Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O4Fe + O2 = 2Fe2O
Fe+O2=Fe2O4Fe + O2 = 2Fe2O
FeSO4 + KMnO4 = MnO2 + Fe2O3 + K2O + SO2 6FeSO4 - 2KMnO4 = -2MnO2 + 3Fe2O3 - K2O + 6SO2
FeSO4 + KMnO4 = MnO2 + Fe2O3 + K2O + SO26FeSO4 - 2KMnO4 = -2MnO2 + 3Fe2O3 - K2O + 6SO2
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe + CuS04 = FeS04 + CuFe + CuS04 = FeS04 + Cu
Fe + HNO3 = Fe(NO3)2 + H2Fe + 2HNO3 = Fe(NO3)2 + H2
Fe + CuS04 = FeS04 + CuFe + CuS04 = FeS04 + Cu
Fe3O4+H2=Fe3H2O4Fe3O4 + H2 = Fe3H2O4
Fe3O4+H2=Fe3H2O4Fe3O4 + H2 = Fe3H2O4
Fe3O4+H2=Fe3H2O4Fe3O4 + H2 = Fe3H2O4
Fe2O3 + CO = Fe +CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + C = CO + FeFe2O3 + 3C = 3CO + 2Fe
FeS + O2= Fe2O3 + SO2 4FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe O2 + CO= Fe + CO2FeO2 + 2CO = Fe + 2CO2
FeO3 + C = Fe + COFeO3 + 3C = Fe + 3CO
FeO3 + C = Fe + COFeO3 + 3C = Fe + 3CO
Fe(OH)3 + H2SO4 = Fe(HSO4)3 + H2OFe(OH)3 + 3H2SO4 = Fe(HSO4)3 + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)2 + NH4OH = NH4NO3 + Fe(OH)2Fe(NO3)2 + 2NH4OH = 2NH4NO3 + Fe(OH)2
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe+ CrO4= FeCrO4Fe + CrO4 = FeCrO4
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe+O2=FeO2Fe + O2 = 2FeO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
F2 (g) + LiCl (aq) = LiF (aq) + Cl2 (l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
Fe+(NO3)2 = Fe(NO3)2Fe + (NO3)2 = Fe(NO3)2
Fe+MgCl2=Mg+FeCl32Fe + 3MgCl2 = 3Mg + 2FeCl3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3+3CO=3CO2+2FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O2+CO = Fe+CO0Fe2O2 + CO = 0Fe + CO
Fe2O2+CO = Fe+CO0Fe2O2 + CO = 0Fe + CO
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeCl2+NaOH=Fe2+NaCl(OH)2FeCl2 + 4NaOH = Fe2 + 4NaCl(OH)
FeCl2+NaOH=Fe2+NaCl(OH)2FeCl2 + 4NaOH = Fe2 + 4NaCl(OH)
FeCl2+NaOH=Fe(OH)2+NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
FeCl2+2NaOH=Fe(OH)2+2NaClFeCl2 + 2NaOH = Fe(OH)2 + 2NaCl
Fe+HC2H3O2=Fe(C2H3O2)3+H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
FeCl2+H2O2+HCl=FeCl3+H2O2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
F2+N2=NF33F2 + N2 = 2NF3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+F2=FeF32Fe + 3F2 = 2FeF3
Fe3O4 + KMnO4 + H2SO4 = Fe2(SO4)3 + K2SO4 + MnSO4 + H2O10Fe3O4 + 2KMnO4 + 48H2SO4 = 15Fe2(SO4)3 + K2SO4 + 2MnSO4 + 48H2O
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe2O3(s) + C(s)= Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe(s) + O2(g) + H2O(l) = Fe(OH)2(aq)2Fe(s) + O2(g) + 2H2O(l) = 2Fe(OH)2(aq)
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe2O3 + CO = Fe(CO)5 +CO2Fe2O3 + 13CO = 2Fe(CO)5 + 3CO2
Fe2O3 + CO = Fe(CO)5 +CO2Fe2O3 + 13CO = 2Fe(CO)5 + 3CO2
Fe2O3 + CO = Fe(CO)5 +CO2Fe2O3 + 13CO = 2Fe(CO)5 + 3CO2
Fe2O3 + CO = Fe(CO)5 +CO2Fe2O3 + 13CO = 2Fe(CO)5 + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + KH2PO4= FePO4 + 2H + KFe + KH2PO4 = FePO4 + 2H + K
