Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3 Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CaF2 + H2SO4 = CaSO4 + HFCaF2 + H2SO4 = CaSO4 + 2HF
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCl2 + K2CO3 = 2 KCl + CaCO3CaCl2 + K2CO3 = 2KCl + CaCO3
CH3(CH2)2CH3+O2 = CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
Cr +O2= Cr2 O34Cr + 3O2 = 2Cr2O3
CH3(CH2)4CH3+O2 = CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)4CH3+O2=CO2+H2CH3(CH2)4CH3 + 6O2 = 6CO2 + 7H2
CH3(CH2)6CH3+O2 = CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CuO + HNO3 = Cu(NO3)2 + H2OCuO + 2HNO3 = Cu(NO3)2 + H2O
CaCl2 + K3PO4 = Ca3(PO4)2 + KCl3CaCl2 + 2K3PO4 = Ca3(PO4)2 + 6KCl
Cl2O5+LiOH=LiClO3+H2OCl2O5 + 2LiOH = 2LiClO3 + H2O
Cl2O5+LiOH=LiClO3+H2OCl2O5 + 2LiOH = 2LiClO3 + H2O
Cl2O5+H2O=HClO3Cl2O5 + H2O = 2HClO3
CO2+H2O=H2CO3CO2 + H2O = H2CO3
CO2+H2O = H2CO3CO2 + H2O = H2CO3
C2H5NH2 + O2 = CO2 + H2O + N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
Ca(NO3)2 = CaO + NO2+ O22Ca(NO3)2 = 2CaO + 4NO2 + O2
Ca(NO3)2 = CaO + NO2+ O22Ca(NO3)2 = 2CaO + 4NO2 + O2
Ca(NO3)2 = CaO + NO2+ O22Ca(NO3)2 = 2CaO + 4NO2 + O2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3(CH2)7CH3+O2=CO2+H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CuCl2 + (NH4)2CO3 = CuCO3 + 2 Cl(NH4)CuCl2 + (NH4)2CO3 = CuCO3 + 2Cl(NH4)
Cr(s) + S8(s) = Cr2S3(s)16Cr(s) + 3S8(s) = 8Cr2S3(s)
Ca(OH)2(aq) + H3PO4(aq)= H2O(l) + Ca3(PO4)2(s)3Ca(OH)2(aq) + 2H3PO4(aq) = 6H2O(l) + Ca3(PO4)2(s)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+CaO+HCl=CaCl+H2OCa(OH)2 - CaO + 0HCl = 0CaCl + H2O
C + O2 = 2 CO2C + O2 = 2CO
C4H10( g) + 13 O2( g) = 8CO2( g) + 10 H2O(l )2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C + O2 = 2 CO2C + O2 = 2CO
Cr2O3 + KClO3 + KOH = K2Cr2O7 + KCl + H2OCr2O3 + KClO3 + 2KOH = K2Cr2O7 + KCl + H2O
CH4(g) + O2(g) = CO2(g) + H2O(l )CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cl2(g) + KBr(aq) = Br2(l ) + KCl (aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
C3H8 + O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
CaCO3+ 2HCl= CaCl2 +H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C2H6 + Cl2 = C2H5Cl + C2H4Cl2-1C2H6 + 0Cl2 = -2C2H5Cl + C2H4Cl2
CaCl2(aq) + Na2CO3(aq) = 2 NaCl(aq) + CaCO3(s)CaCl2(aq) + Na2CO3(aq) = 2NaCl(aq) + CaCO3(s)
CuO + HCl = CuCl2 + H2OCuO + 2HCl = CuCl2 + H2O
CaCO3 + O2 = CO2 + CaOCaCO3 + 0O2 = CO2 + CaO
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cr+Cl2=CrCl32Cr + 3Cl2 = 2CrCl3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaAl2Si2O8 + H = Ca2 + Al3 + H4SiO4(aq)6CaAl2Si2O8 + 48H = 3Ca2 + 4Al3 + 12H4SiO4(aq)
C7H8O2(l) + O2(g) = CO2(g) + H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g) + O2(g) = CO2(g) + H2O(l)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(l)
Cu + HNO3 = Cu(NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Cu3(OH)2(CO3)2 + H = Cu2 + H2O + HCO32Cu3(OH)2(CO3)2 + 8H = 3Cu2 + 4H2O + 4HCO3
Ca(NO3)2 = CaO + NO2 + O22Ca(NO3)2 = 2CaO + 4NO2 + O2
Cr2(SO4)3 + KClO3 + KOH = K2CrO4 +KCl +K2SO4 +H2OCr2(SO4)3 + KClO3 + 10KOH = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
