Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CuS + HNO3 = Cu(NO3)2 + S + H2O + NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
Cu + HNO3 = NO2 + H2O + Cu(NO3)2Cu + 4HNO3 = 2NO2 + 2H2O + Cu(NO3)2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
C + HNO3 = N2 + CO2 + H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
C + HNO3 = N2 + CO2 + H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
C + HNO3 = CO2 + NO2 +H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
Cr2S3 + Mn(NO3)2 + Na2CO3 = NO + CO2 + Na2CrO4 + Na2MnO4 + Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4 + 2O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H4O2 + C5H12O = C7H14O2 + H2OC2H4O2 + C5H12O = C7H14O2 + H2O
C3H8(g)+O2(g) = CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3COOH(l)+O2(g) = CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CaO + HCl = CaCl2 + H2OCaO + 2HCl = CaCl2 + H2O
C3H5N6O9 = CO2 + N2 + H2O + O24C3H5N6O9 = 12CO2 + 12N2 + 10H2O + O2
Ca + HOH = Ca(OH) + H22Ca + 2HOH = 2Ca(OH) + H2
CrCl3 + KOH + KClO3 = KCl + K2CrO4 + H2O2CrCl3 + 10KOH + KClO3 = 7KCl + 2K2CrO4 + 5H2O
CrCl3 + KOH + K + KClO3 + = KCl + K2CrO4 + H2OCrCl3 + 8KOH - 3K + 0KClO3+ = 3KCl + K2CrO4 + 4H2O
CrCl3 + KOH + K + KClO3 + = KCl + K2CrO4 + H2OCrCl3 + 8KOH - 3K + 0KClO3+ = 3KCl + K2CrO4 + 4H2O
Cu + H2SO2=CuSO4 + SO2 + H2O -1Cu + 2H2SO2 = -1CuSO4 + 3SO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2 + Fl2 =Cl2Fl2Cl2 + Fl2 = Cl2Fl2
CaCl2 + 2Na=2NaCl + CaCaCl2 + 2Na = 2NaCl + Ca
Cu + HNO3 = Cu(NO3)2 +NO+ H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C9H10Cl2N2O + H2O2 = H2O + CO2 + Cl + NC9H10Cl2N2O + 22H2O2 = 27H2O + 9CO2 + 2Cl + 2N
C2H6 + O2 = H2O = CO22C2H6 + 7O2 = 6H2O + 4CO2
C2H8+O2=C02+H2OC2H8 + 2O2 = C02 + 4H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CuO+HNO3=Cu(NO3)2+H2OCuO + 2HNO3 = Cu(NO3)2 + H2O
CO2(g)+4H2(g)=CH4(g)+2H2O(g)CO2(g) + 4H2(g) = CH4(g) + 2H2O(g)
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C(s) + O2(g) = CO(g)2C(s) + O2(g) = 2CO(g)
C2H5OH+3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Ca3 P2 + H2 O = Ca (O H)2 + P H3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C4 H10 O + O2 = C O2 + H2 OC4H10O + 6O2 = 4CO2 + 5H2O
C4 H10 O + O2 = C O2 + H2 OC4H10O + 6O2 = 4CO2 + 5H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 +O2 =H2O(g)+CO2(g)2C2H6 + 7O2 = 6H2O(g) + 4CO2(g)
Ca+HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = CO2
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
Ca(HCO3)2+Ca(OH)2=CaCO3+H2OCa(HCO3)2 + Ca(OH)2 = 2CaCO3 + 2H2O
Cu + O2 = CuO2Cu + O2 = CuO2
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + H2SO4 = CuSO4 + H2O + SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
Ca + 2 H2O =Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CU+HNO3=CU(NO3)2+H2O+NO3-1CU + 0HNO3 = -1CU(NO3)2 + 0H2O + 2NO3
CU+HNO3=CU(NO3)2+H2O+NO3-1CU + 0HNO3 = -1CU(NO3)2 + 0H2O + 2NO3
C2H2 +O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CuO + NH3 = N2 + Cu + H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
CH3COOH +O2 = CO2 + H2OCH3COOH + 2O2 = 2CO2 + 2H2O
