Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C2H2+O2=H2O+CO22C2H2 + 5O2 = 2H2O + 4CO2
Cl2 + O2 = Cl2O72Cl2 + 7O2 = 2Cl2O7
C6H14(g)+O2(g)=CO2(g)+H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C(s)+S(s)=CS2(l) C(s) + 2S(s) = CS2(l)
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CS2+Cl2=CCl4+SCl2CS2 + 4Cl2 = CCl4 + 2SCl2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
Cr2(CO3)3(l)+NaNO3(l)=Cr(NO3)3(s)+Na2CO3(s)Cr2(CO3)3(l) + 6NaNO3(l) = 2Cr(NO3)3(s) + 3Na2CO3(s)
CL2+O2=CL2O32CL2 + 3O2 = 2CL2O3
CO+H2CO3=C27H54O7+O20CO + 27H2CO3 = C27H54O7 + 37O2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cl2(g)+KBr(aq)=Br2(l)+KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
Cl2(g)+KBr(aq)=Br2(l)+KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
C27H54O7+O2=CO+H2CO3C27H54O7 + 37O2 = 0CO + 27H2CO3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH2CH3+O2 = CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cr2(SO4)3+KClO3+KOH=K2CrO4+KCl+K2SO4+H2OCr2(SO4)3 + KClO3 + 10KOH = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
CuO + NH3 = Cu + N2 + H2O3CuO + 2NH3 = 3Cu + N2 + 3H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
Ca(s)+HCl(aq)=CaCl2(aq)+H2(g)Ca(s) + 2HCl(aq) = CaCl2(aq) + H2(g)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Ca(s)+AgNO3(aq)=Ca(NO3)2(aq)+Ag(s)Ca(s) + 2AgNO3(aq) = Ca(NO3)2(aq) + 2Ag(s)
Ca(OH)2(aq)+HNO3(aq)=Ca(NO3)2(aq)+H2O(l)Ca(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O(l)
C4H8(g)+O2(g)=CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
C6H12O2(l) + O2(g) =CO2(g) + H2O(l)C6H12O2(l) + 8O2(g) = 6CO2(g) + 6H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H5OH+MnO4-+OH-=C2H3O-+MnO2+H2O3C2H5OH + 2MnO4- + OH- = 3C2H3O- + 2MnO2 + 5H2O
C5H6O+O2 = CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C3H6+O2 = CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C9H20+ O2=CO2+H2OC9H20 + 14O2 = 9CO2 + 10H2O
C9H10+ O2=CO2+H2O2C9H10 + 23O2 = 18CO2 + 10H2O
C3H8O + KMnO4 + H2SO4 = C3H6O + K2SO4 + MnSO4 + H2O5C3H8O + 2KMnO4 + 3H2SO4 = 5C3H6O + K2SO4 + 2MnSO4 + 8H2O
C3H8O + KMnO4 + H2O = C3H6O + KOH + MnO23C3H8O + 2KMnO4 - 2H2O = 3C3H6O + 2KOH + 2MnO2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu+HNO3=Cu(NO3)2+NO+2H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH4(g)+Br2(g)=CBr4(g) + HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu(ClO4)2(aq)+K2S(aq)=CuS(s)+2KClO4(aq)Cu(ClO4)2(aq) + K2S(aq) = CuS(s) + 2KClO4(aq)
Cu(ClO4)2(aq)+K2S(aq)=CuS(s)+2KClO4(aq)Cu(ClO4)2(aq) + K2S(aq) = CuS(s) + 2KClO4(aq)
C6H6(l) + O2(g) = H2O(g) + CO2(g)2C6H6(l) + 15O2(g) = 6H2O(g) + 12CO2(g)
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C4H10O + 6O2 = CO2 + 5H2OC4H10O + 6O2 = 4CO2 + 5H2O
C2H5NSCl + 11O2 = 4CO2 + H2O + NO2 + SO3 + 2HCl 2C2H5NSCl + 11O2 = 4CO2 + 4H2O + 2NO2 + 2SO3 + 2HCl
CCl4+O2=COCl2+Cl22CCl4 + O2 = 2COCl2 + 2Cl2
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C3H7OH(l) + O2(g) = CO2(g) + H2O(l)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(l)
CuSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Cu(NO3)2(aq)CuSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Cu(NO3)2(aq)
Ca(NO3)2+H2SO4= CaSO4+HNO3Ca(NO3)2 + H2SO4 = CaSO4 + 2HNO3
CO + O2 = CO22CO + O2 = 2CO2
C + O2 = CO2C + O2 = 2CO
Ca2Si +H2O=Ca(OH)2 + SiO2 +H2 Ca2Si + 6H2O = 2Ca(OH)2 + SiO2 + 4H2
C3H8 + 5O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H8 + 5O2 = 4H2O + 3CO2C4H8 + 6O2 = 4H2O + 4CO2
C4H8 + 5O2 = 4H2O + 3CO2C4H8 + 6O2 = 4H2O + 4CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 + HCl=HCO3 + CaClCaCO3 + HCl = HCO3 + CaCl
CaCO3 + HCl= HCO3 + CaClCaCO3 + HCl = HCO3 + CaCl
Ca(NO3)2+C+Ca(OH)2=HNO2+CaCO3+H2O-1Ca(NO3)2 - C + 0Ca(OH)2 = -2HNO2 - CaCO3 + H2O
C2H6+O2=2CO2+3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl+SBr=SCl+BrCl + SBr = SCl + Br
C2H6(g)+O2(g)=CO2(g)+H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C3H5(NO3)3=O2+CO2+H2O+N24C3H5(NO3)3 = O2 + 12CO2 + 10H2O + 6N2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6 +O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C8H18O2 + HIO4 = C4H7O2 + HI + H2OC8H18O2 + HIO4 = 2C4H7O2 + HI + 2H2O
C8H18O2 + HIO4 = C8H16O2 + HI + H2O4C8H18O2 + HIO4 = 4C8H16O2 + HI + 4H2O
C8H18O2 + HIO4 = C8H14O2 + HI + H2O2C8H18O2 + HIO4 = 2C8H14O2 + HI + 4H2O
C8H18O2 + HIO4 = C8H14 + HI + H2OC8H18O2 + 0HIO4 = C8H14 + 0HI + 2H2O
C8H18O2 + HIO4 = C8H14 + HI + H2OC8H18O2 + 0HIO4 = C8H14 + 0HI + 2H2O
CH3CH2OH = CH4 + CO2 2CH3CH2OH = 3CH4 + CO2
Ca+O2=CaO2Ca + O2 = 2CaO
Ca+O2=CaO2Ca + O2 = CaO2
Ca+O=CaO2Ca + 2O = CaO2
Ca + O2 = CaO2Ca + O2 = CaO2
Ca + O2 = CaO2Ca + O2 = 2CaO
C4H8+5O2=3CO2+4H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cu+O2=Cu2O4Cu + O2 = 2Cu2O
Cu(NO3)2=CuO+NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CoCl2 +H2O + Na2O2 + NaOH=Co(OH)3 + NaCl2CoCl2 + 2H2O + Na2O2 + 2NaOH = 2Co(OH)3 + 4NaCl
CrCl3 + Cl2 + KOH = K2CrO4 + KCl + H2O2CrCl3 + 3Cl2 + 16KOH = 2K2CrO4 + 12KCl + 8H2O
CrCl3+KOH+I2= K2CrO4+KClO4+KI+H2O2CrCl3 + 64KOH + 27I2 = 2K2CrO4 + 6KClO4 + 54KI + 32H2O
Ca+CuF2=CaF2+CuCa + CuF2 = CaF2 + Cu
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C+ O2 =CO2C + O2 = CO2
Cl2 + H2 = 2HClCl2 + H2 = 2HCl
Cl2 + H2 = 2HClCl2 + H2 = 2HCl
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 +NH3 =H2 +C2N22CH4 + 2NH3 = 7H2 + C2N2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C7H16 + O2 = CO2+ H2OC7H16 + 11O2 = 7CO2 + 8H2O
C4H10 + O2= CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
CuSO4+Ca3P2=CaSO4+Cu3P23CuSO4 + Ca3P2 = 3CaSO4 + Cu3P2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CS2+O2=SO2+CO2CS2 + 3O2 = 2SO2 + CO2
Co2O3 + C = Co + CO22Co2O3 + 3C = 4Co + 3CO2
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CuCl2+K2CO3=CuCO3+KClCuCl2 + K2CO3 = CuCO3 + 2KCl
CCL4+O2=COCL2+CL2CCL4 + 0O2 = 0COCL2 + 2CL2
CCL4+O2=COCL2+CL2CCL4 + 0O2 = 0COCL2 + 2CL2
Cu (SO4)2 + O2 = CuO2 + SO4Cu(SO4)2 + O2 = CuO2 + 2SO4
CO2(g)+CaSiO3(s)+H2O=SiO2(s)+Ca(HCO3)2 (aq)2CO2(g) + CaSiO3(s) + H2O = SiO2(s) + Ca(HCO3)2(aq)
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
Cu2O(s) +C(s)=Cu(s) +CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+O2 = CO2+H2C3H8 + 3O2 = 3CO2 + 4H2
