Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeBr2 + (NH4)2CO3 = FeCO3 + 2NH4BrFeBr2 + (NH4)2CO3 = FeCO3 + 2NH4Br
FeBr2 + (NH4)2CO3 = FeCO3 + 2NH4BrFeBr2 + (NH4)2CO3 = FeCO3 + 2NH4Br
FeBr2(aq) + (NH4)2CO3 (aq) = FeCO3 (s) + 2NH4Br(aq)FeBr2(aq) + (NH4)2CO3(aq) = FeCO3(s) + 2NH4Br(aq)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe (NO3) 3 * 9H2O + NH4OH = Fe (NO3) 3 + 2NO + H2OFe(NO3)3*9H2O + 0NH4OH = Fe(NO3)3 + 0NO + 9H2O
FeCl3 + Mg(OH)2 = Fe(OH)3 + MgCl2 2FeCl3 + 3Mg(OH)2 = 2Fe(OH)3 + 3MgCl2
FeCl3 + Mg(OH)2 = Fe(OH)3 + MgCl2 2FeCl3 + 3Mg(OH)2 = 2Fe(OH)3 + 3MgCl2
Fe(NO3)3=Fe2O3+NO2+O24Fe(NO3)3 = 2Fe2O3 + 12NO2 + 3O2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(C2H3O2)3+Ba(OH)2=Fe(OH)3=Ba(C2H3O2)22Fe(C2H3O2)3 + 3Ba(OH)2 = 2Fe(OH)3 + 3Ba(C2H3O2)2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe + S = Fe2S32Fe + 3S = Fe2S3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3* 9H2O + 2HNO3 = Fe(NO3)3 + 2NO + H2OFe(NO3)3*9H2O + 0HNO3 = Fe(NO3)3 + 0NO + 9H2O
Fe(NO3)3* 9H2O + HNO3 = Fe(NO3)3 + NO + H2OFe(NO3)3*9H2O + 0HNO3 = Fe(NO3)3 + 0NO + 9H2O
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
Fe2+ + O2 + H20 = FeOH2 + O20Fe2+ + O2 + 0H20 = 0FeOH2 + O2
Fe2 + O2 + H20 = FeOH25Fe2 + 5O2 + H20 = 10FeOH2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2(SO4)3 + BaCl2 = FeCl3 + BaSO4Fe2(SO4)3 + 3BaCl2 = 2FeCl3 + 3BaSO4
FeCl2 + AgNO3 = Fe(NO3)2 + AgClFeCl2 + 2AgNO3 = Fe(NO3)2 + 2AgCl
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeAsS+O2+H2O=FeSO4+H3AsO34FeAsS + 11O2 + 6H2O = 4FeSO4 + 4H3AsO3
Fe(s) + H2SO4(aq) = FeSO4(aq) + H2(g)Fe(s) + H2SO4(aq) = FeSO4(aq) + H2(g)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe2O3(s) + CO(g) = 2FeO + CO2(g) Fe2O3(s) + CO(g) = 2FeO + CO2(g)
Fe2O3(s) + CO(g) = 2FeO + CO2(g) Fe2O3(s) + CO(g) = 2FeO + CO2(g)
Fe(OH)2 + CrO4-- = Fe2O3 + Cr(OH)4- + H2O + OH-6Fe(OH)2 + 2CrO4-- = 3Fe2O3 + 2Cr(OH)4- + H2O + 2OH-
Fe3Cl2 + NaOH=Fe3OH+NaCl2Fe3Cl2 + NaOH = Fe3OH + NaCl2
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
FeSO4=FeO3+SO2+SO3-1FeSO4 = -1FeO3 - 2SO2 + SO3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+H2=2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2=2Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe + Cl=FeCl2Fe + 2Cl = FeCl2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(NO3)3 + K2SO4 = Fe2(SO4)3 + KNO32Fe(NO3)3 + 3K2SO4 = Fe2(SO4)3 + 6KNO3
FeS + O2 + H2O = Fe2O3 + H2SO44FeS + 9O2 + 4H2O = 2Fe2O3 + 4H2SO4
FeCl2 (aq) + Li3PO4 (aq) = LiCl (aq) + Fe3(PO4)2 (aq)3FeCl2(aq) + 2Li3PO4(aq) = 6LiCl(aq) + Fe3(PO4)2(aq)
FeCl2 (aq) + Li3PO4 (aq) = LiCl (aq) + Fe3(PO4)2 (aq)3FeCl2(aq) + 2Li3PO4(aq) = 6LiCl(aq) + Fe3(PO4)2(aq)
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + Li2CO3 = LiCl + Fe2(CO3)32FeCl3 + 3Li2CO3 = 6LiCl + Fe2(CO3)3
Fe+O=FeOFe + O = FeO
F+H2O=O2+HF4F + 2H2O = O2 + 4HF
