Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CuO + 2 H3O + 3 H2O = Cu(H2O)6 CuO + 2H3O + 3H2O = Cu(H2O)6
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
Cu + AgNO3 = CuNO3 +Ag Cu + AgNO3 = CuNO3 + Ag
Cu (s )+ AgNO3 (aq) = CuNO3 (aq) +Ag (s)Cu(s) + AgNO3(aq) = CuNO3(aq) + Ag(s)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cr2O3 + Na2CO3 + KNO3 = Na2CrO4 + CO2+ KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
C3H8(g)  +  O2(g) = CO2(g)  +  H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C4H10O+NaBr+H2SO4=H2O+NaHSO4+C4H9BrC4H10O + NaBr + H2SO4 = H2O + NaHSO4 + C4H9Br
Ca(OH)2 (aq)+ H3PO4 (aq) = Ca3(PO4)2 (aq) + 6H2O (l)3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(aq) + 6H2O(l)
CaC03=Ca0+2C020CaC03 = -1Ca0 + C02
Ca(OH)2 (aq)+ H3PO4 (aq) = Ca3(PO4)2 (aq) + 6H2O (l)3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(aq) + 6H2O(l)
Cr2O7-- + S-- + H+ = Cr+++ + S + H2OCr2O7-- + 3S-- + 14H+ = 2Cr+++ + 3S + 7H2O
CH3SH + CO = CH3CO(SCH3) + 2H2S2CH3SH + CO = CH3CO(SCH3) + H2S
C10H15N(s) + O2(g) = CO2(g) + H2O(g) + NO2(g)4C10H15N(s) + 59O2(g) = 40CO2(g) + 30H2O(g) + 4NO2(g)
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C5H12 + 8O2 = CO2 + 6H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cl2(g)=Cl(Aq)Cl2(g) = 2Cl(Aq)
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5OH + 3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaSO4 + AlBr3 = CaBr2 + Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
CH3COOH+NaHCO3=CH3COONa+H2O+CO2CH3COOH + NaHCO3 = CH3COONa + H2O + CO2
CO2 + H2O =C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
CO(g)+O2=CO22CO(g) + O2 = 2CO2
C7H16 + 11O2 = 7CO2 + 8H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H16 + 5O2=6CO2 + 4H2O C7H16 + 11O2 = 7CO2 + 8H2O
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
CH3(CH2)7CH3+O2=CO2+H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
Ca(NO3)2 *4H2O + Na2SO4 = CaSO4 + NaNO3 + H2OCa(NO3)2*4H2O + Na2SO4 = CaSO4 + 2NaNO3 + 4H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C3H8 + H2O = CO2 + H2C3H8 + 6H2O = 3CO2 + 10H2
CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C+S8=CS24C + S8 = 4CS2
Cr(C2O4)3+Pb(OH)4=Pb(C2O4)2+Cr(OH)62Cr(C2O4)3 + 3Pb(OH)4 = 3Pb(C2O4)2 + 2Cr(OH)6
Cu+ AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CaF2+H2SO4=CaSO4+HFCaF2 + H2SO4 = CaSO4 + 2HF
C2H5OH(l) + O2(g) =CO2(g) + H2O(g)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
C2H4(g) + O2(g) = CO2(g) + H2O(l)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(l)
