Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CaOH+HCl=CaCl+H2OCaOH + HCl = CaCl + H2O
CH3(CH2)3CH3 + O2 = CO2 + H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)7CH3 + O2 = CO2 + H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
CH3(CH2)7CH3 + O2 = CO2 + H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
CH3CH3(g)+O2=CO2(g)+H2O(g)2CH3CH3(g) + 7O2 = 4CO2(g) + 6H2O(g)
CH3(CH2)7CH3 + O2 = CO2 + H20CH3(CH2)7CH3 + 9O2 = 9CO2 + H20
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
Cl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
Cl2O7 + Ca(OH)2 =Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
Cl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
CuFeS2+O2=Cu2S+FeO+SO22CuFeS2 + 4O2 = Cu2S + 2FeO + 3SO2
C4H10O + K2Cr2O7 + H2SO4 = C4O2 + Cr2(SO4)3 + K2SO4 + H2OC4H10O + 2K2Cr2O7 + 8H2SO4 = C4O2 + 2Cr2(SO4)3 + 2K2SO4 + 13H2O
C6H12O6= C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Ca3(PO4)2+C+SiO2=CaSiO3+CO+P42Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + 10CO + P4
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C4H10 + O3 = CO2 + H2O3C4H10 + 13O3 = 12CO2 + 15H2O
Cr2O3+H2O=Cr(OH)3Cr2O3 + 3H2O = 2Cr(OH)3
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca+S=CaSCa + S = CaS
C2H3+O2 = CO2 + H2O4C2H3 + 11O2 = 8CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2+2KMNO4+2H2O=C2H2(OH)4+2MNO2+2KOH3C2H2 + 4KMNO4 + 8H2O = 3C2H2(OH)4 + 4MNO2 + 4KOH
Cr2O3 + Si = Cr + SiO22Cr2O3 + 3Si = 4Cr + 3SiO2
CO + O2 = CO22CO + O2 = 2CO2
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3 = CO2 + CaOCaCO3 = CO2 + CaO
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH3CH2CH2OH + O2 = H2O + CO22CH3CH2CH2OH + 9O2 = 8H2O + 6CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H16+O2=CO2+H205C8H16 + 40O2 = 40CO2 + 4H20
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaC2+H2O = C2 H2 + CaOCaC2 + H2O = C2H2 + CaO
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CoO + O2 = Co2O34CoO + O2 = 2Co2O3
CoO CoO + O2 = Co2O32CoOCoO + O2 = 2Co2O3
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
Cr2O3 + KNO3 + KOH= K2CrO3 + KNO2+ H2OCr2O3 + KNO3 + 4KOH = 2K2CrO3 + KNO2 + 2H2O
CuCO3 + O2 = CuO + CO32CuCO3 + O2 = 2CuO + 2CO3
CuCO3 + O2 = CuO + CO2CuCO3 + 0O2 = CuO + CO2
CuFeS2+O2=Cu2S+FeO+SO22CuFeS2 + 4O2 = Cu2S + 2FeO + 3SO2
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca(OH)2 + CO2 = CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
Ca(NO3)2 + LiCl = CaCl2 + LiNO3Ca(NO3)2 + 2LiCl = CaCl2 + 2LiNO3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H10 + H3PO4 = CO2 + P2O3 + H2010C5H10 + 40H3PO4 = 50CO2 + 20P2O3 + 11H20
CaSo4+AlCl3=CaCl2 + Al2(So4)33CaSo4 + 2AlCl3 = 3CaCl2 + Al2(So4)3
CuFeS2(s) + O2(g) = Cu2S(s) + FeO(s) +SO2(g)2CuFeS2(s) + 4O2(g) = Cu2S(s) + 2FeO(s) + 3SO2(g)
Cr2O3+Li2SO4=Cr2(SO4)3+Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
CaCO3 + (NH4)2HPO4 + H2O = Ca5(PO4) 3OH + (NH4) 2CO3 + H2CO35CaCO3 + 3(NH4)2HPO4 + H2O = Ca5(PO4)3OH + 3(NH4)2CO3 + 2H2CO3
