Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CaSO4 + O2 = CaSO4CaSO4 + 0O2 = CaSO4
CaO + SO2 = CaSO3CaO + SO2 = CaSO3
Cu(NO3)2*3H2O + H2O + 4NH3OH = Cu(NH3)4 +H2O0Cu(NO3)2*3H2O + H2O + 0NH3OH = 0Cu(NH3)4 + H2O
Cu(NO3)2*3H2O + H2O + NH3OH = Cu(NH3)4 +H2O0Cu(NO3)2*3H2O + H2O + 0NH3OH = 0Cu(NH3)4 + H2O
Cl2+Fe=ClFeCl2 + 2Fe = 2ClFe
Cl2+Ca=Cl2CaCl2 + Ca = Cl2Ca
C6H8O7 + CHO3- = H2O + CO2 + C6H8O7C6H8O7 + 0CHO3- = 0H2O + 0CO2 + C6H8O7
Cl2+Zn=Cl2ZnCl2 + Zn = Cl2Zn
Cl2+Al=Cl2AlCl2 + Al = Cl2Al
Cl2+Na=ClNaCl2 + 2Na = 2ClNa
Ca + H2O = Ca (OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C3H5(NO3)3 = CO2 + N2 + H2O +O24C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H5+O2=CO2+H2O4C2H5 + 13O2 = 8CO2 + 10H2O
C3H7NO3 + O2 = H20 + CO2 +NH310C3H7NO3 + 15O2 = 2H20 + 30CO2 + 10NH3
C3H7NO3 + O2 = H20 + CO2 +NH310C3H7NO3 + 15O2 = 2H20 + 30CO2 + 10NH3
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
Cr2+OH=Cr(OH)3Cr2 + 6OH = 2Cr(OH)3
CaCl2+ NaHCO3 + H2O = Ca2(HCO6)+ NaCl + H2O0CaCl2 + 0NaHCO3 + H2O = 0Ca2(HCO6) + 0NaCl + H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Ca3(PO4)2 + H3PO4 = Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Ca3(PO4)2+C+SiO2=CaSiO3+CO+P42Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + 10CO + P4
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H12+O2=CO2+H2OC3H12 + 6O2 = 3CO2 + 6H2O
C2H5OH + O2 = H2O + CO2C2H5OH + 3O2 = 3H2O + 2CO2
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
CH4+O2=C2H6+H2O4CH4 + O2 = 2C2H6 + 2H2O
C2H6+O2=CO2=H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
C2H2=CHC2H2 = 2CH
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Cu(NO3)2(aq)+KI(aq)=CuI(aq)+KNO3(aq)+I22Cu(NO3)2(aq) + 4KI(aq) = 2CuI(aq) + 4KNO3(aq) + I2
CH4(g) + O2(g)=CO2(g)+H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
C6H12O6 + O2 = CO2 + H2O C6H12O6 + 6O2 = 6CO2 + 6H2O
C7H8 + O2 = CO2 + H2OC7H8 + 9O2 = 7CO2 + 4H2O
C19H36+O2=H2O+CO2C19H36 + 28O2 = 18H2O + 19CO2
ClO3+KOH=KClO3+H2O+KClO4 2ClO3 + 2KOH = KClO3 + H2O + KClO4
C2H4 + O2 = H2O + CO2C2H4 + 3O2 = 2H2O + 2CO2
CH3 + O2 = H2O + CO24CH3 + 7O2 = 6H2O + 4CO2
CH4 + O2 = H2O + CO2CH4 + 2O2 = 2H2O + CO2
CuCl2 + AgNO3 = CuNO3 + AgCl2CuCl2 + AgNO3 = CuNO3 + AgCl2
CH3COOH + CaCO3 = Ca(CH3COO)2 + H2O + CO22CH3COOH + CaCO3 = Ca(CH3COO)2 + H2O + CO2
Ca(CH3COO)2 + H2CO3 = CaCO3 + CH3COOHCa(CH3COO)2 + H2CO3 = CaCO3 + 2CH3COOH
C2H2Cl4+Ca(OH)2=C2HCl3+CaCl2+H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
Cu + HNO3 = Cu(NO3)2 + H2O + NO3 -1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq) Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Cr2+ + Al = Cr + Al3+Cr2+ + 3Al = 2Cr + Al3+
Cr2+ + Al = Cr + Al3+Cr2+ + 3Al = 2Cr + Al3+
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH(l)+O2(g)=CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Cr2 O3= Cr+OCr2O3 = 2Cr + 3O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + H2SO4=2H2O + CaSO4Ca(OH)2 + H2SO4 = 2H2O + CaSO4
