Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C2H8N2+2N2O4=2N2+2CO2+4H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C2H8N2+2N2O4=2N2+2CO2+4H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu+HNO3=Cu(NO3)2+H2O+NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
Co(s) + H2SO4(aq) = Co2(SO4)3(aq) + H2(g)2Co(s) + 3H2SO4(aq) = Co2(SO4)3(aq) + 3H2(g)
Cr2O3(s)+Al(s)=2Cr+Al2O3Cr2O3(s) + 2Al(s) = 2Cr + Al2O3
C3H8O +O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CO + H2 = CH3OHCO + 2H2 = CH3OH
C18H36O2 +O2=CO2+H2OC18H36O2 + 26O2 = 18CO2 + 18H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CO + O2 = CO2 2CO + O2 = 2CO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH +O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + CH3CO2H = Ca(CH3CO2)2 + 2H2OCa(OH)2 + 2CH3CO2H = Ca(CH3CO2)2 + 2H2O
Ca + H3PO4 = Ca3 (P O4)2+H23Ca + 2H3PO4 = Ca3(PO4)2 + 3H2
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
C8H16(l) + O2(g) = CO2(g) + H2O(g)C8H16(l) + 12O2(g) = 8CO2(g) + 8H2O(g)
C8N8O16(s) = CO2(g) + N2(g)C8N8O16(s) = 8CO2(g) + 4N2(g)
CuSO4 + Pb(NO3)2 = Cu(NO3)2 + PbSO4 CuSO4 + Pb(NO3)2 = Cu(NO3)2 + PbSO4
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C2H5NO2 + O2 =CO2 + H2O +CH4N2O2C2H5NO2 + 3O2 = 3CO2 + 3H2O + CH4N2O
CH3(CH2)7CH3 + O2 = CO2 +H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
C6H1206 + O2 = CO2 + H2O2C6H1206 + 615O2 = 12CO2 + 1206H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H118+O2=CO2+H2O2C8H118 + 75O2 = 16CO2 + 118H2O
CaCO3 + BaCl2 = BaCO3 + CaCl2CaCO3 + BaCl2 = BaCO3 + CaCl2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H8N2O2+Ni(NO3)2=C8H14N4NiO4+H2O+N+O2C4H8N2O2 + Ni(NO3)2 = C8H14N4NiO4 + H2O + 2N + 5O
C4H8N2O2+Ni(NO3)2=C8H14N4NiO4+H2+O2+N22C4H8N2O2 + Ni(NO3)2 = C8H14N4NiO4 + H2 + 3O2 + N2
C4H8N2O2+Ni(NO3)2=C8H14N4NiO4+H+O+N2C4H8N2O2 + Ni(NO3)2 = C8H14N4NiO4 + 2H + 6O + 2N
C+HNO2=CO2+NO2+H2O-1C + 4HNO2 = -1CO2 + 4NO2 + 2H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CoCl2+KClO3+KOH=Co2O3+KCl+H2O6CoCl2 + KClO3 + 12KOH = 3Co2O3 + 13KCl + 6H2O
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
Ca(s)+AgNO3(aq)=Ca(NO3)2(aq)+Ag(s)Ca(s) + 2AgNO3(aq) = Ca(NO3)2(aq) + 2Ag(s)
CuCl2(aq)+NaOH(aq)=Cu(OH)2(s)+NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Ca(s)+HNO3(aq)=Ca(NO3)2(aq)+H2(g)Ca(s) + 2HNO3(aq) = Ca(NO3)2(aq) + H2(g)
Ca+H2=CaH2Ca + H2 = 2CaH
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H4 + 2O2 = 2CO2 + 2 H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cs+F2=CsF2Cs + F2 = 2CsF
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C3H10+O2=CO2+H2O2C3H10 + 11O2 = 6CO2 + 10H2O
Ca(NO3)2 + Ba(ClO4)2 = Ba(NO3)2 + Ca(ClO4)2Ca(NO3)2 + Ba(ClO4)2 = Ba(NO3)2 + Ca(ClO4)2
CH3CH2OH+O2=CO2+H2010CH3CH2OH + 15O2 = 20CO2 + 3H20
Ca(HCO3)2+Na2CO3=CaCO3+NaHCO3Ca(HCO3)2 + Na2CO3 = CaCO3 + 2NaHCO3
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C3H8(g) + O2(g)= CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca3(PO4)2+SiO2+C=CaSiO3+CO+PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C+SO2=CS2+CO5C + 2SO2 = CS2 + 4CO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8+2O2=2CO2+5H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+2O2=2CO2+5H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+3O2=2CO2+3H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cu2O + C = Cu + COCu2O + C = 2Cu + CO