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l) 3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CaCO3 + O2 = CaO + CO2CaCO3 + 0O2 = CaO + CO2
CaCO3 + O2 = CaO + CO2CaCO3 + 0O2 = CaO + CO2
C 5 H 6 O(l)+O 2 (g)=CO 2 (g)+H 2 O(g) C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C 3 H 6 (g)+O 2 (g)=CO 2 (g)+H 2 O(g) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CuFeS2 + O2 = Cu2S +FeO +SO2(g)2CuFeS2 + 4O2 = Cu2S + 2FeO + 3SO2(g)
C3H6+O2 =CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cr2O3 + Na2CO3 + KNO3 = Na2CrO4 + CO2 + KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
C3H6(g) + O2(g)=CO2(g) +H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CuFeS2(s) + O2(g)=Cu2S(s) +FeO(s) +SO2(g)2CuFeS2(s) + 4O2(g) = Cu2S(s) + 2FeO(s) + 3SO2(g)
Ca+SO4=CaSO4Ca + SO4 = CaSO4
C6H12O6+6O2 = 6CO2 + 6H20 5C6H12O6 + 15O2 = 30CO2 + 3H20
C6H12O6+6O2 = 6CO2 + 6H205C6H12O6 + 15O2 = 30CO2 + 3H20
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CO2 + C = COCO2 + C = 2CO
C(s)+O2(g)=CO2(g)C(s) + O2(g) = CO2(g)
CuO+ H2 = Cu + H2OCuO + H2 = Cu + H2O
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CuO+H2=Cu+H2OCuO + H2 = Cu + H2O
CuO+H2=Cu+H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuFeS2(s) + O2(g) = Cu2S(s) + FeO(s) + SO2(g)2CuFeS2(s) + 4O2(g) = Cu2S(s) + 2FeO(s) + 3SO2(g)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca3(PO4)2+SiO+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO + 4C = 6CaSiO3 + P4 + 4CO
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Ca(OH)+MgCl=MgOH+CaClCa(OH) + MgCl = MgOH + CaCl
C2H4O (g) + O2 (g) = CO2 (g) + H2O (g)2C2H4O(g) + 5O2(g) = 4CO2(g) + 4H2O(g)
CS3+O2=CO2+SO2CS3 + 4O2 = CO2 + 3SO2
CS3+O2=CO2+SO2CS3 + 4O2 = CO2 + 3SO2
Cu + Ag NO3 = CuNO3 + AgCu + AgNO3 = CuNO3 + Ag
Cu + Ag NO3 = Cu (NO3) + AgCu + AgNO3 = Cu(NO3) + Ag
C3H8 + H2O = H2 + CO2C3H8 + 6H2O = 10H2 + 3CO2
CaC2 + CO2 + H2O = CH2CHCO2H + Ca(OH)26CaC2 + 3CO2 + 16H2O = 5CH2CHCO2H + 6Ca(OH)2
CuS+HNO3=Cu(NO3)2+NO+H2O+S3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O + 3S
Cu+HNO3=Cu(NO3)2+H2O+NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H12O6 + O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C6H12O6 + O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C4H10+O2= CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co(NO3)2 +Na2S = CoS +2NaNO3Co(NO3)2 + Na2S = CoS + 2NaNO3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
C+ Ca3(PO4)2 + SiO2 = CaSiO3 + CO + P5C + Ca3(PO4)2 + 3SiO2 = 3CaSiO3 + 5CO + 2P
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaO+2NH4Cl=2NH3+H2O+CaCl2CaO + 2NH4Cl = 2NH3 + H2O + CaCl2
CH3(CH2)6 CH3+O2= CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)6 CH3+O2= CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4 + NH3 + O2 = HCN + H2O2CH4 + 2NH3 + 3O2 = 2HCN + 6H2O
CrCl3 + NH3 + H2O = Cr(OH)3 + NH4ClCrCl3 + 3NH3 + 3H2O = Cr(OH)3 + 3NH4Cl