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeS + 2HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=FeO32Fe + 3O2 = 2FeO3
FeCl2 + KNO3 + HCl = FeCl3 + NO + H2O + KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
FeSO4+NH4OH=Fe(OH)2+(NH4)2SO4 FeSO4 + 2NH4OH = Fe(OH)2 + (NH4)2SO4
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe3++NO2-+H2O=Fe2++H++NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3++NO2-+H2O=Fe2++2H++2NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3++NO2-+H2O=Fe2++2H++2NO2-0Fe3+ + NO2- + 0H2O = 0Fe2+ + 0H+ + NO2-
FE + Cl2 = FECl32FE + 3Cl2 = 2FECl3
FE + Cl2 = FECl32FE + 3Cl2 = 2FECl3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
FeS2 + O2 = Fe2O + SO24FeS2 + 9O2 = 2Fe2O + 8SO2
FeS2 + O3 = Fe2O + SO22FeS2 + 3O3 = Fe2O + 4SO2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeS2 + H2SO4 + H2O2 = Fe2(SO4)3 + H2O2FeS2 - H2SO4 + 15H2O2 = Fe2(SO4)3 + 14H2O
Fe2S + H2O2 = Fe2(SO4)3 + H2SO4 + H2OFe2S + 6H2O2 = Fe2(SO4)3 - 2H2SO4 + 8H2O
Fe2S + H2O2 + H2O = Fe2(SO4)3 + H2SO4 -1Fe2S - 6H2O2 + 8H2O = -1Fe2(SO4)3 + 2H2SO4
Fe2S+H2O2 = Fe2(SO4)3 + H2SO4 + H2OFe2S + 6H2O2 = Fe2(SO4)3 - 2H2SO4 + 8H2O
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + O2= Fe3O46Fe2O3 - O2 = 4Fe3O4
FeSO4 + KCl = FeCl2 + K2SO4FeSO4 + 2KCl = FeCl2 + K2SO4
Fe+Cl2=Fe++++Cl-2Fe + 3Cl2 = 2Fe+++ + 6Cl-
Fe + H2O = Fe3O4 + H2O0Fe + H2O = 0Fe3O4 + H2O
FeS2 + O3 = Fe2O + SO22FeS2 + 3O3 = Fe2O + 4SO2
Fe+4H2O=Fe2O4+4H22Fe + 4H2O = Fe2O4 + 4H2
Fe+Br2=Fe+++Br-Fe + Br2 = Fe++ + 2Br-
FeS + 2HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(s) + H2SO4 (aq) = FeSO4 (aq) + H2 (g)Fe(s) + H2SO4(aq) = FeSO4(aq) + H2(g)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + 3H2O = Fe3O4 + H2O0Fe + H2O = 0Fe3O4 + H2O
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + HNO3 = Fe(NO3)3 + NO + H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe(ClO4)2(aq)+Na2S(aq)=FeS(s)+2NaClO4(aq)Fe(ClO4)2(aq) + Na2S(aq) = FeS(s) + 2NaClO4(aq)
Fe(ClO4)2(aq)+Na2S(aq)=FeS(s)+2NaClO4(aq)Fe(ClO4)2(aq) + Na2S(aq) = FeS(s) + 2NaClO4(aq)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2(aq)+KMnO4(aq)+HCl(aq)=FeCl3(aq)+MnCl2(aq)+H2O(l)+KCl(aq)5FeCl2(aq) + KMnO4(aq) + 8HCl(aq) = 5FeCl3(aq) + MnCl2(aq) + 4H2O(l) + KCl(aq)
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
FeSO4+NH4CH3COO=(NH4)2SO4+Fe(CH3COO)2FeSO4 + 2NH4CH3COO = (NH4)2SO4 + Fe(CH3COO)2
Fe2+ + Fe3+ + H2O = FeO(OH) + H2O0Fe2+ + 0Fe3+ + H2O = 0FeO(OH) + H2O
Fe + O2 = FeO2Fe + O2 = 2FeO
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
F2 + KBr = KF + Br2F2 + 2KBr = 2KF + Br2
Fe(s) + H2SO4(aq) =Fe2(SO4)3(aq) + SO2(g) + H2O(l)2Fe(s) + 6H2SO4(aq) = Fe2(SO4)3(aq) + 3SO2(g) + 6H2O(l)
Fe2O3 + CO =Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl2+K3PO4=Fe3(PO4)2+KCl3FeCl2 + 2K3PO4 = Fe3(PO4)2 + 6KCl
FeI3+(NH4)2CO3=Fe2(CO3)3+NH4I2FeI3 + 3(NH4)2CO3 = Fe2(CO3)3 + 6NH4I
