Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C4H9OH+H2SO4=C4H10+H2O+H2SO40C4H9OH + H2SO4 = 0C4H10 + 0H2O + H2SO4
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cr2O3(s)+C(s)=Cr(s)+CO(g)Cr2O3(s) + 3C(s) = 2Cr(s) + 3CO(g)
Ca(OH)2(aq)+HNO3(aq)=Ca(NO3)2(aq)+H2O(l)Ca(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O(l)
C4H8(g)+O2(g)=CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
C2H5OH+O2=2CO2+3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Co(s) + H2SO4(aq) = Co2(SO4)3(aq) + H2(g)2Co(s) + 3H2SO4(aq) = Co2(SO4)3(aq) + 3H2(g)
Co + HCl=H2+ CoCl2Co + 2HCl = H2 + 2CoCl
C10H18O+O2=CO2+H2OC10H18O + 14O2 = 10CO2 + 9H2O
Cu2O(s)+O2(g)=CuO(s)2Cu2O(s) + O2(g) = 4CuO(s)
CuO(s)=Cu(s)+O22CuO(s) = 2Cu(s) + O2
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C7H16 (g) + O2 (g)=CO2 (g) + H2O (l)C7H16(g) + 11O2(g) = 7CO2(g) + 8H2O(l)
CuS + HNO3 = Cu(NO3)2 + NO + S +H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 3S + 4H2O
Cu(s) + AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + Ag(s)Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
Cl2 + AgNO3 + H2O = AgCl + AgClO3+ HNO33Cl2 + 6AgNO3 + 3H2O = 5AgCl + AgClO3 + 6HNO3
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
CO(NO3)2 +NaCl= CO(NO2)3+NaCl0CO(NO3)2 + NaCl = 0CO(NO2)3 + NaCl
CaCl2 + BaOH = BaCl + Ca(OH)2CaCl2 + 2BaOH = 2BaCl + Ca(OH)2
CO(NO3)2 +NaCl= CO(NO2)3+NaCl0CO(NO3)2 + NaCl = 0CO(NO2)3 + NaCl
Cl2+I-=I2+Cl-Cl2 + 2I- = I2 + 2Cl-
Cl2+I-=I2+Cl-Cl2 + 2I- = I2 + 2Cl-
Co(NO3)2(aq) + H2S(g) = CoS(s) + HNO3(aq)Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
Cu(s) + AgC2H3O2(aq)= Cu(C2H3O2)2(aq) + Ag(s)Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
C 4 H 10 (g)+O 2 (g)=CO 2 (g)+H 2 O(g) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Co(NO3)2(aq) + H2S(g) = CoS(s) + HNO3(aq)Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
Co(NO3)2(aq) + H2S(g) = CoS(s) + HNO3(aq)Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
Cu(s) + AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + Ag(s)Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
C2H4 + HCl + O2 = ClCH2CH2Cl + H2O2C2H4 + 4HCl + O2 = 2ClCH2CH2Cl + 2H2O
C2H4 + HCl + O2 = ClCH2CH2Cl + H2O2C2H4 + 4HCl + O2 = 2ClCH2CH2Cl + 2H2O
CS2 + S2Cl2 = S8 + CCl44CS2 + 8S2Cl2 = 3S8 + 4CCl4
Cr(NO3)3(aq) + K3PO4(aq) =CrPO4(s) + 3KNO3(aq) Cr(NO3)3(aq) + K3PO4(aq) = CrPO4(s) + 3KNO3(aq)
CS2 + S2Cl2 = S8 + CCl44CS2 + 8S2Cl2 = 3S8 + 4CCl4
CS2 + Cl2 = S2Cl2 + CCl4CS2 + 3Cl2 = S2Cl2 + CCl4
Cl2(g) + CH4(g) + O2(g) = HCl(g) + CO(g)4Cl2(g) + 2CH4(g) + O2(g) = 8HCl(g) + 2CO(g)
CuCl2(aq) + Al(s) = AlCl3(aq) + Cu(s)3CuCl2(aq) + 2Al(s) = 2AlCl3(aq) + 3Cu(s)
Cu(OH)2(s) = CuO(s) + H2O(l)Cu(OH)2(s) = CuO(s) + H2O(l)
Cu(s) + HNO3(aq) = Cu(NO3)2(aq) + NO2(g) + H2O(l)Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)
C2H5OH+K2Cr2O7+HCl=CH3COOH+CrCl3+KCl+H2O3C2H5OH + 2K2Cr2O7 + 16HCl = 3CH3COOH + 4CrCl3 + 4KCl + 11H2O
C6H8O7 = C4H6O5 + CO2 + H2O-2C6H8O7 = -3C4H6O5 + 0CO2 + H2O