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C5H12 + 8O2 = 5CO2 + 6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C15H24O + NO3- =N2 + CO2 + H2O + e6C15H24O + 82NO3- = 41N2 + 90CO2 + 72H2O + 82e
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C14H22O + NO3- =N2 + CO2 + H2O + e3C14H22O + 38NO3- = 19N2 + 42CO2 + 33H2O + 38e
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CH4(g) + H2O(g) = CO(g) + H(g)CH4(g) + H2O(g) = CO(g) + 6H(g)
Cu(s) + AgNO3(aq) = Cu (NO3)2(aq) + Ag(s)Cu(s) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2Ag(s)
CaC2+H2O=CaO+C2H2CaC2 + H2O = CaO + C2H2
Ca(s) + H2O(g) = Ca(OH)2(aq) + H2(g)Ca(s) + 2H2O(g) = Ca(OH)2(aq) + H2(g)
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Ca(OH)2+H2O=Ca+ OHCa(OH)2 + 0H2O = Ca + 2OH
Ca(OH)2+H2O=Ca+ H3O-1Ca(OH)2 + 4H2O = -1Ca + 2H3O
C2H4OH + O2 = CO2 + H2O14C2H4OH + 11O2 = 8CO2 + 10H2O1
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H4OH + O2 = CO2 + H2O14C2H4OH + 11O2 = 8CO2 + 10H2O1
C2H4O1H1 + O2 = C1O2 + H2O14C2H4O1H1 + 11O2 = 8C1O2 + 10H2O1
C2H4OH + O3 = CO2 + H204C2H4OH + 4O3 = 8CO2 + H20
C2H4OH + O3 = CO2 + H204C2H4OH + 4O3 = 8CO2 + H20
C2H4OH + O2 = CO2 + H204C2H4OH + 6O2 = 8CO2 + H20
C2H4OH + O3 = CO2 + H204C2H4OH + 4O3 = 8CO2 + H20
C2H4OH + O2 = CO2 + H204C2H4OH + 6O2 = 8CO2 + H20
C2H4OH + O3 = CO2 + H204C2H4OH + 4O3 = 8CO2 + H20
C2H4OH + O2 = CO2 + H204C2H4OH + 6O2 = 8CO2 + H20
Cu + H2SO4 = CuSO4 + SO2 + H2O Cu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cr2O7--+C2H5OH+H2O=OH-+CO2+Cr+++2Cr2O7-- + C2H5OH + 5H2O = 16OH- + 2CO2 + 4Cr+++
C2H6O(l)+O2(g)=CO2+H2OC2H6O(l) + 3O2(g) = 2CO2 + 3H2O
Cr2(SO4)3 + RbOH = Cr(OH)3 + Rb2SO4Cr2(SO4)3 + 6RbOH = 2Cr(OH)3 + 3Rb2SO4
CS2(s)+O2(g)=CO2+SO2CS2(s) + 3O2(g) = CO2 + 2SO2
CS2(s)+O2(g)=CO2+SOCS2(s) + 2O2(g) = CO2 + 2SO
C(s)+O2(g)=CO2C(s) + O2(g) = CO2
C4H6(g)+O2(g)=CO2+H2O2C4H6(g) + 11O2(g) = 8CO2 + 6H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CS2 + Cl2= CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C3H8 + O = CO2 + H2OC3H8 + 10O = 3CO2 + 4H2O
CH4 + O2 =CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CS2 + Cl2= CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2(g) + NaI(aq) = I2(s) + NaCl(aq)Cl2(g) + 2NaI(aq) = I2(s) + 2NaCl(aq)
Ca3N2(s) + H2O(l) = Ca(OH)2(aq) + NH3(g)Ca3N2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2NH3(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(NO3)2 + Na3PO4 = Ca3(PO4)2 + NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C3H8O(l) + O2(g) = CO2(g) + H2O(g)2C3H8O(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
C6H6 + O = C6H12O6 + H2O-1C6H6 - 3O = -1C6H12O6 + 3H2O
C3H8O(l) + O2(g) = CO2(g) + H2O(g)2C3H8O(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
Cl2(g) + NaI(aq) = I2(s) + NaCl(aq)Cl2(g) + 2NaI(aq) = I2(s) + 2NaCl(aq)
Ca3N2(s) + H2O(l) = Ca(OH)2(aq) + NH3(g)Ca3N2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2NH3(g)
