Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C8H18 + O2 = CO2 + H2010C8H18 + 80O2 = 80CO2 + 9H20
Cl2+KNO3+H2O=KClO3+KCl+HNO33Cl2 + 6KNO3 + 3H2O = KClO3 + 5KCl + 6HNO3
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
CaCO3(s)+CH3COOH(l)=Ca(CH3COO)2+H2CO3CaCO3(s) + 2CH3COOH(l) = Ca(CH3COO)2 + H2CO3
Cu+H2SO4=CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
CuI + O2 = CuIO2CuI + O2 = 2CuIO
CuI + O2 = CuIO2CuI + O2 = 2CuIO
Ca + H2O = H2 + Ca(OH)2Ca + 2H2O = H2 + Ca(OH)2
Ca + H2O = H2 + Ca(OH)2Ca + 2H2O = H2 + 2Ca(OH)
Cu + HNO3 = Cu(NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
Cl2 + KBr = Br + KClCl2 + 2KBr = 2Br + 2KCl
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
Cr + H2SO4 = Cr2(SO4)3 + H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CrCl3+Na2O2+NaOH=Na2CrO4+NaCl+H2O2CrCl3 + 3Na2O2 + 4NaOH = 2Na2CrO4 + 6NaCl + 2H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CuS + HNO3 = Cu(NO3)2 + NO + S8 + H2O 24CuS + 64HNO3 = 24Cu(NO3)2 + 16NO + 3S8 + 32H2O
C3H8 + O2=3CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2=3CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2=3CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO + O2=2CO22CO + O2 = 2CO2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CO + O2=2CO22CO + O2 = 2CO2
Cu(s) + 3HNO3 = Cu(NO3)2(aq) + 2NO2(g) +2H2O(l)Cu(s) + 4HNO3 = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)
CuO(s) + 2HCl(aq) = CuCl2(aq) + H2O(l)CuO(s) + 2HCl(aq) = CuCl2(aq) + H2O(l)
C6H12O6(s) + O2(g) = CO2(g) + H2O(l)C6H12O6(s) + 6O2(g) = 6CO2(g) + 6H2O(l)
CaCl2 + AgNO3 = AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CH3CH2CH2CH3 + O2 = C2H2(CO)2O + H2O2CH3CH2CH2CH3 + 7O2 = 2C2H2(CO)2O + 8H2O
CuO(s) + 2HCl(aq) = CuCl2(aq) + H2O(l)CuO(s) + 2HCl(aq) = CuCl2(aq) + H2O(l)
CaCO3(s)+CH3COOH(l)=Ca(CH3COO)2+H2CO3CaCO3(s) + 2CH3COOH(l) = Ca(CH3COO)2 + H2CO3
C3 H8+O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3 H8+O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10+O2= CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH3CH2OH+O2=CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C4H10+O2= CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H5OH + K2Cr2O7 + H2SO4 = C2H4 + K2SO4 + Cr2(SO4)3 + H2OC2H5OH + 0K2Cr2O7 + 0H2SO4 = C2H4 + 0K2SO4 + 0Cr2(SO4)3 + H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C6H6 + O2 = H2O + CO22C6H6 + 15O2 = 6H2O + 12CO2
Cu+AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CuCl2+H2=Cu+HClCuCl2 + H2 = Cu + 2HCl
CH3CH2CH2CH2OH + O2 = CO2 + H2OCH3CH2CH2CH2OH + 6O2 = 4CO2 + 5H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu + H2O = CuO + H2Cu + H2O = CuO + H2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu + O2= CuO2Cu + O2 = 2CuO
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
CaC2+6H2O+3O2=Ca(OH)2+5CH2CHCO2H6CaC2 + 14H2O + 3O2 = 6Ca(OH)2 + 4CH2CHCO2H
Ca(OH)2 = Ca2 + OH2Ca(OH)2 = Ca2 + 4OH
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu(OH)2 + H3PO4 = Cu3(PO4)2 + H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
