Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2P(s) + S(s)=P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
FeCO3 + AlPO4 = Fe3 (PO4)2 + Al2(CO3)33FeCO3 + 2AlPO4 = Fe3(PO4)2 + Al2(CO3)3
Fe= Fe+2 +2eFe = Fe+2 + 2e
Fe= Fe+2 +2eFe = Fe+2 + 2e
Fe2O3 + CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO (s) + O2 (g) = Fe2O3 (s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeCl3(aq) + NaSbCl4(aq) = FeCl2(aq) + NaSbCl6(aq) 2FeCl3(aq) + NaSbCl4(aq) = 2FeCl2(aq) + NaSbCl6(aq)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe3S+NaCN=Fe3CN+NaSFe3S + NaCN = Fe3CN + NaS
Fe2P(s) + S(s)=P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe2Si2O6 + O2 + H2O = Fe2O3 + H4SiO42Fe2Si2O6 + O2 + 8H2O = 2Fe2O3 + 4H4SiO4
Fe3++SO2++H2O=Fe2++SO4-2+H3O+-2Fe3+ + SO2+ + 6H2O = -3Fe2+ + SO4-2 + 4H3O+
Fe2O3+HNO3 = Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe + 3Pb(NO3)2 = 2Fe(NO3)3 +3Pb2Fe + 3Pb(NO3)2 = 2Fe(NO3)3 + 3Pb
Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
Fe2(CO3)3+HCl=FeCl3+CO2+H2OFe2(CO3)3 + 6HCl = 2FeCl3 + 3CO2 + 3H2O
FeO + H2O = Fe(OH)2FeO + H2O = Fe(OH)2
FeS + HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
FeCl3 + NaOH = Fe(OH)3 = NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2(C2O4)3 = 2FeC2O4 + 2CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe2(C2O4)3 = 2FeC2O4 + 2CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe + H2O + O2 = Fe(OH)34Fe + 6H2O + 3O2 = 4Fe(OH)3
Fe2S3+NO2 = Fe + SO4+ N2Fe2S3 + 6NO2 = 2Fe + 3SO4 + 3N2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2(g)=Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe+HCl=FeCl2+ H2Fe + 2HCl = FeCl2 + H2
Fe(s)+O2(g)=Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe2O3 + C = CO2 + Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3+NaOH =Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+2 + O-2 = Fe OFe+2 + O-2 = FeO
FeCO3(s)+H2CO3(aq)=Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe2O3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O 2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + NaNO3 = Fe2O3 + Na + N2Fe + NaNO3 = Fe2O3 + Na + N
Fe (NO3)3+3Li=3Li (NO3)+3FeFe(NO3)3 + 3Li = 3Li(NO3) + Fe
Fe (NO3)3+3Li=3Li (NO3)+FeFe(NO3)3 + 3Li = 3Li(NO3) + Fe
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe+S=Fe3S23Fe + 2S = Fe3S2
FeCl2(aq) + Ag3PO4(aq)= Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe(s)+O2+H2O=Fe(OH)2(s)2Fe(s) + O2 + 2H2O = 2Fe(OH)2(s)
Fe2O3+CO= CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2 +O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 +O2=Fe2O3+4SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeBr2 + KCl = FeCl2 + KBrFeBr2 + 2KCl = FeCl2 + 2KBr
Fe + S8= FeS8Fe + S8 = 8FeS
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) +HCl(aq) = FeCl2(aq) + H2(g) Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s) + 3 CO(g) = 2 Fe(l) + 3 CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
F e 3 O 4 (s)+ O 2 (g)=F e 2 O 3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + S8= FeS8Fe + S8 = 8FeS
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + H2O = H2 + Fe3O43Fe + 4H2O = 4H2 + Fe3O4
