Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(ClO4)2(aq)+K2S(aq)=FeS(s)+2KClO4(aq)Fe(ClO4)2(aq) + K2S(aq) = FeS(s) + 2KClO4(aq)
Fe2O3 +CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS +O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2(SO4)3 + NH4(SCN) = Fe(SCN)3 + (NH4)2SO4Fe2(SO4)3 + 6NH4(SCN) = 2Fe(SCN)3 + 3(NH4)2SO4
FeCl2+NaClO4+H2SO4=Fe(ClO3)3+Na2SO4+NaClO3+H2O2FeCl2 + 13NaClO4 + H2SO4 = 2Fe(ClO3)3 + Na2SO4 + 11NaClO3 + H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe+H2SO4 = Fe3S4 + H2 +H2O3Fe + 4H2SO4 = Fe3S4 - 12H2 + 16H2O
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+O=FeOFe + O = FeO
FeCl3+Mg(OH)2=Fe(OH)3+MgCl22FeCl3 + 3Mg(OH)2 = 2Fe(OH)3 + 3MgCl2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeNO3(aq) + KOH(aq) = FeOH(s) + KNO3(aq) FeNO3(aq) + KOH(aq) = FeOH(s) + KNO3(aq)
Fe(s) + O2(g) = Fe2O3(s) 4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + C =CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe + HNO3 = Fe(NO3)3 + NO2 + H2OFe + 6HNO3 = Fe(NO3)3 + 3NO2 + 3H2O
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
FeSO4+K2Cr2O7+H2SO4=Fe2(SO4)3+K2SO4+Cr2(SO4)3+H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
Fe(s) +H2SO4(aq) = Fe2(SO4)3(aq) +H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
FeSO4(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
Fe + HCl = FeCl + HFe + HCl = FeCl + H
Fe + 2 HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + 2 HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl + HFe + HCl = FeCl + H
Fe + 3HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(aq)+ H2SO4(aq) =Fe2(SO4)3(aq)+ H2(aq)2Fe(aq) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(aq)
Fe(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2(g)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(g)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeSO4(Aq)+AgNO3(Aq)=Ag2SO4(s)+Fe(NO3)2(Aq)FeSO4(Aq) + 2AgNO3(Aq) = Ag2SO4(s) + Fe(NO3)2(Aq)
Fe2O3 + CO2 = Fe2(CO3)3Fe2O3 + 3CO2 = Fe2(CO3)3
Fe + Cd(NO3)2 = Fe(NO3)3 + Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
Fe + 2 HCl= FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe1S2 + O2 = Fe2O3 + SO24Fe1S2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+Cl2=FeCl3+S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3 = Fe2O3 + H2O 2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeS + 2 HCl = FeCl2 + 2 H2SFeS + 2HCl = FeCl2 + H2S
Fe(NO3)=Fe2O3+NO2+O2-4Fe(NO3) = -2Fe2O3 - 4NO2 + O2
FeO(s) + HNO3(aq) = Fe(NO3)2(aq) + H2O(l)FeO(s) + 2HNO3(aq) = Fe(NO3)2(aq) + H2O(l)
F2+KIO3+H2O=KIO4+HFF2 + KIO3 + H2O = KIO4 + 2HF
FeO + HNO3 = Fe(NO3)3 + N2 + H2O10FeO + 32HNO3 = 10Fe(NO3)3 + N2 + 16H2O
Fe + HCl = FeCl 3+ H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeS2+O2=Fe2O3+SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + H2O = Fe(OH)3 + HClFeCl3 + 3H2O = Fe(OH)3 + 3HCl
