Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe + CuNO3 = Cu + Fe(NO3)2Fe + 2CuNO3 = 2Cu + Fe(NO3)2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeCl2 + K3PO4 = Fe3(PO4)2 + KCl3FeCl2 + 2K3PO4 = Fe3(PO4)2 + 6KCl
FeCl2 + K3PO4 = FePO4 +K3Cl2FeCl2 + K3PO4 = FePO4 + K3Cl2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe3O23Fe + O2 = Fe3O2
Fe2O3+3H2=2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+3H2=2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe + O2 +H2O = Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe2(SO4)3 + CaCl2 = FeCl3 + CaSO4Fe2(SO4)3 + 3CaCl2 = 2FeCl3 + 3CaSO4
Fe2(SO4)3 + CaCl2 = FeCl3 + CaSO4Fe2(SO4)3 + 3CaCl2 = 2FeCl3 + 3CaSO4
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + 3C = 4Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + 3C = 4Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + 3C = 4Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + 3C = 4Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe 2 O 3 (s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(NO3)2 + H2S = FeS + HNO3Fe(NO3)2 + H2S = FeS + 2HNO3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeO + H2O2 = Fe2O3 + H2O2FeO + H2O2 = Fe2O3 + H2O
FeO+H2SO4=FeSO4+H2OFeO + H2SO4 = FeSO4 + H2O
Fe2O3+H2SO4=Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + MgSO4 = FeSO4 + MgFe + MgSO4 = FeSO4 + Mg
Fe + Zn(NO3)2 = Fe(NO3)2 + ZnFe + Zn(NO3)2 = Fe(NO3)2 + Zn
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+H2O=FeO+H2Fe + H2O = FeO + H2
FeS + O2 = Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
FeBr3 +Cl2 = FeCl3 +Br2FeBr3 + 3Cl2 = 2FeCl3 + 6Br
Fe(s) + O2 = Fe2O34Fe(s) + 3O2 = 2Fe2O3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 + H2O = Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeO3+C=Fe+CO3FeO3 + C = Fe + CO3
Fe2O3+C=Fe+CO3Fe2O3 + C = 2Fe + CO3
FeCl3+Ca(OH)2(aq)=Fe(OH)3(s)+CaCl2(aq)2FeCl3 + 3Ca(OH)2(aq) = 2Fe(OH)3(s) + 3CaCl2(aq)
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
F2 + SnCl2= SnF2 + Cl2F2 + SnCl2 = SnF2 + Cl2
FeO3+H2=Fe+H2OFeO3 + 3H2 = Fe + 3H2O
Fe2O3(s) = Fe(s) + O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
Fe2(SO4)3 + CaCl2 = FeCl3 + CaSO4Fe2(SO4)3 + 3CaCl2 = 2FeCl3 + 3CaSO4
Fe +O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe2(SO4)3 + CaCl2 = FeCl3 + CaSO4Fe2(SO4)3 + 3CaCl2 = 2FeCl3 + 3CaSO4
Fe + H2CO3 = Fe2(CO3)3 + H22Fe + 3H2CO3 = Fe2(CO3)3 + 3H2
Fe2O3 + C =Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3+3C=2Fe+3COFe2O3 + 3C = 2Fe + 3CO
Fe(H2O)6+ 4Cl= FeCl4+ 6H2OFe(H2O)6 + 4Cl = FeCl4 + 6H2O
Fe(H2O)6+ 4Cl=FeCl4 + 6H2OFe(H2O)6 + 4Cl = FeCl4 + 6H2O
Fe(H2O)6+ NH3 = Fe(OH)3 + 3H2O + NH4Fe(H2O)6 + 3NH3 = Fe(OH)3 + 3H2O + 3NH4
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe + CuCl2 = FeCl3 + Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2SO4=Fe2SO4+H2O3Fe2O3 + H2SO4 = Fe2SO4 + H2O3
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO3(s) + CO(g)=Fe(g)+CO2(g)FeO3(s) + 3CO(g) = Fe(g) + 3CO2(g)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe(NO3)3 + K2CO3 = Fe2(CO3)3 + KNO32Fe(NO3)3 + 3K2CO3 = Fe2(CO3)3 + 6KNO3