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
Cu+ HNO3 = Cu(NO3)2+NO2 + H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO2 + H20
Cr2O3(s)+C(s)=Cr(s)+CO(g)Cr2O3(s) + 3C(s) = 2Cr(s) + 3CO(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C4H9OH+O2=4CO2+5H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H6O3+ CH3OH=C8H8O3+ H2OC7H6O3 + CH3OH = C8H8O3 + H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Ca(NO3)2 + Na3PO4 = 6NaNO3(s) + Ca3(PO4)2(s)3Ca(NO3)2 + 2Na3PO4 = 6NaNO3(s) + Ca3(PO4)2(s)
Ca(NO3)2 + Na3PO4 = 6NaNO3(s) + Ca3(PO4)2(s)3Ca(NO3)2 + 2Na3PO4 = 6NaNO3(s) + Ca3(PO4)2(s)
CH2+HCl=CH3CH2Cl 2CH2 + HCl = CH3CH2Cl
Cl2+Al=AlCl33Cl2 + 2Al = 2AlCl3
Cu(OH)2 + 2 HCl = CuCl2 + 2 H2OCu(OH)2 + 2HCl = CuCl2 + 2H2O
C6H6+ O2 = CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H6+ O2 = CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cu(NO3)2=NO2+CuO+O22Cu(NO3)2 = 4NO2 + 2CuO + O2
Co2(s)=Co2(g)Co2(s) = Co2(g)
C6H14(g)+O2(g)=CO2(g)+H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C2H3O2+S=H2S+CO2+H20C2H3O2 - S = -1H2S + 0CO2 + H2
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Ca(OH)2(aq)+Na3PO4(aq)=Ca3(PO4)2(s)+NaOH(aq)3Ca(OH)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
Ca(OH)2(aq)+Na3PO4(aq)=Ca3(PO4)2(s)+NaOH(aq)3Ca(OH)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
CO2+H2=CH3CO2+CH4-2CO2 + H2 = -2CH3CO2 + 2CH4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
CO2+H2=CH3CO2+CH4-2CO2 + H2 = -2CH3CO2 + 2CH4
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cr2S3+Mn(NO3)2+Na2CO3=NO+CO2+Na2CrO4+Na2MnO4+Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
Cu2O(s)+O2(g)=CuO(s)2Cu2O(s) + O2(g) = 4CuO(s)
Cl2 + NaBr = Br2 + NaClCl2 + 2NaBr = Br2 + 2NaCl
C + O2 = CO2C + O2 = 2CO
C + O = COC + O = CO
CoCl2 + Na2O2 + NaOH + H2O = Co(OH)3 + NaCl2CoCl2 + Na2O2 + 2NaOH + 2H2O = 2Co(OH)3 + 4NaCl
C8H9NO2+NaOH+C4H9I=C12H17NO2+Na+H20+I20C8H9NO2 + 0NaOH + 20C4H9I = 20C12H17NO2 + 0Na + H20 + 20I
Cr + HCl = CrCl2 + H2Cr + 2HCl = CrCl2 + H2
CaPO4 +MgCl = MgPO4 + CaClCaPO4 + MgCl = MgPO4 + CaCl
Ca(NO3)2+Na3PO4=NaNO3+Ca3(PO4)23Ca(NO3)2 + 2Na3PO4 = 6NaNO3 + Ca3(PO4)2
Cr2O3+CCl4=CrCl3+3COCl2Cr2O3 + 3CCl4 = 2CrCl3 + 3COCl2
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
CoCl2*6H2O + Na3PO4*12H2O = Co3(PO4)2 +NaCl + H2O3CoCl2*6H2O + 2Na3PO4*12H2O = Co3(PO4)2 + 6NaCl + 42H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(NO3)2+NaOH=Cu(OH)2+NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
Cr2S3 + Mn(NO3)2 + Na2CO3 = NO + CO2 + Na2CrO4 + Na2MnO4 + Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
CoSO4+NaClO3=Na2SO4+Co(ClO3)2CoSO4 + 2NaClO3 = Na2SO4 + Co(ClO3)2
Cu + HNO3 = Cu(NO3)2 +NO2+ H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH4 + Br2 = CH3 + HBr2CH4 + Br2 = 2CH3 + 2HBr
CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
C2H6 + Cl2 = C2H4Cl2 + HClC2H6 + 2Cl2 = C2H4Cl2 + 2HCl
CO(g)+I2O5(s)=I2(s)+CO2(g)5CO(g) + I2O5(s) = I2(s) + 5CO2(g)