Cr2(SO4)3 + KClO3 + KOH = K2CrO4 +KCl +K2SO4 +H2OCr2(SO4)3 + KClO3 + 10KOH = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
Cr2(SO4)3 + KClO3 + KOH = K2CrO4 +KCl +K2SO4 +H2OCr2(SO4)3 + KClO3 + 10KOH = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
Cu3(OH)2(CO3)2 + H = Cu2 + H2O + HCO32Cu3(OH)2(CO3)2 + 8H = 3Cu2 + 4H2O + 4HCO3
C5H6O(l) + O2(g) = CO2(g) + H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g) + O2(g)= CO2(g) + H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CaAl2Si2O8 + H = Ca2 + Al3 + H4SiO46CaAl2Si2O8 + 48H = 3Ca2 + 4Al3 + 12H4SiO4
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaSO4 + Mg(OH)2 = Ca(OH)2 + MgSO4CaSO4 + Mg(OH)2 = Ca(OH)2 + MgSO4
C6H12 + O = CO + H2OC6H12 + 12O = 6CO + 6H2O
C7H16 + O = CO2 + H2OC7H16 + 22O = 7CO2 + 8H2O
CO + H2 = C8H18 + H2O8CO + 17H2 = C8H18 + 8H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3ONa +NaClO2+HCl =COCl2+NaCl+H2O2CH3ONa + 3NaClO2 + 6HCl = 2COCl2 + 5NaCl + 6H2O
Cu +HNO3 =Cu(NO3)2 +NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO+H2=C8H18+H2O8CO + 17H2 = C8H18 + 8H2O
Cr2O7-- + C2O4-- + H+ = Cr+++ + CO2 +H2OCr2O7-- + 3C2O4-- + 14H+ = 2Cr+++ + 6CO2 + 7H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C2H6 +O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO2 + CA(OH)2 = CACO3 + H2OCO2 + CA(OH)2 = CACO3 + H2O
CH3COONa + H2SO4 = Na2SO4 + CH3COOH2CH3COONa + H2SO4 = Na2SO4 + 2CH3COOH
CH3COONa + Ca(OH)2 = CH4 + CO2 +NaOH +CaOCH3COONa + Ca(OH)2 = CH4 + CO2 + NaOH + CaO
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CH3COONa + Ca(OH)2 = CH4 + CO2 +NaOH +CaOCH3COONa + Ca(OH)2 = CH4 + CO2 + NaOH + CaO
C4H10+O2 =CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2 =CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca + H2O = H2 + Ca(OH)2Ca + 2H2O = H2 + Ca(OH)2
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
Cu(NO3)2+2KI=CuI2+2KNO3Cu(NO3)2 + 2KI = CuI2 + 2KNO3
Cu(NO3)2+2KI=CuI2+KNO3Cu(NO3)2 + 2KI = CuI2 + 2KNO3
Cu(NO3)2+2KI=CuI2+2KNO3Cu(NO3)2 + 2KI = CuI2 + 2KNO3
Cr + S8 = Cr2S316Cr + 3S8 = 8Cr2S3
Ca(CN)2 + HBr = CaBr2 + HCNCa(CN)2 + 2HBr = CaBr2 + 2HCN
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
C4H10O + O2= H2O +CO2C4H10O + 6O2 = 5H2O + 4CO2
C6H14O + O2= H2O +CO2C6H14O + 9O2 = 7H2O + 6CO2
C2H6O + O2= H2O +CO2C2H6O + 3O2 = 3H2O + 2CO2
C8H18 + O2= H2O +CO22C8H18 + 25O2 = 18H2O + 16CO2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CU+HNO3=CU(NO3)2+NO+H2O3CU + 8HNO3 = 3CU(NO3)2 + 2NO + 4H2O
CU+HNO3=CU(NO3)2+NO+H2O3CU + 8HNO3 = 3CU(NO3)2 + 2NO + 4H2O
Cl2O7 + H2 = HCl + H2OCl2O7 + 8H2 = 2HCl + 7H2O
C4H8 + O2 = H2O + CO2C4H8 + 6O2 = 4H2O + 4CO2
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
CH3CH3+O2 = CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C+KClO3=KCl+CO23C + 2KClO3 = 2KCl + 3CO2
CH3(CH2)2CH3+O2 = CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CUS+HNO3=CU(NO3)2+NO+S+H2O3CUS + 8HNO3 = 3CU(NO3)2 + 2NO + 3S + 4H2O
CH3(CH2)6CH3+O2 = CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + K2SO4 + MnSO4 + H2O + CO25CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + K2SO4 + 2MnSO4 + 8H2O + 10CO2
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + K2SO4 + MnSO4 + H2O + CO25CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + K2SO4 + 2MnSO4 + 8H2O + 10CO2
