Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CO2 +H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Co+AgC2H3O2=Co(C2H3O2)3+AgCo + 3AgC2H3O2 = Co(C2H3O2)3 + 3Ag
Co+AgC2H3O2=Co(C2H3O2)3+AgCo + 3AgC2H3O2 = Co(C2H3O2)3 + 3Ag
CuClO4+PbS2=Cu2S+Pb(ClO4)44CuClO4 + PbS2 = 2Cu2S + Pb(ClO4)4
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu(NO3)2+Na3(PO4)=Cu3(PO4)2+NaNO33Cu(NO3)2 + 2Na3(PO4) = Cu3(PO4)2 + 6NaNO3
Cu + AgNO3 =Cu(NO3)2 + Ag Cu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+H20=C6H12O6+O230CO2 + 3H20 = 5C6H12O6 + 15O2
CaC2O4 +KMnO4 +H2SO4 = CaSO4 +KSO4 + MnSO4 + H2O + CO22CaC2O4 + KMnO4 + 4H2SO4 = 2CaSO4 + KSO4 + MnSO4 + 4H2O + 4CO2
CH4 + O2 = H2O + CO2CH4 + 2O2 = 2H2O + CO2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu + CI2 = Cu CI2Cu + CI2 = CuCI2
CS2 + Cl = CCl4 + SCl2CS2 + 8Cl = CCl4 + 2SCl2
Co(NO3)2+HNO2= NO+Co(NO3)3+H2OCo(NO3)2 + 4HNO2 = 3NO + Co(NO3)3 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CO + NO = CO2 + N22CO + 2NO = 2CO2 + N2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H12 + O2 = CO2 +H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H10 + O2 = CO2 +H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C2H5 OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
Cu2O=Cu+O22Cu2O = 4Cu + O2
CaBr2(aq) + Na2CO3(s) = CaCO3(s) + NaBr(aq)CaBr2(aq) + Na2CO3(s) = CaCO3(s) + 2NaBr(aq)
Ca(s) + HCl (aq) = CaCl2 (aq) + H2(g)Ca(s) + 2HCl(aq) = CaCl2(aq) + H2(g)
C3H6O(g) + O2(g) = CO2(g) + H2O(l)C3H6O(g) + 4O2(g) = 3CO2(g) + 3H2O(l)
C3H7(l) + O2(g) = CO2(g) + H2O(l)4C3H7(l) + 19O2(g) = 12CO2(g) + 14H2O(l)
CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
Co(NO3)3 + (NH4)2S = Co2S3 + NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
C2H8N2+2N2O4=2N2+2CO2+4H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CH4+4S=CS2+2H2SCH4 + 4S = CS2 + 2H2S
CH4+4S=CS2+2H2SCH4 + 4S = CS2 + 2H2S
CaO+H2PO4=Ca2(PO4)2+H2O2CaO + 2H2PO4 = Ca2(PO4)2 + 2H2O
CrI3 + K2Cr2O7 + H2SO4 = HIO3 + K2SO4 + Cr2(SO4)3 + H2O2CrI3 + 6K2Cr2O7 + 27H2SO4 = 6HIO3 + 6K2SO4 + 7Cr2(SO4)3 + 24H2O
CuO+NH3=N2+H2O+Cu3CuO + 2NH3 = N2 + 3H2O + 3Cu
Ca+HCl=CaCl + HCa + HCl = CaCl + H
Ca10(PO4)6(OH)2 + H3PO4 = Ca3(PO4)2 + O2 +H23Ca10(PO4)6(OH)2 + 2H3PO4 = 10Ca3(PO4)2 + 3O2 + 6H2
Cu+HNO3=CuNO3+NO2+H2OCu + 2HNO3 = CuNO3 + NO2 + H2O
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
CH3CH2OH+O2=CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
CH3CH2OH + 3 O2 = 2 CO2 + 3 H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Cu2O=Cu+O22Cu2O = 4Cu + O2
C6H10 + O2 = CO2 + H2O2C6H10 + 17O2 = 12CO2 + 10H2O
CrI2 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2OCrI2 + 24KOH + 10Cl2 = K2CrO4 + 2KIO4 + 20KCl + 12H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CuS + HCl = HS + CuClCuS + HCl = HS + CuCl
CaBr2+Na2CO3=CaCO3+NaBrCaBr2 + Na2CO3 = CaCO3 + 2NaBr
Ca+HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C + H2O= CO2 + HC + 2H2O = CO2 + 4H