F2 + AlCl3=AlF3 + Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeCl2 + Na2SiO3=NaCl + FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe+H2O=Fe3O2+H3Fe + 2H2O = Fe3O2 + 4H
FeBr2 + Br2 = FeBr32FeBr2 + Br2 = 2FeBr3
FeBr2 + Br2 = FeBr32FeBr2 + Br2 = 2FeBr3
Fe3O3(s)+3H2(g)=Fe+H2OFe3O3(s) + 3H2(g) = 3Fe + 3H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
F2 +LiCl = LiF +Cl2F2 + 2LiCl = 2LiF + Cl2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+Ba(OH)2= BaSO4+Fe(OH)3Fe2(SO4)3 + 3Ba(OH)2 = 3BaSO4 + 2Fe(OH)3
F2+HCl=Cl2+HFF2 + 2HCl = Cl2 + 2HF
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
F2 + NaCl = NaF + Cl2F2 + 2NaCl = 2NaF + Cl2
F2 + NaCl = NaF + Cl2F2 + 2NaCl = 2NaF + Cl2
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe(NO3)3(aq) + LiOH(aq) = LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe(NO3)3(aq) + LiOH(aq) = LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
Fe(NO3)3(aq) + LiOH(aq) = LiNO3(aq) + Fe(OH)3(s)Fe(NO3)3(aq) + 3LiOH(aq) = 3LiNO3(aq) + Fe(OH)3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s) +S(s)=Fe2S3(s)2Fe(s) + 3S(s) = Fe2S3(s)
Fe(s) +S(s)=Fe2S3(s)2Fe(s) + 3S(s) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2(g)=Fe2 O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2 O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2 O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe (s) =Fe (l)Fe(s) = Fe(l)
FeSO4+KMnO4+H2SO4 = Fe(SO4)3+KHSO4+MnSO4+H2O5FeSO4 + 4KMnO4 + 18H2SO4 = 5Fe(SO4)3 + 4KHSO4 + 4MnSO4 + 16H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2+2LiCl=2LiF+Cl2F2 + 2LiCl = 2LiF + Cl2
FeO4 + Al = Al2O3 + Fe3FeO4 + 8Al = 4Al2O3 + 3Fe
FeC2O4= Fe2O3 + CO + CO22FeC2O4 = Fe2O3 + 3CO + CO2
FeCl3 + NO2 + H2O = Fe + HNO3 + HClFeCl3 + 3NO2 + 3H2O = Fe + 3HNO3 + 3HCl
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
FeCl3+Na2SO3=NaCl+Fe2(SO3)32FeCl3 + 3Na2SO3 = 6NaCl + Fe2(SO3)3
FeO + H2SO4 = Fe2(SO4)3 + SO2 + H2O2FeO + 4H2SO4 = Fe2(SO4)3 + SO2 + 4H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3+6H2= 4Fe + 6H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + H2So4 = Fe2(So4)3 + H22Fe + 3H2So4 = Fe2(So4)3 + 3H2
Fe + H2So4 = Fe2(So4)3 + H22Fe + 3H2So4 = Fe2(So4)3 + 3H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2(SO4)3+Ba(OH)2=Fe2(OH)3+Ba(SO4)22Fe2(SO4)3 + 3Ba(OH)2 = 2Fe2(OH)3 + 3Ba(SO4)2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+O=Fe2O32Fe + 3O = Fe2O3
FeCl3 + Cs3PO4 = FePO4 + 3CsClFeCl3 + Cs3PO4 = FePO4 + 3CsCl
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe +KMnO4 +H30 = Fe3O4 +KOH + Mn135Fe + 60KMnO4 + 2H30 = 45Fe3O4 + 60KOH + 60Mn
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FECL+KPO4=FEPO4+KCLFECL + KPO4 = FEPO4 + KCL
FECL+ CUSO4=FESO4+CUCLFECL + CUSO4 = FESO4 + CUCL
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3+NaOH=FeOH+Cl3NaFeCl3 + NaOH = FeOH + Cl3Na
