Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CH3NH2(g)+O2(g)=CO2(g)+N2(g)+H2O(g)4CH3NH2(g) + 9O2(g) = 4CO2(g) + 2N2(g) + 10H2O(g)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l) 3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C2H8N2 + N2O4=N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
Cu(s) + H2SO4(aq) = CuSO4(aq) + SO2(g) + H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
Cu(s) + H2SO4(aq) = CuSO4(aq) + SO2(g) + H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
C2H4 + O2 = H2O + CO2C2H4 + 3O2 = 2H2O + 2CO2
C2H4 + O2 = H2O + CO2C2H4 + 3O2 = 2H2O + 2CO2
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C + H2O = CO + H2O0C + H2O = 0CO + H2O
CH4+3O2=CO2+2H205CH4 + 5O2 = 5CO2 + H20
CH4+2O2=CO2+2H205CH4 + 5O2 = 5CO2 + H20
Cr(OH)3 + HNO3 = Cr(NO3)3 + H2OCr(OH)3 + 3HNO3 = Cr(NO3)3 + 3H2O
Cr(OH)3 + 3HNO3 = Cr(NO3)3 + 3H2OCr(OH)3 + 3HNO3 = Cr(NO3)3 + 3H2O
C5H12O + O2 = CO2 + H2O2C5H12O + 15O2 = 10CO2 + 12H2O
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C5H12O(g) + O2(g) = CO2(g) + H2O(g)2C5H12O(g) + 15O2(g) = 10CO2(g) + 12H2O(g)
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CaCO3 + CuCl = CuCO3 + CaClCaCO3 + CuCl = CuCO3 + CaCl
Ca(s)+O2(g)=CaO2Ca(s) + O2(g) = 2CaO
CaCO3 (s) + HCl (aq) = CaCl2 (aq) + CO2 (g) + H2O (l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
C2H6O +  3 O2 (g)=  2 CO2(g)  + 3 H2O (g) C2H6O + 3O2(g) = 2CO2(g) + 3H2O(g)
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CO + O2 = CO22CO + O2 = 2CO2
Cl2O5+H2O=HClO3Cl2O5 + H2O = 2HClO3
Ca(OH)2 + HCl = H2O + CaCl2Ca(OH)2 + 2HCl = 2H2O + CaCl2
CHSO + O2 = CO2 + H2O + S88CHSO + 6O2 = 8CO2 + 4H2O + S8
CH3CH2OH + PCl3 = CH3CH2Cl + H3PO3 3CH3CH2OH + PCl3 = 3CH3CH2Cl + H3PO3
C H 4 O (l) + O2(g) = CO2(g) + H2O(l) 2CH4O(l) + 3O2(g) = 2CO2(g) + 4H2O(l)
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C2H2O4+CH4O=C4H8O4+H2O4C2H2O4 + 12CH4O = 5C4H8O4 + 8H2O
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C5H6O +O2 = CO2 + H2O C5H6O + 6O2 = 5CO2 + 3H2O
C3H6+O2 = CO2 +H2010C3H6 + 30O2 = 30CO2 + 3H20
C7H16(l) + 11O2(g)= 7CO2(g) + 8H2O(l)C7H16(l) + 11O2(g) = 7CO2(g) + 8H2O(l)
C3H6+O2 = CO2 +H2010C3H6 + 30O2 = 30CO2 + 3H20
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3CH2OH + PCl3 = CH3CH2Cl + H3PO3 3CH3CH2OH + PCl3 = 3CH3CH2Cl + H3PO3
CuO(s)+CO(g)=Cu(s)+CO2(g)CuO(s) + CO(g) = Cu(s) + CO2(g)
C5H10+O2 = CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H8O3 + CaCl2 = H20 + CO2 + Cl2O3 + Ca2CO3-35C3H8O3 + 30CaCl2 = -14H20 - 120CO2 + 30Cl2O3 + 15Ca2CO3
CaCl2 + Cs3PO4 = CaPO4 + Cs3Cl2CaCl2 + Cs3PO4 = CaPO4 + Cs3Cl2
CaCl2 + Cs3PO4 = CaPO4 + Cs3Cl2CaCl2 + Cs3PO4 = CaPO4 + Cs3Cl2
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C12H22011=C+H2020C12H22011 = 240C + 22011H20
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C4H10(g) + O2(g) = CO2(g) + H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C5H8O(l) + O2(g) = CO2(g) + H2O(l)2C5H8O(l) + 13O2(g) = 10CO2(g) + 8H2O(l)
C5H8(l) + O2(g) = CO2(g) + H2O(l)C5H8(l) + 7O2(g) = 5CO2(g) + 4H2O(l)
C4H8(g) +O2(g) = CO2(g) + H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