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H8 + O2 = 5CO2 + 4H2OC5H8 + 7O2 = 5CO2 + 4H2O
CaCO3(s)=3CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Cu (s) + HNO3 (aq) = Cu (NO3)2 (aq) + H2O (l) + NO2 (g)Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2H2O(l) + 2NO2(g)
Cu (s) + AgNO3 (l) = Cu (NO3)2 (aq) + Ag ( l)Cu(s) + 2AgNO3(l) = Cu(NO3)2(aq) + 2Ag(l)
C5H12 + 5 O2 = 5 CO2 + 6 H2C5H12 + 5O2 = 5CO2 + 6H2
C5H12 + 5 O2 = 5 CO2 + 6 H2C5H12 + 5O2 = 5CO2 + 6H2
C4H8 + 6 O2 = 4 CO2 + 3 H2OC4H8 + 6O2 = 4CO2 + 4H2O
C3H8+H2=CH4C3H8 + 2H2 = 3CH4
CH=C3H8+H2-6CH = -2C3H8 + 5H2
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CrCl3(aq) + Na2CO3(aq) = Cr2(CO3)3(s) + NaCl(aq)2CrCl3(aq) + 3Na2CO3(aq) = Cr2(CO3)3(s) + 6NaCl(aq)
Cu(s) + HNO3(aq) = Cu(NO3)2(s) + NO2(g) + H2O(l)Cu(s) + 4HNO3(aq) = Cu(NO3)2(s) + 2NO2(g) + 2H2O(l)
C3H2+O2=CO2+H2O2C3H2 + 7O2 = 6CO2 + 2H2O
C3H2+O2=CO2+H2O2C3H2 + 7O2 = 6CO2 + 2H2O
Cs(s) + S(s) = CsSCs(s) + S(s) = CsS
C (s) + O2 (g)= CO (g)2C(s) + O2(g) = 2CO(g)
Cr+S8=Cr2S316Cr + 3S8 = 8Cr2S3
Ca+H2O=CaOH+H22Ca + 2H2O = 2CaOH + H2
Cu+HNO3=NO2+Cu(NO3)2+2H2OCu + 4HNO3 = 2NO2 + Cu(NO3)2 + 2H2O
Cu+HNO3=NO2+Cu(NO3)2+2H2OCu + 4HNO3 = 2NO2 + Cu(NO3)2 + 2H2O
C6H12O2 + O2 = CO2 + H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CaCl2+H2CO3=CaCO3+HClCaCl2 + H2CO3 = CaCO3 + 2HCl
C4H10O(l)+O2(g)=CO2(g)+H2O(g)C4H10O(l) + 6O2(g) = 4CO2(g) + 5H2O(g)
C2H6O(l)+O2(g)=CO2(g)+H2O(g)C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cu(NO3)2+6NH3+H2O=CuOH2+NH4NO34Cu(NO3)2 + 10NH3 + 7H2O = 4CuOH2 + 9NH4NO3
CuNO3+6NH3+H2O=CuOH+NH4NO3CuNO3 + NH3 + H2O = CuOH + NH4NO3
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cr2(CO3)3 = Cr2O3 + CO2Cr2(CO3)3 = Cr2O3 + 3CO2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH4 + O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
C+O2=CO2C + O2 = 2CO
Ca + Br2 = CaBr2Ca + Br2 = CaBr2
Cu(s) + HNO3(aq) = Cu(NO3)2(s) + NO2(g) + H2O(l)Cu(s) + 4HNO3(aq) = Cu(NO3)2(s) + 2NO2(g) + 2H2O(l)
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
C2H3Cl+O2=CO+H2O+HCl2C2H3Cl + 3O2 = 4CO + 2H2O + 2HCl
CaO+Al=Al2O3+Ca3CaO + 2Al = Al2O3 + 3Ca
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Cu+O2=CuO2Cu + O2 = 2CuO
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C7H7 MgBr+CO2=C8H8O2 + MgBr + H2O -36C7H7MgBr - 28CO2 = -35C8H8O2 - 36MgBr + 14H2O
C7H7 MgBr+CO2+ H2O=C8H8O2 + MgBr36C7H7MgBr + 28CO2 + 14H2O = 35C8H8O2 + 36MgBr
C7H8 MgBr+CO2=C8H8O2 + MgBrC7H8MgBr + CO2 = C8H8O2 + MgBr
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2 = CO2+ H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6 (g)+O2 (g)=CO2 (g)+H2O (g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C7H14+O2=CO2+7H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu+HNO3=Cu (NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3 = Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C3H8+ H2O= CO + H2C3H8 + 3H2O = 3CO + 7H2
Ca+HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
CH4(g) = C2H2(g) + H2(g)2CH4(g) = C2H2(g) + 3H2(g)
