Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu(NO3)2+NaOH=Cu(OH)2+NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
CaCl2(aq) + Na2CO3(aq) = CaCO3(s) + 2 NaCl(aq)CaCl2(aq) + Na2CO3(aq) = CaCO3(s) + 2NaCl(aq)
CaCl2(aq) + Na2CO3(aq) = CaCO3(s) + 2 NaCl(aq)CaCl2(aq) + Na2CO3(aq) = CaCO3(s) + 2NaCl(aq)
CU(NO3)2+2LiOH=CU(OH)2+2LiNO3CU(NO3)2 + 2LiOH = CU(OH)2 + 2LiNO3
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cr(s) + S8(s) = Cr2S3(s)16Cr(s) + 3S8(s) = 8Cr2S3(s)
Cr(s) + S8(s) = Cr2S3(s) 16Cr(s) + 3S8(s) = 8Cr2S3(s)
CoCl2(s) + Na(s) = Co(s) + NaCl(s)CoCl2(s) + 2Na(s) = Co(s) + 2NaCl(s)
CoCl2(s) + Na(s) = Co(s) + NaCl(s) CoCl2(s) + 2Na(s) = Co(s) + 2NaCl(s)
ClO2(l) + H2O(l) = HClO2(aq) + HClO3(aq) 2ClO2(l) + H2O(l) = HClO2(aq) + HClO3(aq)
C2H4(g) + O2(g) = CO2(g) + H2O(g) C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cs2O(s) + H2O(l) = CsOH(aq) Cs2O(s) + H2O(l) = 2CsOH(aq)
CuO(s) + NH3(g) = Cu(s) + N2(g) + H2O(l) 3CuO(s) + 2NH3(g) = 3Cu(s) + N2(g) + 3H2O(l)
CaCl2 + K3AsO4 = Ca3(AsO4)2 + KCl3CaCl2 + 2K3AsO4 = Ca3(AsO4)2 + 6KCl
Cl2O7(l) + H2O(l) = HClO4(aq) Cl2O7(l) + H2O(l) = 2HClO4(aq)
Ca(C2H3O2)2(aq) + K2CO3(aq) = CaCO3(s) + KC2H3O2(aq)Ca(C2H3O2)2(aq) + K2CO3(aq) = CaCO3(s) + 2KC2H3O2(aq)
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C3H8O3 + O2 = CO2 + H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CUO + H2 = CU + H2OCUO + H2 = CU + H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C7H6O + O2 = CO2 + H2OC7H6O + 8O2 = 7CO2 + 3H2O
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C6H12(l)+2O6=CO2(g)+H2O(g)C6H12(l) + 3O6 = 6CO2(g) + 6H2O(g)
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Cu(NO3)2=2CuO+NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
Cu(NO3)2=2CuO+NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C4H7N + O2 = CO2 + H2O + NO24C4H7N + 27O2 = 16CO2 + 14H2O + 4NO2
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Ca(s)+Br2(l)=CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
CO(g)+ 2H2 (g) = CH3OH(g)CO(g) + 2H2(g) = CH3OH(g)
CO(g)+ 2H2 (g) = CH3OH(g)CO(g) + 2H2(g) = CH3OH(g)
C2H8N2+2N2O4=2N2+2CO2+4H205C2H8N2 + 5N2O4 = 10N2 + 10CO2 + 2H20
CsOH(aq)+H2SO4(aq)=CsSO4(aq)+H2O(l) +H(g)CsOH(aq) + H2SO4(aq) = CsSO4(aq) + H2O(l) + H(g)
CsOH(aq)+H2SO4(aq)=CsSO4+H2O +HCsOH(aq) + H2SO4(aq) = CsSO4 + H2O + H
Cu + AgNO3= Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cu+2AgNO3=Cu(NO3)2+2Ag Cu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cu+2AgNO3=Cu(NO3)2+2Ag Cu + 2AgNO3 = Cu(NO3)2 + 2Ag
C5H11OH+O2=CO2+H2O2C5H11OH + 15O2 = 10CO2 + 12H2O
CH3COOH(l)+O2(g) = 2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
Cu(OH)2+H3PO4 = Cu3(PO4)2+H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
C3H5O(CO2H)3+NaOH=C3H5O(CO2)3Na3+H2O C3H5O(CO2H)3 + 3NaOH = C3H5O(CO2)3Na3 + 3H2O
C3H5O(CO2H)3+NaOH=C3H5O(CO2)3Na3+H2O C3H5O(CO2H)3 + 3NaOH = C3H5O(CO2)3Na3 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(NO3)2 + Na2CO3 = CaCO3 + NaNO3Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3
