Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2+O2=FeO+SO22FeS2 + 5O2 = 2FeO + 4SO2
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3 + Zn = ZnSO4 + FeFe2(SO4)3 + 3Zn = 3ZnSO4 + 2Fe
Fe(SO4)3 + Zn = ZnSO4 + FeFe(SO4)3 + 3Zn = 3ZnSO4 + Fe
Fe2O3 + CO = Fe + CO0Fe2O3 + CO = 0Fe + CO
FeOOH + H2S + H+ = FeS + SO4-- + H2O8FeOOH + 9H2S - 2H+ = 8FeS + SO4-- + 12H2O
FeOOH + H2S + H+ = FeS + SO4-- + H2O8FeOOH + 9H2S - 2H+ = 8FeS + SO4-- + 12H2O
FeOOH + H2S + H+ = FeS + SO-4-- + H2O2FeOOH + H2S + 6H+ = 2FeS - SO-4-- + 5H2O
FeS2(s) + O2(g) = FeO(s) + SO2(g)2FeS2(s) + 5O2(g) = 2FeO(s) + 4SO2(g)
FeS (s) + O2(g) = FeO(s) + SO2(g)2FeS(s) + 3O2(g) = 2FeO(s) + 2SO2(g)
FeSO4+O2=Fe2O3+SO34FeSO4 + O2 = 2Fe2O3 + 4SO3
Fe(NO3)3+NH4OH=Fe(OH)+NH4(NO3)3Fe(NO3)3 + NH4OH = Fe(OH) + NH4(NO3)3
Fe(NO3)3+NH4OH=FeOH+NH4(NO3)3Fe(NO3)3 + NH4OH = FeOH + NH4(NO3)3
FeCl3+SnCl2=FeCl2+SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
FeS (s) +O2(g) = FeO(s) +SO2(g) 2FeS(s) + 3O2(g) = 2FeO(s) + 2SO2(g)
FeS2(s) + O2(g)=FeO(s) + SO2(g)2FeS2(s) + 5O2(g) = 2FeO(s) + 4SO2(g)
FeS (s) + O2(g)=FeO(s) + SO2(g)2FeS(s) + 3O2(g) = 2FeO(s) + 2SO2(g)
FeCl3 +2 NH4OH = 3 Fe(OH)3 + 4 NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3 +2 NH4OH = 3 Fe(OH)3 + 4 NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3+SO2+H2O=FeCl2+HCl+H2SO42FeCl3 + SO2 + 2H2O = 2FeCl2 + 2HCl + H2SO4
FeS2(s) + O2(g) = FeO(s) + SO2(g)2FeS2(s) + 5O2(g) = 2FeO(s) + 4SO2(g)
FeS (s) + O2(g) = FeO(s) + SO2(g)2FeS(s) + 3O2(g) = 2FeO(s) + 2SO2(g)
FeS2 + Fe3 + H2O = H2SO4 + Fe20FeS2 + 2Fe3 + 0H2O = 0H2SO4 + 3Fe2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(SCN) + AgNO3 = Fe(NO3) + AgSCNFe(SCN) + AgNO3 = Fe(NO3) + AgSCN
Fe + V2O3 = Fe2O2 + VO2Fe + 2V2O3 = Fe2O2 + 4VO
FeS +H2S=FeS2 + H2FeS + H2S = FeS2 + H2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeCr2O4+K2CO3+O2=K2CrO4+Fe2O3+CO24FeCr2O4 + 8K2CO3 + 7O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe(s)+O2(g)+H2O=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(aq)
Fe(NO3)3+NH4OH=FeOH+NH4(NO3)3Fe(NO3)3 + NH4OH = FeOH + NH4(NO3)3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + O2 = Fe O 2Fe + O2 = 2FeO
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe + O2 +H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 +H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O2 + CO = Fe + CO2Fe3O2 + 2CO = 3Fe + 2CO2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeS2 + O2+ H2O = Fe2O3 + H2SO44FeS2 + 15O2 + 8H2O = 2Fe2O3 + 8H2SO4
Fe3O3(s)+CO(g)=CO2+Fe(s)Fe3O3(s) + 3CO(g) = 3CO2 + 3Fe(s)
Fe2(SO4)3 + (NH4)2SO4 + H2O = NH4Fe(SO4)2*12H2OFe2(SO4)3 + (NH4)2SO4 + 24H2O = 2NH4Fe(SO4)2*12H2O
Fe2(SO4)3 + (NH4)2SO4 + H2O = NH4Fe(SO4)2*12H2OFe2(SO4)3 + (NH4)2SO4 + 24H2O = 2NH4Fe(SO4)2*12H2O
FeCl2 + Ag3PO4 = Fe3(PO4)2 + AgCl3FeCl2 + 2Ag3PO4 = Fe3(PO4)2 + 6AgCl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FE(OH)2+HCL=FECL+H3O2FE(OH)2 + HCL = FECL + H3O2
FE(OH)2+HCL=FECL+H3O2FE(OH)2 + HCL = FECL + H3O2
FeO3 + C = Fe = COFeO3 + 3C = Fe + 3CO
Fe3O4+HBr=FeBr2+FeBr3+H2OFe3O4 + 8HBr = FeBr2 + 2FeBr3 + 4H2O
