SO4)+ K2Cr2O7+H2SO4 = Fe2(SO4)3+Cr2(SO4)3+K2SO4+H2O6Fe(SO4) + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
Fe+O2=FeO2Fe + O2 = FeO2
Fe(SO4)+ KMnO4+H2SO4 = Fe(SO4)3+MnSO4+K2SO4+H2O5Fe(SO4) + 4KMnO4 + 16H2SO4 = 5Fe(SO4)3 + 4MnSO4 + 2K2SO4 + 16H2O
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2+O2=F2O2F2 + O2 = 2F2O
FeO+C=CO+FeFeO + C = CO + Fe
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 (s) + O2 ( g) = Fe2O3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2(SO4)3 + BaCl2=BaSO4+FeCl3Fe2(SO4)3 + 3BaCl2 = 3BaSO4 + 2FeCl3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe (OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+HNO3=Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe(OH)3+HNO3=Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
FeS2+O2=FeO+SO22FeS2 + 5O2 = 2FeO + 4SO2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 +SiO2= Fe2Si2O7Fe2O3 + 2SiO2 = Fe2Si2O7
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + H2O = FeO4 + H2Fe + 4H2O = FeO4 + 4H2
Fe2S3+O2=Fe+SO2Fe2S3 + 3O2 = 2Fe + 3SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(C2H3O2) + Hg(NO3)2 = Fe(NO3)2 + Hg2(C2H3O2)22Fe(C2H3O2) + 2Hg(NO3)2 = 2Fe(NO3)2 + Hg2(C2H3O2)2
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(NO3)3 + ZnSO3 = Fe(SO3)3 + ZnNO3Fe(NO3)3 + 3ZnSO3 = Fe(SO3)3 + 3ZnNO3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+H2 = Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + Cu(NO3)2 = Cu + Fe(NO3)2Fe + Cu(NO3)2 = Cu + Fe(NO3)2
Fe +O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2S3 + SO3 =FeO + SO2Fe2S3 + 5SO3 = 4FeO + 11SO
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe+HCl =FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeO + SiO2 = FeSiO3FeO + SiO2 = FeSiO3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+S(l)=Fe 2 S 3 (s) 2Fe(s) + 3S(l) = Fe2S3(s)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS+2HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + NaOH = FeOH + NaSO4FeSO4 + NaOH = FeOH + NaSO4
Fe2(SO4)3+SO2+H2O=FeSO4+H2SO4Fe2(SO4)3 + SO2 + 2H2O = 2FeSO4 + 2H2SO4
Fe+O2+H2O=Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
FeSO4 +KClO3 +H2SO4 = Fe2(SO4)3 + K2SO4 +Cl2 +H2O10FeSO4 + 2KClO3 + 6H2SO4 = 5Fe2(SO4)3 + K2SO4 + Cl2 + 6H2O
Fe2O3+ H2= Fe+ H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeCl3 + MgO = FeO + MgCl3FeCl3 + MgO = FeO + MgCl3
FeCl3 + MgO = FeO + MgCl3FeCl3 + MgO = FeO + MgCl3
FePO4+AgNO3= Ag3PO4 +Fe(NO3)3FePO4 + 3AgNO3 = Ag3PO4 + Fe(NO3)3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe2O3+3Zn=3ZnO+2FeFe2O3 + 3Zn = 3ZnO + 2Fe
F+D+S=FDSF + D + S = FDS
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+S(l)=Fe2S3(s)2Fe + 3S(l) = Fe2S3(s)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=FeO4+H2Fe + 4H2O = FeO4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
F2+LiCl = LiF+Cl2F2 + 2LiCl = 2LiF + Cl2
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe+3O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3+Cl2=FeCl3+Br22FeBr3 + 3Cl2 = 2FeCl3 + 3Br2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2S3 + H2O + O2 = Fe2O3 + H2SO4Fe2S3 + 3H2O + 6O2 = Fe2O3 + 3H2SO4
Fe2S3 + H2O + O2 = Fe2O3 + H2SO4Fe2S3 + 3H2O + 6O2 = Fe2O3 + 3H2SO4
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
F2 + NaBr = NaF + Br2F2 + 2NaBr = 2NaF + Br2
Fe2S3 + H2O + O2 = Fe2O3 + H2SO4Fe2S3 + 3H2O + 6O2 = Fe2O3 + 3H2SO4
Fe3O4+ Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeO + H2 = Fe + H2OFeO + H2 = Fe + H2O
Fe2 O3 + H2 = Fe + H2O Fe2O3 + 3H2 = 2Fe + 3H2O
FeO + H2 = FeOH2FeO + H2 = FeOH2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
FePO4+NaSO4=FeSO4+NaPO4FePO4 + NaSO4 = FeSO4 + NaPO4
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+HCL+HNO3=H2+CL2+FeOH+NO2Fe + 0HCL + HNO3 = 0H2 + 0CL2 + FeOH + NO2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2+Br=FeBr2Fe2 + 4Br = 2FeBr2