Ca(OH)2 + H3PO4= Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CH3(CH2)2CH3(g)+O2(g) = CO2(g)+H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CS2+O2 = CO2+SO2CS2 + 3O2 = CO2 + 2SO2
Cl2+ SiO2 + C = SiCl4 + CO 2Cl2 + SiO2 + 2C = SiCl4 + 2CO
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Cl2 + H2O2 + Na(OH) = NaClO2 + H2OCl2 + 3H2O2 + 2Na(OH) = 2NaClO2 + 4H2O
C6H6 + O2 = CO2 +H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
Co(C6H10O(NO))3 +O2=Co3O4+NO2+CO2+H2O6Co(C6H10O(NO))3 + 157O2 = 2Co3O4 + 18NO2 + 108CO2 + 90H2O
Co(C6H10O(NO))3 +O2=Co3O4+NO2+CO2+H2O6Co(C6H10O(NO))3 + 157O2 = 2Co3O4 + 18NO2 + 108CO2 + 90H2O
Co(C6H10O(NO))3 + H2 =Co + NO2+C6H14Co(C6H10O(NO))3 + 6H2 = Co + 3NO2 + 3C6H14
C2H8N2+2N2O4=2N2+2CO2+4H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C3H8(g)+5O2(g)=2CO2(g)+H2O(l) C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CaCl2 + H2SO4 = CaSO4 + HClCaCl2 + H2SO4 = CaSO4 + 2HCl
CO2+KOH=K2CO3+H2OCO2 + 2KOH = K2CO3 + H2O
C6H12O6 = C2H6O + CO2 C6H12O6 = 2C2H6O + 2CO2
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3(CH2)5CH3 + O2 = CO2 +H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3(CH2)5CH3 + O2 = CO2 +H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CO + Fe2O3 = Fe + COCO + 0Fe2O3 = 0Fe + CO
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Cl2+H2O=HClO+HClCl2 + H2O = HClO + HCl
Cl2+H2O=HClO+HCl23Cl2 + 2H2O = 2HClO + 2HCl2
Cl2+H2O=HClO+HClCl2 + H2O = HClO + HCl
Cl2+H2O=HClO+HClCl2 + H2O = HClO + HCl
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H12O6 = C2H6O + CO2 C6H12O6 = 2C2H6O + 2CO2
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C6H12O6 = CH3CH2OH + CO2C6H12O6 = 2CH3CH2OH + 2CO2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H12O6+6O2=6CO2+6H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca3(PO4)2+HNO3=Ca(NO3)2+H3PO4Ca3(PO4)2 + 6HNO3 = 3Ca(NO3)2 + 2H3PO4
C8H18(g) + O2(g) = CO2(g) + H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C2H6+O2 = CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O3 = 2CO2+3H2O3C2H6 + 7O3 = 6CO2 + 9H2O
C2H6+O2= CO2+ H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H6O2 + O2= CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca3P2 + H2O=Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Co(s) + H2SO4(aq) = Co2(SO4)3(aq) + H2(g)2Co(s) + 3H2SO4(aq) = Co2(SO4)3(aq) + 3H2(g)
Cr2O3 (s) + H2 (g) = Cr (s) + H2O (g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
CuS + SO4 = CuO + SO22CuS + 3SO4 = 2CuO + 5SO2
CH3 + 2O2 = CO2 + 2H2O4CH3 + 7O2 = 4CO2 + 6H2O
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C12H22O11+KClO3=KCl+CO2+H2OC12H22O11 + 8KClO3 = 8KCl + 12CO2 + 11H2O
C8N8O16(s) = CO2(g) + N2(g)C8N8O16(s) = 8CO2(g) + 4N2(g)
CrCl3+AgNO3=Cr(NO3)3+AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C+Fe2O3=Fe+CO3C + Fe2O3 = 2Fe + 3CO
Cu+2HNO3=Cu(NO3)2+H2Cu + 2HNO3 = Cu(NO3)2 + H2
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C+Cl=CCl4C + 4Cl = CCl4
C+O2=CO2C + O2 = CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C5H12(g)+O2(g)=CO2(g)+ H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
CaCl2(aq) + 2 NaHSO4(aq) = Ca(HSO4)2 + 2 NaClCaCl2(aq) + 2NaHSO4(aq) = Ca(HSO4)2 + 2NaCl
