Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeS + O2 = SO2 + Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
Fe(NO3)3 + MgO = Fe2O3 + Mg(NO3)22Fe(NO3)3 + 3MgO = Fe2O3 + 3Mg(NO3)2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2+Na2CO3=FeCO3+NaClFeCl2 + Na2CO3 = FeCO3 + 2NaCl
Fe3O4+Co = FeO+Co20Fe3O4 + 2Co = 0FeO + Co2
Fe(NO3)3+(NH4)2 C2O4=Fe2(C2O4)3+NH4NO3 2Fe(NO3)3 + 3(NH4)2C2O4 = Fe2(C2O4)3 + 6NH4NO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(SO4)2+KOH=FeK+(SO4)2OHFe(SO4)2 + KOH = FeK + (SO4)2OH
Fe(SO4)2+KOH=FeK+(SO4)2OHFe(SO4)2 + KOH = FeK + (SO4)2OH
Fe(III)(SO4)2+KOH=Fe(III)K+(SO4)2OHFe(III)(SO4)2 + KOH = Fe(III)K + (SO4)2OH
Fe(OH)2 + Ag3N = Fe3N2 + AgOH3Fe(OH)2 + 2Ag3N = Fe3N2 + 6AgOH
Fe(s) + Pb(C2H3O2)2 = Fe(C2H3O2)3 + Pb(s)2Fe(s) + 3Pb(C2H3O2)2 = 2Fe(C2H3O2)3 + 3Pb(s)
Fe2(SO4)3 + KOH= K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2SO4+H2SO4+2HNO3=Fe2(SO4)3+NO+H2O3Fe2SO4 + 6H2SO4 + 4HNO3 = 3Fe2(SO4)3 + 4NO + 8H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + 2CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeSO4 + HNO3 = Fe2(SO4)3 + Fe(NO3)3 + NO+H2O3FeSO4 + 4HNO3 = Fe2(SO4)3 + Fe(NO3)3 + NO + 2H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe +6 CH3COOH = 2 Fe(CH3COO)3 + 3 CO2 + 3 H2O 8Fe + 21CH3COOH = 8Fe(CH3COO)3 - 6CO2 + 6H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
FeCl3+Cu(OH)2=Fe(OH)3+CuCl22FeCl3 + 3Cu(OH)2 = 2Fe(OH)3 + 3CuCl2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3+CaO=Fe2O3+Ca(SO4)Fe2(SO4)3 + 3CaO = Fe2O3 + 3Ca(SO4)
FeO + PdF2 = FeF2 + PdO FeO + PdF2 = FeF2 + PdO
Fe2 (SO4)3+KOH= K2SO4+Fe (OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + HNO3 = Fe(NO3)3 + NO + H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe + HNO3 = Fe(NO3)3 + NO + H2OFe + 4HNO3 = Fe(NO3)3 + NO + 2H2O
Fe + HNO3 = Fe(NO3)3 + NO + H2020Fe + 60HNO3 = 20Fe(NO3)3 + 0NO + 3H20
Fe+O2+H2O= Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(NO3)3 +H2S=FeS +S+ HNO32Fe(NO3)3 + 3H2S = 2FeS + S + 6HNO3
Fe2(SO4)3 + NaOH=Fe(OH)3+ Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
FeS+HCl=H2S+FeCl2FeS + 2HCl = H2S + FeCl2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2S2 + O2 = Fe2O3 + SO22Fe2S2 + 7O2 = 2Fe2O3 + 4SO2
Fe+H2TeO4=H2+Fe2(TeO4)2Fe + H2TeO4 = H2 + Fe2(TeO4)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe(NO3)3+Na(OH)=Fe(OH)3+Na(NO3)Fe(NO3)3 + 3Na(OH) = Fe(OH)3 + 3Na(NO3)
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeCl3 +Na2CO3 =Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeO=Fe + O22FeO = 2Fe + O2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe +HCl = FeCl2 +H2Fe + 2HCl = FeCl2 + H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS2 +Fe3+ +H2O = Fe2+ +SO4 2- + H+FeS2 - 333Fe3+ + 84H2O = -499Fe2+ + 2SO42- + 168H+
FeS2 +O2 +H2O = Fe2+ +SO4 2- + H+8FeS2 + 333O2 + 6H2O = 4Fe2+ + 16SO42- + 12H+
FeS+2HCl = FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe++ + Cr2O7-- + H+ = Fe+++ + Cr+++ + H2O6Fe++ + Cr2O7-- + 14H+ = 6Fe+++ + 2Cr+++ + 7H2O