C3H8+O2 = CO2+H2C3H8 + 3O2 = 3CO2 + 4H2
CuI2+Fe=FeI2+CuCuI2 + Fe = FeI2 + Cu
CuO+HCl=CuCl2+H2OCuO + 2HCl = CuCl2 + H2O
C4H8(g) + O2(g) = CO2(g) + H2O(l)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(l)
C4H8(g) + O2(g) = CO2(g) + H2O(l)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(l)
C4H8(g) + O2(g) = CO2(g) + H2O(l)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(l)
C4H8(g) + O2(g) = CO2(g) + H2O(l)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(l)
C6H6(l) + O2(g) = H2O(g) + CO2(g)2C6H6(l) + 15O2(g) = 6H2O(g) + 12CO2(g)
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C10H6(g) + Cl2(g) = HCl(g) + C(s)C10H6(g) + 3Cl2(g) = 6HCl(g) + 10C(s)
CH2+2O2=2CO2+2H2O2CH2 + 3O2 = 2CO2 + 2H2O
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C10H8= C6H14 + C4H82C10H8 = -12C6H14 + 23C4H8
CCl4+O2=COCl2+Cl22CCl4 + O2 = 2COCl2 + 2Cl2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H2 + O2 = 2C + H2O2C2H2 + O2 = 4C + 2H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3H8 + O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2 + 2HNO3 = 2H2O + Ca(NO3)2Ca(OH)2 + 2HNO3 = 2H2O + Ca(NO3)2
Cu+AgNO3=Cu (NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C5H10+H3PO4=CO2+P2O3+H2O2C5H10 + 30H3PO4 = 10CO2 + 15P2O3 + 55H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6+O2=CO+H2OC6H12O6 + 3O2 = 6CO + 6H2O
C3H8 + O2 = CO + H2O2C3H8 + 7O2 = 6CO + 8H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C4H4O4 + NH3 = C4H7O4NC4H4O4 + NH3 = C4H7O4N
Ca (OH)2+HBr=CaBr2+H2OCa(OH)2 + 2HBr = CaBr2 + 2H2O
Cl2 + 2OH- + 3Br2=Cl- +BrO3 + H2O6Cl2 + 12OH- + Br2 = 12Cl- + 2BrO3 + 6H2O
Cl2 + 2OH- + 3Br2=Cl- +BrO3 + H2O6Cl2 + 12OH- + Br2 = 12Cl- + 2BrO3 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3 (CH2)2 CH3 + O2= CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3CH22CH3 + O2= CO2 + H2OCH3CH22CH3 + 10O2 = 3CO2 + 14H2O
CH3CH22CH3 + O2== CO2 + H2OCH3CH22CH3 + 10O2 = 3CO2 + 14H2O
C3H8 + H2 = C3H8C3H8 + 0H2 = C3H8
CuSO4 * 5 H2O (aq) + SrCl2 * 6H2O (aq) = CuCl2 (aq) + SrSO4 (s) + H2O (l)CuSO4*5H2O(aq) + SrCl2*6H2O(aq) = CuCl2(aq) + SrSO4(s) + 11H2O(l)
C2H6+3O2= CO2+3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 +Cl2 =CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C8H18(g) + O2(g) = CO2(g) + H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
CrO3+ HCl + C2H5OH= CrCl3+Cl3CHO+H2O4CrO3 + 18HCl + C2H5OH = 4CrCl3 + 2Cl3CHO + 11H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+HNO=Cu(NO3)2+NO2+H2O-3Cu + 4HNO = -3Cu(NO3)2 + 10NO2 + 2H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Cr2O3+Al=Al2O3+CrCr2O3 + 2Al = Al2O3 + 2Cr
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H5O+O2=CO2+H2O4C2H5O + 11O2 = 8CO2 + 10H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO+O2= CO22CO + O2 = 2CO2
CO+2H2=CH3OHCO + 2H2 = CH3OH
C5H9O+O2=CO2+H2020C5H9O + 90O2 = 100CO2 + 9H20