C2H5OH (g) + O2 (g) = CO2 (g) + H2O (l)C2H5OH(g) + 3O2(g) = 2CO2(g) + 3H2O(l)
C2H6 (g) + O2 (g) = CO2 (g) + H2O (l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
Co(OH)2(s) + HNO3(aq) = Co(NO3)2(s) + 2H2O(l)Co(OH)2(s) + 2HNO3(aq) = Co(NO3)2(s) + 2H2O(l)
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
Co2O3(s) +CH3COOH(aq) = Co(CH3COO)2(s) + H2O(l) + O2(g)2Co2O3(s) + 8CH3COOH(aq) = 4Co(CH3COO)2(s) + 4H2O(l) + O2(g)
Co2O3 + CH3COOH = Co(CH3COO)2 + H2O + O22Co2O3 + 8CH3COOH = 4Co(CH3COO)2 + 4H2O + O2
Ca(s)+H2O(g)=Ca(OH)2(aq)+H2(g)Ca(s) + 2H2O(g) = Ca(OH)2(aq) + H2(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CuSO4+Mg=MgSO4+CuCuSO4 + Mg = MgSO4 + Cu
CuSO4 + KMnO4 = CuMnO4 + KSO4CuSO4 + KMnO4 = CuMnO4 + KSO4
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO+H2O2C3H8 + 7O2 = 6CO + 8H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2 + 2KI = 2KCl + I2 Cl2 + 2KI = 2KCl + I2
Cl + KI = KCl + I Cl + KI = KCl + I
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
CH3(CH2)5 CH3 +O2 =CO2 + H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
C6H12O6 + 9O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6 + 9O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H7OH(l) + O2 = CO2(g) + H2O(g)2C3H7OH(l) + 9O2 = 6CO2(g) + 8H2O(g)
C3H8(g) + 6 O2(g) = 7 CO2(g) +8 H2O(l) C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C2H6O(l) + O2(g) = CO2(g) + H2O(g)C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CaCl2 + Na3PO4 = Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C14 H28 +2CH4= 2C8 H18C14H28 + 2CH4 = 2C8H18
C14 H28 +H2 = 2C7 H14C14H28 + 0H2 = 2C7H14
C12 H24 +H2 = 2C6 H13C12H24 + H2 = 2C6H13
Ca(NO3)2+K3PO4=Ca3(PO4)2+KNO33Ca(NO3)2 + 2K3PO4 = Ca3(PO4)2 + 6KNO3
Cl2+KBr=Br2+KClCl2 + 2KBr = Br2 + 2KCl
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 +NO + H2O 3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 +NO + H2O 3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 +NO + H2O 3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH3(NH2)+O2=CO2+H2O+NO24CH3(NH2) + 13O2 = 4CO2 + 10H2O + 4NO2
Cu3 + (PO4)2 = Cu3(PO4)2Cu3 + (PO4)2 = Cu3(PO4)2
Co(NO3)2+H2SO4= CoSO4+HNO3Co(NO3)2 + H2SO4 = CoSO4 + 2HNO3
Co(NO3)2+Na2CO3= CoCO3+2NaNO3Co(NO3)2 + Na2CO3 = CoCO3 + 2NaNO3
CH4 + O2 =CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CH4 + O2= CO + H2O2CH4 + 3O2 = 2CO + 4H2O
C4H10 + 4 H2O = 4 CO + 9 H2C4H10 + 4H2O = 4CO + 9H2
Cl2+O2=Cl2O32Cl2 + 3O2 = 2Cl2O3
C2H6 + 7O2 = 2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl+O=ClOCl + O = ClO
C10H8 + O2=CO2 + H2OC10H8 + 12O2 = 10CO2 + 4H2O
C3H8(g)+O2(g)=CO2(g)+H20(l)5C3H8(g) + 15O2(g) = 15CO2(g) + 2H20(l)
CH3OH + O2 =CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C3H4+O2=CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
CH3(CH2)5 + O2 = CO2 +H2O4CH3(CH2)5 + 37O2 = 24CO2 + 26H2O
C3H7OH(l)+O2(g)=CO2(g)+H2O(g)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
C3H8(g) + O2(g) = CO2(g) + H2O(l) C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CH3(CH2)5 + O2 = CO2 +H2O4CH3(CH2)5 + 37O2 = 24CO2 + 26H2O
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C7H14(l) +O2(g) =CO2(g)+H2O(g)2C7H14(l) + 21O2(g) = 14CO2(g) + 14H2O(g)