C2H2 + O2=CO2 + H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
Cu2S + Cu2O = Cu + SO2Cu2S + 2Cu2O = 6Cu + SO2
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3COOH(l)+O2(g)=2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
C5H10O+O2 = CO2+H2OC5H10O + 7O2 = 5CO2 + 5H2O
CH4 + Cl2 = CHCl3 + HClCH4 + 3Cl2 = CHCl3 + 3HCl
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C8H16 + O2 = CO2 + H2OC8H16 + 12O2 = 8CO2 + 8H2O
C+Fe2O3=Fe+CO23C + 2Fe2O3 = 4Fe + 3CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C12+KBr=Br2+KC1C12 + 12KBr = 6Br2 + 12KC1
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10(l) + O2(g) = CO2(g) + H2O(l)2C4H10(l) + 13O2(g) = 8CO2(g) + 10H2O(l)
C4H10(l) + O2(g) = CO2(g) + H2O(l)2C4H10(l) + 13O2(g) = 8CO2(g) + 10H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CaCl2+Al2(SO4)3=CaSO4+AlCl33CaCl2 + Al2(SO4)3 = 3CaSO4 + 2AlCl3
Cu+HNO3=Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
Ca5(PO4)3F+H2SO4=H3PO4+HF+CaSO4Ca5(PO4)3F + 5H2SO4 = 3H3PO4 + HF + 5CaSO4
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H5(NO3)3=CO2+N2+H2O+O24C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
CH3COOH+NH3=CH3COO+NH4CH3COOH + NH3 = CH3COO + NH4
CH3COOH+NH3=CH3COO+NH4CH3COOH + NH3 = CH3COO + NH4
CCl4(g)+O2(g)=COCl2(g) +Cl22CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2
C3H8(g)+O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
CO2H2O=C6H12O6+O26CO2H2O = C6H12O6 + 6O2
C6H11Br + C2H6O = C4H10O + C6H10 + HBrC6H11Br + 0C2H6O = 0C4H10O + C6H10 + HBr
CaCO3+HNO3= CO2+H2O+Ca(NO3)2CaCO3 + 2HNO3 = CO2 + H2O + Ca(NO3)2
CaSO4+FeCl3=CaCl2+Fe2(SO4)33CaSO4 + 2FeCl3 = 3CaCl2 + Fe2(SO4)3
Ca(OH)2+NH3=Ca3N2+H2O3Ca(OH)2 + 2NH3 = Ca3N2 + 6H2O
Cl(g)+KI(aq) = I(s)+KCl(aq)Cl(g) + KI(aq) = I(s) + KCl(aq)
C12H22O11 + H2O = C2H5OH + CO2C12H22O11 + H2O = 4C2H5OH + 4CO2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca+Al(NO3)3=Ca(NO3)3+AlCa + Al(NO3)3 = Ca(NO3)3 + Al
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Cu(NO3)2+H2SO4=HNO3+CuSO4Cu(NO3)2 + H2SO4 = 2HNO3 + CuSO4
CuCl2+H2S=CuS+HClCuCl2 + H2S = CuS + 2HCl
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Cu+HNO3=Cu(NO3)2+H2O+NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO+O2=CO22CO + O2 = 2CO2
CO2+H2O=C6H12O6+O66CO2 + 6H2O = C6H12O6 + 2O6
C2H6+O2=CO2+H2C2H6 + 2O2 = 2CO2 + 3H2
CdCO3=CdO+CO2CdCO3 = CdO + CO2
Ca+N2= Ca3N23Ca + N2 = Ca3N2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cu(OH)2 + H3PO4 = Cu3(PO4)2 + H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
C+O2=2CO2C + O2 = 2CO
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2 + H2O= C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
Cu+S = Cu2S2Cu + S = Cu2S
CoS+CO+Cu=Co2(CO)8+Cu2S2CoS + 8CO + 4Cu = Co2(CO)8 + 2Cu2S
