Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe2P + FeS2 = FeS + P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe2S + O2 = Fe2O3 + SO22Fe2S + 5O2 = 2Fe2O3 + 2SO2
FeCl2 + NH3 + H2O = Fe(OH)2 + NH4ClFeCl2 + 2NH3 + 2H2O = Fe(OH)2 + 2NH4Cl
FeCl2 + NH3 + H2O = Fe(OH)2 + NH4ClFeCl2 + 2NH3 + 2H2O = Fe(OH)2 + 2NH4Cl
Fe2P+FeS2=FeS+P4S104Fe2P + 18FeS2 = 26FeS + P4S10
FeCl3+H2S=Fe2S3+HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe(C2H3O2)3 +(NH4)2CO3=Fe2(CO3)3+NH4C2H3O22Fe(C2H3O2)3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4C2H3O2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
FeCl3 (s) + NH3 (g) + H2O (l) = Fe(OH)3 (s) + NH4Cl FeCl3(s) + 3NH3(g) + 3H2O(l) = Fe(OH)3(s) + 3NH4Cl
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3+H2S=Fe2S3+HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2 + H2O = Fe (OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeSO4=Fe2O3+SO2+O24FeSO4 = 2Fe2O3 + 4SO2 + O2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + Pb(NO3)2 = PbSO4 + Fe(NO3)2FeSO4 + Pb(NO3)2 = PbSO4 + Fe(NO3)2
FeS2 + O2 = Fe2SO3 + SO24FeS2 + 9O2 = 2Fe2SO3 + 6SO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe+O2+H20=Fe(OH)210Fe + 10O2 + H20 = 10Fe(OH)2
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3+Ca(OH)2=Fe(OH)3+CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl + NaHO = FeCl3 + NaHO0FeCl + NaHO = 0FeCl3 + NaHO
Fe2(CO3)3(s)=Fe2O3(s)+3CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(CO3)2 + H = Fe + H2O + CO2Fe2(CO3)2 + 4H = 2Fe + 2H2O + 2CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe2(CO3)2 + H3O = Fe + H2O + CO2Fe2(CO3)2 + 4H3O = 2Fe + 6H2O + 2CO2
Fe + O2 = Fe2O22Fe + O2 = Fe2O2
Fe + O2 = Fe2O22Fe + O2 = Fe2O2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe(SO4)3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
Fe 2 O 3 (s)+CO(g)=2Fe(s)+CO 2 (g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
FePO4 + Zn = Zn3(PO4)2 + Fe3(PO4)26FePO4 + 3Zn = Zn3(PO4)2 + 2Fe3(PO4)2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(OH)3+C3H5O3=Fe+C2H3O2+HCO32Fe(OH)3 - 15C3H5O3 = 2Fe - 24C2H3O2 + 3HCO3
Fe + ZnBr2 = FeBr + Zn2Fe + ZnBr2 = 2FeBr + Zn
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
Fe(OH)2 + NO2 = Fe3O4 + NO3 + H2O3Fe(OH)2 - NO2 = Fe3O4 - NO3 + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeC2O4*2H2O + H2C2O4 +H2O2 + K2C2O4 = K3(Fe(C2O4)3)*3H2O2FeC2O4*2H2O + H2C2O4 + H2O2 + 3K2C2O4 = 2K3(Fe(C2O4)3)*3H2O
Fe(NH4)2(SO4)2*6H2O + H2C2O4 = FeC2O4*2H2O + (NH4)2SO4 + H2SO4 + H2OFe(NH4)2(SO4)2*6H2O + H2C2O4 = FeC2O4*2H2O + (NH4)2SO4 + H2SO4 + 4H2O
FeI3 + Na2SO4 = Fe2(SO4)3 + NaI2FeI3 + 3Na2SO4 = Fe2(SO4)3 + 6NaI
Fe + 2H2O = Fe3O + 2H23Fe + H2O = Fe3O + H2
Fe + 2H2O = Fe2O + 2H22Fe + H2O = Fe2O + H2
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+H2O= Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g) FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe+3+ NH3 + H2O = Fe(OH)3 + NH4+Fe+3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4+