Fe++ + Cr2O7 + H+ = Fe+++ + Cr+++ + H2O8Fe++ + Cr2O7 + 14H+ = 8Fe+++ + 2Cr+++ + 7H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+ CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe +H2SO4= Fe 2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe +H2SO4= Fe (SO4)3 + H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
FeS2 + O2 = Fe3O4 + SO23FeS2 + 8O2 = Fe3O4 + 6SO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS2 + O2=Fe2O3 +SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+KCNS= Fe(KCNS)Fe + KCNS = Fe(KCNS)
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe 2 O3 = Fe + O 22Fe2O3 = 4Fe + 3O2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4+H2O2+H2SO4=Fe2(SO4)3+H2O2FeSO4 + H2O2 + H2SO4 = Fe2(SO4)3 + 2H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + H2SO4= Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeCl2 + Cl2 = FeCl32FeCl2 + Cl2 = 2FeCl3
FeBr2+HNO3+HCl=FeCl3+Br2+NO+H2OFeBr2 + HNO3 + 3HCl = FeCl3 + Br2 + NO + 2H2O
FeBr3+HNO3+HCl=FeCl3+Br2+NO+H2O2FeBr3 + 2HNO3 + 6HCl = 2FeCl3 + 3Br2 + 2NO + 4H2O
FeCl2+Cl2=FeCl32FeCl2 + Cl2 = 2FeCl3
Fe3O4 + Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + PbCl4 = FeCl3 + PbO22Fe2O3 + 3PbCl4 = 4FeCl3 + 3PbO2
FeCl2 + K2SO4 = FeSO4 + KClFeCl2 + K2SO4 = FeSO4 + 2KCl
FeCrO4 + K2CO3 + KClO3 = Fe2O3 + K2Cr2O4 + KCl + CO26FeCrO4 + 3K2CO3 - 2KClO3 = 3Fe2O3 + 3K2Cr2O4 - 2KCl + 3CO2
FeCrO4 + K2CO3 + KClO3 = Fe2O3 + K2Cr2O4 + KCl + CO26FeCrO4 + 3K2CO3 - 2KClO3 = 3Fe2O3 + 3K2Cr2O4 - 2KCl + 3CO2
FeSO4 + (NH4)2SO4 + HNO3 + H2O = NH4Fe(SO4)2 + H2O0FeSO4 + 0(NH4)2SO4 + 0HNO3 + H2O = 0NH4Fe(SO4)2 + H2O
FeSO4 + (NH4)2SO4 + HNO3 + H2O = NH4Fe(SO4)2 + H2O0FeSO4 + 0(NH4)2SO4 + 0HNO3 + H2O = 0NH4Fe(SO4)2 + H2O
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2+H2S=HCl+FeSFeCl2 + H2S = 2HCl + FeS
FeCl3+AgNO3=Fe(NO3)3+AgClFeCl3 + 3AgNO3 = Fe(NO3)3 + 3AgCl
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+HNO3 =Fe(NO3)2+NH4NO3+H2O4Fe + 10HNO3 = 4Fe(NO3)2 + NH4NO3 + 3H2O
FeO+H2O=Fe(OH)2FeO + H2O = Fe(OH)2
FeS + 2HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
FeS2 + O2= Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O4 + CO =FeO + CO2Fe3O4 + CO = 3FeO + CO2
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
FeSo4+ O2 = Fe2(So4)3 + Fe2O312FeSo4 + 3O2 = 4Fe2(So4)3 + 2Fe2O3
FeSo4+ O2 + H2O = Fe2(So4)3 + Fe2OH24FeSo4 + O2 + 2H2O = 8Fe2(So4)3 + 4Fe2OH
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeO+Na2CO3=Fe+CO2+Na2O0FeO + Na2CO3 = 0Fe + CO2 + Na2O
Fe+O2= Fe3O23Fe + O2 = Fe3O2
Fe+O2= Fe3O36Fe + 3O2 = 2Fe3O3
Fe + H2O = H2 + Fe3O43Fe + 4H2O = 4H2 + Fe3O4
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
Fe2O3+HNO3=Fe(NO3)3+H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(OH)2+H2O2=Fe (OH)2Fe(OH)2 - H2O2 = 2Fe(OH)
Fe+H2SO4=FeSO4+H2O+SO2Fe + 2H2SO4 = FeSO4 + 2H2O + SO2
Fe+HNO3=Fe(NO3)2+H2O+NO3Fe + 8HNO3 = 3Fe(NO3)2 + 4H2O + 2NO
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2SO4 = FeSO4 +H2Fe + H2SO4 = FeSO4 + H2
Fe2O3+CO=Fe+CO0Fe2O3 + CO = 0Fe + CO