CH2 + O2 = CO2+ 2H2O2CH2 + 3O2 = 2CO2 + 2H2O
C3H8+3H2O=3 CO+7H2C3H8 + 3H2O = 3CO + 7H2
CoBr3 + CaSO4 = CaBr2 + Co2(SO4)32CoBr3 + 3CaSO4 = 3CaBr2 + Co2(SO4)3
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Ca3N2 + 6H2O = Ca(OH)2 + 2NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
Ca(ClO3)2 + Al( OH)3 = Al(ClO3)2 + Ca(OH)3Ca(ClO3)2 + Al(OH)3 = Al(ClO3)2 + Ca(OH)3
CH4(g) + 2 O2(g) = CO2(g) + 2 H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CH4(g) + 2 O2(g) = CO2(g) + 2 H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C3H6O + O2= H2O + CO2 C3H6O + 4O2 = 3H2O + 3CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+5O2=3 CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+5O2=3 CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H12O6 + 3O2 = 3H2O + 3CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C6H12O6 + 3O2 = 3H2O + 3CO2C6H12O6 + 6O2 = 6H2O + 6CO2
Cl2+BaBr2=BaCl2+Br2Cl2 + BaBr2 = BaCl2 + Br2
COF2 + 4NH3 =CO(NH2)2 +2NH4FCOF2 + 4NH3 = CO(NH2)2 + 2NH4F
CaS(aq)+CuCl2(aq)=CuS(s)+CaCl2(aq)CaS(aq) + CuCl2(aq) = CuS(s) + CaCl2(aq)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CaSO4*2H2O + SO3 = CaSO4 +H2SO4CaSO4*2H2O + 2SO3 = CaSO4 + 2H2SO4
Ca(NO3)2 + Na2CO3 = CaCO3 + NaNO3Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3
Cu(s)+AgC2H3O2(aq)=Cu(C2H3O2)2(aq)+Ag(s)Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
C5H10+O2(g)=H2O+CO2(g)2C5H10 + 15O2(g) = 10H2O + 10CO2(g)
Ca+N2=Ca3N23Ca + N2 = Ca3N2
C2H4+O2=CO+H2OC2H4 + 2O2 = 2CO + 2H2O
CH3OH+O3=CO2+H2OCH3OH + O3 = CO2 + 2H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cl2+HI=HCl+I2Cl2 + 2HI = 2HCl + I2
Ca(OH)2+HCl=H2O+CaCl2Ca(OH)2 + 2HCl = 2H2O + CaCl2
Cr(NO3)2+Li=LiNO3+CrCr(NO3)2 + 2Li = 2LiNO3 + Cr
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C 8 H 18 (g)+ O 2 (g)=C O 2 (g)+ H 2 O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
CH3COOH(l)+O2(g)= 2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g) =CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CS2(l) + O2(g) = CO2(g) + SO2(g)CS2(l) + 3O2(g) = CO2(g) + 2SO2(g)
Cu+HNO3=Cu(NO3)2=NO2+H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO2 + H20
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
CH4 + O2= CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C5H11OH+O2=CO2+H2O2C5H11OH + 15O2 = 10CO2 + 12H2O
CaCO3+HCl = CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C4H9OH + O2 =CO2 +H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C O 2 (g)+ H 2 O(l)=H 2 C O 3 (aq)CO2(g) + H2O(l) = H2CO3(aq)
Cu(NO3)2(aq)+NaOH(aq)=Cu(OH)2(s)+NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Ca(NO3)2 + K3PO4 = Ca3(PO4)2 + KNO33Ca(NO3)2 + 2K3PO4 = Ca3(PO4)2 + 6KNO3
Ca2I +AgNO3 = Ag2I +CaNO3Ca2I + 2AgNO3 = Ag2I + 2CaNO3
CoI2 + SBa = SI2 + CoBaCoI2 + SBa = SI2 + CoBa
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C9H20 + O2=CO2 + H2OC9H20 + 14O2 = 9CO2 + 10H2O