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = CO2
C5H6O(l) + O2(g) = CO2(g) + H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CH4=C2H6+H22CH4 = C2H6 + H2
CH4=C2H6+H22CH4 = C2H6 + H2
C3H6(g) + O2(g) = CO2(g) + H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cr(OH)3(aq)+H2SO4(aq)=Cr2(SO4)3(aq)+H2O(l)2Cr(OH)3(aq) + 3H2SO4(aq) = Cr2(SO4)3(aq) + 6H2O(l)
CS2 + O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
C6H6 + O2 = CO2 + H2010C6H6 + 60O2 = 60CO2 + 3H20
Ca+ HNO3 = H2+ (CaNO3)2 2Ca + 2HNO3 = H2 + (CaNO3)2
Ca+ HNO3 = H2+ (CaNO3)2 2Ca + 2HNO3 = H2 + (CaNO3)2
Cu+HNO3 = Cu(NO3)2+NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cl2(g) + S8(s) = S2Cl2(l)4Cl2(g) + S8(s) = 4S2Cl2(l)
CoCl2(s) + Al(s) = Co(s) + AlCl3(s)3CoCl2(s) + 2Al(s) = 3Co(s) + 2AlCl3(s)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C5H10O2(l) + O2(g) =CO2(g) + H2O(l)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(l)
CH4(g) + Br2(g) =CBr4(l) + HBr(g)CH4(g) + 4Br2(g) = CBr4(l) + 4HBr(g)
C2H6OS (l) + O2 (g) = H2SO4 (l) + CO2 (g) + H2O (l)2C2H6OS(l) + 9O2(g) = 2H2SO4(l) + 4CO2(g) + 4H2O(l)
C3H8O3+H2O=C3H10O4C3H8O3 + H2O = C3H10O4
Ca + HNO3 = CaNO3 + N2O +H2O8Ca + 10HNO3 = 8CaNO3 + N2O + 5H2O
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C10H8(s)+12O2(g)=10CO2(g)+4H2OC10H8(s) + 12O2(g) = 10CO2(g) + 4H2O
C10H8(s)+12O2(g)=10CO2(g)+4H2OC10H8(s) + 12O2(g) = 10CO2(g) + 4H2O
CH4(g) + O2(s) = H2O + CO2(g)CH4(g) + 2O2(s) = 2H2O + CO2(g)
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCl2 + KOH = Ca(OH)2 + KClCaCl2 + 2KOH = Ca(OH)2 + 2KCl
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca+Fe(NO3)3=Ca(NO3)2+Fe3Ca + 2Fe(NO3)3 = 3Ca(NO3)2 + 2Fe
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
Cr2O3+CCl4=CrCl3+CCl2OCrCl3Cr2O3 + 3CCl4 = -1CrCl3 + 3CCl2OCrCl3
CaC2(g) + H2O(l) = C2H2(g) + Ca(OH)2(aq) CaC2(g) + 2H2O(l) = C2H2(g) + Ca(OH)2(aq)
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr2O3+Si=Cr+SiO22Cr2O3 + 3Si = 4Cr + 3SiO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+H2O = CO+HCH4 + H2O = CO + 6H
CH4+H2O = CO+6HCH4 + H2O = CO + 6H
Ca(NO3)2(aq)+K3PO4(aq)=KNO3(aq)+Ca3(PO4)2(s)3Ca(NO3)2(aq) + 2K3PO4(aq) = 6KNO3(aq) + Ca3(PO4)2(s)
C3H7NO3(aq)+O2(g)=CO2(g)+H2O(l)+CH4N2O(aq)2C3H7NO3(aq) + 5O2(g) = 5CO2(g) + 5H2O(l) + CH4N2O(aq)
CO+H2=CH4OCO + 2H2 = CH4O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Ca3P2(s) + H2O(l) = Ca(OH)2(s) + PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(s) + 2PH3(g)