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe(OH)3(s) + KSCN = Fe(SCN)3 + KOH(aq)Fe(OH)3(s) + 3KSCN = Fe(SCN)3 + 3KOH(aq)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeBr3+Na=Fe+NaBrFeBr3 + 3Na = Fe + 3NaBr
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3+ H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(NO3)3+HPO4+HCl=FePO4+HNO3+ClPO4Fe(NO3)3 + 2HPO4 + HCl = FePO4 + 3HNO3 + ClPO4
FeBr3 + NH4OH = Fe(OH)3 + NH4BrFeBr3 + 3NH4OH = Fe(OH)3 + 3NH4Br
Fe + O2 + H2O = Fe(OH2)Fe + 0O2 + H2O = Fe(OH2)
Fe + O2 + H2O = Fe(OH2)Fe + 0O2 + H2O = Fe(OH2)
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)2 + H3PO4 = Fe3(PO4)2 + H2O3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
Fe2O3+H2O= Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+K2SO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS(s)+HCl(aq) = FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(SO4)3+(NH4)2CO3=Fe2(CO3)3+(NH4)2SO4Fe2(SO4)3 + 3(NH4)2CO3 = Fe2(CO3)3 + 3(NH4)2SO4
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(s)+CuSO4(aq)=Fe2(SO4)3(aq)+Cu(s)2Fe(s) + 3CuSO4(aq) = Fe2(SO4)3(aq) + 3Cu(s)
Fe(s)+CuSO4(aq)=Fe(SO4)3(aq)+Cu(s)Fe(s) + 3CuSO4(aq) = Fe(SO4)3(aq) + 3Cu(s)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O4 + C = Fe + COFe3O4 + 4C = 3Fe + 4CO
FeCl3 + H2S = Fe2S3 + HCl2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeI2 + Cl2 = FeCl3 + I22FeI2 + 3Cl2 = 2FeCl3 + 2I2
FeCl3+NaOH=3Fe(OH)3+3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=3Fe(OH)3+3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=3Fe(OH)3+3NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + NH3 + H2O = Fe(OH)3 + NH4Fe + 3NH3 + 3H2O = Fe(OH)3 + 3NH4
FeBr3+H2SO4=Fe2(SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe2SO4 = Fe2O3 + SO2 + SOFe2SO4 = Fe2O3 + 0SO2 + SO
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS+K2Cr2O7=Fe2O3+K2S+S+Cr2O42FeS + K2Cr2O7 = Fe2O3 + K2S + S + Cr2O4
FeS+K2Cr2O7=Fe2O3+K2SO4+S+Cr2O4-2FeS + 3K2Cr2O7 = -1Fe2O3 + 3K2SO4 - 5S + 3Cr2O4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FePO4 + Zn = Zn3(PO4)2 + Fe3(PO4)26FePO4 + 3Zn = Zn3(PO4)2 + 2Fe3(PO4)2
Fe2O3+CO= Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4(s)+CO(g)=Fe(s)+CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe3O4(s)+H2(g)=Fe(s)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe2O3(s) +HNO3(aq) = Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe3O4 + C = Fe + COFe3O4 + 4C = 3Fe + 4CO
FeS+HCl=FeCl+2HSFeS + HCl = FeCl + HS
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
FeS+K2Cr2O7=FeO+K2SO4+CrO2+SO3-1FeS - 2K2Cr2O7 = -1FeO - 2K2SO4 - 4CrO2 + SO3
FeS+K2Cr2O7=FeO+K2SO4+Cr2O4+SO3-1FeS - 2K2Cr2O7 = -1FeO - 2K2SO4 - 2Cr2O4 + SO3
FeS+K2Cr2O7=Fe2O3+K2SO4+Cr2O4+SO3-4FeS - 9K2Cr2O7 = -2Fe2O3 - 9K2SO4 - 9Cr2O4 + 5SO3
FeS+K2Cr2O7=Fe2O3+K2SO4+Cr2O4+O2-4FeS - 4K2Cr2O7 = -2Fe2O3 - 4K2SO4 - 4Cr2O4 + 5O2
FeS2+K2Cr2O7=Fe2O3+K2SO4+Cr2O4+O2-4FeS2 - 8K2Cr2O7 = -2Fe2O3 - 8K2SO4 - 8Cr2O4 + 7O2
FeS2+K2Cr2O7=Fe2O3+K2SO4+Cr2O4+SO2-2FeS2 - 11K2Cr2O7 = -1Fe2O3 - 11K2SO4 - 11Cr2O4 + 7SO2