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
F2O+H2=HF+O22F2O + 2H2 = 4HF + O2
FeCO3+O2= FeO+CO2FeCO3 + 0O2 = FeO + CO2
Fe + LiOH = Li + FeOHFe + LiOH = Li + FeOH
FeSO4+K2CrO4=FeCrO4+ K2SO4FeSO4 + K2CrO4 = FeCrO4 + K2SO4
Fe2O3 + CO = Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS +O2 =Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO =Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+Ba(OH)2=BaSO4+Fe(OH)3Fe2(SO4)3 + 3Ba(OH)2 = 3BaSO4 + 2Fe(OH)3
FeCl2 + KMnO4 +HCl = FeCl3 +MnCl2 + H2O +KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeSO4 + H2SO4 + KMnO4 = Fe2(SO4)3 + K2SO + MnSO4 + H2O16FeSO4 + 11H2SO4 + 2KMnO4 = 8Fe2(SO4)3 + K2SO + 2MnSO4 + 11H2O
FeSO4 +H2SO4 +KMnO4 = Fe2(SO4)3 + K2SO+MnSO4 +H2O16FeSO4 + 11H2SO4 + 2KMnO4 = 8Fe2(SO4)3 + K2SO + 2MnSO4 + 11H2O
FeS + 2HF = FeF + 2HSFeS + HF = FeF + HS
Fe+AgNO3=Fe(NO3)3+AgFe + 3AgNO3 = Fe(NO3)3 + 3Ag
FeO Cr2O3+O2+KOH=Fe2O3+K2CrO4+H2O4FeOCr2O3 + 7O2 + 16KOH = 2Fe2O3 + 8K2CrO4 + 8H2O
FeCl3+HCl+NaOH=Fe2O3+NaClH2O0FeCl3 + HCl + NaOH = 0Fe2O3 + NaClH2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3Al2Si3O12 + O2 = Al2SiO5 + Fe3O4 + SiO2Fe3Al2Si3O12 - O2 = 2Al2SiO5 + 2Fe3O4 + 4SiO
Fe3Al23SiO12 +O2 = Fe3O4 + Al2SiO5 + SiO2-4Fe3Al23SiO12 - 57O2 = -4Fe3O4 - 46Al2SiO5 + 42SiO2
Fe3Al2(SiO4)3 +O2 = Fe3O4 + Al2SiO5 + SiO22Fe3Al2(SiO4)3 + O2 = 2Fe3O4 + 2Al2SiO5 + 4SiO2
Fe3Al2Si3O12 + SiO2 = Fe3O4 + Al2SiO5 + O2-2Fe3Al2Si3O12 + 4SiO2 = -2Fe3O4 - 2Al2SiO5 + O2
Fe3O4 + Al2SiO5 + O2 = Fe3Al2Si3O12 + SiO2-2Fe3O4 - 2Al2SiO5 + O2 = -2Fe3Al2Si3O12 + 4SiO2
Fe3O4 + Al2SiO5 + SiO2 = Fe3Al2Si3O12 + SiO20Fe3O4 + 0Al2SiO5 + SiO2 = 0Fe3Al2Si3O12 + SiO2
Fe3O4 + Al2SiO5 + H2 = Fe3Al2Si3O12 +H200Fe3O4 + 0Al2SiO5 + 10H2 = 0Fe3Al2Si3O12 + H20
Fe3O4 + Al2SiO5 + SiO2 = Fe3Al2Si3O12 +O22Fe3O4 + 2Al2SiO5 + 4SiO2 = 2Fe3Al2Si3O12 + O2
Fe3O4 + Al2SiO5 + SiO2 = Fe3Al2(SiO4)3 +O22Fe3O4 + 2Al2SiO5 + 4SiO2 = 2Fe3Al2(SiO4)3 + O2
Fe3O4 + Al2SiO5 + SiO2 = Fe3Al2Si3O12 +O22Fe3O4 + 2Al2SiO5 + 4SiO2 = 2Fe3Al2Si3O12 + O2
Fe3O4 + Al2SiO5 + O2 + SiO2 = Fe3Al2Si3O122Fe3O4 + 2Al2SiO5 - O2 + 4SiO2 = 2Fe3Al2Si3O12
Fe2O3 + Al2SiO5 + O2 + SiO2 = Fe3Al2Si3O126Fe2O3 + 4Al2SiO5 - 3O2 + 8SiO2 = 4Fe3Al2Si3O12
Fe2O3 + CO = 2Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3+Na2CO3=Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FePO4 + Na2SO4 = Fe2(SO4)3 + Na3PO42FePO4 + 3Na2SO4 = Fe2(SO4)3 + 2Na3PO4
FePO4 + NaSO4 = Fe(SO4)3 + Na3PO4FePO4 + 3NaSO4 = Fe(SO4)3 + Na3PO4
Fe(s)+CuNO3(aq)=Cu(s)+Fe(NO3)2(aq)Fe(s) + 2CuNO3(aq) = 2Cu(s) + Fe(NO3)2(aq)
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3+Na2CO3=Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeCl2+K2Cr2O7+HCl=FeCl3+2CrCl3+7H2O+KCl6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2CrCl3 + 7H2O + 2KCl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+CO2=Fe2O3+CO2Fe + 3CO2 = Fe2O3 + 3CO
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3+Fe(s)=3FeSO4Fe2(SO4)3 + Fe(s) = 3FeSO4
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + H2O + O2 = FeOH4Fe + 2H2O + O2 = 4FeOH
