Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CHI+O=IO+CO+H2O2CHI + 5O = 2IO + 2CO + H2O
CHI+O=IO+CO+H2O2CHI + 5O = 2IO + 2CO + H2O
CHI+O=IO+CO2+H2O2CHI + 7O = 2IO + 2CO2 + H2O
CHI+O=IO+CO2+HCHI + 3O = IO + CO2 + H
CHS+O=SO+CO+HCHS + 2O = SO + CO + H
CHN+O=NO+CO+HCHN + 2O = NO + CO + H
C3H8+O2=H2O +C3H8C3H8 + 0O2 = 0H2O + C3H8
CO2(g) + Li2O(s) = Li2CO3(s)CO2(g) + Li2O(s) = Li2CO3(s)
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cu+Cl2=CuCl2Cu + Cl2 = CuCl2
C4H8O+CaCO3 = CaO + H2O+CO20C4H8O + CaCO3 = CaO + 0H2O + CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuCl2+Na2S=NaCl+CuSCuCl2 + Na2S = 2NaCl + CuS
Ca(NO3)2 + H3PO4= Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca+AlCl3=CaCl2+Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CrCl3+KOH+KClO3=KCl+K2CrO4+H2O2CrCl3 + 10KOH + KClO3 = 7KCl + 2K2CrO4 + 5H2O
Ca(OH)2+Al2(So4)3=CaSo4+Al(OH)33Ca(OH)2 + Al2(So4)3 = 3CaSo4 + 2Al(OH)3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(NO3)2 +H3PO4 = Ca3(PO4)2 +HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CO2 + H2O = C6H12O6 + O66CO2 + 6H2O = C6H12O6 + 2O6
CH4(g)+O2(g)=CO2(g)+H2O(g) CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C2H6O + O2 = H2O + CO2C2H6O + 3O2 = 3H2O + 2CO2
Ca(C2H3O2)2 + O2 = Ca + H20 + CO210Ca(C2H3O2)2 + 20O2 = 10Ca + 3H20 + 40CO2
Ca(s)+Au(NO3)3(aq)= Ca(NO3)2(aq)+Au(s)3Ca(s) + 2Au(NO3)3(aq) = 3Ca(NO3)2(aq) + 2Au(s)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
CaCl2O + NaAsO2 + NaOH=CaCl2 + Na3AsO4 + H2O CaCl2O + NaAsO2 + 2NaOH = CaCl2 + Na3AsO4 + H2O
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
Cl2 + NH3 = N2H4 + NH4 ClCl2 + 4NH3 = N2H4 + 2NH4Cl
Cl2 + NH3 = N2H4 + NH4 ClCl2 + 4NH3 = N2H4 + 2NH4Cl
C2H3+O2=CO2+H2O4C2H3 + 11O2 = 8CO2 + 6H2O
C + K2Cr2O7 + H2SO4 = CO2 + K2SO4 + Cr2(SO4)3 + H2O3C + 2K2Cr2O7 + 8H2SO4 = 3CO2 + 2K2SO4 + 2Cr2(SO4)3 + 8H2O
Ca(OH)2 + NaOH + ClO2 + C = NaClO2 + CaCO3 + H2OCa(OH)2 + 4NaOH + 4ClO2 + C = 4NaClO2 + CaCO3 + 3H2O
C2H6+7O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C4H8 + O2 = CO + H2OC4H8 + 4O2 = 4CO + 4H2O
CaSO4 + AlCl3 = Al2(SO4)3 + CaCl23CaSO4 + 2AlCl3 = Al2(SO4)3 + 3CaCl2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H5(NO2)3=C+CO+H2+N22C7H5(NO2)3 = 2C + 12CO + 5H2 + 3N2
C2H6O+O2 = C2H4O2+H2OC2H6O + O2 = C2H4O2 + H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C2H6O(l)+O2(g)=C2H4O2(l)+H2OC2H6O(l) + O2(g) = C2H4O2(l) + H2O
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cr+H2S=Cr2S3+H22Cr + 3H2S = Cr2S3 + 3H2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H6 + 5O2 = 3CO2 + 4H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2Cl3OH + C6H5Cl = Cl5C14H9 + H2OC2Cl3OH + 2C6H5Cl = Cl5C14H9 + H2O
CuO + CH3CH2OH = Cu + CO2 + H2O6CuO + CH3CH2OH = 6Cu + 2CO2 + 3H2O
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
CrCl2 + H2O2 + KOH = K2CrO4 + KCl + H2OCrCl2 + 2H2O2 + 4KOH = K2CrO4 + 2KCl + 4H2O