Fe(s) + O2(g) = Fe2O34Fe(s) + 3O2(g) = 2Fe2O3
Fe(s) + O2(g) = Fe2O34Fe(s) + 3O2(g) = 2Fe2O3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3O4 + CO = FeO + CO2Fe3O4 + CO = 3FeO + CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O+H=Fe+H2OFe3O + 2H = 3Fe + H2O
Fe3+ +NO2- +H2O=Fe2+H+NO3-0Fe3+ + NO2- + H2O = 0Fe2 + 2H + NO3-
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
FeCl3 + CuSO4 = FeSO4 + CuCl3FeCl3 + CuSO4 = FeSO4 + CuCl3
FeCl3 + CoCl2 = FeCl2 + CoCl3FeCl3 + CoCl2 = FeCl2 + CoCl3
FeCl2 + 3NaOH = Fe(OH)2 + NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
FeCl2 + 3NaOH = Fe(OH)2 + 3NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
Fe + H2SO4 = Fe SO4+ H2Fe + H2SO4 = FeSO4 + H2
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS + O2 + H2O = Fe2O3 + H2SO44FeS + 9O2 + 4H2O = 2Fe2O3 + 4H2SO4
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3++NO2-+H2O=Fe2++H++NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+++ + NO2 + H2O = Fe++ + H+ +NO3-Fe+++ + NO2 + H2O = Fe++ + 2H+ + NO3-
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O3+C=Fe+CO22Fe3O3 + 3C = 6Fe + 3CO2
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe +O2 +H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(C2H3O2)3 + (NH4)2CO3 = Fe2(CO3)3 + NH4C2H3O22Fe(C2H3O2)3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4C2H3O2
Fe2O3(s) + C(s) = Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2+Cl=FeCl3FeCl2 + Cl = FeCl3
Fe+Br=FeBr3Fe + 3Br = FeBr3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+3C=Fe+3COFe2O3 + 3C = 2Fe + 3CO
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe3O4 + FeO = Fe2O3Fe3O4 - FeO = Fe2O3
Fe3O4 + FeO = Fe2O3Fe3O4 - FeO = Fe2O3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCr2O7+K2CO3+O2 = K2CrO4+Fe2O3+CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3O4 + CO = FeO + CO2Fe3O4 + CO = 3FeO + CO2
FeCl2+KMnO4+HCl=FeCl3+KCl+MnCl2+H2O5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + KCl + MnCl2 + 4H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
FeCl3+KOH=KCl+Fe(OH)3FeCl3 + 3KOH = 3KCl + Fe(OH)3
FeS + HCl = FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeO+CO=Fe=CO2FeO + CO = Fe + CO2
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeO3(s) + CO(g) = Fe(l) + CO2(g)FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(NO3)3+ NH4OH=Fe(OH)3+NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(s)+HCl(aq)=FeCl2(aq)+H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
Fe(s)+HCl(aq)=FeCl2(aq)+H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + H2S= Fe2S3+ H2OFe2O3 + 3H2S = Fe2S3 + 3H2O
Fe2S3=2FeS+SFe2S3 = 2FeS + S
Fe + H2SO4 = Fe2 (SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2+(SO4)3+Ba(NO3)2 = Fe(NO3)3+BaSO4Fe2 + (SO4)3 + 3Ba(NO3)2 = 2Fe(NO3)3 + 3BaSO4
Fe3+++ + CH3CH3CHCl+H2O = CO2 + Fe2+ + Cl- +H+12Fe3+++ + CH3CH3CHCl + 6H2O = 3CO2 + 18Fe2+ + Cl- + 19H+
Fe3+++ + CH3CH3CHCl+H2O = CO2 + Fe2+ + Cl- +OH--12Fe3+++ - CH3CH3CHCl + 13H2O = -3CO2 - 18Fe2+ - Cl- + 19OH-
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + 3O2 = 2Fe2O34Fe + 3O2 = 2Fe2O3