Cl2+NaOH=H2O+NaCl+O22Cl2 + 4NaOH = 2H2O + 4NaCl + O2
CH3OH+6O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO+O2 = CO22CO + O2 = 2CO2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CuO + H2SO4 = CuSO4 + H2OCuO + H2SO4 = CuSO4 + H2O
Ca + 2H = Ca2+ + H20Ca + 2H = 0Ca2+ + H2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaCN2 + O2 = CaO + NO2 + CO22CaCN2 + 7O2 = 2CaO + 4NO2 + 2CO2
CaS + H3AsO4 = H2S + Ca3(AsO4)23CaS + 2H3AsO4 = 3H2S + Ca3(AsO4)2
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CaS + H3AsO4 = H2S + Ca3(AsO4)23CaS + 2H3AsO4 = 3H2S + Ca3(AsO4)2
C2H2+O2=H2O+CO22C2H2 + 5O2 = 2H2O + 4CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+BaSO4 = CO + BaS4C + BaSO4 = 4CO + BaS
C3H7BO3 + O2 = CO2 + H2O + B2O32C3H7BO3 + 8O2 = 6CO2 + 7H2O + B2O3
C5H12O+O2=CO2+H2O2C5H12O + 15O2 = 10CO2 + 12H2O
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C5H12O+O2=CO2+H2O2C5H12O + 15O2 = 10CO2 + 12H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cl2O5 + H2O = HClO3Cl2O5 + H2O = 2HClO3
C7H16O(g) + O2(g) = CO2(g) + H2O(g)2C7H16O(g) + 21O2(g) = 14CO2(g) + 16H2O(g)
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C11H22+H2=C7H147C11H22 + 0H2 = 11C7H14
C11H24+H2=C7H147C11H24 - 7H2 = 11C7H14
C10H22+H2=C7H147C10H22 - 7H2 = 10C7H14
C12H26+H2=C7H147C12H26 - 7H2 = 12C7H14
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H2 (g)+O2=CO2+H2O2C2H2(g) + 5O2 = 4CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6O(l)+O2(g) =CO2(g)+H2O(l)C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
CaClO = CaCl + OCaClO = CaCl + O
C3H8O+O2 = CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C6H6(l)+O2(g)=CO2(g)+H2O(l) 2C6H6(l) + 15O2(g) = 12CO2(g) + 6H2O(l)
C2H6+3O2 = CO2+3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4O (g) + O2 (g) =CO2 (g) + H2O (g)2C2H4O(g) + 5O2(g) = 4CO2(g) + 4H2O(g)
C3H8O3 (g) + O2 (g) = CO2 (g) + H2O (g)2C3H8O3(g) + 7O2(g) = 6CO2(g) + 8H2O(g)
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3 + 5 O2 = 3 CO2 + 4 H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3 + 10 O2 = 3 CO2 + 4 H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3 + O2 =CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3 + O2 = 3 CO2 + 4 H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu(OH)2=CuO+H2OCu(OH)2 = CuO + H2O
Ca(NO3)2+Na2CO3=CaCO3+Na2(NO3)2Ca(NO3)2 + Na2CO3 = CaCO3 + Na2(NO3)2
C4H8 + O2 = CO2 + H2O C4H8 + 6O2 = 4CO2 + 4H2O
C6H5OH+O2=CO2+H2OC6H5OH + 7O2 = 6CO2 + 3H2O
Cu2O+C=Cu+COCu2O + C = 2Cu + CO
C+O2=CO2C + O2 = 2CO
C+O2=CO2C + O2 = 2CO
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
CuCl3+Na2CO3=CuCO3+Na2Cl3CuCl3 + Na2CO3 = CuCO3 + Na2Cl3
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C3H6O3 +O2= CO2+H2OC3H6O3 + 3O2 = 3CO2 + 3H2O
CS2(g) + N2O(g) = S8(s) + CO2(g) + N2(g)4CS2(g) + 8N2O(g) = S8(s) + 4CO2(g) + 8N2(g)
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H8O3 + HNO3 = C3H5N3O9 + H2OC3H8O3 + 3HNO3 = C3H5N3O9 + 3H2O
C7H16O(g) + O2(g) = CO2(g) + H2O(g)2C7H16O(g) + 21O2(g) = 14CO2(g) + 16H2O(g)