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CH3OH + O2 = CO2 + H2010CH3OH + 5O2 = 10CO2 + 2H20
CH3OH + O2 = CO2 + H2010CH3OH + 5O2 = 10CO2 + 2H20
C2H6+O2 = CO2+ H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C 2 H 6 (g)+O 2 (g)=CO 2 (g)=H 2 O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3NH2 + O2 = CO2 + H2O + N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cl2 + I- = I2 + Cl-Cl2 + 2I- = I2 + 2Cl-
Ca3(PO4)2 + SiO2 +C =P4 +CaSiO3 + CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
CH3OCH3 + O2 = CO2 + H2OCH3OCH3 + 3O2 = 2CO2 + 3H2O
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C5H6O+O2=5CO2+3H2OC5H6O + 6O2 = 5CO2 + 3H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O2 = CO2 + 10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4(g) + NH3(g) + O2(g) =HCN(g) + H2O(g)2CH4(g) + 2NH3(g) + 3O2(g) = 2HCN(g) + 6H2O(g)
CaCl2 + H2O = Ca(OH)2 + HClCaCl2 + 2H2O = Ca(OH)2 + 2HCl
C2H6(g)+O2(g) =CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H8N2+O2=CO2+H2O+N2C2H8N2 + 4O2 = 2CO2 + 4H2O + N2
CH3CHCH2 + KMnO4 + H2O = CH3CHOHCH2OH + MnO2 + KOH3CH3CHCH2 + 2KMnO4 + 4H2O = 3CH3CHOHCH2OH + 2MnO2 + 2KOH
CH3CHCH2 + KMnO4 + H2O = CH3CHCH2(OH)2 + MnO2 + KOH3CH3CHCH2 + 2KMnO4 + 4H2O = 3CH3CHCH2(OH)2 + 2MnO2 + 2KOH
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH3CHCH2 + KMnO4 + H2O = CH3CHCH2(OH)2 + MnO2 +KOH3CH3CHCH2 + 2KMnO4 + 4H2O = 3CH3CHCH2(OH)2 + 2MnO2 + 2KOH
CuO+Al=Al2O3+Cu3CuO + 2Al = Al2O3 + 3Cu
ClO2=Cl2+O22ClO2 = Cl2 + 2O2
Cl2+Br2=BrClCl2 + Br2 = 2BrCl
C6H12O6 = CO2 + C2H5OHC6H12O6 = 2CO2 + 2C2H5OH
C6H12O6 + CO(NH2)2 = H2O + CH + NO5C6H12O6 + 6CO(NH2)2 = 24H2O + 36CH + 12NO
C6H12O6 + CO(NH2)2 = H2O + NO + CC6H12O6 + 0CO(NH2)2 = 6H2O + 0NO + 6C
Ca(IO3)2 + KI + HCl = CaCl2 + KCl +I2 + H2OCa(IO3)2 + 10KI + 12HCl = CaCl2 + 10KCl + 6I2 + 6H2O
C2H6 + O2 =CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + H3PO4 =Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cu2S + H2O = SO2 + H + CuCu2S + 2H2O = SO2 + 4H + 2Cu
CH3CH2OH + CrH2O4 = CH3COOH + CrO2 + H2OCH3CH2OH + 2CrH2O4 = CH3COOH + 2CrO2 + 3H2O
C2H2 + O2 = CO2 + H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
Cl2 +MgBr2=MgCl+BrCl2 + 2MgBr2 = 2MgCl + 4Br
CH4 =C+2H2CH4 = C + 2H2
C6H6 + O2= CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH4+F2=CF4+HFCH4 + 4F2 = CF4 + 4HF
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2OH+ O2 = CO2 + H2010CH3CH2OH + 15O2 = 20CO2 + 3H20
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaCO3+HNO3=Ca(NO3)2+CO2+H2OCaCO3 + 2HNO3 = Ca(NO3)2 + CO2 + H2O
CaCO3+HNO3=Ca(NO3)2+CO2+H2OCaCO3 + 2HNO3 = Ca(NO3)2 + CO2 + H2O
C+H2SO4=CO2+SO2+H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
C+H2SO4=CO2+SO2+H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
C+H2SO4=CO2+SO2+H2010C + 10H2SO4 = 10CO2 + 10SO2 + H20
C+H2SO4=CO2+SO2+H2010C + 10H2SO4 = 10CO2 + 10SO2 + H20
