Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C7H12 + H+ + MnO4- = H2O + C7O2H12 + MnO23C7H12 + 4H+ + 4MnO4- = 2H2O + 3C7O2H12 + 4MnO2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C4H8O2 + Na2CO3 =Na(C3H7COO) + H2O + CO22C4H8O2 + Na2CO3 = 2Na(C3H7COO) + H2O + CO2
CaCo3+H2O2=CaO+H2O+Co22CaCo3 + 2H2O2 = 2CaO + 2H2O + 3Co2
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cr2O7-- + SO3-- + H+ = Cr+++ + SO4-- + H2OCr2O7-- + 3SO3-- + 8H+ = 2Cr+++ + 3SO4-- + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca+2HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
CuS + HNO3 = Cu(NO3)2 + NO + S + H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 3S + 4H2O
C6 + 6H2O = 6O2 + 6C6H12O6C6 + 6H2O = 0O2 + C6H12O6
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
Cl2 + KI = KCl + ICl2 + 2KI = 2KCl + 2I
CuS+HNO3=Cu(NO3)2+S+NO+H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 2NO + 4H2O
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cl2O3 + H2O=HClO2Cl2O3 + H2O = 2HClO2
C3H6 + O2=CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C6H12O6 = C + H2OC6H12O6 = 6C + 6H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CdCO3 = CdO + CO2CdCO3 = CdO + CO2
CO2 + Ca(OH)2 = CaCO3 + H2OCO2 + Ca(OH)2 = CaCO3 + H2O
CH3CH2OH + O2 = H2O+ CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C6H12O6 + K2Cr2O7 + H2SO4 = CO2 + H2O + Cr2(SO4)3 + K2SO4C6H12O6 + 4K2Cr2O7 + 16H2SO4 = 6CO2 + 22H2O + 4Cr2(SO4)3 + 4K2SO4
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8 +O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CaO3 = CaO + CaO2CaO3 = -1CaO + 2CaO2
Cu + HNO3 = Cu(NO3)2 + H2O + NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
Cu + HNO3 = Cu(NO3)2 + H2O + NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO2 +H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CaC2 + H2O = C2H2 + Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH3CHO+O2=CO2+H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
Ca(NO3)2(aq) + Na3PO4(aq)= Ca3(PO4)2(s) + NaNO3(aq)3Ca(NO3)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaNO3(aq)
CoBr3(aq) + Pb(NO3)2(aq)= Co(NO3)3(aq) + PbBr2(s)2CoBr3(aq) + 3Pb(NO3)2(aq) = 2Co(NO3)3(aq) + 3PbBr2(s)
C4H10(g) + O2(g)= CO2(g) + H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
CrCl3(aq) + AgNO3(aq)= Cr(NO3)3(aq) + AgCl(s)CrCl3(aq) + 3AgNO3(aq) = Cr(NO3)3(aq) + 3AgCl(s)
CH3(CH2)2CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH3(CH2)2CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6O2H6 + C6O3H10= C10O2H8+H2O4C6O2H6 + C6O3H10 = 3C10O2H8 + 5H2O
CH4+O2=CO2+H2CH4 + O2 = CO2 + 2H2
Cu+3HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+3HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+3HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C6 H12 O6 + O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C5H12O+O2=CO2+H2O2C5H12O + 15O2 = 10CO2 + 12H2O
C4H10(g) + O2(g)= CO2(g) + H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C5H10O5+O2=CO2+H2OC5H10O5 + 5O2 = 5CO2 + 5H2O