Ca(PO4)2 + SiO2 + C = CaSiO3 + CO + PCa(PO4)2 + SiO2 + 7C = CaSiO3 + 7CO + 2P
CH3CH3+O2 = CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4 + O2 = H2O + CO2CH4 + 2O2 = 2H2O + CO2
Ca(NO3)2 + Li2CO3 = 2LiNO3 + CaCO3Ca(NO3)2 + Li2CO3 = 2LiNO3 + CaCO3
CH3(CH2)4CH3 + O2 = CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C6H6 + Br2 = C6H5Br + HBrC6H6 + Br2 = C6H5Br + HBr
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
Cu + K2SO3 + HCL = CuCLO3 + H2SO4 + KCL +HOH2Cu - 7K2SO3 - 12HCL = 2CuCLO3 - 7H2SO4 - 14KCL + HOH
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C 5 H 10 O 2 (l)+O 2 (g)=CO 2 (g)+H 2 O(g) 2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H2O2 + O2 = CH3COCH3 + H2O-2C3H2O2 + 3O2 = -2CH3COCH3 + 4H2O
Cr2O3 + H2O=Cr(OH)3Cr2O3 + 3H2O = 2Cr(OH)3
CaCl2+H2SO4=CaSO4+2HClCaCl2 + H2SO4 = CaSO4 + 2HCl
Cu + HNO3 = NO + Cu(NO3)2 + H2O3Cu + 8HNO3 = 2NO + 3Cu(NO3)2 + 4H2O
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C5H12O2 + O2 = CO2 + H2OC5H12O2 + 7O2 = 5CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C5H10O2 + O2 = CO2 +H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CO+H2=CH3OHCO + 2H2 = CH3OH
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuCl2+NaOH=Cu(OH)2+NaClCuCl2 + 2NaOH = Cu(OH)2 + 2NaCl
CuCl2+NaOH=Cu(OH)2+NaClCuCl2 + 2NaOH = Cu(OH)2 + 2NaCl
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
Ca(NO3)2+2NABr=CaBr2+NA(NO3)Ca(NO3)2 + 2NABr = CaBr2 + 2NA(NO3)
Ca(NO3)2+2NABr=CaBr2+NA(NO3)Ca(NO3)2 + 2NABr = CaBr2 + 2NA(NO3)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10O + 6O2 = 4CO2 + 5H2OC4H10O + 6O2 = 4CO2 + 5H2O
C7H16+CoF3=C7F16+HF+CoF2C7H16 + 32CoF3 = C7F16 + 16HF + 32CoF2
CaCO3 = Ca O + CO2CaCO3 = CaO + CO2
CaCO3 = Ca O + CO2CaCO3 = CaO + CO2
C3CH2OH + O2 = 3H2O + 2CO24C3CH2OH + 17O2 = 6H2O + 16CO2
C6H14 + H2SO4 = C6SO4 + H16C6H14 + H2SO4 = C6SO4 + H16
C6H14 + H2SO4 = C6SO4 + H16C6H14 + H2SO4 = C6SO4 + H16
C2H6 + O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + 5 O = 2 CO + 3 H2OC2H6 + 5O = 2CO + 3H2O
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CH3NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g) 4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
Ca(OH)2(aq)+H3PO4(aq)=Ca3(PO4)2(s)+H2O(l)3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(s) + 6H2O(l)
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
CH2OH-CHOH-CH2OH+HNO3=CH2ONO2-CHONO2-CH2ONO2+H2OCH2OH-CHOH-CH2OH + 3HNO3 = CH2ONO2-CHONO2-CH2ONO2 + 3H2O
Cl2 + KOH = KCl + KClO3 + H2O3Cl2 + 6KOH = 5KCl + KClO3 + 3H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
CO2 + KHO = K2CO3 + H2OCO2 + 2KHO = K2CO3 + H2O
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CH3NH2+O2=CO2+H2O+N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
Ca3(PO4)2 + SiO2 +C = P4 + CaSiO3 + CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
C6H10O5 + O2 = CO2 + H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
C6H10O5 + O2 = CO2 + H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CuCO3 + HCl = CuCl2 + H2O + CO2CuCO3 + 2HCl = CuCl2 + H2O + CO2
CO(g) + O2(g) = CO2(g)2CO(g) + O2(g) = 2CO2(g)