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2(SO4)3+ H2O+ SO2= Fe2SO4+H2SO4Fe2(SO4)3 + 4H2O + 2SO2 = Fe2SO4 + 4H2SO4
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2S3 + H2O + O2 = Fe(OH)3 +SO22Fe2S3 + 6H2O + 9O2 = 4Fe(OH)3 + 6SO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3 +Cl +H = FeCl2 +H2OFe(OH)3 + 2Cl + 3H = FeCl2 + 3H2O
FeSO4 = Fe + SO4FeSO4 = Fe + SO4
Fe3O4(s)+4H2(g)=3Fe(s)+4H2O(l)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(l)
Fe3O4(s)+4H2(g)=3Fe(s)+4H2O(l)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(l)
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 +H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3+3CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + Sb2O5 + Na2CO3 = Na4FeSbO6 + CO2Fe2O3 + Sb2O5 + 4Na2CO3 = 2Na4FeSbO6 + 4CO2
Fe+O2+H2O=Fe (OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2 + Cl2 = FeCl32FeCl2 + Cl2 = 2FeCl3
Fe(OH)3 +H2S=Fe2S3+H2O2Fe(OH)3 + 3H2S = Fe2S3 + 6H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Be3(PO4)2 = BeCl2 + FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe + HC2H3O2 = Fe(C2H3O2)3 + H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3+HNO2=Fe(NO2)3+HClFeCl3 + 3HNO2 = Fe(NO2)3 + 3HCl
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+HO=Fe(OH)2Fe + 0O2 + 2HO = Fe(OH)2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+ HNO3+H20=Fe(NO3)3+H2SO4+NH4NO360FeS2 + 500HNO3 + 19H20 = 60Fe(NO3)3 + 120H2SO4 + 160NH4NO3
Fe3O4+H2SO4= Fe2(SO4)3 + SO2 +H2O2Fe3O4 + 10H2SO4 = 3Fe2(SO4)3 + SO2 + 10H2O
FeO+H2SO4= Fe2(SO4)3 + H2S +H2O8FeO + 13H2SO4 = 4Fe2(SO4)3 + H2S + 12H2O
Fe3O4+HNO3= Fe(NO3)3 + N2O+ H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + N2O + 37H2O
FeSO4+NH4OH=Fe(OH)2+(NH4)2SO4FeSO4 + 2NH4OH = Fe(OH)2 + (NH4)2SO4
Fe3O4 + HNO3 = Fe(NO3)3 + NO + H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + 3H2 =2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + 2O2 = 2FeO2Fe + O2 = 2FeO
FeSO4+KI+KIO+H2O=Fe(OH)2+K2SO4+I2FeSO4 + KI + KIO + H2O = Fe(OH)2 + K2SO4 + I2
FeSO4+KI+KIO+H2O=Fe(OH)2+K2SO4+I2FeSO4 + KI + KIO + H2O = Fe(OH)2 + K2SO4 + I2
FeSO4+KI+KIO+H2O=Fe(OH)2+K2SO4+I2FeSO4 + KI + KIO + H2O = Fe(OH)2 + K2SO4 + I2
FeSO4+KI+KIO+H2O=Fe(OH)2+K2SO4+I2FeSO4 + KI + KIO + H2O = Fe(OH)2 + K2SO4 + I2
FeSO4+KI+KIO+H2O = Fe(OH)2+K2SO4+I2FeSO4 + KI + KIO + H2O = Fe(OH)2 + K2SO4 + I2
FeSO4 + KI + KIO + H2O = Fe (OH)2 + K2SO4 + I2FeSO4 + KI + KIO + H2O = Fe(OH)2 + K2SO4 + I2
FeSO4 + KI + KIO + H2O = Fe (OH)2 + K2SO4 + I2FeSO4 + KI + KIO + H2O = Fe(OH)2 + K2SO4 + I2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2SiO4 + O2= Fe3 + SiO23Fe2SiO4 - 3O2 = 2Fe3 + 3SiO2
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe(s)+H2O(g)=FeO(s)+H2(g)Fe(s) + H2O(g) = FeO(s) + H2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3(aq)+KOH(aq)=Fe(OH)3(s)+KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(s) + 3KCl(aq)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+F2=FeF32Fe + 3F2 = 2FeF3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + (OH) = Fe(OH)3Fe + 3(OH) = Fe(OH)3
FeS+HNO3+H2SO4=Fe2(SO4)3+NO+H2020FeS + 40HNO3 + 10H2SO4 = 10Fe2(SO4)3 + 40NO + 3H20