CaCO3+HCl = CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaCO3+HCl = CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6(l) + O2(g) = CO2(g) + H2O(g)2C2H6(l) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6(g) + O2(g) = CO2(g) + H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
CH3(CH4)2(CH3)+O2=CO2+H2010CH3(CH4)2(CH3) + 40O2 = 40CO2 + 7H20
CH3(CH4)2(CH3)+O2=CO2+H2010CH3(CH4)2(CH3) + 40O2 = 40CO2 + 7H20
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C3H5(NO3)3 = N2 + O2 + CO2 + H2O4C3H5(NO3)3 = 6N2 + O2 + 12CO2 + 10H2O
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2+NaOH=NaCl+NaClO+H2OCl2 + 2NaOH = NaCl + NaClO + H2O
Cu+HNO3=Cu(NO3)2+H2O+NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Cl2+NH3=N2H4+NH4ClCl2 + 4NH3 = N2H4 + 2NH4Cl
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH4 + 3O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C3H5(NO3)3 = CO2 + H2O + N2 + O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cl2 + NaClO + HCl = NaCl + H2O-1Cl2 + NaClO + 2HCl = NaCl + H2O
Cl2 + NaClO + HCl = NaCl + H2O-1Cl2 + NaClO + 2HCl = NaCl + H2O
CH3(CH2)2CH3 + 7O2 = 6CO2 + 2H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C+O2=CO2C + O2 = 2CO
CaCO3+H2SO4= CaSO4+H2CO3CaCO3 + H2SO4 = CaSO4 + H2CO3
C(s)+O2(g)=CO2(g)C(s) + O2(g) = CO2(g)
Ca(s) + HCl(l) =CaCl2(aq) + H2(g)Ca(s) + 2HCl(l) = CaCl2(aq) + H2(g)
CrCl3+KOH=K2Cr2O7+KCl+H2+H2O2CrCl3 + 8KOH = K2Cr2O7 + 6KCl + 3H2 + H2O
CrCl3+KOH=K2Cr2O7+KCl+H2+H2O2CrCl3 + 8KOH = K2Cr2O7 + 6KCl + 3H2 + H2O
CrCl3+KOH=K2Cr2O7+KCl+H2+H2O2CrCl3 + 8KOH = K2Cr2O7 + 6KCl + 3H2 + H2O
CrCl3+KOH=K2Cr2O7+KCl+H2+H2O2CrCl3 + 8KOH = K2Cr2O7 + 6KCl + 3H2 + H2O
CrI3 + NaOH + Cl2 = NaCrO4 + NaIO4 + NaCl + H2OCrI3 + 32NaOH + 14Cl2 = NaCrO4 + 3NaIO4 + 28NaCl + 16H2O
CaCo3+O2=CaO+Co22CaCo3 + O2 = 2CaO + 3Co2
CaCo3+O2=CaO+Co22CaCo3 + O2 = 2CaO + 3Co2
C8H18(g) + O2(g) =CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3(CH2)5CH3 +O2 = CO2 + H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3CH2CH3+O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3+O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)2CH3+O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)4CH3+O2 = CO2+ H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)5CH3+O2=CO2+H205CH3(CH2)5CH3 + 35O2 = 35CO2 + 4H20
C6H12O6 = CH4 + CO2C6H12O6 = 3CH4 + 3CO2
Co(NH2)6++ + H+ + O2 = Co(NH3)6+++ + H2O-4Co(NH2)6++ - 4H+ + 5O2 = -4Co(NH3)6+++ + 10H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + H3PO4 =Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
CH4+O2=H2O+CO2CH4 + 2O2 = 2H2O + CO2
Cl2 + KOH = KClO3 + KCl + H2O3Cl2 + 6KOH = KClO3 + 5KCl + 3H2O
CrI3 + NaOH + Cl2 = NaCrO4 + NaIO4 + NaCl + H2OCrI3 + 32NaOH + 14Cl2 = NaCrO4 + 3NaIO4 + 28NaCl + 16H2O
CaO+HNO3=Ca(NO3)2+H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
Cu +HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cr2O3+ Na2CO3 + KNO3 = 2NaCrO4 + CO2 + KNO2 Cr2O3 + Na2CO3 + 4KNO3 = 2NaCrO4 + CO2 + 4KNO2
Cr2O3+ Na22CO3 + KNO3 = 2NaCrO4 + CO2 + KNO2 11Cr2O3 + Na22CO3 + 54KNO3 = 22NaCrO4 + CO2 + 54KNO2