Ca(C2H3O2)2 = CaCO3 +C3H6OCa(C2H3O2)2 = CaCO3 + C3H6O
CO+H2=CH4OCO + 2H2 = CH4O
C4H8(g)+O2(g)=CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cr (OH)3 +HI = CrI3 +H2OCr(OH)3 + 3HI = CrI3 + 3H2O
CaCO3+H2SO4=CaSO4+CO2+H2OCaCO3 + H2SO4 = CaSO4 + CO2 + H2O
CH4+O2= CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H8+O2= CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
CH4+O2= CO+H2O2CH4 + 3O2 = 2CO + 4H2O
CH3COOH + CaCO3 = Ca(CH3COO)2 + CO2 + H2O2CH3COOH + CaCO3 = Ca(CH3COO)2 + CO2 + H2O
CH3COOH + CaCO3 = Ca(CH3COO) + CO2 + H2O9CH3COOH + 8CaCO3 = 8Ca(CH3COO) + 10CO2 + 6H2O
CH3 + CaCO3 = Ca(CH3COO) + CO2 + H2O9CH3 + 7CaCO3 = 7Ca(CH3COO) + 2CO2 + 3H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
Co(s) + Zn(NO3)2(aq)=Co(NO3)2(aq)+Zn(s)Co(s) + Zn(NO3)2(aq) = Co(NO3)2(aq) + Zn(s)
Cr(OH)3(aq)+H2SO4(aq)=Cr2(SO4)3(aq)+H2O(l)2Cr(OH)3(aq) + 3H2SO4(aq) = Cr2(SO4)3(aq) + 6H2O(l)
Cr2(SO4)3 + Na2CO3 = Cr2(CO3)3 + Na2SO4Cr2(SO4)3 + 3Na2CO3 = Cr2(CO3)3 + 3Na2SO4
C3H8(g)+O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
ClO- + I- + H+ = Cl- + I2 + H2OClO- + 2I- + 2H+ = Cl- + I2 + H2O
CO2(g) + H2O(l) =C6H12O6(s) + O2(g) 6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
CO2(g) + H2O(l) =C6H12O6(s) + O2(g) 6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
Cr2(SO4)3 + NaOH = Cr(OH)3 + Na2SO4Cr2(SO4)3 + 6NaOH = 2Cr(OH)3 + 3Na2SO4
C5H8 (l) + O2 (g) =CO2 (g) + H2O (g)C5H8(l) + 7O2(g) = 5CO2(g) + 4H2O(g)
Ca(ClO)2+HCl=CaCl2+Cl2+H2OCa(ClO)2 + 4HCl = CaCl2 + 2Cl2 + 2H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CuCl2 + KOH = Cu(OH)2 + KClCuCl2 + 2KOH = Cu(OH)2 + 2KCl
Cr2O2+O= CrOCr2O2 + 0O = 2CrO
C4H16 +O2 =CO2 +H2OC4H16 + 8O2 = 4CO2 + 8H2O
C4H16 +O2 =CO2 +H2OC4H16 + 8O2 = 4CO2 + 8H2O
C3H30 +O2 = CO2 +H2O2C3H30 + 21O2 = 6CO2 + 30H2O
C4H22 +O2 = CO2 +H2O2C4H22 + 19O2 = 8CO2 + 22H2O
C3H30 +O2 = CO2 +H2O2C3H30 + 21O2 = 6CO2 + 30H2O
C3H30 +O2 = CO2 +H2O2C3H30 + 21O2 = 6CO2 + 30H2O
C4H16 +O2=CO2 +H2OC4H16 + 8O2 = 4CO2 + 8H2O
C4H16 +O2=CO2 +H2OC4H16 + 8O2 = 4CO2 + 8H2O
C4H22 +O2 = CO2 +H2O2C4H22 + 19O2 = 8CO2 + 22H2O
C2H5OH+6O2=CO+HO2C2H5OH + 7O2 = 4CO + 12HO
C2H5OH+6O2=CO+HO2C2H5OH + 7O2 = 4CO + 12HO
C4H22 +O2=CO2 +H2O2C4H22 + 19O2 = 8CO2 + 22H2O
C3H30 +O2 =CO2 +H2O2C3H30 + 21O2 = 6CO2 + 30H2O
C3H30 +O2= CO2 +H2O2C3H30 + 21O2 = 6CO2 + 30H2O
C4H16 +O2 =CO2 +H2OC4H16 + 8O2 = 4CO2 + 8H2O
C3H30 +O2=CO2 +H2O2C3H30 + 21O2 = 6CO2 + 30H2O
C4H22 +O2 =CO2 +H2O2C4H22 + 19O2 = 8CO2 + 22H2O
C3H30 +O2 = CO2 +H2O2C3H30 + 21O2 = 6CO2 + 30H2O