C + H2SO4 = CO2 + SO2 + H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
C5H12+O2=C+H2OC5H12 + 3O2 = 5C + 6H2O
Ca10F2(PO4)6 + H2SO4 = Ca(H2PO4)2 + CaSO4 + HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
C2H5NSCl + O2 = CO + H2O + NO + SO2 + Cl24C2H5NSCl + 15O2 = 8CO + 10H2O + 4NO + 4SO2 + 2Cl2
Cl2 + NaI = NaCl + I2Cl2 + 2NaI = 2NaCl + I2
C6H5N2Cl = C6H5Cl + N2C6H5N2Cl = C6H5Cl + N2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2 = CaO + H2OCa(OH)2 = CaO + H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C9H20 + O2 = CO2 + H2O C9H20 + 14O2 = 9CO2 + 10H2O
CaCl2+Na2CO3=NaCl+CaCO3CaCl2 + Na2CO3 = 2NaCl + CaCO3
CaCl2+Na2CO3=NaCl+CaCO3CaCl2 + Na2CO3 = 2NaCl + CaCO3
CaCl2 + CuSO4 = CaSO4 + CuCl2CaCl2 + CuSO4 = CaSO4 + CuCl2
C7H14 = C7H8 + H2C7H14 = C7H8 + 3H2
CaCO3+H3PO4 = Ca3(PO4)2+H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
C7H17+O2 = CO2+H2020C7H17 + 140O2 = 140CO2 + 17H20
C3H8OS + O2 = CO2 + H2O + SO3C3H8OS + 6O2 = 3CO2 + 4H2O + SO3
C7H14 = C7H8 + H2C7H14 = C7H8 + 3H2
C3H6O2S + O2 = CO2 + H2O + SO3C3H6O2S + 5O2 = 3CO2 + 3H2O + SO3
C2H5NSCl + O2 = CO2 + H2O + NO2 + SO2 + Cl24C2H5NSCl + 21O2 = 8CO2 + 10H2O + 4NO2 + 4SO2 + 2Cl2
Cr(OH)3 + HCl = CrCl3 + H2OCr(OH)3 + 3HCl = CrCl3 + 3H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
C3H8 + O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CuCl2 + KI = CuI + KCl + I22CuCl2 + 4KI = 2CuI + 4KCl + I2
CaCl2 + CuSO4 = CaSO4 + CuCl2CaCl2 + CuSO4 = CaSO4 + CuCl2
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCl2+H2CO3 =CaCO3+2HClCaCl2 + H2CO3 = CaCO3 + 2HCl
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
Ca(HCO3)2(aq)+HCl(aq)=CaCl2(s)+H2O(l)+CO2(g)Ca(HCO3)2(aq) + 2HCl(aq) = CaCl2(s) + 2H2O(l) + 2CO2(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g) = CO2(g)+H2O(g) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CrBr2+AgNO3=CrNO3+AgBr2CrBr2 + AgNO3 = CrNO3 + AgBr2
CaS + NaNO3 = Na2S + Ca(NO3)2CaS + 2NaNO3 = Na2S + Ca(NO3)2
CH4O + C7H6O3 = C8H8O4 + H2O0CH4O - 8C7H6O3 = -7C8H8O4 + 4H2O
CH4O + C7H6O3 = C8H8O3 + H2OCH4O + C7H6O3 = C8H8O3 + H2O
C4H10+O2 = CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H6+O2 = CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H4+O2 = H2O+CO2C2H4 + 3O2 = 2H2O + 2CO2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCI2+H2O=H2CI2+CaOCaCI2 + H2O = H2CI2 + CaO
Cu2S+O2=2Cu+SO2Cu2S + O2 = 2Cu + SO2
CH4 + 2O2 = 2CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 2O2 = 2CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cr2O7+C2O4=Cr+CO20Cr2O7 + C2O4 = 0Cr + 2CO2
C4H8 (g) + O2 (g)=CO2 (g) + H2O (l) C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(l)
Co(OH)3 + H+ = Co++ + O2 + H2O4Co(OH)3 + 8H+ = 4Co++ + O2 + 10H2O
CaCO3+HCl=H2O+CaCl2+CO2CaCO3 + 2HCl = H2O + CaCl2 + CO2
ClO- +2I- +3H+ = I2 +H2O +HClClO- + 2I- + 3H+ = I2 + H2O + HCl
C7H16+O2=CO2+H205C7H16 + 35O2 = 35CO2 + 4H20
C2H2+O2=CO2=H2010C2H2 + 20O2 = 20CO2 + H20