Ca(SiO3) = SiO2 + CaOCa(SiO3) = SiO2 + CaO
Cr2O3 + KNO3 + Na2CO3 = Na2CrO4 + KNO2 + CO2Cr2O3 + 3KNO3 + 2Na2CO3 = 2Na2CrO4 + 3KNO2 + 2CO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C6H8 + O2 = CO2 + H2OC6H8 + 8O2 = 6CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C+H20=C6H120660C + 603H20 = 10C6H1206
C6H12O3 + O2 = CO2 + H2O2C6H12O3 + 15O2 = 12CO2 + 12H2O
Cd+Pb(NO3)2=Cd(NO3)+Pb2Cd + Pb(NO3)2 = 2Cd(NO3) + Pb
C11H12O2 + O2 = CO2 + H2OC11H12O2 + 13O2 = 11CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H5OCH3(g) + O2(g) = CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
C4H6O3 + H2O = C2H4O2C4H6O3 + H2O = 2C2H4O2
C4H4 + O2 = CO2 + H2OC4H4 + 5O2 = 4CO2 + 2H2O
CdCl2 + NaOH = Cd(OH)2 + NaClCdCl2 + 2NaOH = Cd(OH)2 + 2NaCl
Cu(NO3)2(aq)+3NaOH(aq)=Cu(OH)2(s)+3NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Cr2O3 + KNO3 + KOH = K2CrO4 + KNO2 + H2OCr2O3 + 3KNO3 + 4KOH = 2K2CrO4 + 3KNO2 + 2H2O
CrO2Cl2 + C3H6O= C2H4O2 +CrCl3 + Cr2O324CrO2Cl2 + 18C3H6O = 27C2H4O2 + 16CrCl3 + 4Cr2O3
CrO2Cl2 + C3H6O= C2H4O2 +H2O + CrCl3 + Cr2O324CrO2Cl2 + 18C3H6O = 27C2H4O2 + 0H2O + 16CrCl3 + 4Cr2O3
CrO2Cl2 + C3H6O= C2H4O2 +H2O + CrCl3 + Cr2O324CrO2Cl2 + 18C3H6O = 27C2H4O2 + 0H2O + 16CrCl3 + 4Cr2O3
CrO2Cl2 + C3H6O= C2H4O2 +H2O + CrCl3 + Cr2O324CrO2Cl2 + 18C3H6O = 27C2H4O2 + 0H2O + 16CrCl3 + 4Cr2O3
CrO2Cl2 + C2H5OH= C4H8O2 +H2O + CrCl3 + Cr2O312CrO2Cl2 + 18C2H5OH = 9C4H8O2 + 18H2O + 8CrCl3 + 2Cr2O3
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
C3H8(g)+O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3OH + O = CO2 +H2OCH3OH + 3O = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3COOH+CH3OH=CH3COOCH3+H2OCH3COOH + CH3OH = CH3COOCH3 + H2O
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaCl2+Na2SO4=CaSO4+NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H6O + O2 = CO2 + H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H6O + O2 = CO2 + H20 10C3H6O + 25O2 = 30CO2 + 3H20
CH4 + O2 = H2O + CO2CH4 + 2O2 = 2H2O + CO2
CaCl2*2H2O+KOH=CaCl2KOH+2H2OCaCl2*2H2O + KOH = CaCl2KOH + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C11H10O6 + O2 = CO2 + H2O2C11H10O6 + 21O2 = 22CO2 + 10H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C36H74 + O2 = CO2 + H2O2C36H74 + 109O2 = 72CO2 + 74H2O
CO2(aq)+H2O(l)=H(aq)+ HCO(aq)CO2(aq) - H2O(l) = -3H(aq) + HCO(aq)
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C10H22+O=H2O+CO2C10H22 + 31O = 11H2O + 10CO2
Ca(OH)2 + H2SO4 = H2O + CaSO4Ca(OH)2 + H2SO4 = 2H2O + CaSO4
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO + HO2CH4 + 5O2 = 2CO + 8HO
CH4 + O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
C7H16+ O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3O3+O2=CO2+H2O4CH3O3 + O2 = 4CO2 + 6H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaF2 + Li2SO4=CaSO4 + LiFCaF2 + Li2SO4 = CaSO4 + 2LiF
