Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
FeSO4+7H2O+MgO= Fe2O3+MgSO4+H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2(SO4)3+NaOH=Fe(OH)3+Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
Fe2O3 + Al = Al2 O3 +FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe(s) + S(s) = FeS(s)Fe(s) + S(s) = FeS(s)
Fe(CN) + MgO = FeO+ CNMgFe(CN) + MgO = FeO + CNMg
Fe S2 + O2 = Fe2 O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2 (CO3)3 + H2 SO4 = Fe2 (SO4)3 + H2O + CO2 Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe Cl3 + Na2 CO3 = Fe2 (CO3)3 + Na Cl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe + O2 + H20 = 2Fe2O2*3H202Fe + O2 + 3H20 = Fe2O2*3H20
Fe S2 + O2 = Fe2 O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2 (CO3)3 + H2 SO4 = Fe2 (SO4)3 + H2O + CO2 Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
FeCl3 + Ca(OH)2= Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
FeSO4 + HBrO + H2SO4 = Fe2(SO4)3 + FeBr3 + H2O12FeSO4 + 6HBrO + 3H2SO4 = 5Fe2(SO4)3 + 2FeBr3 + 6H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS2+ O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2+O2=SO2+Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2S3 + H2O + O2 = Fe(OH)3 + S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
Fe3O=Fe3OFe3O = Fe3O
Fe3O4=Fe3O4Fe3O4 = Fe3O4
Fe3O4=Fe3O4Fe3O4 = Fe3O4
Fe+S=FeSFe + S = FeS
Fe+S=FeSFe + S = FeS
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(NO3)3 + CaSO4 = FeSO4+Ca(NO3)3Fe(NO3)3 + CaSO4 = FeSO4 + Ca(NO3)3
Fe2O3+HBr=FeBr3+H2OFe2O3 + 6HBr = 2FeBr3 + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(HCO3)2 +Cl2 + H2O = Fe(OH)3 + CO2 + Cl- + H+2Fe(HCO3)2 + Cl2 + 2H2O = 2Fe(OH)3 + 4CO2 + 2Cl- + 2H+
FeS + O2 + H2O = Fe2O3 + H2SO44FeS + 9O2 + 4H2O = 2Fe2O3 + 4H2SO4
FeS + O2 + H2O = Fe2O3 + H2SO44FeS + 9O2 + 4H2O = 2Fe2O3 + 4H2SO4
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl3+NaOH=Fe(OH)3+ NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe + HCl =FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
Fe2O3+C2=Fe+CO24Fe2O3 + 3C2 = 8Fe + 6CO2
Fe +NaNO3 + H2O = NH3 + NaOH + Fe(OH)38Fe + 3NaNO3 + 18H2O = 3NH3 + 3NaOH + 8Fe(OH)3
Fe+S=FeSFe + S = FeS
FeCl3 + NaOH = Fe(OH)3 + NaCl FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3 +NaOH = Fe(OH)3 + NaCl FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2 + Cl2 = FeCl32FeCl2 + Cl2 = 2FeCl3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2S3 + H2O + O2 = Fe(OH)3 + S2Fe2S3 + 6H2O + 3O2 = 4Fe(OH)3 + 6S
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3+H2S=Fe2S3+H2O2Fe(OH)3 + 3H2S = Fe2S3 + 6H2O
Fe + HNO3 = Fe(NO3)3 + NH4NO3 + H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe + HNO3 = Fe(NO3)3 + NH4NO3 + H2020Fe + 60HNO3 = 20Fe(NO3)3 + 0NH4NO3 + 3H20
FeSO4+7H2O + MgO = Fe2O3 + MgSO4 + H2O0FeSO4 + H2O + 0MgO = 0Fe2O3 + 0MgSO4 + H2O
Fe+O2+H2O = Fe2O3 3H2O4Fe + 33O2 + 2H2O = 2Fe2O33H2O
FeSO4+HBrO+H2SO4=Fe2(SO4)3+H2O+HBr2FeSO4 + HBrO + H2SO4 = Fe2(SO4)3 + H2O + HBr
