Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe(s) + HCl(aq) = FeCl3 (aq) + H2 (g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe + O = Fe2O3 2Fe + 3O = Fe2O3
Fe2O3(s) + Al(s) = Al2O3(s) + Fe(s)Fe2O3(s) + 2Al(s) = Al2O3(s) + 2Fe(s)
Fe(s) + Cd(NO3)2(aq) = Fe(NO3)3(aq) + Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe2(CO3)3(s) = Fe2O3(s) + CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s) + Cd(NO3)2(aq) = Fe(NO3)3(aq) + Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS(s)+HCl(aq) = FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+O=FeO+4SOFeS + 2O = FeO + SO
FeS+O=FeO+4SOFeS + 2O = FeO + SO
FeS+O=FeO+SOFeS + 2O = FeO + SO
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(NO3)3+H2CO3=Fe2(CO3)3+HNO32Fe(NO3)3 + 3H2CO3 = Fe2(CO3)3 + 6HNO3
Fe+ O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeSO4+HBrO+H2SO4=Fe(SO4)3+FeBr3+H2O9FeSO4 + 12HBrO + 6H2SO4 = 5Fe(SO4)3 + 4FeBr3 + 12H2O
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe2O3+CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe(NO3)3 + Na2 S = Fe2S3 + NaNO32Fe(NO3)3 + 3Na2S = Fe2S3 + 6NaNO3
FeS(s) + O2(g) + H2O(l) = Fe2O3(s) + H2SO4(aq)4FeS(s) + 9O2(g) + 4H2O(l) = 2Fe2O3(s) + 4H2SO4(aq)
Fe(s) + H2O(l) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe3O4 + Al = Fe +Al2OFe3O4 + 8Al = 3Fe + 4Al2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+2Al=Al2O3+2FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3+2Al=Al2O3+2FeFe2O3 + 2Al = Al2O3 + 2Fe
FeCl3 + Na3Po4 = FePo4 + NaClFeCl3 + Na3Po4 = FePo4 + 3NaCl
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe(NO3)3 + H2O = Fe(H2O)6 + (NO3)3Fe(NO3)3 + 6H2O = Fe(H2O)6 + (NO3)3
Fe(OH)3+HNO3=Fe(NO3)3+H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe2O3(s)+CO(g)=Fe(s)+CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(s) + Sn(NO3)5(aq) = Fe(NO3)3(aq) + Sn(s)5Fe(s) + 3Sn(NO3)5(aq) = 5Fe(NO3)3(aq) + 3Sn(s)
Fe(s) + F(g) = FeF3(s)Fe(s) + 3F(g) = FeF3(s)
Fe + H2O = Fe(OH)3 + HFe + 3H2O = Fe(OH)3 + 3H
Fe + H2O = Fe(OH)3 + HFe + 3H2O = Fe(OH)3 + 3H
Fe + H2O = Fe(OH)3 +HFe + 3H2O = Fe(OH)3 + 3H
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(NO3)2 + H2SO4 =FeSO4 +HNO3Fe(NO3)2 + H2SO4 = FeSO4 + 2HNO3
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeO(s) + C(s) = Fe(l) + CO2(g) 2FeO(s) + C(s) = 2Fe(l) + CO2(g)
FeI2 + Ba(OH)2 = Fe(OH)2 + BaI2FeI2 + Ba(OH)2 = Fe(OH)2 + BaI2
Fe + HNO3 = Fe(NO3)3 + H22Fe + 6HNO3 = 2Fe(NO3)3 + 3H2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe2O6+Na=Fe+NaOFe2O6 + 6Na = 2Fe + 6NaO
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe(s)+S(l) = Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl = Fe+++Cl0Fe + Cl = 0Fe++ + Cl
Fe + Cl = FeClFe + Cl = FeCl
FeSO4 + ZnSO4 = Zn + Fe(SO4)3FeSO4 + 2ZnSO4 = 2Zn + Fe(SO4)3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + 3CO = 3Fe + 3CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe + HCi = FeCi2 + H2Fe + 2HCi = FeCi2 + H2
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
FeO(s) + C(s) = Fe(l) + CO2(g) 2FeO(s) + C(s) = 2Fe(l) + CO2(g)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3 + CH2O = Fe + CO2 +H2020Fe(OH)3 + 60CH2O = 20Fe + 60CO2 + 9H20