Fe3+Cu(OH)2=Fe3(OH)2+CuFe3 + Cu(OH)2 = Fe3(OH)2 + Cu
Fe3+Cu(OH)2=Fe3(OH)2+CuFe3 + Cu(OH)2 = Fe3(OH)2 + Cu
Fe2O3+Al=Al2O3=FeFe2O3 + 2Al = Al2O3 + 2Fe
FeO(s)+CO(g)=Fe2(s)+CO2(g)2FeO(s) + 2CO(g) = Fe2(s) + 2CO2(g)
FeO(s)+CO(g)=Fe(s)+CO2(g)FeO(s) + CO(g) = Fe(s) + CO2(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2Si2O6+O2+H2O=Fe2O3+H4SiO42Fe2Si2O6 + O2 + 8H2O = 2Fe2O3 + 4H4SiO4
Fe2Si2O6 + O2 + H2O = Fe2O3 + H4SiO42Fe2Si2O6 + O2 + 8H2O = 2Fe2O3 + 4H4SiO4
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3 + 3CO2= 2Fe + 3CO2 0Fe2O3 + CO2 = 0Fe + CO2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + C= CO2 + Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe + O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2O3 + C=CO2 + Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe +2HCl = H2 + FeCl2Fe + 2HCl = H2 + FeCl2
FeCl3 + 3Ca(OH)2 = Fe(OH)3 + 3CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
FeCl3 +3 NaOH = Fe(OH)3 + 3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(CO)5=Fe2(CO)9+CO2Fe(CO)5 = Fe2(CO)9 + CO
Fe+CO=Fe(CO)5Fe + 5CO = Fe(CO)5
Fe + AgC2H3O2 = 2Ag + Fe(C2H3O2)2Fe + 2AgC2H3O2 = 2Ag + Fe(C2H3O2)2
Fe + Pb(NO3)2 = Pb+ Fe(NO3)2Fe + Pb(NO3)2 = Pb + Fe(NO3)2
Fe3+ + NO-2 +H2O = Fe2+ +H+ + NO-32Fe3+ + NO-2 + 0H2O = 3Fe2+ + 0H+ + NO-3
Fe3+ + NO2- +H2O = Fe2+ +H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeO3(s)+CO(g)=Fe(l)+CO2(g)FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
FeO3(s) + CO(g) = Fe(l) + CO2(g)FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
Fe(H2O)6+6HCl=6H2O+Fe(HCl)6Fe(H2O)6 + 6HCl = 6H2O + Fe(HCl)6
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe2O3 + CO = CO2 + 2FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+++HNO2+H+=Fe++++NO+H2OFe++ + HNO2 + H+ = Fe+++ + NO + H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2 + NH4NO3 = Fe(NO3)2+NH4ClFeCl2 + 2NH4NO3 = Fe(NO3)2 + 2NH4Cl
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe2O3+CO= Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
FeCl3 + Na2CO3 = Fe2C3O9 + NaCl2FeCl3 + 3Na2CO3 = Fe2C3O9 + 6NaCl
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + Cl2 = 5FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4+HNO3+H2SO4= Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe + S = FeSFe + S = FeS
Fe(OH)3+H2SO4=Fe2(SO4)3+HOH2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6HOH
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO(s)+O2(g)=Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe + CO2=Fe2O3 +CO2Fe + 3CO2 = Fe2O3 + 3CO
F2 + H2O = HF + O33F2 + 3H2O = 6HF + O3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe + Br2 = FeBr2Fe + Br2 = FeBr2
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + Cl2 = FeCl3 + O22Fe2O3 + 6Cl2 = 4FeCl3 + 3O2
FeS2 + O2 =Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+HNO3=Fe(NO3)3+H2O+NOFe + 4HNO3 = Fe(NO3)3 + 2H2O + NO
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe2O3 + CO = CO2 + Fe2Fe2O3 + 3CO = 3CO2 + Fe2
Fe2O3+ H2=2Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O(s)+CO(g)=2Fe(s)+CO2(g)Fe2O(s) + CO(g) = 2Fe(s) + CO2(g)
FeO(s)+CO(g)=2Fe(s)+CO2(g)FeO(s) + CO(g) = Fe(s) + CO2(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe +2HCl = H2 + FeCl2Fe + 2HCl = H2 + FeCl2