Fe(s)+HCl(aq)=FeCl3(aq)+H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe3+ + SO2 + H2O = Fe2+ + H+ + SO42--158Fe3+ + SO2 + 40H2O = -237Fe2+ + 80H+ + SO42-
Fe3+ + SO2 + H2O = Fe2+ + H+ + SO4 2--158Fe3+ + SO2 + 40H2O = -237Fe2+ + 80H+ + SO42-
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2+O2=Fe2O32Fe2 + 3O2 = 2Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(s) + CuCl2(aq) = FeCl2(aq) + Cu(s)Fe(s) + CuCl2(aq) = FeCl2(aq) + Cu(s)
Fe (s) + O2 (g) = Fe2O3 (s) 4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2(SO4)3 + NH4OH = Fe(OH)3 + (NH4)2SO4Fe2(SO4)3 + 6NH4OH = 2Fe(OH)3 + 3(NH4)2SO4
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeSO4 + H2SO4 + HNO3 = Fe2(SO4)3 + NO + H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe3O4 + 3 CO = 3 Fe + 3 CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeCl3+3 NH4OH=Fe(OH)3+ 3NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
Fe2S3+K2O2=Fe2O3+K2(SO4)+K2OFe2S3 + 12K2O2 = Fe2O3 + 3K2(SO4) + 9K2O
FeS2+H2O+O2=Fe2S3+H2O0FeS2 + H2O + 0O2 = 0Fe2S3 + H2O
FeS2+O2=Fe2S3+SO42FeS2 + 2O2 = Fe2S3 + SO4
Fe2SO3+K2O2=Fe2O3+K2(SO4)+K2OFe2SO3 + 3K2O2 = Fe2O3 + K2(SO4) + 2K2O
Fr+HNO3=Fr(NO3)+NH4(NO3)+H2O8Fr + 10HNO3 = 8Fr(NO3) + NH4(NO3) + 3H2O
Fe3O4(s) + 2 CO(g) = 3 Fe(s) + 2 CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe3O4(s) + H2(g) = Fe(s) + H2OFe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O
FeTiO3 + Cl2 + C = TiCl4 + FeCl3 + CO2FeTiO3 + 7Cl2 + 6C = 2TiCl4 + 2FeCl3 + 6CO
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(s)+H2O(l) = Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
FeS+ 6HCl= H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeS+ 6HCl= H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeS+ 6HCl= HS+FeClFeS + HCl = HS + FeCl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(HCO3)3+H2SO4=Fe2(SO4)3+H2O+CO22Fe(HCO3)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O + 6CO2
Fe2O3(s) + 3 H2(g) = 2 Fe(s) + 3 H2O(g) Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
FeSO4 + H2SO4 + Cl2 = Fe2 (SO4)3 + HCl2FeSO4 + H2SO4 + Cl2 = Fe2(SO4)3 + 2HCl
FeO + Cl2 =Fe2O +Cl0FeO + Cl2 = 0Fe2O + 2Cl
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe+++ + NO2- +H2O = Fe++ + H+ +NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
Fe3+ + NO2- +H2O = Fe2+ + H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe +O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4 + KMnO4 = FeMnO4 + KSO4FeSO4 + KMnO4 = FeMnO4 + KSO4
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe(OH)3+HMnO4=Fe(MnO4)3+H2OFe(OH)3 + 3HMnO4 = Fe(MnO4)3 + 3H2O
Fe2(SO4)3+Ba=BaSO4+FeFe2(SO4)3 + 3Ba = 3BaSO4 + 2Fe
Fe(s) + Cl2(g) = FeCl32Fe(s) + 3Cl2(g) = 2FeCl3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+HC2H3O2=Fe(C2H3O2)3+H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
Fe + HCl = H+ FeClFe + HCl = H + FeCl
