Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NaOH=Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3 + HCl = FeCl3 + H2OFe2O3 + 6HCl = 2FeCl3 + 3H2O
FeCl2 = 2Fe + Cl2FeCl2 = Fe + Cl2
Fe(NO3)3 + Na2CO3 = FeCO3 + Na2(NO3)3Fe(NO3)3 + Na2CO3 = FeCO3 + Na2(NO3)3
Fe(NO3)3 + Na2(CO3) = Fe(CO3) + Na2(NO3)3Fe(NO3)3 + Na2(CO3) = Fe(CO3) + Na2(NO3)3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2 + KMnO4 + HCl = FeCl3 + MnCl2 + H2O + KCl5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 + 4H2O + KCl
Fe+MgO=Fe2O3+Mg2Fe + 3MgO = Fe2O3 + 3Mg
Fe2P+S=P4S10+FeS4Fe2P + 18S = P4S10 + 8FeS
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2(g)+NaBr(aq)=Br2(l)+NaF(aq)F2(g) + 2NaBr(aq) = Br2(l) + 2NaF(aq)
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + MgO = Fe2O3 + Mg2Fe + 3MgO = Fe2O3 + 3Mg
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2+ HBr= Br2 +HFF2 + 2HBr = Br2 + 2HF
FeCl2 + AgNO3 = AgCl + Fe(NO3)2FeCl2 + 2AgNO3 = 2AgCl + Fe(NO3)2
FeBr3 + H2(SO4) = Fe2(SO4)3 + HBr2FeBr3 + 3H2(SO4) = Fe2(SO4)3 + 6HBr
FeBr3 + H2(SO4) = Fe2(SO4)3 + HBr2FeBr3 + 3H2(SO4) = Fe2(SO4)3 + 6HBr
FeBr3 + H2(SO4) = Fe2(SO4)3 + HBr2FeBr3 + 3H2(SO4) = Fe2(SO4)3 + 6HBr
Fe3O4 +HNO3 = Fe(NO3)3 + NO +H2O3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO + 14H2O
FeS2 + HSO4 = Fe2(SO4)3 + SO2 + H2O6FeS2 + 28HSO4 = 3Fe2(SO4)3 + 31SO2 + 14H2O
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 +NO2 + H2OFeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 15NO2 + 7H2O
FeS2 + HNO3 = Fe(NO3)3 + H2SO4 +NO2 + H2OFeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 + 15NO2 + 7H2O
Fe(NO3)2 +2NaOH = Fe(OH)2 + 2NaNO3Fe(NO3)2 + 2NaOH = Fe(OH)2 + 2NaNO3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+Al2O3=Fe2O3+Al=2Fe + Al2O3 = Fe2O3 + 2Al
Fe + H2O = Fe2 O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe3O4(s) + CO(g) = CO2(g) + Fe(s)Fe3O4(s) + 4CO(g) = 4CO2(g) + 3Fe(s)
Fe2O3(s) + CO(g) = 2 Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(s) + O2(g) = Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
F2(g)+NaBr(aq)=Br2(l)+NaF(aq)F2(g) + 2NaBr(aq) = Br2(l) + 2NaF(aq)
Fe + SCN = FeSCNFe + SCN = FeSCN
Fe + SCN = FeSCNFe + SCN = FeSCN
Fe2O3+ H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
FeS2+ O2 = Fe2O3+ SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + Na2CO3 = FeCO3 + Na2Cl3FeCl3 + Na2CO3 = FeCO3 + Na2Cl3
Fe + LiCN = FeCN+ LiFe + LiCN = FeCN + Li
Fe + LiCl = FeCl + LiFe + LiCl = FeCl + Li
FeS + H2O = FeS2 + Fe3O4 + H2S2FeS + 4H2O = -1FeS2 + Fe3O4 + 4H2S
FeS + H2O = FeS2 + Fe3O4 + H2S2FeS + 4H2O = -1FeS2 + Fe3O4 + 4H2S
Fe3(PO4)2 + MgCl2 = FeCl2 + Mg3(PO4)2Fe3(PO4)2 + 3MgCl2 = 3FeCl2 + Mg3(PO4)2
Fe2(SO3)3 = Fe2O3 + SO2 Fe2(SO3)3 = Fe2O3 + 3SO2
FeS + H2O = FeS2 + Fe3O4 + H26FeS + 4H2O = 3FeS2 + Fe3O4 + 4H2
Fe2 C + O3=Fe+CO23Fe2C + 2O3 = 6Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + Al = Al2O + FeFe2O3 + 6Al = 3Al2O + 2Fe
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+HCl=H2+FeCl2Fe + 2HCl = H2 + FeCl2