CaCO3 + CH3COOH = CO2 + Ca(CH3COO)2 + H2OCaCO3 + 2CH3COOH = CO2 + Ca(CH3COO)2 + H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C4H10+O2= CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8 + O2 =CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(H2PO4)2+C+SiO2=P4+CO+CaSiO3+H2O2Ca(H2PO4)2 + 10C + 2SiO2 = P4 + 10CO + 2CaSiO3 + 4H2O
CaCl2 + AgNO3 = AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
C3H5N3O9 = N2 + CO2 + H2O + O24C3H5N3O9 = 6N2 + 12CO2 + 10H2O + O2
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
Cu(NO3)2 + KCl =CuCl2 + KNO3Cu(NO3)2 + 2KCl = CuCl2 + 2KNO3
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C5H8+C3H6O = C2+H2O-2C5H8 + 4C3H6O = C2 + 4H2O
C5H8+C3H6O = C2+H2O-2C5H8 + 4C3H6O = C2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaH2+H2O= Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
Ca CO3 = CO2 + CaOCaCO3 = CO2 + CaO
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C4H8+O2=CO2+H2C4H8 + 4O2 = 4CO2 + 4H2
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CaCO3+ SO2+O2= CaSO4+ CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
Cs + O2 = Cs2O4Cs + O2 = 2Cs2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H12 + KMnO4 + H2SO4 = C8H6O4 + K2SO4 + MnSO4 + H2O5C8H12 + 14KMnO4 + 21H2SO4 = 5C8H6O4 + 7K2SO4 + 14MnSO4 + 36H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C12H22O11 + O2 = CO2 + H2010C12H22O11 + 65O2 = 120CO2 + 11H20
CuCO3 + HCl = CuCl2 + H2O + CO2CuCO3 + 2HCl = CuCl2 + H2O + CO2
CuCO3 + HCl = CuCl2 + H2O + CO2CuCO3 + 2HCl = CuCl2 + H2O + CO2
CuCO3 + HCl = CuCl2 + H2O + CO2CuCO3 + 2HCl = CuCl2 + H2O + CO2
Cu + O2 = Cu2O4Cu + O2 = 2Cu2O
Ca + O2 = CaO2Ca + O2 = 2CaO
Ca + O2 = CaO2Ca + O2 = 2CaO
Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)
Cl2O5 + H2O = HClO3Cl2O5 + H2O = 2HClO3
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CuFeS2(s)+O2(g)=CuO(s)+Fe2O3(s)+SO2(g)4CuFeS2(s) + 13O2(g) = 4CuO(s) + 2Fe2O3(s) + 8SO2(g)
Ca(s) + Co(Cl)3(aq) = Ca(Cl)2(s) + Co(s)3Ca(s) + 2Co(Cl)3(aq) = 3Ca(Cl)2(s) + 2Co(s)
CH4+Br2=CH3Br+HBrCH4 + Br2 = CH3Br + HBr
CS2+Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CH4 + NO2 = NH3 + CO2 + O23CH4 + 4NO2 = 4NH3 + 3CO2 + O2
C5H12O2(l) + O2(g) = CO2(g) + H2O(l)C5H12O2(l) + 7O2(g) = 5CO2(g) + 6H2O(l)
Ca(s)+Br2(l)=CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
C4H8(g)+O2(g)=CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
Cr2O3 + KNO3 + Na2CO3 = Na2CrO4 + KNO2 + CO2Cr2O3 + 3KNO3 + 2Na2CO3 = 2Na2CrO4 + 3KNO2 + 2CO2
Cr2O3 + KNO3 + Na2CO3 = Na2Cr4 + KNO2 + CO22Cr2O3 - 7KNO3 + Na2CO3 = Na2Cr4 - 7KNO2 + CO2
Ca F2+H2SO4=CaSO4+HFCaF2 + H2SO4 = CaSO4 + 2HF
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C6H12O6 = 6C + 6H2OC6H12O6 = 6C + 6H2O
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CCl4(g)+O2(g)=COCl2(g)+Cl22CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CaH2+H2O= Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H8O6 + H2SO4 + NaHCO3 = CO2 + H2O + NaSO4-1C6H8O6 + 20H2SO4 + 20NaHCO3 = 14CO2 + 26H2O + 20NaSO4
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C8H18 + C2H5OH = CO2 + H2O-6C8H18 + 25C2H5OH = 2CO2 + 21H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 + H2SO4 = CaSO4 + H2O + CO2CaCO3 + H2SO4 = CaSO4 + H2O + CO2