Fe(OH)3 + CH2O = Fe + CO2 +H2020Fe(OH)3 + 60CH2O = 20Fe + 60CO2 + 9H20
Fe2O2+H2C2O4+H2O= Fe(CO2O4)3+H3OFe2O2 + 3H2C2O4 + 72H2O = 2Fe(CO2O4)3 + 50H3O
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3 +SO2 + H2O = FeCl2 + FeSO4+ HCl2FeCl3 + SO2 + 2H2O = FeCl2 + FeSO4 + 4HCl
FeCl3 +SO2 + H2O = FeCl2 + Fe2(SO4)3 + HCl8FeCl3 + 3SO2 + 6H2O = 6FeCl2 + Fe2(SO4)3 + 12HCl
FeCl3 +SO2 + H2O = FeCl2 + Fe2(SO4)3 + H2SO44FeCl3 + 3SO2 + 6H2O = 6FeCl2 - Fe2(SO4)3 + 6H2SO4
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeCr2O4+K2CO3+O2=K2CrO4+Fe2O3+CO24FeCr2O4 + 8K2CO3 + 7O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe+3O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2+ + MnO4- + H+ = Fe + Mn2+ + H2O -13Fe2+ + 2MnO4- + 16H+ = -26Fe + Mn2+ + 8H2O
Fe(NO3)3(aq) + KOH(aq) = Fe(OH)3 + KNO3Fe(NO3)3(aq) + 3KOH(aq) = Fe(OH)3 + 3KNO3
Fe(s)+HCl(aq)=FeCl2+H2Fe(s) + 2HCl(aq) = FeCl2 + H2
Fe(s)+HCl(aq)=FeCl3+H22Fe(s) + 6HCl(aq) = 2FeCl3 + 3H2
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+CuCl2=FeCl2+CuFe + CuCl2 = FeCl2 + Cu
Fe+Ni(OH)3=Fe(OH)2+Ni(OH)2Fe + 2Ni(OH)3 = Fe(OH)2 + 2Ni(OH)2
Fe(HCO3)3+Li2S= Fe2S3+Li(HCO3)2Fe(HCO3)3 + 3Li2S = Fe2S3 + 6Li(HCO3)
Fe2+(SO4)3+BaCl2=FeCl3+BaSO4Fe2 + (SO4)3 + 3BaCl2 = 2FeCl3 + 3BaSO4
FeCl2+AgNo3=Fe(No3)2+AgClFeCl2 + 2AgNo3 = Fe(No3)2 + 2AgCl
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe+Cd(NO3)2=Fe(NO3)3+Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe+Br2=FeBr2Fe + Br2 = FeBr2
FeS+O2 = Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + O2(s)= Fe2O3(s)4Fe(s) + 3O2(s) = 2Fe2O3(s)
Fe2O3+CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS2+ O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3+K2C2O4+H2O=K3Fe(C2O4)3(H2O)3+KClFeCl3 + 3K2C2O4 + 3H2O = K3Fe(C2O4)3(H2O)3 + 3KCl
Fe2S3(s)+O2(g)=Fe2O3(s)+SO2(g)2Fe2S3(s) + 9O2(g) = 2Fe2O3(s) + 6SO2(g)
Fe2S3(S)+O2(g)=Fe2O3(s)+SO2(g)2Fe2S3(S) + 11O2(g) = 2Fe2O3(s) + 8SO2(g)
FeCrO4+C=Cr+Fe+COFeCrO4 + 4C = Cr + Fe + 4CO
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4+C2O=FeO+CO23Fe3O4 + C2O = 9FeO + 2CO2
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+Mg=MgO+FeFe2O3 + 3Mg = 3MgO + 2Fe
Fe + H2O= Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
FeCl2(aq) + Ag3PO4(aq) = Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
F2+Li2O=LiF+OF2 + Li2O = 2LiF + O
FeO(s) + O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2++MnO4-+H+=Fe3++Mn2++H2O-39Fe2+ + 2MnO4- + 16H+ = -26Fe3+ + Mn2+ + 8H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO2+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O2FeSO2 + 2KMnO4 + 5H2SO4 = Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 4H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCO3+H2CO3=Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe (s) + H2SO4 (aq) = Fe2(SO4)3 + H22Fe(s) + 3H2SO4(aq) = Fe2(SO4)3 + 3H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2(CO3)3(s) = Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
FeS2 + 11O2 = 2Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O4+CO=Fe+CO2Fe2O4 + 4CO = 2Fe + 4CO2
Fe2O3(s)+C(g)= CO2+FeO(s)2Fe2O3(s) + C(g) = CO2 + 4FeO(s)
FeCl2+Na2Co3=FeCo3+NaClFeCl2 + Na2Co3 = FeCo3 + 2NaCl