C6H10O5+O2=CO2+H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
C6H10O5+O2=CO2+H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
C6H12O6+O2=CO2+H2O2C6H12O6 + 9O2 = 6CO2 + 6H2O2
C5H10O2(l) + O2(g) = CO2(g) + H2O(l)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(l)
CH4(g) + Br2(g) = CBr4(l) + HBr(g)CH4(g) + 4Br2(g) = CBr4(l) + 4HBr(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cl2 + NH3 = N2H4 + NH4ClCl2 + 4NH3 = N2H4 + 2NH4Cl
CO(g) + O2 = CO22CO(g) + O2 = 2CO2
Cl2 + NH3 = N2H4 + NH4ClCl2 + 4NH3 = N2H4 + 2NH4Cl
CO(g) + O2 = CO22CO(g) + O2 = 2CO2
C6H12O2+O2 = CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CH3(CH2)7CH3 + O2 = CO2 + H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
C6H8O7 + C2H4O2 +H2O = HCO2C6H8O7 - 2C2H4O2 + H2O = 2HCO2
C6H8O7 + C2H4O2 = H2O +CO24C6H8O7 - 9C2H4O2 = -2H2O + 6CO2
C6H8O7 + C2H4O2 = H2O +C0C6H8O7 + C2H4O2 = 2H2O + 2C
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
CO + H20 = CO2 + H2O-10CO + H20 = -10CO2 + 10H2O
Ca + O2 = CaO2Ca + O2 = 2CaO
C6H8O7 + NaHCO3 + HCl = CO2 + Na3C6H5O7 + NaCl-1C6H8O7 + 0NaHCO3 + 3HCl = 0CO2 - Na3C6H5O7 + 3NaCl
CO + NO = CO2 + N22CO + 2NO = 2CO2 + N2
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H10 + 6O2 = 4CO2 + 5H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO + O2=CO22CO + O2 = 2CO2
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CS2 + H2S + Cu = Cu2S + CH4CS2 + 2H2S + 8Cu = 4Cu2S + CH4
CuSO4 + KI = Cu2I2 + K2SO4 + I22CuSO4 + 4KI = Cu2I2 + 2K2SO4 + I2
ClO = ClO3 + Cl3ClO = ClO3 + 2Cl
CH4+Cl2=C+HClCH4 + 2Cl2 = C + 4HCl
Ca(OH)2+HCI=CaCI+H3O2Ca(OH)2 + HCI = CaCI + H3O2
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C10H16 + Cl2 = C + HClC10H16 + 8Cl2 = 10C + 16HCl
CaCO3=CaO + CO2CaCO3 = CaO + CO2
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H12+O2 = CO2 + H2OC4H12 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2 +SiO2 +C= P4 + CaSiO3 +CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
CO+O2=CO22CO + O2 = 2CO2
C6 H10 O5 +O2 =C O2 +H2 OC6H10O5 + 6O2 = 6CO2 + 5H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CS2+H2S+CU = CU2S+CH4-1CS2 + 6H2S + 8CU = 4CU2S + 3CH4
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + K2SO4 + MnSO4 + H2O + CO25CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + K2SO4 + 2MnSO4 + 8H2O + 10CO2
C4H6O2+NAOH=C4H5O2NA+H2OC4H6O2 + NAOH = C4H5O2NA + H2O
C4H6O2+NAOH=C4H5O2NA+H2OC4H6O2 + NAOH = C4H5O2NA + H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CO + O2 = CO22CO + O2 = 2CO2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CaSiO3 + HF = H2SiF6 + CaF2 + H2OCaSiO3 + 8HF = H2SiF6 + CaF2 + 3H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
Co(OH)2 +HBr = CoBr2 + H2OCo(OH)2 + 2HBr = CoBr2 + 2H2O
CoH2 +HBr = CoBr2 + H205CoH2 + 10HBr = 5CoBr2 + H20
CH3OH(l) + PCl5(g) = CH3Cl(g) + POCl3(l) + H2O(g)2CH3OH(l) + PCl5(g) = 2CH3Cl(g) + POCl3(l) + H2O(g)
CH3OH(l) + PCl5(g) = CH3Cl(g) + POCl3(l) + H2O(g)2CH3OH(l) + PCl5(g) = 2CH3Cl(g) + POCl3(l) + H2O(g)
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CsI+Br2=CsBr+I22CsI + Br2 = 2CsBr + I2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C25H52+O2=CO2+H2OC25H52 + 38O2 = 25CO2 + 26H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C25H52 + O = CO2 + H2OC25H52 + 76O = 25CO2 + 26H2O