CrCl2 + H2O2 + KOH = K2CrO4 + KCl + H2OCrCl2 + 2H2O2 + 4KOH = K2CrO4 + 2KCl + 4H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CCl3CHO + C6H5Cl = (ClC6H4)2CHCCl3 + H2OCCl3CHO + 2C6H5Cl = (ClC6H4)2CHCCl3 + H2O
C4H6 + 4O2 = 4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C4H6 + 11O2 = 4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Cu+HNO3=NO+Cu(NO3)2+H2O3Cu + 8HNO3 = 2NO + 3Cu(NO3)2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2 + Ba = Cl-1 + Ba2+Cl2 + 4Ba = 2Cl-1 + 2Ba2+
CH4+CO2= H2O+CO20CH4 + CO2 = 0H2O + CO2
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H12O6 +O2=CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CH4+CO2= H2O+CO20CH4 + CO2 = 0H2O + CO2
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO 2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3OH + I = CO2 + H20 + I0CH3OH + I = 0CO2 + 0H20 + I
CH3 + OH = CO2 + H204CH3 + 8OH = 4CO2 + H20
CH3OH + H= CO2 + H200CH3OH + 20H = 0CO2 + H20
CH3OH + 0H= CO2 + H200CH3OH + 20H = 0CO2 + H20
C2H6O + O2 = CO2 +H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H5OH+O2 = CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cr(No3)3+K3Po4=K(No3)+CrPo4Cr(No3)3 + K3Po4 = 3K(No3) + CrPo4
CH3 + OH=CO2 + H2OCH3 + 7OH = CO2 + 5H2O
CH3 + OH=CO2 + H2OCH3 + 7OH = CO2 + 5H2O
CH3 + OH=CO2 + H2OCH3 + 7OH = CO2 + 5H2O
C2H4 + O2=CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CaO + HCl = CaCl2 + H2OCaO + 2HCl = CaCl2 + H2O
CO + O2 = CO22CO + O2 = 2CO2
Ca + O2 = CaO2Ca + O2 = 2CaO
CO + O2 = CO22CO + O2 = 2CO2
Ca(s) + H2O = Ca(OH)2(aq) + H2(g)Ca(s) + 2H2O = Ca(OH)2(aq) + H2(g)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Ca3P2 + H2O = Ca (OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C4H10 + O2= CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaO+H2O = Ca(OH)2CaO + H2O = Ca(OH)2
Cu+HNO3=Cu(NO3)2 +NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C8H16 + O2 = CO2 + H2OC8H16 + 12O2 = 8CO2 + 8H2O
CCl3CHO+Ca(OH)2=CHCl3+(HCOO)2Ca2CCl3CHO + Ca(OH)2 = 2CHCl3 + (HCOO)2Ca
C(g) + H2(g) = CH 4 (g)C(g) + 2H2(g) = CH4(g)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca+AlCl3=CaCl2+Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2 + 5HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2 + 4HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2 + 3HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2 + 2HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2 + 1 HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H5OH+O2=2CO2+3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CH3OCH3 + AlCl3 = (CH3)2OAlCl3CH3OCH3 + AlCl3 = (CH3)2OAlCl3
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H12O6 + O2 = CO2 + H2O C6H12O6 + 6O2 = 6CO2 + 6H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
C6H14(l) + O2(g) = CO2(g) + H2O(l)2C6H14(l) + 19O2(g) = 12CO2(g) + 14H2O(l)
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cr2O3(s)+3H2S(g)=Cr2S3(s)+3H2O(l)Cr2O3(s) + 3H2S(g) = Cr2S3(s) + 3H2O(l)