CO 2 (g)+CaSiO 3 (s)+H 2 O(l)=SiO 2 (s)+Ca(HCO 3 ) 2 (aq) 2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C3H8+O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuS + HNO3 = Cu(NO3)2 + S + NO + H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 2NO + 4H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C10H24+O2=CO+H2OC10H24 + 11O2 = 10CO + 12H2O
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu + HCl + Na2S = CuS + NaCl + HCu + 2HCl + Na2S = CuS + 2NaCl + 2H
Cu + HCl + Na2S = CuS + NaCl + HCu + 2HCl + Na2S = CuS + 2NaCl + 2H
C + O2 = CO2C + O2 = 2CO
Ca(NH3) + 2NH4I = CaI2 + 2NH3 + H2Ca(NH3) + 2NH4I = CaI2 + 3NH3 + H2
C6H6S2 + 15O2 = CO + 6H2O + SO32C6H6S2 + 15O2 = 12CO + 6H2O + 4SO3
CH4+S8=CS2+H2S2CH4 + S8 = 2CS2 + 4H2S
Cu+F2=CuF2Cu + F2 = 2CuF
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca + HNO3 = Ca(NO3)2 + NH4NO3 + H2O4Ca + 10HNO3 = 4Ca(NO3)2 + NH4NO3 + 3H2O
Cu2CO3(OH)2=CuO+CO2+H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
Cu2S+HNO3=Cu(NO3)2+H2SO4+NO2+H2OCu2S + 14HNO3 = 2Cu(NO3)2 + H2SO4 + 10NO2 + 6H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CrI3+KOH + Cl2= K2CrO4 +KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
Cu + HNO3= Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CuO + C = Cu + CO22CuO + C = 2Cu + CO2
CrCl3+NaOH+H2O2=Na2CrO4+NaCl+H2O2CrCl3 + 10NaOH + 3H2O2 = 2Na2CrO4 + 6NaCl + 8H2O
C12H22O11+ H2O = CH3CH2OH + CO2C12H22O11 + H2O = 4CH3CH2OH + 4CO2
CaCO3 + HCl = CaCl2 + CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C11H22+O2=CO2+H2010C11H22 + 110O2 = 110CO2 + 11H20
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cr2(SO4)3+KI+KIO3+H2O=Cr(OH)3+K2SO4+I2Cr2(SO4)3 + 5KI + KIO3 + 3H2O = 2Cr(OH)3 + 3K2SO4 + 3I2
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cr2(SO4)+KI+KIO3+H2O=Cr(OH)3+K2SO4+I2Cr2(SO4) + KI + KIO3 + 3H2O = 2Cr(OH)3 + K2SO4 + I2
Ca + HNO3 = Ca(NO3)2 + NH4NO3 + H2O 4Ca + 10HNO3 = 4Ca(NO3)2 + NH4NO3 + 3H2O
C2H2 + O2 =CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C6H12O6 + O2 =CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CH4 + O2 =CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca(IO3)2+KI+HCl=CaCl+KCl+I2+H2O2Ca(IO3)2 + 22KI + 24HCl = 2CaCl + 22KCl + 13I2 + 12H2O
CrI3+KOH+Cl2=K2CrO4+KIO4+KCl+H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
C6H14O2 + O2 = CO2 + H2O2C6H14O2 + 17O2 = 12CO2 + 14H2O
C6H12O6 + O2 =CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CO2+CaO=CaCO3CO2 + CaO = CaCO3
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C+Cl2+H2=CHCl32C + 3Cl2 + H2 = 2CHCl3
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C+H2+O2 = CH3OH2C + 4H2 + O2 = 2CH3OH
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C4H10 + O2= CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuS+HNO3=Cu(NO3)2+S+H2O+NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
Ca + HCl = CaCl2 + H2Ca + 2HCl = CaCl2 + H2
Ca + HCl = CaCl2 + H2Ca + 2HCl = CaCl2 + H2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cu(NO3)2=CuO+NO2+OCu(NO3)2 = CuO + 2NO2 + O
Ca + Br2 = CaBr2Ca + Br2 = CaBr2
CH4 + 2 O2 = CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
Ca + Cl2 = CaCl2Ca + Cl2 = CaCl2
C6H12O2 = C + H2 + O2C6H12O2 = 6C + 6H2 + O2