Fe+O2+H2O=2Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe(s) + H2SO4(aq) = H2(g) + Fe2(SO4)3 (aq)2Fe(s) + 3H2SO4(aq) = 3H2(g) + Fe2(SO4)3(aq)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe +H2SO4 = Fe2(SO4)3 +H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeSO4 = Fe2O3+ O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeSO4 = Fe2O3 + O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeSO4 = Fe2O3 + O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeSO4 = Fe2O3 + O2 + SO3 4FeSO4 = 2Fe2O3 - O2 + 4SO3
FeS + NO3- + H+ = SO4-- + N2 + Fe++ + H2O5FeS + 8NO3- + 8H+ = 5SO4-- + 4N2 + 5Fe++ + 4H2O
FeS2 + NO3- + H+ = SO4-- + N2 + Fe++ + H2O5FeS2 + 14NO3- + 4H+ = 10SO4-- + 7N2 + 5Fe++ + 2H2O
FeO(s)+O2(g) = Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeO4+HBr = FeBr2+FeBr3+H2OFeO4 + 8HBr = -5FeBr2 + 6FeBr3 + 4H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + HNO3 = Fe(NO3) + NH4NO3 + H2O8Fe + 10HNO3 = 8Fe(NO3) + NH4NO3 + 3H2O
Fe + SbS3 = FeS3 + SbFe + SbS3 = FeS3 + Sb
FeS2 + HNO3 = Fe2(SO4)3 + H2SO4 + NO + H2O2FeS2 + 10HNO3 = Fe2(SO4)3 + H2SO4 + 10NO + 4H2O
Fe2O3 + H2S = FeS2 + S + H2OFe2O3 + 3H2S = 2FeS2 - S + 3H2O
FeS2 + Na2O2 = Fe2O3 + Na2SO4 + Na2O2FeS2 + 15Na2O2 = Fe2O3 + 4Na2SO4 + 11Na2O
FeS+HBr=FeBr2+H2SFeS + 2HBr = FeBr2 + H2S
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe(NO3)2 = Fe2O3 + NO2 + O24Fe(NO3)2 = 2Fe2O3 + 8NO2 + O2
FeS2+Na2O2=Fe2O3+Na2SO4+NaO2-4FeS2 + 3Na2O2 = -2Fe2O3 - 8Na2SO4 + 22NaO2
FeS2+Na2O2=Fe2O3+Na2SO4+NaO2-4FeS2 + 3Na2O2 = -2Fe2O3 - 8Na2SO4 + 22NaO2
Fe2(SO4)3+Ba(OH)2=BaSO4+Fe(OH)3Fe2(SO4)3 + 3Ba(OH)2 = 3BaSO4 + 2Fe(OH)3
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(OH)2 + HCl = FeCl2 + H2OFe(OH)2 + 2HCl = FeCl2 + 2H2O
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + HI = FeI2 + I2 + H2OFe2O3 + 6HI = 2FeI2 + I2 + 3H2O
Fe + H2SO4 = Fe2(SO4)3 + SO2 + H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
FeSO4 + KMnO4 + H2SO4 = K2SO4 + MnSO4 + Fe2(SO4)3 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
Fe+++ + NO2- + H2O = Fe++ + H+ + NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
Fe3+ + NO2- + H2O =Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe++ + HCO3- + O2 + H2O = Fe(OH)3 + CO2 4Fe++ + 8HCO3- + O2 + 2H2O = 4Fe(OH)3 + 8CO2
Fe2+ + HCO3 + O2 + H2O = Fe(OH)3 + CO2 0Fe2+ + 4HCO3 - O2 - 2H2O = 0Fe(OH)3 + 4CO2
FeTiO3+Cl2+C=TiCl4+FeCl3+CO2FeTiO3 + 7Cl2 + 6C = 2TiCl4 + 2FeCl3 + 6CO
Fe3O4+CO=FeO+CO2Fe3O4 + CO = 3FeO + CO2
Fe2O3+6HCl=FeCl2+Cl2+H2OFe2O3 + 6HCl = 2FeCl2 + Cl2 + 3H2O
FeS2(s) + O2(g) = Fe2O3(s) + SO2(g)4FeS2(s) + 11O2(g) = 2Fe2O3(s) + 8SO2(g)
Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3
Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3Fe(NO3)3 + C2H3NaO2 = FeC2H3O2 + Na(NO3)3
Fe(NO3)2 + H2O = Fe(OH)2 + HNO3Fe(NO3)2 + 2H2O = Fe(OH)2 + 2HNO3