C5H12O2+O2=CO2+H2OC5H12O2 + 7O2 = 5CO2 + 6H2O
CO2+4H2=CH4+2H2OCO2 + 4H2 = CH4 + 2H2O
C8H12O3N2 + O2 = C5H7NO2 + NH3 + H2O-5C8H12O3N2 + 0O2 = -8C5H7NO2 - 2NH3 + H2O
C8H12O3N2 + O2 = C5H7NO2 + NH3 + H2O-5C8H12O3N2 + 0O2 = -8C5H7NO2 - 2NH3 + H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CaCN2 +H2O = CaCO3 +NH3CaCN2 + 3H2O = CaCO3 + 2NH3
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C 2 H 5 NH 2 +O 2 =CO 2 +H 2 O+N 2 4C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
Ca 3 P 2 +H 2 O=Ca(OH) 2 +PH 3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C5H8 +O2 =5 CO2 + 4H2OC5H8 + 7O2 = 5CO2 + 4H2O
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C21 H42+O2=CO2+H2O2C21H42 + 63O2 = 42CO2 + 42H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CuO=Cu+O22CuO = 2Cu + O2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCO3 + O2 = CaO +CO2CaCO3 + 0O2 = CaO + CO2
CaCO3 + O2 = CaO +CO2CaCO3 + 0O2 = CaO + CO2
CaO + CO2 = CaCO3CaO + CO2 = CaCO3
C5H8 +O2 = CO2 +H2OC5H8 + 7O2 = 5CO2 + 4H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H10+O2=CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H5OH+O2=H2O+CO2C2H5OH + 3O2 = 3H2O + 2CO2
CH4 + 2 O2=CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
CO + H2 = CH3OHCO + 2H2 = CH3OH
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
C2H2 + O2 = CO2 + H2010C2H2 + 20O2 = 20CO2 + H20
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
Ca(NO3)2*3H2O + LaC2 = Ca(NO3)2 + La(OH)2 + C2H22Ca(NO3)2*3H2O + 3LaC2 = 2Ca(NO3)2 + 3La(OH)2 + 3C2H2
C5H12+ O2 = 5 CO2+ H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca+O2=CaO2Ca + O2 = 2CaO
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
Cu+HNO3=Cu(NO3)2+H2O+NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
Ca(OH)2 + H3PO3 = Ca3(PO3)2 + H2O3Ca(OH)2 + 2H3PO3 = Ca3(PO3)2 + 6H2O
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
CaO + H2O = Ca (OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
Cl2 + NaBr= NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(NO3)2(aq) + H2SO4(aq) = CaSO4(s) + 2HNO3(aq)Ca(NO3)2(aq) + H2SO4(aq) = CaSO4(s) + 2HNO3(aq)
Ca +O2= CaO2Ca + O2 = CaO2
CuSo4+NaOh=CuOh2+Na2So4CuSo4 + 2NaOh = CuOh2 + Na2So4
CuSo4+NaOh=CuOh+NaSo4CuSo4 + NaOh = CuOh + NaSo4
CuSo4+NaOh=CuOh+NaSo4CuSo4 + NaOh = CuOh + NaSo4
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Cr(NO2)2 + (NH4)2SO4 = CrSO4 + NH4NO2Cr(NO2)2 + (NH4)2SO4 = CrSO4 + 2NH4NO2
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
Cr+H2SO4=Cr2(SO4)3+H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CaCO3 + H3PO4 = Ca3(PO4)2 + H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
CH3OCH3 + AlCl3 = CH3OCH2AlCl3 + HCH3OCH3 + AlCl3 = CH3OCH2AlCl3 + H
CH3OCH3 + AlCl3 = CH3OCH3AlCl3CH3OCH3 + AlCl3 = CH3OCH3AlCl3
Ca3(PO4)2+H2SO4=CaSO4+H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
