Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CO + O2 = CO22CO + O2 = 2CO2
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
CaF2 + Li2SO4 = CaSO4 + LiFCaF2 + Li2SO4 = CaSO4 + 2LiF
C2H5OH+O2=H20+CO210C2H5OH + 15O2 = 3H20 + 20CO2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H5(NO3)3 + O2 = H2O + CO2 + N24C3H5(NO3)3 - O2 = 10H2O + 12CO2 + 6N2
CaCO3+H2PO4 = CaPO4+CO2+H2OCaCO3 + H2PO4 = CaPO4 + CO2 + H2O
C2H4O2+NaOH=H2O+NaC2H3O2C2H4O2 + NaOH = H2O + NaC2H3O2
CaCO3+H2PO4 = CaPO4+CO2+H2OCaCO3 + H2PO4 = CaPO4 + CO2 + H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cl2 + KBr = KCl + Br2Cl2 + 2KBr = 2KCl + Br2
Cl + KBr = KCl + Br22Cl + 2KBr = 2KCl + Br2
CuCl+MnO2+HCl= CuCl2+MnCl2+H2O2CuCl + MnO2 + 4HCl = 2CuCl2 + MnCl2 + 2H2O
C2H5OH+ O2= H2O+CO2C2H5OH + 3O2 = 3H2O + 2CO2
CaCO3 +HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaSO4+Ga=Ga2(SO4)3+Ca3CaSO4 + 2Ga = Ga2(SO4)3 + 3Ca
CaSO4+Ga = Ga2(SO4)3+Ca3CaSO4 + 2Ga = Ga2(SO4)3 + 3Ca
CaCl2 + Na3PO4 =NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
Cu + O2 = CuO2Cu + O2 = 2CuO
Ca + H2O = Ca (OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
Ca3(PO4)2 + SiO2 = P4O10 + CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3(PO4)2 + SiO2 = P4O10 + CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
Ca(OH)2 + HClO3 = Ca(ClO3)2 + H2OCa(OH)2 + 2HClO3 = Ca(ClO3)2 + 2H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C+O2=CO2C + O2 = 2CO
Ca+HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu + (HNO3) = Cu(NO3)2 + 2(H2O) + (NO)3Cu + 8(HNO3) = 3Cu(NO3)2 + 4(H2O) + 2(NO)
C8H18O + C2H4O2 + ClNaO = C8H16O + CH2Cl2 + CHNaO3-14C8H18O + 29C2H4O2 + 28ClNaO = -12C8H16O + 14CH2Cl2 + 28CHNaO3
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C5H10 + H3PO4 = CO2 +P2O3 + H2O2C5H10 + 30H3PO4 = 10CO2 + 15P2O3 + 55H2O
Cd(OH) 2 + Na2S = CdS + Na(OH) Cd(OH)2 + Na2S = CdS + 2Na(OH)
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
Cu (CH3COO) 2 + K4(Fe (CN)6)= Cu2 Fe (CN) 6 + KCH3COO2Cu(CH3COO)2 + K4(Fe(CN)6) = Cu2Fe(CN)6 + 4KCH3COO
CH3COOH(l)+O2(g) = CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cu+AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cu+AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cu+AgNO3=Cu(NO3)+AgCu + AgNO3 = Cu(NO3) + Ag
CuCO3=CuO+CO2CuCO3 = CuO + CO2
C2O4Na2+KMnO4+H2SO4=CO2+K2SO4+Na2SO+MnSO4+H2O-5C2O4Na2 + 4KMnO4 + H2SO4 = -10CO2 + 2K2SO4 - 5Na2SO + 4MnSO4 + H2O
C2O5Na2+KMnO4+H2SO4=CO2+K2SO4+Na2SO+MnSO4+H2O-5C2O5Na2 + 6KMnO4 + 4H2SO4 = -10CO2 + 3K2SO4 - 5Na2SO + 6MnSO4 + 4H2O
Ca + HCl = CaCl2 + H2Ca + 2HCl = CaCl2 + H2
C2H6O + O2 = CO2 + H2010C2H6O + 15O2 = 20CO2 + 3H20
C+S=CS2C + 2S = CS2
Cl2+NaBr=NaCl+Br2Cl2 + 2NaBr = 2NaCl + Br2
CuCl+Mg(OH)2=MgCl2+Cu(OH)2CuCl + Mg(OH)2 = MgCl2 + 2Cu(OH)