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 + H2O + NO2FeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 7H2O + 15NO2
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 + H2O + NO2 FeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 7H2O + 15NO2
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
FeSO4+H2SO4+HNO3=Fe2(SO4)3+NO+H2O6FeSO4 + 3H2SO4 + 2HNO3 = 3Fe2(SO4)3 + 2NO + 4H2O
Fe+N2O=N2+Fe3O43Fe + 4N2O = 4N2 + Fe3O4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe S2 + O2 = Fe2 O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2 (CO3)3 + H2SO4 = Fe2 (SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe Cl3 + Na2 CO3 = Fe2 (CO3)3 + Na Cl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe Cl3 + Na2 CO3 = Fe2 (CO3)3 + Na Cl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe2S3+ HCl = FeCl3 + H2SFe2S3 + 6HCl = 2FeCl3 + 3H2S
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
F2+H2O=HF+O33F2 + 3H2O = 6HF + O3
FeCl2+NaNO3+HCl=FeCl3+NaCl+H2O+NO3FeCl2 + NaNO3 + 4HCl = 3FeCl3 + NaCl + 2H2O + NO
FeSO4 + H2O +H2O2 =Fe2O3+2H2SO42FeSO4 + H2O + H2O2 = Fe2O3 + 2H2SO4
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + HCl = H2 + FeCl32Fe + 6HCl = 3H2 + 2FeCl3
Fe2S3+O2=Fe+SO2Fe2S3 + 3O2 = 2Fe + 3SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2 + H2O = FeO + HClFeCl2 + H2O = FeO + 2HCl
Fe(NO3)3*9H2O+C2H6O2 =Fe3O4+CO2+H2O+N2 30Fe(NO3)3*9H2O + 46C2H6O2 = 10Fe3O4 + 92CO2 + 408H2O + 45N2
Fe3(NO3)*9H2O+C2H6O2 =Fe3O4+CO2+H2O+N2 10Fe3(NO3)*9H2O - 2C2H6O2 = 10Fe3O4 - 4CO2 + 84H2O + 5N2
FeS+H2SO4=FeSO4+H2SFeS + H2SO4 = FeSO4 + H2S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3 + Zn = ZnCl2 + Fe2FeCl3 + 3Zn = 3ZnCl2 + 2Fe
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe3O4+H=Fe+H2OFe3O4 + 8H = 3Fe + 4H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
F2+BiCl3=Cl2+BiF33F2 + 2BiCl3 = 3Cl2 + 2BiF3
FeTiO3+Cl2+C=TiCl4+FeCl3+CO2FeTiO3 + 7Cl2 + 6C = 2TiCl4 + 2FeCl3 + 6CO
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe3 + H2O = Fe2O3 + H22Fe3 + 9H2O = 3Fe2O3 + 9H2
FeS + HCl =FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO+CO=Fe+CO2FeO + CO = Fe + CO2
Fe2O3+H=Fe+H2OFe2O3 + 6H = 2Fe + 3H2O
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
FeI3 + NaOH = NaI3 + FeOHFeI3 + NaOH = NaI3 + FeOH
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + V2(SO4)5= Fe2(SO4)3+V2O55Fe2O3 + 3V2(SO4)5 = 5Fe2(SO4)3 + 3V2O5
Fe + AuCl = FeCl3 + AuFe + 3AuCl = FeCl3 + 3Au
Fe2(SO4)3+NH3+H2O=Fe(OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe + S = FeSFe + S = FeS
Fe+HI = FeI2+H2Fe + 2HI = FeI2 + H2
Fe+HI = FeI2+H2Fe + 2HI = FeI2 + H2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeSO2 = O2 = FeS2O3 = SO2-2FeSO2 = -1O2 - 2FeS2O3 + 2SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3(aq) + 6KOH(aq) = 3K2SO4(aq) + 2Fe(OH)3(s)Fe2(SO4)3(aq) + 6KOH(aq) = 3K2SO4(aq) + 2Fe(OH)3(s)
FeS+O2=FeO+SO22FeS + 3O2 = 2FeO + 2SO2
F2+KlO3+H2O=KlO4+HFF2 + KlO3 + H2O = KlO4 + 2HF
Fe+NaOH=FeOH+NaFe + NaOH = FeOH + Na