Fe + Cu(NO3)2 = Cu + Fe(NO3)2Fe + Cu(NO3)2 = Cu + 2Fe(NO3)
FeS2=Fe3S4+S23FeS2 = Fe3S4 + S2
FeSO4+Zn= ZnSO4+FeFeSO4 + Zn = ZnSO4 + Fe
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+I2=FeI32Fe + 3I2 = 2FeI3
FeCl + NaOH= FeOH + NaClFeCl + NaOH = FeOH + NaCl
FeS2+ O2= Fe2O+ SO4FeS2 + 5O2 = 2Fe2O + 8SO
Fe2 + CuSO4= FeSO4 + CuFe2 + 2CuSO4 = 2FeSO4 + 2Cu
F2 + CuSO4= FSO4 + CuF2 + 2CuSO4 = 2FSO4 + 2Cu
Fe + I2 = FeI32Fe + 3I2 = 2FeI3
Fe + I2 = FeI32Fe + 3I2 = 2FeI3
Fe3(PO4)2+AgNO3=Fe3NO3+Ag(PO4)2Fe3(PO4)2 + AgNO3 = Fe3NO3 + Ag(PO4)2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(s)+O2(g)=Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
Fe+H2SO4 = Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+Ni(OH)2=Ni+Fe(OH)32Fe + 3Ni(OH)2 = 3Ni + 2Fe(OH)3
FeS + 2HCl = H2S +FeCl2FeS + 2HCl = H2S + FeCl2
Fe2O3+CO(g)=Fe+CO2Fe2O3 + 3CO(g) = 2Fe + 3CO2
Fe+Ni(OH)2 =Ni +Fe(OH)32Fe + 3Ni(OH)2 = 3Ni + 2Fe(OH)3
Fe+Ni(OH)2 =Ni +Fe(OH)32Fe + 3Ni(OH)2 = 3Ni + 2Fe(OH)3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2 + AgNO3 = AgCl + Fe(NO3)2FeCl2 + 2AgNO3 = 2AgCl + Fe(NO3)2
FeCl3 +NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeCl3 +NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS2+ O2= Fe2O3+ SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2O = Fe(OH)3 + HFe + 3H2O = Fe(OH)3 + 3H
Fe + H2O = FeOH + HFe + H2O = FeOH + H
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Cl2 = FeCl2Fe + Cl2 = FeCl2
Fe2(SO4)3+KSCN=K3Fe(SCN)6+K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
FeO4(s) + H2(g) = Fe(s) + H2O(g)FeO4(s) + 4H2(g) = Fe(s) + 4H2O(g)
Fe3O4(s) + CO(g) = Fe(s) + CO2(g)Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe2O3(s) + H2(g) = Fe(s) + H2O(g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
FeO(s) + H2(g) = Fe(s) + H2O(g)FeO(s) + H2(g) = Fe(s) + H2O(g)
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeSO4 + HBrO3 + H2SO4 = Fe(SO4)3 + HBr + H2O 3FeSO4 + 2HBrO3 + 6H2SO4 = 3Fe(SO4)3 + 2HBr + 6H2O
FeO+NH4Cl=(NH4)2O+FeCl2FeO + 2NH4Cl = (NH4)2O + FeCl2
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2P + FeS2 = FeS + P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(CO3)+H2O+O2 =CO2+Fe(OH)34Fe(CO3) + 6H2O + O2 = 4CO2 + 4Fe(OH)3
Fe(Co3)+H2O+O2 =Co2+Fe(OH)34Fe(Co3) + 6H2O + 3O2 = 6Co2 + 4Fe(OH)3
Fe(NO3)3+NH4OH=Fe(OH)3+NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
Fe(NO3)3+NH4OH=Fe(OH)3+NH4NO3Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4NO3
Fe(NO3)3+Na3PO4=FePO4+NaNO3Fe(NO3)3 + Na3PO4 = FePO4 + 3NaNO3
Fe(NO3)3+Na2S=Fe2S3+NaNO32Fe(NO3)3 + 3Na2S = Fe2S3 + 6NaNO3
Fe(NO3)3+NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe(NO3)3+K2CrO4=Fe2(CrO4)3+KNO32Fe(NO3)3 + 3K2CrO4 = Fe2(CrO4)3 + 6KNO3
Fe(s)+O2(g)+H20(l)=Fe (OH)2 (aq)10Fe(s) + 10O2(g) + H20(l) = 10Fe(OH)2(aq)
Fe(s) + H2O(g) = FeO(s) + H2(g)Fe(s) + H2O(g) = FeO(s) + H2(g)
Fe2O3 + C = Fe + COFe2O3 + 3C = 2Fe + 3CO
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=FeO32Fe + 3O2 = 2FeO3