Cu2O=2Cu+OCu2O = 2Cu + O
Ca+H2O=Ca(HO)2+H2Ca + 2H2O = Ca(HO)2 + H2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C7H10N+O2=CO2+H2O+NO22C7H10N + 21O2 = 14CO2 + 10H2O + 2NO2
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3(CH2)7CH3+O2=CO2+H20CH3(CH2)7CH3 + 9O2 = 9CO2 + H20
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CaCl2+Na3PO4 =Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C6H12O6 + 6O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H1206 + 6O2 = CO2 + H2O2C6H1206 + 615O2 = 12CO2 + 1206H2O
C2H6O + H2O = C2H4O2 + e- +HO--1C2H6O + 3H2O = -1C2H4O2 - 2e- + 4HO-
C2H6O + H+ = C2H4O2 + e- +HO--1C2H6O + 3H+ = -1C2H4O2 - 2e- + HO-
C2H6O + H+ = C2H4O2 + e- + H2O-1C2H6O + 4H+ = -1C2H4O2 - 2e- + H2O
C2H6O + H+ = C2H4O2 + e- + H+0C2H6O + H+ = 0C2H4O2 + 0e- + H+
C2H6O + H2O = C2H4O2 + e- + H+C2H6O + H2O = C2H4O2 + 2e- + 4H+
C2H6O + HO- = C2H4O2 + e- + H+C2H6O + HO- = C2H4O2 + 2e- + 3H+
CuSO4 + Zn(NO3)2=Cu(NO3)+Zn(SO4)22CuSO4 + Zn(NO3)2 = 2Cu(NO3) + Zn(SO4)2
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CrCl3(aq) + KCN(aq) = Cr(CN)3(s) + KCl(aq) CrCl3(aq) + 3KCN(aq) = Cr(CN)3(s) + 3KCl(aq)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2(g) + O2(g) = CO2(g) + H2O(g)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
C2H6O + H+ = C2H4O2 + e- + HO--1C2H6O + 3H+ = -1C2H4O2 - 2e- + HO-
C2H6O + H+ = C2H4O2 + e- + H2O-1C2H6O + 4H+ = -1C2H4O2 - 2e- + H2O
CaCO3 + HCl =CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CuCl2+Na2CO3=CuCO3+NaClCuCl2 + Na2CO3 = CuCO3 + 2NaCl
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca+H2O=Ca(OH)+H22Ca + 2H2O = 2Ca(OH) + H2
C2H6O + O2 = CO2 + H2010C2H6O + 15O2 = 20CO2 + 3H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6O + H2O = C2H4O2 + e- + H+C2H6O + H2O = C2H4O2 + 2e- + 4H+
CeCl3+Na2CO3=Ce2(CO3)3+NaCl2CeCl3 + 3Na2CO3 = Ce2(CO3)3 + 6NaCl
Cu2S+O2=Cu+SO2Cu2S + O2 = 2Cu + SO2
Cl2+HBr=HCl+Br2Cl2 + 2HBr = 2HCl + Br2
CaBr2 + HCl = HBr + CaCl2CaBr2 + 2HCl = 2HBr + CaCl2
Cu + HNO3 = Cu(NO3)2 + H2O + NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
C5H12(g)+O2(g)=CO2(g)+H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
ClO3- + S2- + H2O = Cl- + S + OH-ClO3- + 6S2- + 3H2O = Cl- + 12S + 6OH-
Cr3(PO4)4+Fe2(SO4)3=FePO4+Cr(SO4)2Cr3(PO4)4 + 2Fe2(SO4)3 = 4FePO4 + 3Cr(SO4)2
CrO+O2=Cr2O34CrO + O2 = 2Cr2O3
C + HNO3 = CO2 + NO2 + H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C + HNO3 = CO2 + NO2 + H2929C + 58HNO3 = 29CO2 + 58NO2 + 2H29
Ca(CH3OO)2 + Na3PO4 = NaCH3OO + Ca3(PO4)23Ca(CH3OO)2 + 2Na3PO4 = 6NaCH3OO + Ca3(PO4)2
C2H5OH+O2=2CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CO + KMnO4 + HCl = CO2 + MnCl+ KCl+ H2O3CO + KMnO4 + 2HCl = 3CO2 + MnCl + KCl + H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CaC2+2H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C2H4(OH)2 + O2 = CO2 + H2O2C2H4(OH)2 + 5O2 = 4CO2 + 6H2O
Cr2(SO4)3 + KIO3 + KOH = K2CrO4 + KI+ K2SO4 + H2OCr2(SO4)3 + KIO3 + 10KOH = 2K2CrO4 + KI + 3K2SO4 + 5H2O