Fe+Cl-3 + Co2+(NO3-)2 = Fe(NO3)2 + CoCl3-9Fe + 6Cl-3 + Co2 - 9(NO3-)2 = -9Fe(NO3)2 + 2CoCl3
FeCl3 + Co(NO3)2 = Fe(NO3)2 + CoCl3FeCl3 + Co(NO3)2 = Fe(NO3)2 + CoCl3
Fe+2HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(NO3)2 + Na3PO4 = Fe3(PO4)2 + NaNO33Fe(NO3)2 + 2Na3PO4 = Fe3(PO4)2 + 6NaNO3
FeCl2 + K2S= FeS + KClFeCl2 + K2S = FeS + 2KCl
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(NO3)3 + 3NaOH = Fe(OH)3 (s) + 3NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3(s) + 3NaNO3
Fe(NO3)3 + H2O = Fe(OH)3 + HNO3Fe(NO3)3 + 3H2O = Fe(OH)3 + 3HNO3
Fe8S3 = Fe3 + S824Fe8S3 = 64Fe3 + 9S8
FeCl2+H3PO4=FePO4+HCl+HFeCl2 + H3PO4 = FePO4 + 2HCl + H
FeCl2+H3PO4=FePO4+HCl+HFeCl2 + H3PO4 = FePO4 + 2HCl + H
FeS+O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
FePO4 + NaOH = Fe(OH)3 + Na3PO4FePO4 + 3NaOH = Fe(OH)3 + Na3PO4
Fr2Cr2O7 + Mn3(AsO4)2 = Fr3AsO4 + MnCr2O73Fr2Cr2O7 + Mn3(AsO4)2 = 2Fr3AsO4 + 3MnCr2O7
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(ClO4)2(aq)+K2CO3(aq)=FeCO3(s)+2KClO4(aq)Fe(ClO4)2(aq) + K2CO3(aq) = FeCO3(s) + 2KClO4(aq)
Fe(ClO4)2(aq)+K2CO3(aq)=FeCO3(s)+2KClO4(aq)Fe(ClO4)2(aq) + K2CO3(aq) = FeCO3(s) + 2KClO4(aq)
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
FeSO4+K2Cr2O7+H2SO4=Fe(SO4)3+Cr2(SO4)3+K2SO4+H2O3FeSO4 + 2K2Cr2O7 + 14H2SO4 = 3Fe(SO4)3 + 2Cr2(SO4)3 + 2K2SO4 + 14H2O
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O10FeSO4 + 2KMnO4 + 9H2SO4 = 5Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 8H2O
FeSO4+KMnOO4+H2SO4=Fe2(SO4)3+KHSO4+MnSO4+H2O14FeSO4 + 2KMnOO4 + 11H2SO4 = 7Fe2(SO4)3 + 2KHSO4 + 2MnSO4 + 10H2O
Fe2S3 + O2 = Fe2O3 + SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe2S3 + O2 = FeO + SO2Fe2S3 + 4O2 = 2FeO + 3SO2
Fe2S3 + O2 = FeO + SO2Fe2S3 + 4O2 = 2FeO + 3SO2
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3+Mg2=MgO+Fe2Fe2O3 + 3Mg2 = 6MgO + 4Fe
Fe2O3+3C=3CO+2FeFe2O3 + 3C = 3CO + 2Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + S = FeSFe + S = FeS
Fe2O2+CO=CO2 + FeFe2O2 + 2CO = 2CO2 + 2Fe
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe + O2 =4 FeO2Fe + O2 = 2FeO
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeCl3+ NH4OH= Fe(OH)3+ NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + H2O + CO2Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3H2O + 3CO2
Fe(NO3)2 + K3PO4 = Fe3(PO4)2 + KNO33Fe(NO3)2 + 2K3PO4 = Fe3(PO4)2 + 6KNO3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeO + CO = Fe + CO2FeO + CO = Fe + CO2
Fe(NO3)3 + K2CO3 = Fe2(CO3)3 + KNO32Fe(NO3)3 + 3K2CO3 = Fe2(CO3)3 + 6KNO3
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe2O3+Al=Al2O3+FeFe2O3 + 2Al = Al2O3 + 2Fe
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe2O3+C=3CO+2FeFe2O3 + 3C = 3CO + 2Fe
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+3H2=2Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS2 + H2O + O2 = SO42- + Fe3O4 +H+6FeS2 + 6H2O + 253O2 = 12SO42- + 2Fe3O4 + 12H+
FeS2 + H2O + O2 = SO42- + Fe3O4 +H+6FeS2 + 6H2O + 253O2 = 12SO42- + 2Fe3O4 + 12H+