C5H10(l)+O2(g)=CO2(g)+ H C5H10(l) + 5O2(g) = 5CO2(g) + 10H
C5H6 + O2= CO2 + H2O2C5H6 + 13O2 = 10CO2 + 6H2O
C5H12 + O2= CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C6H6 + O2= CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaOH+HNO3=H2O+NO3CaCaOH + HNO3 = H2O + NO3Ca
CaOH+HNO3=H2O+Ca(NO3)CaOH + HNO3 = H2O + Ca(NO3)
C2H4 + HCl + O2 = ClCH2CH2Cl + H2O2C2H4 + 4HCl + O2 = 2ClCH2CH2Cl + 2H2O
CS2 + S2Cl2 = S8 + CCl44CS2 + 8S2Cl2 = 3S8 + 4CCl4
CS2 + S2Cl2 = S8 + CCl8CS2 + 4S2Cl2 = 3S8 + 8CCl
CS2 + Cl2 = S2Cl2 + CCl4CS2 + 3Cl2 = S2Cl2 + CCl4
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C5H10 (l)+ O2 (g) = CO2 (g) + H2O (g)2C5H10(l) + 15O2(g) = 10CO2(g) + 10H2O(g)
C4H9OH + O2 = CO2 + H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C4H10OH + O2 = CO2 + H2O4C4H10OH + 25O2 = 16CO2 + 22H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca3(PO4)2+SiO2=P4O10+CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(SO4)2 + NaH (CO3)2 = CuH (CO3)2 + Na(SO4)2Cu(SO4)2 + NaH(CO3)2 = CuH(CO3)2 + Na(SO4)2
Cr+S8=Cr2S316Cr + 3S8 = 8Cr2S3
C4H10 + Cl2 + O2 = CCl4 + H2O2C4H10 + 16Cl2 + 5O2 = 8CCl4 + 10H2O
Ca+AlCl=CaCl+AlCa + AlCl = CaCl + Al
Cu+AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CaCl2O+NaAsO2+NaOH=CaCl2+Na3AsO4+H2OCaCl2O + NaAsO2 + 2NaOH = CaCl2 + Na3AsO4 + H2O
Cu+HNO3= Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu(NO3)2+Na2S= CuS+NaNO3Cu(NO3)2 + Na2S = CuS + 2NaNO3
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
C12H26+O2=CO2+H2O2C12H26 + 37O2 = 24CO2 + 26H2O
C30H62+O2=CO2+H2O2C30H62 + 91O2 = 60CO2 + 62H2O
C25H52+O2=CO2+H2OC25H52 + 38O2 = 25CO2 + 26H2O
Cu(NO3)2 + Na2S = CuS + NaNO3Cu(NO3)2 + Na2S = CuS + 2NaNO3
Cu(NO3)2 + Na2S = CuS + NaNO3Cu(NO3)2 + Na2S = CuS + 2NaNO3
CrCl3+H2S=Cr2S3+HCl2CrCl3 + 3H2S = Cr2S3 + 6HCl
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu +Hg2(NO3)2 =Cu(NO3)2 + Hg2Cu + Hg2(NO3)2 = Cu(NO3)2 + Hg2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
CH3OH + O2 = CO2 +H2010CH3OH + 5O2 = 10CO2 + 2H20
CH3OH + O2 = CO2 +H2010CH3OH + 5O2 = 10CO2 + 2H20
CuO(s)+H2SO4(aq)=CuSO4(aq)+H2O(l)CuO(s) + H2SO4(aq) = CuSO4(aq) + H2O(l)
CrO5+H2SO4 =Cr2(SO4)3+ H2O +O24CrO5 + 6H2SO4 = 2Cr2(SO4)3 + 6H2O + 7O2
Cu(OH)2(s)=CuO(s)+H2O(l)Cu(OH)2(s) = CuO(s) + H2O(l)
C2H4O2+CaSO4*2H2O=CO2+CaO+SO2+H2OC2H4O2 + 4CaSO4*2H2O = 2CO2 + 4CaO + 4SO2 + 10H2O
C2H4O2+CaSO4*2H2O=CO2+CaO+SO2+H2OC2H4O2 + 4CaSO4*2H2O = 2CO2 + 4CaO + 4SO2 + 10H2O
C2H4O2*2H2O+CaSO4=CO2+CaO+SO2+H2OC2H4O2*2H2O + 4CaSO4 = 2CO2 + 4CaO + 4SO2 + 4H2O
C2H4O2+CaSO4=CO2+CaO+SO2+H2OC2H4O2 + 4CaSO4 = 2CO2 + 4CaO + 4SO2 + 2H2O
CH3CH2CH3 + O2 = CO2 + H205CH3CH2CH3 + 15O2 = 15CO2 + 2H20
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Co + HCl=CoCl3 + H22Co + 6HCl = 2CoCl3 + 3H2
C2H6 + 4O2 = 2CO2 + 6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(s)+2HNO3(aq)=Ca(NO3)2+H2O(l)+N2O4Ca(s) + 10HNO3(aq) = 4Ca(NO3)2 + 5H2O(l) + N2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