Fe(s)+Cd(NO3)2(aq) = Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe2O3(s)+ H2O (l) = Fe(OH)3 (s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe(NO3)3 + Na2CO3 = Fe2(CO3)3 + NaNO32Fe(NO3)3 + 3Na2CO3 = Fe2(CO3)3 + 6NaNO3
Fe(ClO4)2+Na2C2O4=FeC2O4+NaClO4Fe(ClO4)2 + Na2C2O4 = FeC2O4 + 2NaClO4
Fe(s)+O2(s)=Fe2O3(s)4Fe(s) + 3O2(s) = 2Fe2O3(s)
Fe + O2 = Fe2O22Fe + O2 = Fe2O2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2P + S = P4S10 + FeS4Fe2P + 18S = P4S10 + 8FeS
Fe+H2(SO4)=Fe2(SO4)3+H22Fe + 3H2(SO4) = Fe2(SO4)3 + 3H2
Fe3O2 + Mg2 = MgO + Fe3Fe3O2 + Mg2 = 2MgO + Fe3
Fe3 + O9 = Fe8O724Fe3 + 7O9 = 9Fe8O7
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(C2O4)2+H2O2=Fe(C2O4)+OH0Fe(C2O4)2 + H2O2 = 0Fe(C2O4) + 2OH
Fe+Cd(NO3)2=Fe(NO3)3+Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe+Cd(NO3)2=Fe(NO3)3+Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe+Cd(NO3)2=Fe(NO3)3+Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
FeCl3 + CuSO4 = FeSO4 + CuCl3FeCl3 + CuSO4 = FeSO4 + CuCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe + Cl = FeCl3Fe + 3Cl = FeCl3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe(NO3)2 +H2SO4 =FeSO4 +HNO3Fe(NO3)2 + H2SO4 = FeSO4 + 2HNO3
Fe2O3+ CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(NO3)2 +NaOH =Fe(OH)2 + NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3 + 2Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + (NH4)2S = NH4Cl + Fe2S32FeCl3 + 3(NH4)2S = 6NH4Cl + Fe2S3
FeO + C = Fe + CO22FeO + C = 2Fe + CO2
Fe2O3(s)+C(s) = Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
FeS + 2 HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
FeO3(s) + CO(g) = Fe(l) + CO2(g)FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2S3(s) = 2Fe(s) + 3S(s) Fe2S3(s) = 2Fe(s) + 3S(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(NO3)3 + FeSO4 + H2SO4 = NO + Fe2(SO4)3 + H2OFe(NO3)3 + 9FeSO4 + 6H2SO4 = 3NO + 5Fe2(SO4)3 + 6H2O
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCr2O4+Na2CO3+O2=Na2CrO4+Fe2O3+CO24FeCr2O4 + 8Na2CO3 + 7O2 = 8Na2CrO4 + 2Fe2O3 + 8CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe5O6+ CO = Fe11O12+CO211Fe5O6 + 6CO = 5Fe11O12 + 6CO2
Fe5O6+ CO = Fe7O8+CO0Fe5O6 + CO = 0Fe7O8 + CO
Fe5O6+ CO = Fe3O4+CO2-3Fe5O6 + 2CO = -5Fe3O4 + 2CO2
Fe3O4+ CO = FeO+CO2Fe3O4 + CO = 3FeO + CO2
FeO+ CO = Fe3O4+CO2-3FeO + CO = -1Fe3O4 + CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O + H2 = Fe + H2OFe2O + H2 = 2Fe + H2O
FeO(OH)+H2O+SO4--+K+=KFe3(SO4)2(OH)6+H2O0FeO(OH) + H2O + 0SO4-- + 0K+ = 0KFe3(SO4)2(OH)6 + H2O
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+HNO3=Fe(NO3)3 + NO + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO + 3H2O
Fe(NO3)3 + K3PO4 = FePO4 + 3K(NO3)Fe(NO3)3 + K3PO4 = FePO4 + 3K(NO3)
FeO+HNO3=Fe(NO3)3 + NO + H2O3FeO + 10HNO3 = 3Fe(NO3)3 + NO + 5H2O
Fe3O4+HNO3=Fe(NO3)3 + NO + H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe2O3+HNO3=Fe(NO3)3 + NO + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO + 3H2O
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe(NO3)2 + NaOH =Fe(OH)2 + NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