C7H17 + O2 = CO2 + H2O4C7H17 + 45O2 = 28CO2 + 34H2O
C18H36O2+O2=CO2+H2OC18H36O2 + 26O2 = 18CO2 + 18H2O
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca5(PO4)3F+H2SO4=H3PO4+HF+CaSO4Ca5(PO4)3F + 5H2SO4 = 3H3PO4 + HF + 5CaSO4
C6H12O6 + O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO+O2=CO22CO + O2 = 2CO2
CO2(g)+H2O(l)= H2CO3(aq) CO2(g) + H2O(l) = H2CO3(aq)
C2H2+ O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H6+O2= CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co(SO4)3 + Pb(C2H3O2)2 = Pb(SO4)3 + Co(C2H3O2)2Co(SO4)3 + Pb(C2H3O2)2 = Pb(SO4)3 + Co(C2H3O2)2
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuSO4 + Fe = FeSO4 + CuCuSO4 + Fe = FeSO4 + Cu
C4H10+O2=CO2+H202C4H10 + 8O2 = 8CO2 + H20
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CuO + HN3 = N2 + H2O + CuCuO + 2HN3 = 3N2 + H2O + Cu
CaCO3=CaO+ CO2CaCO3 = CaO + CO2
Cr2O3 + KNO3 + Na2CO3 = NaCrO4 + KNO2 + CO2Cr2O3 + 4KNO3 + Na2CO3 = 2NaCrO4 + 4KNO2 + CO2
Cl + FeCl2 = FeCl3Cl + FeCl2 = FeCl3
CS2+Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C6H12O6 + HCl =C6H + Cl + H2OC6H12O6 + HCl = C6H + Cl + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3COOH + NaClO = NaCl + H2O + CO2CH3COOH + 4NaClO = 4NaCl + 2H2O + 2CO2
CuO + NH3 = N2+ H2O +Cu3CuO + 2NH3 = N2 + 3H2O + 3Cu
CaCO3 = CaO+ CO2CaCO3 = CaO + CO2
C3H8 + O2 = CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2+ O6H2OC3H8 + 17O2 = 3CO2 + 4O6H2O
C3H8 + O2 = CO2+ O6H2OC3H8 + 17O2 = 3CO2 + 4O6H2O
CO2 + H2O = C6H12O6+ O66CO2 + 6H2O = C6H12O6 + 2O6
CO2 + H2O = C6H12O6+ O66CO2 + 6H2O = C6H12O6 + 2O6
C6H5Cl+Na=C6H5(NaCl)C6H5Cl + Na = C6H5(NaCl)
C6H5Cl+Na=C6H5+NaClC6H5Cl + Na = C6H5 + NaCl
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
Cs+N2=CsN32Cs + 3N2 = 2CsN3
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(PO4)2 + 10 CO = P4 + 10CO2 + CaO2Ca(PO4)2 + 14CO = P4 + 14CO2 + 2CaO
C6H6 + O2 = 6CO2 + 3H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuBr2+AlCl3=CuCl3+AlBr2CuBr2 + AlCl3 = CuCl3 + AlBr2
C + O2 =CO2C + O2 = 2CO
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 +H2010C2H6 + 20O2 = 20CO2 + 3H20
C4H9OH+O2=CO2+H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C2F4 + F2 = CF4C2F4 + 2F2 = 2CF4
C100F202 + F2 = CF4C100F202 + 99F2 = 100CF4
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C2H4O +O2= CO2 +H2O2C2H4O + 5O2 = 4CO2 + 4H2O
C2F4 = CF3 + CF4-1C2F4 = -4CF3 + 2CF4
C10H8 +12 O2 = 10 CO2 + 4 H2OC10H8 + 12O2 = 10CO2 + 4H2O
C4H(g)+O2(g) = CO2(g)+H2O(l)4C4H(g) + 17O2(g) = 16CO2(g) + 2H2O(l)
C2F4 = CF4 + F2-1C2F4 = -2CF4 + 2F2
Ca + N2 = Ca3N23Ca + N2 = Ca3N2
C4F8 + F2 = CF4C4F8 + 4F2 = 4CF4
C4F8 + F2 = CF4C4F8 + 4F2 = 4CF4
C3F8 + F2 = CF4C3F8 + 2F2 = 3CF4
C4H6+O2 = CO2+H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C2F4 + F2 = CF4C2F4 + 2F2 = 2CF4