C2H6+7O2= 2CO2+3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2
C3H8+O2 = H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
C3H8+O2 = H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
Cu + AgNO3 = Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CaCO3(s)=3CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CO(g)+2H2(g)=CH3OH(g)CO(g) + 2H2(g) = CH3OH(g)
C3H8O + MnO4- + H+ = Mn2+ + H2O + C3H6O13C3H8O + 4MnO4- + 6H+ = 2Mn2+ + 16H2O + 13C3H6O
C6H6S + O2 = SO3 + CO2 + H2OC6H6S + 9O2 = SO3 + 6CO2 + 3H2O
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
Cu(NO3)2 +Zn= Cu+ 2ZnNO3Cu(NO3)2 + 2Zn = Cu + 2ZnNO3
C3H6O2 +O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cu2CO3(OH)2 +4HNO3 = 2Cu(NO3)2 + 2H2 + 2CO2 + H2OCu2CO3(OH)2 + 4HNO3 = 2Cu(NO3)2 + 0H2 + CO2 + 3H2O
C3H8 + O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C9H20 + O2 = CO2 + H2OC9H20 + 14O2 = 9CO2 + 10H2O
C9H20 + O2 = CO2 + H2OC9H20 + 14O2 = 9CO2 + 10H2O
CO(g)+2H2(g)=CH3OH(g)CO(g) + 2H2(g) = CH3OH(g)
Cr(OH)6(s) = CrO3(s) + H2O(l)Cr(OH)6(s) = CrO3(s) + 3H2O(l)
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H11OH+O2=CO2+H2O2C5H11OH + 15O2 = 10CO2 + 12H2O
C3H6O2+O2=CO2+H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
CO(g)+H2(g)=C2H4(g)+H2O2CO(g) + 4H2(g) = C2H4(g) + 2H2O
Cu+Al2O3=CuO+Al3Cu + Al2O3 = 3CuO + 2Al
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu+O2=Cu2O4Cu + O2 = 2Cu2O
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2
C2H5OH + O2 = 2CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H5Cl + 4O2 = CO + H2O + HClC6H5Cl + 4O2 = 6CO + 2H2O + HCl
CCl4 + 2HF = CCl2F2 + 2HClCCl4 + 2HF = CCl2F2 + 2HCl
C3H8+5O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+5O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3N2 + 6H2O =Ca(OH)2 + 2NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
C3H8 + 5O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
Ca(ClO3)2 + Al(C2H3O2)3 = Ca(C2H3O2)2 + Al(ClO3)33Ca(ClO3)2 + 2Al(C2H3O2)3 = 3Ca(C2H3O2)2 + 2Al(ClO3)3
Cl5 + O2 = Cl2O54Cl5 + 25O2 = 10Cl2O5
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
C4H10 + O2 = H2O + CO22C4H10 + 13O2 = 10H2O + 8CO2
C3H8 + O2 = H2O + CO2C3H8 + 5O2 = 4H2O + 3CO2
CuSO4 + K = Cu + K2SO4CuSO4 + 2K = Cu + K2SO4
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cu + AgNO3 = Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C2H4O(g) + O2(g) = CO2(g) + H2O(g)2C2H4O(g) + 5O2(g) = 4CO2(g) + 4H2O(g)
Cl 2 (g)+NaOH(aq)=NaCl(aq)+ NaClO 3 (aq)+ H 2 O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cr2O3+O2=CrO32Cr2O3 + 3O2 = 4CrO3
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
C2H4 + 2 O2 = 2 CO 2 + 2 H2OC2H4 + 3O2 = 2CO2 + 2H2O
CuS + O2 = Cu2O +SO24CuS + 5O2 = 2Cu2O + 4SO2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
Cl2+NaI=NaCl2+ICl2 + NaI = NaCl2 + I
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CaSiO3 + HF= SiF4+ CaF2+H2OCaSiO3 + 6HF = SiF4 + CaF2 + 3H2O