C3H5(NO3)3=CO2+H2O+N2+O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
Cu2O+C=Cu+COCu2O + C = 2Cu + CO
Cu + H2SO4 = CuSO4 + H2O + SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
Cu + H2SO4 = CuSO4 + H2O + SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
CaSiO3 + HF = H2SiF6 + CaF2 + H2OCaSiO3 + 8HF = H2SiF6 + CaF2 + 3H2O
CH3(CH2)3CH(C2H5)CO2H + NaOH = CH3(CH2)3CH(C2H5)CO2Na +H2OCH3(CH2)3CH(C2H5)CO2H + NaOH = CH3(CH2)3CH(C2H5)CO2Na + H2O
CuO +NH3 = Cu +H2O +N23CuO + 2NH3 = 3Cu + 3H2O + N2
Ca3(PO4)2 + SiO2 = P4O10 + CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
C5H12 + O2 =CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CuCO3+O2=CuO+CO2CuCO3 + 0O2 = CuO + CO2
Cu+HNO3=Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
Cu+HNO3=Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
CuCO3+O2=CuO+CO2CuCO3 + 0O2 = CuO + CO2
Cu(OH)2 + H3PO4 = Cu3(PO4) 2 + 6H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
Cu(OH)2 + H3PO4 = Cu3(PO4) 2 + 6H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
CH4+O2=CO2+H2CH4 + O2 = CO2 + 2H2
CaO+SiO2=CaSiO3CaO + SiO2 = CaSiO3
Cu+O2=CuO2Cu + O2 = 2CuO
CaCO3+SO2=CaSO3+CO2CaCO3 + SO2 = CaSO3 + CO2
CaCO3+SO2=CaSO3+CO2CaCO3 + SO2 = CaSO3 + CO2
Ca2(SO4)2 + HCl = CaCl2 + H2SO4Ca2(SO4)2 + 4HCl = 2CaCl2 + 2H2SO4
Cu(NO3)2 + NaOH = Cu(OH)2 + NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
C5H12+8O2=5CO2+6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H5NS+2CuO = CO2+CN+S+2Cu+5HC2H5NS + 2CuO = CO2 + CN + S + 2Cu + 5H
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C10H20 + O2 = CO2 + H2OC10H20 + 15O2 = 10CO2 + 10H2O
C5H12+ O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C17H29CO2CH3+O2=H2O+CO2C17H29CO2CH3 + 26O2 = 16H2O + 19CO2
C15H31CO2CH3+O2=H2O+CO22C15H31CO2CH3 + 49O2 = 34H2O + 34CO2
C17H29CO2CH3+O2=H2O+CO2C17H29CO2CH3 + 26O2 = 16H2O + 19CO2
C17H31CO2CH3+O2=H2O+CO22C17H31CO2CH3 + 53O2 = 34H2O + 38CO2
C17H35CO2CH3+O2=H2O+CO22C17H35CO2CH3 + 55O2 = 38H2O + 38CO2
C17H31CO2CH3+O2=H2O+CO22C17H31CO2CH3 + 53O2 = 34H2O + 38CO2
C17H33CO2CH3+O2=H2O+CO2C17H33CO2CH3 + 27O2 = 18H2O + 19CO2
CuSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Cu(NO3)2(aq)CuSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Cu(NO3)2(aq)
CuSO4+AgNO3=Ag2SO4+Cu(NO3)2CuSO4 + 2AgNO3 = Ag2SO4 + Cu(NO3)2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C17H35CO2CH3+O2=H2O+CO22C17H35CO2CH3 + 55O2 = 38H2O + 38CO2
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CuSO4+Fe=FeSO4+CuCuSO4 + Fe = FeSO4 + Cu
C2H4(g) + H2O(l) = C2H5OH(l) C2H4(g) + H2O(l) = C2H5OH(l)
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
C6H12O6=CO2+C2H6OC6H12O6 = 2CO2 + 2C2H6O
C8H16 + O2 = H2O + CO2C8H16 + 12O2 = 8H2O + 8CO2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C2H4O + O2 = C2H4O2 2C2H4O + O2 = 2C2H4O2
CH6N2O+H2SO4=CH4N2S+H2O+2O22CH6N2O + 2H2SO4 = 2CH4N2S + 4H2O + 3O2
CH4O + CO = C2H4O2 CH4O + CO = C2H4O2