CrCl3+AgNO3=Cr(NO3)3+AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
CrCl3+AgNO3=Cr(NO3)3+AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
CS2(s)+O2(g)=CO2(g)+SO2(g)CS2(s) + 3O2(g) = CO2(g) + 2SO2(g)
CS2(s)+O2(g)=CO2(g)+SO2(g)CS2(s) + 3O2(g) = CO2(g) + 2SO2(g)
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H60 +O2 = CO2 +H2OC3H60 + 18O2 = 3CO2 + 30H2O
C2H4O+O2=CO2+H2O2C2H4O + 5O2 = 4CO2 + 4H2O
C7H16+O2= H2O+CO2C7H16 + 11O2 = 8H2O + 7CO2
Ca(OH)2(s)+CO2(g)=CaCO3(s)+H2O(l)Ca(OH)2(s) + CO2(g) = CaCO3(s) + H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H6O + O2 = CO2 + H2O C7H6O + 8O2 = 7CO2 + 3H2O
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
CaCl2 + NaH2PO4 = NaCl + Ca3(PO4)2 + HCl3CaCl2 + 2NaH2PO4 = 2NaCl + Ca3(PO4)2 + 4HCl
C4H10(l) + O2(g) = CO2(g) + H2O(l)2C4H10(l) + 13O2(g) = 8CO2(g) + 10H2O(l)
Ca(OH)2 + CO2 = Ca(OH)(HCO3)Ca(OH)2 + CO2 = Ca(OH)(HCO3)
CuO(s) + HCl(aq) = CuCl2(aq) + H2OCuO(s) + 2HCl(aq) = CuCl2(aq) + H2O
Cu(OH)2(s) = CuO(s) + H2OCu(OH)2(s) = CuO(s) + H2O
Cu(NO3)2(aq) + NaOH(aq) = Cu(OH)2(s)+NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
Ca+O2=CaO2Ca + O2 = 2CaO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu(NO3)2+2KOH= Cu(OH)2+2KNO3Cu(NO3)2 + 2KOH = Cu(OH)2 + 2KNO3
Ca + AlCl3 = CaCl2 + Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
C+O2=CO2C + O2 = 2CO
C + H2O = CO + H2C + H2O = CO + H2
Ca(C2H3O2)2 + HCl = H(C2H3O2) + CaCl2Ca(C2H3O2)2 + 2HCl = 2H(C2H3O2) + CaCl2
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CuSO4+NaOH=Cu(OH)2+Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
ClCu+NaOH=CuOH+NaClClCu + NaOH = CuOH + NaCl
ClCu+NaOH=CuOH+NaClClCu + NaOH = CuOH + NaCl
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CS2 + Cl = CCl4 + SCl2CS2 + 8Cl = CCl4 + 2SCl2
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
Ca(CH3CO2)2+HCl=CaCl2+H(CH3CO2)Ca(CH3CO2)2 + 2HCl = CaCl2 + 2H(CH3CO2)
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CaO+MnI4=MnO2+CaI22CaO + MnI4 = MnO2 + 2CaI2
Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + NH4C2H3O2Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + 2NH4C2H3O2
C+H2=C3H83C + 4H2 = C3H8
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Ca+CuF2=CaF2+CuCa + CuF2 = CaF2 + Cu
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
CH4(g)+Cl2(g)=CCl4(g)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(g) + 4HCl(g)
Ca (OH)2 + FeCl3 = CaCl2 + Fe (OH)33Ca(OH)2 + 2FeCl3 = 3CaCl2 + 2Fe(OH)3
C12H22O11 = C + H2OC12H22O11 = 12C + 11H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CS2(l)+O2(g)= SO2 (g) + CO2 (g)CS2(l) + 3O2(g) = 2SO2(g) + CO2(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CaCl2 + Cr2(SO4)3 = CaSO4 + CrCl33CaCl2 + Cr2(SO4)3 = 3CaSO4 + 2CrCl3
C+ O2 =CO2C + O2 = CO2
CF4+ O2 =COF42CF4 + O2 = 2COF4
C+ F+ O2 =COF32C + 6F + O2 = 2COF3
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C10H4+O2=CO2+H2OC10H4 + 11O2 = 10CO2 + 2H2O
CH4+N2Cl4=2H2+N2+CCl4CH4 + N2Cl4 = 2H2 + N2 + CCl4