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CaCO3+(NH4)2HPO4=Ca3(PO4)2+CO2+NH3+H2O3CaCO3 + 2(NH4)2HPO4 = Ca3(PO4)2 + 3CO2 + 4NH3 + 3H2O
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
Cl2 + H2O = HCl + HClO33Cl2 + 3H2O = 5HCl + HClO3
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cr2(SO4)3 + 10KOH + KClO3 = 2K2CrO4 + 5H2O + KCl + 3K2SO4Cr2(SO4)3 + 10KOH + KClO3 = 2K2CrO4 + 5H2O + KCl + 3K2SO4
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
Cu(OH)2 + ClH = CuCl2 + 2HOHCu(OH)2 + 2ClH = CuCl2 + 2HOH
C12H26(g) + O2(g) = CO2(g) + H2O(g) 2C12H26(g) + 37O2(g) = 24CO2(g) + 26H2O(g)
C10H22(g) + O2(g) = CO2(g) + H2O(g)2C10H22(g) + 31O2(g) = 20CO2(g) + 22H2O(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H8N2 + N2O4 = N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C6H12O6 + H2O = HCOOH + HC6H12O6 + 6H2O = 6HCOOH + 12H
Ca(HCOO)2 + 2H2O = Ca(OH)2 + HCOOHCa(HCOO)2 + 2H2O = Ca(OH)2 + 2HCOOH
CH3COOK + H2O = CH3COOH + KOHCH3COOK + H2O = CH3COOH + KOH
CoCO3 + 2 HCl = CO2 + CoCl2 + H2OCoCO3 + 2HCl = CO2 + CoCl2 + H2O
CoCO3 + 2 HCl = CO2 + CoCl2 + H2OCoCO3 + 2HCl = CO2 + CoCl2 + H2O
CaCO3 + 2HNO3 = Ca(NO3)2 + H2O + CO2CaCO3 + 2HNO3 = Ca(NO3)2 + H2O + CO2
Cu(s) + 2H2SO4(aq)=CuSO4(aq)+S02(g)+2H2O(g)6Cu(s) + 8H2SO4(aq) = 6CuSO4(aq) + S02(g) + 8H2O(g)
Cu(s) + H2SO4(aq)=CuSO4(aq)+S02(g)+H2O(g)6Cu(s) + 8H2SO4(aq) = 6CuSO4(aq) + S02(g) + 8H2O(g)
CH3CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C(s)+H2(g)=C2H6(g)2C(s) + 3H2(g) = C2H6(g)
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
CuCl2(aq) + AgNO3(aq) = Cu(NO3)2(aq) + AgCl(s)CuCl2(aq) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2AgCl(s)
C4H6O2(l) + O2(g) = CO2(g) + H2O(g)2C4H6O2(l) + 9O2(g) = 8CO2(g) + 6H2O(g)
C2H2(g) + O2(g) = CO2(g) + H2O(g)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
Ca(ClO3)2(s) = CaCl2(s) + O2(g)Ca(ClO3)2(s) = CaCl2(s) + 3O2(g)
Ca(ClO3)2(s) = CaCl2(s) + O2(g)Ca(ClO3)2(s) = CaCl2(s) + 3O2(g)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C2H3OCl + O2 = CO + 6H2O + 2Cl24C2H3OCl + 5O2 = 8CO + 6H2O + 2Cl2
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Ca(OH)2+H3PO4 = H2O+ Ca+ PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
C2H6O(l) + O2(g) = CO2 + H2OC2H6O(l) + 3O2(g) = 2CO2 + 3H2O
CH3COOH + NaOH = CH3COONa + H2OCH3COOH + NaOH = CH3COONa + H2O
C10H16 + O2 = CO2 + H2OC10H16 + 14O2 = 10CO2 + 8H2O
C2H8N2 + N2O4 = N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C2H8N2 + N2O4 = N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CsCl + Ca2S = CaCl + Cs2S2CsCl + Ca2S = 2CaCl + Cs2S
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca(OH)2 + H3PO4 = H2O + Ca2 + PO46Ca(OH)2 + 4H3PO4 = 12H2O + 3Ca2 + 4PO4
C7H8 + O2 = CO2 + H2OC7H8 + 9O2 = 7CO2 + 4H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H5NH2 + O2 = CO2 + H2O + N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
Ca(OH)2 + H3PO4 = CaHPO4 + H2OCa(OH)2 + H3PO4 = CaHPO4 + 2H2O
CH3(CH2)6CH3 + O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C4 + O2 = CO2C4 + 4O2 = 4CO2
C5H12(g)+O2(g)=CO2(g)+H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3(CH2)5CH3 + O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Ca + H2O = Ca(OH)2 + HCa + 2H2O = Ca(OH)2 + 2H