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H8N2 + N2O4 = N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cr3(PO4)4 +Cu(SO3)=Cr2(SO3)4+Cu3(PO4)22Cr3(PO4)4 + 12Cu(SO3) = 3Cr2(SO3)4 + 4Cu3(PO4)2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cl2 + C2H2 = C2H2Cl42Cl2 + C2H2 = C2H2Cl4
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CdCO3 = CdO + CO2CdCO3 = CdO + CO2
CH3-COOH+KOH=H2O+CH3-COOKCH3-COOH + KOH = H2O + CH3-COOK
CH3(CH2)3COOH+O2=CO2+H2O2CH3(CH2)3COOH + 13O2 = 10CO2 + 10H2O
C6H12O6 + 3O2=6H2O + 6CO2C6H12O6 + 6O2 = 6H2O + 6CO2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cr(OH)4 + H2O2 = CrO4 + H2OCr(OH)4 + 2H2O2 = CrO4 + 4H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO+H2O2C8H18 + 17O2 = 16CO + 18H2O
CO+O2=CO22CO + O2 = 2CO2
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C4H10 + O2 = H2O + CO22C4H10 + 13O2 = 10H2O + 8CO2
Cu + AgNO3 = Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaCl2 + Na3PO4 = Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C+ Cl2=CCl4C + 2Cl2 = CCl4
Ca+H2SO4=CaSO4+H2Ca + H2SO4 = CaSO4 + H2
C3H6 + O2 = CO2 +H6C3H6 + 3O2 = 3CO2 + H6
CS2 + O2 = SO2 + CO2CS2 + 3O2 = 2SO2 + CO2
C3H5(NO3)3=CO2+H2O+N2+O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
C3H6 + O2 = CO2 +H6C3H6 + 3O2 = 3CO2 + H6
C8H9NO2 + Al + CH3COOH = C9H13N + Al(CH3COO)3 + H2O6C8H9NO2 + 16Al + 51CH3COOH = 6C9H13N + 16Al(CH3COO)3 + 18H2O
C8H9NO2 + Al + CH3COOH = C9H13N + Al(CH3COO)3 + H2O6C8H9NO2 + 16Al + 51CH3COOH = 6C9H13N + 16Al(CH3COO)3 + 18H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cr2(SO4) + KClO3 + KOH = K2CrO4 +KCl + K2SO4 + H2O3Cr2(SO4) + 5KClO3 + 18KOH = 6K2CrO4 + 5KCl + 3K2SO4 + 9H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Ca(OH)2 + HCl = CaCl2 + H2O Ca(OH)2 + 2HCl = CaCl2 + 2H2O
Cu + O2 = CuO2Cu + O2 = CuO2
Cu + AgNO3 = CuNO3 + AgCu + AgNO3 = CuNO3 + Ag
CoCl2+NaOH+NaClO3=NaCl+Co2O3+H2O6CoCl2 + 12NaOH + NaClO3 = 13NaCl + 3Co2O3 + 6H2O
Cu + HCl = CuCl + HCu + HCl = CuCl + H
Cu(NO3)2 + NaOH = CuOH + Na(NO3)2Cu(NO3)2 + NaOH = CuOH + Na(NO3)2
CuSO4 + NaOH = CuOH + NaSO4CuSO4 + NaOH = CuOH + NaSO4
Ca + H2O = H + CaO2Ca + 2H2O = 4H + CaO2
CaOH + HCl = CaCl + H2OCaOH + HCl = CaCl + H2O
CaOH + HCl = CaCl + H2OCaOH + HCl = CaCl + H2O
C6H7O7 + O2 = C6H7O82C6H7O7 + O2 = 2C6H7O8
CrCl3 + NaOH= Cr(OH)3+ NaCl CrCl3 + 3NaOH = Cr(OH)3 + 3NaCl
CrCl3 + NaOH+ Cl2= Na2CrO4+ NaCl + H2O2CrCl3 + 16NaOH + 3Cl2 = 2Na2CrO4 + 12NaCl + 8H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO+O=COCO + 0O = CO
CuS+HNO3=Cu(NO3)2+S+H2O+NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
Ca3(PO4)2 + H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
Ca3(PO4)2 + H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
Ca(NO3)2 + H3PO4 =Ca3(PO4)2 + HNO3 3Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
CaCO3+(NH4)2HPO4+H2O=Ca10(PO4)6(OH)2+(NH4)2CO3+H2CO310CaCO3 + 6(NH4)2HPO4 + 2H2O = Ca10(PO4)6(OH)2 + 6(NH4)2CO3 + 4H2CO3
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
C6H12O6=C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