FeSO4 + Cu3PO4 = Cu2SO4 + Fe3(PO4)23FeSO4 + 2Cu3PO4 = 3Cu2SO4 + Fe3(PO4)2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeSO4 + Cu3PO4 = Cu2SO4 + Fe3(PO4)23FeSO4 + 2Cu3PO4 = 3Cu2SO4 + Fe3(PO4)2
FeSO4 + Cu3PO4 = Cu2SO4 + Fe3(PO4)23FeSO4 + 2Cu3PO4 = 3Cu2SO4 + Fe3(PO4)2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeCl3+Be3(PO4)2=BeCl2+FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe(NO3)3=Fe+(NO3)3Fe(NO3)3 = Fe + (NO3)3
Fe+H2O=H2+Fe2O32Fe + 3H2O = 3H2 + Fe2O3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS+O2+H20=Fe2O3+H2SO420FeS + 55O2 + 2H20 = 10Fe2O3 + 20H2SO4
Fe + CuNO3 = Fe(NO3)2 + CuFe + 2CuNO3 = Fe(NO3)2 + 2Cu
Fe+CuSO4 = Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
FeCl3 + Mg = MgCl2 + Fe2FeCl3 + 3Mg = 3MgCl2 + 2Fe
Fe(ClO4)2(aq)+Na2CO3(aq) = FeCO3(s) + NaClO4(aq)Fe(ClO4)2(aq) + Na2CO3(aq) = FeCO3(s) + 2NaClO4(aq)
Fe2O3(s) + C(s) = Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe++ + Cr2O7-- + H+ = Fe+++ + Cr+++ + H2O6Fe++ + Cr2O7-- + 14H+ = 6Fe+++ + 2Cr+++ + 7H2O
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe (s) + Cu(PO4)2 (aq) = FePO4 (s) + Cu(s)2Fe(s) + Cu(PO4)2(aq) = 2FePO4(s) + Cu(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3+H2SO4=FeSO4+H2Cl3FeCl3 + H2SO4 = FeSO4 + H2Cl3
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3 + 6NaNO3 +3H2O = 2Fe(NO3)3 + 6NaOHFe2O3 + 6NaNO3 + 3H2O = 2Fe(NO3)3 + 6NaOH
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3+NH4SCN=FeSCN+NH4Cl3FeCl3 + NH4SCN = FeSCN + NH4Cl3
Fe2O3+6H=2Fe+3H2OFe2O3 + 6H = 2Fe + 3H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + CO = 2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe +Cl=FeClFe + Cl = FeCl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe2O3 + CO = 2Fe + CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
Fe + O2 +H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe + O2 +H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+HCl=H2+FeCl2Fe + 2HCl = H2 + FeCl2
Fu2 + Cy2 = Fu2Cy2Fu2 + Cy2 = 2Fu2Cy
Fu2 + Dm2 = Fu2Dm2Fu2 + Dm2 = 2Fu2Dm
Fe+O2=Fe3O43Fe + 2O2 = Fe3O4
FeCl3+KOH=KCl+Fe(OH)3FeCl3 + 3KOH = 3KCl + Fe(OH)3
FeCl3+KOH=KCl+Fe(OH)3FeCl3 + 3KOH = 3KCl + Fe(OH)3
FeS+HCl=H2S+FeCl2FeS + 2HCl = H2S + FeCl2
FeO(s) + CO2(g) = FeCO3(s)FeO(s) + CO2(g) = FeCO3(s)
FeS+HCl=H2S+FeCl2FeS + 2HCl = H2S + FeCl2
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+KOH=KCl+Fe(OH)3FeCl3 + 3KOH = 3KCl + Fe(OH)3
FeCl3+KOH=KCl+Fe(OH)3FeCl3 + 3KOH = 3KCl + Fe(OH)3
Fe + H2SO4 = FeSO4+ H2Fe + H2SO4 = FeSO4 + H2
F2+H2O=HF+O33F2 + 3H2O = 6HF + O3
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + H2SO4 = Fe2(SO4)3 + H2S +H2O8Fe + 15H2SO4 = 4Fe2(SO4)3 + 3H2S + 12H2O
Fe+6HCl=FeCl6+H6Fe + 6HCl = FeCl6 + H6
FeS + HNO3 = Fe(NO3)3 + S + NO2 + H2OFeS + 6HNO3 = Fe(NO3)3 + S + 3NO2 + 3H2O
Fe2P+FeS2=Fe2S3+P2S52Fe2P + 22FeS2 = 13Fe2S3 + P2S5
Fe+H2O = Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(NO3)3 + NaI = FeI3 + NaNO3Fe(NO3)3 + 3NaI = FeI3 + 3NaNO3