C7H14(l) +O2(g) =CO2+H2O2C7H14(l) + 21O2(g) = 14CO2 + 14H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18(l) + O2(g)=CO2(g)+H2O(g)2C8H18(l) + 25O2(g) = 16CO2(g) + 18H2O(g)
CuCl2(aq) + NaOH(aq) = Cu(OH)2(s) + NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
Cr2O3(aq)+ H2(aq) = Cr(aq) + H2OCr2O3(aq) + 3H2(aq) = 2Cr(aq) + 3H2O
C3H4(aq)+ O2(aq) = CO2(aq) + H2OC3H4(aq) + 4O2(aq) = 3CO2(aq) + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H8(aq) + O2(aq) =CO2(aq)+ H2O(aq)C4H8(aq) + 6O2(aq) = 4CO2(aq) + 4H2O(aq)
C3H8 + O2 =3 CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + 5 O2 = CO2 + 4 H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H7OH(l) + O2(g) =CO2(g) + H2O(g)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
Cr + H2SO4 = Cr2(SO4)3 + H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
C7H14 + O2 = CO2 + H2010C7H14 + 70O2 = 70CO2 + 7H20
C8H18(l) + O2(g) = CO2(g)+H2O2C8H18(l) + 25O2(g) = 16CO2(g) + 18H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr(OH)4 + Zn = Cr +Zn(OH)2Cr(OH)4 + 2Zn = Cr + 2Zn(OH)2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Co+HgCl2=CoCl3+Hg2Co + 3HgCl2 = 2CoCl3 + 3Hg
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
C3H6(g) = C(s) + H2(g)C3H6(g) = 3C(s) + 3H2(g)
Ca(HCO3)2(s) = CaCO3(s) + H2O(g) + CO2(g)Ca(HCO3)2(s) = CaCO3(s) + H2O(g) + CO2(g)
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
Cu+AgNO3=Cu (NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cr2O3+HF=CrF3+H2OCr2O3 + 6HF = 2CrF3 + 3H2O
Ca(NO3)2+Na2SO4=CaSO4+NaNO3Ca(NO3)2 + Na2SO4 = CaSO4 + 2NaNO3
Co(NO3)2 + H2S = CoS + HNO3Co(NO3)2 + H2S = CoS + 2HNO3
C3H6O + 4O2 =3CO2 + 3H2OC3H6O + 4O2 = 3CO2 + 3H2O
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
C3H8O+K2Cr2O7+H2SO4=C3H6O2+ K2SO4+Cr2(SO4)3+H2O3C3H8O + 2K2Cr2O7 + 8H2SO4 = 3C3H6O2 + 2K2SO4 + 2Cr2(SO4)3 + 11H2O
C3H8O+K2Cr2O7+H2SO4=C3H8O2+ K2SO4+Cr2(SO4)3+H2O3C3H8O + K2Cr2O7 + 4H2SO4 = 3C3H8O2 + K2SO4 + Cr2(SO4)3 + 4H2O
C3H8O+KMnO4+H2SO4=C3H8O2+K2SO4+MnSO4+H2O5C3H8O + 2KMnO4 + 3H2SO4 = 5C3H8O2 + K2SO4 + 2MnSO4 + 3H2O
C3H8O+KMnO4+H2SO4=C3H6O2+K2SO4+MnSO4+H2O5C3H8O + 4KMnO4 + 6H2SO4 = 5C3H6O2 + 2K2SO4 + 4MnSO4 + 11H2O
C3H8O+KMnO4+H2SO4=C3H6O+K2SO4+MnSO4+H2O5C3H8O + 2KMnO4 + 3H2SO4 = 5C3H6O + K2SO4 + 2MnSO4 + 8H2O
CH3CHO+K2Cr2O7+H2SO4=CH3COOH+K2SO4+Cr2(SO4)3+H2O3CH3CHO + K2Cr2O7 + 4H2SO4 = 3CH3COOH + K2SO4 + Cr2(SO4)3 + 4H2O
CH3CHO+KMnO4+H2SO4=CH3COOH+K2SO4+MnSO4+H2O5CH3CHO + 2KMnO4 + 3H2SO4 = 5CH3COOH + K2SO4 + 2MnSO4 + 3H2O
CH3CH2OH+K2Cr2O7+H2SO4=CH3COOH+K2SO4+Cr2(SO4)3+H2O3CH3CH2OH + 2K2Cr2O7 + 8H2SO4 = 3CH3COOH + 2K2SO4 + 2Cr2(SO4)3 + 11H2O
CH3CH2OH+K2Cr2O7+H2SO4=C2H4O+K2SO4+Cr2(SO4)3+H2O3CH3CH2OH + K2Cr2O7 + 4H2SO4 = 3C2H4O + K2SO4 + Cr2(SO4)3 + 7H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3CH2OH+KMnO4+H2SO4=CH3COOH+K2SO4+MnSO4+H2O5CH3CH2OH + 4KMnO4 + 6H2SO4 = 5CH3COOH + 2K2SO4 + 4MnSO4 + 11H2O
CH3CH2OH+KMnO4+H2SO4=CH3COOH+K2SO4+MnSO4+H2O5CH3CH2OH + 4KMnO4 + 6H2SO4 = 5CH3COOH + 2K2SO4 + 4MnSO4 + 11H2O
CH4(g)+O2(g)=CO2(g)+H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