Ca(OH)(HCO3) =CaCO3 + H2OCa(OH)(HCO3) = CaCO3 + H2O
Ca(OH)2 + CO2 =Ca(OH)(HCO3)Ca(OH)2 + CO2 = Ca(OH)(HCO3)
CaO + H2O =Ca(OH)2CaO + H2O = Ca(OH)2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10 (g) + 2O2 (g) = C4O2 (g) + 2H2O(g)2C4H10(g) + 7O2(g) = 2C4O2(g) + 10H2O(g)
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3(CH2)3CH3+O2=CO2+H205CH3(CH2)3CH3 + 25O2 = 25CO2 + 3H20
Cd(s) + Zn(NO3)2(aq)= Zn(s)+Cd(NO3)2(aq)Cd(s) + Zn(NO3)2(aq) = Zn(s) + Cd(NO3)2(aq)
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Ca+H2O=CaOH+H22Ca + 2H2O = 2CaOH + H2
C6H6=C2H2C6H6 = 3C2H2
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C2H2+O2=H2O+CO22C2H2 + 5O2 = 2H2O + 4CO2
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CH3(CH2)3CH3+O2=CO2+H205CH3(CH2)3CH3 + 25O2 = 25CO2 + 3H20
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca3N2+ Al= AlN+ CaCa3N2 + 2Al = 2AlN + 3Ca
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Co(OH)3+H2SO4=Co2(SO4)3+H2O2Co(OH)3 + 3H2SO4 = Co2(SO4)3 + 6H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca(HCO3)2+HCl=CaCl2+CO2+H2OCa(HCO3)2 + 2HCl = CaCl2 + 2CO2 + 2H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C6H12O6 + O2= CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H4O + O2= CO2 + H2O2C6H4O + 13O2 = 12CO2 + 4H2O
CH4O + O2= CO2 + H2O2CH4O + 3O2 = 2CO2 + 4H2O
C2H6O + O2= CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H12 + O2= CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
C6H14 + O2= CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2= CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C14H28 + O2= CO2 + H2OC14H28 + 21O2 = 14CO2 + 14H2O
Cu+H2SO4=Cu2S+CuSO4+H2O5Cu + 4H2SO4 = Cu2S + 3CuSO4 + 4H2O
CaNO3 + LiCO3 = CaCO3 + LiNO3CaNO3 + LiCO3 = CaCO3 + LiNO3
CaNO3+LiCO3=CaCO3+LiNO3CaNO3 + LiCO3 = CaCO3 + LiNO3
CuCl2 + NaOH = CuOH + NaCl2CuCl2 + NaOH = CuOH + NaCl2
CuCl2 + NaSO4 = CuSO4 = NaCl2CuCl2 + NaSO4 = CuSO4 + NaCl2
CuCl2 + Na3PO4 = CuPO4 + Na3Cl2CuCl2 + Na3PO4 = CuPO4 + Na3Cl2
CuCl2 + Na2CO3 = CuCO3 + Na2Cl2CuCl2 + Na2CO3 = CuCO3 + Na2Cl2
CuCl2 + NaBr = CuBr + NaCl2CuCl2 + NaBr = CuBr + NaCl2
CCl4(g)+O2(g)=COCl2(g)+Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C5H10N2O3 + O2 = CH4N2O + H2O + CO22C5H10N2O3 + 9O2 = 2CH4N2O + 6H2O + 8CO2
C6H12O6 + CO2 + NH4 = C4H7O4N + O2C6H12O6 + 10CO2 + 4NH4 = 4C4H7O4N + 5O2
C4H3O + H2O2 = CO2 + H2O2C4H3O + 17H2O2 = 8CO2 + 20H2O
C6H12O6 + CO2 + NH4 = C4H7O4N + O2C6H12O6 + 10CO2 + 4NH4 = 4C4H7O4N + 5O2
C6H12O6 + CO2 + NH3 = C4H7O4N + O2C6H12O6 + 6CO2 + 3NH3 = 3C4H7O4N + 3O2
Co + Ni+++ = Co+++ +NiCo + Ni+++ = Co+++ + Ni
Cs+O2=CsO2Cs + O2 = 2CsO
Cu(s)+S(s)=Cu2S(s)2Cu(s) + S(s) = Cu2S(s)
Ca3 (PO4)2+H3 PO4=Ca(H2 PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
C5H8 + KMnO4 + H2SO4 = C5H8O4 + K2SO4 + MnSO4 + H2O5C5H8 + 8KMnO4 + 12H2SO4 = 5C5H8O4 + 4K2SO4 + 8MnSO4 + 12H2O
Ca (PO4)+H4PO4=Ca(H2PO4)2Ca(PO4) + H4PO4 = Ca(H2PO4)2
C6H6+Cl2=C6H5Cl+HClC6H6 + Cl2 = C6H5Cl + HCl
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3COOH + NaHCO3 = NaCHCOO + H2 + CO23CH3COOH + 2NaHCO3 = 2NaCHCOO + 6H2 + 4CO2