Fe2O3 + 3 C = 4 Fe + 3 CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + 3 C = 4 Fe + 3 CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(NO3)3(aq) + LiOH(aq) = LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe(NO3)3 (aq) + NaOH(aq) = Fe(OH)3 (s) + NaNO3 (aq) Fe(NO3)3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaNO3(aq)
Fe(s) + O2 (g) = Fe2O3 (s) 4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2Si2O6 + O2 +H2O = Fe2O3 + H4SiO42Fe2Si2O6 + O2 + 8H2O = 2Fe2O3 + 4H4SiO4
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=FeOH2Fe + 0O2 + H2O = FeOH2
FeCr2O7+K2CO3+O2=K2CrO4+Fe2O3+CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeCr2O7+K2CO3+O2=K2CrO4+FeO3+CO2FeCr2O7 + 2K2CO3 + O2 = 2K2CrO4 + FeO3 + 2CO2
Fe(s) + H2O(l) = Fe3O4 + H2(g)3Fe(s) + 4H2O(l) = Fe3O4 + 4H2(g)
FeS + O2=Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO=CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeS + 3O2 = FeO + SO22FeS + 3O2 = 2FeO + 2SO2
FeS +O2 = Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 +CO =Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FePO4 + Na2SO4 = Fe2(SO4)3 + Na3PO42FePO4 + 3Na2SO4 = Fe2(SO4)3 + 2Na3PO4
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS+ HCl= FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeSO4(aq) + 2KOH(aq) = Fe(OH)2(aq) + K2SO4(aq)FeSO4(aq) + 2KOH(aq) = Fe(OH)2(aq) + K2SO4(aq)
Fe + HNO3 = Fe(NO3)3 + H22Fe + 6HNO3 = 2Fe(NO3)3 + 3H2
Fe + HNO3 = Fe(NO3)3 + H22Fe + 6HNO3 = 2Fe(NO3)3 + 3H2
Fe3So4 + NaI = Fe2So4 + NaSo4 + I-2Fe3So4 + NaI = -3Fe2So4 + NaSo4 + I
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
FeCl2 + KNO3 + HCl = FeCl3 + NO + H2O + KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe + H2SO4 = H2 + FeSO4Fe + H2SO4 = H2 + FeSO4
FeO +O2 =Fe2O34FeO + O2 = 2Fe2O3
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeS+2NaClO3=FeClO3+NaSFeS + NaClO3 = FeClO3 + NaS
FeS+NaClO3=FeClO3+NaSFeS + NaClO3 = FeClO3 + NaS
Fe2(SO4)3 + Mg(OH)2 = Fe(OH)3 + MgSO4Fe2(SO4)3 + 3Mg(OH)2 = 2Fe(OH)3 + 3MgSO4
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3 + CO = CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 +SrBr2 = SrF2 + Br2F2 + SrBr2 = SrF2 + Br2
Fe2O3+H+Cl2=FeO+HClO48Fe2O3 + 2H + Cl2 = 16FeO + 2HClO4
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe +HNO3= Fe(NO3)2+NH3(NH4NO3)+ H2O8Fe + 19HNO3 = 8Fe(NO3)2 + NH3(NH4NO3) + 6H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O2=FeO2Fe + O2 = 2FeO
Fe(NO3)3(aq) + LiOH(aq) = LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe3O4 + HBr = FeBr2 + FeBr3 + H2OFe3O4 + 8HBr = FeBr2 + 2FeBr3 + 4H2O
Fe2(SO4)3 + H2O + SO2 = Fe2SO4 + H2SO4Fe2(SO4)3 + 4H2O + 2SO2 = Fe2SO4 + 4H2SO4
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=+Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=3Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=3Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(ClO4)2(aq)+Na2CO3(aq)=FeCO3(s)+2NaClO4(aq)Fe(ClO4)2(aq) + Na2CO3(aq) = FeCO3(s) + 2NaClO4(aq)
FeS2+O2=3Fe2O3+SO4FeS2 + 7O2 = 2Fe2O3 + 8SO
FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4FeSO4 + Pb(NO3)2 = Fe(NO3)2 + PbSO4