C3H8 + O2=CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 =CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+HNO3= Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CaCl 2 ( a q ) ? + ? H 2 SO 4 ( a q ) ? = ? CaSO 4 ( s ) ? + ? HCl( a q )CaCl2(aq) + H2SO4(aq) = CaSO4(s) + 2HCl(aq)
CaCl 2 ( a q ) ? + ? H 2 SO 4 ( a q ) ? = ? CaSO 4 ( s ) ? + ? HCl( a q )CaCl2(aq) + H2SO4(aq) = CaSO4(s) + 2HCl(aq)
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 +O2 = CO2 +H205C2H4 + 10O2 = 10CO2 + H20
C2H4 +O2 = CO2 +H205C2H4 + 10O2 = 10CO2 + H20
C2H4+O2 = CO2 +H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H2 + O2= CO2 +H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CO2 + H2O = C2H6 + O24CO2 + 6H2O = 2C2H6 + 7O2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CuCNS+KIO3+HCl = HCN+CuSO4+ICl+H2O+KCl4CuCNS + 7KIO3 + 14HCl = 4HCN + 4CuSO4 + 7ICl + 5H2O + 7KCl
CuCNS+KIO3+HCl = HCN+CuSO4+ICl+H2O+KCl4CuCNS + 7KIO3 + 14HCl = 4HCN + 4CuSO4 + 7ICl + 5H2O + 7KCl
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C3H8 + O2 = H2O + CO2 C3H8 + 5O2 = 4H2O + 3CO2
Cu + AgNO3 = CuNO3 + AgCu + AgNO3 = CuNO3 + Ag
CuCl2 + Al3 = AlCl3 + Cu9CuCl2 + 2Al3 = 6AlCl3 + 9Cu
Ca(NO3)2 + H3PO4 =Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CuS + HNO3 = Cu(NO3)2 + S + H2O + NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
Cu + HNO3 =Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cr2(SO4)3+K2S2O8+H2O=H2CrO4+K2SO4+H2SO4Cr2(SO4)3 + 3K2S2O8 + 8H2O = 2H2CrO4 + 3K2SO4 + 6H2SO4
Cu + HNO3 =Cu(NO3) + NO + H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu+HNO3=NO+Cu(NO3)2+H2O3Cu + 8HNO3 = 2NO + 3Cu(NO3)2 + 4H2O
C3H8+O=CO2+H2OC3H8 + 10O = 3CO2 + 4H2O
C3H8+O=CO2+H2OC3H8 + 10O = 3CO2 + 4H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH + O2 = CO2 + H2010CH3OH + 5O2 = 10CO2 + 2H20
C+O2=2C4O24C + O2 = C4O2
Cu(OH)2+HC2H3O2=Cu(C2H3O2)2+H2OCu(OH)2 + 2HC2H3O2 = Cu(C2H3O2)2 + 2H2O
Cl2+KBr=KCl+Br2Cl2 + 2KBr = 2KCl + Br2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO3 3Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cr4 + Sn(ClO2)4 = Cr(ClO2)3 + SnCr4 + 3Sn(ClO2)4 = 4Cr(ClO2)3 + 3Sn
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CuCO3= CuO+CO2CuCO3 = CuO + CO2
Cu + Ag(NO3) = Cu(NO3)2 + AgCu + 2Ag(NO3) = Cu(NO3)2 + 2Ag
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
C10H12O2+O2 = CO2+H2OC10H12O2 + 12O2 = 10CO2 + 6H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3H6O+O2 = CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C11H24+17(O2)=11(CO2)+12(H2O)C11H24 + 17(O2) = 11(CO2) + 12(H2O)
C2H4O + O2 = CO2 + H2O2C2H4O + 5O2 = 4CO2 + 4H2O
Cu + O2 = Cu+2 + 2O-22Cu + O2 = 2Cu+2 + 2O-2
CuFeS2 +O2 =SO2 +CuO +FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
C3H8 +O2 =CO2 +H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2 + H2O = C6H12O6 + O66CO2 + 6H2O = C6H12O6 + 2O6
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+H2O =C6H12O6 +O66CO2 + 6H2O = C6H12O6 + 2O6
