Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
Ca+HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
C2H7N+O2=CO2+H2O+N24C2H7N + 15O2 = 8CO2 + 14H2O + 2N2
C8H10 + CuO = CO +H2O + CuC2C8H10 + 13CuO = 3CO + 10H2O + 13CuC
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CO2 + H2O = C12H22O11 + O212CO2 + 11H2O = C12H22O11 + 12O2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca3(PO4)2 + SiO2 + C = P4 + CO + CaSiO32Ca3(PO4)2 + 6SiO2 + 10C = P4 + 10CO + 6CaSiO3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(NO3)2 + H2SO4 = CaSO4 + 2HNO3Ca(NO3)2 + H2SO4 = CaSO4 + 2HNO3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CoBr2+KH2PO4=CoH2PO4+KBr2CoBr2 + KH2PO4 = CoH2PO4 + KBr2
Cr2(SO4)3 + 6 NaOH = 2Cr(OH)3 + 3Na2SO4Cr2(SO4)3 + 6NaOH = 2Cr(OH)3 + 3Na2SO4
Cr2(SO4)3 + 6 NaOH = 2Cr(OH)3 + 3Na2SO4Cr2(SO4)3 + 6NaOH = 2Cr(OH)3 + 3Na2SO4
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cr + H2SO4 = Cr2(SO4)3 + H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CH3((CH2)6)CH3 + O2 = CO2 + H2O2CH3((CH2)6)CH3 + 25O2 = 16CO2 + 18H2O
CH3OH + O2 =CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CS2 + Cl2 =CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C3H6O = C2H2O + CH4C3H6O = C2H2O + CH4
CuNO3 (aq) + 2 KOH (aq) = Cu(OH)2 (s) + K2NO3 (aq)CuNO3(aq) + 2KOH(aq) = Cu(OH)2(s) + K2NO3(aq)
CuNO3 (aq) + 2 KOH (aq) = Cu(OH)2 (s) + K2NO3 (aq)CuNO3(aq) + 2KOH(aq) = Cu(OH)2(s) + K2NO3(aq)
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca + H2 SO4 = Ca SO4 + H2Ca + H2SO4 = CaSO4 + H2
Cl2 + KBr = KCl + Br2Cl2 + 2KBr = 2KCl + Br2
CO2 + Mg = C + MgOCO2 + 2Mg = C + 2MgO
Cl2 + Na = NaClCl2 + 2Na = 2NaCl
Ca + O2 = CaO2Ca + O2 = 2CaO
Cr2S3(aq)+KH2PO4(aq)=Cr2PO4+KH2S3Cr2S3(aq) + KH2PO4(aq) = Cr2PO4 + KH2S3
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3 + HCl = CaCl2 + CO2 + H2O CaCO3 + 2HCl = CaCl2 + CO2 + H2O
C3H8O +CrO3 +H2SO4 = Cr2(SO4)3 + C3H6O+ H2010C3H8O + 0CrO3 + 0H2SO4 = 0Cr2(SO4)3 + 10C3H6O + H20
C6H14O + O2 = CO2 + H2O C6H14O + 9O2 = 6CO2 + 7H2O
Cr2S3(aq)+KH2PO4(aq)=Cr2K +S3H2PO4Cr2S3(aq) + KH2PO4(aq) = Cr2K + S3H2PO4
Cr2S3+KH2PO4=Cr2K +S3H2PO4Cr2S3 + KH2PO4 = Cr2K + S3H2PO4
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu+H2O=CuO+H2Cu + H2O = CuO + H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuSO4*5H2O= CuSO4 + H2OCuSO4*5H2O = CuSO4 + 5H2O
C6H5COOH + O2= CO2 + H2O2C6H5COOH + 15O2 = 14CO2 + 6H2O
CH4+2O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+2O2 = CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
Ca3(PO4)2+SiO2+C = CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca3(PO4)2+SiO2+C = CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CO + K2Cr2O7 + HCl = CO2 + CrCl3 + KCl +H2O3CO + K2Cr2O7 + 8HCl = 3CO2 + 2CrCl3 + 2KCl + 4H2O