CH3O + CO = C2H4O2 4CH3O + 2CO = 3C2H4O2
C2H6O + O2 = C2H4O2+ H2O C2H6O + O2 = C2H4O2 + H2O
C2H6 + O2 = C2H4O2+ H2O 2C2H6 + 3O2 = 2C2H4O2 + 2H2O
C2H4O + O2 = C2H4O2 2C2H4O + O2 = 2C2H4O2
C4H8 + O2 = C2H4O2 C4H8 + 2O2 = 2C2H4O2
C4H8 + CO2 = C2H4O2 + CH2O2-1C4H8 + 0CO2 = -4C2H4O2 + 4CH2O2
C4H8 + CO = C2H4O2 + CH2O2-1C4H8 + 0CO = -4C2H4O2 + 4CH2O2
C4H8 + O2 = C2H4O2 C4H8 + 2O2 = 2C2H4O2
C4H8 + O2 = C2H4O2 C4H8 + 2O2 = 2C2H4O2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O2 = C2H4O2 + H2O2C4H10 + 5O2 = 4C2H4O2 + 2H2O
C2H4 + O2 = C2H4O2C2H4 + O2 = C2H4O2
Ca + N2 = Ca3N23Ca + N2 = Ca3N2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3OH + O2 = H2O + CH34CH3OH - O2 = 2H2O + 4CH3
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3COF + H2O = CH3COOH + HFCH3COF + H2O = CH3COOH + HF
C2H6O + O2= CO2+ H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6O + O2= CO2+ H2010C2H6O + 15O2 = 20CO2 + 3H20
CL + O2 = CLO2CL + O2 = 2CLO
C2H6O+O2=CO2+H2010C2H6O + 15O2 = 20CO2 + 3H20
CH3CH2COOH + O2 = CO2 + H2O2CH3CH2COOH + 7O2 = 6CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
Cr2O7+e+H=Cr+H2OCr2O7 + 0e + 14H = 2Cr + 7H2O
C+O2=CO2C + O2 = 2CO
Cr2O7+e+H=Cr+H2OCr2O7 + 0e + 14H = 2Cr + 7H2O
CuSO4 + NaHCO3 = CuCO3 + CO2 + H2O + Na2SO4CuSO4 + 2NaHCO3 = CuCO3 + CO2 + H2O + Na2SO4
CuSO4 + NaHCO3 = CuCO3 + CO2 + H2O + Na2SO4CuSO4 + 2NaHCO3 = CuCO3 + CO2 + H2O + Na2SO4
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C17H35COOH(s) + O2(g) = CO2(g) + H2O(g)C17H35COOH(s) + 26O2(g) = 18CO2(g) + 18H2O(g)
C17H35COOH + O2(g) = CO2(g) + H2O(g)C17H35COOH + 26O2(g) = 18CO2(g) + 18H2O(g)
C12H22O11 + 24O = 12CO2 + 11H2OC12H22O11 + 24O = 12CO2 + 11H2O
C12H22O11 + O = CO2 + H2OC12H22O11 + 24O = 12CO2 + 11H2O
C12H22O11 + O = 11CO2 + 10H2OC12H22O11 + 24O = 12CO2 + 11H2O
CO+O2 = CO22CO + O2 = 2CO2
C+H2O+CL2=HCL+CO2C + H2O + CL2 = 2HCL + CO
CuSO4+NaOH=Cu(OH)2+Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca(OH)2+H2SO4=CaSO4+H2OCa(OH)2 + H2SO4 = CaSO4 + 2H2O
Cu+O2=CuO2Cu + O2 = 2CuO
C6H14 + O2 = CO2 +H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CACO3 = CAO + CO2CACO3 = CAO + CO2
CO2 + H2O = C6 H12 O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C5 H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5 H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5 H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C8H18 + O2 = CO2 +H2010C8H18 + 80O2 = 80CO2 + 9H20
C8H18(l) + O2(g) = CO2(g)+ H20(g)10C8H18(l) + 80O2(g) = 80CO2(g) + 9H20(g)
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CuNO3+MgCl2= CuCl+Mg(NO3)22CuNO3 + MgCl2 = 2CuCl + Mg(NO3)2
C6H4Cl2O+CuO=2CuCl+C6H4+O22C6H4Cl2O + 4CuO = 4CuCl + 2C6H4 + 3O2
C6H4Cl2O+Na=NaCl+ CO+C5H4C6H4Cl2O + 2Na = 2NaCl + CO + C5H4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
Ca+S= CaSCa + S = CaS
CrCl3+NaClO3+NaOH = Na2CrO4+NaCl+H2O2CrCl3 + NaClO3 + 10NaOH = 2Na2CrO4 + 7NaCl + 5H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C6H12O2+O2=CO2+H205C6H12O2 + 25O2 = 30CO2 + 3H20