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3+NH4(OH)= Fe(OH)3+NH4(Cl)FeCl3 + 3NH4(OH) = Fe(OH)3 + 3NH4(Cl)
Fe2(SO4)3+ KOH= K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3=Fe+Cl3FeCl3 = Fe + Cl3
Fe+CuSO4=Cu+FeSO4Fe + CuSO4 = Cu + FeSO4
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeCl3+NaOH=Fe(OH)3=NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + NH3 + H2O = Fe(OH)3 + NH4Fe + 3NH3 + 3H2O = Fe(OH)3 + 3NH4
F2(g)+NaBr(aq)=Br2(l)+NaF(aq)F2(g) + 2NaBr(aq) = Br2(l) + 2NaF(aq)
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2S3 + SO34FeS2 + 3O2 = 2Fe2S3 + 2SO3
Fe(OH)3 + HCl = FeCl3 + H2OFe(OH)3 + 3HCl = FeCl3 + 3H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + MnSO4 + K2SO4 + H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 + 2MnSO4 + K2SO4 + 8H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl3 2Fe + 3Cl2 = 2FeCl3
Fe2O3(s) + C(s) = Fe(s) + CO2(g) 2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe + Br = FeBr3Fe + 3Br = FeBr3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
F2 + NaBr = Br2 + NaFF2 + 2NaBr = Br2 + 2NaF
Fe2O3 + Al = Fe + AlO3Fe2O3 + Al = 2Fe + AlO3
F2+Xe=XeF84F2 + Xe = XeF8
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl2+HCl+H2O2=FeCl3+H2O2FeCl2 + 2HCl + H2O2 = 2FeCl3 + 2H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + C(s) = Fe(s) + CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe + O2 = Fe3O23Fe + O2 = Fe3O2
Fe+S=FeSFe + S = FeS
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
FeS2 +O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = Fe2O3 + SO34FeS2 + 15O2 = 2Fe2O3 + 8SO3
FeCl3+Ca(OH)2=Fe(OH)3+CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2+AgC2H3O2=Ag+FeC2H3O2Fe2 + 2AgC2H3O2 = 2Ag + 2FeC2H3O2
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+S8=FeS8Fe + S8 = 8FeS
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS2 + O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe2O3 + H2 = Fe + H2O Fe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2= FeCl32Fe + 3Cl2 = 2FeCl3
FeCi3+NaOH=Fe(OH)3+NaCiFeCi3 + 3NaOH = Fe(OH)3 + 3NaCi
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+AgNO3= Fe(NO3)2+AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+3H2SO4 = Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
FeCl3 + Na2CO3 = NaCl + Fe2(CO3)32FeCl3 + 3Na2CO3 = 6NaCl + Fe2(CO3)3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeS+O2=SO2+Fe2O34FeS + 7O2 = 4SO2 + 2Fe2O3
Fe2O3(s)+H2O(l)=Fe(OH)3(s)Fe2O3(s) + 3H2O(l) = 2Fe(OH)3(s)
Fe+CuCl2=FeCl+Cu2Fe + CuCl2 = 2FeCl + Cu
Fe+CuCl2=Fe2Cl3+Cu4Fe + 3CuCl2 = 2Fe2Cl3 + 3Cu
Fe(OH)2+H2O2=Fe(OH)32Fe(OH)2 + H2O2 = 2Fe(OH)3
FeCl2 + (NH4)3PO3 = Fe3 (PO3)2 + NH4Cl3FeCl2 + 2(NH4)3PO3 = Fe3(PO3)2 + 6NH4Cl
Fe2O3 + HNO3 = Fe (NO3)3 + H2OFe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe3 + SO2 = FeS + O2Fe3 + 3SO2 = 3FeS + 3O2
Fe + SO2 = FeS + O2Fe + SO2 = FeS + O2
Fe3 + SO2 = 2FeS + O2Fe3 + 3SO2 = 3FeS + 3O2