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CH3(CH2)3CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)3CH3(l) + 8O2(g) = 5CO2(g) + 6H2O(g)
Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 +NH4C2H3O2Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + 2NH4C2H3O2
CH4(g)+ O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH3(g)CH2(g)CH3(g)+O2(g)=CO2(g)+H20(g)5CH3(g)CH2(g)CH3(g) + 15O2(g) = 15CO2(g) + 2H20(g)
CH3(g)CH2(g)CH3(g)+O2(g)=CO2(g)+H20(g)5CH3(g)CH2(g)CH3(g) + 15O2(g) = 15CO2(g) + 2H20(g)
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
Ca(OH)2 + H3PO4 = H2O + Ca2 + PO43162Ca(OH)2 + 4H3PO4 = 168H2O + 81Ca2 + 4PO43
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C6H14(g) + O2(g) = CO2(g) +H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
Ca(OH)2+H3PO4=H2O+Ca+PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
Cr + H2SO4 = Cr2(SO4)3 + H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
C3H8O + O2 = CO2 + H2O 2C3H8O + 9O2 = 6CO2 + 8H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 + H2O =C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
CO + C = CO22CO - C = CO2
CuO(s) +NH3(g) = Cu(s) + N2(g) + H2O(g)3CuO(s) + 2NH3(g) = 3Cu(s) + N2(g) + 3H2O(g)
C3H8O+O2 = CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C2H8N2 + N2O4 = N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CH3(CH2)6CH3(g) + O2(g) = CO2(g) + H20(g)10CH3(CH2)6CH3(g) + 80O2(g) = 80CO2(g) + 9H20(g)
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C + 2O2 = 2CO2C + O2 = CO2
CH3CH3 + O2 = CO2 + H2010CH3CH3 + 20O2 = 20CO2 + 3H20
CH3(CH2)4CH3(g) + O2(g) = CO2(g) + H20(g)10CH3(CH2)4CH3(g) + 60O2(g) = 60CO2(g) + 7H20(g)
C 5 H 10 O 2 (l)+ O 2 (g)= CO 2 (g)+ H 2 O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CO + NO = N2 + CO22CO + 2NO = N2 + 2CO2
Ca(s)+B r 2 (l)=CaB r 2 (s)Ca(s) + Br2(l) = CaBr2(s)
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CACO3=CAO+CO2CACO3 = CAO + CO2
C8 H18 + O2 = CO + H2O2C8H18 + 17O2 = 16CO + 18H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2 + H3PO4 = H2O + Ca2 + PO43162Ca(OH)2 + 4H3PO4 = 168H2O + 81Ca2 + 4PO43
CrCl3(aq) + Ca(OH)2(aq) = Cr(OH)3(s) + CaCl2(aq)2CrCl3(aq) + 3Ca(OH)2(aq) = 2Cr(OH)3(s) + 3CaCl2(aq)
CoCl2(s) + Na(s) = Co(s) + NaCl(s)CoCl2(s) + 2Na(s) = Co(s) + 2NaCl(s)
C3H8(g) + O2(g) = CO2(g) + H2O(g)(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)(l)
Ca(OH)2+H3PO4= H2O+Ca2+PO43162Ca(OH)2 + 4H3PO4 = 168H2O + 81Ca2 + 4PO43
Ca(OH)2(aq) + H3PO4(aq) = H2O(l) + Ca(aq) + PO43(aq)81Ca(OH)2(aq) + 2H3PO4(aq) = 84H2O(l) + 81Ca(aq) + 2PO43(aq)
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
CH3COOH=CO2(g)+CH4(g)CH3COOH = CO2(g) + CH4(g)
CO(NH2)2+HOCl=NCl3+CO2+H2OCO(NH2)2 + 6HOCl = 2NCl3 + CO2 + 5H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C12H26(g) + O2(g) = CO2(g) + H2O(g)2C12H26(g) + 37O2(g) = 24CO2(g) + 26H2O(g)
Cu 2 O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C4H10 (g) + O2 (g) = CO2 (g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH2O+ NO2 = N2 + CO2 + H2O2CH2O + 2NO2 = N2 + 2CO2 + 2H2O