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CuO+C=Cu+CO22CuO + C = 2Cu + CO2
Cu+O2=Cu2O4Cu + O2 = 2Cu2O
CuCO3+C=Cu+CO22CuCO3 + C = 2Cu + 3CO2
Ce(SO4)2 + KI = I2 + K2SO4 + CeCe(SO4)2 + 4KI = 2I2 + 2K2SO4 + Ce
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C 5 H 6 O(l)+O 2 (g)=CO 2 (g)+H 2 O(g) C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C 3 H 6 (g)+O 2 (g)=CO 2 (g)+H 2 O(g) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C2H5OH + O2= CO2 +H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H2+O2 = CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cr2O3+Mn(NO3)2+Na2(CO3)=Na2(CrO4)+Na2(MnO4)+NO+CO2Cr2O3 + 3Mn(NO3)2 + 5Na2(CO3) = 2Na2(CrO4) + 3Na2(MnO4) + 6NO + 5CO2
Cr2O3+Mn(NO3)2+Na2(CO3)=Na2(CrO4)+Na2(MnO4)+NO+CO2Cr2O3 + 3Mn(NO3)2 + 5Na2(CO3) = 2Na2(CrO4) + 3Na2(MnO4) + 6NO + 5CO2
Cr2O3+Mn(NO3)2+Na2CO3=Na2(CrO4)+Na2(MnO4)+NO+CO2Cr2O3 + 3Mn(NO3)2 + 5Na2CO3 = 2Na2(CrO4) + 3Na2(MnO4) + 6NO + 5CO2
Cr2O3+Mn(NO3)2+Na2CO3=Na2(CrO4)+Na2(MnO4)+NO+CO2Cr2O3 + 3Mn(NO3)2 + 5Na2CO3 = 2Na2(CrO4) + 3Na2(MnO4) + 6NO + 5CO2
C2H4O2 + KOH = CH3CO2K + H2OC2H4O2 + KOH = CH3CO2K + H2O
C2H4(g)+O2(g)= CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C2H4(g)+O2(g)= CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
Ca(ClO3)2 + Mg2CO3=CaCO3 + MgClO3Ca(ClO3)2 + Mg2CO3 = CaCO3 + 2MgClO3
Ca(ClO3)2 + Mg2CO3=CaCO3 + MgClO3Ca(ClO3)2 + Mg2CO3 = CaCO3 + 2MgClO3
Cl2 + F2 = ClF2Cl2 + 2F2 = 2ClF2
Cl2 + F2 = ClF2Cl2 + 2F2 = 2ClF2
Cl2 + F2 = ClF2Cl2 + 2F2 = 2ClF2
CaCO3 +2HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CH3-CH=CH2+H2=CH40CH3-CH = -1CH2 - H2 + CH4
C2H6 (g) + O2 (g) = CO (g) + H2O (g)2C2H6(g) + 5O2(g) = 4CO(g) + 6H2O(g)
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C6H5COOH + O2 = CO2 +H2O2C6H5COOH + 15O2 = 14CO2 + 6H2O
C +H2SO4 = CO2 +SO2 + H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
CaCl2 + Na3PO4 = NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
C2H6 + 4O2 = 2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(NO3)2+Na2S = CuS(s)+NaNO3(aq)Cu(NO3)2 + Na2S = CuS(s) + 2NaNO3(aq)
C5H12 + O2 = CO2+ H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + HNO3 = H2O = Ca(NO3)2Ca(OH)2 + 2HNO3 = 2H2O + Ca(NO3)2
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
C2H2O4 + H2SO4 = H2O + CO2 + SO2C2H2O4 + H2SO4 = 2H2O + 2CO2 + SO2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Cu(s) + Ni(NO3)2(aq) = Ni(s) + Cu(NO3)2(aq)Cu(s) + Ni(NO3)2(aq) = Ni(s) + Cu(NO3)2(aq)
C2H5N+O2=2CO2+H2O+N24C2H5N + 13O2 = 8CO2 + 10H2O + 2N2
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaCO3=CO2+CaOCaCO3 = CO2 + CaO
CaCO3=CO2+CaOCaCO3 = CO2 + CaO
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca(NO3)2 + K3(PO4) = CaPO4 + K3(NO3)2Ca(NO3)2 + K3(PO4) = CaPO4 + K3(NO3)2
Ca(NO3) + KPO4 = CaPO4 + K(NO3)Ca(NO3) + KPO4 = CaPO4 + K(NO3)
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CO + O2 = CO22CO + O2 = 2CO2