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CH3CH3 + O2 = CO2 +H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Ca(NO3)2=CaO+NO2+O22Ca(NO3)2 = 2CaO + 4NO2 + O2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca3(PO4)2(s) + SiO2 + C(s) = CaSiO3(s) +CO(g) + P4(s) 2Ca3(PO4)2(s) + 6SiO2 + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
CaCO3 + H2SO4 = CaSO4 + H2O + CO2CaCO3 + H2SO4 = CaSO4 + H2O + CO2
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 + H2O = Ca + CO2 + H2O0CaCO3 + H2O = 0Ca + 0CO2 + H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 + H2O = Ca + CO2 + H2O0CaCO3 + H2O = 0Ca + 0CO2 + H2O
CH3(CH2)3CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)3CH3(l) + 8O2(g) = 5CO2(g) + 6H2O(g)
CO2+H2=CH3OOOH+H2O-1CO2 - H2 = -1CH3OOOH + H2O
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu ( NO3 ) 2 + NO + H2 O 3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C+HNO3 = NO2+2CO2+H2OC + 4HNO3 = 4NO2 + CO2 + 2H2O
C2H6 + O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2 + C = Ca3P2 + COCa3(PO4)2 + 8C = Ca3P2 + 8CO
CH4 + O2 = 2CO2 + 4H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH2OH + K2Cr2O7 + H2SO4= CH3COH + Cr2(SO4)3 + K2SO4 + H2O3CH3CH2OH + K2Cr2O7 + 4H2SO4 = 3CH3COH + Cr2(SO4)3 + K2SO4 + 7H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CuO+H2SO4=CuSO4+H2OCuO + H2SO4 = CuSO4 + H2O
CuO+H2SO4=CuSO4+H2OCuO + H2SO4 = CuSO4 + H2O
CuCO3 + CH3COONa = CuCH3COO + NaHCO3 + CO2 + H2O -8CuCO3 - 9CH3COONa = -8CuCH3COO - 9NaHCO3 - CO2 + 3H2O
C (s) + H 2 (g) = C2 H 6 (g)2C(s) + 3H2(g) = C2H6(g)
Ca+O2=CaO2Ca + O2 = 2CaO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH2O + O2 = C2H6O + CO23CH2O + 0O2 = C2H6O + CO2
CaO+2HCl=CaCl2+H2OCaO + 2HCl = CaCl2 + H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca(NO3)2+NaF=CaF2+Na(NO3)Ca(NO3)2 + 2NaF = CaF2 + 2Na(NO3)
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cr3N2+H2O=Cr(OH)2+NH3Cr3N2 + 6H2O = 3Cr(OH)2 + 2NH3
C+O2 = CO2C + O2 = CO2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C6H13OH + O2 = CO2 + H2OC6H13OH + 9O2 = 6CO2 + 7H2O
C2H4+O2= CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2= CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2= CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CU+2H2SO4=CUSO4+2H2O+SO2CU + 2H2SO4 = CUSO4 + 2H2O + SO2
Cu + NHO3 = Cu(NO3)2+ NO2 + H2OCu + 4NHO3 = Cu(NO3)2 + 2NO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C6H12O6 = 2C2H5OH + 3CO2C6H12O6 = 2C2H5OH + 2CO2
C6H12O6 = 2C2H5OH + 3CO2C6H12O6 = 2C2H5OH + 2CO2
CCl4 = C +ClCCl4 = C + 4Cl
CH3CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca(NO3)2(aq) + 2 NaOH(aq) = Ca(OH)2(s) + 2 NaNO3(aq)Ca(NO3)2(aq) + 2NaOH(aq) = Ca(OH)2(s) + 2NaNO3(aq)
Ca+PO4=Ca2(PO4)22Ca + 2PO4 = Ca2(PO4)2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2 H5 OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2 H5 OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu+HNO3=Cu(NO3)2+H2O+NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CoBr3(aq) + Pb(NO3)2(aq) = Co(NO3)3(aq) + PbBr2(s)2CoBr3(aq) + 3Pb(NO3)2(aq) = 2Co(NO3)3(aq) + 3PbBr2(s)