FeS2+HNO3=Fe(NO3)3+H2SO4+NO2+H2OFeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 15NO2 + 7H2O
FeS+HNO3=Fe(NO3)3+Fe2(SO4)3+NO+H2O3FeS + 12HNO3 = Fe(NO3)3 + Fe2(SO4)3 + 9NO + 6H2O
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe +Br = FeBr3Fe + 3Br = FeBr3
FeSO4 + Br2=FeBr2+Fe2(SO4)FeSO4 - Br2 = -1FeBr2 + Fe2(SO4)
FeSO4 + Br2=FeBr3+Fe2(SO4)36FeSO4 + 3Br2 = 2FeBr3 + 2Fe2(SO4)3
FeCl3 + MgO = Fe2O3 + MgCl22FeCl3 + 3MgO = Fe2O3 + 3MgCl2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCr2O7 + K2CO3 + O2 = K2CrO4 + Fe2O3 + CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeSO4 + KI + KIO3 + H2O = Fe(OH)2 + K2SO4 + I2 3FeSO4 + 5KI + KIO3 + 3H2O = 3Fe(OH)2 + 3K2SO4 + 3I2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+++(NO3)3 + KI- = Fe + I2 + KNO33Fe++ + 2(NO3)3 + 6KI- = 3Fe + 3I2 + 6KNO3
Fe(NO3)3 + KI = Fe + I2 + KNO32Fe(NO3)3 + 6KI = 2Fe + 3I2 + 6KNO3
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe + HCl = FeCl3 + HFe + 3HCl = FeCl3 + 3H
Fe + HCl = FeCl + HFe + HCl = FeCl + H
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
Fe2O3 +Al = Al2O3 +Fe2Fe2O3 + 2Al = Al2O3 + Fe2
Fe2O3 + Al + Na2CO3 = Na2Al2O4 + Fe + CO2Fe2O3 + 2Al + Na2CO3 = Na2Al2O4 + 2Fe + CO2
Fe+O2+H2O=Fe (OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2+H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe3O2+CO=Fe+CO2Fe3O2 + 2CO = 3Fe + 2CO2
Fe2O3(s)+CO2(g)=Fe(s)+CO2(g)0Fe2O3(s) + CO2(g) = 0Fe(s) + CO2(g)
Fe3O2+CO2=Fe+CO20Fe3O2 + CO2 = 0Fe + CO2
Fe2O3(s)+3CO(g)=2Fe(s)+3CO(g)0Fe2O3(s) + CO(g) = 0Fe(s) + CO(g)
Fe3(PO4)2 + Cu2SO3 = Fe3(SO3) + Cu2 (PO4)2Fe3(PO4)2 + Cu2SO3 = Fe3(SO3) + Cu2(PO4)2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(NO3)3 = Fe3 + NO33Fe(NO3)3 = Fe3 + 9NO3
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeO + H2O = Fe(OH)2FeO + H2O = Fe(OH)2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ O2 = FeO2Fe + O2 = 2FeO
Fe3O4 +HNO3 = Fe(NO3)3 + NO + H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe3O4 +HNO3 = Fe2(NO3)3 + NO + H2O6Fe3O4 + 20HNO3 = 9Fe2(NO3)3 - 7NO + 10H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+ NH3= FeH3 + N22Fe + 2NH3 = 2FeH3 + N2
FeSo4+H2So4+KMnO4 =MnSo4 +Fe2(So4)+H2O+K2So4-10FeSo4 + 8H2So4 + 2KMnO4 = 2MnSo4 - 5Fe2(So4) + 8H2O + K2So4
Fe(OH)2+O2=Fe2O3+H2O4Fe(OH)2 + O2 = 2Fe2O3 + 4H2O
Fe +O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4+CO=CO2+FeFe3O4 + 4CO = 4CO2 + 3Fe
Fe+ O2 + H2O =Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+ZnCl2=Zn+FeCl32Fe + 3ZnCl2 = 3Zn + 2FeCl3
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4+H2SO4+H2O2=Fe2(SO4)3+H2O2FeSO4 + H2SO4 + H2O2 = Fe2(SO4)3 + 2H2O
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeCl2+Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(s)+O2(g) +H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s) + O2 (g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3(s) = Fe(s) + O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
FeSO4 + KCl = K2SO4 + FeCl2FeSO4 + 2KCl = K2SO4 + FeCl2
FeO+CO2= FeCO3FeO + CO2 = FeCO3
FeO+CO2= FeCO3FeO + CO2 = FeCO3
FeO+CO2= FeCO3FeO + CO2 = FeCO3