Cr2O3+ NaCO3 + KNO3 = 2NaCrO4 + CO2 + KNO2 Cr2O3 + 2NaCO3 + 3KNO3 = 2NaCrO4 + 2CO2 + 3KNO2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
CuO + NH3 = Cu + H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
CuO + NH3 = Cu + H2O + N3CuO + 2NH3 = 3Cu + 3H2O + 2N
CO2 + 2LiOH=Li2CO3 + 3H2OCO2 + 2LiOH = Li2CO3 + H2O
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaSO4 + FeBr3 = CaBr2 + Fe2(SO4)33CaSO4 + 2FeBr3 = 3CaBr2 + Fe2(SO4)3
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O2 = CO2 +H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CaCO3+H2O=CaOH+CO2+O24CaCO3 + 2H2O = 4CaOH + 4CO2 + O2
Cr + NO3- + H+ = NO2 + Cr2O3 + H2O2Cr + 6NO3- + 6H+ = 6NO2 + Cr2O3 + 3H2O
CrI3 + K2Cr2O7 +H2SO4 = HIO3 + K2SO4 +Cr2(SO4)3 +H2O2CrI3 + 6K2Cr2O7 + 27H2SO4 = 6HIO3 + 6K2SO4 + 7Cr2(SO4)3 + 24H2O
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
Ca3(PO4)2 + SnCl2 = Ca3Cl2 + Sn(PO4)2Ca3(PO4)2 + SnCl2 = Ca3Cl2 + Sn(PO4)2
C2H4O2 + Mg(OH)2 = Mg(CH3COO)2 + H2O2C2H4O2 + Mg(OH)2 = Mg(CH3COO)2 + 2H2O
CH4+2O2= CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C+O2=CO2C + O2 = 2CO
C+O2=CO2C + O2 = 2CO
CO+O2=CO22CO + O2 = 2CO2
C+O2=CO2C + O2 = 2CO
C+O2=CO2C + O2 = 2CO
C5H7NO2 + O2 = CO2 + H20 + N220C5H7NO2 + 80O2 = 100CO2 + 7H20 + 10N2
C5H7NO2 + O2 = CO2 + H20 + N20C5H7NO2 + 80O2 = 100CO2 + 7H20 + 20N
CaS+CaSO4=CaO+SO2CaS + 3CaSO4 = 4CaO + 4SO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H8O7+NaOH= C6H7O7Na+H2OC6H8O7 + NaOH = C6H7O7Na + H2O
C6H8O7+NaOH= C6H7O7Na+2H2OC6H8O7 + NaOH = C6H7O7Na + H2O
C6H8O7+NaOH= C6H7O7Na+H2OC6H8O7 + NaOH = C6H7O7Na + H2O
CoS2 + O2 = Co2O3 + SO24CoS2 + 11O2 = 2Co2O3 + 8SO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CuCl2 + Fe = Cu + FeCl33CuCl2 + 2Fe = 3Cu + 2FeCl3
C+O2=CO2C + O2 = CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=H2O+CO2CH4 + 2O2 = 2H2O + CO2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
C6H6 + O2 = CO + H2O2C6H6 + 9O2 = 12CO + 6H2O
C4H10 + O2 = CO + H2O2C4H10 + 9O2 = 8CO + 10H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3(CH2)6CH3+O2=CO2+H2010CH3(CH2)6CH3 + 80O2 = 80CO2 + 9H20
CH3(CH2)2CH3+3O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CO + H2= CH3OHCO + 2H2 = CH3OH
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O = K2Cr2O7+FeSO4+H2SO4Cr2(SO4)3 + 3Fe2(SO4)3 + K2SO4 + 7H2O = K2Cr2O7 + 6FeSO4 + 7H2SO4
Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O = K2Cr2O7+FeSO4+H2SO4Cr2(SO4)3 + 3Fe2(SO4)3 + K2SO4 + 7H2O = K2Cr2O7 + 6FeSO4 + 7H2SO4
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C+AL2O3=AL2C3+CO6C + AL2O3 = AL2C3 + 3CO
CH3COOH (aq) + NaOH (aq) = CH3COONa (aq) + H2O (l)CH3COOH(aq) + NaOH(aq) = CH3COONa(aq) + H2O(l)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(s)+HNO3(aq)=Cu(NO3)2(aq)+NO2(g)+H2O(l)Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)
C3H8+O2=CO22+ H2OC3H8 + 35O2 = 3CO22 + 4H2O
C4H8 + 6O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H8 + 6O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C + O2 = CO2C + O2 = CO2