CH4 + O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CrO4 +Br = Cr +BrO33CrO4 + 4Br = 3Cr + 4BrO3
CrO4 +Br = Cr +BrO33CrO4 + 4Br = 3Cr + 4BrO3
CrO4 +Br = Cr +BrO33CrO4 + 4Br = 3Cr + 4BrO3
CH3CH2OH + O2=CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Cl2 + KIO + KOH = KCl + KIO4 + H2O3Cl2 + KIO + 6KOH = 6KCl + KIO4 + 3H2O
Cr2O3+Li2SO4=Cr2(SO4)3+Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
Ca(NO3)2 + Li3PO4 = Ca3(PO4)2 + LiNO33Ca(NO3)2 + 2Li3PO4 = Ca3(PO4)2 + 6LiNO3
C6H6 + O2 = H2O + CO22C6H6 + 15O2 = 6H2O + 12CO2
C5H10O2(l) + O2(g) = CO2(g) + H2O(l)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(l)
CaCO3= CaO+CO2CaCO3 = CaO + CO2
Co(OH)2 + H2O2 = Co(OH)32Co(OH)2 + H2O2 = 2Co(OH)3
CaSiO3 + HF = H2SiF6 + CaF2 + H2OCaSiO3 + 8HF = H2SiF6 + CaF2 + 3H2O
CH3CHOOH + NANO3 = CH3CHONA + HONO3CH3CHOOH + NANO3 = CH3CHONA + HONO3
C4H8O + O2 = CO2 + H2010C4H8O + 35O2 = 40CO2 + 4H20
C3H8O + O2 = CO2 + H2010C3H8O + 25O2 = 30CO2 + 4H20
Cl2 + NaOH = NaOCl + NaCl + H2OCl2 + 2NaOH = NaOCl + NaCl + H2O
Ca(PO4)2=Ca+PO4Ca(PO4)2 = Ca + 2PO4
Ca(PO4)2=Ca+PO4Ca(PO4)2 = Ca + 2PO4
C+O=CO2C + 2O = CO2
C2+O2=CO2C2 + 2O2 = 2CO2
C+O=CO2C + 2O = CO2
CO + H2O = C2H5OH + H2O0CO + H2O = 0C2H5OH + H2O
CO + H2O = C2H5OH + H20-10CO + 5H2O = -5C2H5OH + 2H20
Cl + HNO3 + AgNO3 = AgCl + 2HNO30Cl + HNO3 + 0AgNO3 = 0AgCl + HNO3
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CCl4+O2=CO2+Cl2CCl4 + O2 = CO2 + 2Cl2
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C3H8 + H2O = H2 + CO2C3H8 + 6H2O = 10H2 + 3CO2
C3H8 + 4H2O = 8H2 + CO2C3H8 + 6H2O = 10H2 + 3CO2
C4 H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca3 (PO4)2 (s) +SiO2+C(s) = CaSiO3+ P4(s) +CO(g)2Ca3(PO4)2(s) + 6SiO2 + 10C(s) = 6CaSiO3 + P4(s) + 10CO(g)
CH3 (CH2)6 CH3 + O2 (g) = CO2(g) + H2O (g)2CH3(CH2)6CH3 + 25O2(g) = 16CO2(g) + 18H2O(g)
CH3OH + O2 = CH2O + H2O2CH3OH + O2 = 2CH2O + 2H2O
CH3CHO + O2 = CO2 + H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
Cu(NO3)2+NaOH=Cu(OH)2+NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
CaCO3 + HCl = CaCl2 + CO2 + H2O CaCO3 + 2HCl = CaCl2 + CO2 + H2O
C7H17+O2=CO2+H2O4C7H17 + 45O2 = 28CO2 + 34H2O
C6H12O6+O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C3H8+O2 =CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Cu + H N O3 = Cu(NO3)2 + N O2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
C5H6O + O2 = CO2 + H2OC5H6O + 6O2 = 5CO2 + 3H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca3P2 + H2O = 3Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C6H10 + O2 = CO2 + H2O2C6H10 + 17O2 = 12CO2 + 10H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3NH2+O2=CO2+H2O+N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
Ca(OH)2 + H2SO4 = CaSO4 + H2OCa(OH)2 + H2SO4 = CaSO4 + 2H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Cl2+NaI=NaCl +I2Cl2 + 2NaI = 2NaCl + I2
Cl2+H2O=HCl+ HClOCl2 + H2O = HCl + HClO