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 +CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe2 O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HCl = FeCl + H22Fe + 2HCl = 2FeCl + H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(NO3)3 + NaOH = FeOH + Na(NO3)3Fe(NO3)3 + NaOH = FeOH + Na(NO3)3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe3Cl3 + NaOH = FeOH + NaClFe3Cl3 + 3NaOH = 3FeOH + 3NaCl
Fe+HCl = FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4 + C = Fe + COFe3O4 + 4C = 3Fe + 4CO
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl2+H2O+HCl=FeCl3+H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe2O3+2Al=Al2O3+Fe Fe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3 +CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + HBrO + HCl = FeCl3 + HBr + H2SO4 + H2O2FeSO4 + HBrO + 6HCl = 2FeCl3 + HBr + 2H2SO4 + H2O
Fe2 O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3+SnCl2+HCl=SnCl4+Fe+H2OFe2O3 + 3SnCl2 + 6HCl = 3SnCl4 + 2Fe + 3H2O
F2+Os=OsF63F2 + Os = OsF6
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 + KCl = KF + Cl2F2 + 2KCl = 2KF + Cl2
Fe2O3 (s) + C (s) = Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = 8Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3Mg = MgO + FeFe2O3 + 3Mg = 3MgO + 2Fe
Fe2O3+6HCi=2FeCi3+H2OFe2O3 + 6HCi = 2FeCi3 + 3H2O
F2+ KCl= KF+Cl2F2 + 2KCl = 2KF + Cl2
Fe2O3 +HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 +HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O2+CO=CO2+FeFe2O2 + 2CO = 2CO2 + 2Fe
Fe2O2+CO=CO2+FeFe2O2 + 2CO = 2CO2 + 2Fe
Fe(OH)2 (s) + O2 (g) = Fe2H2O4 (s) + H2O4Fe(OH)2(s) + O2(g) = 2Fe2H2O4(s) + 2H2O
Fe (s) + H2O (l) + O2 (g) = Fe(OH)2 (s)2Fe(s) + 2H2O(l) + O2(g) = 2Fe(OH)2(s)
Fe2O3 + CO = Fe + CO0Fe2O3 + CO = 0Fe + CO
Fe+ O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)2+HNO=Fe(NO3)3+NO+H2O-1Fe(NO3)2 + 4HNO = -1Fe(NO3)3 + 5NO + 2H2O
FePO4+Na2SO4=Fe2(SO4)3=Na3PO42FePO4 + 3Na2SO4 = Fe2(SO4)3 + 2Na3PO4
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
F2+KCl=KF+Cl2F2 + 2KCl = 2KF + Cl2
Fe(s) + O2(g) = FeO(s)2Fe(s) + O2(g) = 2FeO(s)
Fe3O4 + H2 = Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + H2S = FeCl2 + S + HCl2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + Al = Fe + Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe+ Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O2 + C = Fe + CO2Fe3O2 + C = 3Fe + CO2
Fe3O2 + C = Fe + COFe3O2 + 2C = 3Fe + 2CO
FeO2 + C = Fe + COFeO2 + 2C = Fe + 2CO
F2+Al2O3=AlF3+O26F2 + 2Al2O3 = 4AlF3 + 3O2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4 + KMnO4 + H2SO4 = MnSO4 + Fe2(SO4)3 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS + HCl=FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeCl3 + 3 KSCN + NaOH = Fe(OH)3 + KCl + NaSCNFeCl3 + 3KSCN + 3NaOH = Fe(OH)3 + 3KCl + 3NaSCN
Fe(NO3)3 + 3LiOH = Fe(OH)3 = 3LiNO3Fe(NO3)3 + 3LiOH = Fe(OH)3 + 3LiNO3
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3 + H = Fe + H2OFe2O3 + 6H = 2Fe + 3H2O
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3(s) + CO(g) =CO2(g) + Fe (s)Fe2O3(s) + 3CO(g) = 3CO2(g) + 2Fe(s)