C4H8 + 6O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
CH4O+O2=CO2+H2O2CH4O + 3O2 = 2CO2 + 4H2O
C+O2=CO2C + O2 = 2CO
C5H10 + O2 = CO2 + H2O2C5H10 + 15O2 = 10CO2 + 10H2O
Cl2O3+H2O=HClO2Cl2O3 + H2O = 2HClO2
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CaCO3+HCl=CO2+CaCl2+H2OCaCO3 + 2HCl = CO2 + CaCl2 + H2O
CO2+SiC=SiO2+CCO2 + SiC = SiO2 + 2C
Ca3(PO4)2 + SiO2 + C = Ca(SiO3) + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6Ca(SiO3) + 10CO + P4
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H12O2 + O2 = CO2 +H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CH3OH + O2 = CO2 +H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3(CH2)2CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CH4 + O2 = CH2 + H2O2CH4 + O2 = 2CH2 + 2H2O
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C3H8O + O2 = C02 + H2O2C3H8O + 3O2 = 3C02 + 8H2O
C2H6+O2=2CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co(NO3)2+Na3PO4=Co3(PO4)2+NaNO33Co(NO3)2 + 2Na3PO4 = Co3(PO4)2 + 6NaNO3
C12H22O11 + 12O2 = 12CO2 + 11H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H3+O2 = CO2+H2O4C3H3 + 15O2 = 12CO2 + 6H2O
C3H3+O2 = CO2+H2O4C3H3 + 15O2 = 12CO2 + 6H2O
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaH2+H2O = Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaH2+H2O = Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H4O2+NaOH=NaC2H3O2+H2OC2H4O2 + NaOH = NaC2H3O2 + H2O
CO2+H2=CO+H2OCO2 + H2 = CO + H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaC2 + 6H2O + 3CO2 = Ca(OH)2 + 5CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
CH3CH3+O2=CO2+H2010CH3CH3 + 20O2 = 20CO2 + 3H20
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H12+4O2=CO2+4H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H8+9O2=5CO2+4H2OC5H8 + 7O2 = 5CO2 + 4H2O
C2H6 + O2=CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+HNO3=CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C+4 HNO3 = CO2 + 4 NO2 + 2 H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
CaO+HCl=CaCl2+H2OCaO + 2HCl = CaCl2 + H2O
Cu2S+ HNO3=Cu(NO3)2+CuSO4+NO2+H2OCu2S + 12HNO3 = Cu(NO3)2 + CuSO4 + 10NO2 + 6H2O
C6H10O + O2 = CO2 + H2O C6H10O + 8O2 = 6CO2 + 5H2O
Cl2 + O2 = Cl2O7 2Cl2 + 7O2 = 2Cl2O7
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cu2S + 2Fe(SO4)3 = 2CuSO4 + 4FeSO4 + SCu2S + Fe(SO4)3 = 2CuSO4 + FeSO4 + S
CO + H2 = CH3 OHCO + 2H2 = CH3OH
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H10 (g) + O2(g)= H2O(g) + CO2(g)2C2H10(g) + 9O2(g) = 10H2O(g) + 4CO2(g)
CO2+SiC=SiO2+CCO2 + SiC = SiO2 + 2C
CO+SiC=SiO2+C2CO + SiC = SiO2 + 3C
C+CO=CO2-1C + 2CO = CO2
C5 H10 + O2 = CO2 H2O2C5H10 + 15O2 = 10CO2H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C2H6(g) +O2(g) =CO2(g) +H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Co(NO3)2 + HNO2 = NO + Co(NO3)3 + H2OCo(NO3)2 + 4HNO2 = 3NO + Co(NO3)3 + 2H2O
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)6CH3+O2=CO2+H2010CH3(CH2)6CH3 + 80O2 = 80CO2 + 9H20