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + 2 O2=3 Fe2O3 +4 SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(s)+H2=Fe(l)+H2O(g)Fe2O3(s) + 3H2 = 2Fe(l) + 3H2O(g)
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe(SCN)3+K2Cr2O7+HCl=FeCl3+CrCl3+KCl+CO2+SO2+HNO2+H2OFe(SCN)3 + 6K2Cr2O7 + 51HCl = FeCl3 + 12CrCl3 + 12KCl + 3CO2 + 3SO2 + 3HNO2 + 24H2O
Fe+Na2S2O3+HCl=FeCl3+NaCl+H2S+H2O8Fe + 3Na2S2O3 + 30HCl = 8FeCl3 + 6NaCl + 6H2S + 9H2O
FeFe2O4+KMnO4+H2SO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10FeFe2O4 + 2KMnO4 + 48H2SO4 = 15Fe2(SO4)3 + K2SO4 + 2MnSO4 + 48H2O
Fe3O4+KMnO4+H2SO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10Fe3O4 + 2KMnO4 + 48H2SO4 = 15Fe2(SO4)3 + K2SO4 + 2MnSO4 + 48H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe3+ + NO2- + H2O =Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + HSO4 = Fe2O3 + S8 +OH16Fe + 8HSO4 = 8Fe2O3 + S8 + 8OH
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaCl=FeCl+NaCl3FeCl3 + NaCl = FeCl + NaCl3
Fe(SCN)3+K2Cr2O7+HCl=FeCl3+CrCl3+KCl+CO2+SO2+N2+H2O2Fe(SCN)3 + 9K2Cr2O7 + 78HCl = 2FeCl3 + 18CrCl3 + 18KCl + 6CO2 + 6SO2 + 3N2 + 39H2O
FeS2+HNO3=Fe2(SO4)3+H2SO4+NO+H2O2FeS2 + 10HNO3 = Fe2(SO4)3 + H2SO4 + 10NO + 4H2O
FeS2+Na2O2=Fe2O3+Na2SO4+NaO0FeS2 + Na2O2 = 0Fe2O3 + 0Na2SO4 + 2NaO
FeS2+Na2O2=Fe2(SO4)3+Na2SO4+NaO0FeS2 + Na2O2 = 0Fe2(SO4)3 + 0Na2SO4 + 2NaO
FeS2+Na2O2=Fe2O3+Na2SO4+NaO0FeS2 + Na2O2 = 0Fe2O3 + 0Na2SO4 + 2NaO
Fe2S3+HCl=FeCl3+H2SFe2S3 + 6HCl = 2FeCl3 + 3H2S
Fe2S3 + O2 = Fe2O3 + SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
F2O+Na(OH)=NaF+O2+H2OF2O + 2Na(OH) = 2NaF + O2 + H2O
FeS(s)+HCl(aq) =FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + H2SO4 = H2 + Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
Fe + H2O = Fe2O3 + H2Fe + 3H2O = Fe2O3 + 6H
Fe + H2O = Fe2O3 + H2Fe + 3H2O = Fe2O3 + 6H
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2 O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO2=Fe+CO20Fe2O3 + CO2 = 0Fe + CO2
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe3+ +NO2- +H2O=Fe2+ +H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2(SO4)3(aq) + 3NH42S (aq) = Fe2S3 (s) + 3NH42SO4 (aq)Fe2(SO4)3(aq) + 3NH42S(aq) = Fe2S3(s) + 3NH42SO4(aq)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+Na2O=Fe2O3+Na2SO4+Na2O0FeS + Na2O = 0Fe2O3 + 0Na2SO4 + Na2O
FeS+Na2O=Fe2O3+Na2SO4+Na2O0FeS + Na2O = 0Fe2O3 + 0Na2SO4 + Na2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2S3+H2O+O2=Fe(OH)3+S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
Fe(NO3)3*9H2O+C2H6O2 =Fe3O4+N2 +H2O+CO230Fe(NO3)3*9H2O + 46C2H6O2 = 10Fe3O4 + 45N2 + 408H2O + 92CO2
Fe(NO3)3*9H2O+C2H6O2 =Fe3O4+N2 +H2O+CO230Fe(NO3)3*9H2O + 46C2H6O2 = 10Fe3O4 + 45N2 + 408H2O + 92CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + C = Fe + CO3Fe2O3 + C = 2Fe + CO3
F2 + NO2 + H2O =HNO3 + HFF2 + 2NO2 + 2H2O = 2HNO3 + 2HF
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2+Br2=FeBr3Fe2 + 3Br2 = 2FeBr3