C9H20+ O2=CO2+H2OC9H20 + 14O2 = 9CO2 + 10H2O
C6H6+ O2=CO2+ H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cu+ H2SO4=CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
CO 2 (g)+ CaSiO 3 (s)+ H 2 O(l)= SiO 2 (s)+ Ca(HCO 3 ) 2 (aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Cd(s) + NiO2(s) + H2O(l) = Cd(OH)2(s) + Ni(OH)2(s)Cd(s) + NiO2(s) + 2H2O(l) = Cd(OH)2(s) + Ni(OH)2(s)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C2H6(g)+O2(g)=CO2(g)+H20(g)10C2H6(g) + 20O2(g) = 20CO2(g) + 3H20(g)
CaBr2(aq)+2KF(aq)=CaF2(s)+2KBr(aq)CaBr2(aq) + 2KF(aq) = CaF2(s) + 2KBr(aq)
C4H6 (g)+O2 (g) = CO2 (g)+H2O(g)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(g)
C6H12O6 = 6C + 6H2OC6H12O6 = 6C + 6H2O
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
C6H8+O2 =CO2 + H2O C6H8 + 8O2 = 6CO2 + 4H2O
CuCl2+Al= AlCl3+Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
Cr2O7 + 14H + 6e- = + 2Cr3+ + 7 H2O3Cr2O7 + 42H - e- = 2Cr3+ + 21H2O
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
CaCl2 + Na2CO3 = CaCO3 + NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
CaCl2 + Na3BO3 = Ca3BO3 + NaCl23CaCl2 + Na3BO3 = Ca3BO3 + 3NaCl2
CO(g) + 2O2(g) = 2CO2(g) 2CO(g) + O2(g) = 2CO2(g)
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CuO+NH3=N2+Cu+H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
C3H8 + 5O2= 2CO2+1H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C2H4(g)+3O2(g)=2CO(g)+H2O(l)C2H4(g) + 2O2(g) = 2CO(g) + 2H2O(l)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
CuFeS2 +O2 = SO2 + CuO + FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
Cr2O3 + Al = Al2O3 + CrCr2O3 + 2Al = Al2O3 + 2Cr
C3H8+O2=CO+H2O2C3H8 + 7O2 = 6CO + 8H2O
C2H5OH + 6O2 = 3H2O + 2CO2C2H5OH + 3O2 = 3H2O + 2CO2
C 3 H 4 (g)+ O 2 (g) = CO 2 (g)+ H 2 O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C4H6(g)+O2(g)=CO2(g)+H2O(g)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(g)
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
CuSO4+NaOH=Cu(OH)2+Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
CaO+MnI4=MnO2+CaI22CaO + MnI4 = MnO2 + 2CaI2
C5H8 + O2 =5CO2 + 4H2OC5H8 + 7O2 = 5CO2 + 4H2O
C+H2=C3H83C + 4H2 = C3H8
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C2H6(g)+O2(g) = CO2(g)+H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
C3H8+5 O2 = 2 CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
Cr(NO3)3 + LiOH = Cr(OH)3 + LiNO3Cr(NO3)3 + 3LiOH = Cr(OH)3 + 3LiNO3
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
Cl 2 (g)+NaOH(aq)=NaCl(aq)+ NaClO 3 (aq)+ H 2 O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CaC2+H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Cr2O3+O2=CrO32Cr2O3 + 3O2 = 4CrO3
CuS + O2 = Cu2O +SO24CuS + 5O2 = 2Cu2O + 4SO2
CH4+5O2 = 3CO2+4H2OCH4 + 2O2 = CO2 + 2H2O
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CuS + O2 = Cu2O +SO24CuS + 5O2 = 2Cu2O + 4SO2
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
CO2+H2O=H2CO3CO2 + H2O = H2CO3