FeS2 + H2O + O2 = SO4- + Fe3O4 + H+6FeS2 + 6H2O + 25O2 = 12SO4- + 2Fe3O4 + 12H+
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS2 + H2O + O2 = HS- + Fe2O3 + H+4FeS2 + 8H2O - O2 = 8HS- + 2Fe2O3 + 8H+
FeS2 + H2O + O2 = SO4- + Fe2O3 + H+4FeS2 + 4H2O + 17O2 = 8SO4- + 2Fe2O3 + 8H+
Fe + Zn (NO3) = Zn +Fe (NO3)Fe + Zn(NO3) = Zn + Fe(NO3)
Fe + CuSO4 = Cu2 + Fe 2 SO44Fe + 2CuSO4 = Cu2 + 2Fe2SO4
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
FeCl3 + Ca(OH)2 = Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
Fe(s)+S(l) = Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe3O4 + H2SO4 = Fe2(SO4)3+ SO2 + H2O2Fe3O4 + 10H2SO4 = 3Fe2(SO4)3 + SO2 + 10H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
FeBr3+ Cl2 = FeCl3 + Br22FeBr3 + 3Cl2 = 2FeCl3 + 3Br2
FeO(OH)+H3PO4=H2O+FePO4FeO(OH) + H3PO4 = 2H2O + FePO4
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe(NO3)2 + K3PO4 = Fe3(PO4)2 + KNO33Fe(NO3)2 + 2K3PO4 = Fe3(PO4)2 + 6KNO3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + AgNO3= Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3 + FeCl2 + NH3 + H2O = FeO4 + NH4Cl6FeCl3 - 5FeCl2 + 8NH3 + 4H2O = FeO4 + 8NH4Cl
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe2O3 + Zn = ZnO3 + FeFe2O3 + Zn = ZnO3 + 2Fe
Fe2O3 + Zn = ZnO3 +2FeFe2O3 + Zn = ZnO3 + 2Fe
FeSO4 + K2Cr2O7 + H2SO4 = Fe(SO4)3 + Cr(SO4)3 + K2SO4 + H205FeSO4 + 0K2Cr2O7 + 10H2SO4 = 5Fe(SO4)3 + 0Cr(SO4)3 + 0K2SO4 + H20
Fe(OH)2 + O2 + H2O = Fe(OH)34Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
Fe2 + O3 = Fe2O3Fe2 + O3 = Fe2O3
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(NO3)3 + NH4SCN = Fe(SCN)3 + NH4NO3Fe(NO3)3 + 3NH4SCN = Fe(SCN)3 + 3NH4NO3
Fe+S=FeSFe + S = FeS
Fe2P + FeS2 = FeS+ P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe2P + FeS2 = Fe + P4S104Fe2P + 5FeS2 = 13Fe + P4S10
Fe2P + FeS2 = Fe + P4S104Fe2P + 5FeS2 = 13Fe + P4S10
Fe+SCN=FeNCSFe + SCN = FeNCS
Fe+SCN=FeNCSFe + SCN = FeNCS
Fe2(SO4)3+KOH=K2(SO4)+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2(SO4) + 2Fe(OH)3
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+ O2+ H2O= Fe3OH12Fe + O2 + 2H2O = 4Fe3OH
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2(CO3)3 = Fe2O3 + CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe2(SO4)3+KOH=K2(SO4)+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2(SO4) + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + 4H2 = 3Fe + 4H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + 4H2 = 3Fe + 4H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS2+O2=Fe2O2+SO22FeS2 + 5O2 = Fe2O2 + 4SO2
Fe(NO3)3 + NH4OH = Fe(OH)3 + H2O + NH30Fe(NO3)3 + NH4OH = 0Fe(OH)3 + H2O + NH3
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3(s) +H2O(l) = Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2So4=Fe2(So4)3+H22Fe + 3H2So4 = Fe2(So4)3 + 3H2
Fe(NO3)2 + K3PO4 = Fe3(PO4)2 + KNO33Fe(NO3)2 + 2K3PO4 = Fe3(PO4)2 + 6KNO3
Fe+ O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 =Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe2S2 + HNO3 = N2O + Fe2(SO4)2 + H2O Fe2S2 + 4HNO3 = 2N2O + Fe2(SO4)2 + 2H2O