CaCl2+Na2SO4=CaSO4+NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
C6H14O = C + H2 + OC6H14O = 6C + 7H2 + O
CH4O + O2 =CO2 + H2O 2CH4O + 3O2 = 2CO2 + 4H2O
C3H6 = C + H2C3H6 = 3C + 3H2
C5H10O2 = C + H2 + O2C5H10O2 = 5C + 5H2 + O2
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
C7H16 +O2= CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCl2 + Na3PO4 = NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
ClO-+Al+H+=Cl-+Al3++H2OClO- + 6Al + 2H+ = Cl- + 2Al3+ + H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C2H4+O2=2CO2+2H2OC2H4 + 3O2 = 2CO2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaO+H2O=Ca (OH)2CaO + H2O = Ca(OH)2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H12O + C4H6O3 = C7H14O2 + H2O2C5H12O + C4H6O3 = 2C7H14O2 + H2O
C+S8=CS24C + S8 = 4CS2
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C6H12O6 + O2 = CO + H2OC6H12O6 + 3O2 = 6CO + 6H2O
CdSO4 + H3PO4= Cd3(PO4)2 + H2SO43CdSO4 + 2H3PO4 = Cd3(PO4)2 + 3H2SO4
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C3H8 + O2= CO2 +H2OC3H8 + 5O2 = 3CO2 + 4H2O
CS2+Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C2H5OH + O2 = 2CO2 + H2010C2H5OH + 15O2 = 20CO2 + 3H20
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
CH3COOH +O2(g)=2CO2(g) +2H2OCH3COOH + 2O2(g) = 2CO2(g) + 2H2O
C6H12O2 + O2 = CO2 + H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C2H12O2 + O2 = CO2 + H2OC2H12O2 + 4O2 = 2CO2 + 6H2O
Cu + SO4 = CuSO4Cu + SO4 = CuSO4
C10 H22 + O2 = CO2 +H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H12O6=C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
C10 H22 + O2 = CO2 +H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C10 H22 + O2 = CO2 +H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CaCO3+Al2Si2O7=CaSiO3+Ca2Al2O5+CO24CaCO3 + Al2Si2O7 = 2CaSiO3 + Ca2Al2O5 + 4CO2
CH3COCH3 + 4O2 = 3CO2 +3H2OCH3COCH3 + 4O2 = 3CO2 + 3H2O
CU + HNO3 = CU(NO3)2 + NO + H2O3CU + 8HNO3 = 3CU(NO3)2 + 2NO + 4H2O
C12H22O11+O2 = CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CO + O2 = CO22CO + O2 = 2CO2
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H5(NO3)3=N2+O2+H20+CO24C3H5(NO3)3 = 6N2 + 6O2 + H20 + 12CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6O +HNO3 = CO2(g) +H2O(g) +N2(g)5C2H6O + 12HNO3 = 10CO2(g) + 21H2O(g) + 6N2(g)
Ca3(PO4)2 + C = Ca3P2 + COCa3(PO4)2 + 8C = Ca3P2 + 8CO
Cu2CO3(OH)2 = CuO + CO2 + H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
Cu2O + Cu2S = Cu + SO22Cu2O + Cu2S = 6Cu + SO2
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
CaSi2 + SbCl3 = Si + Sb + CaCl23CaSi2 + 2SbCl3 = 6Si + 2Sb + 3CaCl2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cr2(SO4)2 + KClO3 + K(OH) = K2CrO4 + KCl + K2SO4 + H2O3Cr2(SO4)2 + 4KClO3 + 24K(OH) = 6K2CrO4 + 4KCl + 6K2SO4 + 12H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CO + O2 = CO22CO + O2 = 2CO2
CO + O2 = CO22CO + O2 = 2CO2
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
CH3COO + O2 = CO2 + H2O4CH3COO + 7O2 = 8CO2 + 6H2O
CH4+NH3=HCN+H2CH4 + NH3 = HCN + 3H2
C7H8+O2=CO2+H2OC7H8 + 9O2 = 7CO2 + 4H2O