CH3OH + O2 = H2 + COCH3OH + 0O2 = 2H2 + CO
CoS+HNO3=Co(NO3)2+NO+S+H2O3CoS + 8HNO3 = 3Co(NO3)2 + 2NO + 3S + 4H2O
CoS+HNO3=Co(NO3)2+NO+S+H2CoS + 2HNO3 = Co(NO3)2 + 0NO + S + H2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca + HNO3 = Ca(NO3)2 + H2Ca + 2HNO3 = Ca(NO3)2 + H2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
Cu+HNO3= Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3= Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3= Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C6H4OH+7O2= 6CO3+2H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+7O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+O2= CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+7O2= 6CO3+2H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+7O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cu + 4NO4NO3 + 2NO = 5Cu(NO3)25Cu + 4NO4NO3 + 2NO = 5Cu(NO3)2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C12H22O11 = C + H2O C12H22O11 = 12C + 11H2O
Cr2S3+Mn(NO3)2+Na2CO3=NO+CO2+Na2CrO4+Na2MnO4+Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
Ca(s) + HNO3 = CaNO3 (aq) + H (g)Ca(s) + HNO3 = CaNO3(aq) + H(g)
CH3(CH2)4CH3 + O2 = CO2 + H2010CH3(CH2)4CH3 + 60O2 = 60CO2 + 7H20
ClCH2CO2H + O2 = CO + H2O + Cl24ClCH2CO2H + 3O2 = 8CO + 6H2O + 2Cl2
CuCl2+H2=Cu+HClCuCl2 + H2 = Cu + 2HCl
CuCl2+H2=Cu+HClCuCl2 + H2 = Cu + 2HCl
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CrI3+KOH+Cl2=K2CrO4+KIO4+KCl+H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CrI3+NaOH+Cl2=NaIO4+Na2CrO4+NaCl+H2O2CrI3 + 64NaOH + 27Cl2 = 6NaIO4 + 2Na2CrO4 + 54NaCl + 32H2O
C2H6 + 4O2 =2CO2 + 6H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Co++ + BrO- + H+ = Co+++ + Br2 + H2O2Co++ + 2BrO- + 4H+ = 2Co+++ + Br2 + 2H2O
CdS+L2+HCL=CdCL2+HL+SCdS + L2 + HCL = CdCL2 + HL + S
CdS+L2+HCL=CdCL2+HL+SCdS + L2 + HCL = CdCL2 + HL + S
CaC2O4+KMnO4+H2SO4=CaSO4+K2SO4+MnSO4+H2O+CO25CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + K2SO4 + 2MnSO4 + 8H2O + 10CO2
Cu+HNO3=Cu(NO3)2+H2O+NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
C4 H 10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CoCl2 + Cl2 = CoCl32CoCl2 + Cl2 = 2CoCl3
CH3 + S8 = CS2 + HS8CH3 + 5S8 = 8CS2 + 24HS
CH3COOH( aq) + NaOH( aq) =H2O (l) + NaCH3CO2( aq)CH3COOH(aq) + NaOH(aq) = H2O(l) + NaCH3CO2(aq)
Co(NO3)2 + Na2CO3 = NaNO3 + CoCO3Co(NO3)2 + Na2CO3 = 2NaNO3 + CoCO3
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4 + O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CuSO4+Zn=Cu+ZnSO4CuSO4 + Zn = Cu + ZnSO4
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + H2O = CO2 + H2O0C4H10 + H2O = 0CO2 + H2O
C+O2=CO2C + O2 = CO2
Cu + HNO3 + H2SO4 = CuSO4 + NO + H2O3Cu + 2HNO3 + 3H2SO4 = 3CuSO4 + 2NO + 4H2O
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
CO2 + C = COCO2 + C = 2CO
CO(g) + H2O(g) = CO2(g) + H2(g)CO(g) + H2O(g) = CO2(g) + H2(g)
Cu2CO3(OH)2(s) + C(s) = Cu(s) + CO2(g) + H2O(g)Cu2CO3(OH)2(s) + C(s) = 2Cu(s) + 2CO2(g) + H2O(g)
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cu2O(s) + Cu2S(s) = Cu(s) + SO2(g)2Cu2O(s) + Cu2S(s) = 6Cu(s) + SO2(g)