CuS+HNO3=Cu(NO3)2+S+H2O+NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C+HNO3=CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
CH4 + H2O = CO + 3H2 CH4 + H2O = CO + 3H2
CH4 + 3H2O =CO + H2 CH4 + H2O = CO + 3H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
C2H5OH+O2=2CO2+2H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C5H5OH+O2=CO2+H2OC5H5OH + 6O2 = 5CO2 + 3H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CH3(CH2)7CH3+O2=CO2+H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
CH4(g) + O2(g) = CO2(g) + H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
CH3NH2+H2O=CH3NH3+OHCH3NH2 + H2O = CH3NH3 + OH
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
CH3CO2H+NaHCO3=NaCH3CO2+CO2+H2OCH3CO2H + NaHCO3 = NaCH3CO2 + CO2 + H2O
CH3CO2H+NaHCO3=NaCH3CO2+CO2+H2OCH3CO2H + NaHCO3 = NaCH3CO2 + CO2 + H2O
Cr2S3 + Mn(NO3)2 + Na2CO3 = NO + CO2 + Na2CrO4 + Na2MnO4 + Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
Ca + HNO3 = CaNO3 + HCa + HNO3 = CaNO3 + H
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CCl3CHO + C6H5Cl = (ClC6H4)2CHCCl3 + H2O CCl3CHO + 2C6H5Cl = (ClC6H4)2CHCCl3 + H2O
Cl2(g)+KOH(aq)=KClO3(aq)+KCl(aq)+H2O(l)3Cl2(g) + 6KOH(aq) = KClO3(aq) + 5KCl(aq) + 3H2O(l)
Cl(g)+KOH(aq)=KClO3(aq)+KCl(aq)+H2O(l)6Cl(g) + 6KOH(aq) = KClO3(aq) + 5KCl(aq) + 3H2O(l)
CH4 + Cl2 = CH2Cl2 + HClCH4 + 2Cl2 = CH2Cl2 + 2HCl
Cu + HNO3 = Cu(NO4)2 + NO2 + H2OCu + 8HNO3 = Cu(NO4)2 + 6NO2 + 4H2O
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca(OH)2 + 2 HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(HCO3)2 + HCl = CaCl2+ CO2 + H2OCa(HCO3)2 + 2HCl = CaCl2 + 2CO2 + 2H2O
Ca(HCO3)2 + HCl = CaCl2+ CO2 + H2OCa(HCO3)2 + 2HCl = CaCl2 + 2CO2 + 2H2O
CH3OH+PCl5=CH3Cl+POCl3+H2O2CH3OH + PCl5 = 2CH3Cl + POCl3 + H2O
CH4+SO2=CS2+H2O+CO23CH4 + 4SO2 = 2CS2 + 6H2O + CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(HCO3)2 + HCl = CaCl2 + CO2+ H2OCa(HCO3)2 + 2HCl = CaCl2 + 2CO2 + 2H2O
Ca + H2(SO4) = Ca(SO4) + H2Ca + H2(SO4) = Ca(SO4) + H2
CH3OH+PCl5=CH3Cl+POCl3+H2O2CH3OH + PCl5 = 2CH3Cl + POCl3 + H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
C2H4 (g) +O2 (g)=CO2 (g) +H2O (l)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(l)
C6H12O6 + O2 =CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO2 + H2O = C2H5OH + O22CO2 + 3H2O = C2H5OH + 3O2
CaO+HCl=CaCl2+H2OCaO + 2HCl = CaCl2 + H2O
CaCO3+HNO3=Ca(NO3)2+H2O+CO2CaCO3 + 2HNO3 = Ca(NO3)2 + H2O + CO2
C12H22O11 + H2O = C2H6 + CO27C12H22O11 - 5H2O = 24C2H6 + 36CO2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH3(CH2)CH3+O2=CO2+H205CH3(CH2)CH3 + 15O2 = 15CO2 + 2H20
C6H12O6+KMnO4=H2O+CO2+KOH+MnOHC6H12O6 + 4KMnO4 = 2H2O + 6CO2 + 4KOH + 4MnOH
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca (OH)2+HNO3=Ca (NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CaCl2 + H2SO4 = CaSO4 + HClCaCl2 + H2SO4 = CaSO4 + 2HCl