Fe+H3PO4=FePO4+H3Fe + H3PO4 = FePO4 + H3
Fe+CuSO4 = FeSO4+CuFe + CuSO4 = FeSO4 + Cu
FeCl3+3(NH4)2S = Fe2S3+6NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe2O3+C=Fe+COFe2O3 + 3C = 2Fe + 3CO
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+S=Fe2S32Fe + 3S = Fe2S3
FeCl3 + NH4OH = Fe(OH)3 + NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe+HCl=FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + H2O = Fe(OH)2 + HFe + 2H2O = Fe(OH)2 + 2H
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+S=Fe2S32Fe + 3S = Fe2S3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3+SO2+2H2O =2FeSO4+2H2SO4Fe2(SO4)3 + SO2 + 2H2O = 2FeSO4 + 2H2SO4
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3+Al=Fe+Al2O22Fe2O3 + 6Al = 4Fe + 3Al2O2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeBr3+H2SO4 = Fe2(SO4)3+ HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
FeO+Mg=Fe+MgOFeO + Mg = Fe + MgO
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(s) + H2O (g) = Fe2 O3(s)+H2(g)2Fe(s) + 3H2O(g) = Fe2O3(s) + 3H2(g)
FeSO4+KMnO4+H2SO4=MnSO4+Fe2(SO4)3+K2SO4+H2O10FeSO4 + 2KMnO4 + 8H2SO4 = 2MnSO4 + 5Fe2(SO4)3 + K2SO4 + 8H2O
Fe+H2SO4=FeSO4+H2Fe + H2SO4 = FeSO4 + H2
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe3O4 + Al = Al2O3 + Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2O3+H2= Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO4 = FeH2SO4Fe + H2SO4 = FeH2SO4
Fe + H2SO4 = FeH2SO4Fe + H2SO4 = FeH2SO4
Fe(OH)3 + H2SO4 = Fe2(SO4)3 +H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe2(SO4)3 (aq) + KSCN(aq) = (FeSCN)SO4(aq) + K2SO4(aq)Fe2(SO4)3(aq) + 2KSCN(aq) = 2(FeSCN)SO4(aq) + K2SO4(aq)
FeS+HCl=FeCl2+H2SFeS + 2HCl = FeCl2 + H2S
Fe+H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + HBr = FeBr3 + H22Fe + 6HBr = 2FeBr3 + 3H2
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=FeO2Fe + O2 = 2FeO
Fe2(SO4)3 + Li2(CO3) = Li2(SO4) + Fe2(CO3)3Fe2(SO4)3 + 3Li2(CO3) = 3Li2(SO4) + Fe2(CO3)3
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe3O+H2=Fe+H2OFe3O + H2 = 3Fe + H2O
Fe3O+H2=Fe+H2OFe3O + H2 = 3Fe + H2O
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = FeO3 + SO22FeS2 + 7O2 = 2FeO3 + 4SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=FeO2Fe + O2 = 2FeO
Fe2O3+CO= Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + CuSO4 = FeSO4 + Cu88Fe + 8CuSO4 = 8FeSO4 + Cu8
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2=Fe3O43Fe + 2O2 = Fe3O4
Fe + 2HCl = FeCl2+H2Fe + 2HCl = FeCl2 + H2
Fe + O2=Fe3O43Fe + 2O2 = Fe3O4
FeS2+O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + KOH=K2SO4+ Fe (OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeO3+CO=Fe+CO2FeO3 + 3CO = Fe + 3CO2
FeO + H2SO4 = FeSO4 + H2OFeO + H2SO4 = FeSO4 + H2O
Fe2(C2O4)3 = FeC2O4 + CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)+H2O(l)2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 6H2O(l)
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe(NO3)3+3NaOH=Fe(OH)3+3NaNO3Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