C9H20O4S2(l) + 14 O2(g) =9 CO2(g) + 10 H2O(l) + 2 SO2(g)C9H20O4S2(l) + 14O2(g) = 9CO2(g) + 10H2O(l) + 2SO2(g)
C+CO2=CO3-1C + 3CO2 = 2CO3
C3H8+O2=CO2 +H2C3H8 + 3O2 = 3CO2 + 4H2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8+O2 =CO2+H2C3H8 + 3O2 = 3CO2 + 4H2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CuSO4+H2O= CuO+SO4+HCuSO4 + H2O = CuO + SO4 + 2H
CuSO4+H2O= CuO+SO4+HCuSO4 + H2O = CuO + SO4 + 2H
C3H5(NO3)3=N2+H2O+CO2+H2O0C3H5(NO3)3 = 0N2 - H2O + 0CO2 + H2O
C2H6 + O2 = CH3COOH + H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
Ca(OH)2 + C20H14O4 = CaO2H2C20H14O4Ca(OH)2 + C20H14O4 = CaO2H2C20H14O4
Ca(OH)2 + CO2 = CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
CO2+ H2O = H2CO3CO2 + H2O = H2CO3
Ca(OH)2 + Na2CO3 = 2NaOH + CaCO3 Ca(OH)2 + Na2CO3 = 2NaOH + CaCO3
CH4 + O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CH4 + O2 = CO + H2010CH4 + 5O2 = 10CO + 2H20
Ca(OH)2 + Na2CO3 = 2NaOH + CaCO3 Ca(OH)2 + Na2CO3 = 2NaOH + CaCO3
Ca + AlCl3 = CaCl3 +AlCa + AlCl3 = CaCl3 + Al
C+H2=CH4C + 2H2 = CH4
CO+O2=CO22CO + O2 = 2CO2
C+O2=CO2C + O2 = 2CO
CH4+Br2=CBr4+HBrCH4 + 4Br2 = CBr4 + 4HBr
Cl2+NaI=NaCl+I2Cl2 + 2NaI = 2NaCl + I2
CO+O2=CO22CO + O2 = 2CO2
C+O2=CO2C + O2 = 2CO
Ca(OH)2 + (NH4)2C2O4 = CaC2O4 + NH4OHCa(OH)2 + (NH4)2C2O4 = CaC2O4 + 2NH4OH
Ca(OH)2 + (NH4)2C2O4 = CaC2O4 + NH4OHCa(OH)2 + (NH4)2C2O4 = CaC2O4 + 2NH4OH
CsClO3 = CsCl + O22CsClO3 = 2CsCl + 3O2
Cd + AgNO3 = Cd(NO3)2 + AgCd + 2AgNO3 = Cd(NO3)2 + 2Ag
CrO4 + NaBr + HCl = CrCl3 + NaCl + Br2 + H2O2CrO4 + 10NaBr + 16HCl = 2CrCl3 + 10NaCl + 5Br2 + 8H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co+PbSO4=CoSO4+PbCo + PbSO4 = CoSO4 + Pb
C12H22011=H2C03+C2H60176C12H22011 = -43302H2C03 + 66009C2H60
Ca3(PO4)2 + SiO2 + C = P + CO + CaSiOCa3(PO4)2 + 3SiO2 + 11C = 2P + 11CO + 3CaSiO
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
Cr2(SO4)3 + Br2 + NaOH = Na2SO4 + NaCrO4 + NaBr + H2OCr2(SO4)3 + 4Br2 + 16NaOH = 3Na2SO4 + 2NaCrO4 + 8NaBr + 8H2O
CaO + Cl2 = CaCl2 + O2 2CaO + 2Cl2 = 2CaCl2 + O2
C10H16 + Cl2 = C + HClC10H16 + 8Cl2 = 10C + 16HCl
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
CO2+Ca(OH)2=CaCO3+H2OCO2 + Ca(OH)2 = CaCO3 + H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
Ca(NO3)2 = CaO + NO2 +O22Ca(NO3)2 = 2CaO + 4NO2 + O2
CCl4+O2= CO2+Cl2CCl4 + O2 = CO2 + 2Cl2
CCl4+O2= CO2+Cl2CCl4 + O2 = CO2 + 2Cl2
C7H16 + 5O2= 7CO2 + 8H2OC7H16 + 11O2 = 7CO2 + 8H2O
COCl2 + 2H2O = 2HCl + H2CO3COCl2 + 2H2O = 2HCl + H2CO3
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C5H10 + H3PO = CO2 + P2O3 + H2O-4C5H10 + 30H3PO = -20CO2 + 15P2O3 + 25H2O
C5H10 + H3PO = CO2 + P2O3 + H2O-4C5H10 + 30H3PO = -20CO2 + 15P2O3 + 25H2O
Ca(NO3)2+Cu2SO4=CaSO4+CuNO3Ca(NO3)2 + Cu2SO4 = CaSO4 + 2CuNO3
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C7H16+H2SO4=H2O+C4H10+S-4C7H16 + H2SO4 = 4H2O - 7C4H10 + S
CaF2 + Li2SO4 = CaSO4 + 2 LiFCaF2 + Li2SO4 = CaSO4 + 2LiF