CrI3 + K2Cr2O7 + H2SO4 = HIO3 + K2SO4 + Cr2(SO4)3 + H2O2CrI3 + 6K2Cr2O7 + 27H2SO4 = 6HIO3 + 6K2SO4 + 7Cr2(SO4)3 + 24H2O
C3H8N2O+ O2=CO2+H2O+NO22C3H8N2O + 13O2 = 6CO2 + 8H2O + 4NO2
C3H8N2O + O2= CO2+H2O + NO22C3H8N2O + 13O2 = 6CO2 + 8H2O + 4NO2
C + O = COC + O = CO
C + O = COC + O = CO
C + O = COC + O = CO
C + O = COC + O = CO
C + O = COC + O = CO
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu+AgNO3= Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CO+O2=CO22CO + O2 = 2CO2
ClO3- + Mn++ + H2O = Mn2O5 + Cl2 + H3O+6ClO3- + 10Mn++ + 21H2O = 5Mn2O5 + 3Cl2 + 14H3O+
Ca2B6O11 +Na2CO3 = Na2B4O7+ NaBO2 +CaCO3Ca2B6O11 + 2Na2CO3 = Na2B4O7 + 2NaBO2 + 2CaCO3
Cr(OH)3+ NaOH +H2O2= Na2CrO4+ H2O2Cr(OH)3 + 4NaOH + 3H2O2 = 2Na2CrO4 + 8H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cr2O3+CCl4=CrCl3+COCl2Cr2O3 + 3CCl4 = 2CrCl3 + 3COCl2
Ca (OH)2 + HNO3 = Ca (NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C + O2 = CO2C + O2 = 2CO
C + O2 = CO2C + O2 = 2CO
CH3(CH2)6CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)6CH3(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
CH3(CH2)5CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)5CH3(l) + 11O2(g) = 7CO2(g) + 8H2O(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH3(CH2)3CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)3CH3(l) + 8O2(g) = 5CO2(g) + 6H2O(g)
CH3(CH2)7CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)7CH3(l) + 14O2(g) = 9CO2(g) + 10H2O(g)
CaCl2 + Na3PO4 = NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C+O2=CO2C + O2 = CO2
C4H6+O2=CO2+H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Cu2O=Cu+O22Cu2O = 4Cu + O2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Co2+H20=H2Co315Co2 + H20 = 10H2Co3
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Co(No3)2 (aq) + NaI (aq) = CoI2 + NaNo3Co(No3)2(aq) + 2NaI(aq) = CoI2 + 2NaNo3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CO + H2 = CH4OCO + 2H2 = CH4O
CO + 2 H2 = CH4OCO + 2H2 = CH4O
Cl2+AlBr3=AlCl3+Br23Cl2 + 2AlBr3 = 2AlCl3 + 3Br2
CuSO4 + Na3PO4 = Cu3(PO4)2 + Na2SO43CuSO4 + 2Na3PO4 = Cu3(PO4)2 + 3Na2SO4
C12H22O11=C+H2OC12H22O11 = 12C + 11H2O
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CrCl3(aq) + Na2CO3(aq) = Cr2(CO3)3(s) + NaCl(aq) 2CrCl3(aq) + 3Na2CO3(aq) = Cr2(CO3)3(s) + 6NaCl(aq)
CaSiO3(s) + HF(g) =SiF4(g) + CaF2(s) + H2O(l) CaSiO3(s) + 6HF(g) = SiF4(g) + CaF2(s) + 3H2O(l)
C2H6 +O2 =CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H10 + 9O2 = 4CO2 + 5H202C4H10 + 8O2 = 8CO2 + H20
C4H9OH(l)+O2(g)=CO2(g)+H2O(l) C4H9OH(l) + 6O2(g) = 4CO2(g) + 5H2O(l)
Ca+CuCO3 = CaCO3 + CuCa + CuCO3 = CaCO3 + Cu
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C6H1206+O2=H2O+CO22C6H1206 + 615O2 = 1206H2O + 12CO2
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2
CO + 2H2=CH3OHCO + 2H2 = CH3OH
Cl2+Na=NaClCl2 + 2Na = 2NaCl
Cl3+Na=NaClCl3 + 3Na = 3NaCl
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CO + O2 = CO2 2CO + O2 = 2CO2
Cl2+AlBr3=AlCl3+Br2 3Cl2 + 2AlBr3 = 2AlCl3 + 3Br2