C12H28O4Ti + C2H5NO2 =TiO2 + CO2 +H2O + N2 -1C12H28O4Ti + 8C2H5NO2 = -1TiO2 + 4CO2 + 6H2O + 4N2
CO2(g) + H2O(l) = H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
C12H28O4Ti + C2H5NO2 =TiO2 + CO2 +H2O + N2 -1C12H28O4Ti + 8C2H5NO2 = -1TiO2 + 4CO2 + 6H2O + 4N2
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
Ca(OH)2+H3PO4=H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
Ca(OH)2+H3PO4=H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C+HNO3=CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C4H6+O2=CO2+H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C4H6(g)+O2(g)=CO2(g)+H2O(g)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(g)
CH4+O2=CH3OH2CH4 + O2 = 2CH3OH
CO+O2=CO22CO + O2 = 2CO2
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
C+O2=CO2C + O2 = 2CO
Cl 2 (g)+NaOH(aq) = NaCl(aq)+ NaClO 3 (aq)+ H 2 O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cr2O3(s) + O2(g) = CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CO2+NaOH=Na2CO3+H2OCO2 + 2NaOH = Na2CO3 + H2O
Cr2O3(s) + CCl4(l) = CrCl3(s) + 3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
CO2(g) + H2O(l) = H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C6H6S + O2 = SO3 + CO2 + H2OC6H6S + 9O2 = SO3 + 6CO2 + 3H2O
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
C r 2 O 3 (s)+ O 2 (g)=Cr O 3 (s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Co2O3 + H2 = Co + H2OCo2O3 + 3H2 = 2Co + 3H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cl2 + LiF = LiCl + F2Cl2 + 2LiF = 2LiCl + F2
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
C3H6O+4O2=3CO2+3H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
CaCO3+K3PO4=Ca3(PO4)2+K2CO33CaCO3 + 2K3PO4 = Ca3(PO4)2 + 3K2CO3
Cu2O+C=Cu+COCu2O + C = 2Cu + CO
C4H6(g)+O2(g)=CO2(g)+H2O(g)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(g)
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
Cu2S (s) + O2 (g) = Cu2O (s) + SO2 (g)2Cu2S(s) + 3O2(g) = 2Cu2O(s) + 2SO2(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CuSO4(aq)+Pb(NO3)2(aq)=Cu(NO3)2+PbSO4CuSO4(aq) + Pb(NO3)2(aq) = Cu(NO3)2 + PbSO4
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CoCl2+Na3PO4=Co3(PO4)2+NaCl3CoCl2 + 2Na3PO4 = Co3(PO4)2 + 6NaCl
CH3(CH2)4CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)4CH3(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cu(NO3)2(aq)+NaOH(aq)=Cu(OH)2(s)+NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CuSO4+KOH=Cu(OH)2+K2SO4CuSO4 + 2KOH = Cu(OH)2 + K2SO4
Cr2O3+Al=Al2O3+CrCr2O3 + 2Al = Al2O3 + 2Cr
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C2H6 + O2 =CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(NO3)2(aq)+NaOH(aq)=Cu(OH)2(s)+NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Cr2O3+H2=Cr+H2OCr2O3 + 3H2 = 2Cr + 3H2O
C8H16 + O2 = CO2 + H2OC8H16 + 12O2 = 8CO2 + 8H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CrO4 + OH + H3O = Cr2O7 H2O2CrO4 - OH + H3O = Cr2O7H2O