Fe+O2+H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + Cl2 = Fe2Cl34Fe + 3Cl2 = 2Fe2Cl3
FeCl3 + 3KSCN = Fe(SCN)3 + 3KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
FeS2 + H2SO4 =FeO + SO2 + H2OFeS2 + 5H2SO4 = FeO + 7SO2 + 5H2O
Fe+CO2=Fe2O3+CO2Fe + 3CO2 = Fe2O3 + 3CO
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl36H2O + FeCl24H2O + NaOH + Mn(NO3)24H2O = MnFe2O4 + H2O + NaCl+N2-46FeCl36H2O + 52FeCl24H2O - 408NaOH + 3Mn(NO3)24H2O = 3MnFe2O4 - 195H2O - 408NaCl + 36N2
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS2+HNO3=NO2+Fe(NO3)3+H2SO4+H2OFeS2 + 18HNO3 = 15NO2 + Fe(NO3)3 + 2H2SO4 + 7H2O
FeS2+HNO3=NO2+Fe(NO3)3+Fe2(SO4)3+H2O3FeS2 + 42HNO3 = 45NO2 - Fe(NO3)3 + 2Fe2(SO4)3 + 21H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2 + NaBr= NaCl + FeBr2FeCl2 + 2NaBr = 2NaCl + FeBr2
Fe+Ca(OH)2=Ca+Fe(OH)2Fe + Ca(OH)2 = Ca + Fe(OH)2
FeCl3+ 3NaOH= 2NaCl + Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
FeCl3+ 3NaOH= 3 NaCl + Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
F2CL2+F4=CL2F4F2CL2 - F4 = 4CL2F
F2CL2+F4=CL2F4F2CL2 - F4 = 4CL2F
Fe+O3=Fe2O32Fe + O3 = Fe2O3
Fe+HNO3=Fe(NO3)2+NH4NO3+H2O4Fe + 10HNO3 = 4Fe(NO3)2 + NH4NO3 + 3H2O
FeSO4+H2SO4=Fe(SO4)3+H2S+H2O2FeSO4 + 5H2SO4 = 2Fe(SO4)3 + H2S + 4H2O
Fe(NO3)2 +HNO3 =Fe(NO3)3+NH4NO3 +H2O8Fe(NO3)2 + 10HNO3 = 8Fe(NO3)3 + NH4NO3 + 3H2O
Fe(NO3)2 +HNO3 = Fe(NO3)3+N2+H2O10Fe(NO3)2 + 12HNO3 = 10Fe(NO3)3 + N2 + 6H2O
Fe(NO3)2 +HNO3 = Fe(NO3)3+N2+H2O10Fe(NO3)2 + 12HNO3 = 10Fe(NO3)3 + N2 + 6H2O
Fe(NO3)2 +HNO3 = Fe(NO3)3+N2O+H2O8Fe(NO3)2 + 10HNO3 = 8Fe(NO3)3 + N2O + 5H2O
Fe(NO3)2 +HNO3 = Fe(NO3)3+NO2+H2OFe(NO3)2 + 2HNO3 = Fe(NO3)3 + NO2 + H2O
Fe(NO3)2 +HNO3 = Fe(NO3)3+NO+H2O3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO + 2H2O
Fe(NO3)2 +HNO3 = Fe(NO3)3+NO+H2O3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO + 2H2O
Fe3O4 +HNO3 = Fe(NO3)3+NH4NO3+H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + NH4NO3 + 35H2O
Fe3O4 +HNO3 = Fe(NO3)3+NH4NO3+H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + NH4NO3 + 35H2O
Fe3O4 +HNO3 = Fe(NO3)3+N2+H2O10Fe3O4 + 92HNO3 = 30Fe(NO3)3 + N2 + 46H2O
Fe3O4 +HNO3 = Fe(NO3)3+NO+H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
FeO4+HNO3=Fe(NO3)3+NO2+H2O-1FeO4 + 2HNO3 = -1Fe(NO3)3 + 5NO2 + H2O
FeO+HNO3=Fe(NO3)3+NH4NO3+H2O8FeO + 26HNO3 = 8Fe(NO3)3 + NH4NO3 + 11H2O
FeO+HNO3=Fe(NO3)3+NH4NO3+H2O8FeO + 26HNO3 = 8Fe(NO3)3 + NH4NO3 + 11H2O
FeO+HNO3=Fe(NO3)3+NO2+H2OFeO + 4HNO3 = Fe(NO3)3 + NO2 + 2H2O
Fe3O4 +HNO3 =Fe(NO3)3+N2O+H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + N2O + 37H2O
FeSO4+H2SO4+O3= Fe2(SO4)3+H2O6FeSO4 + 3H2SO4 + O3 = 3Fe2(SO4)3 + 3H2O
Fe (s) + H2O (l) + O2 (g) = Fe(OH)2 (s)2Fe(s) + 2H2O(l) + O2(g) = 2Fe(OH)2(s)
FeSO4+H2SO4+KMnO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10FeSO4 + 8H2SO4 + 2KMnO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
Fe CO3(s) + H2 CO3 (aq) = Fe (HCO3)2 (aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe2O3 (s) + HNO3 (aq) = Fe(NO3)3 (aq) + H2OFe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O
Fe2O3 (s) + HNO3 (aq) = Fe(NO3)3 (aq) + H2OFe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O