C3H8 + 5O2 = 3CO2 + 4H205C3H8 + 15O2 = 15CO2 + 2H20
Ca3(PO4)2+SiO2=P4O10+CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
Co3(PO4)2+CaCl2 =CoCl2+Ca3(PO4)2Co3(PO4)2 + 3CaCl2 = 3CoCl2 + Ca3(PO4)2
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Cu2O+C=2Cu+1CO22Cu2O + C = 4Cu + CO2
Cu + O2 = CuO2Cu + O2 = 2CuO
Ca2CO3 + HC2H3O2 = CaC2H3O2 + H2CO3Ca2CO3 + 2HC2H3O2 = 2CaC2H3O2 + H2CO3
CaO + HNO3 = Ca(NO3)2 + H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
Ca+O2=2CaO2Ca + O2 = 2CaO
C3H8 + O2 = H2O + CO2C3H8 + 5O2 = 4H2O + 3CO2
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
C+O2=CO2C + O2 = CO2
Cu + O2 =CuO2Cu + O2 = 2CuO
Cu + O =CuO2Cu + 2O = CuO2
Cu + O =CuOCu + O = CuO
Cr2(SO4)3 + KClO3 + K(OH) = K2CrO4 + KCl + K2SO4 + H2OCr2(SO4)3 + KClO3 + 10K(OH) = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
Cr2(SO4)2 + KClO3 + K(OH) = K2CrO4 + KCl + K2SO4 + H2O3Cr2(SO4)2 + 4KClO3 + 24K(OH) = 6K2CrO4 + 4KCl + 6K2SO4 + 12H2O
Cu + O2 = CuO2Cu + O2 = CuO2
Cu + O2 = CuO2Cu + O2 = CuO2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+O2=CuO2Cu + O2 = 2CuO
C7H17 + O2 =CO2 + H2O4C7H17 + 45O2 = 28CO2 + 34H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO+O2=CO22CO + O2 = 2CO2
C3H3+O2=CO2+H2O4C3H3 + 15O2 = 12CO2 + 6H2O
C6H5NO2 + Fe + H20 = C6H5NH2 + Fe3O410C6H5NO2 + 15Fe + H20 = 10C6H5NH2 + 5Fe3O4
Co(NO3)2(aq)+H2S(g)=CoS(s)+HNO3(aq) Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
Co(NO3)2(aq)+H2S(g)=CoS(s)+HNO3(aq) Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
CH3OH+N2=HCN+NH3+O22CH3OH + 2N2 = 2HCN + 2NH3 + O2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cs + N3 = Cs3N9Cs + N3 = 3Cs3N
Cs + N3 = Cs3N9Cs + N3 = 3Cs3N
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
C + S8 = CS24C + S8 = 4CS2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CoF2 + F2= CoF32CoF2 + F2 = 2CoF3
Cl2 + LiI= LiCl + I2Cl2 + 2LiI = 2LiCl + I2
C10H8+O2=CO2+H2OC10H8 + 12O2 = 10CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca3 P2 +6 H2 O = 3Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CuCl + NaCN = CuCN + NaClCuCl + NaCN = CuCN + NaCl
C6H6S2 + O2 = CO2 + H2O + SO32C6H6S2 + 21O2 = 12CO2 + 6H2O + 4SO3
C3H7OH + O2 = CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C2H3O2Br + O2 = CO + H2O + HBr2C2H3O2Br + O2 = 4CO + 2H2O + 2HBr
C42H69O29N+H2O=CH4+CO2+NH3 C42H69O29N + 11H2O = 22CH4 + 20CO2 + NH3
CO + H2O + HF = C2H3O2F + O24CO + 2H2O + 2HF = 2C2H3O2F + O2
C6H6O2 + O2 = CO + H2O2C6H6O2 + 7O2 = 12CO + 6H2O
CoS2+O2=Co2O3+SO24CoS2 + 11O2 = 2Co2O3 + 8SO2
Ca + N2 = Ca3N23Ca + N2 = Ca3N2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H6S + O2 = CO + H2O + SO22C6H6S + 11O2 = 12CO + 6H2O + 2SO2
C2H3OF + O2 = CO2 + H2O + HFC2H3OF + 2O2 = 2CO2 + H2O + HF
C4H10O + 6O2 = 4CO2 + 5H2OC4H10O + 6O2 = 4CO2 + 5H2O
C2H6O + 3O2 = CO2 + 3H2OC2H6O + 3O2 = 2CO2 + 3H2O
CrI3+KOH+Cl2=K2CrO4+KIO4+KCl+H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CoCl2+Na2O2+NaOH+H2O=Co(OH)3+NaCl2CoCl2 + Na2O2 + 2NaOH + 2H2O = 2Co(OH)3 + 4NaCl
C2HC+O=CO2+H2O2C2HC + 13O = 6CO2 + H2O
C + H2O = CO + H2C + H2O = CO + H2