Fe2O3 + H2 = Fe + H2O Fe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeCl3 + Ba(NO3)2 = BaCl2 + Fe(NO3)32FeCl3 + 3Ba(NO3)2 = 3BaCl2 + 2Fe(NO3)3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe(NO3)3 + H2S = Fe2S3 + HNO32Fe(NO3)3 + 3H2S = Fe2S3 + 6HNO3
Fe3O4 + O2 = Fe2O34Fe3O4 + O2 = 6Fe2O3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(s) + H2SO4(aq) = Fe(SO4)3(aq) + H2Fe(s) + 3H2SO4(aq) = Fe(SO4)3(aq) + 3H2
Fe + H2SO4 = H2 + Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + HCl = FeCl2 + H2Fe + 2HCl = FeCl2 + H2
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe(NO3)3 + H2S = Fe2S3 + HNO32Fe(NO3)3 + 3H2S = Fe2S3 + 6HNO3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + H2SO4 = H2 + Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
Fe3O4 = Fe2O3 + FeOFe3O4 = Fe2O3 + FeO
FeC2 O4=FeO+CO+CO2FeC2O4 = FeO + CO + CO2
Fe + H2O = FeOH + H22Fe + 2H2O = 2FeOH + H2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3 = Fe2O3 + H2O2Fe(OH)3 = Fe2O3 + 3H2O
FE+O2+H2O=FE(OH)22FE + O2 + 2H2O = 2FE(OH)2
Fe + HCl= FeCl3+ H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HCl= FeCl3+ H22Fe + 6HCl = 2FeCl3 + 3H2
Fe + HCl= FeCl+ H22Fe + 2HCl = 2FeCl + H2
Fe + O2 + H2O = Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe +H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
F2+AlCl3=AlF3+Cl23F2 + 2AlCl3 = 2AlF3 + 3Cl2
Fe2(SO4)3 + 6 H2O+ 6NH3 = 2Fe(OH)3 + 3(NH4)2SO4Fe2(SO4)3 + 6H2O + 6NH3 = 2Fe(OH)3 + 3(NH4)2SO4
Fe2(CO3)3=Fe2O3+CO2Fe2(CO3)3 = Fe2O3 + 3CO2
Fe + O2 = FeO2Fe + O2 = 2FeO
F2 + H2O = HF + O22F2 + 2H2O = 4HF + O2
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 +CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + CO = 2Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe(OH)3 + H3O+ = H2O + Fe+++Fe(OH)3 + 3H3O+ = 6H2O + Fe+++
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
F2 + NaBr = Br2 + NaFF2 + 2NaBr = Br2 + 2NaF
Fe2(CO3)2=CO2+FeOFe2(CO3)2 = 2CO2 + 2FeO
FeBr3 + H2SO4 = Fe2(SO4)3 + HBr2FeBr3 + 3H2SO4 = Fe2(SO4)3 + 6HBr
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + O2 = FeO2Fe + O2 = 2FeO
Fe + O = FeOFe + O = FeO
Fe (OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe(NO3)3+MgS=Fe2S3+Mg(NO3)22Fe(NO3)3 + 3MgS = Fe2S3 + 3Mg(NO3)2
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+CO2=Fe2O3+CO4-4Fe + 3CO2 = -2Fe2O3 + 3CO4
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + CO = Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FePO4+Na2SO4=Fe2(SO4)3+Na3PO42FePO4 + 3Na2SO4 = Fe2(SO4)3 + 2Na3PO4
FeCl2+Ag3PO4=Fe3(PO4)2+AgCl3FeCl2 + 2Ag3PO4 = Fe3(PO4)2 + 6AgCl
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
FeS + HCl = FeCl2 + H2SFeS + 2HCl = FeCl2 + H2S
Fe(OH)3=H2O + Fe2O32Fe(OH)3 = 3H2O + Fe2O3
Fe+H2SO4=Fe (SO4)3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
Fe2O3 + H2 = Fe +H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H2 = Fe +H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + C = CO2 +Fe2Fe2O3 + 3C = 3CO2 + 4Fe