Cr2O3=Cr+O22Cr2O3 = 4Cr + 3O2
CaCl2 = 2Ca + Cl2CaCl2 = Ca + Cl2
C5H12+O12=CO2+H2O3C5H12 + 4O12 = 15CO2 + 18H2O
C3H8 + O = CO2 + H2OC3H8 + 10O = 3CO2 + 4H2O
Cd+CN=Cd(CN)4Cd + 4CN = Cd(CN)4
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3COOH+O2=CO2+H2OCH3COOH + 2O2 = 2CO2 + 2H2O
CH3COOH+O2=CO2+H2OCH3COOH + 2O2 = 2CO2 + 2H2O
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
Cu2O + Cu2S = Cu + SO22Cu2O + Cu2S = 6Cu + SO2
CO2(g)+CaSiO3(s)+H2O = SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O = SiO2(s) + Ca(HCO3)2(aq)
Cu2CO3(OH)2 = CuO + CO2 + H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
CH4+N2Cl4=2H2+N2+CCl4CH4 + N2Cl4 = 2H2 + N2 + CCl4
C4H10S + O2 = CO2 + H2O + SO22C4H10S + 15O2 = 8CO2 + 10H2O + 2SO2
Cu(OH)2 + H2SO4 = CuSO4 + H2OCu(OH)2 + H2SO4 = CuSO4 + 2H2O
CuSO4+Ba(NO3)2=Cu(NO3)2+BaSO4CuSO4 + Ba(NO3)2 = Cu(NO3)2 + BaSO4
CH3CH2CH2CO2H(l)+CH2CH3OH(l)=CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l) + CH2CH3OH(l) = CH3CH2CH2CO2CH2CH3(l) + H2O(l)
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
Cu(NO3)2 + NaOH = Cu(OH)2 + Na(NO3)Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2Na(NO3)
CH4+ H2O= CO2+ H2O2-1CH4 + 6H2O = -1CO2 + 4H2O2
C5H12 + 5 O2 = 5 CO2 + 6 H2C5H12 + 5O2 = 5CO2 + 6H2
C5H12 + 5 O2 = 5 CO2 + 6 H2C5H12 + 5O2 = 5CO2 + 6H2
C4H8 + 6 O2 = 4 CO2 + 3 H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H8 + 6 O2 = 4 CO2 + 3 H2OC4H8 + 6O2 = 4CO2 + 4H2O
CuCl2 + NH3 = Cu(NH3) + 2Cl(NH3)CuCl2 + 3NH3 = Cu(NH3) + 2Cl(NH3)
CO + AlCl3 = C + Cl2 + AlO36CO + 2AlCl3 = 6C + 3Cl2 + 2AlO3
C2H5OH + O2= CO2 = 4H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6 + O2= CO2 = 4H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2= CO2 = 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3CH2OH+O2=H2O+CHCOOH2CH3CH2OH + 3O2 = 4H2O + 2CHCOOH
Ca+O2=CaO2Ca + O2 = 2CaO
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
C5 + H10 + O2 =(CH3)CHCH2CO2H8C5 + 7H10 + 10O2 = 10(CH3)CHCH2CO2H
C6 + H14 + O = C6H14OC6 + H14 + O = C6H14O
CaC2 + H2O + CO2 = Ca(OH)2 + CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
CaC2 + H2O + CO2 = Ca(OH)2 + CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C+S8=CS24C + S8 = 4CS2
CO + AlCl3 = C + Cl + AlO33CO + AlCl3 = 3C + 3Cl + AlO3
CO4+Fe=Fe2(CO4)33CO4 + 2Fe = Fe2(CO4)3
C2H8N2+N2O4=N2+CO2+H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C6H12O6 =6C + 6H2OC6H12O6 = 6C + 6H2O
C6H12O+O2=CO2+H2O2C6H12O + 17O2 = 12CO2 + 12H2O
CH4 + CCl4 = CH2Cl2CH4 + CCl4 = 2CH2Cl2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
Cr2O3+CO=Cr+CO2Cr2O3 + 3CO = 2Cr + 3CO2
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaC2(s) + H2O(l) = Ca(OH)2(s) + C2H2(g) CaC2(s) + 2H2O(l) = Ca(OH)2(s) + C2H2(g)
Cl2(g) + KI(aq) = KCl(aq) + I2(s) Cl2(g) + 2KI(aq) = 2KCl(aq) + I2(s)
Cu(s) + AgNO3(aq) = Ag(s) + Cu(NO3 )2(aq)Cu(s) + 2AgNO3(aq) = 2Ag(s) + Cu(NO3)2(aq)
Cr2O7 + Cl2 = Cr + ClO2Cr2O7 + 7Cl2 = 4Cr + 14ClO
C4H9OH+O2=H2O+CO2C4H9OH + 6O2 = 5H2O + 4CO2