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C12H22O11 = C + H2OC12H22O11 = 12C + 11H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CaC2 + H2O + 3CO2 = Ca(OH)2 + 5CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
C16H32O2 + O2 = CO2 + H2OC16H32O2 + 23O2 = 16CO2 + 16H2O
C4H9OH + O2 = C4H7O2H + H2OC4H9OH + O2 = C4H7O2H + H2O
CH9OH + O2 = C4H7O2H + H2O4CH9OH + 7O2 = C4H7O2H + 16H2O
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H8+O2 = CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
C2H6(g) + O2(g) = H2O(g) + CO2(g)2C2H6(g) + 7O2(g) = 6H2O(g) + 4CO2(g)
Cl- + NO3- + H+ = NO + Cl2 + H2O6Cl- + 2NO3- + 8H+ = 2NO + 3Cl2 + 4H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
CH3COOH+NaOH=H2O+NaCH3COOCH3COOH + NaOH = H2O + NaCH3COO
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8(g) + O2(g)=CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8(g) + O2(g) =CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C10H20 + O2 = CO2 + H2OC10H20 + 15O2 = 10CO2 + 10H2O
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
CaCl2+(NH4)2CO3=CaCO3+NH4ClCaCl2 + (NH4)2CO3 = CaCO3 + 2NH4Cl
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3CH3CH3+O2=CO2+H2O4CH3CH3CH3 + 21O2 = 12CO2 + 18H2O
CH3CH3CH3(g)+O2=CO2(g)+H2O4CH3CH3CH3(g) + 21O2 = 12CO2(g) + 18H2O
CH3CH3CH3(g)+O2=CO2(g)+4H2O4CH3CH3CH3(g) + 21O2 = 12CO2(g) + 18H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cu+HNO3 = Cu(NO3)2+H2O+NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CrI3+KOH+Cl2=K2CrO4+KIO4+KCl+H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu2O+O2=CuO2Cu2O + O2 = 4CuO
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Ca3 (PO4)2 + SiO2 = P4O10 + CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
Cu + HNO3 = NO2 + H2O + Cu(NO3)2Cu + 4HNO3 = 2NO2 + 2H2O + Cu(NO3)2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
C + HNO3 = CO2 + NO2 + H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C + HNO3 = CO2 + NO2 + H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C + HNO3 = N2 + CO2 + H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
Cu +6HNO3 = 2Cu(NO3)2 + 2NO + 3H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH3OH + O2 = CO2 + 2H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO+Fe2O3=CO2+Fe3CO + Fe2O3 = 3CO2 + 2Fe
CO+Fe2O3=CO2+Fe3CO + Fe2O3 = 3CO2 + 2Fe
Cr+S8=Cr2S316Cr + 3S8 = 8Cr2S3
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaCO3+HCl = CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Cr2O3+KNO3+Na3CO3=NaCrO4+KNO2+CO23Cr2O3 + 13KNO3 + 2Na3CO3 = 6NaCrO4 + 13KNO2 + 2CO2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO + H2 = CH3OHCO + 2H2 = CH3OH
CuS+O2=CuO+SOCuS + O2 = CuO + SO
CuO+C=Cu+COCuO + C = Cu + CO
C4H8 + Br2 = C4H8Br2C4H8 + Br2 = C4H8Br2
C3H8 + Br2 = C3H7Br + HBrC3H8 + Br2 = C3H7Br + HBr
C2H6 + Cl2 = C2Cl6 + HClC2H6 + 6Cl2 = C2Cl6 + 6HCl
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
Ca+O2=CaO2Ca + O2 = 2CaO
Cr2O3 + Li2SO4 = Cr2(SO4)3 + Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H6O + O2 = CO2 + H2OC5H6O + 6O2 = 5CO2 + 3H2O