CuFeS2+CuCl2=CuCl+FeCl2+SCuFeS2 + 3CuCl2 = 4CuCl + FeCl2 + 2S
CuFeS2+3CuCl2=4CuCl+FeCl2+2SCuFeS2 + 3CuCl2 = 4CuCl + FeCl2 + 2S
Ca (OH)2 + HNO3 = Ca (NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C2H4O(g) + O2 = CO2(g) +H20(g)10C2H4O(g) + 15O2 = 20CO2(g) + 2H20(g)
C2H4O(g) + O2 = CO2(g) +H20(g)10C2H4O(g) + 15O2 = 20CO2(g) + 2H20(g)
C4H6+O2=CO2+H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Cl2+AlBr3=AlCl3+Br23Cl2 + 2AlBr3 = 2AlCl3 + 3Br2
Cl2+AlBr3=AlCl3+Br23Cl2 + 2AlBr3 = 2AlCl3 + 3Br2
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H8O7 + 3NaHCO3 = 3H2O + 3CO2 + Na3C6H5 O7C6H8O7 + 3NaHCO3 = 3H2O + 3CO2 + Na3C6H5O7
C3 H8 O + CrO3 + H2 SO4 = Cr2 (SO4 ) 3 + C3 H6 O + H2 O3C3H8O + 2CrO3 + 3H2SO4 = Cr2(SO4)3 + 3C3H6O + 6H2O
CO+O2 = CO22CO + O2 = 2CO2
C2H3OH + Na= NaOH +H2O+ CO2C2H3OH - 10Na = -10NaOH + 7H2O + 2CO2
C2H3OH + Na= NaOH + H2O + CO2C2H3OH - 10Na = -10NaOH + 7H2O + 2CO2
C2H3OH + Na= NaOH + H2O + CO2C2H3OH - 10Na = -10NaOH + 7H2O + 2CO2
C2H3OH+Na= NaOH + H2O + CO2C2H3OH - 10Na = -10NaOH + 7H2O + 2CO2
Cu + HNO3 = Cu(NO3)2 +NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO4-2 +I2 + Ca(OH)2 = CaI2 + Ca(IO3)2 + CO2 + H2O 0CO4-2 + 6I2 + 6Ca(OH)2 = 5CaI2 + Ca(IO3)2 + 0CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 +NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO(g)+2H2(g)=CH3OH(g)CO(g) + 2H2(g) = CH3OH(g)
Cr2O3 + H2 = Cr + H2OCr2O3 + 3H2 = 2Cr + 3H2O
CH3CH2COOH + O2 = CO2 + H2O2CH3CH2COOH + 7O2 = 6CO2 + 6H2O
C2H5OH+ O2 = CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca + Br2 = CaBr2Ca + Br2 = CaBr2
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
Ca(s) + H2O(l) = Ca(OH)2(aq) + H2(g)Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
C4H8 + 6O2 = 4CO2 + 4H2OC4H8 + 6O2 = 4CO2 + 4H2O
C2H6 + 3O2 = 2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H6 + 3O2 = 3CO2 + 3H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
C7H16O(g) + O2(g) = CO2(g) + H2O(g)2C7H16O(g) + 21O2(g) = 14CO2(g) + 16H2O(g)
C5H12O(g) + O2(g) = CO2(g) + H2O(g)2C5H12O(g) + 15O2(g) = 10CO2(g) + 12H2O(g)
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C5H12O(g) + O2(g) = CO2(g) + H2O(g)2C5H12O(g) + 15O2(g) = 10CO2(g) + 12H2O(g)
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C+H2O=CO2+H2C + 2H2O = CO2 + 2H2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3OH +O2=H2CO+H2O2CH3OH + O2 = 2H2CO + 2H2O
CH3OH +O2=H2CO3+H2O2CH3OH + 3O2 = 2H2CO3 + 2H2O
CH3OH +O2=H2CO3+H2O2CH3OH + 3O2 = 2H2CO3 + 2H2O
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g) 4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g) Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H8O7(aq) + 3NaHCO3 (aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7 (aq)C6H8O7(aq) + 3NaHCO3(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7(aq)
C6H8O7(aq) + 3NaHCO3 (aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7 (aq)C6H8O7(aq) + 3NaHCO3(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7(aq)