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CrO3+Al=Cr2+AlO2CrO3 + 6Al = Cr2 + 6AlO
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2+Al=AlCl33Cl2 + 2Al = 2AlCl3
Ca(HCO3)2 =CaCO3 + H2O +CO2Ca(HCO3)2 = CaCO3 + H2O + CO2
C12 H22 O11 = C +H2OC12H22O11 = 12C + 11H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaO +SO3 = CaSO4CaO + SO3 = CaSO4
C + O2 =CO2C + O2 = CO2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = 2CO
Ca3(PO4)2 + H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
Cl2 + KOH = KClO3 + KCl + H2O3Cl2 + 6KOH = KClO3 + 5KCl + 3H2O
Cl2 + KOH = KClO + KCl + H2OCl2 + 2KOH = KClO + KCl + H2O
C6H8O6 + O2 = CO2 + H2OC6H8O6 + 5O2 = 6CO2 + 4H2O
Cr2(CO3)3 + HNO3 = Cr(NO3)3 + CO2 + H2OCr2(CO3)3 + 6HNO3 = 2Cr(NO3)3 + 3CO2 + 3H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Ca+2H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Cu+HNO3=CuNO3+NO+H2O3Cu + 4HNO3 = 3CuNO3 + NO + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+HCl=CaCl+H22Ca + 2HCl = 2CaCl + H2
CS2 + NO = CO + SO2 + N22CS2 + 10NO = 2CO + 4SO2 + 5N2
CuS+HNO3=Cu(NO3)2+S+H2O+NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH4 (g) + 2O2 (g) = CO2 (g) + 2H2O (l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cu+HNO3=Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
CaCl2 + Li3PO4 = CaPO4 + Li3Cl2CaCl2 + Li3PO4 = CaPO4 + Li3Cl2
Cr(s) + S8(s) = Cr2S3(s)16Cr(s) + 3S8(s) = 8Cr2S3(s)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C7H16(l) + O2(g) = CO2(g) + H2O(g)C7H16(l) + 11O2(g) = 7CO2(g) + 8H2O(g)
Cr(s) + O2(g) = Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
Cl2(g) + KBr(aq) = Br2(l) + KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
CaSiO3(s) + HF(g) = CaF2(aq) + SiF4(g) + H2O(l)CaSiO3(s) + 6HF(g) = CaF2(aq) + SiF4(g) + 3H2O(l)
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CaSiO3(s) + HF(g) = CaF2(aq) + SiF4(g) + H2O(l)CaSiO3(s) + 6HF(g) = CaF2(aq) + SiF4(g) + 3H2O(l)
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Cu(OH)2+H3PO4=Cu3(PO4)2+H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
CaSiO3 + HF = CaF2 + SiF4 + H2OCaSiO3 + 6HF = CaF2 + SiF4 + 3H2O
CaCO3 + HBr = H2CO3 + CaBr2CaCO3 + 2HBr = H2CO3 + CaBr2
C2H6O+O2=CO+H2OC2H6O + 2O2 = 2CO + 3H2O
Cr2(B4O7)3 + H2O = Cr2O3*2H2O + H3BO3Cr2(B4O7)3 + 20H2O = Cr2O3*2H2O + 12H3BO3
Cl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C + SO2 = CS2 + CO5C + 2SO2 = CS2 + 4CO
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cl2+KBr=KCl+Br2Cl2 + 2KBr = 2KCl + Br2
Cu3(PO4)2 + Fe (OH)3=FePO4 + Cu(OH)2Cu3(PO4)2 + 2Fe(OH)3 = 2FePO4 + 3Cu(OH)2
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu2CO3(OH)2=2CuO+CO2+2H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
Ca3(PO4)2 + SiO2 + C= CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C4H10+O2 =CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C12H24 + 15 O2 =12 CO2 + 12 H2OC12H24 + 18O2 = 12CO2 + 12H2O