CH4(g)+O2(g)=CO2(g)+H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaH2 + H2O = Ca(OH)2 + H2 CaH2 + 2H2O = Ca(OH)2 + 2H2
C + O2 = CO2C + O2 = CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10+9O2=4CO2+5H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6O+3O2=2CO2+3H2010C2H6O + 15O2 = 20CO2 + 3H20
C3H8 + O2 = H2O + CO2C3H8 + 5O2 = 4H2O + 3CO2
C2H6O+3O2=2CO2+3H2OC2H6O + 3O2 = 2CO2 + 3H2O
C + O2=2 CO2C + O2 = 2CO
C5H12O+O2=CO2+H2O2C5H12O + 15O2 = 10CO2 + 12H2O
CaO + HNO3 = Ca(NO3)2 + H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
C2H4(g) + O2(g) = CO2(g) + H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
CO(NH2)2+H+2H2O=2NH3+HCO3CO(NH2)2 - H + 2H2O = 2NH3 + HCO3
CS2+H2S+CU=CU2S+CH4-1CS2 + 6H2S + 8CU = 4CU2S + 3CH4
C (s) + O2 (g) = CO2 (g)C(s) + O2(g) = CO2(g)
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
Cl2+H2=HClCl2 + H2 = 2HCl
C+S8 = CS24C + S8 = 4CS2
C+S8 = CS24C + S8 = 4CS2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CuS + O2 = CuSO2CuS + O2 = CuSO2
C2H5OH + 3 O2 = 2 CO2 + 3 H2O C2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + 3 O2 = 2 CO2 + 3 H2O C2H5OH + 3O2 = 2CO2 + 3H2O
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
CuI2(aq) + (NH4)2CO3(aq) = CuCO3(s) + 2NH4I(aq)CuI2(aq) + (NH4)2CO3(aq) = CuCO3(s) + 2NH4I(aq)
Ca(ClO3)2 = CaCl2+O2Ca(ClO3)2 = CaCl2 + 3O2
C2H5OH(l) + O2(g) = CO2(g) + H2O(g)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
C2H5OH(l) + O2(g) = CO2(g) + H2O(g)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
CU + HNO3 = CU(NO3)2 + NO + H2O3CU + 8HNO3 = 3CU(NO3)2 + 2NO + 4H2O
Cr2O3+Al=AlO3+CrCr2O3 + Al = AlO3 + 2Cr
Cr2O3+Al=AlO3+CrCr2O3 + Al = AlO3 + 2Cr
CH4+ O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C2H5OCH3(g) + O2(g) =CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
C7H8 + HSO3CI = C7H7SO2CI + C7H7SO2CI0C7H8 + 0HSO3CI = -1C7H7SO2CI + C7H7SO2CI
CS2 + N2O = S8 + CO2 + N24CS2 + 8N2O = S8 + 4CO2 + 8N2
C2H5OCH3(g) + O2(g) =CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
C2H6+O2= CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H8+O2 =5CO2+4H2OC5H8 + 7O2 = 5CO2 + 4H2O
C3H6+NH3+O2=C3H3N+H2O2C3H6 + 2NH3 + 3O2 = 2C3H3N + 6H2O
CaN+Na(PO4)=CaPO4+NaNCaN + Na(PO4) = CaPO4 + NaN
CH3COOH(aq) + KOH(aq) = CH3COOK + H2OCH3COOH(aq) + KOH(aq) = CH3COOK + H2O
CAOH+FECL=CACL+FEOHCAOH + FECL = CACL + FEOH
Ca3(PO4)2 + SiO2 + 10C = CaSiO3 + CO + PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
C6H14(g) + O2(g) =CO2(g) + H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
Ca Cl2 + Ag (NO3) = Ca (NO3)2 + Ag ClCaCl2 + 2Ag(NO3) = Ca(NO3)2 + 2AgCl
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OCH3 + O2(g) = CO2 + H2O2C2H5OCH3 + 9O2(g) = 6CO2 + 8H2O
C2H6 + O2 = CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
Cu + HNO3 = Cu(NO3)2 + NO2 + 2H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3COOH+O2=CO2+H205CH3COOH + 5O2 = 10CO2 + H20
Cu+O2=CuO2Cu + O2 = 2CuO
Cr(OH)3 + HClO4 = Cr(ClO4)3 + H2OCr(OH)3 + 3HClO4 = Cr(ClO4)3 + 3H2O
Ca(NO3)2 (aq) + K3PO4(aq) = Ca3(PO4)2 (s) + KNO3 (aq)3Ca(NO3)2(aq) + 2K3PO4(aq) = Ca3(PO4)2(s) + 6KNO3(aq)
Cl2 (g) + KBr (aq) = Br2 (aq) + KCl (aq)Cl2(g) + 2KBr(aq) = Br2(aq) + 2KCl(aq)