Fe(NO3)2 + NaOH = Fe(OH)2 + NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 +H2O = 4 Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(NO3)2 +H2SO4 =FeSO4 + HNO3Fe(NO3)2 + H2SO4 = FeSO4 + 2HNO3
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe(NO3)2 + NaOH = Fe(OH)2 + NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=Fe+CO0Fe2O3 + CO = 0Fe + CO
Fe2O3+CO=Fe+CO0Fe2O3 + CO = 0Fe + CO
Fe2O3+2CO=Fe+2CO0Fe2O3 + CO = 0Fe + CO
F + Cl = FClF + Cl = FCl
FeO+C=Fe+COFeO + C = Fe + CO
FeCr2O7+K2CO3+O2= K2CrO4+Fe2O3+CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
FeCl3 + CuSO4 = Fe2SO4 + Cu(Cl3)22FeCl3 + CuSO4 = Fe2SO4 + Cu(Cl3)2
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe2(CO3)3 + HNO3 = Fe(NO3)3 + CO2 + H2OFe2(CO3)3 + 6HNO3 = 2Fe(NO3)3 + 3CO2 + 3H2O
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeO+C=Fe+CO22FeO + C = 2Fe + CO2
Fe + O2 = FeO2Fe + O2 = 2FeO
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeCl2 + AgNO3 = FeNO3 + AgCl2FeCl2 + AgNO3 = FeNO3 + AgCl2
FeCl3+KOH=Fe(OH)3+KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe(NH4)2(SO4)2*6H2O + H2C2O4=FeC2O4*2H2O + (NH4)2SO4+ H2SO4+ H2OFe(NH4)2(SO4)2*6H2O + H2C2O4 = FeC2O4*2H2O + (NH4)2SO4 + H2SO4 + 4H2O
Fe2O3+Al=Fe2+Al2O3Fe2O3 + 2Al = Fe2 + Al2O3
Fe2(So4)3 + AgNO3 = Ag2So4 + Fe(NO3)3Fe2(So4)3 + 6AgNO3 = 3Ag2So4 + 2Fe(NO3)3
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
F-+e=FF- - e = F
Fe + SCN = FeN + SCFe + SCN = FeN + SC
Fe(OH)3 + H = Fe + H3OFe(OH)3 + 6H = Fe + 3H3O
Fe + OH = FeOHFe + OH = FeOH
Fe + NH3 + H2O = FeOH + NH4Fe + NH3 + H2O = FeOH + NH4
FeCl2(aq) + Ag3PO4(aq) = Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe(ClO3)3+Mg=Fe+Mg(ClO3)22Fe(ClO3)3 + 3Mg = 2Fe + 3Mg(ClO3)2
Fe2S3(s)+H2O+O2(g)=Fe(OH)3(s)+S(s)2Fe2S3(s) + 6H2O + 3O2(g) = 4Fe(OH)3(s) + 6S(s)
Fe(OH)2 + H3PO4 = Fe3(PO4)2 + H2O3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
Fe2O3+HClO4= Fe(ClO4)3+H2OFe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
FeSO4 + H2SO4 + H2O2 = 3 2 Fe (SO4)3 + H2OFeSO4 + 2H2SO4 + 2H2O2 = Fe(SO4)3 + 4H2O
Fe1Mg5Al2(OH)16(CO3)*5H2O +2O2 = FeO + MgO + Al2O3 + CO2 + H2OFe1Mg5Al2(OH)16(CO3)*5H2O + 0O2 = FeO + 5MgO + Al2O3 + CO2 + 13H2O
FeMgAl(OH)(CO3)*5H2O +O2 = FeO + MgO + Al2O3 + CO2 + H2O2FeMgAl(OH)(CO3)*5H2O + 2O2 = 2FeO + 2MgO + Al2O3 + 2CO2 + 11H2O
FeCl2+KOH+O2+H2O=Fe(OH)3+KCl4FeCl2 + 8KOH + O2 + 2H2O = 4Fe(OH)3 + 8KCl
FeCl2+KOH+O2+H2O=Fe(OH)3+KCl4FeCl2 + 8KOH + O2 + 2H2O = 4Fe(OH)3 + 8KCl
Fe2O3 + BaCl2= BaO+2FeCl3Fe2O3 + 3BaCl2 = 3BaO + 2FeCl3
Fe(NO3)3 + 3 NH3 + 3 H2O = Fe(OH)3 + 3 NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3+Na=Fe+NaBrFeBr3 + 3Na = Fe + 3NaBr
Fe(OH)2 + CrO4-2 = Fe2O3 +Cr(OH)- +H2O+ OH-6Fe(OH)2 + CrO4-2 = 3Fe2O3 + Cr(OH)- + 5H2O + OH-
Fe3O4 + KMnO4 + KHSO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10Fe3O4 + 2KMnO4 + 96KHSO4 = 15Fe2(SO4)3 + 2MnSO4 + 49K2SO4 + 48H2O
Fe(OH)2 + CrO4-2 = Fe2O3 +Cr(OH)- +H2O+ OH-6Fe(OH)2 + CrO4-2 = 3Fe2O3 + Cr(OH)- + 5H2O + OH-
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeO4+H2=Fe+H2OFeO4 + 4H2 = Fe + 4H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+H2SO4 = Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3(s) + H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2S3+H2O+O2=Fe(OH)3+S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