Fe2O3+NaCl=FeCl3 + Na2OFe2O3 + 6NaCl = 2FeCl3 + 3Na2O
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeO(s)+O2(g)=Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeO(s)+O2(g)=Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe2(SO4)3 + NaOH = Fe(OH)3 + Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
Fe+S=Fe2S2Fe + S = Fe2S
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe+KMnO4+H2SO4=FeSO4+K2SO4+MnSO4+H2O5Fe + 2KMnO4 + 8H2SO4 = 5FeSO4 + K2SO4 + 2MnSO4 + 8H2O
FeCl3 + NH4OH =Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+H2OFe2O3 + 0KMnO4 + 3H2SO4 = Fe2(SO4)3 + 0MnSO4 + 0K2SO4 + 3H2O
Fe2O3+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+H2OFe2O3 + 0KMnO4 + 3H2SO4 = Fe2(SO4)3 + 0MnSO4 + 0K2SO4 + 3H2O
Fe(NO3)2+ZnSO4=Fe2(SO4)2+Zn(NO3)22Fe(NO3)2 + 2ZnSO4 = Fe2(SO4)2 + 2Zn(NO3)2
Fe(OH)2 + HCl = Fe + ClO3- + H20 + H+30Fe(OH)2 + 20HCl = 30Fe + 20ClO3- + 3H20 + 20H+
FeCl3 + 3NaOH = Fe (OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl2 + NaOH = Fe(OH)2 + 2NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2SO4=Fe2(SO4)3+SO2+H2O2Fe + 6H2SO4 = Fe2(SO4)3 + 3SO2 + 6H2O
Fe2O2+C=Fe+CO2Fe2O2 + C = 2Fe + CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(NO3)3*9H2O+H2O=Fe3O4+N2 +H2 -6Fe(NO3)3*9H2O + 100H2O = -2Fe3O4 - 9N2 + 46H2
Fe(NO3)3*9H2O+H2O=Fe3O4+N2 +H2 -6Fe(NO3)3*9H2O + 100H2O = -2Fe3O4 - 9N2 + 46H2
FeS+H2SO4=H2S+FeSO4FeS + H2SO4 = H2S + FeSO4
Fe(NO3)3*9H2O+H2O=Fe3O4+N2 +H2O0Fe(NO3)3*9H2O + H2O = 0Fe3O4 + 0N2 + H2O
Fe(NO3)3*9H2O+H2O=Fe3O4+N2 +H2O0Fe(NO3)3*9H2O + H2O = 0Fe3O4 + 0N2 + H2O
FeS + H2SO4 = Fe2(SO4)3 + SO2 + H2O2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O
FeS + HNO3 = Fe(NO3)3 + Fe2(SO4)3 + NO + H2O3FeS + 12HNO3 = Fe(NO3)3 + Fe2(SO4)3 + 9NO + 6H2O
FeS2 + HNO3 + HCl = FeCl3 + H2SO4 + NO + H2OFeS2 + 5HNO3 + 3HCl = FeCl3 + 2H2SO4 + 5NO + 2H2O
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 + NO2 + H2OFeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 15NO2 + 7H2O
FeS + KNO3 = KNO2 + Fe2O3 + SO32FeS + 9KNO3 = 9KNO2 + Fe2O3 + 2SO3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO+Al=Fe+Al2O33FeO + 2Al = 3Fe + Al2O3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeS2+HNO3=Fe2(SO4)3+SO2+H2O+NO22FeS2 + 28HNO3 = Fe2(SO4)3 + SO2 + 14H2O + 28NO2
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe2O3+C=CO2+Fe2Fe2O3 + 3C = 3CO2 + 4Fe
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(s) + O2(g) + H2O = Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(s)
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeCr2O4 + Na2CO3 + O2 = Na2CrO4 + 2Fe2O3 + 8CO24FeCr2O4 + 8Na2CO3 + 7O2 = 8Na2CrO4 + 2Fe2O3 + 8CO2
Fe + BrO3=FeBrO3Fe + BrO3 = FeBrO3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe3(Po4)2 + Sn3N4 = Fe3N2 + Sn3(Po4)42Fe3(Po4)2 + Sn3N4 = 2Fe3N2 + Sn3(Po4)4
Fe3(Po4)2 + Sn3N4 = Fe3N2 + Sn3(Po4)42Fe3(Po4)2 + Sn3N4 = 2Fe3N2 + Sn3(Po4)4