Co(NO3)2+KI=CoI+K(NO3)2Co(NO3)2 + KI = CoI + K(NO3)2
Ca(NO3)2 + Na3PO4 = Ca3(PO4)2 + NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
CuCl2+GaCl3+4CS(NH2)2+8H2O +TiCl4=CuGaTiS2+5NH4Cl+4CO2+2H2S+NH30CuCl2 + 0GaCl3 + CS(NH2)2 + 2H2O + 0TiCl4 = 0CuGaTiS2 + 0NH4Cl + CO2 + H2S + 2NH3
CuCl2+GaCl3+4CS(NH2)2+8H2O=CuGaS2+5NH4Cl+4CO2+2H2S+NH30CuCl2 + 0GaCl3 + CS(NH2)2 + 2H2O = 0CuGaS2 + 0NH4Cl + CO2 + H2S + 2NH3
CuCl2+GaCl3+4CS(NH2)2+8H2O=CuGaS2+5NH4Cl+4CO2+2H2S+NH30CuCl2 + 0GaCl3 + CS(NH2)2 + 2H2O = 0CuGaS2 + 0NH4Cl + CO2 + H2S + 2NH3
CuCl2+GaCl3+4CS(NH2)2+8H2O=CuGaS2+5NH4Cl+CO2+H2S+NH30CuCl2 + 0GaCl3 + CS(NH2)2 + 2H2O = 0CuGaS2 + 0NH4Cl + CO2 + H2S + 2NH3
CuCl2+GaCl3+4CS(NH2)2+8H2O=CuGaS2+NH4Cl+CO2+H2S+NH30CuCl2 + 0GaCl3 + CS(NH2)2 + 2H2O = 0CuGaS2 + 0NH4Cl + CO2 + H2S + 2NH3
CuCl2+GaCl3+4CS(NH2)2+8H2O=CuGaS2+NH4Cl+CO2+H2S+NH4CuCl2 + 4GaCl3 + 11CS(NH2)2 + 22H2O = 4CuGaS2 + 20NH4Cl + 11CO2 + 3H2S + 2NH
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cu+HNO3=Cu(NO3)2+H2O+NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cu+HNO3=Cu(NO3)2+H2O+NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
CO+O2=CO22CO + O2 = 2CO2
CO3+ O2= CO22CO3 - O2 = 2CO2
C2H6O + O2 = H2O + CO2C2H6O + 3O2 = 3H2O + 2CO2
C5H12+O2 =CO2 +H205C5H12 + 25O2 = 25CO2 + 3H20
C2H2 + O2 = H2O + CO22C2H2 + 5O2 = 2H2O + 4CO2
C6H12O6(aq)=2C2H6O(aq)+ 2CO2(g)C6H12O6(aq) = 2C2H6O(aq) + 2CO2(g)
C6H12O6(aq)=2C2H6O(aq)+ 2CO2(g)C6H12O6(aq) = 2C2H6O(aq) + 2CO2(g)
C6H10O + O2 = CO2 + H2OC6H10O + 8O2 = 6CO2 + 5H2O
Cl2 + O2 = Cl2O72Cl2 + 7O2 = 2Cl2O7
Cl2 + O2 = Cl2O72Cl2 + 7O2 = 2Cl2O7
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
CaO(s)+C(s)=CaC2(s)+CO2(g)2CaO(s) + 5C(s) = 2CaC2(s) + CO2(g)
CaO(s)+C(s)=CaC2(s)+CO2(g)2CaO(s) + 5C(s) = 2CaC2(s) + CO2(g)
C4H8+CH2O=C5H10OC4H8 + CH2O = C5H10O
CH3(CH2)4CH3+O2=CO2+H2010CH3(CH2)4CH3 + 60O2 = 60CO2 + 7H20
CH3OH+O2=H2O+CO22CH3OH + 3O2 = 4H2O + 2CO2
C2H4(g) + H2O2(g) = CH2OHCH2OH(g)C2H4(g) + H2O2(g) = CH2OHCH2OH(g)
Cr2S3+Mn(NO3)2+Na2CO3=Na2CrO4+NO+Na2MnO4+Na2SO4+CO2Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 2Na2CrO4 + 30NO + 15Na2MnO4 + 3Na2SO4 + 20CO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4+O2=CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CH3COOH + O2 = H2O + CO2CH3COOH + 2O2 = 2H2O + 2CO2
Ca3P2(s) + H2O(l) = Ca(OH)2(aq) + PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C5H10O2(l) + O2(g) = CO2(g) + H2O(l)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(l)
Cr2O7 + C2O4 = Cr + CO20Cr2O7 + C2O4 = 0Cr + 2CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(NO3)2(aq) + Na3PO4(aq) =Ca3(PO4)2(s) + NaNO3(aq)3Ca(NO3)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaNO3(aq)
Ca(NO3)2(aq) + Na3PO4(aq) = Ca3(PO4)2(s) + NaNO3(aq)3Ca(NO3)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaNO3(aq)
C4H10(g) + O2(g) = CO2(g) + H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