FeSO4+H2SO4+K2Cr2O7= Fe(SO4)3+ H2O+K2SO4+ H24Cr2S3O243FeSO4 + 14H2SO4 + 2K2Cr2O7 = 3Fe(SO4)3 - 10H2O + 2K2SO4 + 2H24Cr2S3O24
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS + O2 =Fe2O3 +SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+F2= FeF32Fe + 3F2 = 2FeF3
Fe2O3 + 3CO = 2Fe + 3CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe++ + Cr2O7-- + H+ = Fe+++ + Cr+++ + H2O6Fe++ + Cr2O7-- + 14H+ = 6Fe+++ + 2Cr+++ + 7H2O
Fe+O2+H2=Fe(OH)2Fe + O2 + H2 = Fe(OH)2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeO3 +SO2 =FeS +O22FeO3 + 2SO2 = 2FeS + 5O2
Fe (s) + H2O (l) + O2 (g) = Fe(OH)2 (s)2Fe(s) + 2H2O(l) + O2(g) = 2Fe(OH)2(s)
F2 + NaOH = NaF + OF2 + H2O2F2 + 2NaOH = 2NaF + OF2 + H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + H2O + K2SO16FeSO4 + 2KMnO4 + 11H2SO4 = 8Fe2(SO4)3 + 2MnSO4 + 11H2O + K2SO
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeCl3+NaOH=NaCl+Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3 + Zn = ZnCl2 + Fe2FeCl3 + 3Zn = 3ZnCl2 + 2Fe
FeCl2 + KMnO4 + HCl=FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3 + Zn = ZnCl2 + Fe2FeCl3 + 3Zn = 3ZnCl2 + 2Fe
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3+3H2=Fe+3 H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS + O2 = FeO + SO22FeS + 3O2 = 2FeO + 2SO2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeO+Na2CO3=Fe+CO2+Na2O0FeO + Na2CO3 = 0Fe + CO2 + Na2O
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(s)+S(s)=FeS(s)Fe(s) + S(s) = FeS(s)
Fe+O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+Cu(NO3)2=Fe(NO3)3+Cu2Fe + 3Cu(NO3)2 = 2Fe(NO3)3 + 3Cu
Fe2(SO4)3+Ca(OH)2=Fe(OH)3+CaSO4Fe2(SO4)3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaSO4
Fe (s) + CuO (aq) = Fe2O3 + Cu2Fe(s) + 3CuO(aq) = Fe2O3 + 3Cu
FeSO4 + H2SO4 + KMnO4 = Fe2(SO4)3 + K2SO + MnSO4 + H2O16FeSO4 + 11H2SO4 + 2KMnO4 = 8Fe2(SO4)3 + K2SO + 2MnSO4 + 11H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe(NO3)2+Zn= Zn(NO3)2+FeFe(NO3)2 + Zn = Zn(NO3)2 + Fe
Fe +AgBr = Ag +FeBr2Fe + 2AgBr = 2Ag + FeBr2
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3(s)+H2(g)=Fe(s)+H2O(g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
FeBr3 + K2SO4 =KBr + Fe2(SO4)32FeBr3 + 3K2SO4 = 6KBr + Fe2(SO4)3
FeCl3+SO2+H2O=FeCl2+HCl+H2SO42FeCl3 + SO2 + 2H2O = 2FeCl2 + 2HCl + H2SO4
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2SO4= Fe ( S O4) 3 + H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS(s) + HCl(aq) = H2S(g) + FeCl2(aq)FeS(s) + 2HCl(aq) = H2S(g) + FeCl2(aq)
Fe2(SO4)3 + Fe = 3FeSO4Fe2(SO4)3 + Fe = 3FeSO4
Fe2O3 + HNO3 = Fe(NO3)3 + NO2 + H2O Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO2 + 3H2O
Fe2O3 + HNO3 = Fe(NO3)3 + NO2 + H2O Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO2 + 3H2O
FeO + HNO3 = Fe(NO3)3 + NO2 + H2O FeO + 4HNO3 = Fe(NO3)3 + NO2 + 2H2O
Fe2O3 + HNO3 = Fe(NO3)3 + NO2 + H2O Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 0NO2 + 3H2O