Fe2S3+H2O+O2=Fe(OH)3+S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO(s) + H2O(l) = Fe(OH)2(s)FeO(s) + H2O(l) = Fe(OH)2(s)
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeO+PdF2=FeF2+PdOFeO + PdF2 = FeF2 + PdO
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+ H2SO4 = Fe2(SO4)3 +H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe 2 O 3 (s)+C(s)=Fe(s)+CO(g) Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3O4 + CO = Fe + CO2 Fe3O4 + 4CO = 3Fe + 4CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeTiO3 + H2SO4 = TiOSO4 + FeSO4 + 7H2OFeTiO3 + 2H2SO4 = TiOSO4 + FeSO4 + 2H2O
FeS2+O2= Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2= Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2(CO3)3 = Fe2O3 + CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe + Cd(NO3)2 = Fe(NO3)3 + Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2 + KMnO4 +HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + KMnO4 +HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + KMnO4 +HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + Cu(NO3)2 = Cu + Fe(NO3)2Fe + Cu(NO3)2 = Cu + Fe(NO3)2
Fe2O3+H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(ClO3)3+Mg=Fe+Mg(ClO3)3Fe(ClO3)3 + Mg = Fe + Mg(ClO3)3
Fe2O3 + BaCl2 = BaO + FeCl3Fe2O3 + 3BaCl2 = 3BaO + 2FeCl3
FeCl3+Mg(NO3)2=Fe(NO3)3+ MgCl22FeCl3 + 3Mg(NO3)2 = 2Fe(NO3)3 + 3MgCl2
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + Na3PO4 = FePO4+NaClFeCl3 + Na3PO4 = FePO4 + 3NaCl
Fe(s) + Cl2(g) =FeCl3(s) 2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeS2 + O2 = Fe2 + 2SO2FeS2 + 2O2 = Fe2 + 4SO
FeS2 + O2 = Fe2 + 2SO2FeS2 + 2O2 = Fe2 + 4SO
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
FeCl3 + Na2CO3 = Fe2O3 + CO2 +NaCl2FeCl3 + 3Na2CO3 = Fe2O3 + 3CO2 + 6NaCl
FeO + CO = Fe + CO2FeO + CO = Fe + CO2
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
FeO(s)+C(s)=Fe(l)+CO2(g)2FeO(s) + C(s) = 2Fe(l) + CO2(g)
Fe+Cd(NO3)2=Fe(NO3)3+Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe2S3(s)+H2O+O2(g)=Fe(OH)3(s)+S(s)2Fe2S3(s) + 6H2O + 3O2(g) = 4Fe(OH)3(s) + 6S(s)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3 + FeS = Fe2S3 + FeCl22FeCl3 + 3FeS = Fe2S3 + 3FeCl2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3 + H2S + H2O = FeS + H2SO44Fe2(SO4)3 + 9H2S + 4H2O = 8FeS + 13H2SO4
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl3 + NaNO3 = Fe + NO3 + NaClFeCl3 + 3NaNO3 = Fe + 3NO3 + 3NaCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe + H2S04 = Fe2(S04)3 + H22Fe + 3H2S04 = Fe2(S04)3 + 3H2
Fe(aq)+OH(aq)=Fe(OH)2(aq)Fe(aq) + 2OH(aq) = Fe(OH)2(aq)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + O2=FeO32Fe + 3O2 = 2FeO3
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)(aq)=Fe(NO3)3(aq)+Cd(s)Fe(s) + 3Cd(NO3)(aq) = Fe(NO3)3(aq) + 3Cd(s)
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+HNO3=FeNO3+H22Fe + 2HNO3 = 2FeNO3 + H2
Fe+Pb(NO3)2=FeNO3+Pb2Fe + Pb(NO3)2 = 2FeNO3 + Pb
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+++ + I- + H2O = Fe++ + IO3- + H+6Fe+++ + I- + 3H2O = 6Fe++ + IO3- + 6H+
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl2(aq) + Ag3PO4(aq)=Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