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Cu2O(s) + C(s) = Cu(s) + CO2(g)2Cu2O(s) + C(s) = 4Cu(s) + CO2(g)
CO(g) + H2O(g) = CO2(g) + H2(g)CO(g) + H2O(g) = CO2(g) + H2(g)
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6+O=CO+H2OC2H6 + 5O = 2CO + 3H2O
CaCO3 + H3PO4 = CaHPO4 + CO2 + H2OCaCO3 + H3PO4 = CaHPO4 + CO2 + H2O
CH3COOC2H5 = CH3CH2OH + C2H5OH0CH3COOC2H5 = -1CH3CH2OH + C2H5OH
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Cl2 + KI = KCl + ICl2 + 2KI = 2KCl + 2I
CaCO3 + H3PO4 = CO2 + H2O + Ca3(PO4)23CaCO3 + 2H3PO4 = 3CO2 + 3H2O + Ca3(PO4)2
C3H8+ O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
CaCO3 +HCl = CaCl2 + CO2 +H2O=CaCO3 + 2HCl = CaCl2 + CO2 + H2O
C + H2 + O = CH2OC + H2 + O = CH2O
CH4 + 2 O2 = CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3+2HCl =CaCl2 +H2O +CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2OH + 3O2=2CO2+3H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca + O2= CaO2Ca + O2 = 2CaO
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cu2O=Cu+O22Cu2O = 4Cu + O2
CO2+H2=CH4+H2OCO2 + 4H2 = CH4 + 2H2O
CaCO3=CaO + CO2CaCO3 = CaO + CO2
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCl2+(NH4)2CO3=CaCO3+NH4ClCaCl2 + (NH4)2CO3 = CaCO3 + 2NH4Cl
CaCO3+H3PO4=Ca3(PO4)2+CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
Ca+O2=CaO2Ca + O2 = 2CaO
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2(g) + KOH(aq) = KClO3(aq) + KCl(aq) + H2O(l)3Cl2(g) + 6KOH(aq) = KClO3(aq) + 5KCl(aq) + 3H2O(l)
Ca + 2 H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CO2+H=H2O+CCO2 + 4H = 2H2O + C
C2H2 + O2 =H2O + CO22C2H2 + 5O2 = 2H2O + 4CO2
Cu + 2H2SO4 = CuSO4 + SO2 + 2H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C+H2SO4=CO2+H2O+SO2C + 2H2SO4 = CO2 + 2H2O + 2SO2
C3H3(NO3)3 = CO2 + H2O + N2 + O24C3H3(NO3)3 = 12CO2 + 6H2O + 6N2 + 3O2
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CrCl3 + AgNO3 = Cr(NO3)3 + AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
C + Fe2O3=Fe + CO3C + Fe2O3 = 2Fe + 3CO
C + Fe2O3=Fe + CO3C + Fe2O3 = 2Fe + 3CO
CaCO3 +(NH4)2HPO4 + H2O = Ca10(PO4)6(OH)2+(NH4)2+ CO2+H2O0CaCO3 + 0(NH4)2HPO4 + H2O = 0Ca10(PO4)6(OH)2 + 0(NH4)2 + 0CO2 + H2O
CH3COOH+NaHCO3= Na(CH3COO)2 +H2O +CO215CH3COOH + 8NaHCO3 = 8Na(CH3COO)2 + 10H2O + 6CO2
Cu + HNO3 = Cu(NO3)2 + NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH3OOH + Mg = MgCH3OO + H22CH3OOH + 2Mg = 2MgCH3OO + H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6O+H2=C2H8OC2H6O + H2 = C2H8O
CaCO3 + H3PO4 = Ca3(PO4)2 + CO2 + H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C6H14 + O2 = C O2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6 H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = C02 + H2O2C6H14 + 7O2 = 6C02 + 14H2O
C48H100O6+O2=48CO2+50H2OC48H100O6 + 70O2 = 48CO2 + 50H2O
C6H12O6+O2 = C6O2+6H6OC6H12O6 - O2 = C6O2 + 2H6O
Cr + S8 = Cr2S316Cr + 3S8 = 8Cr2S3
Cr + S8 = Cr2S316Cr + 3S8 = 8Cr2S3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH4+O2= CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2 +KBr=Br2 +KClCl2 + 2KBr = Br2 + 2KCl