F2(g)+NaBr(aq)=Br2(l)+NaF(aq)F2(g) + 2NaBr(aq) = Br2(l) + 2NaF(aq)
FeO+Al=Al2O3+Fe3FeO + 2Al = Al2O3 + 3Fe
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s) + H2 O(l) = Fe3 O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s) + O2 (g) = Fe2 O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s) + H2 O(l) = Fe3 O4 (s) + H2 (g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s) + O2 (g) = Fe2 O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + Br2 = FeBr2Fe + Br2 = FeBr2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CuO=Fe2O3+Cu2Fe + 3CuO = Fe2O3 + 3Cu
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + H2S = FeCl2 + HCl +S2FeCl3 + H2S = 2FeCl2 + 2HCl + S
FeCl3+NH3+H2O= Fe(OH)3+NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+H2O+O2=Fe(OH)34Fe + 6H2O + 3O2 = 4Fe(OH)3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3 + NH3 + H2O = Fe(OH)3 + NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
FeCl3 + NH3 + H2O = Fe(OH)3 + NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
FeCl2 + NaBr = NaCl + FeBr2FeCl2 + 2NaBr = 2NaCl + FeBr2
FeSo4 + Zn(OH)2=Fe(OH)2+ ZnSo4FeSo4 + Zn(OH)2 = Fe(OH)2 + ZnSo4
FeCl3+NH3+H2O=Fe(OH)3+NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
FeCl3+NH3+H2O=Fe(OH)3+NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
FeCl3+NH3+H2O=Fe(OH)3+NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe(OH)3 + H3PO4 = FePO4 + 3H2O Fe(OH)3 + H3PO4 = FePO4 + 3H2O
FeF2 = Fe + F2FeF2 = Fe + F2
FeTiO3 + H2SO4 = TiO2 + Fe2(SO4)2 + H2O2FeTiO3 + 2H2SO4 = 2TiO2 + Fe2(SO4)2 + 2H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
FeNO3 + NaPo4 = FePo4 NaNO3FeNO3 + NaPo4 = FePo4NaNO3
FeNO3 + NaPo4 = FePo4 NaNO3FeNO3 + NaPo4 = FePo4NaNO3
Fe2O3 + 6H2C2O4 = 2Fe(C2O4) + 3H2O + 3H2-1Fe2O3 - 2H2C2O4 = -2Fe(C2O4) - 3H2O + H2
Fe (OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
F2+NaCl=Na+FClF2 + 2NaCl = 2Na + 2FCl
F2 + NaCl = NaF + Cl2F2 + 2NaCl = 2NaF + Cl2
Fe(OH)2 + O2 + OH = Fe(OH) 3 Fe(OH)2 + 0O2 + OH = Fe(OH)3
Fe++ + Fe+++ + OH- = Fe3O4 +H2OFe++ + 2Fe+++ + 8OH- = Fe3O4 + 4H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + H3BO3(aq) = FeBO3(s) + H2(g)2Fe(s) + 2H3BO3(aq) = 2FeBO3(s) + 3H2(g)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeI3(aq) + K2S(aq) = Fe2S3(s) + KI(aq) 2FeI3(aq) + 3K2S(aq) = Fe2S3(s) + 6KI(aq)
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 +NH3 +H2O= Fe(OH)3 +NH4Cl FeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe++ + Fe+++ + OH- = FeO4 + H2O-5Fe++ + 6Fe+++ + 8OH- = FeO4 + 4H2O
Fe2O3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)Fe2O3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2O(l)
FeCl3+Na2(CrO4)=Fe2(CrO4)3+NaCl2FeCl3 + 3Na2(CrO4) = Fe2(CrO4)3 + 6NaCl
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+H+Cl2=FeO+HClO48Fe2O3 + 2H + Cl2 = 16FeO + 2HClO4
FeCl 3 + NH 3 + H 2 O = Fe(OH) 3 + NH 4 ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
FeSO4 + KMnO4+ H2SO4= Fe2(SO4)3 + MnO2+ K2SO4 + H2O6FeSO4 + 2KMnO4 + 4H2SO4 = 3Fe2(SO4)3 + 2MnO2 + K2SO4 + 4H2O
Fe2O3 + CO = CO2 +Fe3O23Fe2O3 + 5CO = 5CO2 + 2Fe3O2