Fe2O3 + Mn=Fe + MnO44Fe2O3 + 3Mn = 8Fe + 3MnO4
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(NO3)3+3NaOH=Fe(OH)3=3NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=FeO4Fe + 2O2 = FeO4
Fe2O3+ CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Br=FeBrFe + Br = FeBr
Fe+2 + Cl2 = Fe+3 + Cl-12Fe+2 + Cl2 = 2Fe+3 + 2Cl-1
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeSO4 = Fe2O3 + SO2 + SO32FeSO4 = Fe2O3 + SO2 + SO3
FeSO4 = Fe2O3 + S02 + SO312FeSO4 = 6Fe2O3 + S02 + 10SO3
Fe3O2+CO=FeO+CO2-1Fe3O2 + CO = -3FeO + CO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + CO =Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe2O3 + H2O =Fe(OH)3 Fe2O3 + 3H2O = 2Fe(OH)3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + HNO3 = Fe(NO3)3 + NO + H2040Fe2O3 + 180HNO3 = 80Fe(NO3)3 - 60NO + 9H20
Fe2O3 + HNO3= Fe(NO3)3 + NO + H2040Fe2O3 + 180HNO3 = 80Fe(NO3)3 - 60NO + 9H20
FeS + O2 = FeO + SO22FeS + 3O2 = 2FeO + 2SO2
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
Fe + S = Fe++ + S--Fe + S = Fe++ + S--
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 (s) + Hg2(Cr2O4)2 (s) = Fe2(Cr2O4)3 (s) + Hg2(SO4)2 (g)2Fe2(SO4)3(s) + 3Hg2(Cr2O4)2(s) = 2Fe2(Cr2O4)3(s) + 3Hg2(SO4)2(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + S = FeSFe + S = FeS
Fe(OH)3 + HNO3 = Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe(NO3)3 + (NH4)2CO3 = Fe2CO3 + NH4(NO3)32Fe(NO3)3 + (NH4)2CO3 = Fe2CO3 + 2NH4(NO3)3
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS + O = Fe2(SO4)3 + SO2-2FeS - 10O = -1Fe2(SO4)3 + SO2
FeO4-- + NH3+ H+ = N2 + Fe+++ +H2O2FeO4-- + 2NH3 + 10H+ = N2 + 2Fe+++ + 8H2O
Fe+S=FeSFe + S = FeS
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe+H2O=Fe(OH)2+H2O0Fe + H2O = 0Fe(OH)2 + H2O
Fe3(PO4)2 + Cu2SO3 = Fe3(SO3) + Cu2 (PO4)2Fe3(PO4)2 + Cu2SO3 = Fe3(SO3) + Cu2(PO4)2
FeCO3 + HNO3 = Fe(NO3)3 + NO + CO2 + H2O3FeCO3 + 10HNO3 = 3Fe(NO3)3 + NO + 3CO2 + 5H2O
Fe2O3+C=Fe3O4+CO3Fe2O3 + C = 2Fe3O4 + CO
Fe2O3+C=Fe3O4+CO3Fe2O3 + C = 2Fe3O4 + CO
Fe+O2=FeO32Fe + 3O2 = 2FeO3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FE (OH)+HCL=FECL+ H2OFE(OH) + HCL = FECL + H2O
FE (OH)+HCL=FECL+ H2OFE(OH) + HCL = FECL + H2O
Fe+3HBr=FeBr+3HFe + HBr = FeBr + H
Fe+HBr=FeBr+HFe + HBr = FeBr + H
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe2O3 + H2S = Fe2S3 + H2OFe2O3 + 3H2S = Fe2S3 + 3H2O
FeCl2+Na3Po4=Fe3(Po4)2+NaCl3FeCl2 + 2Na3Po4 = Fe3(Po4)2 + 6NaCl
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3O4 + Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3 + 3C = 2Fe + 3COFe2O3 + 3C = 2Fe + 3CO
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + H2O = Fe3O4+ H23Fe + 4H2O = Fe3O4 + 4H2
Fe3O4 + HNO3 = Fe(NO3)3 + NH4NO3 + H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + NH4NO3 + 35H2O
Fe3O4 + HNO3 = Fe(NO3)3 + N2 + H2O10Fe3O4 + 92HNO3 = 30Fe(NO3)3 + N2 + 46H2O
Fe3O4 + HNO3 = Fe(NO3)3 + N2O + H2O8Fe3O4 + 74HNO3 = 24Fe(NO3)3 + N2O + 37H2O
Fe3O4 + HNO3 = Fe(NO3)3 + NO + H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe3O4 + HNO3 = Fe(NO3)3 + NO2 + H2OFe3O4 + 10HNO3 = 3Fe(NO3)3 + NO2 + 5H2O
Fe + HNO3 = Fe(NO3)3 + NO + H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