CuCl2+Fe=FeCl2+CuCuCl2 + Fe = FeCl2 + Cu
C2H8N2 + N2O4 = N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Ca+AlCl3=CaCl2+Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
Ca3(PO4)2+SiO2=P4O10+CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
C7H10N+O2=CO2+H2O+NO22C7H10N + 21O2 = 14CO2 + 10H2O + 2NO2
C7H10N+O2=CO2+H2O+NO22C7H10N + 21O2 = 14CO2 + 10H2O + 2NO2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C3H8O(l)+O2(g) =3CO2(g)+4H2O2C3H8O(l) + 9O2(g) = 6CO2(g) + 8H2O
CH4+3O2=1CO2+4H2OCH4 + 2O2 = CO2 + 2H2O
Ca(OH) 2 (aq) + H 3 PO 4 (aq) = H 2 O (l) + Ca 3 (PO 4 ) 2 (s)3Ca(OH)2(aq) + 2H3PO4(aq) = 6H2O(l) + Ca3(PO4)2(s)
Cl2 + Na = NaClCl2 + 2Na = 2NaCl
Cu2S + O2 = Cu + SO2Cu2S + O2 = 2Cu + SO2
CaCN2+H2O=CaCO3+NH3CaCN2 + 3H2O = CaCO3 + 2NH3
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CaO + HCl = CaCl2 + H2OCaO + 2HCl = CaCl2 + H2O
Cd(s) +H2SO4(aq)=CdSO4+H2Cd(s) + H2SO4(aq) = CdSO4 + H2
C(s) + Fe2O3(s) = Fe(s) + CO2(g)3C(s) + 2Fe2O3(s) = 4Fe(s) + 3CO2(g)
Co(NO3)2(aq)+H2S(g)=CoS(s)+HNO3(aq) Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
Cr2O3+Ce(SO4)2=Ce2(SO3)+O2+CrO32Cr2O3 + 0Ce(SO4)2 = 0Ce2(SO3) - 3O2 + 4CrO3
Cu(s)+AgC2H3O2(aq)=Cu(C2H3O2)2(aq)+Ag(s) Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
Co(s)+O2(g)=Co2O3(s) 4Co(s) + 3O2(g) = 2Co2O3(s)
Ca+H2S=CaS+H2Ca + H2S = CaS + H2
CaCl2 + Na2CO3 = NaCl + CaCO3CaCl2 + Na2CO3 = 2NaCl + CaCO3
C4H6CaO4+K2SO4=CaSO4+CH3CO2KC4H6CaO4 + K2SO4 = CaSO4 + 2CH3CO2K
CaCl2+Na2SO4=CaSO4+NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
CaCl2+Na2SO4=CaSO4+NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
C3H4 + I2 = C3H4I2C3H4 + I2 = C3H4I2
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C6H6 + HNO3 = C6H5NO2 + H2OC6H6 + HNO3 = C6H5NO2 + H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C7H14 + O2 = CO + H22C7H14 + 7O2 = 14CO + 14H2
CaCl2 + K3PO4 =KCl +Ca3(PO4)23CaCl2 + 2K3PO4 = 6KCl + Ca3(PO4)2
CuH6N2O9 + H2O= Cu + NO2 + H2O0CuH6N2O9 + H2O = 0Cu + 0NO2 + H2O
CuH6N2O9+H2O= Cu+NO2+H2O0CuH6N2O9 + H2O = 0Cu + 0NO2 + H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO22Ca3(PO4)2 + 6SiO2 + 5C = 6CaSiO3 + P4 + 5CO2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH4O + O2 = CO2 + H2O2CH4O + 3O2 = 2CO2 + 4H2O
Cl+NO3=NO+Cl22Cl + 0NO3 = 0NO + Cl2
Cl+NO3=NO+Cl22Cl + 0NO3 = 0NO + Cl2
C11H12+O2=CO2+H2OC11H12 + 14O2 = 11CO2 + 6H2O
Cr2O3+CO=Cr+CO2Cr2O3 + 3CO = 2Cr + 3CO2
ClO3- + 2 PH3 = 2 P + Cl- + 3 H2OClO3- + 2PH3 = 2P + Cl- + 3H2O
CaC + H2O + CO2=CH2CHCO2H + Ca(OH)22CaC + 4H2O + CO2 = CH2CHCO2H + 2Ca(OH)2
Cu + AgNO3 = Cu (NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cr2(SO4)3 + KClO3 + KOH = K2CrO4 + KCl + K2SO4 + H2OCr2(SO4)3 + KClO3 + 10KOH = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
CH3COCH3 + O2 = CO2 + H2OCH3COCH3 + 4O2 = 3CO2 + 3H2O
C2OH + NaOH = C + Na OH0C2OH + NaOH = 0C + NaOH
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO + O2 = CO22CO + O2 = 2CO2
Cu+HgNO3=Cu(NO3)2+HgCu + 2HgNO3 = Cu(NO3)2 + 2Hg