CH3CH2CH3+O2=CO2+H205CH3CH2CH3 + 15O2 = 15CO2 + 2H20
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C3H8(g) + O2(g) = CO2(g) + H2OC3H8(g) + 5O2(g) = 3CO2(g) + 4H2O
C3H6O2+O2=CO2+H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C+H2 =C2H62C + 3H2 = C2H6
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
CH3CH2CH3 + 3O2 = 3CO2 + 4H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)3CH3 + O2 = CO2 + H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Cu(OH)2=CuO+H2OCu(OH)2 = CuO + H2O
C6H14S + O2 = CO2 + H2O + SO22C6H14S + 21O2 = 12CO2 + 14H2O + 2SO2
C + O2 = CO2C + O2 = CO2
C + O2 = CO 2C + O2 = 2CO
C6H14S + O2 = CO2 + H2O + SO22C6H14S + 21O2 = 12CO2 + 14H2O + 2SO2
C6H5COOH + O2 = CO2 + H2O2C6H5COOH + 15O2 = 14CO2 + 6H2O
CH4+H2O+N2 = NH3+CO23CH4 + 6H2O + 4N2 = 8NH3 + 3CO2
CO + OK = COOKCO + OK = COOK
COOK = CO2 + KCOOK = CO2 + K
CO2 + K = COOKCO2 + K = COOK
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CO2 + H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C2H4O + KMnO4 = CO2 + MnO + K2O + H2OC2H4O + 2KMnO4 = 2CO2 + 2MnO + K2O + 2H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca + Fe(NO3)3 = CaNO3 + Fe3Ca + Fe(NO3)3 = 3CaNO3 + Fe
Ca + FeSO4 = CaSO4 + FeCa + FeSO4 = CaSO4 + Fe
CH30H+O2=CO2+H2O4CH30H + 35O2 = 4CO2 + 62H2O
CO2(g) + H2O(l) = H2CO3CO2(g) + H2O(l) = H2CO3
C2O4+MnO2=Mn+CO2C2O4 + 0MnO2 = 0Mn + 2CO2
C2O4+MnO2=Mn+CO2C2O4 + 0MnO2 = 0Mn + 2CO2
C2O4+MnO2=Mn+CO2C2O4 + 0MnO2 = 0Mn + 2CO2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2+CO2=CaCO3+H2OCa(OH)2 + CO2 = CaCO3 + H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g) 2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu + H+ + HNO3 = Cu++ + NH4+ + 3H2O4Cu + 9H+ + HNO3 = 4Cu++ + NH4+ + 3H2O
Cu + H+ + HNO3 = Cu++ + NH4 + 3H2O9Cu + 18H+ + 2HNO3 = 9Cu++ + 2NH4 + 6H2O
CH3(CH2)2CH3(g) + O2(g) = CO2(g) + H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C(s)+H2(g) = C2H6(g)2C(s) + 3H2(g) = C2H6(g)
CaO + Na3PO4 = Na2O + Ca3 (PO4)23CaO + 2Na3PO4 = 3Na2O + Ca3(PO4)2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CO(g)+O2(g)=CO22CO(g) + O2(g) = 2CO2
Cl2 + SrI2 = Sr + ClI2Cl2 + 2SrI2 = 2Sr + 2ClI2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H19+O2=CO2+H2O4C8H19 + 51O2 = 32CO2 + 38H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH3(CH2)6CH3+O2 = CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)2(CH3)+O2=CO2+H2O2CH3(CH2)2(CH3) + 13O2 = 8CO2 + 10H2O
Cr(OH)3 + IO3- + OH- = CrO4-- + I- + H2012Cr(OH)3 - 4IO3- + 24OH- = 12CrO4-- - 4I- + 3H20
CaC2+H2O=C2H2+CaOCaC2 + H2O = C2H2 + CaO
C2H6O + CrO7++ + H+ = Cr+++ + CH3CO2H + H2028C2H6O + 4CrO7++ + 4H+ = 4Cr+++ + 28CH3CO2H + 3H20
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
Ca (OH) 2+H3PO4=Ca3 (PO4) 2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)6CH3(g)+O2(g) = CO2(g)+H2O(g)2CH3(CH2)6CH3(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