C3H8 + 5 O2 = 3 CO2 + 4 H2OC3H8 + 5O2 = 3CO2 + 4H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C12H22O11 + O2 = CO2 + 11H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H4+O2=C+H2OC2H4 + O2 = 2C + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2=CO+H2OC2H4 + 2O2 = 2CO + 2H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C3H8 + H2S + H2O = CH4 + SO23C3H8 + 2H2S + 4H2O = 9CH4 + 2SO2
C2H8+O2=CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
Cr2O3 + Li2SO4 = Cr2(SO4)3 + Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
Cr(NO3)3 + Ba = Cr + NO3BaCr(NO3)3 + 3Ba = Cr + 3NO3Ba
C8H14+O2= CO2+H2O2C8H14 + 23O2 = 16CO2 + 14H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Co3+NaCl= CoCl+ NaCo3 + 3NaCl = 3CoCl + 3Na
Cu2+ Cl2 = CuClCu2 + Cl2 = 2CuCl
Cu2S(s)+O2(g) =CuO(s)+SO2(g)Cu2S(s) + 2O2(g) = 2CuO(s) + SO2(g)
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C6H3O7(aq) + 3NaHCO3(aq) = 3H2O(l) + 3CO2(g) + Na3C6H5O7(aq)18C6H3O7(aq) + 39NaHCO3(aq) = 14H2O(l) + 69CO2(g) + 13Na3C6H5O7(aq)
Cl2+ KOH= KClO3 + KCl+ H2O3Cl2 + 6KOH = KClO3 + 5KCl + 3H2O
Cl2+ 4KOH= 2KClO3 + 2KCl+ H2O3Cl2 + 6KOH = KClO3 + 5KCl + 3H2O
Cu(s)+Al(NO3)3(aq)=3CuNO3+Al3Cu(s) + Al(NO3)3(aq) = 3CuNO3 + Al
C12H22O11+ O2= CO2+ H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C5H10O4+O2= CO2+H2O2C5H10O4 + 11O2 = 10CO2 + 10H2O
CO2(g)+H2O(l) = H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4S + 7O2 = CO2 + H2O + 2SO32CH4S + 7O2 = 2CO2 + 4H2O + 2SO3
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + 6H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H6O + 4O2 = CO + 3H2OC6H6O + 4O2 = 6CO + 3H2O
C6H4Cl2 + O2 = CO + 2H2O + Cl2C6H4Cl2 + 4O2 = 6CO + 2H2O + Cl2
C6H6OS + O2 = 12CO + 6H2O + SO32C6H6OS + 11O2 = 12CO + 6H2O + 2SO3
Ca(NO3)2 + H3PO4 =Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca(NO2)2 + Li2O= CaO+LiNO2Ca(NO2)2 + Li2O = CaO + 2LiNO2
C2H4+ O2 = CO2+ H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaSO4 + AlBr3 = CaBr2 + Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C6H6 + O2=CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C7H16 + O2=CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H16 + O2=CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C+O2=CO2C + O2 = 2CO
CH4 + Cl2 =CH2Cl2 + HClCH4 + 2Cl2 = CH2Cl2 + 2HCl
Ca(NO3)2 + H3PO4 =Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CO=C+CO22CO = C + CO2
C3H8+O2=CO+H2O2C3H8 + 7O2 = 6CO + 8H2O
CaOH + AgNO=CaNO + AgOHCaOH + AgNO = CaNO + AgOH
CaOH + AgNO=CaNO + AgOHCaOH + AgNO = CaNO + AgOH
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cl2 +NaOH = NaClO3 +NaCl +H2O3Cl2 + 6NaOH = NaClO3 + 5NaCl + 3H2O
C3H8(g) +O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C8H18+ O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCO3+O2=CO2+CaOCaCO3 + 0O2 = CO2 + CaO