C4H9OH+O2=H2O+CO2C4H9OH + 6O2 = 5H2O + 4CO2
C4H6 + C4H2O3 = C8H8O3C4H6 + C4H2O3 = C8H8O3
C4H6 + C4H2O3 = C8H8O3C4H6 + C4H2O3 = C8H8O3
C4H6+O2 = CO2 + H2O 2C4H6 + 11O2 = 8CO2 + 6H2O
Ca CN2+C+Na2 CO3 = Ca CO3+NaCNCaCN2 + C + Na2CO3 = CaCO3 + 2NaCN
Ca CN2+C+Na2 CO3 = Ca CO3+NaCNCaCN2 + C + Na2CO3 = CaCO3 + 2NaCN
Ca CN2+C+Na2 CO3 = Ca CO3+NaCNCaCN2 + C + Na2CO3 = CaCO3 + 2NaCN
CH3NO2+O2=H2O+CO2+N24CH3NO2 + 3O2 = 6H2O + 4CO2 + 2N2
Cr(NO2)2+(NH4)2SO4=CrSO4+NH4NO2Cr(NO2)2 + (NH4)2SO4 = CrSO4 + 2NH4NO2
CH3NO2+O2=H2O+CO2+N24CH3NO2 + 3O2 = 6H2O + 4CO2 + 2N2
CaCO3+H3PO4=Ca3(PO4)2+H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
C8H18+NH4NO3=N2+H2O+CO2C8H18 + 25NH4NO3 = 25N2 + 59H2O + 8CO2
CuCl2(aq)+Na2S(aq)=CuS+NaClCuCl2(aq) + Na2S(aq) = CuS + 2NaCl
C7H17+O2=CO2+H2O4C7H17 + 45O2 = 28CO2 + 34H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl 2 (g)+NaOH(aq)=NaCl(aq)+NaClO3 (aq)+H 2 O(l) 3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4 + H2O = CO2 + H2O 0CH4 + H2O = 0CO2 + H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca(NO3)2 + K3PO4 = Ca3(PO4)2 + KNO33Ca(NO3)2 + 2K3PO4 = Ca3(PO4)2 + 6KNO3
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C 2 H 8 N 2 +N 2 O 4 =N 2 +CO 2 +H 2 O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C + H2 = CH4C + 2H2 = CH4
CuCl2 + H2S = CuS + HClCuCl2 + H2S = CuS + 2HCl
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CuCl2 + H2S = CuS + HClCuCl2 + H2S = CuS + 2HCl
C3H8 +O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H6SO2 + C6H4(CH3)2 = C6H4 + SO27C4H6SO2 - 5C6H4(CH3)2 = -2C6H4 + 7SO2
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CH2+O2=CO2+H2O2CH2 + 3O2 = 2CO2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca(OH)2+CO2=Ca(OH)(HCO3)Ca(OH)2 + CO2 = Ca(OH)(HCO3)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H12+O2=CO2+H2OC2H12 + 5O2 = 2CO2 + 6H2O
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuSO4 + KBr = CuBr + KSO4CuSO4 + KBr = CuBr + KSO4
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CrCl3+H2S=Cr2S3+HCl2CrCl3 + 3H2S = Cr2S3 + 6HCl
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CoI3 (aq) + Pb(NO3)2 (aq) = Co(NO3)3 (aq) + PbI2 (s)2CoI3(aq) + 3Pb(NO3)2(aq) = 2Co(NO3)3(aq) + 3PbI2(s)
CCl4 =C + Cl CCl4 = C + 4Cl
CCl4 =C + Cl CCl4 = C + 4Cl
CCl4 =C + Cl CCl4 = C + 4Cl
CCl4 =C + Cl CCl4 = C + 4Cl
Ca + S8 = CaS8Ca + S8 = 8CaS
C4 H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4 H10 + O2 = 4CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CU + HNO3 = CU(NO3)2 + NO + H2O3CU + 8HNO3 = 3CU(NO3)2 + 2NO + 4H2O
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
Cr2O3 (s) + 3 CO(g) = 2Cr(s) + 3CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
CuSO4+NaOH=Cu(OH)2+Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
C6H12O6+O2 = CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO2 + KOH = K2CO3 + H2OCO2 + 2KOH = K2CO3 + H2O
C+H2=C3H83C + 4H2 = C3H8
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