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
F- + Cl2=Cl-+F22F- + Cl2 = 2Cl- + F2
Fe2O3 + 3H2 = 2Fe + 3H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2S3+O2=Fe2O3+SO22Fe2S3 + 9O2 = 2Fe2O3 + 6SO2
Fe+O=Fe2O32Fe + 3O = Fe2O3
Fe2O3(s) + CO(g) = 2Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2O3+CO=CO2+FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(s) + S(l) = Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + NiCl2 = FeCl3 + Ni2Fe + 3NiCl2 = 2FeCl3 + 3Ni
Fe(NO3)3 + Na2Co3 = 2Na2(NO3)3 + FeCo3Fe(NO3)3 + Na2Co3 = Na2(NO3)3 + FeCo3
Fe(NO3)3 + Na2Co3 = 2Na2(NO3)3 + FeCo3Fe(NO3)3 + Na2Co3 = Na2(NO3)3 + FeCo3
Fe(NO3)3 + Na2Co3 = 2Na2(NO3)3 + FeCo3Fe(NO3)3 + Na2Co3 = Na2(NO3)3 + FeCo3
Fe(NO3)3 + Na2Co3 = Na2(NO3)3 + FeCo3Fe(NO3)3 + Na2Co3 = Na2(NO3)3 + FeCo3
Fe + C12 = FeC1312Fe + 13C12 = 12FeC13
Fe+S8=FeS8Fe + S8 = 8FeS
FeSO4=Fe2O3+SO2+SO32FeSO4 = Fe2O3 + SO2 + SO3
Fe2O3(s) = Fe(s) + O2(g)2Fe2O3(s) = 4Fe(s) + 3O2(g)
FeCl3+Be3(PO4)2=BeCl2+FePO42FeCl3 + Be3(PO4)2 = 3BeCl2 + 2FePO4
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3(s) + CO(g) = 2 Fe(s) + CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe + H 2 SO 4 =FeSO 4 + H 2Fe + H2SO4 = FeSO4 + H2
Fe + H 2 SO 4 = FeSO 4 + H 2211Fe + 11H2SO4 = 11FeSO4 + H22
Fe(NO3)3+MgCO3 =Fe2(CO3)3+Mg(NO3)22Fe(NO3)3 + 3MgCO3 = Fe2(CO3)3 + 3Mg(NO3)2
Fe2(SO4)3 + KOH = Fe(OH)3 + K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
Fe+ CuSO4 = Cu + Fe2 (SO4)3 2Fe + 3CuSO4 = 3Cu + Fe2(SO4)3
Fe (s) + CuSO4 (aq) = Cu(s) + Fe2 (SO4)3 (aq)2Fe(s) + 3CuSO4(aq) = 3Cu(s) + Fe2(SO4)3(aq)
Fe(NO3)3 + MgS = Fe2S3 + Mg(NO3)22Fe(NO3)3 + 3MgS = Fe2S3 + 3Mg(NO3)2
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe3O4 + H2 = Fe + H2OFe3O4 + 4H2 = 3Fe + 4H2O
FePO4(s)=FePO3(s)+O2(g)2FePO4(s) = 2FePO3(s) + O2(g)
Fe + O2 = Fe3O43Fe + 2O2 = Fe3O4
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + S = FeS2Fe + 2S = FeS2
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+C=Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+H2SO4=H2+Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
Fe2(CO3)3(s)=Fe2O3(s)+CO2(g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s)+Cd(NO3)2(aq)=Fe(NO3)3(aq)+Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+CO2=Fe2O3+C4Fe + 3CO2 = 2Fe2O3 + 3C
Fe+H2O=Fe2O3+H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O4 + SO2 =FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3+CO =CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
FeCl3+Na2CO3 = FeCO3+Na2Cl3FeCl3 + Na2CO3 = FeCO3 + Na2Cl3
FeCl3+Na2CO3= FeCO3+Na2Cl3FeCl3 + Na2CO3 = FeCO3 + Na2Cl3
FeCl3+Na2CO3=FeCO3+Na2Cl3FeCl3 + Na2CO3 = FeCO3 + Na2Cl3
FeCl3+Na2CO3=FeCO3+Na2Cl3FeCl3 + Na2CO3 = FeCO3 + Na2Cl3
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
FeSO4+HgNO3=FeNO3+HgSO4FeSO4 + HgNO3 = FeNO3 + HgSO4
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+ H2O = Fe2O3+ H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+HBr=FeBr=FeBr2+H2OFe3O4 + 8HBr = -2FeBr + 5FeBr2 + 4H2O