C2H3F3+O2=CO+H2O+F24C2H3F3 + 7O2 = 8CO + 6H2O + 6F2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C3H8+O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuS + O2 = Cu2O + SO24CuS + 5O2 = 2Cu2O + 4SO2
CaCO3 = CO2 + CaOCaCO3 = CO2 + CaO
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H8+10O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuS + O2 = Cu2O + SO24CuS + 5O2 = 2Cu2O + 4SO2
C2H4O + KMnO4 + KOH = C2H3O2K + MnO2 + H2O3C2H4O + 2KMnO4 + KOH = 3C2H3O2K + 2MnO2 + 2H2O
CaCO3+HBr=CaBr2+H2O+CO2CaCO3 + 2HBr = CaBr2 + H2O + CO2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaO+HCl=CaCl2+H2OCaO + 2HCl = CaCl2 + H2O
CaO+HCl=CaCl2+H2OCaO + 2HCl = CaCl2 + H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C3H8+O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaSO4+Ga=Ga2(SO4)3+Ca3CaSO4 + 2Ga = Ga2(SO4)3 + 3Ca
CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CuCO3 + NaOH = Cu(OH)2 + Na2CO3CuCO3 + 2NaOH = Cu(OH)2 + Na2CO3
Cl-1+Mg(OH)2=Cl-1(OH)2+MgCl-1 + Mg(OH)2 = Cl-1(OH)2 + Mg
Cu+S=Cu2S2Cu + S = Cu2S
CCi4+2HF=CCi2F2+2HCiCCi4 + 2HF = CCi2F2 + 2HCi
C2H3OCi+O2=8CO+6H2O+Ci24C2H3OCi + 5O2 = 8CO + 6H2O + 2Ci2
C2H3OCi+O2=8CO+6H2O+Ci24C2H3OCi + 5O2 = 8CO + 6H2O + 2Ci2
C2H3OCi+O2=8CO+6H2O+Ci24C2H3OCi + 5O2 = 8CO + 6H2O + 2Ci2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H8O2+ O2= H2O+ CO2C4H8O2 + 5O2 = 4H2O + 4CO2
C5H12 + O2 = H2O + CO2C5H12 + 8O2 = 6H2O + 5CO2
C5H12 + O2 = H2O + CO2C5H12 + 8O2 = 6H2O + 5CO2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cr2O3 + KNO3 + KOH = KNO2 + K2CrO4 + H2OCr2O3 + 3KNO3 + 4KOH = 3KNO2 + 2K2CrO4 + 2H2O
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H12 + O2 = CO2 +H2OC6H12 + 9O2 = 6CO2 + 6H2O
CaCO3+ 2HCl = CaCl2+ H2O+ CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C2H6 + O2 = CO + H2O2C2H6 + 5O2 = 4CO + 6H2O
CuCl2+Na2S=Na2Cl2+CuSCuCl2 + Na2S = Na2Cl2 + CuS
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
CH3CH2CH2OH + H2CrO4 = CH3CH2CHO + Cr + H2O3CH3CH2CH2OH + H2CrO4 = 3CH3CH2CHO + Cr + 4H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C12H24O11+O2=CO2+H2O2C12H24O11 + 25O2 = 24CO2 + 24H2O
C12H24O11+O2=CO2+H2010C12H24O11 + 65O2 = 120CO2 + 12H20
C12H24O11+O2=CO2+H2010C12H24O11 + 65O2 = 120CO2 + 12H20
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2(aq) = Ca+2 + OH-1Ca(OH)2(aq) = Ca+2 + 2OH-1
CO2 +NH2OH = CO +N2 + H2OCO2 + 2NH2OH = CO + N2 + 3H2O
CO2 +NH2OH = CO +N2 + H2OCO2 + 2NH2OH = CO + N2 + 3H2O
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C2H4 +O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH3 (CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C5H12+ O2= CO2+ H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH4 + H2O =CO + 3H2 CH4 + H2O = CO + 3H2
CuCl2+Na2S=Na2Cl2+CuSCuCl2 + Na2S = Na2Cl2 + CuS
CuCl2+Na2S=Na2Cl2+CuSCuCl2 + Na2S = Na2Cl2 + CuS
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CaCl+O2=CaO+Cl22CaCl + O2 = 2CaO + Cl2
CaCl+O2=CaO+Cl22CaCl + O2 = 2CaO + Cl2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuCl + Al = AlCl3 + Cu3CuCl + Al = AlCl3 + 3Cu