CoCl2 + KOH = KCl + Co(OH)2CoCl2 + 2KOH = 2KCl + Co(OH)2
C2H6 + O = CO2 + H2010C2H6 + 40O = 20CO2 + 3H20
CsI + Br = CsBr + ICsI + Br = CsBr + I
C25H52+O2=CO2+H2OC25H52 + 38O2 = 25CO2 + 26H2O
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
CoCl3+KOH=KCl+Co(OH)3CoCl3 + 3KOH = 3KCl + Co(OH)3
C2H6(g) + O2(g) = CO2(g) + H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
CsI+Br2=CsBr+I22CsI + Br2 = 2CsBr + I2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C6H10+O2=CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C5H8+O2=CO2+H2OC5H8 + 7O2 = 5CO2 + 4H2O
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C4H6+O2=CO2+H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
C3H4+O2=CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
C3 H8 +O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C25H52+O2=CO2+H2OC25H52 + 38O2 = 25CO2 + 26H2O
C25H52+O2=CO2+H2OC25H52 + 38O2 = 25CO2 + 26H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C25H52+O2=CO2+H2OC25H52 + 38O2 = 25CO2 + 26H2O
CoCl3+KOH=KCl+Co(OH)3CoCl3 + 3KOH = 3KCl + Co(OH)3
CH3NH2 + O2 = CO2 + H2O + N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
CsI + Br2 = CsBr + I22CsI + Br2 = 2CsBr + I2
C25H52 + O2 = CO2 + H2OC25H52 + 38O2 = 25CO2 + 26H2O
CU+HNO3=CU(NO3)2+NO+H2O3CU + 8HNO3 = 3CU(NO3)2 + 2NO + 4H2O
Cu2S + O2= Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C8H18+O2= CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H10O2 + C4H10O = C16H26O2 + H2OC8H10O2 + 2C4H10O = C16H26O2 + 2H2O
C2H6 + O2 = 2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = 2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CsI+Br2=CsBr+I22CsI + Br2 = 2CsBr + I2
CsI+Br2=CsBr+I22CsI + Br2 = 2CsBr + I2
ClO3- + H2O = HClO3 + OH-ClO3- + H2O = HClO3 + OH-
Ca3 ( PO4)2 + SiO2 + C = CaSiO3 + CO + PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
CaCO3 + 2Cl2=Cl2O + CaCl2 + CO2CaCO3 + 2Cl2 = Cl2O + CaCl2 + CO2
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
C4H9N + O2 = CO2 + H2O + NO24C4H9N + 29O2 = 16CO2 + 18H2O + 4NO2
C6H4Cl2 + O2 = CO + H2O + HCl2C6H4Cl2 + 7O2 = 12CO + 2H2O + 4HCl
C2H3OF + O2 = CO + H2O + F24C2H3OF + 5O2 = 8CO + 6H2O + 2F2
Ca + LaF3 = La + CaF23Ca + 2LaF3 = 2La + 3CaF2
Ca (OH)2 = CaO + H2OCa(OH)2 = CaO + H2O
Ca + CeF3 = Ce + CaF23Ca + 2CeF3 = 2Ce + 3CaF2
C2H6O = C3H6 + H2O3C2H6O = 2C3H6 + 3H2O
Co(OH)2+HBr=CoBr2+H2OCo(OH)2 + 2HBr = CoBr2 + 2H2O
Ca3(PO4)2 +H2SO4=CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
C9N2H6O2 + O2 = CO3 + H2O + NH3 2C9N2H6O2 + 25O2 = 18CO3 + 0H2O + 4NH3
C9N2H6O2 + O2 = CO3 + H2O + NH3 2C9N2H6O2 + 25O2 = 18CO3 + 0H2O + 4NH3
C9N2H6O2 + O2 = CO3 + H2O + NH3 2C9N2H6O2 + 25O2 = 18CO3 + 0H2O + 4NH3
C2H4 + O2 = CO2 +H2OC2H4 + 3O2 = 2CO2 + 2H2O
C9N2H6O2 + O2 = CO3 + H2O + NH3 2C9N2H6O2 + 25O2 = 18CO3 + 0H2O + 4NH3
C9N2H6O2 + O2 = CO3 + H2O + NH3 2C9N2H6O2 + 25O2 = 18CO3 + 0H2O + 4NH3
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C7H16(g)+O2(g)=CO2(g)+H2O(g)C7H16(g) + 11O2(g) = 7CO2(g) + 8H2O(g)