CH9 +O2 = CO2 +H2020CH9 + 20O2 = 20CO2 + 9H20
CH9 +O2=CO2 +H2020CH9 + 20O2 = 20CO2 + 9H20
C4H22 +O2 =CO2 +H2O2C4H22 + 19O2 = 8CO2 + 22H2O
Ca(ClO3)2 + Li3PO4 = Ca3(PO4)2 + LiClO33Ca(ClO3)2 + 2Li3PO4 = Ca3(PO4)2 + 6LiClO3
Cl2+LiI=LiCl+I2Cl2 + 2LiI = 2LiCl + I2
Cr(C2O4)3+Pb(OH)4=Pb(C2O4)2+Cr(OH)62Cr(C2O4)3 + 3Pb(OH)4 = 3Pb(C2O4)2 + 2Cr(OH)6
Cr(s) + S8(s) = Cr2S3(s)16Cr(s) + 3S8(s) = 8Cr2S3(s)
Cr(s) + O2(g) = Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CaCO3+HCl=CaCl2+H2CO3CaCO3 + 2HCl = CaCl2 + H2CO3
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca(OH)2(aq)+Na3PO4(aq)=Ca3(PO4)2(s)+NaOH(aq)3Ca(OH)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
Cu+AgNO3=CuNO3+AgCu + AgNO3 = CuNO3 + Ag
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
C5H12+CCl4=C5Cl4 + CH12C5H12 + CCl4 = C5Cl4 + CH12
Cr+Cl2=CrCl32Cr + 3Cl2 = 2CrCl3
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+H2S= CuS+ H2Cu + H2S = CuS + H2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=C20+H2O10C2H6 + 15O2 = C20 + 30H2O
CaO+ClH=CaCl2+H2OCaO + 2ClH = CaCl2 + H2O
CuSO4(aq)+Pb(NO3)2(aq)=Cu(NO3)2+PbSO4CuSO4(aq) + Pb(NO3)2(aq) = Cu(NO3)2 + PbSO4
CuCO3 = CO2 + CuOCuCO3 = CO2 + CuO
CoCO3 + NH3=Co(NH3) + CO3CoCO3 + NH3 = Co(NH3) + CO3
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CH3CHO+O2=CO2+H2010CH3CHO + 15O2 = 20CO2 + 2H20
C5H8O2+NaH+HCl=C5H12O2+NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
C7H9+HNO3=C7H6(NO2)3+H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
Ce(NO3)3 + FeSO4 = Fe(NO3)2 + Ce2(SO4)32Ce(NO3)3 + 3FeSO4 = 3Fe(NO3)2 + Ce2(SO4)3
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Ca(s)+AlCl3(s)=CaCl3+AlCa(s) + AlCl3(s) = CaCl3 + Al
Ca(ClO3)2(aq) + Li3PO4(aq) = Ca3(PO4)2(s) + LiClO3(aq)3Ca(ClO3)2(aq) + 2Li3PO4(aq) = Ca3(PO4)2(s) + 6LiClO3(aq)
CO+H2=CH3OHCO + 2H2 = CH3OH
C6H12O6(aq)+O2(g)=CO2(g)+H2O(l)C6H12O6(aq) + 6O2(g) = 6CO2(g) + 6H2O(l)
CO+H2=CH3OHCO + 2H2 = CH3OH
C12H22O11(s) + O2(g) = CO2(g) + H2O(g)C12H22O11(s) + 12O2(g) = 12CO2(g) + 11H2O(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cl2(g)+KI(aq)=KCl(aq)+I2(s)Cl2(g) + 2KI(aq) = 2KCl(aq) + I2(s)
C2H6+O2= CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CoSO4 + KIO3 = Co(IO3)2 + K2SO4CoSO4 + 2KIO3 = Co(IO3)2 + K2SO4
CoSO4 + KIO3 = Co(IO3)2 + K2SO4CoSO4 + 2KIO3 = Co(IO3)2 + K2SO4
Cr(OH)3(aq)+H2SO4(aq)=Cr2(SO4)3(aq)+H2O(l)2Cr(OH)3(aq) + 3H2SO4(aq) = Cr2(SO4)3(aq) + 6H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Co3O4(s)+C(s)=Co(s)+CO(g)Co3O4(s) + 4C(s) = 3Co(s) + 4CO(g)