FeS2 + HNO3 = Fe(NO3)3 + Fe2(SO4)3 + NO2 + H2O3FeS2 + 42HNO3 = -1Fe(NO3)3 + 2Fe2(SO4)3 + 45NO2 + 21H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe + H2MnPO4 = H2MnFePO4Fe + H2MnPO4 = H2MnFePO4
FeS+H2SO4=Fe2(SO4)3+SO2+H2O2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O
Fe+HCl=FeCl+H22Fe + 2HCl = 2FeCl + H2
FeC2O4 + KMnO4+ H2SO4 = K2SO4+ MnSO4+ Fe2(SO4)3 + H2O + CO210FeC2O4 + 6KMnO4 + 24H2SO4 = 3K2SO4 + 6MnSO4 + 5Fe2(SO4)3 + 24H2O + 20CO2
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl3 + NaOH = Fe (OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(CIO3)2 + Ga2(Cr2O7)3 = Fe(Cr2O7) + Ga(CIO3)33Fe(CIO3)2 + Ga2(Cr2O7)3 = 3Fe(Cr2O7) + 2Ga(CIO3)3
Fe(s)+CuSO4(aq)=Cu(s)+FeSO4(aq)Fe(s) + CuSO4(aq) = Cu(s) + FeSO4(aq)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)2(aq) + K2CO3(aq) = FeCO3(s) + 2KNO3(aq) Fe(NO3)2(aq) + K2CO3(aq) = FeCO3(s) + 2KNO3(aq)
Fe2O3 (s) + H2 (g) =Fe (s) + H2O (g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
Fe2O3 (s) + H2 (g) = Fe (s) + H2O (g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
Fe + CuCl2 = FeCl2 +CuFe + CuCl2 = FeCl2 + Cu
Fe2O3(s) + Al(s) = Fe(s) + Al2O3(s)Fe2O3(s) + 2Al(s) = 2Fe(s) + Al2O3(s)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(OH)3 + H3PO4 = FePO4 +H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
Fe2O3 (s) + H2 (g) = Fe (s) + H2O (g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
FeS + H2O2 = FeO + SO2 + H2OFeS + 3H2O2 = FeO + SO2 + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl2+K2Cr2O7+HCl=FeCl3+KCl+CrCl3+H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
FeO + H2SO4 = Fe2(SO4)3 + SO2 + H2O2FeO + 4H2SO4 = Fe2(SO4)3 + SO2 + 4H2O
FeC2O4 + KMnO4+ H2SO4= K2SO4+ MnSO4+ Fe2(SO4)3 + H2O + CO210FeC2O4 + 6KMnO4 + 24H2SO4 = 3K2SO4 + 6MnSO4 + 5Fe2(SO4)3 + 24H2O + 20CO2
Fe2O3+ CO = Fe3O4 + CO2 3Fe2O3 + CO = 2Fe3O4 + CO2
FeS+O= FeO+SO2FeS + 3O = FeO + SO2
FeO + CO = Fe + CO2FeO + CO = Fe + CO2
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
FeSO4 + Na3PO4 = Na3SO4 + FePO4 FeSO4 + Na3PO4 = Na3SO4 + FePO4
FeSO4 + Na3PO4 = NaPO4+ FeSO4FeSO4 + 0Na3PO4 = 0NaPO4 + FeSO4
Fe3O2+CO=Fe+CO2Fe3O2 + 2CO = 3Fe + 2CO2
Fe(s) + S(s)=Fe2S3(s)2Fe(s) + 3S(s) = Fe2S3(s)
FeCO3 + HNO3 = Fe(NO3)2 + H2O + CO2FeCO3 + 2HNO3 = Fe(NO3)2 + H2O + CO2
Fe + S = FeSFe + S = FeS
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2Cl + Mg = MgCl + FeFe2Cl + Mg = MgCl + 2Fe
Fe + Cl = FeCl2Fe + 2Cl = FeCl2
FeSO4(aq) + 2KCl(aq) = K2SO4 + FeCl2FeSO4(aq) + 2KCl(aq) = K2SO4 + FeCl2
FeSO4(aq) + 2KCl(aq) = K2SO4 + FeCl2FeSO4(aq) + 2KCl(aq) = K2SO4 + FeCl2
FeSO4(aq) + 2KCl(aq) = K2SO4 + FeCl2FeSO4(aq) + 2KCl(aq) = K2SO4 + FeCl2
FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeSO4 + H2SO4 + H2O2 = Fe2(SO4)3 + H2O2FeSO4 + H2SO4 + H2O2 = Fe2(SO4)3 + 2H2O
FeS+O2=SO2+Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
FeSO4+O2=SO2+Fe2O34FeSO4 - O2 = 4SO2 + 2Fe2O3
FeSO4+O=SO2+Fe2O32FeSO4 - O = 2SO2 + Fe2O3
FeSO4+H2SO4+HNO3=Fe2(SO4)3+NO+H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