Fe + KSCN = Fe(SCN)3 + KFe + 3KSCN = Fe(SCN)3 + 3K
Fe + NH3 +H2O = Fe(OH)3 + NH4Fe + 3NH3 + 3H2O = Fe(OH)3 + 3NH4
Fe + NH3 +H2O = Fe(OH) + NH4Fe + NH3 + H2O = Fe(OH) + NH4
FeO + H2 = FeOH2FeO + H2 = FeOH2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3+KOH=Fe(OH)3+KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe3+++ + CH3CH3CHCl +OH- = CO2 + Fe2+ + Cl- +H2O 12Fe3+++ + CH3CH3CHCl + 19OH- = 3CO2 + 18Fe2+ + Cl- + 13H2O
Fe3+++ + CH3CH3CHCl+H2O = CO2 + Fe2+ + Cl- +OH--12Fe3+++ - CH3CH3CHCl + 13H2O = -3CO2 - 18Fe2+ - Cl- + 19OH-
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3+CO = Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+C= Fe+ CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3 + HBr = FeBr3 + H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
Fe(OH)2+K2CrO4+H2O=Fe(OH)3+KCr(OH)4+KOH3Fe(OH)2 + K2CrO4 + 4H2O = 3Fe(OH)3 + KCr(OH)4 + KOH
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe3+ + I1- = Fe2+ + I2-4Fe3+ + 2I1- = -6Fe2+ + I2
FeCO3(s)+H2CO3(aq)= Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe2O3(s)+HNO3(aq)= Fe(NO3)3(aq)+H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe3O4(s)+CO(g)= Fe(s)+CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe3O4(s)+H2(g)= Fe(s)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe2O4+H2= Fe+H2OFe2O4 + 4H2 = 2Fe + 4H2O
Fe + HNO3 = Fe(NO3)3 +NO + H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe+CO2=Fe2O3+CO2Fe + 3CO2 = Fe2O3 + 3CO
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe(C2H3O2)3 + (NH4)2CO3=Fe2(CO3)3+NH4C2H3O22Fe(C2H3O2)3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4C2H3O2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+Pb(C2H3O2)2=Fe(C2H3O2)2+PbFe + Pb(C2H3O2)2 = Fe(C2H3O2)2 + Pb
Fe+Pb(C2H3O2)2=Fe(C2H3O2)2+PbFe + Pb(C2H3O2)2 = Fe(C2H3O2)2 + Pb
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(NO3)2+KOH=Fe(OH)2+KNO3Fe(NO3)2 + 2KOH = Fe(OH)2 + 2KNO3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe3O4 + CO0Fe2O3 + CO = 0Fe3O4 + CO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(NO3)3 + NaOH = Fe(OH)3 + NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+CO=FeO+CO2Fe2O3 + CO = 2FeO + CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)3 + (NH4)2CO3 = Fe2(CO3)3 + NH4NO32Fe(NO3)3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4NO3
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe3+ + NO2 - H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2-H2O = -6Fe2+ + 2H+ + NO3-
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+ O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS2 + Cl2 = FeCl3 + 2S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3(aq) + Zn(s) = ZnCl(aq) + Fe(s)FeCl3(aq) + 3Zn(s) = 3ZnCl(aq) + Fe(s)
FeCl(aq) + Zn(s) = ZnCl(aq) + Fe(s)FeCl(aq) + Zn(s) = ZnCl(aq) + Fe(s)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCr2O7 + K2CO3 + O2 = K2CrO4 + Fe2O3 + CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeC2O4*2H2O + H2C2O4 + H2O2 + K2C2O4 = K3(Fe(C2O4)3)*3H2O2FeC2O4*2H2O + H2C2O4 + H2O2 + 3K2C2O4 = 2K3(Fe(C2O4)3)*3H2O