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CoS2 + O2 = Co2O3 + SO24CoS2 + 11O2 = 2Co2O3 + 8SO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C2H10+O2=CO2+H2O2C2H10 + 9O2 = 4CO2 + 10H2O
C2H10+O2=CO2+H2O2C2H10 + 9O2 = 4CO2 + 10H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CH3NH2+O2=CO2+H2O+N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
Cu + H2SO4 = CuSO4 + H2Cu + H2SO4 = CuSO4 + H2
CH3CHO = CH4 + COCH3CHO = CH4 + CO
C6H6OS + O2 =6CO + H2O + SO2C6H6OS + 5O2 = 6CO + 3H2O + SO2
C6H6S + O2 = 12CO2 + 6H2O + SO22C6H6S + 17O2 = 12CO2 + 6H2O + 2SO2
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
COCl2 + NaOH = NaCl + H2O + CO2COCl2 + 2NaOH = 2NaCl + H2O + CO2
C+HNO3=NO2+CO2+H2OC + 4HNO3 = 4NO2 + CO2 + 2H2O
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
CaC2+H2O=C2H2+CaOCaC2 + H2O = C2H2 + CaO
CaC2+H2O=C2H2+CaOCaC2 + H2O = C2H2 + CaO
CaC2+H2O=C2H2+CaOCaC2 + H2O = C2H2 + CaO
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3=Cu2NO3+NO2+H2O2Cu + 2HNO3 = Cu2NO3 + NO2 + H2O
CLO2 + NAOH = NACLO2 + NACLO3 + H2O2CLO2 + 2NAOH = NACLO2 + NACLO3 + H2O
CLO2 + NAOH = NACLO2 + NACLO3 + H2O2CLO2 + 2NAOH = NACLO2 + NACLO3 + H2O
C5H8 + O2 = 5CO2 + 4H2OC5H8 + 7O2 = 5CO2 + 4H2O
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
C6H12O6=C2H6O+CO2C6H12O6 = 2C2H6O + 2CO2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
CuO+HNO3=Cu(NO3)2+H2OCuO + 2HNO3 = Cu(NO3)2 + H2O
CH4+O2=H2O+CO2CH4 + 2O2 = 2H2O + CO2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
COCl2+2NaOH=2NaCl+H2O+CO2COCl2 + 2NaOH = 2NaCl + H2O + CO2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 4Cl2 = CCl4 + 4HClCH4 + 4Cl2 = CCl4 + 4HCl
C2H5Cl+ O2 = CO2+ H2O+ Cl24C2H5Cl + 13O2 = 8CO2 + 10H2O + 2Cl2
C12H22O11+O2=CO2+H2010C12H22O11 + 65O2 = 120CO2 + 11H20
C12H22+O2=CO2+H2010C12H22 + 120O2 = 120CO2 + 11H20
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C3H8+O2=C2O3+H24C3H8 + 9O2 = 6C2O3 + 16H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H5(NO3)3 = CO2 + H2O + N2 + O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
CH5(NO3)3 = CO2 + H2O + N2 + O24CH5(NO3)3 = 4CO2 + 10H2O + 6N2 + 9O2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CO(NH2)2 = HNCO + NH3CO(NH2)2 = HNCO + NH3
CO(NH2)2 = HNCO + NH3CO(NH2)2 = HNCO + NH3
CO(NH2)2 = HNCO + NH3CO(NH2)2 = HNCO + NH3
CO(NH2)2 = HNCO + NH3CO(NH2)2 = HNCO + NH3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H4O4 + Br2 = C4H6O4 + Br0C4H4O4 + Br2 = 0C4H6O4 + 2Br
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
Co(NO3)2 + (NH4)S = CoS2 + NH4NO3Co(NO3)2 + 2(NH4)S = CoS2 + 2NH4NO3
C2H5Cl+ O2 = CO2+ H2O+ Cl24C2H5Cl + 13O2 = 8CO2 + 10H2O + 2Cl2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C5H10 + K2CrO4 + HCl + H2O = C5H12 + CrO4 + KClC5H10 + K2CrO4 + 2HCl + 0H2O = C5H12 + CrO4 + 2KCl
C9H20 + O2 = CO2 +H2OC9H20 + 14O2 = 9CO2 + 10H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H5Cl + O2 = CO2 + H20 + Cl24C2H5Cl + 8O2 = 8CO2 + H20 + 2Cl2
Cu + Al2(SO4)3= CuSO4 + Al3Cu + Al2(SO4)3 = 3CuSO4 + 2Al
CH3OH + O2 = CH2O + H2O2CH3OH + O2 = 2CH2O + 2H2O
CH3 + O2 = CH2O + H2O4CH3 + 3O2 = 4CH2O + 2H2O
C2H6+Cl2=C2H5Cl+C2H4Cl2-1C2H6 + 0Cl2 = -2C2H5Cl + C2H4Cl2
Co(H2O)6 + HCl = Co(Cl)4 + H2O + HCo(H2O)6 + 4HCl = Co(Cl)4 + 6H2O + 4H