CH2O+ N2O = N2 + CO2 + H2OCH2O + 2N2O = 2N2 + CO2 + H2O
CH3(CH2)4CH3+O2 = CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)4CH3+O2 = CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Co(NO3)2+NaOH=Co(OH)2+NaNO3Co(NO3)2 + 2NaOH = Co(OH)2 + 2NaNO3
CoNO3+NaOH=CoOH+NaNO3CoNO3 + NaOH = CoOH + NaNO3
Cr2(SO4)3 + H2O2 + KOH = K2CrO4 + K2SO4 + H2OCr2(SO4)3 + 3H2O2 + 10KOH = 2K2CrO4 + 3K2SO4 + 8H2O
C + HNO3 = CO2 + NO2 + H2010C + 20HNO3 = 10CO2 + 20NO2 + H20
CuS + HNO3 = Cu(NO3)2 + S + H2O + NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cr(s) + S8(s) = Cr2S3(s) 16Cr(s) + 3S8(s) = 8Cr2S3(s)
Ca(s) + H2(g) = CaH2(s) Ca(s) + H2(g) = CaH2(s)
Cs2O(s) + H2O(l) = CsOH(aq) Cs2O(s) + H2O(l) = 2CsOH(aq)
Cl2O7(l) + H2O(l) = HClO4(aq) Cl2O7(l) + H2O(l) = 2HClO4(aq)
C2H4 + O2 = 2CO2 + 2H2O C2H4 + 3O2 = 2CO2 + 2H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2O5 + H2O = HClO3Cl2O5 + H2O = 2HClO3
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
CH3SH + O2 = CO2+ SO2+ H2OCH3SH + 3O2 = CO2 + SO2 + 2H2O
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
C8H18 + O2 = C O2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C7H8 + O2 = CO2 + H2OC7H8 + 9O2 = 7CO2 + 4H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH+O2=CO2+H2O4CH + 5O2 = 4CO2 + 2H2O
CuSO4 + KI = CuI + K2SO4 + I22CuSO4 + 4KI = 2CuI + 2K2SO4 + I2
CuSO4 + KI = CuI + K2SO4 + I22CuSO4 + 4KI = 2CuI + 2K2SO4 + I2
C 8 H 18 (g)+ O 2 (g)=C O 2 (g)+ H 2 O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
CH4 + 2O2=CO2 + 2H2O CH4 + 2O2 = CO2 + 2H2O
CaCO3(s)+2HCl(aq)=H2O(l)+CO2(g)+CaCl2(aq)CaCO3(s) + 2HCl(aq) = H2O(l) + CO2(g) + CaCl2(aq)
CuS+HNO3=Cu(NO3)2+NO2+S8+H2O8CuS + 32HNO3 = 8Cu(NO3)2 + 16NO2 + S8 + 16H2O
CuS+HNO3=Cu(NO3)+NO2+S8+H2O8CuS + 16HNO3 = 8Cu(NO3) + 8NO2 + S8 + 8H2O
C2H4O (g) + O2 (g) =CO2 (g) + H2O (g)2C2H4O(g) + 5O2(g) = 4CO2(g) + 4H2O(g)
CaCO3 (s) + HCl (aq) = CaCl2 (aq) + CO2 (g) + H2O (l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Ca3(PO4)2+(SiO)2+C=(CaSiO)3+P4+CO2Ca3(PO4)2 + 3(SiO)2 + 16C = 2(CaSiO)3 + P4 + 16CO
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Cr2(SO4)3+KOH+KClO3=K2CrO4+H2O+KCl+K2(SO)44Cr2(SO4)3 + 22KOH - 5KClO3 = 8K2CrO4 + 11H2O - 5KCl + 3K2(SO)4
C5H12(g)+O2(g)=CO2(g)+H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
Cu2O(s)+O2(g)=CuO(s)2Cu2O(s) + O2(g) = 4CuO(s)
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH3SH + O2 = CO2+ SO2+ H2OCH3SH + 3O2 = CO2 + SO2 + 2H2O
Ca(NO3)2 + (NH4)2HPO4 + NH3 + H2O = Ca10(PO4)6(OH)2 + NH4NO310Ca(NO3)2 + 6(NH4)2HPO4 + 8NH3 + 2H2O = Ca10(PO4)6(OH)2 + 20NH4NO3
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CH3(CH2)4CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)4CH3(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu(NO3)2(s)=CuO(s)+NO2(g)+O2(g)2Cu(NO3)2(s) = 2CuO(s) + 4NO2(g) + O2(g)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
C10H14O+NaHCO3 = H2O+CO2+NaC10H1327C10H14O + 26NaHCO3 = 33H2O + 36CO2 + 26NaC10H13
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
C8H8O2+NaHCO3 = H2O+CO2+NaC8H7O2 C8H8O2 + NaHCO3 = H2O + CO2 + NaC8H7O2