Fe3O4+HBr=FeBr=FeBr3+H2O2Fe3O4 + 16HBr = FeBr + 5FeBr3 + 8H2O
FeO3 + CO = Fe + CO2FeO3 + 3CO = Fe + 3CO2
Fe2NO2+NaCO3=Fe2CO3+NaNO2Fe2NO2 + NaCO3 = Fe2CO3 + NaNO2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe + CuCl2 = FeCl3 + Cu2Fe + 3CuCl2 = 2FeCl3 + 3Cu
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
FeS+HBr=FeBr2+H2SFeS + 2HBr = FeBr2 + H2S
FeCl2+Na3PO4=Fe3(PO4)2+NaCl3FeCl2 + 2Na3PO4 = Fe3(PO4)2 + 6NaCl
Fe2(SO4)3+Ba(OH)2=BaSO4+Fe(OH)3Fe2(SO4)3 + 3Ba(OH)2 = 3BaSO4 + 2Fe(OH)3
FeO3(s)+CO(g)=Fe(l)+CO2(g)FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe(SO4)3+H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
F2+NaOH=NaF+O2+H2O2F2 + 4NaOH = 4NaF + O2 + 2H2O
Fe2O3=Fe+O22Fe2O3 = 4Fe + 3O2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe(ClO4)3 + KH2PO4 = Fe(PO4)3 + KH2(ClO4)Fe(ClO4)3 + 3KH2PO4 = Fe(PO4)3 + 3KH2(ClO4)
Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NH4CNS = Fe(CNS)3 + NH4ClFeCl3 + 3NH4CNS = Fe(CNS)3 + 3NH4Cl
FeS + O2 = FeO + SO22FeS + 3O2 = 2FeO + 2SO2
Fe + H2O = Fe3O4 +H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe3O4 +H23Fe + 4H2O = Fe3O4 + 4H2
Fe2(SO4)3 + KOH = Fe(OH)3 + K2SO4Fe2(SO4)3 + 6KOH = 2Fe(OH)3 + 3K2SO4
FeS + O2 = Fe2O3 + SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2O3+H2SO4=Fe2(SO4)3+H2OFe2O3 + 3H2SO4 = Fe2(SO4)3 + 3H2O
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3+NH4OH=Fe(OH)3+NH4ClFeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe2S3 + H3PO4 = FePO4 + H2SFe2S3 + 2H3PO4 = 2FePO4 + 3H2S
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe+O2+H2O=Fe(OH)22Fe + O2 + 2H2O = 2Fe(OH)2
Fe2O3+ CO = CO2+ FeFe2O3 + 3CO = 3CO2 + 2Fe
Fe(s)+S(s)=Fe2S3(s)2Fe(s) + 3S(s) = Fe2S3(s)
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3+H=Fe+H2OFe2O3 + 6H = 2Fe + 3H2O
Fe + H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = CO2 + FeFe2O3 + 3CO = 3CO2 + 2Fe
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
Fe + H2O = Fe2O3 + H22Fe + 3H2O = Fe2O3 + 3H2
Fe2O4 + SO2 = FeS + O2Fe2O4 + 2SO2 = 2FeS + 4O2
Fe2O3(s) + HCl(aq) = FeCl3(aq) + H2O(l)Fe2O3(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2O(l)
FeCl2(aq)+Ag3PO4(aq)=Fe3(PO4)2(aq)+AgCl(s) 3FeCl2(aq) + 2Ag3PO4(aq) = Fe3(PO4)2(aq) + 6AgCl(s)
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + C4 = Fe + CO28Fe2O3 + 3C4 = 16Fe + 12CO2
FeCl2 + Ag3PO4 = Fe3(PO4)2 + AgCl3FeCl2 + 2Ag3PO4 = Fe3(PO4)2 + 6AgCl
Fe+S=FeSFe + S = FeS
Fe+S=FeSFe + S = FeS
Fe2O3+2CO=2Fe+2CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
FeSO4 + HNO3 + H2SO4 = Fe(SO4)3 + NO + H2O3FeSO4 + 4HNO3 + 6H2SO4 = 3Fe(SO4)3 + 4NO + 8H2O
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe(CO)5 +NaOH = Na2Fe(CO)4 + Na2CO3 + H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
Fe(CO)5 +NaOH = Na2Fe(CO)4 + Na2CO3 + H2OFe(CO)5 + 4NaOH = Na2Fe(CO)4 + Na2CO3 + 2H2O
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