C6H8O7(aq) + 3NaHCO3 (aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7 (aq)C6H8O7(aq) + 3NaHCO3(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7(aq)
Cu + H2SO = CuSO4 + H2O+ SO2-1Cu + H2SO = -1CuSO4 + H2O + 2SO2
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
Cu2O+C=Cu+COCu2O + C = 2Cu + CO
Ca3P2 + H2O = PH3 + Ca(OH)2Ca3P2 + 6H2O = 2PH3 + 3Ca(OH)2
Ca(OCl)Cl+CO2+H2O=CaCO3+CaCl2+HOCl2Ca(OCl)Cl + CO2 + H2O = CaCO3 + CaCl2 + 2HOCl
Ca(OH)2+Cl2=Ca(ClO3)2+CaCl2+H2O6Ca(OH)2 + 6Cl2 = Ca(ClO3)2 + 5CaCl2 + 6H2O
Ca(NO3)+NaCl=Na(NO3)+CaClCa(NO3) + NaCl = Na(NO3) + CaCl
Cu(OH)2 + NH4NO3 = Cu(NO3)2 + NH3 + H2OCu(OH)2 + 2NH4NO3 = Cu(NO3)2 + 2NH3 + 2H2O
C2H6 + O = CO2 + H2OC2H6 + 7O = 2CO2 + 3H2O
C3H6O2+O2=CO2+H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H9OH(g)+O2(g)=4CO2(g)+5H2O(l)C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
C4H9OH(g)+O2(g)= CO2(g)+5H2O(l)C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
C4H9OH(g)+O2(g)= CO2(g)+H2O(l)C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
Ca3(PO4)2 + NaHSO4 = CaSO4 + Na3PO4 + H3PO4Ca3(PO4)2 + 3NaHSO4 = 3CaSO4 + Na3PO4 + H3PO4
Ca3(PO4)2 + NaHSO4 = CaSO4 + Na3PO4 + H3PO4Ca3(PO4)2 + 3NaHSO4 = 3CaSO4 + Na3PO4 + H3PO4
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cs(s) + H2O(l) = CsOH(aq) + H2(g)2Cs(s) + 2H2O(l) = 2CsOH(aq) + H2(g)
Ca(s) + Br2(l) = CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
C + H2 = C3H63C + 3H2 = C3H6
C + H2 + O2 = C3H6O23C + 3H2 + O2 = C3H6O2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C3H8(g)+5O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2+O2 = CO2+H2010C2H2 + 20O2 = 20CO2 + H20
CaCl2+Pb(NO3)2=PbCl2+Ca(NO3)2CaCl2 + Pb(NO3)2 = PbCl2 + Ca(NO3)2
Ca2Cl2+Pb(NO3)2=PbCl2+CaNO3Ca2Cl2 + Pb(NO3)2 = PbCl2 + 2CaNO3
C5H8NO4Na + C2H6O = C5H8NNaO4C5H8NO4Na + 0C2H6O = C5H8NNaO4
C12H22O11(s) + O2(g) = CO2(g) + H2O(g)C12H22O11(s) + 12O2(g) = 12CO2(g) + 11H2O(g)
Cu(s) + 2H2SO4(aq) = CuSO4(aq)+ SO2(g) + 2H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
Ca + AgNO3 = Ca(NO3)2 +Ag Ca + 2AgNO3 = Ca(NO3)2 + 2Ag
Cu + 2H2SO4 = CuSO4 + SO2 + 2H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca(s)+H2O(l)=Ca(OH)(aq)+H2(g)2Ca(s) + 2H2O(l) = 2Ca(OH)(aq) + H2(g)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C12H22O11(s) + O2(g) = CO2(g) + H2O(g)C12H22O11(s) + 12O2(g) = 12CO2(g) + 11H2O(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CrO4-- + CN- + H2O = CNO- + Cr(OH)4- + OH-2CrO4-- + 3CN- + 5H2O = 3CNO- + 2Cr(OH)4- + 2OH-
CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cu(s)+AgC2H3O2(aq)=Cu(C2H3O2)2(aq)+Ag(s)Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCl2+Al2(SO4)3=CaSO4+AlCl33CaCl2 + Al2(SO4)3 = 3CaSO4 + 2AlCl3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3CH2OH + 3O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Ca+HBr=CaBr2+H2Ca + 2HBr = CaBr2 + H2
C2H6(g) + O2(g) = H2O(g) + CO2(g)2C2H6(g) + 7O2(g) = 6H2O(g) + 4CO2(g)