FeS2 + 11O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe(OH)2 + HCl = FeCl2 + H2OFe(OH)2 + 2HCl = FeCl2 + 2H2O
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2 + KNO3 + HCl = FeCl3 + NO + H2O + KClFe2 + 2KNO3 + 8HCl = 2FeCl3 + 2NO + 4H2O + 2KCl
Fe2 + KNO3 + HCl = FeCl3 + NO + H2O + KClFe2 + 2KNO3 + 8HCl = 2FeCl3 + 2NO + 4H2O + 2KCl
FeCl2 + KNO3 + HCl = FeCl3 + NO + H2O + KCl3FeCl2 + KNO3 + 4HCl = 3FeCl3 + NO + 2H2O + KCl
Fe2 + KNO3 + HCl = FeCl3 + NO + H2O + KClFe2 + 2KNO3 + 8HCl = 2FeCl3 + 2NO + 4H2O + 2KCl
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe+AgNO3=Ag+Fe(NO3)3Fe + 3AgNO3 = 3Ag + Fe(NO3)3
FeSO4=Fe2O3+SO2+O24FeSO4 = 2Fe2O3 + 4SO2 + O2
FeO+C=Fe+CO22FeO + C = 2Fe + CO2
FeCl2 + 2HCl + H2O2 = FeCl3 + H2O2FeCl2 + 2HCl + H2O2 = 2FeCl3 + 2H2O
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2 = FeO2Fe + O2 = 2FeO
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
FeCl3 + CuSO4 = Fe2(SO4)3 + CuCl22FeCl3 + 3CuSO4 = Fe2(SO4)3 + 3CuCl2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS +O2 =Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeSO4= FeO3+SO2+SO3 -1FeSO4 = -1FeO3 - 2SO2 + SO3
FeSO4= FeO3+SO2+SO3 -1FeSO4 = -1FeO3 - 2SO2 + SO3
FeCl2 +Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe + H2O=Fe3O4 + H2 3Fe + 4H2O = Fe3O4 + 4H2
FeS3 + NO3- + H+ = Fe3+ + SO4-- + NO + H2O9FeS3 + 55NO3- + 4H+ = 3Fe3+ + 27SO4-- + 55NO + 2H2O
FeS2 + 11O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeO(s) = Fe(s) + O2(g)2FeO(s) = 2Fe(s) + O2(g)
FeSo4+HNo3=No2+H2So4+FeFeSo4 + 2HNo3 = 3No2 + H2So4 + Fe
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2+Na2SiO3=NaCl+FeSiO3FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
FeS+H2SO4=Fe2(SO4)3+SO2+H2O2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2S04=Fe2(S04)3+H22Fe + 3H2S04 = Fe2(S04)3 + 3H2
Fe (s) + H2 S O4 (l) = Fe2 (SO4)3 (s) + H2(g)2Fe(s) + 3H2SO4(l) = Fe2(SO4)3(s) + 3H2(g)
Fe2O3+2Al=Al2O3+2FeFe2O3 + 2Al = Al2O3 + 2Fe
FeCl2(aq) + Ag3PO4(aq) = Fe3(PO4)2(aq) + AgCl(s)3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe(OH)3(s) + H2O2(l) = Fe2O3(s) + H2O(l)2Fe(OH)3(s) + 0H2O2(l) = Fe2O3(s) + 3H2O(l)
FeO + PdF2 = FeF2 + PdOFeO + PdF2 = FeF2 + PdO
F2 + RbI = RbF + I2F2 + 2RbI = 2RbF + I2
F2(g) + RbI(aq) = RbF(aq) + I2 (g)F2(g) + 2RbI(aq) = 2RbF(aq) + I2(g)
F2(g) + RbI(aq) = RbF(aq) + I2 (g)F2(g) + 2RbI(aq) = 2RbF(aq) + I2(g)
Fe(NO3)2 + Na3CO3= Fe3(CO3)2 + NaNO33Fe(NO3)2 + 2Na3CO3 = Fe3(CO3)2 + 6NaNO3
FeCl3+ 3H2O= Fe(OH)3+ 3HClFeCl3 + 3H2O = Fe(OH)3 + 3HCl
FeS + H2SO4 = FeSO4 + H2SFeS + H2SO4 = FeSO4 + H2S
Fe(OH)3+ H3PO4= FePO4+ H2OFe(OH)3 + H3PO4 = FePO4 + 3H2O
FeS + HCl= FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + Br2 = FeBr2Fe + Br2 = FeBr2
Fe+H2So4=Fe3(So4)2+H23Fe + 2H2So4 = Fe3(So4)2 + 2H2
Fe(s) + O2(g) = Fe2O3(g)4Fe(s) + 3O2(g) = 2Fe2O3(g)
Fe+3 + NO2 - + H2O = Fe2+ + H+ + NO3-4Fe+3 + 5NO2- + 5H2O = 2Fe2+ + 10H+ + 5NO3-