Fe(NO3)3 + K3PO4 = FePO4 + KNO3Fe(NO3)3 + K3PO4 = FePO4 + 3KNO3
FeCl3 + NaOH = Fe(OH)3 +NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + H2O + O2 = FeOH2Fe + H2O + 0O2 = FeOH2
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe(s)+S8(s)=FeS(s)8Fe(s) + S8(s) = 8FeS(s)
Fe2O3(s)+H2(g)=Fe(s)+H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe(s)+H2O(g)=H2(g)+Fe3O4(s)3Fe(s) + 4H2O(g) = 4H2(g) + Fe3O4(s)
Fe(s)+H2O(g)=H2(g)+Fe3O43Fe(s) + 4H2O(g) = 4H2(g) + Fe3O4
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe + H2(SO4) = Fe2(SO4)3 + H22Fe + 3H2(SO4) = Fe2(SO4)3 + 3H2
Fe(NO3)2(aq) + H2S(g) = FeS(s) + HNO3(aq)Fe(NO3)2(aq) + H2S(g) = FeS(s) + 2HNO3(aq)
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
F2+H2O=HF+O22F2 + 2H2O = 4HF + O2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+ Ni(OH)2 = Ni + Fe(OH)32Fe + 3Ni(OH)2 = 3Ni + 2Fe(OH)3
Fe2O3(s) + CO(g) = 2 Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3 + H2SO4 = H2O + Fe2(SO4)32Fe(OH)3 + 3H2SO4 = 6H2O + Fe2(SO4)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+H2O=Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe3O4(s) + CO(g) = CO2(g) + Fe(s)Fe3O4(s) + 4CO(g) = 4CO2(g) + 3Fe(s)
FeCl3(aq) + Na2CO3(aq) = Fe2(CO3)3(s) + NaCl(aq)2FeCl3(aq) + 3Na2CO3(aq) = Fe2(CO3)3(s) + 6NaCl(aq)
Fe(NO3)2(aq) + NaOH(aq) = Fe(OH)2(s) + NaNO3(aq) Fe(NO3)2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaNO3(aq)
FeCl2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaCl(aq)3FeCl2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaCl(aq)
FeCl2(aq) + Na2CO3(aq) = FeCO3(s) + NaCl(aq)FeCl2(aq) + Na2CO3(aq) = FeCO3(s) + 2NaCl(aq)
FeCl3(aq)+H2S(g)=Fe2S3(s)+HCl(aq)2FeCl3(aq) + 3H2S(g) = Fe2S3(s) + 6HCl(aq)
FeS+O2+H2O=Fe2O3+H2SO44FeS + 9O2 + 4H2O = 2Fe2O3 + 4H2SO4
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + NaOH = Fe(OH)3 + Na2SO4Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
Fe + O = Fe2O32Fe + 3O = Fe2O3
Fe(NO3)3 + 3HCl = FeCl3 + 3HNO3Fe(NO3)3 + 3HCl = FeCl3 + 3HNO3
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl2 + (NH4)3 PO3 = Fe3 (PO3)2 + NH4Cl3FeCl2 + 2(NH4)3PO3 = Fe3(PO3)2 + 6NH4Cl
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FePO4 + AgNO3 = FeNO3 + AgPO4FePO4 + AgNO3 = FeNO3 + AgPO4
FeO+Al=AlO +FeFeO + Al = AlO + Fe
Fe2O3 +HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + O = FeOFe + O = FeO
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe2O3(s)+CO(g)=Fe(l)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(l) + 3CO2(g)
Fe(s)+HCl(l)=FeCl3( aq)+H2(g)2Fe(s) + 6HCl(l) = 2FeCl3(aq) + 3H2(g)
Fe(NO3)3(aq) + 3KSCN = Fe(SCN)3 + 3KNO3Fe(NO3)3(aq) + 3KSCN = Fe(SCN)3 + 3KNO3
Fe(s)+O2=Fe2O3(s)4Fe(s) + 3O2 = 2Fe2O3(s)
F2 + PF5 = PF3-1F2 + PF5 = PF3
F2 + PF5 = PF3-1F2 + PF5 = PF3
FeCl3+Na2CO3 = Fe2C3O9+NaCl2FeCl3 + 3Na2CO3 = Fe2C3O9 + 6NaCl
Fe2(SO4)3 (aq) + KOH (aq) = K2SO4 (aq) + Fe(OH)3 (s)Fe2(SO4)3(aq) + 6KOH(aq) = 3K2SO4(aq) + 2Fe(OH)3(s)