FeCl2(aq) + Ag3PO4(aq)=Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+Br2=FeBr32Fe + 3Br2 = 2FeBr3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeCl3 + Ca(OH)2 =Fe(OH)3 + CaCl2 2FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
FeCl2(aq) + KMnO4(aq) + HCl(aq) = FeCl3(aq) +MnCl2(aq) +H2O(l) + KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4+CO2=Fe+CO20Fe3O4 + CO2 = 0Fe + CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H = Fe + H2OFe2O3 + 6H = 2Fe + 3H2O
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCO3 + C6H8O7 = FeC12H10O14 + CO2 + H2O9FeCO3 + 16C6H8O7 = 9FeC12H10O14 - 3CO2 + 19H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(NO3)3(aq) + LiOH(aq)=LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeSO4(aq) + Na3PO4(aq)=Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
Fe2O3+S=Fe+SO22Fe2O3 + 3S = 4Fe + 3SO2
FeCl2(aq) + (NH4)2S(aq) = FeS + NH4ClFeCl2(aq) + (NH4)2S(aq) = FeS + 2NH4Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe(NO3)3 +Na3PO4 = FePO4 + 3Na(NO3)Fe(NO3)3 + Na3PO4 = FePO4 + 3Na(NO3)
FeSO4 + K3PO4 = Fe3(PO4)2 + K2SO43FeSO4 + 2K3PO4 = Fe3(PO4)2 + 3K2SO4
FeCO3(s) + HNO3(aq) = Fe(NO3)2 + CO2 + H2OFeCO3(s) + 2HNO3(aq) = Fe(NO3)2 + CO2 + H2O
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe(OH)3(s) + HNO3(aq) = Fe(NO3)3 + H2OFe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3 + 3H2O
Fe2(SO4)3+6KOH = 2Fe(OH)3+3K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
Fe2(SO4)3+6KOH = 2Fe(OH)3+3K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
Fe(NO3)3(aq) + LiOH(aq) = LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe + O2+H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe3O4 + CO = FeO + CO2Fe3O4 + CO = 3FeO + CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g) = Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCO3 + HNO3 = Fe(NO3)2 + CO2 + H2OFeCO3 + 2HNO3 = Fe(NO3)2 + CO2 + H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4
FeSO4 + SCN + H2O2 = FeO2 + SCNH2 + SO4FeSO4 + SCN + H2O2 = FeO2 + SCNH2 + SO4
FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4FeSO4 + KSCN + H2O2 = FeO2 + KSCNH2 + SO4
Fe2+OH=Fe(OH)2Fe2 + 4OH = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeO(s)+O2(g)=Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeSO4(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
FE+ CL2=FECL2FE + CL2 = FECL2
FeO3H3=Fe2O3+H2O2FeO3H3 = Fe2O3 + 3H2O
Fe+H2O=Fe3O4+4H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+4H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2O=Fe3O4+H2O0Fe + H2O = 0Fe3O4 + H2O
FeS2+ HNO3=Fe2(SO4)3 + NO2+H2O+H2SO42FeS2 + 30HNO3 = Fe2(SO4)3 + 30NO2 + 14H2O + H2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+S8=Fe2S316Fe + 3S8 = 8Fe2S3
FeO(s)+ O2(g)= Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2 + O2 + H2O = Fe(OH)3 + H2SO44FeS2 + 15O2 + 14H2O = 4Fe(OH)3 + 8H2SO4
FeS2 + O2 + H2O = Fe(OH)3 + H2SO44FeS2 + 15O2 + 14H2O = 4Fe(OH)3 + 8H2SO4
FeCl3+Zn=FeCl2+ZnCl22FeCl3 + Zn = 2FeCl2 + ZnCl2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe 2 (CO 3 ) 3 (s)=Fe 2 O 3 (s)+CO 2 (g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.