CH4 + Br2 = CBr4 + HBrCH4 + 4Br2 = CBr4 + 4HBr
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuO+HCl=CuCl2+H2OCuO + 2HCl = CuCl2 + H2O
C5H12+O2=CO2+6H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C4H10+13O2=CO2+1H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2 + NaI =NaCl + I2Cl2 + 2NaI = 2NaCl + I2
C3H8+O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H8+O2=3CO2+4H2OC8H8 + 10O2 = 8CO2 + 4H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C5H12+O2=CO2+6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2OH + O2 = CO2 + H2O4C2OH + 7O2 = 8CO2 + 2H2O
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C2H5OH+O2=2CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CO +H2 = CH3OHCO + 2H2 = CH3OH
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2O7 + H2O= HClO4Cl2O7 + H2O = 2HClO4
Cl2O7 + H2O= ClO3(OH) Cl2O7 + H2O = 2ClO3(OH)
C2H5OH (aq) + K2Cr2O7 (aq) + HCl(aq) = CH3COOH (aq) + CrCl3 (aq) + KCl (aq) + H2O (l)3C2H5OH(aq) + 2K2Cr2O7(aq) + 16HCl(aq) = 3CH3COOH(aq) + 4CrCl3(aq) + 4KCl(aq) + 11H2O(l)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH3COOH(l)+O2(g)=CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
C6H12O6+O2=CO2+H205C6H12O6 + 15O2 = 30CO2 + 3H20
Cr(s)+NiSO4(aq)=Cr2(SO4)3(aq)+Ni(s)2Cr(s) + 3NiSO4(aq) = Cr2(SO4)3(aq) + 3Ni(s)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
CH3OOH + H2O = H3O + CH3OOCH3OOH + H2O = H3O + CH3OO
Ca3N2+H2O=Ca(OH)2+NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
C8 H18 (g) + O2 (g) = CO2 (g) + H2O(g) 2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C 8 H 18 (g)+O 2 (g) = CO 2 (g)+H 2 O(g) 2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
CaI2+H2SO4=HI+CaSO4CaI2 + H2SO4 = 2HI + CaSO4
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CoI3 (aq) + Pb(NO3)2 (aq) = Co(NO3)3 (aq) + PbI2 (s)2CoI3(aq) + 3Pb(NO3)2(aq) = 2Co(NO3)3(aq) + 3PbI2(s)
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cu2CO3(OH)2 = CuO + CO2 + H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
CS2 +O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
CO + H = CH4OCO + 4H = CH4O
CO2 + LiOH = Li2CO3 + H2OCO2 + 2LiOH = Li2CO3 + H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H5(NO3)3=CO2+N2+H2O+O24C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
C3H5(NO3)3=CO3+N2+H2O+O2-4C3H5(NO3)3 = -12CO3 - 6N2 - 10H2O + 5O2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
CaCl2+(NH4)2CO3=CaCO3+NH4ClCaCl2 + (NH4)2CO3 = CaCO3 + 2NH4Cl
C3H8O(l) + O2(g)= CO2(g) +H2O(l)2C3H8O(l) + 9O2(g) = 6CO2(g) + 8H2O(l)
Cu +HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu +HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH10+O2=CO2+H2O2CH10 + 7O2 = 2CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO+H2=C8H18+H2O8CO + 17H2 = C8H18 + 8H2O
C2H4O+O2 =CO2 +H2O2C2H4O + 5O2 = 4CO2 + 4H2O
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C8H18 + O2 =CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Co(NO3)2+H2S=CoS+HNO3Co(NO3)2 + H2S = CoS + 2HNO3