Fe2(SO4)3+Ba(NO3)2=BaSO4+Fe(NO3)3Fe2(SO4)3 + 3Ba(NO3)2 = 3BaSO4 + 2Fe(NO3)3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=2Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS2 + HNO3 = Fe(SO4)3 + NO + H2SO4 + H2OFeS2 + 6HNO3 = Fe(SO4)3 + 6NO - H2SO4 + 4H2O
FeS2 + HNO3 = Fe(SO4)3 + NO + H2SO4 + H2OFeS2 + 6HNO3 = Fe(SO4)3 + 6NO - H2SO4 + 4H2O
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe+S8=FeS8Fe + S8 = 8FeS
Fe+H2O=H2+Fe3O43Fe + 4H2O = 4H2 + Fe3O4
Fe (s) + O2 (g) = Fe2O34Fe(s) + 3O2(g) = 2Fe2O3
F2 + KCl = KF + Cl2F2 + 2KCl = 2KF + Cl2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=FeO2O32Fe + 5O2 = 2FeO2O3
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe+O2=FeO2Fe + O2 = 2FeO
FeCl3 + KSCN = (FeSCN)Cl2 + KClFeCl3 + KSCN = (FeSCN)Cl2 + KCl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl2+ KOH= Fe(OH)2+ KClFeCl2 + 2KOH = Fe(OH)2 + 2KCl
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 + H2(SO4) = Fe2(SO4)3 + HCl2FeCl3 + 3H2(SO4) = Fe2(SO4)3 + 6HCl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + CaOH = Fe(OH)3 + CaClFeCl3 + 3CaOH = Fe(OH)3 + 3CaCl
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+PbCl2=FeCl+Pb2Fe + PbCl2 = 2FeCl + Pb
Fe2O3+K2SO4= Fe2SO4 + K2O3Fe2O3 + K2SO4 = Fe2SO4 + K2O3
Fe2O3+H2=2Fe+3 H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2=2Fe+3 H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)
FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)
FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)FeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl(aq)
FeSO4+H2SO4+HNO3=Fe2(SO4)3+NO+H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
FeCI2 + H2O + HCI = FeCI3 + H2O0FeCI2 + H2O + 0HCI = 0FeCI3 + H2O
FeCI2 + H2O + HCI = FeCI3 + H2O0FeCI2 + H2O + 0HCI = 0FeCI3 + H2O
FeI3+HClO4+H2SO4=HIO3+HCl+Fe2(SO4)34FeI3 + 9HClO4 + 6H2SO4 = 12HIO3 + 9HCl + 2Fe2(SO4)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+SiO2+H2O=FeO+SiH5Fe + 2SiO2 + H2O = 5FeO + 2SiH
Fe+SiO2+H2O=FeO+SiH5Fe + 2SiO2 + H2O = 5FeO + 2SiH
Fe+SiO2+H2O=FeO2+Si4H1013Fe + 8SiO2 + 10H2O = 13FeO2 + 2Si4H10
Fe+HCl=FeCl+HFe + HCl = FeCl + H
Fe + H2O + NaCl = FeCl + NaOH + HFe + H2O + NaCl = FeCl + NaOH + H
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2+NaPO4=Fe(PO4)2+NaClFeCl2 + 2NaPO4 = Fe(PO4)2 + 2NaCl
FeCl2+NaPO4=Fe(PO4)2+NaClFeCl2 + 2NaPO4 = Fe(PO4)2 + 2NaCl
Fe2O3 = O2 + Fe2Fe2O3 = 3O2 + 4Fe
FeCl2+K2Cr2O7+HCl=FeCl3+KCl+CrCl3+H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
FeCl2+ H2O + HCl = FeCl3+ H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(NO3)3 +K2SO4 = Fe2(SO4)3 + KNO32Fe(NO3)3 + 3K2SO4 = Fe2(SO4)3 + 6KNO3
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + KHSO4 + MnSO4 + H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeO(s) + 2HClO4(aq) = H2O(l) + Fe(ClO4)2(aq)FeO(s) + 2HClO4(aq) = H2O(l) + Fe(ClO4)2(aq)
FeO(s) + 2HClO4(aq) = H2O(l) + Fe(ClO4)2(aq)FeO(s) + 2HClO4(aq) = H2O(l) + Fe(ClO4)2(aq)
Fe2O3 + CO2 = Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
Fe2O3 + CO2 = Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