Ca +AIPO4= AI +Ca3(PO4)23Ca + 2AIPO4 = 2AI + Ca3(PO4)2
Cu + O2 = 2Cu2O4Cu + O2 = 2Cu2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuO(s)=Cu(s)+O2(g)2CuO(s) = 2Cu(s) + O2(g)
C5H9O+O2 = CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
Cr + Fe(NO3)2 = Fe + Cr(NO3)32Cr + 3Fe(NO3)2 = 3Fe + 2Cr(NO3)3
C4H6 + O2 = CO2 +H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Cu(NO3)2 = CuO + NO+O22Cu(NO3)2 = 2CuO + 4NO + 3O2
C9H20+O2=CO2+H20C9H20 + 9O2 = 9CO2 + H20
CCl4+O2=CO2+Cl2CCl4 + O2 = CO2 + 2Cl2
Cu2O+H2=Cu+H2OCu2O + H2 = 2Cu + H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr2O3+Al=Cr+Al2O3Cr2O3 + 2Al = 2Cr + Al2O3
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C2H4+O2=CO2+HO2C2H4 + 6O2 = 2CO2 + 4HO2
C15H32+O2=CO2+H2OC15H32 + 23O2 = 15CO2 + 16H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaO+HNO3=Ca(NO3)2+H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
C6H15O4PS2 + C6H6N2O = C6H15O5PS + C6H6N2SC6H15O4PS2 + C6H6N2O = C6H15O5PS + C6H6N2S
C6H10+O2=CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
Cu+AgNO3 =Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CH4(g)+O2(g)=CO2(g)+2H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
CO(g)+O2=2CO2(g)2CO(g) + O2 = 2CO2(g)
CO(g)+O2=2CO2(g)2CO(g) + O2 = 2CO2(g)
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CaCl2+AgNO3=AgCl+Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CaCO3 + HCl = CaCl + HCO3CaCO3 + HCl = CaCl + HCO3
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CaO +P2O5 =Ca3(PO4)23CaO + P2O5 = Ca3(PO4)2
Ca(HCO3)2 + H3PO4 = Ca3(PO4)2 + H2O + CO23Ca(HCO3)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O + 6CO2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2=CO2=H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H8+O2= CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H6O3 + O2 = CO2 + H2OC4H6O3 + 4O2 = 4CO2 + 3H2O
C4H6O3 + O2 = CO2 + H2OC4H6O3 + 4O2 = 4CO2 + 3H2O
Ca3P2 +H2O = Ca(OH) 2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca + O2 = CaO2Ca + O2 = 2CaO
Ca+H2O=CaO+H2Ca + H2O = CaO + H2
CO+O2=CO22CO + O2 = 2CO2
Ca+H2O=CaO+H2Ca + H2O = CaO + H2
CO+O2=CO22CO + O2 = 2CO2
Ca+H2O=CaO+H2Ca + H2O = CaO + H2
Ca + O2 = CaO2Ca + O2 = 2CaO
C7H16 + 5O2 = 7CO2 + 8H2O C7H16 + 11O2 = 7CO2 + 8H2O
C7H16 + 5O2 = 7CO2 + 8H2OC7H16 + 11O2 = 7CO2 + 8H2O
Cu + H2O2 + H2SO4 = CuSO4 +2H2OCu + H2O2 + H2SO4 = CuSO4 + 2H2O
Cu + 2OH= Cu(OH)2 Cu + 2OH = Cu(OH)2
C6H12+O2 = CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
Cu(NO3)2+ 2 NaI = CuI2 + 2 NaNO3Cu(NO3)2 + 2NaI = CuI2 + 2NaNO3
Ca + O= CaOCa + O = CaO
C2H6O2 +Cr2O2- + H+ = C2H2O2 + Cr3+ H2O9C2H6O2 + 12Cr2O2- + 12H+ = 9C2H2O2 + 8Cr3 + 24H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H6+O=C+OH6C3H6 + O = 3C + OH6