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCr2O4 + K2CO3 + O2 = K2CrO4 + Fe2O3 + CO24FeCr2O4 + 8K2CO3 + 7O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeS2+H2O=Fe2O3+SO3+H2SO40FeS2 + H2O = 0Fe2O3 - SO3 + H2SO4
Fe2O3 + CO =Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
FeS2+O2+H2O=Fe(OH)3+H2SO44FeS2 + 15O2 + 14H2O = 4Fe(OH)3 + 8H2SO4
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + H2SO4 = Fe2 (SO4)3+ H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeS2+H2O2=Fe2(SO4)3+H2SO4+H2O2FeS2 + 15H2O2 = Fe2(SO4)3 + H2SO4 + 14H2O
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
F2 + CH4 = CF4 + HF4F2 + CH4 = CF4 + 4HF
Fe + H+ = Fe+++ + H22Fe + 6H+ = 2Fe+++ + 3H2
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeCr2O4+Na2CO3+O2=Na2CrO4+2Fe2O3+8CO24FeCr2O4 + 8Na2CO3 + 7O2 = 8Na2CrO4 + 2Fe2O3 + 8CO2
FeCr24+Na2CO3+O2=Na2CrO4+2Fe2O3+8CO24FeCr24 + 96Na2CO3 + 147O2 = 96Na2CrO4 + 2Fe2O3 + 96CO2
FeCl2 + AgNO3 = Fe(NO3)2 + AgClFeCl2 + 2AgNO3 = Fe(NO3)2 + 2AgCl
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + HNO3 = Fe(NO3)3 + H22Fe + 6HNO3 = 2Fe(NO3)3 + 3H2
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + O = Fe2O32Fe + 3O = Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2P+FeS2=FeS +P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe2P+FeS2=Fe2S3 +P4S104Fe2P + 44FeS2 = 26Fe2S3 + P4S10
Fe2P+FeS2=Fe2S3 +P2S52Fe2P + 22FeS2 = 13Fe2S3 + P2S5
Fe2(SO4)3(aq) + 2Na3PO4(aq) = 2FePO4(s) + 3Na2SO4(aq)Fe2(SO4)3(aq) + 2Na3PO4(aq) = 2FePO4(s) + 3Na2SO4(aq)
Fe2P+FeS2=Fe2S3 +P2S52Fe2P + 22FeS2 = 13Fe2S3 + P2S5
Fe2P+FeS2=Fe2S3 +PS3Fe2P + 12FeS2 = 7Fe2S3 + PS3
Fe2P+FeS2=Fe2S3 +P3S93Fe2P + 36FeS2 = 21Fe2S3 + P3S9
Fe(III)+O2=Fe(III)O2Fe(III) + O2 = Fe(III)O2
Fe2P+FeS2=Fe2S3 +PFe2P + 6FeS2 = 4Fe2S3 + P
Fe+H2SO4 = (Fe)SO4+H2Fe + H2SO4 = (Fe)SO4 + H2
Fe(C2H3O2)3+ (NH4)2CO3 = Fe2(CO3)3 =NH4C2H3O22Fe(C2H3O2)3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4C2H3O2
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeCl+SnCl2=FeCl2+SnCl4-2FeCl + SnCl2 = -2FeCl2 + SnCl4
Fe + O = Fe OFe + O = FeO
FeCl3 + NaOH = FeOH + NaCl3FeCl3 + NaOH = FeOH + NaCl3
FeCl3 + NaOH = FeOH + NaCl3FeCl3 + NaOH = FeOH + NaCl3
Fe+++ + NO2- +H2O = Fe++ + H+ + NO3-2Fe+++ + NO2- + H2O = 2Fe++ + 2H+ + NO3-
FeCl3 + K4Fe(CN)6 = KCl + Fe4(Fe(CN)6)34FeCl3 + 3K4Fe(CN)6 = 12KCl + Fe4(Fe(CN)6)3
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl3*6H2O+NH3=Fe(OH)3+NH4Cl+H2OFeCl3*6H2O + 3NH3 = Fe(OH)3 + 3NH4Cl + 3H2O
Fe(NO3)3 = NO2 + Fe2O3 + O24Fe(NO3)3 = 12NO2 + 2Fe2O3 + 3O2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe(s) + CuCl2(aq) = FeCl2(aq) + Cu(s)Fe(s) + CuCl2(aq) = FeCl2(aq) + Cu(s)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + HBr = FeBr3 + H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeSO4 = Fe2O3 + SO2 + O24FeSO4 = 2Fe2O3 + 4SO2 + O2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeSO4 = Fe2O3 + SO2 + O24FeSO4 = 2Fe2O3 + 4SO2 + O2