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + HNO3 = H2O +Ca(NO3)2Ca(OH)2 + 2HNO3 = 2H2O + Ca(NO3)2
Cl + H2O = HCl + O2Cl + H2O = 2HCl + O
Ca(NO3)2+Na2SO4= CaSO4+ NaNO3Ca(NO3)2 + Na2SO4 = CaSO4 + 2NaNO3
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cr(NO3)3 + Na2CO3 = CrCO3 + Na2(NO3)3Cr(NO3)3 + Na2CO3 = CrCO3 + Na2(NO3)3
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C4H6O3 + H2O = C2H4O2C4H6O3 + H2O = 2C2H4O2
C5H8O2 + NaH + HCl = C5H12O2 + NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
C5H8O2 + NaH + HCl = C5H12O2 + NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
C2H6(g) + O2(g) = CO2(g) + H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C6H13OH+O2 = CO2+H2OC6H13OH + 9O2 = 6CO2 + 7H2O
C2H5OH + O2 = CO2 +H2O C2H5OH + 3O2 = 2CO2 + 3H2O
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Cr2O3(s)+H2(g)=Cr(s)+H2O(g)Cr2O3(s) + 3H2(g) = 2Cr(s) + 3H2O(g)
C3H4(g)+4O2(g)=3CO2(g)+2H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
CoBr3 + Ba(OH)2 = BaBr2 + Co(OH)32CoBr3 + 3Ba(OH)2 = 3BaBr2 + 2Co(OH)3
CoBr3 + Ba(OH)2 = BaBr2 + Co(OH)32CoBr3 + 3Ba(OH)2 = 3BaBr2 + 2Co(OH)3
CO(g) + 2O2(g) =2CO2(g)2CO(g) + O2(g) = 2CO2(g)
Ca (s)+H3Po4 (aq)=Ca3 (Po4)2 (s)+H2 (g)3Ca(s) + 2H3Po4(aq) = Ca3(Po4)2(s) + 3H2(g)
Cu + 2AgCLO3 = Cu(CLO3)2 + 2AgCu + 2AgCLO3 = Cu(CLO3)2 + 2Ag
Cu + 2AgCLO3 = Cu(CLO3)2 + 2AgCu + 2AgCLO3 = Cu(CLO3)2 + 2Ag
CO2(g)+ H2O(l)=C6H12O6(aq) +O2(g)6CO2(g) + 6H2O(l) = C6H12O6(aq) + 6O2(g)
CaO+Na2SO4= CaSO4+Na2OCaO + Na2SO4 = CaSO4 + Na2O
CaO+Al2(SO4)3= CaSO4+Al2O33CaO + Al2(SO4)3 = 3CaSO4 + Al2O3
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
C3H7OH + O2 = CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H6O(l)+4O2(g)=3CO2(g)+3H2O(g)C3H6O(l) + 4O2(g) = 3CO2(g) + 3H2O(g)
CoS + H3O+ + NO3- = Co2+ + S + NO + H2O6CoS + 4H3O+ + NO3- = 3Co2+ + 6S + NO + 6H2O
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CS2+3O2=CO2+2SO2CS2 + 3O2 = CO2 + 2SO2
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C3H8+O2=CO+H2O2C3H8 + 7O2 = 6CO + 8H2O
Cr(OH)3(aq)+H2SO4(aq)=Cr2(SO4)3(aq)+H2O(l)2Cr(OH)3(aq) + 3H2SO4(aq) = Cr2(SO4)3(aq) + 6H2O(l)
C22H46 (l) + O2(g) = CO2(g) + H2O(g)2C22H46(l) + 67O2(g) = 44CO2(g) + 46H2O(g)
C7H16 (l) + O2 (g) = CO2(g) + H2O(g)C7H16(l) + 11O2(g) = 7CO2(g) + 8H2O(g)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CO(g) + O2(g) = CO2(g)2CO(g) + O2(g) = 2CO2(g)
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C6H12O6 = 6C + 6H2OC6H12O6 = 6C + 6H2O