C2H5OCH3(g) + O2(g) = CO2(g) + H2O2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3 H8 + O2 = C O2 + H2 OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C3H8+5O2=2CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10+O2 = CO2 + H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 + Ca(OH)2 = CaCO3 + H2OCO2 + Ca(OH)2 = CaCO3 + H2O
CS2(l) + Cl2(g) = CCl4(s) + S2Cl2(g)CS2(l) + 3Cl2(g) = CCl4(s) + S2Cl2(g)
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C + O2 = CO2C + O2 = 2CO
CH3CH2OH+O2=CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CS2+CaO=CO2+CaSCS2 + 2CaO = CO2 + 2CaS
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CrCl3+ Na2CO3=Cr2(CO3)3 + NaCl2CrCl3 + 3Na2CO3 = Cr2(CO3)3 + 6NaCl
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
C2H4 + L2=C2H4L2C2H4 + L2 = C2H4L2
C2H4 + L2=C2H4L2C2H4 + L2 = C2H4L2
CrI3 + Cl2 + KOH = KIO4 + K2CrO4 + KCl + H2O2CrI3 + 27Cl2 + 64KOH = 6KIO4 + 2K2CrO4 + 54KCl + 32H2O
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH3CH2OH+O2=CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2+H3PO3=H2O+Ca3(PO3)23Ca(OH)2 + 2H3PO3 = 6H2O + Ca3(PO3)2
CrI3 + Cl2 + NaOH = NaCl + Na2CrO4 + NaIO4 + H2O2CrI3 + 27Cl2 + 64NaOH = 54NaCl + 2Na2CrO4 + 6NaIO4 + 32H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cr2O3 + Na2CO3 + KNO3 = Na2CrO4 + CO2 + KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cr2O3 + Na2CO3 + KNO3 = Na2CrO4 + CO2 + KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
CrI3+Cl2+KOH=K2CrO4+3KIO3+KCl+H2O2CrI3 + 21Cl2 + 52KOH = 2K2CrO4 + 6KIO3 + 42KCl + 26H2O
CuSO4+KI=CuI+K2SO4+I22CuSO4 + 4KI = 2CuI + 2K2SO4 + I2
CuSO4+PH3=Cu3P2+H2SO43CuSO4 + 2PH3 = Cu3P2 + 3H2SO4
CuSO4+PH3=Cu3P2+H2SO43CuSO4 + 2PH3 = Cu3P2 + 3H2SO4
Cu+HNO3=Cu(NO3)2+H2O+N25Cu + 12HNO3 = 5Cu(NO3)2 + 6H2O + N2
Cu+HNO3=Cu(NO3)2+H2O+N25Cu + 12HNO3 = 5Cu(NO3)2 + 6H2O + N2
Ca(ClO4)2(aq) + K2CO3(aq) = CaCO3(s) + KClO4(aq)Ca(ClO4)2(aq) + K2CO3(aq) = CaCO3(s) + 2KClO4(aq)
CuO+NH3=Cu+N2+H2O3CuO + 2NH3 = 3Cu + N2 + 3H2O
Cu+HNO3=Cu (NO3) 2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cl2 + KBr = KCl + Br2Cl2 + 2KBr = 2KCl + Br2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6+O2=CO2H2OC6H12O6 + 6O2 = 6CO2H2O
CaO+HCl=CaCl2+H2OCaO + 2HCl = CaCl2 + H2O
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
CO2(g)+H2S(g)=COS(g)+H2O(g)CO2(g) + H2S(g) = COS(g) + H2O(g)
C6H12O6 + O2=CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca3N2+H2O = Ca(OH)2+NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
Cl2 + Na=NaClCl2 + 2Na = 2NaCl
C8H18 + O2 = H2O + CO22C8H18 + 25O2 = 18H2O + 16CO2
Cr2O7 -2 + Fe2+ + H+ = Cr3+ + Fe3+ + H2O3Cr2O7-2 - 102Fe2+ + 42H+ = 2Cr3+ - 68Fe3+ + 21H2O
Ca(OH)2 + NH4Cl = NH3 + CaCl2 + H2OCa(OH)2 + 2NH4Cl = 2NH3 + CaCl2 + 2H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3CH2OH + HI = I2 + 2CH3CH2OHCH3CH2OH + 0HI = 0I2 + CH3CH2OH
Cr+3+MnO2+OH-1=CrO4-2+Mn+2+H2O2Cr+3 + 3MnO2 + 4OH-1 = 2CrO4-2 + 3Mn+2 + 2H2O
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
Cr(OH)3+IO3-1+OH-1=CrO4-2+I-1+H2O2Cr(OH)3 + IO3-1 + 4OH-1 = 2CrO4-2 + I-1 + 5H2O
Cr(OH)3+IO3-1+OH-1=CrO4-2+I-1+H2O2Cr(OH)3 + IO3-1 + 4OH-1 = 2CrO4-2 + I-1 + 5H2O