CaSO4+AlCl3=CaCl2+ Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H12O6 + 6O2 = 3CO2 + 3H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6 + 6O2 = 3CO2 + 3H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu+AgC2H3O2=Cu(C2H3O2)2+ AgCu + 2AgC2H3O2 = Cu(C2H3O2)2 + 2Ag
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + O= CO2 + H2OC3H8 + 10O = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Co+O2= Co2O34Co + 3O2 = 2Co2O3
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2 + H3PO4= H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
Cu+HNO3 = Cu(NO3)+H2O+NO2Cu + 2HNO3 = Cu(NO3) + H2O + NO2
Ca+AL CL=Ca CL+ALCa + ALCL = CaCL + AL
CaF2 + Li2SO4 = CaSO4 + LiFCaF2 + Li2SO4 = CaSO4 + 2LiF
CoBr3 + CaSO4 = CaBr2 + Co2(SO4)32CoBr3 + 3CaSO4 = 3CaBr2 + Co2(SO4)3
Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CuCl + H2S= Cu2S +HCl2CuCl + H2S = Cu2S + 2HCl
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CuSO4 + KOH = Cu(OH)2+K2SO4CuSO4 + 2KOH = Cu(OH)2 + K2SO4
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C9H20(g)+O2(g)=CO2(g)+H2O(g)C9H20(g) + 14O2(g) = 9CO2(g) + 10H2O(g)
CuBr2+Cl2=Br2+CuCl2CuBr2 + Cl2 = Br2 + CuCl2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cu(OH)2=CuO +H2OCu(OH)2 = CuO + H2O
CaCl2+Na2CO3=2NaCl+CaCO3CaCl2 + Na2CO3 = 2NaCl + CaCO3
C6H12(l)+O2(g)=CO2(g)+H2O(g)C6H12(l) + 9O2(g) = 6CO2(g) + 6H2O(g)
CuO(s)+CO(g)=Cu(s)+CO2(g)CuO(s) + CO(g) = Cu(s) + CO2(g)
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Ca + AlF3 = CaF2 + Al3Ca + 2AlF3 = 3CaF2 + 2Al
C6H6O+O2=CO2+H2010C6H6O + 55O2 = 60CO2 + 3H20
Ca(OH)2(aq)+Na3PO4(aq)=Ca3(PO4)2(s)+NaOH(aq)3Ca(OH)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH(l)+O2(g)=CO2(g)+H2O(l)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(l)
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C5H12+O2=CO+H2O2C5H12 + 11O2 = 10CO + 12H2O
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C14H30 + O2 = CO2 + H2O2C14H30 + 43O2 = 28CO2 + 30H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C15H32+O2=CO2+H2OC15H32 + 23O2 = 15CO2 + 16H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6+ O2= CO2+ H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5OH+ PCl3= C2H5Cl+ H3PO33C2H5OH + PCl3 = 3C2H5Cl + H3PO3
C3H8+ O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8(g) + O2(g) = CO2(g) + H2O(g) C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C6H6(g) + O2(g) = CO2(g) + H2O(g)2C6H6(g) + 15O2(g) = 12CO2(g) + 6H2O(g)
Ca(OH)2+ H3PO4= Ca3(PO4)2+ H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C3H4+O2= CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C4H8(OH)2+ O2= CO2+ H2O2C4H8(OH)2 + 11O2 = 8CO2 + 10H2O
Ca3P2+ H2O= Ca(OH)2+ PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca+HNO3=Ca(NO3)2+H2Ca + 2HNO3 = Ca(NO3)2 + H2
C5H11 + OH = CO2 + H2OC5H11 + 31OH = 5CO2 + 21H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CO + O2= CO22CO + O2 = 2CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.