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO 2 +H 2O=C 6 H 12 O 6+O 26CO2 + 6H2O = C6H12O6 + 6O2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
CH4+O2=H2O+CO2CH4 + 2O2 = 2H2O + CO2
C2H6+O2 = CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO+O2=CO22CO + O2 = 2CO2
Cr + MgSO4 = MgCr + SO4 Cr + MgSO4 = MgCr + SO4
CaBr2 + CdS = CdBr2 + CaSCaBr2 + CdS = CdBr2 + CaS
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
C6H6 +O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCO3 + HNO3 = Ca(NO3)2 +CO2 + H2OCaCO3 + 2HNO3 = Ca(NO3)2 + CO2 + H2O
CaCO3 + HNO3 = Ca(NO3)2 +CO2 + H2OCaCO3 + 2HNO3 = Ca(NO3)2 + CO2 + H2O
CH4 + O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCO3+H3PO4=Ca3(PO4)2+CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
C2H6(g)+O2(g)=H2O(g)+CO2(g)2C2H6(g) + 7O2(g) = 6H2O(g) + 4CO2(g)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Cl + KOH = KCl + KClO3 + HOCl + KOH = KCl + 0KClO3 + HO
CuCl2+KOH=Cu(OH)+KCl2CuCl2 + KOH = Cu(OH) + KCl2
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CO + O2 = CO22CO + O2 = 2CO2
Ca(ClO)2 + HCl = CaCl2 + Cl2 + H2OCa(ClO)2 + 4HCl = CaCl2 + 2Cl2 + 2H2O
Cl2 + NaOH = NaCl + NaClO + H2OCl2 + 2NaOH = NaCl + NaClO + H2O
Co(No3)2 + NaOh = CoOh + Na(No3)2Co(No3)2 + NaOh = CoOh + Na(No3)2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(s) + O2(g) = CaO(s)2Ca(s) + O2(g) = 2CaO(s)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CrCl3+ 6H2O = HCl + CrO + H2O0CrCl3 + H2O = 0HCl + 0CrO + H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CuClO4 + K2CrO4 = Cu2CrO4 + KClO42CuClO4 + K2CrO4 = Cu2CrO4 + 2KClO4
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cl+NaI=NaCl+ICl + NaI = NaCl + I
C8H18 + O2 = CO + H2O2C8H18 + 17O2 = 16CO + 18H2O
Cu(SO4)=Cu+(SO4)Cu(SO4) = Cu + (SO4)
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH4 + 2 O2 = CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cr + Ba(NO3)2 = Cr(NO3)2 + BaCr + Ba(NO3)2 = Cr(NO3)2 + Ba
C2H4O + O2 = CO2 + H2O2C2H4O + 5O2 = 4CO2 + 4H2O
Cr + Ba(NO3)2 = Cr(NO3)2 + BaCr + Ba(NO3)2 = Cr(NO3)2 + Ba
CH4S + 7O2 = 2CO2 + H2O + SO32CH4S + 7O2 = 2CO2 + 4H2O + 2SO3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CuS+NH3=Cu(NH3)2+SCuS + 2NH3 = Cu(NH3)2 + S
Cu2O + P4O6 = CuPO4 + O2-2Cu2O - P4O6 = -4CuPO4 + 4O2
Cu2O + P4O6 = CuPO4 + O2-2Cu2O - P4O6 = -4CuPO4 + 4O2
Cu+HNO=Cu(NO3)2+NO+H2O-1Cu + 8HNO = -1Cu(NO3)2 + 10NO + 4H2O
CaS + NaCl = Na2S + CaCl2CaS + 2NaCl = Na2S + CaCl2
Ca(OH)2 + H3PO3 = Ca3 (PO3)2 + H2O 3Ca(OH)2 + 2H3PO3 = Ca3(PO3)2 + 6H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C3H6+O2=CO2(g)+H2O2C3H6 + 9O2 = 6CO2(g) + 6H2O
C12H22O11 + KClO3 = KCl + CO2 + H2OC12H22O11 + 8KClO3 = 8KCl + 12CO2 + 11H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CO2+C2H4O=CH2O+C3H6O30CO2 + 0C2H4O = -3CH2O + C3H6O3
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
C6H12O6 + O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C7H16+5O2 =6CO2+4H2OC7H16 + 11O2 = 7CO2 + 8H2O
C14H22O(C2H4O) = C7H8 + H2O+CO2-18C14H22O(C2H4O) = -43C7H8 - 62H2O + 13CO2