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + H2O6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + 7H2O
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + H2020FeSO4 + 0K2Cr2O7 + 10H2SO4 = 10Fe2(SO4)3 + 0K2SO4 + 0Cr2(SO4)3 + H20
FeSO4 + KNO3 + H2SO4 = Fe2(SO4)3 + NO + K2SO4 + H2O6FeSO4 + 2KNO3 + 4H2SO4 = 3Fe2(SO4)3 + 2NO + K2SO4 + 4H2O
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + K2SO4 + Cr2(SO4)3 + H2020FeSO4 + 0K2Cr2O7 + 10H2SO4 = 10Fe2(SO4)3 + 0K2SO4 + 0Cr2(SO4)3 + H20
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq)Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
Fe3(PO4)2 + AgNO3 = Fe3NO3 + Ag(PO4)2Fe3(PO4)2 + AgNO3 = Fe3NO3 + Ag(PO4)2
Fe2O3+ H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe+HCl=H2+FeCl2Fe + 2HCl = H2 + FeCl2
FeO + C = Fe + CO22FeO + C = 2Fe + CO2
Fe(OH)2+KClO+H2O=Fe(OH)3+KCl2Fe(OH)2 + KClO + H2O = 2Fe(OH)3 + KCl
FeO + HNO3 = Fe(NO3)3 + NO + H2O3FeO + 10HNO3 = 3Fe(NO3)3 + NO + 5H2O
Fe + Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
Fe + Zn(NO3) 2=Fe(NO3) 3 + Zn2Fe + 3Zn(NO3)2 = 2Fe(NO3)3 + 3Zn
Fe(s) + 2HNO3(aq) = H2O(l) + NO2- + FeFe(s) + 0HNO3(aq) = 0H2O(l) + 0NO2- + Fe
F2(g) + LiCl(aq) = LiF(aq) + Cl2(l)F2(g) + 2LiCl(aq) = 2LiF(aq) + Cl2(l)
F2(g) + LiCl(aq) = LiF(g) + Cl2(l)F2(g) + 2LiCl(aq) = 2LiF(g) + Cl2(l)
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(NO3)3(aq)+H2CO3(aq)=Fe2(CO3)3(s)+HNO3(aq)2Fe(NO3)3(aq) + 3H2CO3(aq) = Fe2(CO3)3(s) + 6HNO3(aq)
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O= Fe2O32Fe + 3O = Fe2O3
Fe2O3 = Fe + OFe2O3 = 2Fe + 3O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
FeCl3 + (NH4)2S = Fe2S3 + NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe2(SO4)3+K(SCN)=K3Fe(SCN)6+K2SO4Fe2(SO4)3 + 12K(SCN) = 2K3Fe(SCN)6 + 3K2SO4
Fe(OH)2=FeO + H2OFe(OH)2 = FeO + H2O
Fe+O2=Fe2 O34Fe + 3O2 = 2Fe2O3
Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + NaNO3(aq)Fe(NO3)3(aq) + Na3PO4(aq) = FePO4(s) + 3NaNO3(aq)
FePO4(s)=FePO3(s)+O2(g)2FePO4(s) = 2FePO3(s) + O2(g)
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe(NO3)3(aq) + Na2CO3(aq) = Fe2(CO3)3(s) + NaNO3(aq)2Fe(NO3)3(aq) + 3Na2CO3(aq) = Fe2(CO3)3(s) + 6NaNO3(aq)
FeCl3(aq) + NaOH(aq) = Fe(OH)3(s) + NaClFeCl3(aq) + 3NaOH(aq) = Fe(OH)3(s) + 3NaCl
Fe(NO3)2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaNO3(aq)3Fe(NO3)2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaNO3(aq)
Fe(NO3)2(aq) + Na2CO3(aq) = FeCO3(s) + NaNO3(aq)Fe(NO3)2(aq) + Na2CO3(aq) = FeCO3(s) + 2NaNO3(aq)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeSO4+Na3PO4=Fe3(PO4)2+Na2SO43FeSO4 + 2Na3PO4 = Fe3(PO4)2 + 3Na2SO4
Fe(NO3)2(aq) + Na2CO3(aq) = FeCO3(s) + NaNO3(aq)Fe(NO3)2(aq) + Na2CO3(aq) = FeCO3(s) + 2NaNO3(aq)
FeCl2(aq) + NaOH(aq) = Fe(OH)2(s) + NaClFeCl2(aq) + 2NaOH(aq) = Fe(OH)2(s) + 2NaCl
FeCl3 + (NH4)2S = NH4Cl + Fe2S32FeCl3 + 3(NH4)2S = 6NH4Cl + Fe2S3
FeCl3(aq) + Na3PO4(aq) = FePO4(s) + NaCl(aq)FeCl3(aq) + Na3PO4(aq) = FePO4(s) + 3NaCl(aq)