Fe2O3 + CO2 = Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
Fe3 + Cu(NO3)2 = Fe2(NO3)3 + Cu28Fe3 + 18Cu(NO3)2 = 12Fe2(NO3)3 + 9Cu2
FeBr2+K2CO3=FeCO3+KBrFeBr2 + K2CO3 = FeCO3 + 2KBr
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ 2NO3-+4H+=Fe2++ NO2 +H2O2Fe + NO3- + 2H+ = Fe2+ + NO2 + H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + Al = Al2(SO4)3 + Fe3FeSO4 + 2Al = Al2(SO4)3 + 3Fe
Fe +H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe +4H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3*6H2O + H2O = HCl + Fe(OH)3FeCl3*6H2O - 3H2O = 3HCl + Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+H2O=FeO4+H2Fe + 4H2O = FeO4 + 4H2
Fe(OH)2 (aq) + Sn (s) = Sn(OH) + FeFe(OH)2(aq) + 2Sn(s) = 2Sn(OH) + Fe
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe(NO3)2 + Cl2 = Fe(NO3)3 + FeCl36Fe(NO3)2 + 3Cl2 = 4Fe(NO3)3 + 2FeCl3
Fe(NO3)2 + Cl2 = Fe(NO3)3 + FeCl36Fe(NO3)2 + 3Cl2 = 4Fe(NO3)3 + 2FeCl3
Fe(NO3)2 + Cl2 = Fe(NO3)3 + FeCl36Fe(NO3)2 + 3Cl2 = 4Fe(NO3)3 + 2FeCl3
FeCl3(aq) + H2S(g) = Fe2S3 (s) + HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2(SO4)3 +Ba(OH)2 = Fe(OH)3 + Ba (SO4)Fe2(SO4)3 + 3Ba(OH)2 = 2Fe(OH)3 + 3Ba(SO4)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe3O + CO = 3FeO + CO2-1Fe3O + 2CO = -3FeO + 2CO2
Fe3O + CO = 3FeO + CO2-1Fe3O + 2CO = -3FeO + 2CO2
Fe3 + CO = 3FeO + CO2-1Fe3 + 3CO = -3FeO + 3CO2
Fe+3+NO2-+H2O=Fe+2+H++NO3-2Fe+3 + NO2- + H2O = 2Fe+2 + 2H+ + NO3-
Fe3+ + NO2- + H2O = Fe2+ + H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3+ + NO2- + H2O = Fe2+ H+ +NO3-2Fe3+ + NO2- + H2O = 3Fe2 + 2H+ + NO3-
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeI3+HClO4+H2SO4=HIO3+HCl+Fe2(SO4)34FeI3 + 9HClO4 + 6H2SO4 = 12HIO3 + 9HCl + 2Fe2(SO4)3
FeI3+HClO4+H2SO4=HIO3+HCl+Fe2(SO4)34FeI3 + 9HClO4 + 6H2SO4 = 12HIO3 + 9HCl + 2Fe2(SO4)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + CO3 = FeCO3Fe + CO3 = FeCO3
FeCl3+Ca(OH)2=Fe(OH)3+CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2(C2O4)3 = FeC2O4 + CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe+H2O=Fe3O4+H3Fe + 4H2O = Fe3O4 + 8H
Fe+H2O=Fe3O4+H3Fe + 4H2O = Fe3O4 + 8H
Fe2O3+H2S=Fe2S3+H2OFe2O3 + 3H2S = Fe2S3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe3 O43Fe + 2O2 = Fe3O4
FE + 2 AgNO3 = FE(NO3)2 + 2 AgFE + 2AgNO3 = FE(NO3)2 + 2Ag
Fe + NaCl + H2O = Fe2O3 + NaOH + Cl-2Fe + 6NaCl + 3H2O = -1Fe2O3 + 6NaOH + 6Cl
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+2MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeSO4+KClO3+H2SO4=Fe(SO4)3+KSO4+Cl2+H2O2FeSO4 + 2KClO3 + 6H2SO4 = 2Fe(SO4)3 + 2KSO4 + Cl2 + 6H2O
FeSO4 + O2 = Fe2O3 +SO24FeSO4 - O2 = 2Fe2O3 + 4SO2
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe+Cl2=FeCl2Fe + Cl2 = FeCl2
Fe(OH)3 + Li2SO4 = Li2(OH)3 + FeSO4Fe(OH)3 + Li2SO4 = Li2(OH)3 + FeSO4
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(C2O4)3 + SCN = Fe(CN)3 + (C2O4)3 + SFe(C2O4)3 + 3SCN = Fe(CN)3 + (C2O4)3 + 3S
Fe(OH)3 + Li2SO4 = Li2(OH)3 +FeSO4Fe(OH)3 + Li2SO4 = Li2(OH)3 + FeSO4