CrCl3 + NaClO3 + NaOH= Na2CrO4 + NaCl + H2O2CrCl3 + NaClO3 + 10NaOH = 2Na2CrO4 + 7NaCl + 5H2O
CrCl3 + NaClO3 + NaOH= Na2CrO4 + NaCl + H2O2CrCl3 + NaClO3 + 10NaOH = 2Na2CrO4 + 7NaCl + 5H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH3 (g) + O2 (g) = CO2 (g) + H2O (g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CO2 (g) + H2O (l) = H2CO3CO2(g) + H2O(l) = H2CO3
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + O2 = CO2 + H2010C2H5OH + 15O2 = 20CO2 + 3H20
C(s)+H2(g)=C2H6(g)2C(s) + 3H2(g) = C2H6(g)
Cr(OH)3 + OH = CrO4 + H2OCr(OH)3 + 5OH = CrO4 + 4H2O
CrO + H2O =Cr(OH)2CrO + H2O = Cr(OH)2
CrO + H2O =Cr(OH)2CrO + H2O = Cr(OH)2
C5H9O + O2 =CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
CdSO4=Cd + SO4CdSO4 = Cd + SO4
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H8O6(aq) + Br2 (aq) = C6H6O6(aq) + HBr(aq)C6H8O6(aq) + Br2(aq) = C6H6O6(aq) + 2HBr(aq)
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CaCl2+H2O=HCl+Ca(OH)2CaCl2 + 2H2O = 2HCl + Ca(OH)2
CH4+H2O = CO+H2CH4 + H2O = CO + 3H2
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
CH4 +O2=CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CaCl2 + K3PO4 = Ca3(PO4)2 + KCl3CaCl2 + 2K3PO4 = Ca3(PO4)2 + 6KCl
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO+O2=CO22CO + O2 = 2CO2
CO2+O2=CO2CO2 + 0O2 = CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH2(COO)2Na+NaOH=C(COO)2Na2+H3OCH2(COO)2Na + NaOH = C(COO)2Na2 + H3O
CH2(COOH)2+NaOH=CH2(COO)2Na+H3OCH2(COOH)2 + NaOH = CH2(COO)2Na + H3O
CH2(COOH)2+NaOH=CH2(COO)2Na+H3OCH2(COOH)2 + NaOH = CH2(COO)2Na + H3O
CuO + C6H8O7 = Cu3(C6H5O7)2 + 3H2O3CuO + 2C6H8O7 = Cu3(C6H5O7)2 + 3H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 (aq) + HCl (aq) = CaCl2 (aq) + H2O (l)Ca(OH)2(aq) + 2HCl(aq) = CaCl2(aq) + 2H2O(l)
C4H10 (g) + O2 (g) = CO2 (g) + H2O (g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C6H12O6+ O2 = CO2 +H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Cl2 (g) + H2O (l) = HCl (aq) + HClO3 (aq)3Cl2(g) + 3H2O(l) = 5HCl(aq) + HClO3(aq)
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca3(PO4)+SiO2+C=CaSiO3+P4+CO4Ca3(PO4) + 12SiO2 + 4C = 12CaSiO3 + P4 + 4CO
CH3(CH2)2CH3 + O2 = CO2 + H202CH3(CH2)2CH3 + 8O2 = 8CO2 + H20
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C10H22+O2=CO2+H22C10H22 + 10O2 = 10CO2 + H22
C6H12O6+O2 = CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C5H12(g) +O2 (g) = H2O(g) + CO2(g)C5H12(g) + 8O2(g) = 6H2O(g) + 5CO2(g)
CaCO3+O2=CaO+CO2CaCO3 + 0O2 = CaO + CO2
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cr + O2 = Cr2O34Cr + 3O2 = 2Cr2O3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO (g) + H2 (g)= H2O (g) + CH4 (g)CO(g) + 3H2(g) = H2O(g) + CH4(g)
C2H4O (g) + O2 (g) = CO2 (g) + H2O (g)2C2H4O(g) + 5O2(g) = 4CO2(g) + 4H2O(g)
C3H8O3 (g) + O2 (g) =CO2 (g) + H2O (g)2C3H8O3(g) + 7O2(g) = 6CO2(g) + 8H2O(g)
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