FeSO4+H2SO4+HNO3=Fe2(SO4)3+NO+H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3 + K3PO4 = FePO4 + KNO3Fe(NO3)3 + K3PO4 = FePO4 + 3KNO3
Fe + Fe2(SO3)3 = 3FeSO3Fe + Fe2(SO3)3 = 3FeSO3
Fe2O3 + H2SO4 = Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe + H2O2 = Fe2O3 + H2O2Fe + 3H2O2 = Fe2O3 + 3H2O
Fe + H2O2 = FeO + H2OFe + H2O2 = FeO + H2O
Fe(NO3)3+Na3PO4=FePO4 + NaNO3Fe(NO3)3 + Na3PO4 = FePO4 + 3NaNO3
Fe(NO3)3+ Ca(C2H3O2)2 = Fe(CH3COO)3 + Ca( NO3)2 2Fe(NO3)3 + 3Ca(C2H3O2)2 = 2Fe(CH3COO)3 + 3Ca(NO3)2
Fe + Mg(No3)2= Fe(No3)2+MgFe + Mg(No3)2 = Fe(No3)2 + Mg
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3 + CaCl2 = FeCl3+ Ca(OH)22Fe(OH)3 + 3CaCl2 = 2FeCl3 + 3Ca(OH)2
Fe(OH)3 + CaCl2 = FeCl3+ Ca(OH)22Fe(OH)3 + 3CaCl2 = 2FeCl3 + 3Ca(OH)2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2SO4=FeO3+SO2+SO3-1Fe2SO4 = -2FeO3 - 5SO2 + 4SO3
Fe2SO4=FeO3+SO2+SO3-1Fe2SO4 = -2FeO3 - 5SO2 + 4SO3
Fe3O4 + HNO3 = Fe(NO3) + NO + H2O3Fe3O4 + 4HNO3 = 9Fe(NO3) - 5NO + 2H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + SnNO3 = FeNO3 + SnFe + SnNO3 = FeNO3 + Sn
Fe+ Cl2 =FeCl3 2Fe + 3Cl2 = 2FeCl3
Fe2O3 + Al = Fe3O4 + AlO26Fe2O3 + Al = 4Fe3O4 + AlO2
FeS2 (s) + 2O2 (g) = Fe3O2 (s) + 2SO2 (g) 3FeS2(s) + 7O2(g) = Fe3O2(s) + 6SO2(g)
FeCl3 + NH4(OH) = Fe(OH)3 + NH4ClFeCl3 + 3NH4(OH) = Fe(OH)3 + 3NH4Cl
FeS2 + Cl2 = FeCl3 + S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
FeCr2O4+Na2CO3+O2= Na2CrO4+Fe2O3+CO24FeCr2O4 + 8Na2CO3 + 7O2 = 8Na2CrO4 + 2Fe2O3 + 8CO2
Fe2O3+C= Fe+COFe2O3 + 3C = 2Fe + 3CO
FeCl3(aq)+NH4OH(aq)=Fe(OH)3(s)+3NH4Cl(aq)FeCl3(aq) + 3NH4OH(aq) = Fe(OH)3(s) + 3NH4Cl(aq)
Fe2O3 + 3CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NH4OH = NH4Cl3 + OHFeFeCl3 + NH4OH = NH4Cl3 + OHFe
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl + H2O = FeOH + H+ + Cl-FeCl + H2O = FeOH + H+ + Cl-
Fe + H2O = Fe(OH)3 + H+ + eFe + 3H2O = Fe(OH)3 + 3H+ + 3e
Fe2S3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2S(g)Fe2S3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2S(g)
Fe(OH)3+HBr =FeBr3+H2OFe(OH)3 + 3HBr = FeBr3 + 3H2O
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
Fe(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe+O2+H2O= Fe (OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCO3 + 6CN = Fe(CN)6 + CO3FeCO3 + 6CN = Fe(CN)6 + CO3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeO + Al = Al2O3 + Fe3FeO + 2Al = Al2O3 + 3Fe
FeCl3 + KBr = KCl3 + FeBrFeCl3 + KBr = KCl3 + FeBr
FeCl3 + KBr = KCl3 + FeBrFeCl3 + KBr = KCl3 + FeBr
FeS + NO3 = NO + SO 2+ Fe33FeS + 3NO3 = 3NO + 3SO2 + Fe3
FeS + NO3 = NO + SO4 + Fe33FeS + 6NO3 = 6NO + 3SO4 + Fe3
FeS+NO3 = NO + SO42+ Fe33FeS + 63NO3 = 63NO + 3SO42 + Fe3
FeS+NO3 = NO + SO42+ Fe33FeS + 63NO3 = 63NO + 3SO42 + Fe3
Fe2O3 (s) + 6HNO3 (aq) = 2Fe(NO3)3 (aq) + 3H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe(NO3)2 + H2S = FeS + HNO3Fe(NO3)2 + H2S = FeS + 2HNO3
Fe(s) + S(l) = Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3 + CO = Fe + 2CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + 2CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe+KCl=FeCl3+KFe + 3KCl = FeCl3 + 3K
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + H2O = Fe3O4 + HCl +H3FeCl2 + 4H2O = Fe3O4 + 6HCl + 2H