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cr2O3 + Li2SO4 = Cr2(SO4)3 + Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H1206+O2=CO2+H2O2C6H1206 + 615O2 = 12CO2 + 1206H2O
C6H1206+O2=CO2+H2O2C6H1206 + 615O2 = 12CO2 + 1206H2O
C3H6O + O2 = CO2 + H2OC3H6O + 4O2 = 3CO2 + 3H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C + HNO3 = NO + CO2 + H2O3C + 4HNO3 = 4NO + 3CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H7COOH + OH = H2O + C3H7COOC3H7COOH + OH = H2O + C3H7COO
CaC2+2H2O+CO2=CH2+CH-COOH+Ca(OH)2CaC2 + 4H2O - CO2 = 3CH2 + 0CH-COOH + 2Ca(OH)
C8 H18 + O2 = CO2 + H2 O2C8H18 + 25O2 = 16CO2 + 18H2O
COO+H2O=CO(OH)2COO + H2O = CO(OH)2
CO2+H2O=H2CO3CO2 + H2O = H2CO3
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H6 + Cl2 = C2H4Cl2 + HClC2H6 + 2Cl2 = C2H4Cl2 + 2HCl
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14+O2=CO2+H2010C6H14 + 60O2 = 60CO2 + 7H20
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cr2O3 + H2SO4 = Cr2(SO4)3 + H2OCr2O3 + 3H2SO4 = Cr2(SO4)3 + 3H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + O2 = CuO2Cu + O2 = 2CuO
CoCl2+NaOH+NaClO3=NaCl+CoO3+H2O3CoCl2 + 6NaOH + 2NaClO3 = 8NaCl + 3CoO3 + 3H2O
C + O2=CO2C + O2 = 2CO
CuS+HNO3=Cu(NO3)2+S+NO+H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 2NO + 4H2O
Cu+HNO3 =Cu( NO3)2 +NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CrO4 + H2O = Cr(OH)3 + OHCrO4 + 4H2O = Cr(OH)3 + 5OH
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
C4H9OH+O2=CO2+H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H5Cl + C2HOCl3 = C14H9Cl5 + H2O2C6H5Cl + C2HOCl3 = C14H9Cl5 + H2O
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H12O2+O2=CO2+H2OC8H12O2 + 10O2 = 8CO2 + 6H2O
CuS+HNO3=Cu(NO3)2+S+NO+H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 2NO + 4H2O
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C12H22O11 + H2O = CH3CH2OH + CO2C12H22O11 + H2O = 4CH3CH2OH + 4CO2
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cu + AgNa3 =Cu(Na)3 + AgCu + AgNa3 = Cu(Na)3 + Ag
Cu(NO3)2+KOH = Cu(OH)2+KNO3Cu(NO3)2 + 2KOH = Cu(OH)2 + 2KNO3
C2H6O+O2 = CO2 = H2OC2H6O + 3O2 = 2CO2 + 3H2O
Cu + Ag Na3 =Cu(Na)3 + AgCu + AgNa3 = Cu(Na)3 + Ag
CO + O2 = CO22CO + O2 = 2CO2
C4H8S + O2 = CO2 + H2O + SO 2C4H8S + 7O2 = 4CO2 + 4H2O + SO2
C7H16 + O2 = H2O + CO2C7H16 + 11O2 = 8H2O + 7CO2
Ca + HCL = CaCL + H22Ca + 2HCL = 2CaCL + H2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3P2 + HCl = CaCl2 + PH3Ca3P2 + 6HCl = 3CaCl2 + 2PH3
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu(NO3)2 = CuO+NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
Ca + H2O = Ca(OH)2 +H2Ca + 2H2O = Ca(OH)2 + H2
Cu + O2 =CuO2Cu + O2 = 2CuO
Cr2O3 + Li2SO4 = Cr2(SO4)3 + Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
Cr2O3 + Li2SO4 = Cr2(SO4)3 + Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
CaO+HNO3=Ca(NO3)2+H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