Ca3(PO4)2+SiO2+C = CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CaCO3+H3PO4=Ca3(PO4)2+H2O+CO23CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2O + 3CO2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cu+HNO3=Cu(NO3)2+H2O+NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
CH3(CH2)6CH3 +O2 = CO2 + H2010CH3(CH2)6CH3 + 80O2 = 80CO2 + 9H20
CH3(CH2)6CH3 +O2 = CO2 + H2010CH3(CH2)6CH3 + 80O2 = 80CO2 + 9H20
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
Ca (ClO)2+KI+HCl =CaCl2+KCl+I2+H2OCa(ClO)2 + 4KI + 4HCl = CaCl2 + 4KCl + 2I2 + 2H2O
Cl2+P=PCl55Cl2 + 2P = 2PCl5
Ca(OH)(HCO3) = CaCO3 + H2OCa(OH)(HCO3) = CaCO3 + H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CdCl2 + CS(NH2)2 + NH3 = CdS + ClH + CSNH0CdCl2 + CS(NH2)2 - NH3 = 0CdS + 0ClH + CSNH
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
C+2Cl2=CCl4C + 2Cl2 = CCl4
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H12O6 + H2O = C6H12O7 + H2O2-1C6H12O6 + H2O = -1C6H12O7 + H2O2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C5H10(l) + O2(g) = CO(g) + H2O(g)C5H10(l) + 5O2(g) = 5CO(g) + 5H2O(g)
Cl2O5 + H2O = 2HClO3Cl2O5 + H2O = 2HClO3
C2H5OH + 3O2 = CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + 3O2 = CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C5H10O2 + KOH = K + C5H9O2 + H2OC5H10O2 + KOH = K + C5H9O2 + H2O
Cu(OH)2 + H3PO4 = Cu3 (PO4)2 + H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
C12H22O11 + H2SO4 = CO2 + SO2 + H2OC12H22O11 + 24H2SO4 = 12CO2 + 24SO2 + 35H2O
CaCO3 + HCl = CaCl2+ CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CO2 + H2O + N2 = C8H10N4O2 + O216CO2 + 10H2O + 4N2 = 2C8H10N4O2 + 19O2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CO2 + Ca(OH)2 + H2O = Ca(HCO3)22CO2 + Ca(OH)2 + 0H2O = Ca(HCO3)2
CO2 + Ca(OH)2+ H2O = Ca(HCO3)22CO2 + Ca(OH)2 + 0H2O = Ca(HCO3)2
C5H12+O2 = CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCO3 + NH4+ + 2O2 = Ca2+ + NO3- + CO2 + 2H2O8CaCO3 + 2NH4+ + O2 = 4Ca2+ + 2NO3- + 8CO2 + 4H2O
CaCO3 + NH4+ + 2O2 = Ca2+ + NO3- + CO2 + 2H2O8CaCO3 + 2NH4+ + O2 = 4Ca2+ + 2NO3- + 8CO2 + 4H2O
C8H18 + O2 = CO2 +H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C9H20 + O2 = CO2 +H2OC9H20 + 14O2 = 9CO2 + 10H2O
C8H16 + O2 = CO2 +H2OC8H16 + 12O2 = 8CO2 + 8H2O
Cl2 + O2 = Cl2O52Cl2 + 5O2 = 2Cl2O5
C4H10O(l)+O2(g)=CO2(g)+H2O(g)C4H10O(l) + 6O2(g) = 4CO2(g) + 5H2O(g)
C7H16 + O2 = CO2 + H205C7H16 + 35O2 = 35CO2 + 4H20
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CaCO3 (s) = CaO (s) + CO2 (g)CaCO3(s) = CaO(s) + CO2(g)
Ca (s) + Br2 (l) = CaBr2 (s)Ca(s) + Br2(l) = CaBr2(s)
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Cl2 (g) + H2O (l) =HCl (aq) + HClO3 (aq)3Cl2(g) + 3H2O(l) = 5HCl(aq) + HClO3(aq)
CrCl3+Na2O2+NaOH=Na2CrO4+NaCl+H2O2CrCl3 + 3Na2O2 + 4NaOH = 2Na2CrO4 + 6NaCl + 2H2O
Cr2(SO4)3+KOH+KClO3=K2CrO3+KCl+K2SO4+H2O3Cr2(SO4)3 + 30KOH + KClO3 = 6K2CrO3 + KCl + 9K2SO4 + 15H2O