Fe2O3 + CO = CO2 + 2Fe3O3Fe2O3 + 7CO = 7CO2 + 2Fe3O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2 + KCr2O7 + HCl = FeCl3 + CrCl3 + KCl + H2O7FeCl2 + KCr2O7 + 14HCl = 7FeCl3 + 2CrCl3 + KCl + 7H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(OH)3+ H2SO4=Fe2(SO4)3 + H2O 2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(NO3)2 + HCl = FeCl + H(NO3)2Fe(NO3)2 + HCl = FeCl + H(NO3)2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + NH3 + H2O = Fe(OH)3 + NH4ClFeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe + HCl = H2 + FeCl2Fe + 2HCl = H2 + 2FeCl
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3+ +NO2- +H2O=Fe2+ H+ NO3-0Fe3+ + NO2- + H2O = 0Fe2 + 2H + NO3-
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe+O=2Fe2O32Fe + 3O = Fe2O3
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe+O=FeOFe + O = FeO
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe3O4 + CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3+ NO2- +H2O = Fe2+ +H+ +NO3--4Fe3 + 3NO2- + 3H2O = -6Fe2+ + 6H+ + 3NO3-
Fe (OH)3 (s)+HNO3 (aq)=Fe (NO3)3 (aq)+H2O (l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe (s)+Cl2 (g)=FeCl3 (s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(OH)2+O2+OH- = Fe(OH)3+H2O-4Fe(OH)2 - O2 + 0OH- = -4Fe(OH)3 + 2H2O
Fe2O3 + 3AlNO3 = Al2O3 + 2(FeNO3)33Fe2O3 + 6AlNO3 = 3Al2O3 + 2(FeNO3)3
F2+H2O=HF+O33F2 + 3H2O = 6HF + O3
Fe3O4 (s) + O2 (g) = Fe2O3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe3O4 (s) + O2 (g) = Fe2O3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2Si2O6+O2+H2O=Fe2O3+H4SiO42Fe2Si2O6 + O2 + 8H2O = 2Fe2O3 + 4H4SiO4
Fe(OH)3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l) Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
FeS2+O=Fe2O3+SO22FeS2 + 11O = Fe2O3 + 4SO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS2(s) + O2(g) = SO4(g) + Fe2O3(s)4FeS2(s) + 19O2(g) = 8SO4(g) + 2Fe2O3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+Al2O3+H2=Fe+H2OAl-1Fe2O3 + 3Al2O3 + 6H2 = -2Fe + 6H2OAl
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3+Fe=FeCl22FeCl3 + Fe = 3FeCl2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FE+O2+H2O=FE(OH)22FE + O2 + 2H2O = 2FE(OH)2
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe+HNO3=Fe(NO3)3+NO+H2020Fe + 60HNO3 = 20Fe(NO3)3 + 0NO + 3H20
Fe2O3+3C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3SO4 +K2Cr2O7+H2SO4 = Fe2(SO4)3+ Cr2(SO4)3+K2SO4+ H2O6Fe3SO4 + 7K2Cr2O7 + 49H2SO4 = 9Fe2(SO4)3 + 7Cr2(SO4)3 + 7K2SO4 + 49H2O
Fe(OH)2 = FeO + H2OFe(OH)2 = FeO + H2O
Fe2O3 + 2AlNO3 = Al2O3 + 2FeNO3Fe2O3 + 2AlNO3 = Al2O3 + 2FeNO3
Fe++ + HCl = Fe+++ +Cl- + H22Fe++ + 2HCl = 2Fe+++ + 2Cl- + H2
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
FeS+2HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2+ + NO3- + H+ = Fe3+ + NO2 +H2O-3Fe2+ + NO3- + 2H+ = -2Fe3+ + NO2 + H2O
Fe2 O3+C=Fe +CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + 3 CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+ 3 CO = Fe + 3 CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS+O2=2Fe2O3+4SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe (NO3)3+(NH4)3PO4=FePO4+NH4NO3Fe(NO3)3 + (NH4)3PO4 = FePO4 + 3NH4NO3