CH3CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Ca3(PO4)+SiO2+C=CaSiO3+P4+CO4Ca3(PO4) + 12SiO2 + 4C = 12CaSiO3 + P4 + 4CO
Cr2O3+Cl2+C=CrCl3+COCr2O3 + 3Cl2 + 3C = 2CrCl3 + 3CO
Ca(s)+Br2(l)=CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
CaCO3(s)=3CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CO(g)+2H2(g)=CH3OH(g)CO(g) + 2H2(g) = CH3OH(g)
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CrCO3 + HCl = CrCl2 + H2CO3CrCO3 + 2HCl = CrCl2 + H2CO3
Cl2 +NaI = NaCl + I2Cl2 + 2NaI = 2NaCl + I2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CH4+O2=CH2+H2O2CH4 + O2 = 2CH2 + 2H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Ca3(PO4)2 + H2SO4 = Ca(H2PO4)2 + CaSO4Ca3(PO4)2 + 2H2SO4 = Ca(H2PO4)2 + 2CaSO4
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
Ca3P2(s)+ H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C5H6O(l)+ O2(g) =CO2(g) +H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
Ca+HCi=CaCi2+H2Ca + 2HCi = CaCi2 + H2
Ca+HCi=CaCi2+H2Ca + 2HCi = CaCi2 + H2
Ca+HCi=CaCi2+H2Ca + 2HCi = CaCi2 + H2
Ca+HCi=CaCi2+H2Ca + 2HCi = CaCi2 + H2
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H5OH+O2=H2O+CO2C2H5OH + 3O2 = 3H2O + 2CO2
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
Ca + HOH = Ca(OH)2 + H2Ca + 2HOH = Ca(OH)2 + H2
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
Cr(NO3)3 + K2CO3 = Cr2(CO3)3 + KNO32Cr(NO3)3 + 3K2CO3 = Cr2(CO3)3 + 6KNO3
CoBr2 + KOH = Co(OH)2 + KBr CoBr2 + 2KOH = Co(OH)2 + 2KBr
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C6H14(g) + O2(g)= CO2(g)+ H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
CaCO3 +CO2 +H2O =Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
C(s)+S(s) = CS2(l)C(s) + 2S(s) = CS2(l)
CuO+NH3=Cu+N2+H2O3CuO + 2NH3 = 3Cu + N2 + 3H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8O+O2=CO+H2OC3H8O + 3O2 = 3CO + 4H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3COOH(l)+O2(g)=2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3CH2CH3(g) + O2(g) = CO2(g) + H2O(g)CH3CH2CH3(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + P4(s) + CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
C + CUSO4 = CU + CSO4C + CUSO4 = CU + CSO4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CaCO3+HCl = CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Cu(NO3)2+H2O=Cu(H2O)6+NO3Cu(NO3)2 + 6H2O = Cu(H2O)6 + 2NO3
Cr(OH)3+HNO2=H2O+Cr(NO2)3Cr(OH)3 + 3HNO2 = 3H2O + Cr(NO2)3
CuCl2(aq) + H2S(aq) = CuS + 2 HClCuCl2(aq) + H2S(aq) = CuS + 2HCl
CH4 (g)+ Cl2 (g) = CCl4 (g) + HCl (g)CH4(g) + 4Cl2(g) = CCl4(g) + 4HCl(g)
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
CaH2 + H2O= CaOH + H22CaH2 + 2H2O = 2CaOH + 3H2
Cu(NO3)3+(NH4)3PO4=NH4NO3+CuPO4Cu(NO3)3 + (NH4)3PO4 = 3NH4NO3 + CuPO4
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C+O2 = CO2C + O2 = CO2
C+O2 = CO2C + O2 = CO2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C7H16(g) + O2(g) = CO2(g) + H2O(g)C7H16(g) + 11O2(g) = 7CO2(g) + 8H2O(g)
CaCO3 (s) + HCl (aq) = CaCl2 (aq) + CO2 (g) + H2O (l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
Ca (s) + H2O (l) = Ca(OH)2 (aq) + H2 (g)Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