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl2(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + NaCl(aq)3FeCl2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaCl(aq)
FeO + C = Fe + CO22FeO + C = 2Fe + CO2
Fe + O2 = FeO2Fe + O2 = 2FeO
FeS2 + O2= Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + NH4OH = Fe(OH)3 + 3NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeSO4+Na3PO4=Fe3(PO4)2+Na2SO43FeSO4 + 2Na3PO4 = Fe3(PO4)2 + 3Na2SO4
F2 + NaI = NaF2 + I22F2 + 2NaI = 2NaF2 + I2
FeCl3 + CuSo4 = FeSo4 + CuCl3FeCl3 + CuSo4 = FeSo4 + CuCl3
FeCl3 + CuSo4 = FeSo4 + CuCl3FeCl3 + CuSo4 = FeSo4 + CuCl3
Fe(s)+CuNO3(aq)=Cu(s)+Fe(NO3)2(aq)Fe(s) + 2CuNO3(aq) = 2Cu(s) + Fe(NO3)2(aq)
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+Cd(NO3)2= Fe(NO3)3 + Cd2Fe + 3Cd(NO3)2 = 2Fe(NO3)3 + 3Cd
FeCO3 + H2CO3 = Fe(HCO3)2FeCO3 + H2CO3 = Fe(HCO3)2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3 + HNO3 = Fe(NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
FeS + HCl = FeCl2 + H2S FeS + 2HCl = FeCl2 + H2S
Fe + H2SO4 = Fe2(SO4)3 + H2 2Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
FeCl2(aq)+Na2S(aq)=FeS(s)+2NaCl(aq)FeCl2(aq) + Na2S(aq) = FeS(s) + 2NaCl(aq)
FeCl2(aq)+Na2S(aq)=FeS(s)+2NaCl(aq)FeCl2(aq) + Na2S(aq) = FeS(s) + 2NaCl(aq)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2(CO3)3 +HClO3 = Fe(ClO3)3 +CO2 +H2OFe2(CO3)3 + 6HClO3 = 2Fe(ClO3)3 + 3CO2 + 3H2O
Fe(OH)3 + H2S = Fe2S3 + H2O2Fe(OH)3 + 3H2S = Fe2S3 + 6H2O
FeSO4+(NH4)2S=FeS+(NH4)2SO4FeSO4 + (NH4)2S = FeS + (NH4)2SO4
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(s)+S(l)=Fe 2 S 3 (s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeSO4+NaOH=Fe(OH)2+Na2+SO4FeSO4 + 2NaOH = Fe(OH)2 + Na2 + SO4
Fe2P+FeS2=FeS+P4S104Fe2P + 18FeS2 = 26FeS + P4S10
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeSO4(aq) + Na3PO4(aq) =Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
F+H2O=HF+OHF + H2O = HF + OH
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe++ + Sn++++ = Fe+++ + Sn++2Fe++ + Sn++++ = 2Fe+++ + Sn++
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3+CO=Fe3O4+CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe (OH)3+H2SO4=Fe2 (SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeSO4(s)+Ag(s)=FeAg+SO4FeSO4(s) + Ag(s) = FeAg + SO4
FeCl3 + Na2CO3 = Fe2C3O9 + NaCl2FeCl3 + 3Na2CO3 = Fe2C3O9 + 6NaCl
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
Fe2(SO4)3 + K(SCN) = K3Fe(SCN)6 + K2SO4Fe2(SO4)3 + 12K(SCN) = 2K3Fe(SCN)6 + 3K2SO4
Fe(OH)3 + 3H2SO4=Fe2(SO4)3 + 6H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4(s)+H2(g)=Fe(s)+H2O(g)Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
Fe3(SO4)2 + ZnSO4 = Zn + Fe3(SO4)2Fe3(SO4)2 + 0ZnSO4 = 0Zn + Fe3(SO4)2
Fe(s) +AlCl3(aq) =FeCl +Al3Fe(s) + AlCl3(aq) = 3FeCl + Al
Fe +Cl2=FeCl2Fe + Cl2 = FeCl2
Fe + O2= Fe2O22Fe + O2 = Fe2O2
Fe3O4 + HNO3 = Fe(NO3)3 + NO + H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe + H2SO4 = FeSO4 + HFe + H2SO4 = FeSO4 + 2H