CO+2+BrO-1+H+1=CO+3+Br2+H2O2CO+2 + 2BrO-1 + 4H+1 = 2CO+3 + Br2 + 2H2O
Cl2+OH-1=Cl-1+ClO3-1+H2O3Cl2 + 6OH-1 = 5Cl-1 + ClO3-1 + 3H2O
Cl2+OH-1=Cl-1+ClO3-1+H2O3Cl2 + 6OH-1 = 5Cl-1 + ClO3-1 + 3H2O
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cl2+H2O2=HCl+O2Cl2 + H2O2 = 2HCl + O2
Cl2+C+H2O=CO2+H+1+Cl-12Cl2 + C + 2H2O = CO2 + 4H+1 + 4Cl-1
Ca3(PO4)2+SiO2+C=CaSiO3+CO+PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
CaC2O4+KMnO4+H2SO4=CaSO4+K2SO4+MnSO4+H2O+CO25CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + K2SO4 + 2MnSO4 + 8H2O + 10CO2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Co + AgNO3 = Co(NO3)2 + AgCo + 2AgNO3 = Co(NO3)2 + 2Ag
Ca + HF = CaF2 + H2Ca + 2HF = CaF2 + H2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Ca (C2H3O2)2 + K3PO4 = Ca3(PO4)2 + KC2H3O23Ca(C2H3O2)2 + 2K3PO4 = Ca3(PO4)2 + 6KC2H3O2
Cs + H2O = H2 + CsOCs + H2O = H2 + CsO
Ca(OH)2 + H3PO3 =H2O + Ca3(PO3)23Ca(OH)2 + 2H3PO3 = 6H2O + Ca3(PO3)2
C3H8 (g) + O2 (g) =CO2 (g) + H2O (g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C+O2=CO2C + O2 = CO2
Ca(CN)2+HBr =CaBr2+HCNCa(CN)2 + 2HBr = CaBr2 + 2HCN
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2+NH4Cl=CaCl2+NH3+H2OCa(OH)2 + 2NH4Cl = CaCl2 + 2NH3 + 2H2O
CaCl2 + H2SO4 =CaSO4 + HClCaCl2 + H2SO4 = CaSO4 + 2HCl
CH3(CH2)CH3 + O2 = CO2 + H2OCH3(CH2)CH3 + 5O2 = 3CO2 + 4H2O
C5H15O6N + O2 = CO2 + H2O + NH44C5H15O6N + 19O2 = 20CO2 + 22H2O + 4NH4
C2H5OCH3 + O2 = CO2 + H2O2C2H5OCH3 + 9O2 = 6CO2 + 8H2O
C2H5OCH3 + O2 = CO2 + H2O2C2H5OCH3 + 9O2 = 6CO2 + 8H2O
C5H15O6N + O2 = CO2 + H2O + NH44C5H15O6N + 19O2 = 20CO2 + 22H2O + 4NH4
C2H5OCH3 + O2 = CO2 + H2O2C2H5OCH3 + 9O2 = 6CO2 + 8H2O
C2H5OCH3 + O2 = CO2 + H2O2C2H5OCH3 + 9O2 = 6CO2 + 8H2O
Cl2(g) + PCl3(g) = PCl5(g) Cl2(g) + PCl3(g) = PCl5(g)
CS2 + CaO= CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2 + SiO2 +C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3NHCH3 + O2 = CO2 + NO2 + H2O4CH3NHCH3 + 19O2 = 8CO2 + 4NO2 + 14H2O
C + H2 = C2H62C + 3H2 = C2H6
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
C4 H 10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCO3(s)+2HCl(aq)=H2O(l)+CO2(g)+CaCl2(aq)CaCO3(s) + 2HCl(aq) = H2O(l) + CO2(g) + CaCl2(aq)
CaCO3+2HCl=H2O+CO2+CaCl2CaCO3 + 2HCl = H2O + CO2 + CaCl2
CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4(g)+Br2(g)=CBr4(g) + HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3P2+H2O=PH3+Ca(OH)2Ca3P2 + 6H2O = 2PH3 + 3Ca(OH)2
Cu(NO3)2 + NaOH = Na(NO3)2 + CuOHCu(NO3)2 + NaOH = Na(NO3)2 + CuOH
C(s) + O2(g) = CO2(g)C(s) + O2(g) = CO2(g)
Cu(OH)2+H2O=Cu(H2O)2+OHCu(OH)2 + 2H2O = Cu(H2O)2 + 2OH
Cu(OH)2+H2O=Cu(H2O)2+4OHCu(OH)2 + 2H2O = Cu(H2O)2 + 2OH
Cu(OH)2+H2O=Cu(H2O)2+OHCu(OH)2 + 2H2O = Cu(H2O)2 + 2OH
C4 H 10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CoCl2 + Cl2 = CoCl32CoCl2 + Cl2 = 2CoCl3
Co + F2 = CoF32Co + 3F2 = 2CoF3
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Co + F2 = CoF32Co + 3F2 = 2CoF3
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CrI3+Cl2+NaOH=Na2CrO4+NaIO4+NaCl+H2O2CrI3 + 27Cl2 + 64NaOH = 2Na2CrO4 + 6NaIO4 + 54NaCl + 32H2O
Cu + Ag(NO3)= Cu(NO3) + AgCu + Ag(NO3) = Cu(NO3) + Ag