Ca(s)+HNO3(aq)=Ca(NO3)2(aq)+N2O(g)+H2O(g)4Ca(s) + 10HNO3(aq) = 4Ca(NO3)2(aq) + N2O(g) + 5H2O(g)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cr2(SO4)3 + 6KOH = 2Cr(OH)3 + 3 K2SO4Cr2(SO4)3 + 6KOH = 2Cr(OH)3 + 3K2SO4
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
CaO + H2SO4 = CaSO4 + H2OCaO + H2SO4 = CaSO4 + H2O
C2H2 (g)+O2 (g)=CO2 (g)+H2O (g)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
C9H18 + O2 = H2O + CO22C9H18 + 27O2 = 18H2O + 18CO2
C9H18 + O2 = H2O + CO22C9H18 + 27O2 = 18H2O + 18CO2
C+Fe2O3=Fe+3CO3C + Fe2O3 = 2Fe + 3CO
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C4H10+9O2=4CO2+5H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+9O2=4CO2+5H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+9O=4CO2+5H2OC4H10 + 13O = 4CO2 + 5H2O
CO(g) +SO2(g)=S(s)+CO2(g)2CO(g) + SO2(g) = S(s) + 2CO2(g)
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H6+O2=CO2+H2010C2H6 + 20O2 = 20CO2 + 3H20
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C3H8+O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H10+O2=CO2+H2O2C3H10 + 11O2 = 6CO2 + 10H2O
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + MnSO4 + K2SO4 + CO2 + H2O5CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + 2MnSO4 + K2SO4 + 10CO2 + 8H2O
C r 2 O 3 (s)+ O 2 (g)=Cr O 3 (s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CaCO3 + HCl = CaCl2 + H2CO3CaCO3 + 2HCl = CaCl2 + H2CO3
C O 2 (g)+ H 2 O(l)= H 2 C O 3 (aq)CO2(g) + H2O(l) = H2CO3(aq)
CASO4+SIO2+C=CASIO3+CO+SCASO4 + SIO2 + 3C = CASIO3 + 3CO + S
C 2 H 8 N 2 +2 N 2 O 4 =2 N 2 +2 CO 2 +4 H 2 OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CaO + H2O = CaOH2OCaO + H2O = CaOH2O
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
Cu(OH)2 + HC2H3O2 = Cu(C2H3O2)2 + H2OCu(OH)2 + 2HC2H3O2 = Cu(C2H3O2)2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CuCl2(aq) + Na3PO4(aq) = Cu3(PO4)2(s) + NaCl(aq)3CuCl2(aq) + 2Na3PO4(aq) = Cu3(PO4)2(s) + 6NaCl(aq)
C4H10 + O2 = 4CO2 + 5H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH2CH(CO2Na)+H2O=CH2CH(CO2Na)H2OCH2CH(CO2Na) + H2O = CH2CH(CO2Na)H2O
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
CaCO3(s) + HCl(aq) = CaCl2(aq) + H2CO3(aq)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + H2CO3(aq)
C8H16+O2=CO2+H2OC8H16 + 12O2 = 8CO2 + 8H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H9OH+KMnO4+HCl=CO2+MnO2+KCl+H2OC4H9OH + 8KMnO4 + 8HCl = 4CO2 + 8MnO2 + 8KCl + 9H2O
CO2+H2O=O2+C6H12O66CO2 + 6H2O = 6O2 + C6H12O6
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CH3COOH(l)+O2(g)=2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=4CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH3COOH(l)+O2(g)=2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
C2H6 + O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8(g)+5 O2(g) = 2 CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C8H16+O2=CO2+H2OC8H16 + 12O2 = 8CO2 + 8H2O