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeCl2+  H2O +  HCl =    FeCl3+  H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
FE + O2 = FE2 + O30FE + 3O2 = 0FE2 + 2O3
FeS+HCl= FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4+H2SO4 +HNO3=Fe2(SO4)3+NO+H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O4+HCl=FeCl2+FeCl3+H2OFe2O4 + 8HCl = -2FeCl2 + 4FeCl3 + 4H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(s)+H2O(g)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(s)+H2O(g)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(s) + O2(g) + H2O (l) = Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
FeS+O2+H2O= Fe2O3+H2SO44FeS + 9O2 + 4H2O = 2Fe2O3 + 4H2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+O2 (g) =Fe2 O3 (s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2(CO3)3 + HBr = FeBr3 + H2O + CO2Fe2(CO3)3 + 6HBr = 2FeBr3 + 3H2O + 3CO2
Fe + HNO3 = Fe(NO3)3 + NH4NO3 + H2O 8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3+NH4SCN = FeSCN + NH4Cl3FeCl3 + NH4SCN = FeSCN + NH4Cl3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+KNO3+H2SO4=Fe2(SO4)3+N2+K2SO4+H2O10Fe + 6KNO3 + 18H2SO4 = 5Fe2(SO4)3 + 3N2 + 3K2SO4 + 18H2O
Fe(s)+O2(g)+H2O= Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O = 2Fe(OH)2(s)
FeS + HNO3 = Fe(NO3)3 + NO + S + H2OFeS + 4HNO3 = Fe(NO3)3 + NO + S + 2H2O
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(s)
Fe+O2 = FeO2Fe + O2 = 2FeO
Fe+O2 = FeO2Fe + O2 = 2FeO
Fe (NO3)3 + Na2S = Fe2S3 + NaNO32Fe(NO3)3 + 3Na2S = Fe2S3 + 6NaNO3
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(SCN)3+KMnO4+HCl=FeCl3+KCl+MnCl2+CO2+NO+SO2+H2O5Fe(SCN)3 + 33KMnO4 + 114HCl = 5FeCl3 + 33KCl + 33MnCl2 + 15CO2 + 15NO + 15SO2 + 57H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2(CO3)3 +2HNO3 = Fe(NO3)3 + H2O + CO2Fe2(CO3)3 + 6HNO3 = 2Fe(NO3)3 + 3H2O + 3CO2
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3 + Be3(PO4)2 =BeCl2 +FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS+O2=Fe2+SO22FeS + 2O2 = Fe2 + 2SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2 O3 + CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2 O3 + CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO2=Fe+CO20Fe2O3 + CO2 = 0Fe + CO2
Fe(s) + H2O(g) =Fe3O4(s) + H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(s) + Cl2(g) =FeCl3(s) 2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe2 O3 + CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + C =CO2 + Fe 2Fe2O3 + 3C = 3CO2 + 4Fe
FeSO4+HBrO+HCl=FeCl3+H2SO4+HBr+H2O2FeSO4 + HBrO + 6HCl = 2FeCl3 + 2H2SO4 + HBr + H2O
FeSO4+KMnO4+H2SO4=KHSO4+MnSO4+Fe2(SO4)3+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 2KHSO4 + 2MnSO4 + 5Fe2(SO4)3 + 8H2O
Fe2+ = Fe3+ + e--6Fe2+ = -4Fe3+ + e-
Fe2+ = Fe3+ + e--6Fe2+ = -4Fe3+ + e-
Fe(SCN)3+KMnO4+HCl=FeCl3+KCl+MnCl2+CO2+NO+SO2+H2O5Fe(SCN)3 + 33KMnO4 + 114HCl = 5FeCl3 + 33KCl + 33MnCl2 + 15CO2 + 15NO + 15SO2 + 57H2O