C14H22O(C2H4O) = C7H8 +C6H6+H2O3C14H22O(C2H4O) = 18C7H8 - 13C6H6 + 6H2O
C9H12 = C6H6 +C7H8C9H12 = -2C6H6 + 3C7H8
Ca(NO3)2+Na2C2O4=Ca(C2O4)+Na2(NO3)2Ca(NO3)2 + Na2C2O4 = Ca(C2O4) + Na2(NO3)2
CO2+C2H4O=CH2O+C3H6O30CO2 + 0C2H4O = -3CH2O + C3H6O3
CO2+C2H4O=CH2O+C3H6O30CO2 + 0C2H4O = -3CH2O + C3H6O3
CrCl3 + NaClO3 + NaOH = Na2CrO4 + NaCl + H2O2CrCl3 + NaClO3 + 10NaOH = 2Na2CrO4 + 7NaCl + 5H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
CoCl2 + Pb(NO3)2 = Co(NO3)2 + PbCl2CoCl2 + Pb(NO3)2 = Co(NO3)2 + PbCl2
C2H2(g) + O2(g) = CO2(g) + H2O2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O
CaCl2 + H2C2O4 = HCl + CaC2O4CaCl2 + H2C2O4 = 2HCl + CaC2O4
CaCl2 + (NH4)2C2O4 = CaC2O4 + NH4ClCaCl2 + (NH4)2C2O4 = CaC2O4 + 2NH4Cl
CuSO4 + NaCl + H2O + NaHSO4 = CuCl + Na2SO4 + H2SO40CuSO4 + 0NaCl + 0H2O + 2NaHSO4 = 0CuCl + Na2SO4 + H2SO4
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCO3 = CO2 + CaOCaCO3 = CO2 + CaO
CH4(g) + O2(g) = H2O(l) + CO2(g) CH4(g) + 2O2(g) = 2H2O(l) + CO2(g)
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
CH4 + 2O2 =CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 =CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 2O2 = 2CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
C+O2=2CO2C + O2 = 2CO
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH + O2 =CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Ca(s)+H2O(l)=Ca(OH)2(aq)+H2(g)Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
CH3CH2CH3 + O2 = H2O + CO2CH3CH2CH3 + 5O2 = 4H2O + 3CO2
CaCO3(s)+HCl(aq) =H2O(l) +CO2(g) + CaCl2(aq)CaCO3(s) + 2HCl(aq) = H2O(l) + CO2(g) + CaCl2(aq)
Ca(s) + O2=CaO(s)2Ca(s) + O2 = 2CaO(s)
Ca(s)+O2=CaO(s)2Ca(s) + O2 = 2CaO(s)
Ca(NO3)2 + Na2S=CaS + NaNO3Ca(NO3)2 + Na2S = CaS + 2NaNO3
Ca8+O2=CaO8Ca8 + 32O2 = 8CaO8
C21H24N2O4 +O2 =CO2 + H2O + NO2 C21H24N2O4 + 27O2 = 21CO2 + 12H2O + 2NO2
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C3H8+O=CO2+H2OC3H8 + 10O = 3CO2 + 4H2O
CaH2+H2O=Ca(OH2)+HCaH2 + H2O = Ca(OH2) + 2H
C2H5OH+O=CO2+H2OC2H5OH + 6O = 2CO2 + 3H2O
CH3CHO=CH4+COCH3CHO = CH4 + CO
CaSO3=CaO+SO2CaSO3 = CaO + SO2
C6H12O6(s) + O2(g) = H2O(l) + CO2(g)C6H12O6(s) + 6O2(g) = 6H2O(l) + 6CO2(g)
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3COCH3(l) + O2(g) = CO2(g) + H2O(g)CH3COCH3(l) + 4O2(g) = 3CO2(g) + 3H2O(g)
CaO + H2SO4 = CaSO4 + H2OCaO + H2SO4 = CaSO4 + H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Cr(s) + Cl2(g) =CrCl3(s)2Cr(s) + 3Cl2(g) = 2CrCl3(s)
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH4+O2=CH3OH2CH4 + O2 = 2CH3OH
CO+O2=CO22CO + O2 = 2CO2
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
Cu + S8 = Cu2S16Cu + S8 = 8Cu2S
Ca(s)+Br2(l)=CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
C2H5OH(l)+O2=2CO2(g)+H20(l)10C2H5OH(l) + 15O2 = 20CO2(g) + 3H20(l)
CaAl2Si2O8 + H2CO3 + H2O = Ca(HCO3)2 + Al2Si2O5(OH)4CaAl2Si2O8 + 2H2CO3 + H2O = Ca(HCO3)2 + Al2Si2O5(OH)4
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.