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(NO3)2+2NaHCO3=Fe(HCO3)2+2NaNO3Fe(NO3)2 + 2NaHCO3 = Fe(HCO3)2 + 2NaNO3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe+Cu+2=Fe+3+Cu2Fe + 3Cu+2 = 2Fe+3 + 3Cu
Fe+Cu+2=Fe3++Cu6Fe + Cu+2 = 2Fe3+ + Cu
Fe + H2O = Fe3O4 +H23Fe + 4H2O = Fe3O4 + 4H2
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl2+KMnO4+KOH = Fe(OH)2 + MnO2+KClFeCl2 + 0KMnO4 + 2KOH = Fe(OH)2 + 0MnO2 + 2KCl
FeCl2+ KMnO4+ HCl= FeCl3+KCl+MnCl2+H2O5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + KCl + MnCl2 + 4H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O=FeOFe + O = FeO
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(SO4)3 + K2S = Fe2S3 + K2SO4Fe2(SO4)3 + 3K2S = Fe2S3 + 3K2SO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)2(s)+H3PO4(aq)=Fe3(PO4)2(aq)+H2O(l)3Fe(OH)2(s) + 2H3PO4(aq) = Fe3(PO4)2(aq) + 6H2O(l)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2 (SO4)3+ NaOH = Fe(OH)3 + Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + K2(SO4)10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + 8H2O + K2(SO4)
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2O=FeO+H2Fe + H2O = FeO + H2
Fe2P+FeS2=FeS+P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe(NO3)3 + LiOH= LiNO3 + Fe(OH)3Fe(NO3)3 + 3LiOH = 3LiNO3 + Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO(OH)+NaHCO3=FeOHCO3 + NaOHFeO(OH) + NaHCO3 = FeOHCO3 + NaOH
FeO(OH)+NaCO3=FeOCO3+NaOHFeO(OH) + NaCO3 = FeOCO3 + NaOH
FeCl2(aq)+(NH4)2S(aq) = FeS(s)+2NH4Cl(aq)FeCl2(aq) + (NH4)2S(aq) = FeS(s) + 2NH4Cl(aq)
FeCl2(aq)+(NH4)2S(aq) = FeS(s)+2NH4Cl(aq)FeCl2(aq) + (NH4)2S(aq) = FeS(s) + 2NH4Cl(aq)
Fe(OH)2+H3PO4=Fe3(PO4)2+H2O3Fe(OH)2 + 2H3PO4 = Fe3(PO4)2 + 6H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeC2O4*2H2O+O2=Fe2O3+H2O+CO24FeC2O4*2H2O + 3O2 = 2Fe2O3 + 8H2O + 8CO2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HCl = FeCl + H22Fe + 2HCl = 2FeCl + H2
Fe + HNO3 = Fe(NO3)2 + H2O + 2 NO 3Fe + 8HNO3 = 3Fe(NO3)2 + 4H2O + 2NO
FeCl3+NaNO3=FeNO3+NaCl3FeCl3 + NaNO3 = FeNO3 + NaCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeS2 + O2 = 5SO2 + FeO2FeS2 + 5O2 = 4SO2 + 2FeO
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+ O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
F e+2 + H+ + H2O2 = F e+3 + H2O2Fe+2 + 2H+ + H2O2 = 2Fe+3 + 2H2O
FeSO4+K2Cr2O7+H2SO4=Fe2(SO4)+K2SO4+Cr(SO4)3+H2O0FeSO4 + K2Cr2O7 + 7H2SO4 = 0Fe2(SO4) + K2SO4 + 2Cr(SO4)3 + 7H2O
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(SCN)6+ NaOH = Fe(OH) + Na + SCNFe(SCN)6 + NaOH = Fe(OH) + Na + 6SCN
Fe(SCN)6+ NaOH = Fe(OH) + 3Na + SCNFe(SCN)6 + NaOH = Fe(OH) + Na + 6SCN
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+3BaCl2=BaO+FeCl3Fe2O3 + 3BaCl2 = 3BaO + 2FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(SCN)6+FeCl3 = Fe(SCN) + ClFe(SCN)6 + 5FeCl3 = 6Fe(SCN) + 15Cl
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeSO4+K2Cr2O7+H2S04=Fe2(SO4)3+Cr2(SO4)3+H2O+K2SO4-80FeSO4 + 17K2Cr2O7 + 7H2S04 = -40Fe2(SO4)3 + 17Cr2(SO4)3 + 7H2O + 17K2SO4
Fe+6SCN=Fe(SCN)6Fe + 6SCN = Fe(SCN)6
Fe+6SCN=Fe(SCN)6Fe + 6SCN = Fe(SCN)6