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
FeSO4+KMnO4+H2SO4 = Fe2(SO4)3+MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeSO4+HNO3+H2SO4 = Fe2(SO4)3+NO+H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe++ +Cr2O7-- +H = Fe+++ + Cr+++ + H2O-8Fe++ + Cr2O7-- + 14H = -8Fe+++ + 2Cr+++ + 7H2O
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2O3 + C = CO2 + Fe 2Fe2O3 + 3C = 3CO2 + 4Fe
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+ SnCl4 = FeCl3 +SnCl22Fe + 3SnCl4 = 2FeCl3 + 3SnCl2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + CO= CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeSO4 + 7H2O+ MgO = Fe2O3 + MgSO4+ H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
Fe + CO2=Fe2O3 + C4Fe + 3CO2 = 2Fe2O3 + 3C
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+ H3O+= Fe2++H2+ H2O4Fe + 2H3O+ = 2Fe2+ + H2 + 2H2O
FeBr3 + K2S = FeS + K2Br3FeBr3 + K2S = FeS + K2Br3
Fe+O2=2FeO2Fe + O2 = 2FeO
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FE2+O3+C=FE+CO0FE2 + O3 + 3C = 0FE + 3CO
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeS2+O2=Fe2O3+SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 (s) + HNO3 (aq) = Fe(NO3)3 (aq) + H2O (l)Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3(aq) + 3H2O(l)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)2+O2=Fe(OH)3 +H2O -4Fe(OH)2 - O2 = -4Fe(OH)3 + 2H2O
Fe(OH)2+O2=Fe(OH) +H2O 4Fe(OH)2 - O2 = 4Fe(OH) + 2H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s) + H2O(l) = Fe3O4(s) + H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3+ +NO2- +H2O=Fe2+ +H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3 + O2 = FeO2Fe3 + 3O2 = 3FeO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeSO4 = Fe2O3 +SO2 + SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(OH)2 + KClO + H2SO4 = KCl + Fe2(SO4)3 + H2O2Fe(OH)2 + KClO + 3H2SO4 = KCl + Fe2(SO4)3 + 5H2O
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe + Br2 = 2FeBr32Fe + 3Br2 = 2FeBr3
Fe+HSO4=H2+Fe(SO4)32Fe + 6HSO4 = 3H2 + 2Fe(SO4)3
Fe + C2O = Fe2O3+C2Fe + 3C2O = Fe2O3 + 6C
Fe S + O2 = Fe2O3 + S4FeS + 3O2 = 2Fe2O3 + 4S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(s) + O2(g) = FeO3(s)2Fe(s) + 3O2(g) = 2FeO3(s)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2+ + NO3- + H+ = NO + H2O + Fe3+9Fe2+ - NO3- - 4H+ = -1NO - 2H2O + 6Fe3+
Fe + H Cl = Fe Cl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeSO4*7H2O+NH3=Fe(OH)3 + N2O3 + H2SO4 + H2O12FeSO4*7H2O - 2NH3 = 12Fe(OH)3 - N2O3 + 12H2SO4 + 51H2O
FeO + 3CO = CO2 + Fe22FeO + 2CO = 2CO2 + Fe2
FeO + 3CO = CO2 + Fe22FeO + 2CO = 2CO2 + Fe2
FeO + CO = CO2 + Fe22FeO + 2CO = 2CO2 + Fe2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + C= Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe (OH)3 =Fe2O3 +H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe +O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cu (NO3)2 = Fe (NO3)2 + CuFe + Cu(NO3)2 = Fe(NO3)2 + Cu