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C + O2 = CO2C + O2 = CO2
C2H6(g) + O2(g)=CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu(s) + HNO3(aq) = Cu(NO3)2(aq) + NO2(g) +H2O(l)Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)
C5H10O2 + O2 =CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CH3(CH2)2CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CaC2 O4+KMnO4+H2 SO4=CaSO4+MnSO4+K2 SO4+CO2+H2 O5CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + 2MnSO4 + K2SO4 + 10CO2 + 8H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
CO2 + Li2(O2) = Li2(CO3)+ O22CO2 + 2Li2(O2) = 2Li2(CO3) + O2
Ca(OH)2 + HCl = H2O + CaCl2Ca(OH)2 + 2HCl = 2H2O + CaCl2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaC2O4+KMnO4+H2SO4=CaSO4+MnSO4+K2SO4+CO2+H2O5CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + 2MnSO4 + K2SO4 + 10CO2 + 8H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+H2O=CO2+HC + 2H2O = CO2 + 4H
C2+H2O=CO2+H2C2 + 4H2O = 2CO2 + 4H2
C2+H2O=CO2+H2C2 + 4H2O = 2CO2 + 4H2
C18H34 + O2 = CO2 + H2O2C18H34 + 53O2 = 36CO2 + 34H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
CaCO3 + H2SO4 = CaSO4 + CO2 + H2OCaCO3 + H2SO4 = CaSO4 + CO2 + H2O
CaCO3 + H2SO4 = CaSO4 + CO2 + H2OCaCO3 + H2SO4 = CaSO4 + CO2 + H2O
CO2(g)+H2O(l)=C6H12O6(aq)+O26CO2(g) + 6H2O(l) = C6H12O6(aq) + 6O2
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C3H6O(l)+O2(g)=CO2(g)+H2O(l)C3H6O(l) + 4O2(g) = 3CO2(g) + 3H2O(l)
Cu(s)+AgNO3(aq)=Ag(s)+Cu(NO3)2(aq)Cu(s) + 2AgNO3(aq) = 2Ag(s) + Cu(NO3)2(aq)
Cu(NO3)2(aq)+NH3(aq)+H2O(l)=Cu(OH)2(s)+NH4NO3(aq)Cu(NO3)2(aq) + 2NH3(aq) + 2H2O(l) = Cu(OH)2(s) + 2NH4NO3(aq)
C6H12O6+CuO = Cu+CO2+H2OC6H12O6 + 12CuO = 12Cu + 6CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H6 + O2 = CO2 + 3H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4(g)+H2O(g)=CO(g)+H2(g)CH4(g) + H2O(g) = CO(g) + 3H2(g)
CH2(g)+H2O(g)=CO(g)+H2(g)CH2(g) + H2O(g) = CO(g) + 2H2(g)
CH3 (CH2)2 CH3+ O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Cu + HBr = CuBr + HCu + HBr = CuBr + H
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 6O2 = CO2 + 4H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 6O2 = CO2 + 4H2OCH4 + 2O2 = CO2 + 2H2O
C4H9OH+ O2= CO2+ H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C4H10 + O2= CO2 + H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H12O + O2 = H2O + CO22C5H12O + 15O2 = 12H2O + 10CO2
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca3(PO4)2+9SiO2+C=P4+CaSiO3+CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
C5H12(g)+O2(g)=CO2(g)+H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C3H8(g) + O2(g) = CO2(g) +H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CaC2 + H2O= Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH4(g) +O2(g) =CO2(g) +H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
Ca(OH)2 + NH4Cl = CaCl2 + H2O + NH3Ca(OH)2 + 2NH4Cl = CaCl2 + 2H2O + 2NH3
Cr2O3 + Na2CO3 + KNO3 = Na2CrO4 + CO2 + KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