Cr2(SO4)3+KOH+KClO3=KCrO3+KCl+K2SO4+H2O3Cr2(SO4)3 + 24KOH + 2KClO3 = 6KCrO3 + 2KCl + 9K2SO4 + 12H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co + HCl = CoCl3 + H22Co + 6HCl = 2CoCl3 + 3H2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ce(SO4)3 + Na2S2O3 = NaSO4 + CeO + SO5Ce(SO4)3 + 8Na2S2O3 = 16NaSO4 + 5CeO + 15SO
CaCO3 + ZnO + (NH4)2HPO4 = CaZn2(PO4)2 + CO2 + H2O + NH2 + H2CaCO3 + 2ZnO + 2(NH4)2HPO4 = CaZn2(PO4)2 + CO2 + 3H2O + 4NH2 + 2H2
CaCO3 + ZnO + (NH4)2HPO4 = CaZn(PO4)2 + CO2 + H2O + NH2 + H2CaCO3 + ZnO + 2(NH4)2HPO4 = CaZn(PO4)2 + CO2 + 2H2O + 4NH2 + 3H2
CaCO3 + ZnO + (NH4)2HPO4 = CaZn(PO4)2 + CO2 + H2O + NH2 + H2CaCO3 + ZnO + 2(NH4)2HPO4 = CaZn(PO4)2 + CO2 + 2H2O + 4NH2 + 3H2
CH3(CH2)7CH3 + O2 = CO2 + H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3(CH2)3CH3 + O2 = CO2 + H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3CH3+O2=CO2+ H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CaCO3+H3PO4=Ca3(PO4)2+H2O+CO23CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2O + 3CO2
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3(CH2)7CH3+O2=CO2+H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CaCO3+H3PO4=Ca3(PO4)2+H2O+CO23CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2O + 3CO2
C3H8 + O2 = CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
CO + O2 = CO22CO + O2 = 2CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH3+O2= CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C6H12O6 = 2 C2H5OH + 2 CO2C6H12O6 = 2C2H5OH + 2CO2
C6H12O6 = 2 C2H5OH + 2 CO2C6H12O6 = 2C2H5OH + 2CO2
C3H8 +O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C6H8O6(aq) + Br2 (aq)= C6H6O6(aq) + HBr(aq)C6H8O6(aq) + Br2(aq) = C6H6O6(aq) + 2HBr(aq)
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu(OH)2=CuO+H2OCu(OH)2 = CuO + H2O
Ca+O2=CaO2Ca + O2 = 2CaO
CH3(CH2)4CH3(g)+O2(g)=CO2(g)+H2O2CH3(CH2)4CH3(g) + 19O2(g) = 12CO2(g) + 14H2O
Ca + O2= CaO2Ca + O2 = CaO2
C2H4 + I2 = C2H4I2C2H4 + I2 = C2H4I2
CaSiO3+HF=H2SiF6+CaF2+H2OCaSiO3 + 8HF = H2SiF6 + CaF2 + 3H2O
Ca(OH)2 + HNO3 =Ca(NO3) 2 + H2O Ca(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cl2 + H2O = HCl + HClOCl2 + H2O = HCl + HClO
Ca3(PO4)2 + H2SO4 = Ca(H2PO4)2 + CaSO4Ca3(PO4)2 + 2H2SO4 = Ca(H2PO4)2 + 2CaSO4
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Co2(SO4)3= 3SO2+ 2O2+ 2 CoOCo2(SO4)3 = 3SO2 + 2O2 + 2CoO
Co2(SO4)= 3SO2+ 2O2+ 2 CoOCo2(SO4) = SO2 + 0O2 + 2CoO
Cr2O3(s)+Al(s)=Al2O3(s)+Cr(s)Cr2O3(s) + 2Al(s) = Al2O3(s) + 2Cr(s)
CH4 (g) + H2O (g)=CO (g) + H2 (g)CH4(g) + H2O(g) = CO(g) + 3H2(g)
CrO4-- + NO2- + H2O = Cr(OH)3- + NO3- + OH-CrO4-- + 2NO2- + 2H2O = Cr(OH)3- + 2NO3- + OH-
CaCl2(aq) + Na2SO4(aq)=2 NaCl(aq) + CaSO4(s)CaCl2(aq) + Na2SO4(aq) = 2NaCl(aq) + CaSO4(s)
CaCl2(aq) + Na2SO4(aq)= 2 NaCl(aq) + CaSO4(s)CaCl2(aq) + Na2SO4(aq) = 2NaCl(aq) + CaSO4(s)
Ce + HCl =CeCl3 + H22Ce + 6HCl = 2CeCl3 + 3H2
Ce + HCl =CeCl3 + H22Ce + 6HCl = 2CeCl3 + 3H2