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Co2O3 +H2O = Co(OH)3Co2O3 + 3H2O = 2Co(OH)3
Co2O3 +H2O = Co(OH)3Co2O3 + 3H2O = 2Co(OH)3
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr2S3+Cu3N=CrN+Cu2SCr2S3 + 2Cu3N = 2CrN + 3Cu2S
CO2(g) + CaSiO3(s) +H2O(l)= SiO2(s) +Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CO2(g) + CaSiO3(s) +H2O(l)= SiO2(s) +Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2+KBr=Br2+KClCl2 + 2KBr = Br2 + 2KCl
CrO2+ClO=CrO4+ClCrO2 + 2ClO = CrO4 + 2Cl
CuSCN + KIO3 + HCl = CuSO4 + KCl + HCN + ICl + H2O4CuSCN + 7KIO3 + 14HCl = 4CuSO4 + 7KCl + 4HCN + 7ICl + 5H2O
C2H5OH + O2 =CO2+ H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr(OH)3 + OH- = (Cr(OH)4)-Cr(OH)3 + OH- = (Cr(OH)4)-
CoCl2 + NH3 + H2O = Co(OH)Cl + NH4+ + Cl-CoCl2 + NH3 + H2O = Co(OH)Cl + NH4+ + Cl-
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C2H5OH + O2 =CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaCl2 + Na2(SO4) = Ca(SO4) + NaClCaCl2 + Na2(SO4) = Ca(SO4) + 2NaCl
C6H6(l) + O2(g) = H2O(g) + CO2(g)2C6H6(l) + 15O2(g) = 6H2O(g) + 12CO2(g)
C3H8+ O2=CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l) 3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C2H5OH + O2 =CO2+ H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2+O2=CO2C2 + 2O2 = 2CO2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C3H8 + O2 = CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CoCl2+Na2O2+OH-=Co(OH)3+Cl-+Na++H2O-2CoCl2 - Na2O2 - 2OH- = -2Co(OH)3 - 4Cl- - 2Na+ + 2H2O
C3H3 + 5 O2 = 3CO2 + 4H2O4C3H3 + 15O2 = 12CO2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H8+O2=CO2+4H2OC5H8 + 7O2 = 5CO2 + 4H2O
CaCO3 + O2 = CaO + CO2CaCO3 + 0O2 = CaO + CO2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cr + 6HCl = CrCl + 6HCr + HCl = CrCl + H
Cr + 6HCl = CrCl +HCr + HCl = CrCl + H
Cr + 6HCl = CrCl +HCr + HCl = CrCl + H
Cu(NO3)2+Al=Al(NO3)2+CuCu(NO3)2 + Al = Al(NO3)2 + Cu
Cu(NO3)2+Al=Al(NO3)2+CuCu(NO3)2 + Al = Al(NO3)2 + Cu
Cu(NO3)2+Al=Al(NO3)2+CuCu(NO3)2 + Al = Al(NO3)2 + Cu
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CaO+P2O5=Ca3(PO4)23CaO + P2O5 = Ca3(PO4)2
CaCO3=CaO + CO2 CaCO3 = CaO + CO2
C2 H2+H2=C4 H82C2H2 + 2H2 = C4H8
C2 H2+H2=C4 H82C2H2 + 2H2 = C4H8
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + HC4H10 + 4O2 = 4CO2 + 10H
Cr(OH)3+HCl=CrCl3+H2OCr(OH)3 + 3HCl = CrCl3 + 3H2O
Cr2O3+Ce(SO4)2=Ce2(SO3)+O2+Cr2O22Cr2O3 + 0Ce(SO4)2 = 0Ce2(SO3) + O2 + 2Cr2O2
Cu+2AgNO3=Cu(NO3)2+2AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CO + H2O = H2 + CO2CO + H2O = H2 + CO2
C3H6+O2=H2O+CO22C3H6 + 9O2 = 6H2O + 6CO2
Cu+S6=CuS6Cu + S6 = 6CuS
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Ca(HCO3)2=CaO+CO2+H2OCa(HCO3)2 = CaO + 2CO2 + H2O
C4H10 + O2 = CO2 + HC4H10 + 4O2 = 4CO2 + 10H
CO2H2 + 2NH4VO3 = 2V2O3 + 2H2O + CO2 + 2NH32CO2H2 + 2NH4VO3 = V2O3 + 3H2O + 2CO2 + 2NH3
CO2H2 + NH4VO3 = V2O5 + 2H2O + CO2 + 2NH30CO2H2 + 2NH4VO3 = V2O5 + H2O + 0CO2 + 2NH3
CO2H2 + NH4VO3 = VO2 + H2O + CO2 + NH3CO2H2 + 2NH4VO3 = 2VO2 + 2H2O + CO2 + 2NH3
CO2H2 + NH4V3O7 = 6VO2 + CO2 + 3NH4VO3 0CO2H2 + NH4V3O7 = 2VO2 + 0CO2 + NH4VO3