Ca(OH)2 + NH4Cl = CaCl2 + H2O + NH3Ca(OH)2 + 2NH4Cl = CaCl2 + 2H2O + 2NH3
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca + H2O = Ca(HO)2 + H2Ca + 2H2O = Ca(HO)2 + H2
CrCl3+AgNO3=Cr(NO3)3+AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(NO3)2+NaI =CuI + I2 + NaNO32Cu(NO3)2 + 4NaI = 2CuI + I2 + 4NaNO3
Cr2O3 + Li2SO4 = Cr2(SO4)3 + Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
CaO + NH4Cl = 2NH3 + H2O + CaCl2CaO + 2NH4Cl = 2NH3 + H2O + CaCl2
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu+KNO3+H2SO4=CuSO4+NO+K2SO4+H2O3Cu + 2KNO3 + 4H2SO4 = 3CuSO4 + 2NO + K2SO4 + 4H2O
Cr2S3+Mn(NO3)2+Na2CO3=NO+CO2+Na2CrO4+NaMnO4+Na2SO4Cr2S3 + 30Mn(NO3)2 + 20Na2CO3 = 60NO + 20CO2 + 2Na2CrO4 + 30NaMnO4 + 3Na2SO4
C3H8O2 + O2 = CO2 + H2OC3H8O2 + 4O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 +H205C3H8 + 15O2 = 15CO2 + 2H20
CH4 + O2 = CO2 =H2OCH4 + 2O2 = CO2 + 2H2O
C6H12O6 + O2= CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C5H10O2+O2=5CO2+H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CuSO4 + H2O2 = O2 + H2SO3 + CuOCuSO4 + H2O2 = O2 + H2SO3 + CuO
CuCO3 + H2SO4 = CuSO4 + H2CO3CuCO3 + H2SO4 = CuSO4 + H2CO3
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3H8O2 + O2 = CO2 + H205C3H8O2 + 10O2 = 15CO2 + 2H20
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
C3H5(NO3)3=N2+O2+CO2+H22C3H5(NO3)3 = 3N2 + 3O2 + 6CO2 + 5H2
C3H5(NO3)3=N2+O2+CO2+H2O4C3H5(NO3)3 = 6N2 + O2 + 12CO2 + 10H2O
C3H5(NO3)3=N2+O2+CO2+H2O4C3H5(NO3)3 = 6N2 + O2 + 12CO2 + 10H2O
CH3(NO3)3=N2+O2+CO2+H2O4CH3(NO3)3 = 6N2 + 11O2 + 4CO2 + 6H2O
Ca + S + O4 = CaSO4Ca + S + O4 = CaSO4
Ca + SO4 = CaSO4Ca + SO4 = CaSO4
Cu+HNO3=Cu(NO3)2+H2O+NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + H3PO3 = H2O + Ca3(PO3)23Ca(OH)2 + 2H3PO3 = 6H2O + Ca3(PO3)2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H5(NO3)3 = CO2 + H2O + N2 + O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4 (OH2) +O2=CO2+H2OC2H4(OH2) + 3O2 = 2CO2 + 3H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H6 + H2 = C6H12C6H6 + 3H2 = C6H12
CH3CH2OH = O2 +H2O+ CH3COOHCH3CH2OH = -1O2 + H2O + CH3COOH
Cu + HNO3 = Cu(NO3)2 + H2O + NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
C3H5N3O9 = CO2 + O2 + N2 + H2O4C3H5N3O9 = 12CO2 + O2 + 6N2 + 10H2O
Cu(ClO4)2 + H2 = HClO4 + Cu22Cu(ClO4)2 + 2H2 = 4HClO4 + Cu2
CuSO4+NH3=CuNH3 + SO4CuSO4 + NH3 = CuNH3 + SO4
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2 + O2 = Cl2O72Cl2 + 7O2 = 2Cl2O7
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H8O6(aq) + I2(aq)= C6H6O6(aq) + HI(aq)C6H8O6(aq) + I2(aq) = C6H6O6(aq) + 2HI(aq)
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C6H10(g)+O2(g) = CO2(g)+H2O(g)2C6H10(g) + 17O2(g) = 12CO2(g) + 10H2O(g)
C6H12O6+ 9O2=C6H12O2C6H12O6 - 5O2 = 2C6H12O
C2H60 + NA2CR2O7 + H2SO4= C2H4O+CR2(SO4)3 + H2O + NA2SO43C2H60 + 29NA2CR2O7 + 116H2SO4 = 3C2H4O + 29CR2(SO4)3 + 200H2O + 29NA2SO4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.