CuCl2 + HAl2 = Cu2 +AlCl3 + H26CuCl2 + 2HAl2 = 3Cu2 + 4AlCl3 + H2
CuO + HCl =CuCl2 +H2OCuO + 2HCl = CuCl2 + H2O
Cu+HNO3 = Cu(NO3)2 + NO2 +H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C6H12O6 = CO2 + H2O + C4H10O211C6H12O6 = 18CO2 + 6H2O + 12C4H10O2
C6H12O6 = CO2 + H2O + 1C4H10O211C6H12O6 = 18CO2 + 6H2O + 12C4H10O2
Cu(s)+O2(g)=CuO(s)2Cu(s) + O2(g) = 2CuO(s)
C6H12O6 = CO2 + H2O + C4H10O21-2C6H12O6 = -24CO2 - 27H2O + 3C4H10O21
C6H12O6 = CO2 + H2O + C4H10O211C6H12O6 = 18CO2 + 6H2O + 12C4H10O2
Cu(s)+O2(g)=CuO(s)2Cu(s) + O2(g) = 2CuO(s)
Cl2 + KL = L2 + KClCl2 + 2KL = L2 + 2KCl
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co(NO3)2 + KCl = CoCl + K(NO3)2Co(NO3)2 + KCl = CoCl + K(NO3)2
Cl2 + IO3 = IO4 + ClCl2 + 0IO3 = 0IO4 + 2Cl
C3H8O(l)+O2(g)=H2O(g)+CO2(g)2C3H8O(l) + 9O2(g) = 8H2O(g) + 6CO2(g)
C3H8O(l)+O2=H2O+CO22C3H8O(l) + 9O2 = 8H2O + 6CO2
Cu(NO3)2+Na2S=CuS+NaNO3Cu(NO3)2 + Na2S = CuS + 2NaNO3
C2H4(g)+3O2(g)=2CO2(g)+2H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
Ca(ClO4)2+H2SO4=CaSO4+HClO4Ca(ClO4)2 + H2SO4 = CaSO4 + 2HClO4
Ca(C2H3O2)2+Na2(CO3)=Ca(CO3)+NaC2H3O2Ca(C2H3O2)2 + Na2(CO3) = Ca(CO3) + 2NaC2H3O2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H9O+O2=CO2+H2O4C4H9O + 23O2 = 16CO2 + 18H2O
C5H8O2+6O2=5CO2+4H2OC5H8O2 + 6O2 = 5CO2 + 4H2O
CaI2+H2(SO4)=Ca(SO4)+HICaI2 + H2(SO4) = Ca(SO4) + 2HI
Cr2O3 + NO2 = Cr + NO42Cr2O3 + 3NO2 = 4Cr + 3NO4
CaPO4 + (NH4)2C2O4 = CaC2O4 + (NH4)2PO4CaPO4 + (NH4)2C2O4 = CaC2O4 + (NH4)2PO4
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Cr2O7--+S-+H+=Cr++++S+H2OCr2O7-- + 6S- + 14H+ = 2Cr+++ + 6S + 7H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H5OH+K2Cr2O7+H2SO4=CH3COOH+Cr2(SO4)3+K2SO4+H2O3C2H5OH + 2K2Cr2O7 + 8H2SO4 = 3CH3COOH + 2Cr2(SO4)3 + 2K2SO4 + 11H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaCO3+HCl=H2O+CO2+CaCl2CaCO3 + 2HCl = H2O + CO2 + CaCl2
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
Cu+ HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca + (OH)2 + H3PO4 = Ca3PO4 + H2O6Ca + 3(OH)2 + 2H3PO4 = 2Ca3PO4 + 6H2O
Ca + (OH)2 + H3PO4 = Ca3PO4 + H2O6Ca + 3(OH)2 + 2H3PO4 = 2Ca3PO4 + 6H2O
CaSO4 + NaI = CaI2 + Na2SO4CaSO4 + 2NaI = CaI2 + Na2SO4
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
ClO2 + H2O = HClO3 + HCl6ClO2 + 3H2O = 5HClO3 + HCl
Ca3(PO4)2+H2SO4=CaSO4+H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
C2H5+O2=CO+H204C2H5 + 4O2 = 8CO + H20
C2H5+O2=CO+H204C2H5 + 4O2 = 8CO + H20
CaO+CO2=CaCO3CaO + CO2 = CaCO3
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca(OH)2+H3PO4=Ca3(PO4)2=H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H4O2 + O2 = CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
Cu+O2=Cu2O4Cu + O2 = 2Cu2O
C2H4O2 + O2 = CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
CF4+2Br2=1CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
Ca(CO3)2 = Ca + CO3Ca(CO3)2 = Ca + 2CO3
CaCO3 = Ca + CO3CaCO3 = Ca + CO3
Cl + 2HBr = BrCl + 2HCl + HBr = BrCl + H
Ce4+ + H2O2 = Ce3+ + O2 + H0Ce4+ + H2O2 = 0Ce3+ + O2 + 2H
C6H3+O2=CO+H2020C6H3 + 60O2 = 120CO + 3H20