Fe (NO3)3+(NH4)3PO4=FePO4+NH4NO3Fe(NO3)3 + (NH4)3PO4 = FePO4 + 3NH4NO3
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+KOH=Fe(OH)3+KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe2 S3 + Fe3 O4= FeO + S6O122Fe2S3 + 16Fe3O4 = 52FeO + S6O12
Fe2 S3 + Fe3 O4= FeO + 6SO2Fe2S3 + 8Fe3O4 = 26FeO + 3SO2
Fe2 S3 + Fe3 O4= FeO + 6 SO2Fe2S3 + 8Fe3O4 = 26FeO + 3SO2
Fe2 S3 + Fe3 O4= FeO + 6 SO2Fe2S3 + 8Fe3O4 = 26FeO + 3SO2
Fe2O3 + CO = Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
FeCl3 + NH4OH = Fe(OH)3+ NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3 + NH4OH = Fe(OH)3+ NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe++ + NO2- + H2O = Fe+++ + H+ + NO3--2Fe++ + NO2- + H2O = -2Fe+++ + 2H+ + NO3-
Fe (s) + S (s) = 3 FeS (s)Fe(s) + S(s) = FeS(s)
FeSO4+KI+KIO3+H2O=Fe(OH)2+K2SO4+I23FeSO4 + 5KI + KIO3 + 3H2O = 3Fe(OH)2 + 3K2SO4 + 3I2
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe+O2=FeO2Fe + O2 = 2FeO
FeS + H2CO3 = FeO + CH2O + S2FeS + H2CO3 = 2FeO + CH2O + 2S
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe (s) + AgBr (aq) = Ag (s) + FeBr2 (aq) Fe(s) + 2AgBr(aq) = 2Ag(s) + FeBr2(aq)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+Na2CO3+O2+H2O= Fe(OH)3+Na2SO4+Na(CO3)212FeS2 + 32Na2CO3 + 57O2 + 18H2O = 12Fe(OH)3 + 24Na2SO4 + 16Na(CO3)2
Fe(OH)3+HNO3=Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe2O3+3CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeC2O4*2H2O = CO + FeCO3 + 2 H2OFeC2O4*2H2O = CO + FeCO3 + 2H2O
FeC2O4*2H2O = CO + FeCO3 + 2 H2OFeC2O4*2H2O = CO + FeCO3 + 2H2O
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe3O4 + HNO3 + H+ = Fe3+ + NO + H2O-3Fe3O4 + 7HNO3 - 3H+ = -3Fe3+ + 7NO + 2H2O
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
F2 + H2O = OF2 + HF2F2 + H2O = OF2 + 2HF
FeS+O2 = Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(s) + SO2(aq) = FeS2(s) + O2(g)2Fe2O3(s) + 8SO2(aq) = 4FeS2(s) + 11O2(g)
Fe2O3(s) + SO2(aq) = FeS2 + O22Fe2O3(s) + 8SO2(aq) = 4FeS2 + 11O2
Fe2P(s) + S(s)= P4S10(s) + FeS(s) 4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
FeCl3(aq)+Mg(s)=MgCl2(aq)+Fe(s)2FeCl3(aq) + 3Mg(s) = 3MgCl2(aq) + 2Fe(s)
FeCl3(aq)+Mg(s)=MgCl2(aq)+Fe(s)2FeCl3(aq) + 3Mg(s) = 3MgCl2(aq) + 2Fe(s)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(OH)2+H3PO4=Fe3(PO4)2+H2O3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2+ C + O = FeCO3Fe2 + 2C + 6O = 2FeCO3
Fe2O3(s) + Al(s)= Al2O3(s) + Fe(s)Fe2O3(s) + 2Al(s) = Al2O3(s) + 2Fe(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeBr3 + Cl2 = FeCl3 + Br22FeBr3 + 3Cl2 = 2FeCl3 + 3Br2
Fe(No3) + C15H15No2 = Fe(C15H14No2) +HNo3Fe(No3) + C15H15No2 = Fe(C15H14No2) + HNo3
Fe+2HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2+KBr=KF+ Br2F2 + 2KBr = 2KF + Br2
Fe2O3+ HCl= FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3+ + NO2- + H2O = Fe2+ + 2H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + CO(g) = Fe3O4(s) + CO2(g)3Fe2O3(s) + CO(g) = 2Fe3O4(s) + CO2(g)
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+Al2(SO4)3=FeSO4+Al3Fe + Al2(SO4)3 = 3FeSO4 + 2Al
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe(NO3)3+Na3PO4=FePO4+NaNO3Fe(NO3)3 + Na3PO4 = FePO4 + 3NaNO3