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeSO4+K2Cr2O7+H2S04=Fe2(SO4)3+Cr2(SO4)3+H2O+K2SO4-80FeSO4 + 17K2Cr2O7 + 7H2S04 = -40Fe2(SO4)3 + 17Cr2(SO4)3 + 7H2O + 17K2SO4
FeCl3 + Na2CO3 = Fe2C3O9 + NaCl2FeCl3 + 3Na2CO3 = Fe2C3O9 + 6NaCl
Fe(NH4)(SO4)2 * 12H2O + KI = I2 + K2SO4 + Fe(NH4)(SO4) + H2O Fe(NH4)(SO4)2*12H2O + 2KI = I2 + K2SO4 + Fe(NH4)(SO4) + 12H2O
Fe2P + FeS2 = FeS + P2S52Fe2P + 9FeS2 = 13FeS + P2S5
FeO+ O2=Fe2O34FeO + O2 = 2Fe2O3
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2(SO4)3 + Zn = 2Fe(SO4) + Zn(SO4)Fe2(SO4)3 + Zn = 2Fe(SO4) + Zn(SO4)
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe2O3+CO=Fe3O+CO23Fe2O3 + 7CO = 2Fe3O + 7CO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2(CO3)3 = Fe2O3 + CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl 3 + NH 4 OH = Fe(OH) 3 + NH 4 ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + HCl = FeCl 3 + H 22Fe + 6HCl = 2FeCl3 + 3H2
Fe + H Br = Fe Br 3 + H 22Fe + 6HBr = 2FeBr3 + 3H2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH) 3 (s)+H 2 SO 4 (aq)=Fe 2 (SO 4 ) 3 (aq)+H 2 O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2O3(s) +CO(g) = 2Fe(s) +CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s) + CO(g) = 2 Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
FeO+Al=Al2O3+Fe3FeO + 2Al = Al2O3 + 3Fe
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeSO4+AgNO3 = Fe(NO3)+Ag (SO4)FeSO4 + AgNO3 = Fe(NO3) + Ag(SO4)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe++ + NO3- + H+ = Fe+++ + H2O + NO3Fe++ + NO3- + 4H+ = 3Fe+++ + 2H2O + NO
Fe2+ + NO3- + H+ = Fe3+ + H2O + NO-9Fe2+ + NO3- + 4H+ = -6Fe3+ + 2H2O + NO
FeCl3 + K3PO4 = FePO4 + 3KCl FeCl3 + K3PO4 = FePO4 + 3KCl
Fe2O3 +Al = Fe + AlO3Fe2O3 + Al = 2Fe + AlO3
Fe2O3 +C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O +C=Fe+CO22Fe2O + C = 4Fe + CO2
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
FeCl3+Ca(OH)2=Fe(OH)3+CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2P+FeS2=FeS+P2S52Fe2P + 9FeS2 = 13FeS + P2S5
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(NO3)3 + LiOH= LiNO3 + Fe(OH)3Fe(NO3)3 + 3LiOH = 3LiNO3 + Fe(OH)3
Fe(NO3)3(aq) + LiOH(aq)= LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe2O3 + 3H2O = 3H+ + 2Fe3+ + 3OH-0Fe2O3 + H2O = H+ + 0Fe3+ + OH-
Fe3O4 +KMnO4 = Fe2O3 + MnO2 + K4Fe3O4 + KMnO4 = 6Fe2O3 + MnO2 + K
FeSO4+NaCl=FeCl+NaSO4FeSO4 + NaCl = FeCl + NaSO4
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(s)+HgSO4(aq)=FeSO4(aq)+Hg(s)Fe(s) + HgSO4(aq) = FeSO4(aq) + Hg(s)
Fe(ClO3)3 = FeCl3 +O22Fe(ClO3)3 = 2FeCl3 + 9O2
FeI3+Cl2= FeCl3+I22FeI3 + 3Cl2 = 2FeCl3 + 3I2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(OH)3(s) + H2SO4(aq)=Fe2 (SO4)3(s) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(s) + 6H2O(l)
Fe2O3 + CO =Fe + CO0Fe2O3 + CO = 0Fe + CO
Fe2O3 + CO =Fe + CO0Fe2O3 + CO = 0Fe + CO
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCr2O4 + K2CO3+O2 = K2CrO4 + Fe2O3+CO24FeCr2O4 + 8K2CO3 + 7O2 = 8K2CrO4 + 2Fe2O3 + 8CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.