Fe2O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2 O3+HCl=FeCl3+H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeS2(s) + O2(g) =FeO(s) +SO2(g)2FeS2(s) + 5O2(g) = 2FeO(s) + 4SO2(g)
FeS (s) + O2(g) =FeO(s) + SO2(g)2FeS(s) + 3O2(g) = 2FeO(s) + 2SO2(g)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(III)Cl + NaC = Fe(III)C + NaClFe(III)Cl + NaC = Fe(III)C + NaCl
Fe2O3(s)=Fe(s)+O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe(s) + H20(l) + O2(g) = Fe(OH)3(s)20Fe(s) + 3H20(l) + 30O2(g) = 20Fe(OH)3(s)
Fe2S+SrBr2=FeBr+SrSFe2S + SrBr2 = 2FeBr + SrS
Fe2O3 + NO = Fe(NO3)3 +O2-2Fe2O3 - 12NO = -4Fe(NO3)3 + 9O2
FeCl3+(NH4)2S = Fe2S3+NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=FeO2Fe + O2 = 2FeO
Fe+3Ci=FeCi3Fe + 3Ci = FeCi3
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe3O4 + H2 = 3Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeC2O4+CO2=Fe2(C2O4)32FeC2O4 + 2CO2 = Fe2(C2O4)3
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeSO4 + KCIO3 + H2SO4 = Fe2(SO4)3 + KCI + H2020FeSO4 + 0KCIO3 + 10H2SO4 = 10Fe2(SO4)3 + 0KCI + H20
FeSO4 + KCIO3 + H2SO4 = Fe2(SO4)3 + KCI + H2020FeSO4 + 0KCIO3 + 10H2SO4 = 10Fe2(SO4)3 + 0KCI + H20
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = SO2 + Fe2O34FeS2 + 11O2 = 8SO2 + 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2SO4 =Fe2 (SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + O2 = FeO2Fe + O2 = 2FeO
F-(aq) = F2(g) + e-2F-(aq) = F2(g) + e-
FeS+O2=FeO3+SO22FeS + 5O2 = 2FeO3 + 2SO2
Fe2S3+O2=Fe+SO2Fe2S3 + 3O2 = 2Fe + 3SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2So4=FeSo4+H2Fe + H2So4 = FeSo4 + H2
Fe+H2So4=FeSo4+H2Fe + H2So4 = FeSo4 + H2
Fe+H2So4=FeSo4+H2Fe + H2So4 = FeSo4 + H2
Fe+H2So4=FeSo4+H2Fe + H2So4 = FeSo4 + H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeBr3 + H2 SO4 = Fe2 (SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
FeBr3 + H2 SO4 = Fe2 (SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
FeCl3+ Be3 (PO4)2 = BeCl2+ FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe 3+ + Hg2= Fe2+ +Hg 2+-2Fe3+ + Hg2 = -3Fe2+ + Hg2+
FE+CUSO4=CU+FESO4FE + CUSO4 = CU + FESO4
FE+CUSO4=CU+FESO4FE + CUSO4 = CU + FESO4
Fe + 2HCl = FeCl + HFe + HCl = FeCl + H
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+CO = Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2P + S = P4S10 + FeS4Fe2P + 18S = P4S10 + 8FeS
Fe2+HCl=2FeCl+H2Fe2 + 2HCl = 2FeCl + H2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3+NH4OH=Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl2 + K2Cr2O7 + HCl =FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe+CuNO3=Cu+Fe(NO3)2Fe + 2CuNO3 = 2Cu + Fe(NO3)2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO= Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl+NaH=FeH +NaClFeCl + NaH = FeH + NaCl
Fe + H2O2(aq) = FeO2(aq) + H2Fe + H2O2(aq) = FeO2(aq) + H2
Fe + NaCl(aq) = FeCl (aq) + NaFe + NaCl(aq) = FeCl(aq) + Na
Fe + NaCl(aq) = FeCl + NaFe + NaCl(aq) = FeCl + Na