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO3+H2O2C2H6 + 9O2 = 4CO3 + 6H2O
C2H6+3O2=CO3+3H2O2C2H6 + 9O2 = 4CO3 + 6H2O
Cr(OH)2+H2CO3=Cr2(CO3)2+H2O2Cr(OH)2 + 2H2CO3 = Cr2(CO3)2 + 4H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CO2+2KOH=K2CO3+H2OCO2 + 2KOH = K2CO3 + H2O
CO2+2KOH=K2CO3+H2OCO2 + 2KOH = K2CO3 + H2O
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CH4(g) + O2(g) = CO2(g) + H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C3H8+5O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H2+2O2=2CO2=H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C+2H2 =CH4C + 2H2 = CH4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca+O=CaOCa + O = CaO
CaO=Ca2O22CaO = Ca2O2
C12H22O11+8KCLO3=8KCL+12CO2+11H2OC12H22O11 + 8KCLO3 = 8KCL + 12CO2 + 11H2O
C2H6 + O2= CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2OH (l)+ 3O2 (g) = 3 H2O (l) + 2CO2 (g)CH3CH2OH(l) + 3O2(g) = 3H2O(l) + 2CO2(g)
CH3CH2COOH + O2= H20 + CO210CH3CH2COOH + 20O2 = 3H20 + 30CO2
C7H16+11O2=7CO2+8H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C18H36O2+54O2=18CO2+18H2OC18H36O2 + 26O2 = 18CO2 + 18H2O
CuO + H2SO4 = SO2 + CuSO4 + H2OCuO + H2SO4 = 0SO2 + CuSO4 + H2O
CuO + H2SO4 = SO2 + CuSO4 + H2OCuO + H2SO4 = 0SO2 + CuSO4 + H2O
Cu2O + H2SO4 = SO2 + CuSO4 + H2OCu2O + 3H2SO4 = SO2 + 2CuSO4 + 3H2O
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CaCl2 + KOH = Ca(OH)2 + KClCaCl2 + 2KOH = Ca(OH)2 + 2KCl
CaCl2 + KOH = Ca(OH)2 + KClCaCl2 + 2KOH = Ca(OH)2 + 2KCl
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C2H4+O2=CO2+H205C2H4 + 10O2 = 10CO2 + H20
Cl2 + Al = AlCl33Cl2 + 2Al = 2AlCl3
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Cu+O2=CuO2Cu + O2 = 2CuO
C2H6O2+O2=H2O+CO22C2H6O2 + 5O2 = 6H2O + 4CO2
CuSO4 +NaCl = CuCl + Na2SO4 + CuCl0CuSO4 + 0NaCl = -1CuCl + 0Na2SO4 + CuCl
CrO3 = Cr2O3 + O24CrO3 = 2Cr2O3 + 3O2
C2H3OF+ O2 = CO2 + H2O + 2F24C2H3OF + 9O2 = 8CO2 + 6H2O + 2F2
CaCl2 + Na2Co3 = CaCo3 + NaClCaCl2 + Na2Co3 = CaCo3 + 2NaCl
Ca(SO4)+Ni3(PO3)2=Ni(SO4)+Ca3(PO3)23Ca(SO4) + Ni3(PO3)2 = 3Ni(SO4) + Ca3(PO3)2
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
CHBr3+O3 = CO2+HBr+O20CHBr3 + 2O3 = 0CO2 + 0HBr + 3O2
CHBr3+O3 = CO2+H2O+HBr3CHBr3 + O3 = 3CO2 - 3H2O + 9HBr
CHCl3+O3 = CO2+H2O+HCl3CHCl3 + O3 = 3CO2 - 3H2O + 9HCl
CHF3+O3 = CO2+H2O+HF3CHF3 + O3 = 3CO2 - 3H2O + 9HF
CHF3 + O3 = CO2 + H2O + HF3CHF3 + O3 = 3CO2 - 3H2O + 9HF
CHF3 + O3 = CO2 + H2O + HF3CHF3 + O3 = 3CO2 - 3H2O + 9HF
CHF3 + O3 = CO2 + H2O + HF3CHF3 + O3 = 3CO2 - 3H2O + 9HF
Cu (NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
C2H6 + O2 = CO + H2O 2C2H6 + 5O2 = 4CO + 6H2O
C2H6(g) + O2(g) = CO(g) + H2O(g) 2C2H6(g) + 5O2(g) = 4CO(g) + 6H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2OH+NO3-=CO2+N2+H2O+OH-5CH3CH2OH + 12NO3- = 10CO2 + 6N2 + 9H2O + 12OH-
CH3OH+NO3-=CO2+N2+H2O+OH-5CH3OH + 6NO3- = 5CO2 + 3N2 + 7H2O + 6OH-
CaCO3= CaO+CO2CaCO3 = CaO + CO2
Ca3(PO4)2+H2SO4=H3PO4+CaSO4Ca3(PO4)2 + 3H2SO4 = 2H3PO4 + 3CaSO4