Fe3 + O2 = Fe2O34Fe3 + 9O2 = 6Fe2O3
Fe2O3 +H2O = Fe + H2O0Fe2O3 + H2O = 0Fe + H2O
FeCl3+Na2S=Fe2S3+NaCl2FeCl3 + 3Na2S = Fe2S3 + 6NaCl
Fe2O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 + HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe3O4(s)+H2(g) =Fe(s)+H2O(l)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(l)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCr2O4 + 7 KClO3 + 12 K2CO3 = 3 Fe2O3 + 12 K2CrO4 + 7 KCl + 12 CO26FeCr2O4 + 7KClO3 + 12K2CO3 = 3Fe2O3 + 12K2CrO4 + 7KCl + 12CO2
FeCr2O7+K2CO3+O2=K2CrO4+Fe2O3+CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
FeCl2 + Cl2 =FeCl32FeCl2 + Cl2 = 2FeCl3
Fe + O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 = Fe + O2Fe3O4 = 3Fe + 2O2
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeI3 + Ag(C2H3O2) = Fe(C2H3O2) + AgI3FeI3 + Ag(C2H3O2) = Fe(C2H3O2) + AgI3
Fe+O2 = FeO2Fe + O2 = 2FeO
Fe+O = FeOFe + O = FeO
Fe+O = Fe(O2)2Fe + 4O = Fe(O2)2
Fe2S3 +6H2O = 2Fe(OH)3+3H2SFe2S3 + 6H2O = 2Fe(OH)3 + 3H2S
FeCl3+H2S=FeCl2+HCl+S2FeCl3 + H2S = 2FeCl2 + 2HCl + S
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl2 + FeCl3 + NH4OH + H2O = Fe3O4 + NH4Cl FeCl2 + 2FeCl3 + 8NH4OH - 4H2O = Fe3O4 + 8NH4Cl
FeCl2 + FeCl3 + NH4OH + H2O = Fe3O4 + NH4Cl FeCl2 + 2FeCl3 + 8NH4OH - 4H2O = Fe3O4 + 8NH4Cl
FeCl2 + FeCl3 + NH4OH + H2O = Fe3O4 + NH4Cl FeCl2 + 2FeCl3 + 8NH4OH - 4H2O = Fe3O4 + 8NH4Cl
FeCl2 + FeCl3 + NH4OH+H2O = Fe3O4 + NH4Cl FeCl2 + 2FeCl3 + 8NH4OH - 4H2O = Fe3O4 + 8NH4Cl
FeCl2 + FeCl3 + NH4OH = Fe3O4 + NH4Cl +H2OFeCl2 + 2FeCl3 + 8NH4OH = Fe3O4 + 8NH4Cl + 4H2O
FeS + HNO3 + H2O = Fe(NO3)3 + Fe2(SO4)3 + NH4NO324FeS + 78HNO3 + 15H2O = 8Fe(NO3)3 + 8Fe2(SO4)3 + 27NH4NO3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe++ +MnO4- + H+ = Fe+++ + Mn++ + H2O5Fe++ + MnO4- + 8H+ = 5Fe+++ + Mn++ + 4H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe + SnCl4 = FeCl3 + SnCl22Fe + 3SnCl4 = 2FeCl3 + 3SnCl2
Fe+O2=2FeO2Fe + O2 = 2FeO
FECL2 + H2O + HCL = FECL3 + H2O0FECL2 + H2O + 0HCL = 0FECL3 + H2O
Fe + H2O = Fe3O4 +H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3(l) + CO(g) = Fe(l) + CO2(g) Fe2O3(l) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(SO4)3+Fe=FeSO4Fe(SO4)3 + 2Fe = 3FeSO4
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe3(PO4)2=Fe+P+OFe3(PO4)2 = 3Fe + 2P + 8O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + H2SO4 = Fe2(SO4)3 + HCl2FeCl3 + 3H2SO4 = Fe2(SO4)3 + 6HCl
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + Br = FeBrFe + Br = FeBr
Fe+S8=FeS8Fe + S8 = 8FeS
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe2O3 + 3Mg = 3MgO + 2Fe Fe2O3 + 3Mg = 3MgO + 2Fe
Fe(OH)3 + H3O +3 NO3 = Fe NO3 + H20-10Fe(OH)3 + 30H3O - 10NO3 = -10FeNO3 + 3H20
FeCl2+Na2SiO3=NaCl+FeSiO3 FeCl2 + Na2SiO3 = 2NaCl + FeSiO3
Fe+HNO3=Fe(NO3)3+NO2+H2OFe + 6HNO3 = Fe(NO3)3 + 3NO2 + 3H2O