CH4+O2=CO+H2010CH4 + 5O2 = 10CO + 2H20
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
CO2 + MgO = MgCO3CO2 + MgO = MgCO3
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
C6H10O5 + O2 = CO2 + H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
CH4+O2=CO+H2010CH4 + 5O2 = 10CO + 2H20
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
C3H7+O2=CO2+H2O4C3H7 + 19O2 = 12CO2 + 14H2O
Co(NO3)2(aq)+H2S(g)=CoS(s)+HNO3(aq)Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
C3H7+O2=CO2+H2O4C3H7 + 19O2 = 12CO2 + 14H2O
C5H10+O2=CO+H2OC5H10 + 5O2 = 5CO + 5H2O
C3H8(g) + 3O2(g) = 3CO2(g) + 4H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
Ca+H3PO4=Ca3(PO4)2+H23Ca + 2H3PO4 = Ca3(PO4)2 + 3H2
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
CuCl2+Al(C2H3O2)3=Cu(C2H3O2)2+AlCl33CuCl2 + 2Al(C2H3O2)3 = 3Cu(C2H3O2)2 + 2AlCl3
C5H5+Fe=Fe(C5H5)22C5H5 + Fe = Fe(C5H5)2
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C3H8+O2=CO3+H2O2C3H8 + 13O2 = 6CO3 + 8H2O
C3H8+O2=CO3=H2O2C3H8 + 13O2 = 6CO3 + 8H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
Ca+CuF2=CaF2+CuCa + CuF2 = CaF2 + Cu
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Cr(C2H3O2)3 +Ni(ClO3)2 =Ni(C2H3O2)2 + Cr(ClO3)32Cr(C2H3O2)3 + 3Ni(ClO3)2 = 3Ni(C2H3O2)2 + 2Cr(ClO3)3
CaI2(aq)+2Li(s)=CaLi2+2ICaI2(aq) + 2Li(s) = CaLi2 + 2I
CuO+H2SO4=CuSO4+H2OCuO + H2SO4 = CuSO4 + H2O
CH+O2=CO2+H2020CH + 20O2 = 20CO2 + H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H12O6+O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H5NSCl + O2 = CO + H2O + NO2 + SO3 + HCl2C2H5NSCl + 9O2 = 4CO + 4H2O + 2NO2 + 2SO3 + 2HCl
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H3O2F + O2 = CO + H2O + HF2C2H3O2F + O2 = 4CO + 2H2O + 2HF
C2H5NSCl + O2 = CO + H2O + NO + SO2 + Cl24C2H5NSCl + 15O2 = 8CO + 10H2O + 4NO + 4SO2 + 2Cl2
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
C5H12O + O2 = CO2 + H2O2C5H12O + 15O2 = 10CO2 + 12H2O
CO + H2O = CO2 + H2CO + H2O = CO2 + H2
CH5N + O2 = CO2 + H2O + NO24CH5N + 13O2 = 4CO2 + 10H2O + 4NO2
C2H5Cl + O2 = CO2 + H2O + Cl24C2H5Cl + 13O2 = 8CO2 + 10H2O + 2Cl2
C2H5NSCl + O2 = CO + H2O + NO + SO2 + Cl24C2H5NSCl + 15O2 = 8CO + 10H2O + 4NO + 4SO2 + 2Cl2
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
Ca + LaF3 = La + CaF23Ca + 2LaF3 = 2La + 3CaF2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CH2S + O2 = CO2 + H2O + SO3CH2S + 3O2 = CO2 + H2O + SO3
CuO+NH3=N2+Cu+H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
CH3COOH + NaHCO3 = CH3COONa +H2O + CO2CH3COOH + NaHCO3 = CH3COONa + H2O + CO2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CO2+H20=C6H12O6+O230CO2 + 3H20 = 5C6H12O6 + 15O2
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
Ca(C2H3O2) + C2H5OH= Ca(C2H5OH) + C2H3O2Ca(C2H3O2) + C2H5OH = Ca(C2H5OH) + C2H3O2
CH4+O2=CH3OH2CH4 + O2 = 2CH3OH
CO+O2=CO22CO + O2 = 2CO2
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
CaO2+H2O = Ca(OH)2+H2O0CaO2 + H2O = 0Ca(OH)2 + H2O
CaO2+H2O = Ca(OH)2+H2O0CaO2 + H2O = 0Ca(OH)2 + H2O
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
CaO+MnI4=MnO2+CaI22CaO + MnI4 = MnO2 + 2CaI2