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Cr + O2 = Cr2O34Cr + 3O2 = 2Cr2O3
C6H12O6=C2H6O+CO2C6H12O6 = 2C2H6O + 2CO2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H4 +O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 +O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cl-+H2O=OH-+HClCl- + H2O = OH- + HCl
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C6H12O6=C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cl2O3+H2O=HClO2Cl2O3 + H2O = 2HClO2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CoSO4 + KI + KIO3 + H2O = Co(OH)2 + K2SO4 + I23CoSO4 + 5KI + KIO3 + 3H2O = 3Co(OH)2 + 3K2SO4 + 3I2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CoSO4 + KI + KIO3 + H2O = Co(OH)2 + K2SO4 + I23CoSO4 + 5KI + KIO3 + 3H2O = 3Co(OH)2 + 3K2SO4 + 3I2
CaCl2+2Li=Li2Cl+CaCaCl2 + 4Li = 2Li2Cl + Ca
CaCl2+ Al(C2H3O2)3= Ca(C2H3O2)2+ AlCl33CaCl2 + 2Al(C2H3O2)3 = 3Ca(C2H3O2)2 + 2AlCl3
C5H12(l)+5O2 (g)=5CO2 (g)+6H2(g)C5H12(l) + 5O2(g) = 5CO2(g) + 6H2(g)
CH3COOH + KOH = H20 + KCOOH5CH3COOH + 10KOH = H20 + 10KCOOH
CaCl2+Al(C2H3O2)3=Ca(C2H3O2)2+AlCl33CaCl2 + 2Al(C2H3O2)3 = 3Ca(C2H3O2)2 + 2AlCl3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(NO3)2 + H3PO4 =Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca(HCO3)2+C2H4O2 = Ca(C2H3O2)2+CO2+H2OCa(HCO3)2 + 2C2H4O2 = Ca(C2H3O2)2 + 2CO2 + 2H2O
Ca(HCO3)2+C2H4O2 = Ca(C2H3O2)2+CO2+H2OCa(HCO3)2 + 2C2H4O2 = Ca(C2H3O2)2 + 2CO2 + 2H2O
Ca(NO3)2 + H3PO4 =Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C+O2=CO2C + O2 = CO2
Ca(OH)2 + Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
CH4+NH3=H2+C2N22CH4 + 2NH3 = 7H2 + C2N2
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
Ca(NO3)2+H3PO4=Ca3(PO4)2+HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca(OH)2 + HCl = H2O + CaCl2Ca(OH)2 + 2HCl = 2H2O + CaCl2
Cr + O2 = Cr2O34Cr + 3O2 = 2Cr2O3
C4H12+O2=CO2+H2OC4H12 + 7O2 = 4CO2 + 6H2O
CH3COOH+LiOH=H2O+LiC2H3O2CH3COOH + LiOH = H2O + LiC2H3O2
C4H12+O2=CO2+H2OC4H12 + 7O2 = 4CO2 + 6H2O
CH3(CH2)5CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)5CH3(l) + 11O2(g) = 7CO2(g) + 8H2O(g)
CH3CH3(g)+O2(g)=CO2(g)+H20(g)10CH3CH3(g) + 20O2(g) = 20CO2(g) + 3H20(g)
C2H5OH+O2= CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2010C2H6 + 20O2 = 20CO2 + 3H20
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CO2 (g)= C(s) + O2(g)CO2(g) = C(s) + O2(g)
CaO + CO2 = CaCO3CaO + CO2 = CaCO3
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2=H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + Al2(SO4)3=CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
C3H6+O2=H2O+CO22C3H6 + 9O2 = 6H2O + 6CO2
CuCO3+HNO3=Cu(NO3)2+CO2+H2OCuCO3 + 2HNO3 = Cu(NO3)2 + CO2 + H2O
C3H4+O2=CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
C5H8+O2=CO2+H2OC5H8 + 7O2 = 5CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca + Au(NO3)3 = Ca(NO3)2 + Au3Ca + 2Au(NO3)3 = 3Ca(NO3)2 + 2Au
Cr2O3 + Si = Cr + SiO22Cr2O3 + 3Si = 4Cr + 3SiO2
C+Fe2O3= Fe+CO3C + Fe2O3 = 2Fe + 3CO