Fe(OH)3 + Li2SO4 = Li2(OH)3 +FeSO4Fe(OH)3 + Li2SO4 = Li2(OH)3 + FeSO4
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCr2O3+Na2CO3+O2=Na2CrO4+2FeO3+8CO2FeCr2O3 + 2Na2CO3 + 3O2 = 2Na2CrO4 + FeO3 + 2CO2
FeO + PdF2 = FeF2 + PdOFeO + PdF2 = FeF2 + PdO
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe3O4+H2O=FeO+H2-1Fe3O4 + H2O = -3FeO + H2
FePO4 + NaSO4 = FeSO4 + NaPO4FePO4 + NaSO4 = FeSO4 + NaPO4
FePO4 + NaSO4 = FeSO4 + NaPO4FePO4 + NaSO4 = FeSO4 + NaPO4
Fe+H3PO4=Fe3(PO4)2+H23Fe + 2H3PO4 = Fe3(PO4)2 + 3H2
FeCl3+NaOH=NaCl+Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
FeCl3+NaOH=NaCl+Fe(OH)3FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
FeCl3+K2CO3=KCl+Fe2(CO3)32FeCl3 + 3K2CO3 = 6KCl + Fe2(CO3)3
FeCl3+(NH4)2SO4=Fe2(SO4)3+NH4Cl2FeCl3 + 3(NH4)2SO4 = Fe2(SO4)3 + 6NH4Cl
FeCl3+(NH4)2SO4=Fe2(SO4)3+NH4Cl2FeCl3 + 3(NH4)2SO4 = Fe2(SO4)3 + 6NH4Cl
FeCl3+Ca(NO3)2=Fe(NO3)3+CaCl22FeCl3 + 3Ca(NO3)2 = 2Fe(NO3)3 + 3CaCl2
Fe2 +3O2=Fe2O32Fe2 + 3O2 = 2Fe2O3
FeSO4 + 2NH3+ H2O = Fe(OH)3+(NH4)2+SO42FeSO4 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2 + 2SO4
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
FeS + 7O2 = 2Fe2O3+4SO44FeS + 11O2 = 2Fe2O3 + 4SO4
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H32Fe + 3H2SO4 = Fe2(SO4)3 + 2H3
Fe + H2O=Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(s) + HCl(aq) = FeCl3(aq) + H2(g) 2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe + O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+++ + Ce++++ = Fe++ + Ce+++-1Fe+++ + Ce++++ = -1Fe++ + Ce+++
Fe2O3(s) + CO(g) =Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(NO3)3+NH3+H2O = Fe(OH)3+NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe++ +MnO4- + H = Fe+++ + Mn++ + H2O-3Fe++ + MnO4- + 8H = -3Fe+++ + Mn++ + 4H2O
Fe++ +MnO4- + H = Fe+++ + Mn++ + H2O-3Fe++ + MnO4- + 8H = -3Fe+++ + Mn++ + 4H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO4FeS2 + 7O2 = 2Fe2O3 + 8SO
FeCrO4+K2CO3+O2=Fe2O3+K2CrO4+CO24FeCrO4 + 4K2CO3 + O2 = 2Fe2O3 + 4K2CrO4 + 4CO2
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeTiO3 + Cl2 + C = TiCl4 + FeCl3 + CO2FeTiO3 + 7Cl2 + 6C = 2TiCl4 + 2FeCl3 + 6CO
Fe2P + S = P4S10 + FeS4Fe2P + 18S = P4S10 + 8FeS
Fe+++ + C2O4-- + H2O = FeC2O4*2H2O + CO22Fe+++ + 3C2O4-- + 4H2O = 2FeC2O4*2H2O + 2CO2
Fe3O4+C=Fe + COFe3O4 + 4C = 3Fe + 4CO
Fe SO4 + KClO3 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cl2 + H2O 10FeSO4 + 2KClO3 + 6H2SO4 = 5Fe2(SO4)3 + K2SO4 + Cl2 + 6H2O
FeSO4 + HNO3 + H2SO4 = Fe2(SO4)3 + NO + H2O6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
FeBr2(aq) + Br2(l) = FeBr3(aq)2FeBr2(aq) + Br2(l) = 2FeBr3(aq)
Fe3O4+H2SO4=Fe2(SO4)3+H2O+SO22Fe3O4 + 10H2SO4 = 3Fe2(SO4)3 + 10H2O + SO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3 + C1O1 = Fe3O4 + C1O23Fe2O3 + C1O1 = 2Fe3O4 + C1O2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3+Ba(OH)2=Fe(OH)3+BaSO4Fe2(SO4)3 + 3Ba(OH)2 = 2Fe(OH)3 + 3BaSO4