C4H10+O2=+CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu + (HNO3)2 = Cu(NO3)2 + NO + H2O3Cu + 4(HNO3)2 = 3Cu(NO3)2 + 2NO + 4H2O
C2H3OCl + O2 = CO + H2O + Cl24C2H3OCl + 5O2 = 8CO + 6H2O + 2Cl2
C3H8+ O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H3Cl + O2 = CO + H2O + HCl2C2H3Cl + 3O2 = 4CO + 2H2O + 2HCl
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CF4 + O2 = CO2 + F2CF4 + O2 = CO2 + 2F2
CaC2 + H2O = C2H2 + Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
C2H7N + O2 = CO + H2O + NO24C2H7N + 15O2 = 8CO + 14H2O + 4NO2
C4H10O2 + O2 = CO2 + H2O2C4H10O2 + 11O2 = 8CO2 + 10H2O
C2H3O2Cl + O2 = CO + H2O + Cl24C2H3O2Cl + 3O2 = 8CO + 6H2O + 2Cl2
CH5N + O2 = CO + H2O + NO4CH5N + 9O2 = 4CO + 10H2O + 4NO
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
Cu + H2SO4 = CuSO4 + H2Cu + H2SO4 = CuSO4 + H2
C2H3NO2S + O2 = CO2 + H2O + NO2 + SO34C2H3NO2S + 17O2 = 8CO2 + 6H2O + 4NO2 + 4SO3
C2H3O2F + O2 = CO + H2O + HF2C2H3O2F + O2 = 4CO + 2H2O + 2HF
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CuO + NH3 = Cu + H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
Cr(NO3)3+ZnCl2=CrCl2+Zn(NO3)3Cr(NO3)3 + ZnCl2 = CrCl2 + Zn(NO3)3
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CuCl2+Zn=ZnCl2+CuCuCl2 + Zn = ZnCl2 + Cu
Cu+HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CuS+HNO3 = Cu(NO)2+S+H2O+NO-1CuS + 0HNO3 = -1Cu(NO)2 - S + 0H2O + 2NO
C2H5(NO3)3 + O2 = CO2 + NO2 + H2O4C2H5(NO3)3 + 7O2 = 8CO2 + 12NO2 + 10H2O
Cu+H2SO4=Cu2SO4+SO2+H2O2Cu + 2H2SO4 = Cu2SO4 + SO2 + 2H2O
Cu+H2SO4=Cu2SO4+SO2+H2O2Cu + 2H2SO4 = Cu2SO4 + SO2 + 2H2O
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CCl4(g)+O2(g) = COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
Ca+MnCl2=CaMn+Cl2Ca + MnCl2 = CaMn + Cl2
Ca3N2(s)+H2O(l)=Ca(OH)2(aq)+NH3(g)Ca3N2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2NH3(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaO(s)+SO3(g)=CaSO4(s)CaO(s) + SO3(g) = CaSO4(s)
Cu+O2=CuO2Cu + O2 = 2CuO
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
Ca(s)+H2O(l)=Ca(OH)2(aq)+H2(g)Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
Ca (NO3) 2+Na3PO4=Ca3 (PO4) 2+NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH3CH2OH+O2=CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C3H2+O2=CO2+H2O2C3H2 + 7O2 = 6CO2 + 2H2O
Ca3(PO4)2+SiO2+C=CaSiO3+CO+P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C02 = 2C02C02 = C02
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca3(PO4)2 + H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
Cr+N2 = Cr3N6Cr + N2 = 2Cr3N
C57H110O6 + O2 = CO2 + H2O2C57H110O6 + 163O2 = 114CO2 + 110H2O
CaO + H2O= Ca(OH)2CaO + H2O = Ca(OH)2
CH4 + O2= CO2 = H2OCH4 + 2O2 = CO2 + 2H2O
CrCl3+Ag(NO3)3=Cr(NO3)3+AgCl3CrCl3 + Ag(NO3)3 = Cr(NO3)3 + AgCl3
Ca+N2=2CaN2Ca + N2 = 2CaN
CaCO3 + O2 = CO2 + CaOCaCO3 + 0O2 = CO2 + CaO
C+Fe2O3=Fe+CO3C + Fe2O3 = 2Fe + 3CO
CO2+Na2O=Na2CO3CO2 + Na2O = Na2CO3
CdCO3=CdO+CO2CdCO3 = CdO + CO2
Ca2Br2+NaCO3=CaCO3+NaBrCa2Br2 + 2NaCO3 = 2CaCO3 + 2NaBr
C6H12O6+O2=6CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.