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C4H6+O2 = CO2+H2010C4H6 + 40O2 = 40CO2 + 3H20
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + H202C4H10 + 8O2 = 8CO2 + H20
Ca(OH)2 + HCl = H2O + CaCl2Ca(OH)2 + 2HCl = 2H2O + CaCl2
Cu+AgNO3=Ag+CuNO3Cu + AgNO3 = Ag + CuNO3
CoCl2H2O+HAuCl4+2NaBH4=Au+CoO+2NaCl+3BH4-1CoCl2H2O + 2HAuCl4 + 6NaBH4 = 2Au - CoO + 6NaCl + 6BH4
CoCl2H2O+HAuCl4+2NaBH4=Au+CoO+2NaCl+2BH4-1CoCl2H2O + 2HAuCl4 + 6NaBH4 = 2Au - CoO + 6NaCl + 6BH4
CoCl2H2O+HAuCl4+2NaBH4=Au+CoO+2NaCl+BH-13CoCl2H2O + 8HAuCl4 + 6NaBH4 = 8Au - 13CoO + 6NaCl + 6BH
CoCl2H2O+HAuCl4+2NaBH4=Au+CoO+NaCl+BH-13CoCl2H2O + 8HAuCl4 + 6NaBH4 = 8Au - 13CoO + 6NaCl + 6BH
CoCl2H2O+HAuCl4+2NaBH4=Au+CoO+NaCl+BH-13CoCl2H2O + 8HAuCl4 + 6NaBH4 = 8Au - 13CoO + 6NaCl + 6BH
CoCl2H2O+HAuCl4+2NaBH4=Au+CoO+NaCl+BH67CoCl2H2O - 2HAuCl4 + 6NaBH4 = -2Au + 7CoO + 6NaCl + 6BH6
CoCl2H2O+HAuCl4+2NaBH4=Au+Co+H2O+NaCl+BH4CoCl2H2O + 0HAuCl4 + 2NaBH4 = 0Au + Co + H2O + 2NaCl + 2BH4
CoCl2H2O+HAuCl4+2NaBH4=Au+Co+H2O+NaCl+BH4CoCl2H2O + 0HAuCl4 + 2NaBH4 = 0Au + Co + H2O + 2NaCl + 2BH4
C4H6(g) + O2(g) = CO2(g) + H2O( l)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(l)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO + O2 = CO22CO + O2 = 2CO2
Ca + FeSO4 = CaSO4 + FeCa + FeSO4 = CaSO4 + Fe
Ca2Mg5Si8O22(OH)2 + H2O + CO2 = Mg2SiO4 + CaMg(CO3)2 + H2O0Ca2Mg5Si8O22(OH)2 + H2O + 0CO2 = 0Mg2SiO4 + 0CaMg(CO3)2 + H2O
CuO + CH4 = Cu + CO2 + H2O4CuO + CH4 = 4Cu + CO2 + 2H2O
Ca2Mg5Si8O22(OH)2 + H2O + CO2 = Mg2 SiO4 + CaCO3 + H2O0Ca2Mg5Si8O22(OH)2 + H2O + 0CO2 = 0Mg2SiO4 + 0CaCO3 + H2O
C2H5OH + O2 = CO2 +H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CuCo3+HCl=CuCl2+H20+Co210CuCo3 + 20HCl = 10CuCl2 + H20 + 15Co2
CuCo3+2HCl=CuCl2+H20+Co210CuCo3 + 20HCl = 10CuCl2 + H20 + 15Co2
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3COOH(l)+O2(g)=CO2(g)+H2O(l) CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca3(PO4)2 + H2SO4 = H3PO4 +CaSO4Ca3(PO4)2 + 3H2SO4 = 2H3PO4 + 3CaSO4
Co(NO3)2+KH2PO4=Co(PO4)2+2KH2(NO3)Co(NO3)2 + 2KH2PO4 = Co(PO4)2 + 2KH2(NO3)
C6H10 + O2 = CO2 + H2O2C6H10 + 17O2 = 12CO2 + 10H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Ca3(Po4)2+H2So4=CaSo4+Ca(H2Po4)2Ca3(Po4)2 + 2H2So4 = 2CaSo4 + Ca(H2Po4)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H5Cl + SiCl4 + Na = (C6H5)4Si + NaCl4C6H5Cl + SiCl4 + 8Na = (C6H5)4Si + 8NaCl
Ca2Mg5Si8O22(OH)2+CaMg(CO3)2=Mg2SiO4+CaCO3+CO2+H2OCa2Mg5Si8O22(OH)2 + 11CaMg(CO3)2 = 8Mg2SiO4 + 13CaCO3 + 9CO2 + H2O
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CuO + NH3 = N2 + Cu + H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
CaCO3+Mg3Si4O10(OH)2=Ca2Mg5Si8O22(OH)2+CaMg(CO3)2+CO2+H2O3CaCO3 + 2Mg3Si4O10(OH)2 = Ca2Mg5Si8O22(OH)2 + CaMg(CO3)2 + CO2 + H2O
CaCO3+Mg3Si4O10(OH)2=Ca2Mg5Si8O22(OH)2+CaMg(CO3)2+CO2+H2O3CaCO3 + 2Mg3Si4O10(OH)2 = Ca2Mg5Si8O22(OH)2 + CaMg(CO3)2 + CO2 + H2O