C3H6O (g) + O2(g) = CO2 (g) + H2O (g)C3H6O(g) + 4O2(g) = 3CO2(g) + 3H2O(g)
C2H6 (g) + O2 (g) = CO2 (g) + H2O (l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
CO + O2 = CO22CO + O2 = 2CO2
C5H12(g) + O2(g) = CO2(g) + H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
C2H8N2+N2O4=N2+CO2+H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cu(OH)2+HClO4=H2O+Cu(ClO4)2Cu(OH)2 + 2HClO4 = 2H2O + Cu(ClO4)2
CO2(g) + 2KOH(l) = K2CO3(s) + H2O(l)CO2(g) + 2KOH(l) = K2CO3(s) + H2O(l)
CO2(g) + 2KOH(l) = K2CO3(s) + H2O(l)CO2(g) + 2KOH(l) = K2CO3(s) + H2O(l)
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
CH3CHO + 3 O2 = 2 CO2 + 2 H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
C3H6O2+H2 = C2H6O+CH4OC3H6O2 + 2H2 = C2H6O + CH4O
Co+HNO3=Co(NO3)3+NH4(NO3)+H2O8Co + 30HNO3 = 8Co(NO3)3 + 3NH4(NO3) + 9H2O
CO2 + H2O = C6H12O6 + O6CO2 + 6H2O = C6H12O6 + 12O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + O2 = CuO2Cu + O2 = 2CuO
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Cr2(SO4)3+NaOH=Cr(OH)3+Na2SO4Cr2(SO4)3 + 6NaOH = 2Cr(OH)3 + 3Na2SO4
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2C2H6 + 2O2 = 2CO2 + 3H2
C3H8O3 + 7O2 = 3CO2 + 4H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
C+O2= CO2C + O2 = 2CO
C+O2= CO2C + O2 = CO2
C+O2= CO 2C + O2 = 2CO
C6H14 +O2 =CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C9H20 + O2 = CO2 + H20 C9H20 + 9O2 = 9CO2 + H20
Cu (OH)2(s) = CuO(s) + H2O(l)Cu(OH)2(s) = CuO(s) + H2O(l)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Cu(NO3) 2 (aq) + NaOH(aq) = Cu(OH)2(s) + NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Cu +Ag(NO3)2 = Cu(NO3)2 +AgCu + Ag(NO3)2 = Cu(NO3)2 + Ag
CH4 + O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaCl2 +NaNO3 = Ca(NO3)2 + NaClCaCl2 + 2NaNO3 = Ca(NO3)2 + 2NaCl
C7H14O2 + NaHCO3 = CH3COONa + H2O + CO24C7H14O2 + 19NaHCO3 = 19CH3COONa + 9H2O + 9CO2
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CaO + SO2 + O2 = CaSO42CaO + 2SO2 + O2 = 2CaSO4
C + 4HNO3 = CO2 + 4NO2 + 2H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
ClO3- + Br- + H+ = Cl- + Br2 + H2OClO3- + 6Br- + 6H+ = Cl- + 3Br2 + 3H2O
C2H6+2Br2=HBr+C2H5BrC2H6 + Br2 = HBr + C2H5Br
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6+Cl2=HCl+C2H5ClC2H6 + Cl2 = HCl + C2H5Cl
C2H6+3Br=HBr+C2H5BrC2H6 + 2Br = HBr + C2H5Br
C2H6+2F2=HF2+C2H5F2C2H6 + 3F2 = 2HF2 + 2C2H5F
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
C6H6(l) +O2(g)= CO2(g) +H2O(g)2C6H6(l) + 15O2(g) = 12CO2(g) + 6H2O(g)
CaCl2+Na3PO4= Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
CuCl2 + KNO3 = Cu (NO3)2 + KClCuCl2 + 2KNO3 = Cu(NO3)2 + 2KCl
C6H6 +O2 = CO + H2O2C6H6 + 9O2 = 12CO + 6H2O
C6H6 +O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H6 +O2 = CO +H2O2C6H6 + 9O2 = 12CO + 6H2O
Ca(HCO3)2= CaCO3 +H2O+CO2Ca(HCO3)2 = CaCO3 + H2O + CO2
Ca(NO3) + K3PO4= Ca3(PO4) +KNO33Ca(NO3) + K3PO4 = Ca3(PO4) + 3KNO3
C2H2 +C2H6 = C3H8C2H2 + 5C2H6 = 4C3H8
Cl2 +KBr = KCl + BrCl2 + 2KBr = 2KCl + 2Br
C3H6O + O2= CO2 +H2OC3H6O + 4O2 = 3CO2 + 3H2O
Ca(OH)2+Na2CO3=2Na(OH)+Ca(CO3)Ca(OH)2 + Na2CO3 = 2Na(OH) + Ca(CO3)
CaN2 + NO3 = Ca(NO3)2 + N33CaN2 + 6NO3 = 3Ca(NO3)2 + 2N3