CO2H2 + NH4V3O7 = VO2 + CO2 + NH4VO3 0CO2H2 + NH4V3O7 = 2VO2 + 0CO2 + NH4VO3
CO2H2 + NH4V3O7 = NH3 + V2O3 + H2O + COCO2H2 + 0NH4V3O7 = 0NH3 + 0V2O3 + H2O + CO
CO2H2 + V2O3 = V2O5 + H2O + CO22CO2H2 - V2O3 = -1V2O5 + 2H2O + 2CO2
CO2H2 + NH4V3O7 = NH3 + V2O3 + H2O + CO24CO2H2 + 2NH4V3O7 = 2NH3 + 3V2O3 + 5H2O + 4CO2
CO2H2 + NH4V3O7 = NH3 + V2O5 + H2O + CO22CO2H2 - 2NH4V3O7 = -2NH3 - 3V2O5 + H2O + 2CO2
CO2H2 + NH4V3O7 = NH3 + V2O3 + H2O + CO24CO2H2 + 2NH4V3O7 = 2NH3 + 3V2O3 + 5H2O + 4CO2
CO2H2 + NH4V3O7 = NH3 + V2O5 + H2O + CO22CO2H2 - 2NH4V3O7 = -2NH3 - 3V2O5 + H2O + 2CO2
CO2H2 + NH4V3O7 = NH3 + VO2 + H2O + CO2CO2H2 + 2NH4V3O7 = 2NH3 + 6VO2 + 2H2O + CO2
Ca3P2 + H2O =Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CH2+H2O=CO2+H2O0CH2 + H2O = 0CO2 + H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCl2 + Na3PO4 = Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+F2=CaF2Ca + F2 = CaF2
Ca(OH)2+Al(NO3)3=Al(OH)3+Ca(NO3)23Ca(OH)2 + 2Al(NO3)3 = 2Al(OH)3 + 3Ca(NO3)2
Cu + HNO3 + H+ = Cu++ +NO2 + H2OCu + 2HNO3 + 2H+ = Cu++ + 2NO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca3(PO4)2+SiO2+C=CaSiO2+CO+P42Ca3(PO4)2 + 6SiO2 + 16C = 6CaSiO2 + 16CO + P4
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C2H6 + O2 =CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCl2= Ca+ Cl2 CaCl2 = Ca + Cl2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2 H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CoBr3 + CaSO4 = CaBr2 + Co2(SO4)32CoBr3 + 3CaSO4 = 3CaBr2 + Co2(SO4)3
CdCl2 + Na2S = CdS + NaClCdCl2 + Na2S = CdS + 2NaCl
CaCl2 + Fe2(SO4)3=CaSO4 + FeCl3 3CaCl2 + Fe2(SO4)3 = 3CaSO4 + 2FeCl3
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C2H5COOH(l) + O2(g) = CO2(g) + H2O(l)2C2H5COOH(l) + 7O2(g) = 6CO2(g) + 6H2O(l)
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
Ca3(PO4)2 + SiO2 + C = CaSiO2 + CO + P42Ca3(PO4)2 + 6SiO2 + 16C = 6CaSiO2 + 16CO + P4
CS2(l) + O2(g) = CO2(g) + SO2(g)CS2(l) + 3O2(g) = CO2(g) + 2SO2(g)
Ca3(PO4)2 + SiO2 + C = CaSiO + CO + P42Ca3(PO4)2 + 6SiO2 + 22C = 6CaSiO + 22CO + P4
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH3OH + O2 = CO2 + H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
CuO=Cu+O22CuO = 2Cu + O2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
Ca+O2=CaO2Ca + O2 = 2CaO
Ca(HCO3)2=CaO + 2CO2 + H2OCa(HCO3)2 = CaO + 2CO2 + H2O
Ca(HCO3)2=CaO + 2CO2 + H2OCa(HCO3)2 = CaO + 2CO2 + H2O
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C7H10O+O2=CO2+H2OC7H10O + 9O2 = 7CO2 + 5H2O
C7H16O+O2=CO2+H2O2C7H16O + 21O2 = 14CO2 + 16H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4H10+O2=CO2+H2O2CH4H10 + 9O2 = 2CO2 + 14H2O
C2H4 +O2= CO2 +H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH3CH2CH3+O2 = CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
Ca(OH)2+Al(NO3)3=Al(OH)3+Ca(NO3)23Ca(OH)2 + 2Al(NO3)3 = 2Al(OH)3 + 3Ca(NO3)2
CH3(CH2)7CH3+O2 = CO2+H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
CH3CH3+O2 = CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cl+NaI=NaCl+ICl + NaI = NaCl + I
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.