Cu + Ag(NO3)= Cu(NO3) + AgCu + Ag(NO3) = Cu(NO3) + Ag
C2 H6 + O2 = C O2+H2 O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C O2 + H2 O = C6 H12 O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Cr2O7-- + SO3--+ H+ = Cr+++ + SO4--+ H2OCr2O7-- + 3SO3-- + 8H+ = 2Cr+++ + 3SO4-- + 4H2O
Cr3 + Hg Cl2 = Cr3Cl2 + HgCr3 + HgCl2 = Cr3Cl2 + Hg
Cr3 + Na (OH) = Cr3(OH) + NaCr3 + Na(OH) = Cr3(OH) + Na
Cr3 + 2Na (OH) = Cr3(OH)2 + 2NaCr3 + 2Na(OH) = Cr3(OH)2 + 2Na
Cr3 + 3Hg Cl2 = Cr3(Cl2)3 + 3HgCr3 + 3HgCl2 = Cr3(Cl2)3 + 3Hg
C2H4 + H2O=CO2 + H2O0C2H4 + H2O = 0CO2 + H2O
Cr2S3+Mn(NO3)2+Na2CO3=NO+CO2+Na2CrO4+Na2MnO4+Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
Cu + HNO3 = Cu(NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Ca + H2O = H + CaOHCa + H2O = H + CaOH
Cr + Ag NO3 = CrNO3 + AgCr + AgNO3 = CrNO3 + Ag
Cr + Fe Cl3 = Cr Cl3 + FeCr + FeCl3 = CrCl3 + Fe
Cr + K4 Fe (CN)6 = CrFe (CN)6 + K4 Cr + K4Fe(CN)6 = CrFe(CN)6 + K4
Cr + 2Na (OH) = Cr(OH)2 + 2NaCr + 2Na(OH) = Cr(OH)2 + 2Na
Cr + NH4 SCN = Cr(SCN) + NH4Cr + NH4SCN = Cr(SCN) + NH4
Cr + Na2 CO3 = Cr CO3 + 2NaCr + Na2CO3 = CrCO3 + 2Na
Cr + Hg Cl2 = CrCl2 + HgCr + HgCl2 = CrCl2 + Hg
C +O2=CO2C + O2 = 2CO
C2H5OH(l)+O2(g)=CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Cr2O7 2- + Fe2+ +H+ = Fe3+ + Cr3+ + H2O3Cr2O72- - 1281Fe2+ + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Cr2O7 2- + Fe2+ +H+ = Fe3+ + Cr3+ + H2O3Cr2O72- - 1281Fe2+ + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Cr2O7 2- + Fe2+ +H+ = Fe3+ + Cr3+ + H2O3Cr2O72- - 1281Fe2+ + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Cr2O7 2- + Fe2+ +H+ = Fe3+ + Cr3+ + H2O3Cr2O72- - 1281Fe2+ + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Cr2O7 2- + Fe2+ +H+ = Fe3+ + Cr3+ + H2O3Cr2O72- - 1281Fe2+ + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Cr2O7 2- + Fe2+ +H+ = Fe3+ + Cr3+ + H2O3Cr2O72- - 1281Fe2+ + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Cr2O72- + Fe2+ +H+ = Fe3+ + Cr3+ + H2O3Cr2O72- - 1281Fe2+ + 432H+ = -854Fe3+ + 2Cr3+ + 216H2O
Cu2S + O2 = Cu2O + S2O 4Cu2S + 3O2 = 4Cu2O + 2S2O
CH4 + O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H4 + O2 = CO2 + H205C2H4 + 10O2 = 10CO2 + H20
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C4H10+Cr2O72-+H+=H6C4O4 +Cr3+ +H2O427C4H10 + 36Cr2O72- + 60H+ = 427H6C4O4 + 24Cr3+ + 884H2O
CO2+Ca(OH)2=CaCO3+H2OCO2 + Ca(OH)2 = CaCO3 + H2O
C2H5OH + CO = H2O + CO2 -1C2H5OH + 6CO = -3H2O + 4CO2
Ca+O2=CaO2Ca + O2 = 2CaO
CaCl2 + Na3PO4=Ca3 (PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
Cr2S3+Mn(NO3)2+K2CO3=K2CrO4+K2SO4+K2MnO4+NO2+CO2-1Cr2S3 + 15Mn(NO3)2 + 10K2CO3 = -2K2CrO4 - 3K2SO4 + 15K2MnO4 + 30NO2 + 10CO2
Cr2S3+Mn(NO3)2+K2CO3=K2CrO4+K2SO4+K2MnO4+NO2+CO2-1Cr2S3 + 15Mn(NO3)2 + 10K2CO3 = -2K2CrO4 - 3K2SO4 + 15K2MnO4 + 30NO2 + 10CO2
Ca(NO3)2 + NaCl=CaNa2 + NO3ClCa(NO3)2 + 2NaCl = CaNa2 + 2NO3Cl
C2H5OH+K2Cr2O7+H2SO4=CH3COOH+Cr2(SO4)3+K2SO4+H2O3C2H5OH + 2K2Cr2O7 + 8H2SO4 = 3CH3COOH + 2Cr2(SO4)3 + 2K2SO4 + 11H2O
C2H5OH + O2 = 2CO2 + H2O C2H5OH + 3O2 = 2CO2 + 3H2O
C5H10OH+K2Cr2O7+H2SO4=CH3COOH+Cr2(SO4)3+K2SO4+H2O2C5H10OH + 3K2Cr2O7 + 12H2SO4 = 5CH3COOH + 3Cr2(SO4)3 + 3K2SO4 + 13H2O