Co(H2O)6 + Cl = Co(Cl)4 + H2OCo(H2O)6 + 4Cl = Co(Cl)4 + 6H2O
C2H5Cl+O2 = CO2+ H2O+ Cl24C2H5Cl + 13O2 = 8CO2 + 10H2O + 2Cl2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C3H5(NO3)3=CO2+H2O+N2+O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
CaCO3 + C2H4O2 = Ca(C2H3O2)2 + CO2 + H2OCaCO3 + 2C2H4O2 = Ca(C2H3O2)2 + CO2 + H2O
Cu(NO3)2 + NaOH = CuOH + Na(NO3)2Cu(NO3)2 + NaOH = CuOH + Na(NO3)2
Co(NO3)2 + Na4SiO4 = CoSiO4 + Na4(NO3)2Co(NO3)2 + Na4SiO4 = CoSiO4 + Na4(NO3)2
Co(NO3)2 + Na3PO4 = CoPO4 + Na3(NO3)2Co(NO3)2 + Na3PO4 = CoPO4 + Na3(NO3)2
Co(NO3)2 + Na2S = CoS + Na2(NO3)2Co(NO3)2 + Na2S = CoS + Na2(NO3)2
Ca(OH)2 + C2H4O2 = Ca(C2H3O2)2 + H2O Ca(OH)2 + 2C2H4O2 = Ca(C2H3O2)2 + 2H2O
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C8H8O2 + NaOH + HCl = C7H6O2 + CH3OH + NaClC8H8O2 + NaOH + HCl = C7H6O2 + CH3OH + NaCl
C8H8O2 + NaOH + HCl = C7H6O2 + CH3OH + NaClC8H8O2 + NaOH + HCl = C7H6O2 + CH3OH + NaCl
CoCl3+KOH=KCl+Co(OH)3CoCl3 + 3KOH = 3KCl + Co(OH)3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CsI+Br = CsBr+ICsI + Br = CsBr + I
C2H6OH+O2=CO2+H2O4C2H6OH + 13O2 = 8CO2 + 14H2O
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C5H10O2(l) + O2(g) = CO2(g) + H2O(l)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(l)
CH4(g) + Br2(g) = CBr4(l) + HBr(g)CH4(g) + 4Br2(g) = CBr4(l) + 4HBr(g)
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CH4 + 2O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CF4 + Br2 = CBr4 + F2CF4 + 2Br2 = CBr4 + 2F2
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
Cr (No3)3 (aq) + FeSo4(aq) = Fe(No3)2 (aq) + Cr2(So4)3(aq)2Cr(No3)3(aq) + 3FeSo4(aq) = 3Fe(No3)2(aq) + Cr2(So4)3(aq)
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CuS+HNO3=Cu(NO3)2+NO+S+H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 3S + 4H2O
CuS+HNO3=Cu(NO3)2+NO+S+H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 3S + 4H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C7H12 + H2O + KMnO4 = C7H14O2 + MnO2 + KOH 3C7H12 + 4H2O + 2KMnO4 = 3C7H14O2 + 2MnO2 + 2KOH
C7H12 + H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4 C7H12 + 0H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4
C7H12 + H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4 C7H12 + 0H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4
C7H12 + H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4 C7H12 + 0H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4
C7H12 + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4C7H12 + KMnO4 + H2SO4 = C7H14O2 + MnO2 + KSO4
C7H12 + KMnO4 + H2SO4 = C7H14O2 + MnO2 + H+ + KSO4C7H12 + KMnO4 + H2SO4 = C7H14O2 + MnO2 + 0H+ + KSO4
C7H12 + H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + H+ + KSO4C7H12 + 0H2O + KMnO4 + H2SO4 = C7H14O2 + MnO2 + 0H+ + KSO4
C7H12 + H2O + MnO4 = C7H14O2 + MnO2 2C7H12 + 2H2O + MnO4 = 2C7H14O2 + MnO2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CrI3 + KOH + Cl2 = K2CrO4 + KI + KCl + H2O2CrI3 + 16KOH + 3Cl2 = 2K2CrO4 + 6KI + 6KCl + 8H2O
C5H12+O2=H20+CO25C5H12 + 25O2 = 3H20 + 25CO2
C4H10+O2=H20+CO22C4H10 + 8O2 = H20 + 8CO2
CO2 + NH3 = OC(NH2)2 + H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaCl2 + Na2SO4 = CaSO4 + NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