Ce + HCl =CeCl2 + H2Ce + 2HCl = CeCl2 + H2
Ca(Mg)Cl2+ NaHCO3 =Ca(Mg)CO3 + NaCl+HClCa(Mg)Cl2 + NaHCO3 = Ca(Mg)CO3 + NaCl + HCl
CH3OH + O2 =CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H4 + I2 = C2H4I2C2H4 + I2 = C2H4I2
CH3OH + O2 = CH2O + H2O2CH3OH + O2 = 2CH2O + 2H2O
CH3CHO + O2 = CO2 + H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
C16H32O2 + O2 = CO2 + H2OC16H32O2 + 23O2 = 16CO2 + 16H2O
C4H9OH +O2 = C4H7O2H + H2OC4H9OH + O2 = C4H7O2H + H2O
CO + H2 = CH3OHCO + 2H2 = CH3OH
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C4H8 + Br2 = C4H8Br2C4H8 + Br2 = C4H8Br2
C3H8 + Br2 =C3H7Br + HBrC3H8 + Br2 = C3H7Br + HBr
C2H6 + Cl2 = C2H4Cl2 + HClC2H6 + 2Cl2 = C2H4Cl2 + 2HCl
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaCl2+KHCO3=CaCO3+KCl+CO2+H2OCaCl2 + 2KHCO3 = CaCO3 + 2KCl + CO2 + H2O
CaCl2+KHCO3=CaCO3+2KCl+CO2+H2OCaCl2 + 2KHCO3 = CaCO3 + 2KCl + CO2 + H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO + O2 = CO22CO + O2 = 2CO2
C + Fe2O3 = CO2 + Fe3C + 2Fe2O3 = 3CO2 + 4Fe
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cr2 (CO3)3+H2SO4=Cr2 (SO4)3+H2O+CO2Cr2(CO3)3 + 3H2SO4 = Cr2(SO4)3 + 3H2O + 3CO2
C(s) + O2(g) = CO2(g)C(s) + O2(g) = CO2(g)
ClO4- + MnO2+ OH- = ClO- + MnO4 2- +H2O79ClO4- + 6MnO2 + 6OH- = 79ClO- + 6MnO42- + 3H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C(s) + H2O(g) = CO(g) + H2(g)C(s) + H2O(g) = CO(g) + H2(g)
C(s) + H2O(g) = CO(g) + H2(g)C(s) + H2O(g) = CO(g) + H2(g)
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C2H5NS+(CH3COO)Pb=PbS+C3H8NCOOC2H5NS + (CH3COO)Pb = PbS + C3H8NCOO
C2H5NS+(CH3COO)Pb=PbS+C3H8COONC2H5NS + (CH3COO)Pb = PbS + C3H8COON
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C2H5NS+(CH3COO)Pb=PbS+C3H8NCOOC2H5NS + (CH3COO)Pb = PbS + C3H8NCOO
CH4(g) = C2H2(g) + H2(g)2CH4(g) = C2H2(g) + 3H2(g)
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6O+C9H8O4=C8H8O3+H2O9C2H6O + 14C9H8O4 = 18C8H8O3 + 11H2O
C2H6O+C4H8O2=C6H12O2+H2OC2H6O + C4H8O2 = C6H12O2 + H2O
C2H6O+CH3COOH=C4H8O2+H2OC2H6O + CH3COOH = C4H8O2 + H2O
C2H6O+CH3COOH=C3H6O2+H2OC2H6O + 2CH3COOH = 2C3H6O2 + H2O
C2H6O+CH3COOH=C4H8O2+H2OC2H6O + CH3COOH = C4H8O2 + H2O
C4H10+O2 = CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6 = C2H6O+CO2C6H12O6 = 2C2H6O + 2CO2
C4H8O2+C2H6O=C6H12O2+H2OC4H8O2 + C2H6O = C6H12O2 + H2O
C2H6O+C9H8O4=C8H8O3+H2O9C2H6O + 14C9H8O4 = 18C8H8O3 + 11H2O
C2H6O+C9H8O4=C8H8O3+H2050C2H6O - 20C9H8O4 = -10C8H8O3 + 11H20
C+H2SO4=SO2+CO2+H2OC + 2H2SO4 = 2SO2 + CO2 + 2H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C2H4 + O2 = CO2+ H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CaC2+H2O=C2H2+CaOCaC2 + H2O = C2H2 + CaO
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H6O + O2 = CO2 +H2OC2H6O + 3O2 = 2CO2 + 3H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C12H26=C3H6+C2H63C12H26 = 10C3H6 + 3C2H6
C5H11OH+O2=CO2+H2O2C5H11OH + 15O2 = 10CO2 + 12H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.