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS + NO3 = NO + SO42 + Fe33FeS + 63NO3 = 63NO + 3SO42 + Fe3
FeO3(s) + CO(g) = Fe(l) + CO2(g)FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeC2O4 + CO2 = Fe2(C2O4)32FeC2O4 + 2CO2 = Fe2(C2O4)3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Br2 = FeBr32Fe + 3Br2 = 2FeBr3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + CuSO4 = Cu + FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + MgCl2 = FeCl2 + MgFe + MgCl2 = FeCl2 + Mg
F2 + 2 NaBr = 2 NaF + Br2F2 + 2NaBr = 2NaF + Br2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe++ + HO2- + H2O = OH- + Fe+++2Fe++ + HO2- + H2O = 3OH- + 2Fe+++
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)2 + K3PO4 = Fe3(PO4)2 + KNO33Fe(NO3)2 + 2K3PO4 = Fe3(PO4)2 + 6KNO3
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeCl3(aq)+H2S(aq)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(aq) = Fe2S3(s) + 6HCl(aq)
Fe+2HClO4 = Fe(ClO4)2 + H2Fe + 2HClO4 = Fe(ClO4)2 + H2
Fe +Ni(NO3)2=Fe(NO3)3 +Ni2Fe + 3Ni(NO3)2 = 2Fe(NO3)3 + 3Ni
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2P(s) + S(s) = P4S10(s) + FeS(s)4Fe2P(s) + 18S(s) = P4S10(s) + 8FeS(s)
FeS3 + O2 = Fe2O3 + SO24FeS3 + 15O2 = 2Fe2O3 + 12SO2
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe(s) + SnSO4(aq) = FeSO4(aq) + Sn(s)Fe(s) + SnSO4(aq) = FeSO4(aq) + Sn(s)
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+C=CO+FeFe2O3 + 3C = 3CO + 2Fe
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3+NH4OH=Fe(OH)3+NH4 ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+ HNO3 = Fe(NO3)2 + NO+ H2 O3Fe + 8HNO3 = 3Fe(NO3)2 + 2NO + 4H2O
Fe2 O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+AgNO3= Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + O2 = Fe2 O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe2 + O = FeO6Fe2 + 12O = 2FeO6
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2(SO4)3(aq)+3BaCl2(aq)=3BaSO4(s)+2FeCl3(aq)Fe2(SO4)3(aq) + 3BaCl2(aq) = 3BaSO4(s) + 2FeCl3(aq)
Fe3O4(s) + CO(g) = Fe(s) + CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
F2+KBr=KF+Br2F2 + 2KBr = 2KF + Br2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(s)+Cl2(g)=FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
Fe(s)+S8(s)=Fe2S3(s)16Fe(s) + 3S8(s) = 8Fe2S3(s)
F2 +NH3 =N2F4 +HF5F2 + 2NH3 = N2F4 + 6HF
FeO+O2=Fe2O34FeO + O2 = 2Fe2O3
FeCr2O7 + K2CO3 + O2 = Fe2O3 + K2CrO4 + CO2 4FeCr2O7 + 8K2CO3 + O2 = 2Fe2O3 + 8K2CrO4 + 8CO2
FeCl+H2O2+HCl=FeCl3+H2OFeCl + H2O2 + 2HCl = FeCl3 + 2H2O
FeCl+H2O2+HCl=FeCl3+H2OFeCl + H2O2 + 2HCl = FeCl3 + 2H2O
Fe2O3+ CO= Fe+ CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Br2=FeBr2Fe + Br2 = FeBr2
Fe+H2SO4 = FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe+H2SO4 = FeSO4+H2Fe + H2SO4 = FeSO4 + H2
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3 + NaOH = Fe2O3 + NaCl + H2O2FeCl3 + 6NaOH = Fe2O3 + 6NaCl + 3H2O
Fe(NO3)2 + LIOH +H2O = Fe + LINO3 + H2O0Fe(NO3)2 + 0LIOH + H2O = 0Fe + 0LINO3 + H2O