Fe2S3 + 5 O = 2 FeSO4 + SO2Fe2S3 + 10O = 2FeSO4 + SO2
Fe2S3 + 5 O2 = 2 FeSO4 + SO2Fe2S3 + 5O2 = 2FeSO4 + SO2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+CO=Fe+CO2 Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4(s)+O2(g)=Fe2O3(s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
FeSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Fe(NO3)2(aq)FeSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Fe(NO3)2(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe3 + S = Fe2S32Fe3 + 9S = 3Fe2S3
Fe3 + S = Fe2S22Fe3 + 6S = 3Fe2S2
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
FeCl2 + Na3PO4 = Fe3(PO4)2 + NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl3 + SnCl2 = FeCl2 + SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fr+F2=FrF2Fr + F2 = FrF2
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe(NO3)3+NaOH=Fe(OH)3+NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe2O3+H2=2Fe+3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3+H2O =Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeBr3 + (NH4)2S = Fe2S3 + NH4Br2FeBr3 + 3(NH4)2S = Fe2S3 + 6NH4Br
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl3 + Pb(NO3)2 = Fe(NO3)3 +PbCl22FeCl3 + 3Pb(NO3)2 = 2Fe(NO3)3 + 3PbCl2
Fe(OH)2=FeO+H2OFe(OH)2 = FeO + H2O
FeCl2+KMnO4+HCl = FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl2+KMnO4+HCl = FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
FeCl3 + Ag(NO3) = Fe(NO3)3 + AgClFeCl3 + 3Ag(NO3) = Fe(NO3)3 + 3AgCl
FeCl3 + NH4 SCN = (FeSCN)Cl2+ NH4 ClFeCl3 + NH4SCN = (FeSCN)Cl2 + NH4Cl
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeS + O2 = Fe2O3 + SO34FeS + 9O2 = 2Fe2O3 + 4SO3
FeS + O2 = Fe2O3 + SO34FeS + 9O2 = 2Fe2O3 + 4SO3
FeCr2O7 + K2CO3 + O2 = K2CrO4 + Fe2O3 + CO24FeCr2O7 + 8K2CO3 + O2 = 8K2CrO4 + 2Fe2O3 + 8CO2
Fe+ZnSO4=FeSO4+ZnFe + ZnSO4 = FeSO4 + Zn
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe 2 O 3 +CO=Fe+CO 2Fe2O3 + 3CO = 2Fe + 3CO2
Fe 2 O 3 +CO=Fe+CO 2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+C(s)=Fe(s)+CO(g)Fe2O3 + 3C(s) = 2Fe(s) + 3CO(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
FeS = Fe3S4 + S2-6FeS = -2Fe3S4 + S2
Fe2+ + MnO2+ + H = Fe3+ + Mn2+ H2O-6Fe2+ + 2MnO2+ + 8H = -4Fe3+ + Mn2 + 4H2O
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
Fe+HC2H3O2=Fe(C2H3O2)3+H22Fe + 6HC2H3O2 = 2Fe(C2H3O2)3 + 3H2
Fe+CuSO4=FeSO4+CuFe + CuSO4 = FeSO4 + Cu
Fe2+ + H3AsO4 = Fe3+ + HAsO2 + H2O + H+6Fe2+ - H3AsO4 = 4Fe3+ - HAsO2 - 2H2O + 2H+
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeO+O2=Fe3O46FeO + O2 = 2Fe3O4
Fe(ClO4)2+K2S=FeS+2KClO4Fe(ClO4)2 + K2S = FeS + 2KClO4
FeSO4(aq) + Na3PO4(aq) = Fe3(PO4)2(s) + Na2SO4(aq)3FeSO4(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 3Na2SO4(aq)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + AlCl3 = FeCl + Al3Fe + AlCl3 = 3FeCl + Al