Fe(s)+H2O=Fe2O3(s)+H2(g)2Fe(s) + 3H2O = Fe2O3(s) + 3H2(g)
Fe+S8=FeS8Fe + S8 = 8FeS
Fe + HClO2 = Fe(ClO2)3 + HFe + 3HClO2 = Fe(ClO2)3 + 3H
F2+ FeBr3= Br3F+ FeF2 + 2FeBr3 = 2Br3F + 2Fe
F2+ FeBr3= BrF+ Fe3F2 + 2FeBr3 = 6BrF + 2Fe
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
F2 + 2KBr = Br + KFF2 + 2KBr = 2Br + 2KF
FeCl3 + K2CrO4 = Fe2(CrO4)3 + 6KCl2FeCl3 + 3K2CrO4 = Fe2(CrO4)3 + 6KCl
FeCl3 + NaOH= Fe(OH)3 +NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + (NH4)2S= Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 + HCl = FeCl3 + H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
Fe(OH)2 + HCl = FeCl2 + H2OFe(OH)2 + 2HCl = FeCl2 + 2H2O
Fe(OH)2 + HCl = FeCl2 + H2OFe(OH)2 + 2HCl = FeCl2 + 2H2O
Fe(OH)2 + HCl = FeCl2 + H2OFe(OH)2 + 2HCl = FeCl2 + 2H2O
Fe2(SO4)3+Zn=FeSO4+ZnSO4Fe2(SO4)3 + Zn = 2FeSO4 + ZnSO4
Fe2O3+3CO = 3Fe+ 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+ 3CO = 2Fe+ 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + C = Fe+ CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(NO3)3+K(OH) = K(NO3)+ Fe(OH)3Fe(NO3)3 + 3K(OH) = 3K(NO3) + Fe(OH)3
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s)+HNO3(aq)=Fe(NO3)3(aq)+NO2(g)+H2O(l)Fe(s) + 6HNO3(aq) = Fe(NO3)3(aq) + 3NO2(g) + 3H2O(l)
FeO + HNO3= Fe(NO3)2 + H2OFeO + 2HNO3 = Fe(NO3)2 + H2O
FeS + HCl = FeCl3 + H3SFeS + 3HCl = FeCl3 + H3S
FeO(s) + HNO3(aq) = Fe(NO3)2(aq) + H2O(l)FeO(s) + 2HNO3(aq) = Fe(NO3)2(aq) + H2O(l)
Fe(s)+HNO3(aq)=Fe(NO3)3(aq)+NO2(g)+H2O(l)Fe(s) + 6HNO3(aq) = Fe(NO3)3(aq) + 3NO2(g) + 3H2O(l)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+HNO3(aq)=Fe(NO3)3(aq)+NO2(g)+H2O(l)Fe(s) + 6HNO3(aq) = Fe(NO3)3(aq) + 3NO2(g) + 3H2O(l)
FeCl3 + Zn = ZnCl2 + Fe2FeCl3 + 3Zn = 3ZnCl2 + 2Fe
Fe2S3+H2O+ O2=Fe(OH)3+S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeTiO3 + H2SO4 = TiO2 + FeSO4 + H2OFeTiO3 + H2SO4 = TiO2 + FeSO4 + H2O
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS3 + NO3- + H+ = Fe3+ + SO42- + NO + H2O9FeS3 + 748NO3- + 724H+ = 3Fe3+ + 27SO42- + 748NO + 362H2O
Fe2O3+3CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS2 + HNO3 = Fe2(SO4)3 + NO + H2SO4 + H2O2FeS2 + 10HNO3 = Fe2(SO4)3 + 10NO + H2SO4 + 4H2O
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe(s)+H2O(l) =Fe3O4(s)+H2(g) 3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+Cl2=FeCl3+S2Cl22FeS2 + 5Cl2 = 2FeCl3 + 2S2Cl2
Fe(OH)2+H2O2=Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
Fe+HCl=FeCl3+HFe + 3HCl = FeCl3 + 3H
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2O3 + S = Fe + SO22Fe2O3 + 3S = 4Fe + 3SO2
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2(SO4)3+Ba(NO3)2=Fe(NO3)3+BaSO4Fe2(SO4)3 + 3Ba(NO3)2 = 2Fe(NO3)3 + 3BaSO4
FeS+NaCl=Na2S+FeCl2FeS + 2NaCl = Na2S + FeCl2
FeS +2H= H2S +FeFeS + 2H = H2S + Fe