FeNO3 + LIOH +H2O = Fe + LINO3 + H2O0FeNO3 + 0LIOH + H2O = 0Fe + 0LINO3 + H2O
Fe3O4 + CO = Fe + CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+O2=FeO2Fe + O2 = 2FeO
Fe2O3 =Fe2 + O2 2Fe2O3 = 2Fe2 + 3O2
FeCl2 + H2O + HCl = FeCl3 + H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
FeCl3(aq) + Na3PO4(aq) =FePO4(s) + NaCl(aq) FeCl3(aq) + Na3PO4(aq) = FePO4(s) + 3NaCl(aq)
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe(s) +H2O(g)= Fe3O4(s) +H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe + MgCl2 = FeCl3 + Mg2Fe + 3MgCl2 = 2FeCl3 + 3Mg
FeS + HNO3 = Fe(NO3)2 + H2SFeS + 2HNO3 = Fe(NO3)2 + H2S
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
FeCl3 + AgC2H3O2 = Fe(C2H3O2)3 + AgClFeCl3 + 3AgC2H3O2 = Fe(C2H3O2)3 + 3AgCl
FeBr3 + NaOH = Fe(OH)3 + NaBrFeBr3 + 3NaOH = Fe(OH)3 + 3NaBr
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe2(SO4)3+NH4OH=Fe(OH)3+(NH4)2SO4Fe2(SO4)3 + 6NH4OH = 2Fe(OH)3 + 3(NH4)2SO4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCr2O7 + KCO3 + O2 = Fe2O3 + K2CrO4 + CO24FeCr2O7 + 16KCO3 - 3O2 = 2Fe2O3 + 8K2CrO4 + 16CO2
Fe(OH)3 + HCl = FeCl3 + H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3 + H2S = FeCl2 + HCl + S2FeCl3 + H2S = 2FeCl2 + 2HCl + S
FeS2+O2=FeO3+SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe(s)+ O2(g) + H2O(g) = Fe(OH)2(s)2Fe(s) + O2(g) + 2H2O(g) = 2Fe(OH)2(s)
Fe(NO3)2 + HCl = FeCl2 + HNO3 Fe(NO3)2 + 2HCl = FeCl2 + 2HNO3
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeS + H2SO4 = H2S + FeSO4FeS + H2SO4 = H2S + FeSO4
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(OH)3 + HCl = FeCl3 + H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe(NO3)3 + LiOH = LiNO3 + Fe(OH)3Fe(NO3)3 + 3LiOH = 3LiNO3 + Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe2O3 + H2SO4 = Fe2(SO4)3 + SO2 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 0SO2 + 3H2O
Fe Br3 +H2SO4 = Fe2 (SO4)3+HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(NO3)3 + NH4SCN = Fe(SCN)6 + NO3 + NH4Fe(NO3)3 + 6NH4SCN = Fe(SCN)6 + 3NO3 + 6NH4
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(NO3)2 + K2S = FeS + KNO3Fe(NO3)2 + K2S = FeS + 2KNO3
FeCl3+Na2CO3= Fe2(CO3)3+NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe(NO3)3 + (Na2)2CO3 = Fe2(CO3)3+Na2 (NO3)2Fe(NO3)3 + 3(Na2)2CO3 = Fe2(CO3)3 + 6Na2(NO3)
Fe2O3 + CO= CO2 + Fe Fe2O3 + 3CO = 3CO2 + 2Fe
Fe+ Cl2 = Fe3Cl23Fe + Cl2 = Fe3Cl2
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeCl2 +H2O2+HCl =FeCl3 +H2O 2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl2 +H2O2+HCl =FeCl3 +H2O 2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl2 +H2O+HCl =FeCl3 +H2O 0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
F2 + Al2O3 = AlF3 + O26F2 + 2Al2O3 = 4AlF3 + 3O2
Fe3O4(s)+CO=Fe(s)+CO2(g)Fe3O4(s) + 4CO = 3Fe(s) + 4CO2(g)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4(s)+H2=Fe(s)+H2O(g)Fe3O4(s) + 4H2 = 3Fe(s) + 4H2O(g)