CaCO3 + NH3 = 1Ca + 1CH2N2 + CaCN2 +H2OCaCO3 + 2NH3 = 0Ca + 0CH2N2 + CaCN2 + 3H2O
CaCO3 + NH3 = Ca + CH2N2 + CaCN2 +H2OCaCO3 + 2NH3 = 0Ca + 0CH2N2 + CaCN2 + 3H2O
Ca+HBr=H+CaBr2Ca + 2HBr = 2H + CaBr2
Cu + AgNO3 = Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CaCO3+HCl=CO2+H2O+CaCl2CaCO3 + 2HCl = CO2 + H2O + CaCl2
CaCO3 + O2 = CaO + CO2CaCO3 + 0O2 = CaO + CO2
CaCO3+O2=CaO+CO2CaCO3 + 0O2 = CaO + CO2
Cu(s)+HCl(aq)=CuCl2(aq)+H2(g)Cu(s) + 2HCl(aq) = CuCl2(aq) + H2(g)
CsF + XeF6 = CsXeF7CsF + XeF6 = CsXeF7
CaOH + HCl = CaCl + H2OCaOH + HCl = CaCl + H2O
CaOH + HCl = CaCl + H2OCaOH + HCl = CaCl + H2O
Cu(s) + H2SO4(aq) = Cu(SO4)2(aq) + SO2(g) + H2O(l)Cu(s) + 4H2SO4(aq) = Cu(SO4)2(aq) + 2SO2(g) + 4H2O(l)
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
Cu + HNO3 = Cu(NO3)2 + H2O + NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
C3H8+5O2=3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=H2O+C2H4OC2H6 + O2 = H2O + C2H4O
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CO2 + H2O = C6H12O6 + H6-6CO2 + 6H2O = -1C6H12O6 + 4H6
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cr2O3+Na2CO3+KNO3=Na2CrO4+CO2+KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
Cr2O3+Na2CO3+KNO3=Na2Cr4+CO2+KNO2-2Cr2O3 - Na2CO3 + 7KNO3 = -1Na2Cr4 - CO2 + 7KNO2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CrO4+N2O= Cr+ 8NOCrO4 + 4N2O = Cr + 8NO
CrO4+N2O= Cr+ 8NOCrO4 + 4N2O = Cr + 8NO
Ca + S = CaSCa + S = CaS
C7H602+O2=CO2+H2O2C7H602 + 315O2 = 14CO2 + 602H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CaO + H2O = Ca (OH)2CaO + H2O = Ca(OH)2
C2H5Cl+NaPb=(C2H5)4Pb+NaCl+Pb4C2H5Cl + 4NaPb = (C2H5)4Pb + 4NaCl + 3Pb
C4H10O +H20=CO2+H200C4H10O + H20 = 0CO2 + H20
C4H10O +H20=CO2+H20C4H10O + H20 = 0CO2 + 10H2
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
Ca3(PO)2+SiO2+C=CaSiO3+P4+CO-2Ca3(PO)2 - 6SiO2 + 2C = -6CaSiO3 - P4 + 2CO
Ca2Mg5Si8O22(OH)2 + CaCO3 = CaMgSi2O6 + Mg2SiO4 + H2O + CO23Ca2Mg5Si8O22(OH)2 + 5CaCO3 = 11CaMgSi2O6 + 2Mg2SiO4 + 3H2O + 5CO2
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca3(PO4)2+SiO2+C=CaSiO3+CO+PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
C2H4O2 + C5H12O = C7H15O2 + H2O15C2H4O2 + 22C5H12O = 20C7H15O2 + 12H2O
C + H2 = CH4C + 2H2 = CH4
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H6(g) + O2(g) = CO2(g) + H2O2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O
Cu(OH)2 + H2CO3 = H2O + CuCO3Cu(OH)2 + H2CO3 = 2H2O + CuCO3
Ca+O2=CaO2Ca + O2 = 2CaO
C2H2 + O2 = CO2 +H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2 + O2 = 4CO2 +H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C + SO2 = CS2 + CO5C + 2SO2 = CS2 + 4CO
C5H5+Fe=Fe(C5H5)22C5H5 + Fe = Fe(C5H5)2
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
Ca(OH)2 + NH3 = H2O + Ca3N23Ca(OH)2 + 2NH3 = 6H2O + Ca3N2
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