F + NaCl = NaF + ClF + NaCl = NaF + Cl
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+NH3+H2O= Fe(OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
F2 + H2O = HF +O33F2 + 3H2O = 6HF + O3
Fe+O2+H2O= Fe(OH)2 2Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)2+H2O2=Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
FeS+O2+H2O=Fe2O3+H2SO44FeS + 9O2 + 4H2O = 2Fe2O3 + 4H2SO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(ClO3)3 = FeCl3 + O22Fe(ClO3)3 = 2FeCl3 + 9O2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3+NH3+H2O=HCl+FeOH+NH4-1FeCl3 + 2NH3 - H2O = -3HCl - FeOH + 2NH4
FeCl3+NH3+H2O=HCl+FeOH+NH4-1FeCl3 + 2NH3 - H2O = -3HCl - FeOH + 2NH4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + Na2CO3 = Fe2(CO3)3 +NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
FeS2 + NaOH+H2O = Fe(OH)3 + Na2S + OHFeS2 + 4NaOH + 0H2O = Fe(OH)3 + 2Na2S + OH
FeS2 + 4 NaOH = Fe(OH)3 + 2 Na2S + OHFeS2 + 4NaOH = Fe(OH)3 + 2Na2S + OH
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+O2 + H20 = Fe2 (OH)220Fe + 10O2 + H20 = 10Fe2(OH)2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeO + Al = Al2O3 + Fe3FeO + 2Al = Al2O3 + 3Fe
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(SO4) + HBrO2 + HCl = FeCl3 + FeBr3 + Fe2(SO4)3 + H2O12Fe(SO4) + 3HBrO2 + 9HCl = 3FeCl3 + FeBr3 + 4Fe2(SO4)3 + 6H2O
Fe3+3H2O=Fe(OH)3+3HFe3 + 9H2O = 3Fe(OH)3 + 9H
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe3O4 (s)+ H2 (g) = Fe (l)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(l) + 4H2O(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + AgNO3 = Fe(NO3)3 + AgFe + 3AgNO3 = Fe(NO3)3 + 3Ag
Fe3O4 + HNO3 = Fe(NO3)3 + NO + H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe3O4 + HNO3 = Fe(NO3)3 + NO + H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe + Cu(NO3)2 = Cu + Fe(NO3)2Fe + Cu(NO3)2 = Cu + Fe(NO3)2
Fe + Cl2 = FeCl2Fe + Cl2 = 2FeCl
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(s)+C(s)=Fe(s)+CO(g) Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(s) + Zn(NO3)2(aq) = Zn(s) + Fe(NO3)2(aq)Fe(s) + Zn(NO3)2(aq) = Zn(s) + Fe(NO3)2(aq)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(s) + H2O(g) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeCl3 + (NH4)2CO3 = Fe2(CO3)3 + NH4Cl2FeCl3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4Cl
Fe + O2 + H2O = Fe(OH)2 2Fe + O2 + 2H2O = 2Fe(OH)2
FeCl3 + NH3 + H2O = HCl + FeO + NO39FeCl3 + NH3 + 12H2O = 27HCl + 9FeO + NO3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeCl3+NH4OH=FeOH+NH4Cl3FeCl3 + NH4OH = FeOH + NH4Cl3
FeCl3+NH4OH=FeOH+NH4Cl3FeCl3 + NH4OH = FeOH + NH4Cl3
Fe + HNO3 = Fe(NO3)3 + H22Fe + 6HNO3 = 2Fe(NO3)3 + 3H2
Fe2O3 + CO=Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + CrO4 = Fe2(CrO4)32Fe + 3CrO4 = Fe2(CrO4)3
Fe + CrO4 = Fe(CrO4)3Fe + 3CrO4 = Fe(CrO4)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4
FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4
FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4
F2 + K2S = KF + S88F2 + 8K2S = 16KF + S8

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.