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca(NO3)2 +H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C2H6O2+ H2SO4 + Na2Cr2O7= CH2OHCOOH+H2O+ Na2SO4+ Cr2(SO4)33C2H6O2 + 8H2SO4 + 2Na2Cr2O7 = 3CH2OHCOOH + 11H2O + 2Na2SO4 + 2Cr2(SO4)3
CrCl3 + KClO3 + K(OH) = K2CrO + KCl + H2O2CrCl3 - KClO3 + 10K(OH) = 2K2CrO + 5KCl + 5H2O
Ca(NO3)2+H3PO4=Ca3(PO4)2+HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C3H7OH+ H2SO4 + Na2Cr2O7= C3H6O+H2O+ Na2SO4+ Cr2(SO4)33C3H7OH + 4H2SO4 + Na2Cr2O7 = 3C3H6O + 7H2O + Na2SO4 + Cr2(SO4)3
Ca(OH)2+H3PO4=H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C6H10 + KMnO1 = K2C6H8O4 + MnO3 + KOH + H2O5C6H10 - 8KMnO1 = 5K2C6H8O4 - 8MnO3 - 18KOH + 14H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CF4 + Br2 = CBr4 + F2CF4 + 2Br2 = CBr4 + 2F2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H6 + Cl2 = CCl4 + HClC2H6 + 7Cl2 = 2CCl4 + 6HCl
Ca(NO3)2 + H3PO4=Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CrCl3+MnO2+H2O=MnCl2+H2CrO42CrCl3 + 3MnO2 + 2H2O = 3MnCl2 + 2H2CrO4
CoCl2+KOH+KClO3=KCl+Co2O3+H2O6CoCl2 + 12KOH + KClO3 = 13KCl + 3Co2O3 + 6H2O
Cr2O3+KNO3+K2CO3=K2CrO4+KNO2+CO2Cr2O3 + 3KNO3 + 2K2CO3 = 2K2CrO4 + 3KNO2 + 2CO2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
C2H6O2 + O2 = CO2 + H2O2C2H6O2 + 5O2 = 4CO2 + 6H2O
Cu + Cl2 = CuCl2Cu + Cl2 = CuCl2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO+I2O5=CO2+I25CO + I2O5 = 5CO2 + I2
C3H6(g) + O2(g) = CO2(g) + H2O(l)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(l)
Ca + N2 = Ca3N23Ca + N2 = Ca3N2
Cl2 + CaF2 = CaCl2 + F2Cl2 + CaF2 = CaCl2 + F2
Cl2 + CaF2 = CaCl2 + F2Cl2 + CaF2 = CaCl2 + F2
C 4 H 10 ( g ) + O 2 ( g ) = CO 2 ( g ) + H 2 O2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O
CaCl2+2NaHCO3=CaCO3+2NaCl+2H2O+CO2CaCl2 + 2NaHCO3 = CaCO3 + 2NaCl + H2O + CO2
C + SO2 = CS2 + CO5C + 2SO2 = CS2 + 4CO
CH3OH + O2 = CH2O + H2O2CH3OH + O2 = 2CH2O + 2H2O
Cu + Zn(NO3)2= Cu(NO3)2 + ZnCu + Zn(NO3)2 = Cu(NO3)2 + Zn
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(C2H3O2)2 + K2CO3 = CaCO3 + K(C2H3O2)Ca(C2H3O2)2 + K2CO3 = CaCO3 + 2K(C2H3O2)
C2H4 + H2O = C2H6OC2H4 + H2O = C2H6O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CaF2 + FeCl3 = FeF3 + CaCl23CaF2 + 2FeCl3 = 2FeF3 + 3CaCl2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH4 + Cl2 = CHCl3 +HClCH4 + 3Cl2 = CHCl3 + 3HCl
CuCl2 + K3PO4 = KCl + Cu3(PO4)23CuCl2 + 2K3PO4 = 6KCl + Cu3(PO4)2
Cr+S8=Cr 2S316Cr + 3S8 = 8Cr2S3
CrCl3+KOH+KClO5=KCl+K2CrO4+H2O10CrCl3 + 50KOH + 3KClO5 = 33KCl + 10K2CrO4 + 25H2O
CaCl2+2NaHCO3=CaCO3+2NaCl+2H2O+CO2CaCl2 + 2NaHCO3 = CaCO3 + 2NaCl + H2O + CO2
CaCl2+2NaHCO3=CaCO3+2NaCl+H2O+CO2CaCl2 + 2NaHCO3 = CaCO3 + 2NaCl + H2O + CO2
C3H6 + O2 =CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C6H8O7 + H2O = C6H507 + H3O-1C6H8O7 + 520H2O = -1C6H507 + 513H3O
C2H4O2 + H2O= C2H3O2 + H3OC2H4O2 + H2O = C2H3O2 + H3O
C2H4O2 + H2O= C2H3O2 + H3OC2H4O2 + H2O = C2H3O2 + H3O
C2H4O2 + H2O= C2H3O2 + H3OC2H4O2 + H2O = C2H3O2 + H3O