C2H5OH+O2=2CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cl + SrI2 = SrCl2 + I2Cl + SrI2 = SrCl2 + 2I
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H6 + O2 = CO2 +H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CH3CH2CH2CH3 + O2 =CO2 +H202CH3CH2CH2CH3 + 8O2 = 8CO2 + H20
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
Cl2+NaBr=NaCl+BrCl2 + 2NaBr = 2NaCl + 2Br
Cu+S=Cu2S2Cu + S = Cu2S
Cu+S=CuSCu + S = CuS
CuS +O2= CuO + SO22CuS + 3O2 = 2CuO + 2SO2
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H8O2 + C5H12O = C9H18O2 + H2O C4H8O2 + C5H12O = C9H18O2 + H2O
C4H8O2 + C5H12O + = C9H18O2 + H2O + C4H8O2 + C5H12O+ = C9H18O2 + H2O+
C4H8O2 + C5H12O + = C9H18O2 + H2O + C4H8O2 + C5H12O+ = C9H18O2 + H2O+
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CuI2+Fe=FeI2+CuCuI2 + Fe = FeI2 + Cu
CaCl2+Na3PO4=NaCl+Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
Cl2+FeBr =FeCl3+Br23Cl2 + 2FeBr = 2FeCl3 + Br2
CS2(l)+3O2(g)=CO2(g)+2SO2(g)CS2(l) + 3O2(g) = CO2(g) + 2SO2(g)
C3H5OH + O2 = CO2 + H2010C3H5OH + 25O2 = 30CO2 + 3H20
C3H5NO3 + O2 = CO2 + H2O + NO24C3H5NO3 + 15O2 = 12CO2 + 10H2O + 4NO2
Ca(OH)2+NH3=H2O+Ca3N23Ca(OH)2 + 2NH3 = 6H2O + Ca3N2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8 + 5 O2= CO2 + 4 H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C6H12O6(s)=C(s)+H2O(g)C6H12O6(s) = 6C(s) + 6H2O(g)
C2H4O2 +NaHCO3 = NaC2H3O2 +H2CO3C2H4O2 + NaHCO3 = NaC2H3O2 + H2CO3
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C57H110O6 + O2 = CO2 + H2O2C57H110O6 + 163O2 = 114CO2 + 110H2O
C2 H1206 + O2 = CO2 + H2O2C2H1206 + 607O2 = 4CO2 + 1206H2O
C2H12O6 + O2 = CO2 + H2OC2H12O6 + 2O2 = 2CO2 + 6H2O
C2 H1206 + O2 = CO2 + H2O2C2H1206 + 607O2 = 4CO2 + 1206H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C6H6 + O2 = CO2 + H2010C6H6 + 60O2 = 60CO2 + 3H20
Cs + N2 = Cs3N6Cs + N2 = 2Cs3N
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(OH)2+NH4Cl=NH4OH+CaCl2Ca(OH)2 + 2NH4Cl = 2NH4OH + CaCl2
C + S8 = CS24C + S8 = 4CS2
Cl+SrI2=SrCl2+I2Cl + SrI2 = SrCl2 + 2I
Ca3(PO4)2 + H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C4H10(g) + O2 = CO2 + H2O2C4H10(g) + 13O2 = 8CO2 + 10H2O
Cu+HNO3=Cu(NO2) 2+CuOH3Cu + 2HNO3 = Cu(NO2)2 + 2CuOH
Cu+HNO3=CuNO2+CuOH2Cu + HNO3 = CuNO2 + CuOH
C4H6(g)+O2(g)=CO2(g)+H2O(l)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(l)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaS + 2HCl = CaCl2 + H2SCaS + 2HCl = CaCl2 + H2S
CH3OCH3+O=CO2+H2OCH3OCH3 + 6O = 2CO2 + 3H2O
CH3CH2OH(g)+O2(g)=HC2H3O2(g)+H2O(g)CH3CH2OH(g) + O2(g) = HC2H3O2(g) + H2O(g)
CS2(s)+O2(g)=CS2O2(s)CS2(s) + O2(g) = CS2O2(s)
CO+O2=CO22CO + O2 = 2CO2
Cl + Na = NaClCl + Na = NaCl
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C4H6 (g) + O2 (g) = CO2 (g) +H2O (l)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(l)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.