Fe+HNO3=Fe(NO3)3+ NH4NO3+H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe+HNO3=Fe(NO3)3+ NH4NO3+H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe2S2 + HNO3 = N2O + Fe2(SO4)2 + H2O Fe2S2 + 4HNO3 = 2N2O + Fe2(SO4)2 + 2H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl + Na PO4 = FePO4 + NaCl FeCl + NaPO4 = FePO4 + NaCl
FeO + SiO2 = FeSiO3FeO + SiO2 = FeSiO3
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe2O3(s) + C(s) = Fe(s) + CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeCl2 + H2O2 + HCl = FeCl3 + H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(NO3)3 + K2CrO4 = K2(NO3)3 + FeCrO4Fe(NO3)3 + K2CrO4 = K2(NO3)3 + FeCrO4
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe(OH)2(s) + H2O(l) + O2(g) = Fe(OH)3(s)4Fe(OH)2(s) + 2H2O(l) + O2(g) = 4Fe(OH)3(s)
Fe(s) + 2 FeCl3(aq) = 3 FeCl2(aq)Fe(s) + 2FeCl3(aq) = 3FeCl2(aq)
Fe(s) + 2 FeCl3(aq) = 3 FeCl2(aq)Fe(s) + 2FeCl3(aq) = 3FeCl2(aq)
Fe(OH)2 + NaCl = FeCl2 + NaOHFe(OH)2 + 2NaCl = FeCl2 + 2NaOH
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + MgSO4 = Mg + FeSO4Fe + MgSO4 = Mg + FeSO4
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeCl3 (aq) + 3NaC2H3O2 (aq) + H2O = Fe(OH)3 (aq) + 3NaCl + 3C2H3O2- +H2O0FeCl3(aq) + 0NaC2H3O2(aq) + H2O = 0Fe(OH)3(aq) + 0NaCl + 0C2H3O2- + H2O
Fe(s) + O2(g) = Fe2O34Fe(s) + 3O2(g) = 2Fe2O3
Fe+O2+H2O=Fe2O3H2O4Fe + 3O2 + 2H2O = 2Fe2O3H2O
Fe(OH)3 = Fe2O3 +H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3 = FeCl2 + Cl22FeCl3 = 2FeCl2 + Cl2
FeS2 = Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe2+ +4H2O = Fe3O4 +4H2O0Fe2+ + H2O = 0Fe3O4 + H2O
FeS2 =Fe3S4 +S23FeS2 = Fe3S4 + S2
FeCO3(s)+H2CO3(aq)=Fe(HCO3)2(aq)FeCO3(s) + H2CO3(aq) = Fe(HCO3)2(aq)
Fe2O3(s)+HNO3(aq)= Fe(NO3)3(aq)+H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
FeCl3+SnCl2=FeCl2+SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe(s)+O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + O2 + H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+ Ca(OH)2 = Fe(OH)3 + CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2+HCl=FeCl2+H2Fe2 + 4HCl = 2FeCl2 + 2H2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(s)+H2O(l)=Fe3O4(s)+H23Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2
Fe+H2O=H2+Fe3O43Fe + 4H2O = 4H2 + Fe3O4
Fe2O3(s)+CO(g) = 2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + Na2SO4 = FeSO4 + Na2Fe + Na2SO4 = FeSO4 + Na2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS + 2HCl = H2S + FeCl2FeS + 2HCl = H2S + FeCl2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2+K3PO4 =Fe3 (PO4)2+ KCl3FeCl2 + 2K3PO4 = Fe3(PO4)2 + 6KCl
FeSO4+K2Cr2O7+H2SO4=Fe2(SO4)3+Cr2(SO4)3+K2SO4+H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeSO4+K2Cr2O7+H2SO4=Fe2(SO4)3+Cr2(SO4)3+K2SO4+H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
FeSO4+KMnO4+H2SO4 =Fe2(SO4)3+MnSO4+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
FeCr2O7+K2CO3+O2=Fe2O3+K2CrO4+CO24FeCr2O7 + 8K2CO3 + O2 = 2Fe2O3 + 8K2CrO4 + 8CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l) 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe(NO3)3+3LiOH=3LiNO3+Fe(OH)3Fe(NO3)3 + 3LiOH = 3LiNO3 + Fe(OH)3