C4H8 + C4H10 = C8H86C4H8 - 4C4H10 = C8H8
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
CH3OH + O2 = HCO2H +H2OCH3OH + O2 = HCO2H + H2O
CH3OH + O2 = HCO2 + H2O4CH3OH + 5O2 = 4HCO2 + 6H2O
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3CH3 + O2 = CO2 + H2010CH3CH3 + 20O2 = 20CO2 + 3H20
CH3COOH+O2=CO2+H205CH3COOH + 5O2 = 10CO2 + H20
Ca(OH)2(aq)+H3PO4(aq)=Ca3(PO4)2(s)+H2O(l)3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(s) + 6H2O(l)
Cu + H2SO4 = CuSO4 + H2Cu + H2SO4 = CuSO4 + H2
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cu2S + O2 = Cu + SO2Cu2S + O2 = 2Cu + SO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2 = CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3P2(s) + H2O(l) = Ca(OH)2(aq) + PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C2H5NH2(g) + O2(g) = CO2(g) + H2O(g) + N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C5H10O2(l) + O2(g) = CO2(g) + H2O(l)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(l)
CH4(g) + Br2(g) = CBr4(l) + HBr(g)CH4(g) + 4Br2(g) = CBr4(l) + 4HBr(g)
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CO2 + Na2O = Na2CO3CO2 + Na2O = Na2CO3
C3 H8 O3+O2=CO2+H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
CH3CH2OH + O2 = H20 + CH3COOH10CH3CH2OH + 5O2 = H20 + 10CH3COOH
C4 H8O+O2=CO+H2O2C4H8O + 7O2 = 8CO + 8H2O
C5 H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5 H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C8H18 + O2 = CO2 + H2010C8H18 + 80O2 = 80CO2 + 9H20
CH3NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C6H10O + O2=CO2 + H2O C6H10O + 8O2 = 6CO2 + 5H2O
Cl2 + O2=Cl2O7 2Cl2 + 7O2 = 2Cl2O7
Ca(OH)2+H3PO4 = H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
Ca3(PO4)2 + H2SO4 = CaSO4+H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
Ca + H2O = Ca(OH) + HCa + H2O = Ca(OH) + H
Ca + 70H2O = Ca(OH) + HCa + H2O = Ca(OH) + H
Ca + H2O = Ca(OH) + HCa + H2O = Ca(OH) + H
C2H2 +O2 = CO2+ H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
CHO3+C2H4O2= H2O +CO28CHO3 + C2H4O2 = 6H2O + 10CO2
C2H +O2 = CO + H2O 4C2H + 5O2 = 8CO + 2H2O
Cu+AgC2H3O2= Cu(C2H3O2)2+AgCu + 2AgC2H3O2 = Cu(C2H3O2)2 + 2Ag
Co+O2=Co2O34Co + 3O2 = 2Co2O3
CH4 = C2H2+H22CH4 = C2H2 + 3H2
C2H5OH+O2 = CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H10 + O2 = CO2 + H202C4H10 + 8O2 = 8CO2 + H20
CaCO3 + (CH2O2) = Ca(HCO2)2 + H2O + CO2CaCO3 + 2(CH2O2) = Ca(HCO2)2 + H2O + CO2
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
CH3CH2OH = CH3CH2OHCH3CH2OH = CH3CH2OH
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H5(OH)3 + 3HNO3 + H2SO4 = C3H5(NO3)3 + 3H20 + H2SO40C3H5(OH)3 + 0HNO3 + H2SO4 = 0C3H5(NO3)3 + 0H20 + H2SO4
CO+ O2 = CO22CO + O2 = 2CO2
Ca(HCO3)2+H2SO4=CaSO4+H2O+CO2Ca(HCO3)2 + H2SO4 = CaSO4 + 2H2O + 2CO2
C+FeO=CO+FeC + FeO = CO + Fe
Ca+O2=CaO2Ca + O2 = 2CaO
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = CO2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C2H7N+O2=CO2+H2O+N24C2H7N + 15O2 = 8CO2 + 14H2O + 2N2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CI2+KI=KCI+I2CI2 + KI = KCI + I2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.