C5H10OH+K2Cr2O7+H2SO4=CH3COOH+Cr2(SO4)3+K2SO4+H2O2C5H10OH + 3K2Cr2O7 + 12H2SO4 = 5CH3COOH + 3Cr2(SO4)3 + 3K2SO4 + 13H2O
CrCl3 + AgNO3 = Cr(NO3)3 + AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
Cu(NO3)2 = CuO + NO2 + O2 2Cu(NO3)2 = 2CuO + 4NO2 + O2
C3H5(NO3)3 = CO2 + H2O + N2 + O2 4C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
Cu2O(s) + C(s) = Cu(s) + CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Ca+SnCl4=CaCl4+SnCa + SnCl4 = CaCl4 + Sn
CuSO4+NH4Cl=CuCl+NH4SO4CuSO4 + NH4Cl = CuCl + NH4SO4
Ca+MgSO4=CaSO4+MgCa + MgSO4 = CaSO4 + Mg
CuCl2=Cu+ClCuCl2 = Cu + 2Cl
C3H4+O2=CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
Cu2 + H2SO4 = SO2 + CuSO4 + H2OCu2 + 4H2SO4 = 2SO2 + 2CuSO4 + 4H2O
C6H12O2 + O2 = CO2 + H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
Cu +H2SO4 =SO2 + CuSO4+H2OCu + 2H2SO4 = SO2 + CuSO4 + 2H2O
Cu +H2SO4 =SO2 + CuSO4+H2OCu + 2H2SO4 = SO2 + CuSO4 + 2H2O
CH3CH2OH + 3O2 = 2CO2 + 3H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cr2S3+Mn(NO3)2+K2CO3=K2CrO4+K2SO4+K2MnO4+NO2+CO2-1Cr2S3 + 15Mn(NO3)2 + 10K2CO3 = -2K2CrO4 - 3K2SO4 + 15K2MnO4 + 30NO2 + 10CO2
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H6+O2=CO2+H2010C6H6 + 60O2 = 60CO2 + 3H20
Cr2+ +H+=Cr3+ + H2-6Cr2+ + 2H+ = -4Cr3+ + H2
CH4+Cl2=CCl4+H2CH4 + 2Cl2 = CCl4 + 2H2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CuS+O2=Cu2O+SO24CuS + 5O2 = 2Cu2O + 4SO2
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
CrCl3+Na2Co3=Cr2(Co3)3+NaCl2CrCl3 + 3Na2Co3 = Cr2(Co3)3 + 6NaCl
C3H5(NO3)3 = N2 + H2O + CO2 + O24C3H5(NO3)3 = 6N2 + 10H2O + 12CO2 + O2
C+HNO3 = CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
CrO4 + HSnO2 = CrO2 + HSnO3CrO4 + 2HSnO2 = CrO2 + 2HSnO3
C2H3Cl3+O2=CO2+HClC2H3Cl3 + 2O2 = 2CO2 + 3HCl
CH5N+O2=CO2+H2O+NO2 4CH5N + 13O2 = 4CO2 + 10H2O + 4NO2
CH5N+O2=CO2+H2O+NO2 4CH5N + 13O2 = 4CO2 + 10H2O + 4NO2
CH5N+O2=CO2+H2O+NO24CH5N + 13O2 = 4CO2 + 10H2O + 4NO2
C2H3O2Cl+O2=CO2+H2O+HCl2C2H3O2Cl + 3O2 = 4CO2 + 2H2O + 2HCl
C6H6O3+O2 = CO+H2OC6H6O3 + 3O2 = 6CO + 3H2O
C2H5NSCl+ O2 = CO2+ H2O+ NO+ SO3+ HClC2H5NSCl + 5O2 = 2CO2 + 2H2O + NO + SO3 + HCl
Cr(NO3)3+Fe(NO3)3+Zn(NO3)2+CH4N2O=ZnFe2Cr2O4+CO2+H2O+N26Cr(NO3)3 + 6Fe(NO3)3 + 3Zn(NO3)2 + 38CH4N2O = 3ZnFe2Cr2O4 + 38CO2 + 76H2O + 59N2
C2H4 + O2 = CO + H2OC2H4 + 2O2 = 2CO + 2H2O
C2H5OCH3(g) + O2(g) = CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
Cr2S3 +Mn(NO3)2 +K2CO3 = K2CrO4 + K2SO4+K2MnO4+NO2+CO2-1Cr2S3 + 15Mn(NO3)2 + 10K2CO3 = -2K2CrO4 - 3K2SO4 + 15K2MnO4 + 30NO2 + 10CO2
Cr2S3+Mn(NO3)2+K2CO3=K2CrO4+K2SO4+K2MnO4+NO2+CO2-1Cr2S3 + 15Mn(NO3)2 + 10K2CO3 = -2K2CrO4 - 3K2SO4 + 15K2MnO4 + 30NO2 + 10CO2
Cr2S3+Mn(NO3)2+K2CO3=K2CrO4+K2SO4+K2MnO4+NO2+CO2-1Cr2S3 + 15Mn(NO3)2 + 10K2CO3 = -2K2CrO4 - 3K2SO4 + 15K2MnO4 + 30NO2 + 10CO2
Ca+O2=CaO2Ca + O2 = 2CaO
CaCl2+F2=CaF2+Cl2CaCl2 + F2 = CaF2 + Cl2
CaCO3 = CaO =CO2CaCO3 = CaO + CO2
Ca+O2=CaO2Ca + O2 = 2CaO
Cu+H2O=CuO+H2Cu + H2O = CuO + H2
Cu+H2O=CuO+H2Cu + H2O = CuO + H2
Ca + O2 = CaO2Ca + O2 = 2CaO
CO2 + CaSiO3 + H2O=SiO2 + Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