FeCl3 + Be3(PO4)2 = BeCl2 + FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe + O2 + H2O = FeO3H2Fe + O2 + H2O = FeO3H2
FeCl + H2O = Fe(OH) + HCl FeCl + H2O = Fe(OH) + HCl
FeCl + H2O = Fe(OH) + HCl FeCl + H2O = Fe(OH) + HCl
Fe+O2+H2O=Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 + NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
F2 + LiCl = LiF + Cl2F2 + 2LiCl = 2LiF + Cl2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + Cu(NO3)2 = Cu + Fe(NO3)32Fe + 3Cu(NO3)2 = 3Cu + 2Fe(NO3)3
Fe (s)+ O2 (g) = FeO3 (s)2Fe(s) + 3O2(g) = 2FeO3(s)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(s) + HCl(aq) = FeCl2(aq) + H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
FeBr3+K2CO3=K2Br+Fe(CO3)3FeBr3 + 3K2CO3 = 3K2Br + Fe(CO3)3
FeCl2 + NaNO3 + HCl = FeCl3 + NaCl + H2O + NO3FeCl2 + NaNO3 + 4HCl = 3FeCl3 + NaCl + 2H2O + NO
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
FeCl2 + (NH4)3PO4 = NH4Cl + Fe3(PO4)23FeCl2 + 2(NH4)3PO4 = 6NH4Cl + Fe3(PO4)2
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeO(l)+Al(l)=Al2O3(l)+Fe(l) 3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO = Fe + O22FeO = 2Fe + O2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(CO3)3 + HCl = FeCl3 + H2O + CO2Fe2(CO3)3 + 6HCl = 2FeCl3 + 3H2O + 3CO2
Fe2(CO3)3 + HClO3 = Fe(ClO3)3 + CO2 + H2OFe2(CO3)3 + 6HClO3 = 2Fe(ClO3)3 + 3CO2 + 3H2O
F2 + LiCl = LiF + Cl2F2 + 2LiCl = 2LiF + Cl2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + H2S = 2 FeS + S + 3H2OFe2O3 + 3H2S = 2FeS + S + 3H2O
Fe + HBr=FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
FeCl3 + (NH4)3PO4 = NH4Cl +FePO4FeCl3 + (NH4)3PO4 = 3NH4Cl + FePO4
Fe(NO3)3 + NaOH = Fe(OH)3 + NaNO3 Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
FeNO3 + NaOH = FeOH + NaNO3 FeNO3 + NaOH = FeOH + NaNO3
Fe2O3 + H2 = Fe3 + H2O3Fe2O3 + 9H2 = 2Fe3 + 9H2O
Fe + Al2(SO4)3= Fe (SO4)3 + Al2Fe + Al2(SO4)3 = Fe(SO4)3 + Al2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F + NaI = NaF + I F + NaI = NaF + I
Fe2(SO3)3 + H3PO4 = FePO4 + SO2 + H2OFe2(SO3)3 + 2H3PO4 = 2FePO4 + 3SO2 + 3H2O
FeCl3 + NaOH = Fe(OH)3 + NaCl FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=FeO2Fe + O2 = 2FeO
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeS+O2 = Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2O3+CO=FeO+CO2Fe2O3 + CO = 2FeO + CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+ Pb(NO3)2= Fe(NO3)2+ PbFe + Pb(NO3)2 = Fe(NO3)2 + Pb
Fe2O3+ H2= Fe+ H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 + (NH4)3PO4 = NH4Cl + FePO4FeCl3 + (NH4)3PO4 = 3NH4Cl + FePO4
Fe2(CO3)3 + HClO3 = H2CO3 + Fe(ClO3)3 Fe2(CO3)3 + 6HClO3 = 3H2CO3 + 2Fe(ClO3)3
Fe+Pb(NO3)2=Fe(NO3)2+PbFe + Pb(NO3)2 = Fe(NO3)2 + Pb
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)2 + H3PO4 = Fe3(PO4)2 + H2O3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS + O2 = SO2 + Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
FeS + O2 = SO2 + Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3+C2I9=Fe2I3 +C2Fe3 + C2I9 = 3Fe2I3 + 2C
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3+H2S=Fe2S3+HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe(OH)3 = Fe + OHFe(OH)3 = Fe + 3OH
Fe(OH)3 = Fe + 3OHFe(OH)3 = Fe + 3OH
Fe2O3 + 3H2=2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe (CrO2) 2+H2=FeH2+CrH3+H2OFe(CrO2)2 + 8H2 = FeH2 + 2CrH3 + 4H2O
Fe+HCl= FeCl+HFe + HCl = FeCl + H
Fe (OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2 (CO3)3= Fe2O3 + CO2Fe2(CO3)3 = Fe2O3 + 3CO2
F2 + NaBr = NaF + Br2F2 + 2NaBr = 2NaF + Br2
Fe+PbSO4= Fe2(SO4)3 + Pb2Fe + 3PbSO4 = Fe2(SO4)3 + 3Pb
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeAsS+HNO3 = Fe3O4+As2O3+S8+NO2+H2O24FeAsS + 136HNO3 = 8Fe3O4 + 12As2O3 + 3S8 + 136NO2 + 68H2O
FeCl3+AuNO3 = AuCl + Fe(N O3)3FeCl3 + 3AuNO3 = 3AuCl + Fe(NO3)3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)2 = FeO + H2OFe(OH)2 = FeO + H2O
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.