C2H4O2 + CaCO3 = CO2 + H2O + Ca(C2H3O2)22C2H4O2 + CaCO3 = CO2 + H2O + Ca(C2H3O2)2
C2H4O2 + MgCO3 = CO2 + H2O + Mg(CH3COO)22C2H4O2 + MgCO3 = CO2 + H2O + Mg(CH3COO)2
C2H4O2 + Na2CO3 = CO2 + H2O + C2H3NaO22C2H4O2 + Na2CO3 = CO2 + H2O + 2C2H3NaO2
Cu+HNO3=Cu(NO3)2+NH4NO3+H2O4Cu + 10HNO3 = 4Cu(NO3)2 + NH4NO3 + 3H2O
Cu+HNO3=Cu(NO3)2+NH4NO3+H2O4Cu + 10HNO3 = 4Cu(NO3)2 + NH4NO3 + 3H2O
C2H4O2 + K2CO3 = CO2 + H2O + CH3CO2K2C2H4O2 + K2CO3 = CO2 + H2O + 2CH3CO2K
CCl4 + C7H8 = C6H5CH2 +CHCl321CCl4 + 21C7H8 = 20C6H5CH2 + 28CHCl3
C2H4O2 + CuCO3 = CO2 + H2O + Cu(CH3COO)22C2H4O2 + CuCO3 = CO2 + H2O + Cu(CH3COO)2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCl + NaCO3 = CaCO3 + NaClCaCl + NaCO3 = CaCO3 + NaCl
CH3CH2OH + CH3COOH = CH3COOCH2CH3 + H2OCH3CH2OH + CH3COOH = CH3COOCH2CH3 + H2O
CH3CH2OH + CH3COOH = CH3COOCH2CH3 + H2OCH3CH2OH + CH3COOH = CH3COOCH2CH3 + H2O
C + Fe2O3 = CO2 + Fe3C + 2Fe2O3 = 3CO2 + 4Fe
CO + O2 = CO22CO + O2 = 2CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2(s)=H2O(g)+CaO(s)Ca(OH)2(s) = H2O(g) + CaO(s)
C2H6=C2H4+H2C2H6 = C2H4 + H2
Cu2Cl2+KCl+H2O=Cu(OH)Cl+KCl0Cu2Cl2 + KCl + 0H2O = 0Cu(OH)Cl + KCl
CaC2 + 6H2O + 3CO2 = Ca(OH)2 + 5 CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CH3CH2O+O2=H2O+CH3COOH4CH3CH2O + 3O2 = 2H2O + 4CH3COOH
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C2H4 + I2 = C2H4I2C2H4 + I2 = C2H4I2
C2H6+O3=H20+CO230C2H6 + 40O3 = 9H20 + 60CO2
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C6H10O2 + O2 = CO2 + H2O2C6H10O2 + 15O2 = 12CO2 + 10H2O
C6H10 + O2 = CO2 + H2O2C6H10 + 17O2 = 12CO2 + 10H2O
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cl2 + KOH = KCl + KClO3 + H2O3Cl2 + 6KOH = 5KCl + KClO3 + 3H2O
C4H10+ O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6 = C2H6O+ CO2C6H12O6 = 2C2H6O + 2CO2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C6H6 + O2 = CO2 + H2010C6H6 + 60O2 = 60CO2 + 3H20
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cr+S8=Cr2S316Cr + 3S8 = 8Cr2S3
Ca3(PO4)2+SiO2+C=CaSiO3+CO+PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C + O2 = CO2C + O2 = 2CO
C + O = COC + O = CO
CuCO3=CuO+CO2CuCO3 = CuO + CO2
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2OH + O2 = H2O +CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH4 + O = CO2 + H2OCH4 + 4O = CO2 + 2H2O
CH2O2 + NH4OH + KOH = KCN + HOHCH2O2 + NH4OH + KOH = KCN + 4HOH
CH2O2 + NH4OH + KOH = KCN + HOHCH2O2 + NH4OH + KOH = KCN + 4HOH
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH4+O2NaOH=NaOH+CO2+H2OCH4 + 2O2NaOH = 2NaOH + CO2 + 2H2O
CaCl2+Na2SO4=CaSO4+NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
Ca+Na3P=CaP+Na3Ca + Na3P = CaP + Na3
CaCl2+Na2SO4=CaSO4+NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
Ca(OH)2(aq) + H3PO4(aq)=H2O(l) +Ca3(PO4)2(s)3Ca(OH)2(aq) + 2H3PO4(aq) = 6H2O(l) + Ca3(PO4)2(s)
CaCl2+KOH=Ca(OH)2+KClCaCl2 + 2KOH = Ca(OH)2 + 2KCl
Cl2+Al=AlCl33Cl2 + 2Al = 2AlCl3
C2H2 + O2= CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.