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3(s)+CO(g)=Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(NO3) + H2S=H2(NO3) + FeSFe(NO3) + H2S = H2(NO3) + FeS
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl2 + Na3PO4(aq) = Fe3(PO4)2(s) + NaCl(aq)3FeCl2 + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaCl(aq)
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq)Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
FeCl3+H2S=FeCl2+HCl+S2FeCl3 + H2S = 2FeCl2 + 2HCl + S
Fe(NO3)3 + Ba(NO3)2 =Ba(NO3)3 + Fe(NO3)2Fe(NO3)3 + Ba(NO3)2 = Ba(NO3)3 + Fe(NO3)2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) + O2(g) = Fe2O3(s) 4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe+HCl=FeCl3+HFe + 3HCl = FeCl3 + 3H
Fe2S3 + O2 + H2O =Fe(OH)3 + S2Fe2S3 + 3O2 + 6H2O = 4Fe(OH)3 + 6S
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s) +HCl(aq) = FeCl3(s) + H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(s) + 3H2(g)
Fe(SO2)2 + Ba(NO)2 = Fe(NO)2 + Ba(SO2)2Fe(SO2)2 + Ba(NO)2 = Fe(NO)2 + Ba(SO2)2
Fe2S3(s) +HCl(g) = FeCl3(s) + H2S(g)Fe2S3(s) + 6HCl(g) = 2FeCl3(s) + 3H2S(g)
Fe2(SO4)3 + KOH = Fe2O3 + K2(SO4) + H2OFe2(SO4)3 + 6KOH = Fe2O3 + 3K2(SO4) + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2+H2O=HF+O33F2 + 3H2O = 6HF + O3
Fe(s)+Cl(g) = FeCl3(s)Fe(s) + 3Cl(g) = FeCl3(s)
FeCl2+NaNO3+HCl=FeCl3+NaCl+H2O+NO3FeCl2 + NaNO3 + 4HCl = 3FeCl3 + NaCl + 2H2O + NO
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe2 O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
FeCl3 +Be(NO3)2 = Fe(NO3)3 + BeCl22FeCl3 + 3Be(NO3)2 = 2Fe(NO3)3 + 3BeCl2
Fe+++ + SO4-- + Ca(OH)2 + H2O = Fe(OH)3 + CaSO4*2H2O2Fe+++ + 3SO4-- + 3Ca(OH)2 + 6H2O = 2Fe(OH)3 + 3CaSO4*2H2O
Fe + FeCl3 = FeCl2Fe + 2FeCl3 = 3FeCl2
FeS2 + O2 = Fe2O2 + 8SO22FeS2 + 5O2 = Fe2O2 + 4SO2
FeSO4+HBrO+HCl=FeCl3+FeBr3+Fe2(SO4)3+H2O6FeSO4 + 3HBrO + 3HCl = FeCl3 + FeBr3 + 2Fe2(SO4)3 + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeS(s) + HCl(aq)=H2S(g) + FeCl2(aq)FeS(s) + 2HCl(aq) = H2S(g) + FeCl2(aq)
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
FeBr2 + Br2 = FeBr3 2FeBr2 + Br2 = 2FeBr3
FeCl2 + K2Cr2O7 + HCl = FeCl3 + KCl + CrCl3 + H2O6FeCl2 + K2Cr2O7 + 14HCl = 6FeCl3 + 2KCl + 2CrCl3 + 7H2O
Fe(s) + O2(g) = Fe3O23Fe(s) + O2(g) = Fe3O2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeBr3 + AgNO3 = AgBr + Fe(NO3)3FeBr3 + 3AgNO3 = 3AgBr + Fe(NO3)3
FeBr3 + AgNO3 = AgBr + Fe(NO3)3FeBr3 + 3AgNO3 = 3AgBr + Fe(NO3)3
FeBr3 + AgNO3 = AgBr + Fe(NO3)3FeBr3 + 3AgNO3 = 3AgBr + Fe(NO3)3
FeBr3 + AgNO3 = AgBr + Fe(NO3)3FeBr3 + 3AgNO3 = 3AgBr + Fe(NO3)3
FeBr3 + AgNO3 = AgBr + Fe(NO3)3FeBr3 + 3AgNO3 = 3AgBr + Fe(NO3)3
FeBr3 + AgNO3 = AgBr + Fe(NO3)3FeBr3 + 3AgNO3 = 3AgBr + Fe(NO3)3
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe + H2SO4=Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeBr2 + Br2 = FeBr32FeBr2 + Br2 = 2FeBr3
FeBr2 + Br2 = FeBr2FeBr2 + 0Br2 = FeBr2