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+H2 = Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+ CuSO4= Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe(OH)3= Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 + HNO3 + H2SO4 = Fe2(SO4)3 + NO + H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe203+NaCl=Na20+FeCl320Fe203 + 12180NaCl = 609Na20 + 4060FeCl3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe3O4 + Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+ HNO3 = Fe(NO3)2 + NH4NO3 + H2O4Fe + 10HNO3 = 4Fe(NO3)2 + NH4NO3 + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + H2O = Fe2O3 + HCl2FeCl3 + 3H2O = Fe2O3 + 6HCl
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeO(s)+O2(g)=Fe2O3(s)4FeO(s) + O2(g) = 2Fe2O3(s)
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe+NH3+H2O=Fe(OH)+NH4Fe + NH3 + H2O = Fe(OH) + NH4
Fe+NH3+H2O=Fe(OH)+NH4Fe + NH3 + H2O = Fe(OH) + NH4
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeSO4 + HNO3 =Fe(NO3)3 +N2O +H2O+H2SO48FeSO4 + 26HNO3 = 8Fe(NO3)3 + N2O + 5H2O + 8H2SO4
FeSO4 + HNO3 =Fe(NO3)3 +NO2 +H2O+H2SO4FeSO4 + 4HNO3 = Fe(NO3)3 + NO2 + H2O + H2SO4
Fe + HNO3 =Fe(NO3)3 +N2 +H2O10Fe + 36HNO3 = 10Fe(NO3)3 + 3N2 + 18H2O
FeBr3+H2(SO4)=Fe2(SO4)3+HBr2FeBr3 + 3H2(SO4) = Fe2(SO4)3 + 6HBr
Fe3O4(s) + 4 C(s) = 3 Fe(s) + 4 CO(g) Fe3O4(s) + 4C(s) = 3Fe(s) + 4CO(g)
FeS2+O2=Fe2O3+SO44FeS2 + 19O2 = 2Fe2O3 + 8SO4
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
FeC2O4*2H2O(s) = FeCO3(s) +H2O(g) + CO(g) FeC2O4*2H2O(s) = FeCO3(s) + 2H2O(g) + CO(g)
FeC2O4*2H2O(s) + O2(g) = Fe2O3(s) + H2O(g) + CO2(g) 4FeC2O4*2H2O(s) + 3O2(g) = 2Fe2O3(s) + 8H2O(g) + 8CO2(g)
FeC2O4*2H2O(s) + O2(g) = FeO(s) + H2O(g) + CO2(g)2FeC2O4*2H2O(s) + O2(g) = 2FeO(s) + 4H2O(g) + 4CO2(g)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 + NaOH= Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3+Ba(NO3)2=BaCl2+Fe(NO3)32FeCl3 + 3Ba(NO3)2 = 3BaCl2 + 2Fe(NO3)3
Fe(NO3)3+MgO=Fe2O3+Mg(NO3)22Fe(NO3)3 + 3MgO = Fe2O3 + 3Mg(NO3)2
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+3CO=2Fe+3CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe+O2=FeO2Fe + O2 = 2FeO
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeO(s)+O2(g)=2Fe2O2(g)2FeO(s) + 0O2(g) = Fe2O2(g)
Fe+HCl=FeCl+HFe + HCl = FeCl + H
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+HCl=FeCl+HFe + HCl = FeCl + H
Fe+HCl=FeCl+HFe + HCl = FeCl + H
FeS2 + HCl = FeCl2 + H2S + S88FeS2 + 16HCl = 8FeCl2 + 8H2S + S8
FeCl2 + K2Cr2O7 + HCl = FeCl3 + CrCl3 + KCl + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2CrCl3 + 2KCl + 7H2O
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + HI = FeI3 + H2OFe2O3 + 6HI = 2FeI3 + 3H2O
FeS+H2SO4=Fe2(SO4)3+SO2+H2O2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3+CsOH=Cs2SO4+Fe(OH)3Fe2(SO4)3 + 6CsOH = 3Cs2SO4 + 2Fe(OH)3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS + HCl=FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