C2H4O2 + H2O= C2H3O2 + H3OC2H4O2 + H2O = C2H3O2 + H3O
Cu + HNO3 = Cu(NO3)2 + 2NO + 4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH4+ O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 + 2NO2 + 4H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C3H6O2 + O2 =CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca3P2 + H2O =Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C6H14O4+O2=CO2+H2O2C6H14O4 + 15O2 = 12CO2 + 14H2O
CoBr3 + 3CaSo4 = 3CaBr2 + Co2(So4)32CoBr3 + 3CaSo4 = 3CaBr2 + Co2(So4)3
C2H6(g) + O2(g) =CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H4O2+NaHCO3=H2O+CO2+NaC2H3O2C2H4O2 + NaHCO3 = H2O + CO2 + NaC2H3O2
Cu(NO3)2=CuO+NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CH3OH(g)+O2(g)=CO2(g)+2H2O(g)2CH3OH(g) + 3O2(g) = 2CO2(g) + 4H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C(s)+O2(g)=CO2(g)C(s) + O2(g) = CO2(g)
C(s)+O2(g)=CO2(g)C(s) + O2(g) = CO2(g)
CO2+C=COCO2 + C = 2CO
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
Cu(NO3)2 + Na2S = NaNO3 + CuSCu(NO3)2 + Na2S = 2NaNO3 + CuS
CaF2 + H2SO4= CaSO4 +HFCaF2 + H2SO4 = CaSO4 + 2HF
Ca3(PO4)2 +SiO2 + C = CaSiO3 + P4 +CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CrI3 + KOH + Cl2 = K2CrO4 +KIO4 + KCl + H2010CrI3 + 160KOH + 55Cl2 = 10K2CrO4 + 30KIO4 + 110KCl + 8H20
Cr2O3 + Na2CO3 + KNO3 = Na2CrO4 + CO2 + KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8 + 5O2= 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H12 (g) + 8O2 (g) = 5CO2 (g) + 6H2O (l)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(l)
C3H7OH + O2 = CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
CaCO3 + KF = KCO3 + CaFCaCO3 + KF = KCO3 + CaF
Ca + CoF2 = CaF2 + CoCa + CoF2 = CaF2 + Co
C15H28+Cl2=C15H28Cl4C15H28 + 2Cl2 = C15H28Cl4
C3H8+F2=C3F8+H2C3H8 + 4F2 = C3F8 + 4H2
C9H20+O2=CO2+H2OC9H20 + 14O2 = 9CO2 + 10H2O
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
CrI3 + Cl2 + NaOH = NaIO4 + NaCrO4 + NaCl +H2OCrI3 + 14Cl2 + 32NaOH = 3NaIO4 + NaCrO4 + 28NaCl + 16H2O
C2H4O2 + NaHCO3 = CO2 + C2H3O2Na + H2OC2H4O2 + NaHCO3 = CO2 + C2H3O2Na + H2O
C2H4O2 + NaHCO3 = CO2 + C2H3O2Na + H2OC2H4O2 + NaHCO3 = CO2 + C2H3O2Na + H2O
Ca(NO3)2+H3PO4= Ca3(PO4)2+HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca+CO2=CaO+CO20Ca + CO2 = 0CaO + CO2
Ca1CO3=CaO+CO2Ca1CO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CrI3 + KOH + S = KIO4 + K2Cr2O7 + K2S + H2O2CrI3 + 62KOH + 27S = 6KIO4 + K2Cr2O7 + 27K2S + 31H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
CH4 + O2 = CH3OH2CH4 + O2 = 2CH3OH
CaSO3 + HBr = CaBr2 + SO2 + H2OCaSO3 + 2HBr = CaBr2 + SO2 + H2O
C4H6+4O2=4CO2+3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Cu+FeSO4=CuSO4+FeCu + FeSO4 = CuSO4 + Fe
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
CaCl2+K3PO4=Ca3(PO4)2+KCl3CaCl2 + 2K3PO4 = Ca3(PO4)2 + 6KCl

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.