Fe++ + HNO2 + H+ = Fe+++ + NO (g)+H2OFe++ + HNO2 + H+ = Fe+++ + NO(g) + H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2 O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(OH)3(s) = Fe2O3(s) + H2O(g)2Fe(OH)3(s) = Fe2O3(s) + 3H2O(g)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeCl3(aq) + KOH(aq) = Fe(OH)3(s) + KCl(aq)FeCl3(aq) + 3KOH(aq) = Fe(OH)3(s) + 3KCl(aq)
Fe2O3+H2=Fe=H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+H3O+ =Fe2+ +H2 +H2O4Fe + 2H3O+ = 2Fe2+ + H2 + 2H2O
Fe(NO3)3+KCl=FeCl3+K(NO3)Fe(NO3)3 + 3KCl = FeCl3 + 3K(NO3)
FeSO4+HBrO+H2SO4=Fe2(SO4)3+HBr+H2O2FeSO4 + HBrO + H2SO4 = Fe2(SO4)3 + HBr + H2O
Fe+NaBr= FeBr3+NaFe + 3NaBr = FeBr3 + 3Na
F2+HBr=Br2+HFF2 + 2HBr = Br2 + 2HF
Fe(NO3)3 + LiOH = FeOH + Li(NO3)3Fe(NO3)3 + LiOH = FeOH + Li(NO3)3
F2 + NaCl = NaF + Cl2F2 + 2NaCl = 2NaF + Cl2
FeCl3 = Fe + Cl22FeCl3 = 2Fe + 3Cl2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 + K2Cr2O7 + H2SO4 = Cr2(SO4)3 + Fe2(SO4)3 + H2O + K2SO46FeSO4 + K2Cr2O7 + 7H2SO4 = Cr2(SO4)3 + 3Fe2(SO4)3 + 7H2O + K2SO4
FE + O2 = FEO2FE + O2 = 2FEO
FeCl3 + H2 = Fe + HCl2FeCl3 + 3H2 = 2Fe + 6HCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = FeSO3 + SO22FeS2 + 5O2 = 2FeSO3 + 2SO2
FeS + O2 = FeO + S2FeS + O2 = 2FeO + 2S
Fe(s)+O2(g)+H2O(l)=Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe (s) + 2I2 (g) = FeI4 (g)Fe(s) + 2I2(g) = FeI4(g)
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s) + CO(g) =Fe + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe + 3CO2(g)
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3 + NH4+ + H+ = 2Fe++ + NO3- + H2O4Fe2O3 + NH4+ + 14H+ = 8Fe++ + NO3- + 9H2O
Fe2O3 + NH4+ + H+ = 2Fe++ + NO2- + H2O3Fe2O3 + NH4+ + 10H+ = 6Fe++ + NO2- + 7H2O
Fe2O3 + NH4+ + H+ = 2Fe2+ + NO2- + H2O6Fe2O3 + 5NH4+ - 4H+ = 6Fe2+ + 5NO2- + 8H2O
Fe2O3+NH4++H+=2Fe++NO2-+H2O3Fe2O3 + 2NH4+ + 2H+ = 6Fe+ + 2NO2- + 5H2O
Fe2O3+NH4+H+=2Fe2++NO2-+H2O7Fe2O3 + 5NH4 + 2H+ = 7Fe2+ + 5NO2- + 11H2O
Fe2O3+NH4++H+=2Fe2++NO2-+H2O6Fe2O3 + 5NH4+ - 4H+ = 6Fe2+ + 5NO2- + 8H2O
Fe2O3+NH4+H+=2Fe2++NO3-+H2O9Fe2O3 + 5NH4 + 4H+ = 9Fe2+ + 5NO3- + 12H2O
Fe2O3+NH4++H+=2Fe2++NO3-+H2O8Fe2O3 + 5NH4+ - 2H+ = 8Fe2+ + 5NO3- + 9H2O
Fe2O3 + CO= Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO =Fe + 2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2=Fe2O42Fe + 2O2 = Fe2O4
Fe + H2SO4 = FeSO4 + H2 Fe + H2SO4 = FeSO4 + H2
FeO(s)+HNO3(aq)=Fe (NO3)2 (aq) + H2O(l)FeO(s) + 2HNO3(aq) = Fe(NO3)2(aq) + H2O(l)
Fe2O4 + SO2= FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+HCl=FeCl3+HFe + 3HCl = FeCl3 + 3H
Fe(OH)3(s) = Fe2O3(s) + H2O(g) 2Fe(OH)3(s) = Fe2O3(s) + 3H2O(g)
FeS2 + O2 = Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe2O4 + CO2-1Fe2O3 + CO = -1Fe2O4 + CO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeCr2O4 + K2CO3 + O2 = Fe2O3 + K2CrO4 + CO24FeCr2O4 + 8K2CO3 + 7O2 = 2Fe2O3 + 8K2CrO4 + 8CO2
FeCl3+H2S=FeCl2+HCl+S2FeCl3 + H2S = 2FeCl2 + 2HCl + S
Fe2O3 + CO = Fe2O4 + CO2-1Fe2O3 + CO = -1Fe2O4 + CO2
Fe +AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3(s) = Fe2O3(s) + H2O(g)2Fe(OH)3(s) = Fe2O3(s) + 3H2O(g)
Fe + H2O = H2 + Fe2O32Fe + 3H2O = 3H2 + Fe2O3