Fe + Cu (NO3)2 = Fe (NO3)2 + CuFe + Cu(NO3)2 = Fe(NO3)2 + Cu
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2 + CO = Fe3O4 + CO2-3Fe2 + 8CO = -2Fe3O4 + 8CO2
FeSO4 + Na2SO3P + KSCN = FeSO3 + K2SO4P + Na(SCN) FeSO4 + Na2SO3P + 2KSCN = FeSO3 + K2SO4P + 2Na(SCN)
FeSO4 + Na2SO3 + KSCN = FeSO3 + K2SO4 + Na(SCN) FeSO4 + Na2SO3 + 2KSCN = FeSO3 + K2SO4 + 2Na(SCN)
Fe(NO3)3*9H2O+C2H6O2=Fe3O4+CO2+H2O+N2 30Fe(NO3)3*9H2O + 46C2H6O2 = 10Fe3O4 + 92CO2 + 408H2O + 45N2
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeSO4 + 7H2O(s) + MgO(s) = Fe2O3(s) + MgSO4(s) + H2O(g)0FeSO4 + H2O(s) + 0MgO(s) = 0Fe2O3(s) + 0MgSO4(s) + H2O(g)
Fe + H2SO4 = Fe2(SO4)3 +H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+2HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3+ H2S= Fe2S3 + HCl 2FeCl3 + 3H2S = Fe2S3 + 6HCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4 + 7H2O+ MgO = Fe2O3 + MgSO4+ H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe +O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + Ga = FeGa + OFe2O3 + 2Ga = 2FeGa + 3O
FeO + Ga = FeGa + OFeO + Ga = FeGa + O
Fe2O3 + Ga = FeGa + O3Fe2O3 + 2Ga = 2FeGa + O3
Fe2O3 + Ga= Fe2Ga + O3Fe2O3 + Ga = Fe2Ga + O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2S3+KMnO4=K2S+Fe (MnO4)3Fe2S3 + 6KMnO4 = 3K2S + 2Fe(MnO4)3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2SO4 =FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe(s) +H2O = Fe3O4+H2(g)3Fe(s) + 4H2O = Fe3O4 + 4H2(g)
FeS2 + O2 = Fe2O3 + SO2 4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = CO2 + Fe Fe2O3 + 3CO = 3CO2 + 2Fe
FeSO4 = Fe2O3 +SO2 + SO32FeSO4 = Fe2O3 + SO2 + SO3
FeS2 = Fe3S4 + S2 3FeS2 = Fe3S4 + S2
Fe3+ + Zn2+ + NaBH4 + 24 H2O = FeZn + B(OH)3 + Na+ + H24Fe3+ + 6Zn2+ + 10NaBH4 + 30H2O = 12FeZn + 10B(OH)3 + 10Na+ + 35H2
FeCl3 + NaBH4 + H2O = Fe + NaCl + B(OH)3 + H22FeCl3 + 6NaBH4 + 18H2O = 2Fe + 6NaCl + 6B(OH)3 + 21H2
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + 3NaHCO3 = Fe(OH)3 + 3NaCl + 3CO2 FeCl3 + 3NaHCO3 = Fe(OH)3 + 3NaCl + 3CO2
FeS (s)+HCl (aq)=FeCl2 (aq)+H2S (g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3+AgNo3 = Fe(No3)3+AgClFeCl3 + 3AgNo3 = Fe(No3)3 + 3AgCl
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + Al = Fe2 + Al2O3Fe2O3 + 2Al = Fe2 + Al2O3
Fe2O3+Al=Fe2+Al2O3Fe2O3 + 2Al = Fe2 + Al2O3
Fe (s) + O2 (g) + H2O(l) = Fe (OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2+S + HCl = FeCl + H2SFe2 + S + 2HCl = 2FeCl + H2S
FeS2+CaO+H2O+O2=Fe(OH)3+CaSO4*2H2O4FeS2 + 8CaO + 22H2O + 15O2 = 4Fe(OH)3 + 8CaSO4*2H2O
FeS2+O2+H2O=Fe(OH)3+H2SO44FeS2 + 15O2 + 14H2O = 4Fe(OH)3 + 8H2SO4
FeS2 + CaO2 = CaSO4 + Fe2O3 + CaO 2FeS2 + 15CaO2 = 4CaSO4 + Fe2O3 + 11CaO
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3+ + NO2- + H2O = Fe2++ H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.