Cu(SO4)(aq) + NaBr(aq) = Na2(SO4)(aq) + CuBr2(s)Cu(SO4)(aq) + 2NaBr(aq) = Na2(SO4)(aq) + CuBr2(s)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cr2O3+Si=Cr+SiO22Cr2O3 + 3Si = 4Cr + 3SiO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CO2 + H2 = C2H2 + H2O2CO2 + 5H2 = C2H2 + 4H2O
CaCO3(s) = CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cu + ZnSO4 = Zn + CuSO4Cu + ZnSO4 = Zn + CuSO4
CaCl2 + Mg(NO3)2 = Ca(NO3)2 + MgCl2CaCl2 + Mg(NO3)2 = Ca(NO3)2 + MgCl2
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
Ca(s)+HNO3(aq)=Ca(NO3)2(aq)+H2(g)Ca(s) + 2HNO3(aq) = Ca(NO3)2(aq) + H2(g)
CaCl2(aq)+K2CO3(aq)=2KCl(aq)+CaCO3(s)CaCl2(aq) + K2CO3(aq) = 2KCl(aq) + CaCO3(s)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
C3H8(g) + 5O2(g) = 2CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C3H8(g) + 5O2(g) = 2CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C3H8(g) + 5O2(g) = 2CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CuSO4+NaOH=Cu(OH)2+Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2+NaOH=NaCl+NaClO3+H2030Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
Cl+H2O=HCl+HClO36Cl + 3H2O = 5HCl + HClO3
C12H22O11+H2O=C2H5OH+CO2C12H22O11 + H2O = 4C2H5OH + 4CO2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Cl+H2O=HCl+HClO2Cl + H2O = HCl + HClO
CH4 + O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C9H18 + O2 = H2O +CO2 = 2C9H18 + 27O2 = 18H2O + 18CO2
C r 2 O 3 (s)+CC l 4 (l)=CrC l 3 (s)+3COC l 2 (aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
Cu2O+CH4 = H2O+ Cu +CO24Cu2O + CH4 = 2H2O + 8Cu + CO2
CO+O2=CO22CO + O2 = 2CO2
CH4 + O = CO2 + H205CH4 + 10O = 5CO2 + H20
CH4 + O = CO2 + 2H205CH4 + 10O = 5CO2 + H20
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Co+O2=Co2O34Co + 3O2 = 2Co2O3
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2 = CO2 + H205C5H12 + 25O2 = 25CO2 + 3H20
C12H12O11+H2O=C2H5OH+CO26C12H12O11 + 21H2O = 19C2H5OH + 34CO2
CaC2 (s) +H2O (l) = C2H2 (g) + CaO (s)CaC2(s) + H2O(l) = C2H2(g) + CaO(s)
Cd + CuNO3 = Cd(NO3)2 + CuCd + 2CuNO3 = Cd(NO3)2 + 2Cu
C7H16(l)+O2(g)=CO2(g)+H2O(l)C7H16(l) + 11O2(g) = 7CO2(g) + 8H2O(l)
C7H16(l)+O2(g)=CO2(g)+H2O(l)C7H16(l) + 11O2(g) = 7CO2(g) + 8H2O(l)
C5H12 + O2 = CO2 + H205C5H12 + 25O2 = 25CO2 + 3H20
Cl2 + BiI3 = BiCl3 + I23Cl2 + 2BiI3 = 2BiCl3 + 3I2
CuSO4+Al=Cu+Al(SO4)33CuSO4 + Al = 3Cu + Al(SO4)3
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CO+3H2=CH4+3H2OCO + 3H2 = CH4 + H2O
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
CH4+Br2=CBr4+HBrCH4 + 4Br2 = CBr4 + 4HBr
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3(s) = CaO(s) + CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CU+HNO3=CU(NO3)2+H2O+NO2CU + 4HNO3 = CU(NO3)2 + 2H2O + 2NO2
C57H104O6+CH3OH = C39H72O5 + C19H36O2C57H104O6 + CH3OH = C39H72O5 + C19H36O2
C57H104O6+CH3OH = C39H72O5 + C19H36O2C57H104O6 + CH3OH = C39H72O5 + C19H36O2
C3H8(g)+O2(g)=CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C+H2=C3H83C + 4H2 = C3H8
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