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+AgNO3=Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3(s)+C(s)=Fe(s)+CO(g)Fe2O3(s) + 3C(s) = 2Fe(s) + 3CO(g)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3 + (NH4)2SO4 + NaOH = Na2SO4 + NH4 + Fe6(OH)12(SO4)43Fe2(SO4)3 + (NH4)2SO4 + 12NaOH = 6Na2SO4 + 2NH4 + Fe6(OH)12(SO4)4
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl2+K2S=FeS+KClFeCl2 + K2S = FeS + 2KCl
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe(s)+H2O(l)=Fe3O4(s)+H2(g)3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeO(s)+H2(g)=Fe(s)+H2O(g)FeO(s) + H2(g) = Fe(s) + H2O(g)
FeO(s)+H2(g)=Fe(s)+H2O(g)=FeO(s) + H2(g) = Fe(s) + H2O(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe + S = FeSFe + S = FeS
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Cl=FeCl2Fe + 2Cl = FeCl2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeCl2+ H2O + HCl = FeCl3+ H2O0FeCl2 + H2O + 0HCl = 0FeCl3 + H2O
Fe3O4+CO=Fe+CO2Fe3O4 + 4CO = 3Fe + 4CO2
Fe2O3+HClO4=Fe(ClO4)3+H2OFe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) + H2O(l)Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2O(l)
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+HClO4=Fe (ClO4) 3+H2OFe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(s) + H2O(g) = Fe3O4(s) + H2(g) 3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(OH)2+CO2=FeCO3+H2OFe(OH)2 + CO2 = FeCO3 + H2O
Fe(s) + AlCl3(aq) = FeCl +Al3Fe(s) + AlCl3(aq) = 3FeCl + Al
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe3O4 (s) + O2 (g) = Fe2O3 (s)4Fe3O4(s) + O2(g) = 6Fe2O3(s)
FeCl3(aq) + 3AgNO3(aq) = 3AgCl(s) + Fe(NO3)3(aq)FeCl3(aq) + 3AgNO3(aq) = 3AgCl(s) + Fe(NO3)3(aq)
Fe2 = Fe33Fe2 = 2Fe3
FeO(l)+Al(l)=Al2O3(l)+Fe(l)3FeO(l) + 2Al(l) = Al2O3(l) + 3Fe(l)
Fe + O= Fe2O32Fe + 3O = Fe2O3
Fe2O3 + H2SO4 = Fe2(SO4)3 + H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe(NO3)3 + KOH=Fe(OH)3 +K(NO3)Fe(NO3)3 + 3KOH = Fe(OH)3 + 3K(NO3)
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe + NHO3 = Fe(NO3)3 + NH4NO3 + H2O8Fe + 30NHO3 = 8Fe(NO3)3 + 3NH4NO3 + 9H2O
Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)Fe(s) + 2HCl(aq) = FeCl2(aq) + H2(g)
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s) + HCl(aq) = FeCl3 (aq) + H2 (g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
FeCl2+KMnO4+HCl=FeCl3+MnCl2+H2O+KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe + O2 = Fe2O3 4Fe + 3O2 = 2Fe2O3
Fe + O = Fe2O3 2Fe + 3O = Fe2O3
Fe2O3(s) + Al(s) = Al2O3(s) + Fe(s)Fe2O3(s) + 2Al(s) = Al2O3(s) + 2Fe(s)
Fe(s) + Cd(NO3)2(aq) = Fe(NO3)3(aq) + Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe2(CO3)3(s) = Fe2O3(s) + CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s) + Cd(NO3)2(aq) = Fe(NO3)3(aq) + Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe2O3(s) + H2(g) = Fe(s) + H2O(l)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(l)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS(s)+HCl(aq) = FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.