CH3(CH2)4 CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)CH3+O2=CO2+H2OCH3(CH2)CH3 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4O + O2 = CO2 + 2H2O2CH4O + 3O2 = 2CO2 + 4H2O
Cl2(g)+Na(s)=NaCl(s)Cl2(g) + 2Na(s) = 2NaCl(s)
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
Ca + Cl2 = CaCl2 Ca + Cl2 = CaCl2
CH3CH2CH3+O2= CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
Ca(OH)2 + H3PO4 = H2O + Ca + PO4381Ca(OH)2 + 2H3PO4 = 84H2O + 81Ca + 2PO43
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
Ca(OH)2 + H3PO4 = H2O + Ca + PO4381Ca(OH)2 + 2H3PO4 = 84H2O + 81Ca + 2PO43
Ca(OH)2 + H3PO4 = H2O + Ca2 + PO43162Ca(OH)2 + 4H3PO4 = 168H2O + 81Ca2 + 4PO43
Ca(OH)2 + H3PO4 = H2O(l) + Ca2 + PO43162Ca(OH)2 + 4H3PO4 = 168H2O(l) + 81Ca2 + 4PO43
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
C8H18 + O2 =CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu(NO3)2 + KOH(aq) = Cu(OH)2 + KNO3Cu(NO3)2 + 2KOH(aq) = Cu(OH)2 + 2KNO3
CH4(g)+O2(g) = CO2(g)+H20(g)5CH4(g) + 5O2(g) = 5CO2(g) + H20(g)
CH4+O2 = CO2+H205CH4 + 5O2 = 5CO2 + H20
C2H4O2 + NaHCO3 =NaC2H3O2 + H2O + CO2C2H4O2 + NaHCO3 = NaC2H3O2 + H2O + CO2
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CH4O + O2 = CO2 + 2H2O2CH4O + 3O2 = 2CO2 + 4H2O
C2H4 + O2 = 2CO2 + 2H2O C2H4 + 3O2 = 2CO2 + 2H2O
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)6CH3 + O2 = CO2+ H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CHON + H2O = CH4 + CO2 + NH3CHON + H2O = 0CH4 + CO2 + NH3
CHON + H2O = CH4 + CO2 + NH3CHON + H2O = 0CH4 + CO2 + NH3
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
CaCO3+H3PO4=Ca3(PO4)2+H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
CH4+O2=CH2+H2O2CH4 + O2 = 2CH2 + 2H2O
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
CH4+O2= CH2+H2O2CH4 + O2 = 2CH2 + 2H2O
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
CuSo4+Fe(No3)3=FeSo4+Cu(No3)3CuSo4 + Fe(No3)3 = FeSo4 + Cu(No3)3
CuSo4+Fe(No3)3=FeSo4+Cu(No3)3CuSo4 + Fe(No3)3 = FeSo4 + Cu(No3)3
CH3SH + O2 = CO2+ SO2+ H2OCH3SH + 3O2 = CO2 + SO2 + 2H2O
CH4 + O2 = C2H2 + H2O4CH4 + 3O2 = 2C2H2 + 6H2O
CH3CH2CH3 + O2 = CO2 + H205CH3CH2CH3 + 15O2 = 15CO2 + 2H20
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2O5 + H2O = HClO3Cl2O5 + H2O = 2HClO3
C5H12O(g) + O2(g)=CO2(g) + H2O(g)2C5H12O(g) + 15O2(g) = 10CO2(g) + 12H2O(g)
C5H12(g) + O2(g) = CO2(g) + H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
CH3SH + O2 = CO2+ SO2+ H2OCH3SH + 3O2 = CO2 + SO2 + 2H2O
Cl2O7+H2O=HClO4Cl2O7 + H2O = 2HClO4
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu + HNO3 = Cu(NO3)2 + NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C + O2 = CO2C + O2 = 2CO
CO+Fe3O4=FeO+CO2CO + Fe3O4 = 3FeO + CO2
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCN2+H2O=CaCO3+NH3CaCN2 + 3H2O = CaCO3 + 2NH3
C2H5OH+CO2=C6H12O62C2H5OH + 2CO2 = C6H12O6
C2H5OH+CO2=C6H12O62C2H5OH + 2CO2 = C6H12O6
CH3(CH2)5CH3+O2 = CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3(CH2)5CH3+O2 = CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3(CH2)5CH3+O2 = CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