FeS + HNO3 = NO + FeSO4 + H2O3FeS + 8HNO3 = 8NO + 3FeSO4 + 4H2O
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+2O=Fe2O32Fe + 3O = Fe2O3
Fe+O2+H3O = Fe3++H2O0Fe + O2 + 4H3O = 0Fe3+ + 6H2O
Fe(NO3)3(aq)+3NaOH(aq)=Fe(OH)3(s)+3NaNO3(aq)Fe(NO3)3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaNO3(aq)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FePO4+NaSO4=FeSO4+NaPO4FePO4 + NaSO4 = FeSO4 + NaPO4
Fe + AgBr = Ag + FeBr2Fe + 2AgBr = 2Ag + FeBr2
Fe(NO3)3+Al2O3 = Fe2O3+Al(NO3)32Fe(NO3)3 + Al2O3 = Fe2O3 + 2Al(NO3)3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)3 + Al2O3 = Fe2O3 + Al(NO3)32Fe(NO3)3 + Al2O3 = Fe2O3 + 2Al(NO3)3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2(SO4)3 + KOH = K2SO4+ Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2(SO4)3 (aq) + KSCN (aq) = K3Fe(SCN)6 (s) + K2SO4 (aq) Fe2(SO4)3(aq) + 12KSCN(aq) = 2K3Fe(SCN)6(s) + 3K2SO4(aq)
Fe2(SO4)3 (aq) + KSCN (aq) = K3Fe(SCN)6 (s) + K2SO4 (aq) Fe2(SO4)3(aq) + 12KSCN(aq) = 2K3Fe(SCN)6(s) + 3K2SO4(aq)
Fe +H2SO4=Fe2(SO4)3 +H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + HCl + O2=FeCl + H2O4Fe + 4HCl + O2 = 4FeCl + 2H2O
Fe2O3 + 3CO = 3CO2 +FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS +HCl=H2S +FeCl2FeS + 2HCl = H2S + FeCl2
Fe2 O3 + CO=CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe3+ +NO2-+H2O=Fe2+ +H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3+ +NO2-+H2O=Fe2+ +H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe3+ +NO2-+H2O=Fe2+ +H+ +NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe (OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3+KI=KCl+FeCl2+I22FeCl3 + 2KI = 2KCl + 2FeCl2 + I2
Fe(NO3)3+NH3+H2O=Fe(OH)3+NH4NO3Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4NO3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeO+H2=Fe+H2OFeO + H2 = Fe + H2O
FeO+H2=Fe+H2OFeO + H2 = Fe + H2O
Fe(OH)2(s)+H2O2(l)=Fe(OH)3(s)2Fe(OH)2(s) + H2O2(l) = 2Fe(OH)3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+C= Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3(s)+H2(g)=Fe(s)+H2OFe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O2 = Fe2 O34Fe + 3O2 = 2Fe2O3
FeS + HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
F2+KBr = KF + Br2F2 + 2KBr = 2KF + Br2
F2+KBr = KF + Br2F2 + 2KBr = 2KF + Br2
FeS + HNO3 = Fe(NO3)3 + H2SO4 + NO + H2OFeS + 6HNO3 = Fe(NO3)3 + H2SO4 + 3NO + 2H2O
FeS + H2O2 = FeSO4 + H2OFeS + 4H2O2 = FeSO4 + 4H2O
FeS + 3H2O2 = FeO + SO2 + 3H2OFeS + 3H2O2 = FeO + SO2 + 3H2O
FeS(s) + H2O2(l) = Fe(OH)3 +S2FeS(s) + 3H2O2(l) = 2Fe(OH)3 + 2S
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
FeCl3 +Al = AlCl3 +FeFeCl3 + Al = AlCl3 + Fe
Fe3+ + NO2- + H2O = Fe2+ + H+ + NO3--4Fe3+ + NO2- + H2O = -6Fe2+ + 2H+ + NO3-
Fe2O3(s) + CO(g) = Fe(s) + CO2(g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeO + C=CO +FeFeO + C = CO + Fe
FeO + C=CO +FeFeO + C = CO + Fe
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + NaOH = Fe(OH)3 + NaFe + 3NaOH = Fe(OH)3 + 3Na
FeS +O2 =Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.