CH3OH + O2 = 2CO2 + 3H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C+H2=CH4C + 2H2 = CH4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CO+H2O=CO2+H2CO + H2O = CO2 + H2
CH4 + O2 = H2O + CO2CH4 + 2O2 = 2H2O + CO2
C3H8O3 + O2 = CO2 + H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H14O + O2 = CO2 + H2OC6H14O + 9O2 = 6CO2 + 7H2O
Cl2 + KI = KCl + I2Cl2 + 2KI = 2KCl + I2
C6H5Cl + O2 = CO2 +H2O + Cl24C6H5Cl + 29O2 = 24CO2 + 10H2O + 2Cl2
C4H8S + O2 = CO2 + H2O + SO32C4H8S + 15O2 = 8CO2 + 8H2O + 2SO3
C2H3Cl + O2 = CO + H2O + Cl24C2H3Cl + 7O2 = 8CO + 6H2O + 2Cl2
C3H6O3 + O2 = CO2 + H2OC3H6O3 + 3O2 = 3CO2 + 3H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
ClO4- + NH4+ = Cl- + N2 + H2O + H+3ClO4- + 8NH4+ = 3Cl- + 4N2 + 12H2O + 8H+
C8H18+O2 = CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2 = CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
CaCl2(aq)+Na2SO4(aq)=NaCl(aq)+CaSO4(s)CaCl2(aq) + Na2SO4(aq) = 2NaCl(aq) + CaSO4(s)
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14+O2=CO2+H2C6H14 + 6O2 = 6CO2 + 7H2
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
CO + O2 = CO22CO + O2 = 2CO2
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CuSO4+Fe=CuFeSO4CuSO4 + Fe = CuFeSO4
Cl2+KI=Cl2KICl2 + KI = Cl2KI
CuCl2+I2=CuCl2I2CuCl2 + I2 = CuCl2I2
C6H6O2+O2=CO2+H2O2C6H6O2 + 13O2 = 12CO2 + 6H2O
Cl2+KI=Cl2KICl2 + KI = Cl2KI
Cu+Ag2SO4=Cu2SO4+Ag2Cu + Ag2SO4 = Cu2SO4 + 2Ag
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
Cu(OH)2 + 2HNO3 = Cu(NO3)2 + 2H2OCu(OH)2 + 2HNO3 = Cu(NO3)2 + 2H2O
Cu + ZnCl2= CuCl2 + ZnCu + ZnCl2 = CuCl2 + Zn
Cu + MgCl2= CuCl2 + MgCu + MgCl2 = CuCl2 + Mg
Cu + MgCl2= CuCl2 + MgCu + MgCl2 = CuCl2 + Mg
CaO+MgF2=CaF2+MgOCaO + MgF2 = CaF2 + MgO
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H6 + O2 = 3CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CuCl2+AgNo3=CuNo3+AgCl2CuCl2 + AgNo3 = CuNo3 + AgCl2
CS2 + S2Cl2 = S8 + CCl44CS2 + 8S2Cl2 = 3S8 + 4CCl4
CS2 + Cl2 = S2Cl2 + CCl4CS2 + 3Cl2 = S2Cl2 + CCl4
C2H5SH(l) + O2(g) =CO2(g) + H2O(l) + SO2(g)2C2H5SH(l) + 9O2(g) = 4CO2(g) + 6H2O(l) + 2SO2(g)
C6H14(l) + O2(g) =CO2(g) + H2O(l)2C6H14(l) + 19O2(g) = 12CO2(g) + 14H2O(l)
C6H14(l) + O2(g) =CO2(g) + H2O(l)2C6H14(l) + 19O2(g) = 12CO2(g) + 14H2O(l)
CH 4 (g)+O 2 (g)=CO 2 (g)+H 2 O(g) CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CrCl3 + Na2S2O8 + NaOH = Na2Cr2O7 + Na2SO4 + NaCl + H2O2CrCl3 + 3Na2S2O8 + 14NaOH = Na2Cr2O7 + 6Na2SO4 + 6NaCl + 7H2O
C + S8 =CS24C + S8 = 4CS2
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H202C4H10 + 8O2 = 8CO2 + H20
Ca3(PO4)2+SiO2+C=CaSiO3+CO+P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
Ca3(PO4)2+SiO2+C=CaSiO+CO+P42Ca3(PO4)2 + 6SiO2 + 22C = 6CaSiO + 22CO + P4
C2H6 + 3O2=2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + 3O2=2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H6 + 3O2= 3CO2 + 3H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CrCl3 + H2O2 + NaOH = NaCrO4 + NaCl + H2OCrCl3 + 2H2O2 + 4NaOH = NaCrO4 + 3NaCl + 4H2O
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO (g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.