Fe(NO3)3+NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS(aq) + MgCl2(aq) = FeCl2(aq) + MgS(aq)FeS(aq) + MgCl2(aq) = FeCl2(aq) + MgS(aq)
FeS(aq) + MgCl2(aq) = FeCl2(l) + MgS(aq)FeS(aq) + MgCl2(aq) = FeCl2(l) + MgS(aq)
FeS(aq) + MgCl2(aq) = FeCl2(aq) + MgS(s)FeS(aq) + MgCl2(aq) = FeCl2(aq) + MgS(s)
FeS(aq) + MgCl2(aq) = FeCl2(aq) + MgS(aq)FeS(aq) + MgCl2(aq) = FeCl2(aq) + MgS(aq)
Fe(NO3)3 + K2CrO4 = Fe2(CrO4)3 + KNO32Fe(NO3)3 + 3K2CrO4 = Fe2(CrO4)3 + 6KNO3
Fe(NO3)3+Na2CO3=Na(NO3)3+Fe2(CO3)2Fe(NO3)3 + Na2CO3 = 2Na(NO3)3 + Fe2(CO3)
Fe(NO3)3+NaI=Na3(NO3)3+FeI3Fe(NO3)3 + 3NaI = Na3(NO3)3 + FeI3
Fe(NO3)3+NaBr=Na3(NO3)3+FeBr3Fe(NO3)3 + 3NaBr = Na3(NO3)3 + FeBr3
Fe(NO3)3+NaCl=Na(NO3)+FeCl3Fe(NO3)3 + 3NaCl = 3Na(NO3) + FeCl3
Fe(s) + S(s)=FeS(s)Fe(s) + S(s) = FeS(s)
Fe(NO3)3+NaCl=Na(NO3)+FeCl3Fe(NO3)3 + 3NaCl = 3Na(NO3) + FeCl3
Fe(NO3)2+NaCl=Na(NO3)+FeCl2Fe(NO3)2 + 2NaCl = 2Na(NO3) + FeCl2
Fe + 3O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + 2FeCl3 = FeCl2Fe + 2FeCl3 = 3FeCl2
Fe2O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 + 2Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + 2Al = Fe + AlO3Fe2O3 + Al = 2Fe + AlO3
Fe2O3 + Al = Fe + AlO3Fe2O3 + Al = 2Fe + AlO3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl 2 + H 2 O + HCl= FeCl 3 + H 2 O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2O3+2C=Fe3C+CO26Fe2O3 + 13C = 4Fe3C + 9CO2
Fe3O4 + 4CO = 4CO2 + 3FeFe3O4 + 4CO = 4CO2 + 3Fe
Fe3O4 + 4CO = 4CO2 + 3FeFe3O4 + 4CO = 4CO2 + 3Fe
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2(SO4)3*6H20+NaOH=Na2SO4+Fe(OH)3+H20Fe2(SO4)3*6H20 + 6NaOH = 3Na2SO4 + 2Fe(OH)3 + 6H20
Fe2(SO4)3+NaOH=Na2SO4+Fe(OH)3Fe2(SO4)3 + 6NaOH = 3Na2SO4 + 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3 + CuSO4 = Fe2(SO4)3 + CuCl22FeCl3 + 3CuSO4 = Fe2(SO4)3 + 3CuCl2
FeCl3+Na2CO3 = Fe2C3O9 + NaCl2FeCl3 + 3Na2CO3 = Fe2C3O9 + 6NaCl
Fe(OH)2 + H2O + O2 = Fe(OH)34Fe(OH)2 + 2H2O + O2 = 4Fe(OH)3
Fe (s) + AgBr (aq) = Ag (s) + FeBr2 (aq) Fe(s) + 2AgBr(aq) = 2Ag(s) + FeBr2(aq)
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s) + 2 HCl(aq) = FeCl2(aq) + H2(g) Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
FeCO3+H20=Fe(OH)3+HCO3+2H0FeCO3 + H20 = 0Fe(OH)3 + 0HCO3 + 20H
FeSO4 + CaCl2 = FeCl2 + FeCl3 + CaSO4FeSO4 + CaCl2 = FeCl2 + 0FeCl3 + CaSO4
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+ CO = Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeCl3 (aq) + K3PO4 (aq) = FePO4 (aq) + 3 KCl (aq)FeCl3(aq) + K3PO4(aq) = FePO4(aq) + 3KCl(aq)
FeCl3 (aq) + K3PO4 (aq) = FePO4 (aq) + 3 KCl (aq)FeCl3(aq) + K3PO4(aq) = FePO4(aq) + 3KCl(aq)
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeCl2 + NH4OH = FeOH + NH4Cl2FeCl2 + NH4OH = FeOH + NH4Cl2
Fe2 + O2 = FeOFe2 + O2 = 2FeO
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)2 + Cu2CO3 = FeCO3 + CuOHFe(OH)2 + Cu2CO3 = FeCO3 + 2CuOH
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + S = FeSFe + S = FeS
Fe + S = FeSFe + S = FeS
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(s) + H2O = Fe(OH)3(s)Fe2O3(s) + 3H2O = 2Fe(OH)3(s)
FeO3(s) + 3C(s) = 2Fe(s) +3CO(g)FeO3(s) + 3C(s) = Fe(s) + 3CO(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.