FeS+O2=Fe2O3+SO24FeS + 7O2 = 2Fe2O3 + 4SO2
Fe2 (CO3)3(s) = Fe2O3(s) + CO2 (g)Fe2(CO3)3(s) = Fe2O3(s) + 3CO2(g)
Fe(s) + Cd (NO3)2(aq) = Fe (NO3)3(aq) + Cd(s)2Fe(s) + 3Cd(NO3)2(aq) = 2Fe(NO3)3(aq) + 3Cd(s)
Fe2O3(s)+CO(g)=2Fe(s)+CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe(s)+S(l)=Fe2S3(s)2Fe(s) + 3S(l) = Fe2S3(s)
Fe+Cl2=FeCl32Fe + 3Cl2 = 2FeCl3
Fe(s)+O2(g)=Fe2O3(s)4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe(NO3)3 (aq) + Li3PO4 (aq) = FePO4 + LiNO3Fe(NO3)3(aq) + Li3PO4(aq) = FePO4 + 3LiNO3
Fe(NO3)3 (aq) + Li3PO4 (aq) = FePO4 + LiNO3Fe(NO3)3(aq) + Li3PO4(aq) = FePO4 + 3LiNO3
Fe(NO3)3 (aq) + Li3PO4 (aq) = FePO4 + LiNO3Fe(NO3)3(aq) + Li3PO4(aq) = FePO4 + 3LiNO3
Fe2O3+H2=Fe+H2OFe2O3 + 3H2 = 2Fe + 3H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe(OH)3 + H2CO3 = Fe2(CO3)3 + H2O 2Fe(OH)3 + 3H2CO3 = Fe2(CO3)3 + 6H2O
Fe 2 O 3 (s)+CO(g)=2Fe(s)+CO 2 (g) Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)3=Fe2O3+H2O2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+Al=Fe+Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
Fe2O3+Al3=Fe+Al2O33Fe2O3 + 2Al3 = 6Fe + 3Al2O3
Fe+V2O3=Fe2O3+VO2-2Fe + 3V2O3 = -1Fe2O3 + 6VO2
Fe+V2O3=Fe3O3+VO2-3Fe + 3V2O3 = -1Fe3O3 + 6VO2
Fe2(C2O4)3=FeC2O4+CO2Fe2(C2O4)3 = 2FeC2O4 + 2CO2
Fe3O4+Al=Al2O3+Fe3Fe3O4 + 8Al = 4Al2O3 + 9Fe
Fe2(SO4)3 + KSCN = K3Fe(SCN)6+ K2SO4Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 + 3K2SO4
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + AgNO3 = Fe(NO3)2 + AgFe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NaOH = Fe(OH)3 + NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
F- + S = F2 + S--2F- + S = F2 + S--
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe2O3 + H2O =Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
FE + OH = FE (OH)2FE + 2OH = FE(OH)2
Fe3O4 + H2 + 2H2O=3Fe (OH)2Fe3O4 + H2 + 2H2O = 3Fe(OH)2
Fe3O4 + H2 + 2H2O=3Fe (OH)2Fe3O4 + 5H2 - 2H2O = 6Fe(OH)
Fe3O4 + H2 + 2H2O=3Fe (OH)2Fe3O4 + H2 + 2H2O = 3Fe(OH)2
Fe3O4 + H2 + 2H2O=3Fe (OH)2Fe3O4 + H2 + 2H2O = 3Fe(OH)2
FeS2 + O2 = Fe2O3 + SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + O2 = Fe2O3 + Cl24FeCl3 + 3O2 = 2Fe2O3 + 6Cl2
Fe + O2 = FeO32Fe + 3O2 = 2FeO3
Fe + CuSO4 = FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
Fe2O3+CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2SO4 = Fe2(SO4)3 + H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
Fe+H2SO4=Fe2(SO4)3+H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + Cl2 = FeCl32Fe + 3Cl2 = 2FeCl3
Fe3O4+H2=Fe+H2OFe3O4 + 4H2 = 3Fe + 4H2O
FeS2+O2=Fe2O3+SO24FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3(s) + Al(s) = Al2O3(s) +Fe(s)Fe2O3(s) + 2Al(s) = Al2O3(s) + 2Fe(s)
Fe3+I = FeI3Fe3 + 9I = 3FeI3
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe2O3 + H2 = Fe + H2OFe2O3 + 3H2 = 2Fe + 3H2O
Fe++ + MnO4- + H+= Fe+++ + Mn++ + H2O5Fe++ + MnO4- + 8H+ = 5Fe+++ + Mn++ + 4H2O
FeSO4 + CaCl2 = FeCl2 + CaSO4FeSO4 + CaCl2 = FeCl2 + CaSO4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.