Ca3(PO4)2+SiO2+C =CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C2H4O+O2=CO2+H2O2C2H4O + 5O2 = 4CO2 + 4H2O
C2H4O+O2=CO2+H2O2C2H4O + 5O2 = 4CO2 + 4H2O
CaCO3 + H2SO4 = CaSO4 + CO2 + H2OCaCO3 + H2SO4 = CaSO4 + CO2 + H2O
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
Co(HCO3)3=Co2(CO3)3+CO2+H2O2Co(HCO3)3 = Co2(CO3)3 + 3CO2 + 3H2O
Co(HCO3)=Co2(CO3)+CO2+H2O2Co(HCO3) = Co2(CO3) + CO2 + H2O
CO(NH2)2+NO2=CO2+H2O+N24CO(NH2)2 + 6NO2 = 4CO2 + 8H2O + 7N2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH3CCl3+O2=CO2+H2O+Cl24CH3CCl3 + 11O2 = 8CO2 + 6H2O + 6Cl2
Cu(NO3)2(aq)  + KOH(aq)   =Cu(OH)2(s)  + KNO3(aq)Cu(NO3)2(aq) + 2KOH(aq) = Cu(OH)2(s) + 2KNO3(aq)
CO2+H2O+H2S = C6H12O6 + H2SO46CO2 + 6H2O + 3H2S = C6H12O6 + 3H2SO4
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H6+H2O2=CO2+H2OC6H6 + 15H2O2 = 6CO2 + 18H2O
CH4 + CCl4 = CH2Cl2CH4 + CCl4 = 2CH2Cl2
CaCO3 + HCl = CaCl2 + CO2 +H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3 + HCl = CaCl2 + CO2 +H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H6O (l) + O2(g) = CO2(g) + H2O(l)C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C6H12 + O2 = CO + H2OC6H12 + 6O2 = 6CO + 6H2O
C2H60+O2=CO2+H2OC2H60 + 17O2 = 2CO2 + 30H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
Ca(OH)2 + H3PO4 = H2O + Ca2 + PO46Ca(OH)2 + 4H3PO4 = 12H2O + 3Ca2 + 4PO4
Cl2(g)+NaOH(aq) = NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cu(NO3)2+KOH=Cu(OH)2+KNO3Cu(NO3)2 + 2KOH = Cu(OH)2 + 2KNO3
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CrCl3+H2S=CrCl2+HCl+S2CrCl3 + H2S = 2CrCl2 + 2HCl + S
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca3P2O6 + SiO2 + C = CaSiO3 + P4 + CO2Ca3P2O6 + 6SiO2 + 6C = 6CaSiO3 + P4 + 6CO
CH3C5H10CH3 +O2 = CO2 + H2OCH3C5H10CH3 + 11O2 = 7CO2 + 8H2O
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
C6H14(g) + O2(g) = CO2(g) + H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
CrCl3+H2SO4=Cr2(SO4)3+HCl2CrCl3 + 3H2SO4 = Cr2(SO4)3 + 6HCl
C6H14+O2=CO2=H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Ca(OH)2 + H3PO4 = H2O + Ca + PO43Ca(OH)2 + 2H3PO4 = 6H2O + 3Ca + 2PO4
C2H4 + O2 = CO2+ H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO + H2OC2H4 + 2O2 = 2CO + 2H2O
C2H4 + O2 = C + H2OC2H4 + O2 = 2C + 2H2O
CH4(g) + O2(g) = CO2(g) + H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C2O42- + Cr2O72- + H+ = CO2 + Cr3+ H2O143C2O42- - 75Cr2O72- + 68H+ = 286CO2 - 50Cr3 + 34H2O
C6H14(g) + O2(g) =CO2(g) + H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C8H18+O2=CO2+H2010C8H18 + 80O2 = 80CO2 + 9H20
Cr2O3 + Cl2 + C = CrCl3 + COCr2O3 + 3Cl2 + 3C = 2CrCl3 + 3CO
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CH3(CH2)6CH3+O2=CO2+H2010CH3(CH2)6CH3 + 80O2 = 80CO2 + 9H20
Ca(OH)2(aq) + H3PO4(aq) = H2O(l) + Ca2(aq) + PO4(aq)6Ca(OH)2(aq) + 4H3PO4(aq) = 12H2O(l) + 3Ca2(aq) + 4PO4(aq)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H8O+5O2=3CO2+4H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CaCO3+H2CO3=Ca(HCO3)2CaCO3 + H2CO3 = Ca(HCO3)2
C2H6+O2=CO2+H2010C2H6 + 20O2 = 20CO2 + 3H20
CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.