FeCr2O7 + K2CO3 + O2 = Fe2O3 + K2CrO4 + CO24FeCr2O7 + 8K2CO3 + O2 = 2Fe2O3 + 8K2CrO4 + 8CO2
FeCl3 + H2S =FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeS2 + O2 = Fe3O4 + SO23FeS2 + 8O2 = Fe3O4 + 6SO2
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe2(SO4)3 + Na2S2O3 = Fe2(S2O3)3 + Na2SO4Fe2(SO4)3 + 3Na2S2O3 = Fe2(S2O3)3 + 3Na2SO4
FeCl2 + 2KCN=2KCl+Fe(CN)2FeCl2 + 2KCN = 2KCl + Fe(CN)2
FeO +O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe+3O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2+3O2=Fe2O32Fe2 + 3O2 = 2Fe2O3
Fe2+3O2=Fe2O32Fe2 + 3O2 = 2Fe2O3
Fe+H2O=H2+Fe3O43Fe + 4H2O = 4H2 + Fe3O4
FeCl + H2O + HCl = FeCl3 + H2O0FeCl + H2O + 0HCl = 0FeCl3 + H2O
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
F2+NaCl=NaF+Cl2F2 + 2NaCl = 2NaF + Cl2
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe + BaCl2 = FeCl3 + Ba24Fe + 6BaCl2 = 4FeCl3 + 3Ba2
Fe(NO3)3=Fe2O3 + NO2 + O24Fe(NO3)3 = 2Fe2O3 + 12NO2 + 3O2
Fe(NO3)2=Fe2O3 + NO2 + O24Fe(NO3)2 = 2Fe2O3 + 8NO2 + O2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 + H2= Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeSO4+KOH=K2SO4+Fe(OH)2FeSO4 + 2KOH = K2SO4 + Fe(OH)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 + O2 + H2O = Fe(OH)3 + S88Fe2(SO4)3 - 36O2 + 24H2O = 16Fe(OH)3 + 3S8
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s)+CO(g)=Fe+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe + 3CO2(g)
F2 + Al2O3 = AlF3 + O26F2 + 2Al2O3 = 4AlF3 + 3O2
F2 + Al2O3 = AlF3 + O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
F2+H2S=2S+2HFF2 + H2S = S + 2HF
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe3O4+Al=Fe+Al2O33Fe3O4 + 8Al = 9Fe + 4Al2O3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + O2 = SO2 + Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
Fe(NO3)3 + MgO = Fe2O3 + Mg(NO3)22Fe(NO3)3 + 3MgO = Fe2O3 + 3Mg(NO3)2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2+Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe3O4+Co = FeO+Co20Fe3O4 + 2Co = 0FeO + Co2
Fe(NO3)3+(NH4)2 C2O4=Fe2(C2O4)3+NH4NO3 2Fe(NO3)3 + 3(NH4)2C2O4 = Fe2(C2O4)3 + 6NH4NO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(SO4)2+KOH=FeK+(SO4)2OHFe(SO4)2 + KOH = FeK + (SO4)2OH
Fe(SO4)2+KOH=FeK+(SO4)2OHFe(SO4)2 + KOH = FeK + (SO4)2OH
Fe(III)(SO4)2+KOH=Fe(III)K+(SO4)2OHFe(III)(SO4)2 + KOH = Fe(III)K + (SO4)2OH
Fe(OH)2 + Ag3N = Fe3N2 + AgOH3Fe(OH)2 + 2Ag3N = Fe3N2 + 6AgOH
Fe(s) + Pb(C2H3O2)2 = Fe(C2H3O2)3 + Pb(s)2Fe(s) + 3Pb(C2H3O2)2 = 2Fe(C2H3O2)3 + 3Pb(s)
Fe2(SO4)3 + KOH= K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2SO4+H2SO4+2HNO3=Fe2(SO4)3+NO+H2O3Fe2SO4 + 6H2SO4 + 4HNO3 = 3Fe2(SO4)3 + 4NO + 8H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + 2CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeSO4 + HNO3 = Fe2(SO4)3 + Fe(NO3)3 + NO+H2O3FeSO4 + 4HNO3 = Fe2(SO4)3 + Fe(NO3)3 + NO + 2H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.