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2OFe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(C2O4)3=FeC2O4+CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe2O3 + H2SO4 = Fe2 (SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
F + S = SFF + S = SF
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 + H2O = FeSO4 + H2SO42FeS2 + 7O2 + 2H2O = 2FeSO4 + 2H2SO4
FeS2 + O2 + H2O = FeSO2 + H2SO42FeS2 + 5O2 + 2H2O = 2FeSO2 + 2H2SO4
Fe + H2S = Fe2S3 + H22Fe + 3H2S = Fe2S3 + 3H2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + S8 = FeS8Fe + S8 = 8FeS
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2+O2=FeO3Fe2 + 3O2 = 2FeO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe +O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O4+SO2=FeS+O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe(OH)3 + HCl = FeCl3 + H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
Fe(OH)3 + HCl = FeCl3 + H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
Fe2O4+SO2=FeS+O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe+ H2O = Fe2O3+ H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe 2 O 4 + SO 2 = FeS + O 2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe 2 P(s) + S(s) = P 4 S 10 (s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe 2 O 3 +CO = CO 2 +FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+H 2 O = Fe 2 O 3 +H 22Fe + 3H2O = Fe2O3 + 3H2
Fe2(CO3)3 + H3O = Fe3+ CO2 + H2O3Fe2(CO3)3 + 18H3O = 2Fe3 + 9CO2 + 27H2O
Fe+Al2(SO4)3=FeSO4+Al3Fe + Al2(SO4)3 = 3FeSO4 + 2Al
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeO4P + Na2SO4 = Fe2(SO4)3 + Na3PO42FeO4P + 3Na2SO4 = Fe2(SO4)3 + 2Na3PO4
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
F2 + HBr = Br2 + HFF2 + 2HBr = Br2 + 2HF
FeCl3+KOH = Fe(OH)3+KClFeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
FeCl3+H2SO4 = Fe2 (SO4)3+HCl2FeCl3 + 3H2SO4 = Fe2(SO4)3 + 6HCl
FeS(s) + HCl(aq) = H2S(g) + FeCl2(aq)FeS(s) + 2HCl(aq) = H2S(g) + FeCl2(aq)
Fe2O3(s) + CO(g) = Fe(s) + CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+H2(g)=Fe(s)+H2O(g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
FeS + HCl = H2S +FeCl2FeS + 2HCl = H2S + FeCl2
Fe(s) + Cl2(g) = FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
FeCl3 + Ca(OH)2 = Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2O3 + CO2 = 2 Fe + CO20Fe2O3 + CO2 = 0Fe + CO2
Fe2O3 + H2 = Fe3O4 +H2O3Fe2O3 + H2 = 2Fe3O4 + H2O
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + 3H2O = 2Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(III)SO4 + NaOH = Fe(III)OH + NaSO4Fe(III)SO4 + NaOH = Fe(III)OH + NaSO4
Fe(III)SO4 + NaOH = Fe(III)OH + NaSO4Fe(III)SO4 + NaOH = Fe(III)OH + NaSO4
FeCl3+H2S=FeCl2+S+HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O4(s)+8HCl(aq) = FeCl2(aq)+2FeCl3(aq)+4H2O(l)Fe3O4(s) + 8HCl(aq) = FeCl2(aq) + 2FeCl3(aq) + 4H2O(l)
Fe2O2+CO=Fe+CO2Fe2O2 + 2CO = 2Fe + 2CO2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe(s)+CO2(g)=Fe2O3(s)+CO(g)2Fe(s) + 3CO2(g) = Fe2O3(s) + 3CO(g)
Fe + H2O = Fe3 O4 +H2O0Fe + H2O = 0Fe3O4 + H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.