C2H2+O2 = CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca(s) + HCl(Aq) = CaCl2(Aq) + H2(g)Ca(s) + 2HCl(Aq) = CaCl2(Aq) + H2(g)
Ca(s) + HCl(Aq) = CaCl2(Aq) + H2(g)Ca(s) + 2HCl(Aq) = CaCl2(Aq) + H2(g)
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cu(s)+AgNO3(aq)=Cu(NO3)2(s)+Ag(s)Cu(s) + 2AgNO3(aq) = Cu(NO3)2(s) + 2Ag(s)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18 + 8H2O = 8CO + 17H2C8H18 + 8H2O = 8CO + 17H2
C4H10 (g) + O2 (g) = CO2 (g) + H2O (g) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C4H10 (g) + O2 (g) = CO2 (g) + H2O (g) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C6H12O6 + 4O2 = 6CO2 + 6H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca+O2=CaO2Ca + O2 = 2CaO
C6H12O6=C3H4O3+HC6H12O6 = 2C3H4O3 + 4H
CO2 + H2O = C2H5OH + O22CO2 + 3H2O = C2H5OH + 3O2
CO2 + H2O = C2H5OH + O22CO2 + 3H2O = C2H5OH + 3O2
C6H12O6=2C3H4O3+H2O+HC6H12O6 = 2C3H4O3 + 0H2O + 4H
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CaH2 + H2O = H2 + Ca(OH)2CaH2 + 2H2O = 2H2 + Ca(OH)2
CaH2 + H2O = H2 + Ca(OH2)CaH2 + H2O = H2 + Ca(OH2)
CaH2 + H2O = H2 + CaOH2CaH2 + H2O = H2 + CaOH2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CS2+O2= SO2+ CO2CS2 + 3O2 = 2SO2 + CO2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Ca + O2 = CaO2Ca + O2 = 2CaO
C3H5+5O2= CO2+ 4H2O4C3H5 + 17O2 = 12CO2 + 10H2O
CO(g)+I2O5(s)=I2(s)+CO2(g)5CO(g) + I2O5(s) = I2(s) + 5CO2(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2 + O2 = H2O + CO22C2H2 + 5O2 = 2H2O + 4CO2
C4H6(g)+O2(g)=CO2(g)+H2O(g)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(g)
C3H4 + O2 = CO2 + H2OC3H4 + 4O2 = 3CO2 + 2H2O
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
CS2 +3O2 =CO2 +SO2CS2 + 3O2 = CO2 + 2SO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
C6H12(l)+9O2(g)=6CO2(g)+6H2O(g)C6H12(l) + 9O2(g) = 6CO2(g) + 6H2O(g)
CU+HNO3=CU(NO3)2+NO+H2O3CU + 8HNO3 = 3CU(NO3)2 + 2NO + 4H2O
CaO+CL2 = CaCL2 + O2 2CaO + 2CL2 = 2CaCL2 + O2
C3H8O+C6H12 = CO2 +H212C3H8O - 5C6H12 = 6CO2 + 18H2
Ca + H2O= Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Ca + H2O =Ca (OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CO2+NH3=CO(NH2)2+H2OCO2 + 2NH3 = CO(NH2)2 + H2O
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
Ca(s) + HCl(aq) = HCa+ ClCa(s) + HCl(aq) = HCa + Cl
CO2+H2O=H2CO3CO2 + H2O = H2CO3
Cu(aq) + Mg(s) = MgCuCu(aq) + Mg(s) = MgCu
CuCl2(aq) + 2 NaOH(aq) = Cu(OH)2(s) + 2 NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C2H6O + O2 = CO2+ H2O C2H6O + 3O2 = 2CO2 + 3H2O
C2H6O + O2 = CO2+ H2O C2H6O + 3O2 = 2CO2 + 3H2O
Cu+2 + Mg = Cu + Mg0Cu+2 + Mg = 0Cu + Mg
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
C7H6O3+(CH3CO2)2O = C9H8O4+CH3COOH-10C7H6O3 + 0(CH3CO2)2O = -8C9H8O4 + CH3COOH
C7H6O3+(CH2CO2)2O = C9H8O4+CH3COOH-10C7H6O3 + 0(CH2CO2)2O = -8C9H8O4 + CH3COOH
CO + I2 O5= CO2 + I25CO + I2O5 = 5CO2 + I2
Ca+HNO3=Ca(NO3)2+N2O+H2O4Ca + 10HNO3 = 4Ca(NO3)2 + N2O + 5H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.