CaN2 + NO3 = Ca(NO3)2 + N2CaN2 + 2NO3 = Ca(NO3)2 + N2
CaN2 + NO3 = Ca(NO3)2 + N33CaN2 + 6NO3 = 3Ca(NO3)2 + 2N3
Cl2+V2O5=VOCl3+O26Cl2 + 2V2O5 = 4VOCl3 + 3O2
C3H8(g) + O2(g) =CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+H2SO4=CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
C + O2 = CO2C + O2 = CO2
C3H6O + 9O2 = 3CO2 + 3H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H6O + 4O2 = 3CO2 + 3H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H8 (g) + 5 O2 (g) = 3 CO2 + 4 H2OC3H8(g) + 5O2(g) = 3CO2 + 4H2O
C3H8 + 5 O2 = 3 CO2 + 4 H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+H2=CaH2 Ca + H2 = CaH2
C3H8(g)+O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C+H2SO4=CO2+H2O+SO2C + 2H2SO4 = CO2 + 2H2O + 2SO2
Ca3(PO4)2+K=K3PO4+CaCa3(PO4)2 + 6K = 2K3PO4 + 3Ca
C + SO2 = CS2 + CO5C + 2SO2 = CS2 + 4CO
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H8O2+O2=CO2+H205C4H8O2 + 15O2 = 20CO2 + 2H20
Cu2O + C = Cu + COCu2O + C = 2Cu + CO
C2H6O + O2 =CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6O + O2 = CO2 (g) + H2O (g)C2H6O + 3O2 = 2CO2(g) + 3H2O(g)
C2H5OH+3O2=2CO2+3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+H2O=CO2+H2O0C4H10 + H2O = 0CO2 + H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C + O2 = CO2C + O2 = CO2
C+SO2=CS2+CO5C + 2SO2 = CS2 + 4CO
Cl2 + NaBr = 2 NaCl +Br2Cl2 + 2NaBr = 2NaCl + Br2
CH4 + O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = 2CO2 +H2C2H6 + 2O2 = 2CO2 + 3H2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H4+O2=CO2+2H2OC2H4 + 3O2 = 2CO2 + 2H2O
CrI3+K2Cr2O7+H2SO4= HIO3+ K2SO4+ Cr2(SO4)3+ H2O 2CrI3 + 6K2Cr2O7 + 27H2SO4 = 6HIO3 + 6K2SO4 + 7Cr2(SO4)3 + 24H2O
CrI3+K2Cr2O7+H2SO4= HIO+ K2SO4+ Cr2(SO4)3+ H2O 2CrI3 + 2K2Cr2O7 + 11H2SO4 = 6HIO + 2K2SO4 + 3Cr2(SO4)3 + 8H2O
CO2+S8=CS2+SO28CO2 + 3S8 = 8CS2 + 8SO2
C5 H11 NH2+O2=CO2+H2O+NO24C5H11NH2 + 37O2 = 20CO2 + 26H2O + 4NO2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CuSO4 + KI = CuI + I2 + K2SO42CuSO4 + 4KI = 2CuI + I2 + 2K2SO4
C4H7OH + O2=CO2 + H2O2C4H7OH + 11O2 = 8CO2 + 8H2O
Ca +HNO3 = Ca(NO3)2 +N2O +H2O4Ca + 10HNO3 = 4Ca(NO3)2 + N2O + 5H2O
CuSO4 + KI = CuI + I2 + K2SO42CuSO4 + 4KI = 2CuI + I2 + 2K2SO4
CuSO4 + KI = CuI + I2 + K2SO42CuSO4 + 4KI = 2CuI + I2 + 2K2SO4
Cu + Cl2 + 2 H2O = CuCl2(H2O)2Cu + Cl2 + 2H2O = CuCl2(H2O)2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
Ca(NO3)2 + Li2S = CaS + 2LiNO3Ca(NO3)2 + Li2S = CaS + 2LiNO3
Ca(s) + CO2(g) + H2O(l) = H2(g) + CaCO3(s)Ca(s) + CO2(g) + H2O(l) = H2(g) + CaCO3(s)
C6 H12 O6 (s) = C2 H6 O (l) + CO2 (g)C6H12O6(s) = 2C2H6O(l) + 2CO2(g)
C22H46+O2=CO2+H2O2C22H46 + 67O2 = 44CO2 + 46H2O
C2H3Cl+ O2 = CO2+ H2O+ Cl24C2H3Cl + 11O2 = 8CO2 + 6H2O + 2Cl2
C6H10O+5O2=3CO2+H2OC6H10O + 8O2 = 6CO2 + 5H2O
C2H5OH(l)+O2(g)=2CO2(g)+3H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Co(NO3)2(aq)+NaOH(aq)=CoOH(s)+Na(NO3)2(aq)Co(NO3)2(aq) + NaOH(aq) = CoOH(s) + Na(NO3)2(aq)
C + O2 = CO2C + O2 = CO2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CaO + HNO3 = Ca(NO3)2 + H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
CS2+N2O=S8+CO2+N24CS2 + 8N2O = S8 + 4CO2 + 8N2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.