Fe + S8 = Fe2S316Fe + 3S8 = 8Fe2S3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(NO3)2 + K2S = FeS + K2(NO3)2Fe(NO3)2 + K2S = FeS + K2(NO3)2
Fe + FeCl3 = FeCl2Fe + 2FeCl3 = 3FeCl2
Fe2O3 +CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe + S8 = Fe2S316Fe + 3S8 = 8Fe2S3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO+CO=Fe+CO2FeO + CO = Fe + CO2
Fe + Cl2 = FeCl3 2Fe + 3Cl2 = 2FeCl3
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
FeS+NO3- + H+ =Fe+++ + NO2+ S +H2OFeS + 3NO3- + 6H+ = Fe+++ + 3NO2 + S + 3H2O
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3 + Pb(NO3)2 = Fe(NO3)3 + Pb2Fe3 + 9Pb(NO3)2 = 6Fe(NO3)3 + 9Pb
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+O2= Fe2O34Fe + 3O2 = 2Fe2O3
Fe(C2H3O2)3+Ba(OH)2=Fe(OH)3+Ba(C2H3O2)22Fe(C2H3O2)3 + 3Ba(OH)2 = 2Fe(OH)3 + 3Ba(C2H3O2)2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 =Fe3S4 + S23FeS2 = Fe3S4 + S2
Fe2O3 + CO =CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2(SO4)3 + Al = Al2(SO4)3 + FeFe2(SO4)3 + 2Al = Al2(SO4)3 + 2Fe
Fe+FeCl3=FeCl2Fe + 2FeCl3 = 3FeCl2
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe + H3PO4=Fe (H2PO4)3 + H2 2Fe + 6H3PO4 = 2Fe(H2PO4)3 + 3H2
Fe + H3PO4=Fe (H2PO4)3 + H2 2Fe + 6H3PO4 = 2Fe(H2PO4)3 + 3H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+HCl=FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe2(SO4)3 +KOH = K2 (SO4) + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2(SO4) + 2Fe(OH)3
Fe2O3 + H2=Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+3KSCN=Fe(SCN)3+3KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe2O3 (s) + C (s) =Fe (s) + CO2 (g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
F2 + NaOH = NaF + O2 + H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
F2 + NaOH = NaF + O2 + H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
F2 + NaOH = NaF + O2 + H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
F2 + NaOH = NaF + O2 + H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
Fe+ H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3 +C = Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe(PO4)+Na2(SO4) = Fe2(SO4)3+Na3(PO4)2Fe(PO4) + 3Na2(SO4) = Fe2(SO4)3 + 2Na3(PO4)
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2(CO3)3+HCl=FeCl3+CO2+H2OFe2(CO3)3 + 6HCl = 2FeCl3 + 3CO2 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 =Fe2O34Fe + 3O2 = 2Fe2O3
Fe +O2 =Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2=FeO2Fe + O2 = 2FeO
Fe2O3 + 3Zn = 3ZnO2 + 2Fe2Fe2O3 + 3Zn = 3ZnO2 + 4Fe
Fe2O2+C=Fe+COFe2O2 + 2C = 2Fe + 2CO
Fe(OH)2+H4CO4=Fe2(CO4)+H2O2Fe(OH)2 + H4CO4 = Fe2(CO4) + 4H2O
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe+Cl=FeCl3Fe + 3Cl = FeCl3
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe+ Zn(OH)2 = Fe(OH) + Zn2Fe + Zn(OH)2 = 2Fe(OH) + Zn
Fe + 2HCl= FeCl2+H2Fe + 2HCl = FeCl2 + H2
FeBr3(aq) + Na3PO4(aq) = FePO4(s) + 3 NaBr(aq)FeBr3(aq) + Na3PO4(aq) = FePO4(s) + 3NaBr(aq)
Fe + HNO3 =Fe(NO3)3 + NH4NO3 + H2O8Fe + 30HNO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.