Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
FeO+O3=Fe2O36FeO + O3 = 3Fe2O3
FeCl3+NaOH=Fe(OH)3+NaClFeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe2O3+H2O=Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3+KSCN=Fe(SCN)3+KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
FeCl3 + KSCN = Fe(SCN)3 + KClFeCl3 + 3KSCN = Fe(SCN)3 + 3KCl
Fe2O3 + H2O = Fe(OH)3Fe2O3 + 3H2O = 2Fe(OH)3
FeBr 3 (aq) + AgNO 3 (aq) = Fe(NO 3 ) 3 (aq) + AgBr(s)FeBr3(aq) + 3AgNO3(aq) = Fe(NO3)3(aq) + 3AgBr(s)
Fe2O3 + Al = Al2O3 + FeFe2O3 + 2Al = Al2O3 + 2Fe
Fe + O2 = Fe2O34Fe + 3O2 = 2Fe2O3
Fe(NO3)2 = FeO + O2 + NO22Fe(NO3)2 = 2FeO + O2 + 4NO2
Fe + 3 H2So4 = Fe2(So4)3 + 3 H22Fe + 3H2So4 = Fe2(So4)3 + 3H2
Fe+H2SO4=FeSO4=H2Fe + H2SO4 = FeSO4 + H2
Fe+H2SO4=FeSO4=HFe + H2SO4 = FeSO4 + 2H
FeO (s)+O3 (g) =Fe2O3 (s)6FeO(s) + O3(g) = 3Fe2O3(s)
FeO (s)+O3 (g) =Fe2O3 (s)6FeO(s) + O3(g) = 3Fe2O3(s)
Fe + H2SO4 = Fe2(SO4)2 + H22Fe + 2H2SO4 = Fe2(SO4)2 + 2H2
FE2+H2SO4=FE2(SO4)2+H2FE2 + 2H2SO4 = FE2(SO4)2 + 2H2
Fe + HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
Fe (s) + H2O (g) = Fe3O4 (s) + H2 (g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(s)+Br2 = FeBr3(s)2Fe(s) + 3Br2 = 2FeBr3(s)
Fe2O3 + CO = Fe + CO2Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O2 + CO = Fe + CO2Fe2O2 + 2CO = 2Fe + 2CO2
Fe+HCl=2FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe+HCl=2FeCl3+H22Fe + 6HCl = 2FeCl3 + 3H2
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2(SO4)3 + NH3 + H2O = 2Fe(OH)3 + (NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4
Fe2(SO4)3 + NH3 + H2O = 2Fe(OH)3 + (NH4)2SO4Fe2(SO4)3 + 6NH3 + 6H2O = 2Fe(OH)3 + 3(NH4)2SO4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.