Ca+H2O= Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H12+O2= CO2 +H205C6H12 + 30O2 = 30CO2 + 3H20
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuFeS2(s) + O2(g) =Cu2S(s) + FeO(s) + SO2(g)2CuFeS2(s) + 4O2(g) = Cu2S(s) + 2FeO(s) + 3SO2(g)
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
C3H6(g) + O2(g) = CO2(g) + H2O(g) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cr2O3+NaNO3+Na2CO3=Na2CrO4+NaNO2+CO2Cr2O3 + 3NaNO3 + 2Na2CO3 = 2Na2CrO4 + 3NaNO2 + 2CO2
CaC2O4+KMnO4+H2SO4=CaSO4+MnSO4+K2SO4+CO2+H2O5CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + 2MnSO4 + K2SO4 + 10CO2 + 8H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cu3(PO4)2 + 3Li2SO4 = 3CuSO4 + 2Li3PO4Cu3(PO4)2 + 3Li2SO4 = 3CuSO4 + 2Li3PO4
Cu3(PO4)2 + 2Li2SO4 = 2CuSO4 + 3Li3PO4Cu3(PO4)2 + 3Li2SO4 = 3CuSO4 + 2Li3PO4
CH3(CH2)3CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)3CH3(l) + 8O2(g) = 5CO2(g) + 6H2O(g)
Cr2O3+H2O=Cr(OH)3Cr2O3 + 3H2O = 2Cr(OH)3
C6H14+O2=H2O+CO22C6H14 + 19O2 = 14H2O + 12CO2
CuSO4+H2O+HNO3=Cu+H2SO4+HNO4CuSO4 + H2O + HNO3 = Cu + H2SO4 + HNO4
CuSO4+H2O+HCL=Cu+H2SO4+HCLOCuSO4 + H2O + HCL = Cu + H2SO4 + HCLO
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CuSO4+H2O+HCL=Cu+H2SO4+OHCLCuSO4 + H2O + HCL = Cu + H2SO4 + OHCL
C2H4O2 + O2 = CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
Cr2O3 + Na2CO3 + KNO3 = Na2CrO4 + CO2 + KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
Cr+Fe(NO3)2=Fe+Cr(NO3)32Cr + 3Fe(NO3)2 = 3Fe + 2Cr(NO3)3
C3H3+O2=CO2+H2O4C3H3 + 15O2 = 12CO2 + 6H2O
C2H5OH+Na2Cr2O7+H2SO4=CH3COOH+Cr2(SO4)3+Na2SO4+H2O3C2H5OH + 2Na2Cr2O7 + 8H2SO4 = 3CH3COOH + 2Cr2(SO4)3 + 2Na2SO4 + 11H2O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
C7H9(NO2)3=C+CO+H2+N22C7H9(NO2)3 = 2C + 12CO + 9H2 + 3N2
C7H9(NO2)3=C+CO+H2+N22C7H9(NO2)3 = 2C + 12CO + 9H2 + 3N2
Co+NH+NH3+02=H20+Co(NH3)65Co + 30NH + 0NH3+02 = -3H20 + 5Co(NH3)6
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CH3(CH2)6CH3(g)+O2(g)= CO2(g)+H2O(g)2CH3(CH2)6CH3(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
CH3(CH2)7CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)7CH3(l) + 14O2(g) = 9CO2(g) + 10H2O(g)
C(s)+H2(g)=C2H6(g)2C(s) + 3H2(g) = C2H6(g)
Cr(NO3)3 + ZnCl2 = CrCl2+ Zn(NO3)3Cr(NO3)3 + ZnCl2 = CrCl2 + Zn(NO3)3
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C(s) + O2(g) = CO(g)2C(s) + O2(g) = 2CO(g)
CH4(g) + O2(g) =CO2(g) + H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
CaO+MnI4=MnO2+CaI22CaO + MnI4 = MnO2 + 2CaI2
C+H2=C3H83C + 4H2 = C3H8
C+H2O=CO+H2C + H2O = CO + H2
C+H2O=CO+H2C + H2O = CO + H2
C6H6+O2 = H2O + CO22C6H6 + 15O2 = 6H2O + 12CO2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4(g)+H2O(g) = CO(g)+H2(g)CH4(g) + H2O(g) = CO(g) + 3H2(g)
C3H8+ O2= CO2 + H2C3H8 + 3O2 = 3CO2 + 4H2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Ca3(PO4)2 + H2SO4 = CaH4(PO4)2 + CaSO4Ca3(PO4)2 + 2H2SO4 = CaH4(PO4)2 + 2CaSO4
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.