C5H10 + MnO3 + H+ = CO + Mn2+ + H2O11C5H10 + 40MnO3 + 20H+ = 55CO + 20Mn2+ + 65H2O
CO2+H2O=H+HCOCO2 - H2O = -3H + HCO
CuCo3+BaCl2=CuBa+Co3Cl2CuCo3 + BaCl2 = CuBa + Co3Cl2
CuCo3+BaCl2=CuBa+Co3Cl2CuCo3 + BaCl2 = CuBa + Co3Cl2
C2H3OCl + O2 = 8CO + H2O + 2Cl24C2H3OCl + 5O2 = 8CO + 6H2O + 2Cl2
Cr(OH)3(aq)+H2SO4(aq)=Cr2(SO4)3(aq)+H2O(l)2Cr(OH)3(aq) + 3H2SO4(aq) = Cr2(SO4)3(aq) + 6H2O(l)
C2H5OH(l)+O2(g)=H2O(l)+CO2(g)C2H5OH(l) + 3O2(g) = 3H2O(l) + 2CO2(g)
C2H3N + 15O2 = CO2 + H2O + 4NO24C2H3N + 15O2 = 8CO2 + 6H2O + 4NO2
Ca(OH)2 + H3PO4 = CaHPO4 + H2OCa(OH)2 + H3PO4 = CaHPO4 + 2H2O
CuO + NH3 = 3Cu + H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
CO2 + H2O = C5H12 + C2H3OH7CO2 + 2H2O = -5C5H12 + 16C2H3OH
CuCl2+(NH4)2C2O4=2NH4Cl+CuC2O4CuCl2 + (NH4)2C2O4 = 2NH4Cl + CuC2O4
C3H8(g)+5O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C 2 H 5 N H 2 (g)+ O 2 (g)=C O 2 (g)+ H 2 O(g)+ N 2 (g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
CaC2(s) + H2O(l) = C2H2(g)+ CaO(s)CaC2(s) + H2O(l) = C2H2(g) + CaO(s)
Cu+HNO3=Cu (NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C4H10+O2=CO2+H202C4H10 + 8O2 = 8CO2 + H20
C a 3 P 2 (s)+ H 2 O(l)=Ca(OH ) 2 (aq)+P H 3 (g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
CrCl3+NaOH=Cr2O3+HCl+NaCl 2CrCl3 + 3NaOH = Cr2O3 + 3HCl + 3NaCl
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2 + H2SO4=HOH+CaSO4Ca(OH)2 + H2SO4 = 2HOH + CaSO4
C3H8 (g) + O2 (g) = CO2 (g) + H2O (g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3OH+30O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CaCO3(s)= CaO(s)+CO2CaCO3(s) = CaO(s) + CO2
C2H2 (g) + H2(g) =C2H6 (g)C2H2(g) + 2H2(g) = C2H6(g)
Cu(s)+H2SO4(l)=CuSO4(aq)+SO2(g)+H2O(l)Cu(s) + 2H2SO4(l) = CuSO4(aq) + SO2(g) + 2H2O(l)
C 3 H 8 (g)+ O 2 (g)= CO 2 (g)+ H 2 O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH4 +O2 = CO2 +H205CH4 + 5O2 = 5CO2 + H20
CH4 +O2 = CO2 +H205CH4 + 5O2 = 5CO2 + H20
CH3OH + H3O+ + e- = CH4 + H2OCH3OH + 2H3O+ + e- = CH4 + 3H2O
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H8 + O2 = CO2 H2OC4H8 + 6O2 = 4CO2H2O
Ca(NO3)2(s)=2Ca(g)+2N2(g)+3O2(g)Ca(NO3)2(s) = Ca(g) + N2(g) + 3O2(g)
Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cl2(g)+NaOH(aq) = NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CaCO3+HCl = CaCl2 + CO2 +H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca3(PO4)2(s) + H2SO4(aq) = CaSO4(s) + H3PO4(aq) Ca3(PO4)2(s) + 3H2SO4(aq) = 3CaSO4(s) + 2H3PO4(aq)
CH4 +O2 =CO2 +H205CH4 + 5O2 = 5CO2 + H20
C2H8 +O2 =CO2 +H2OC2H8 + 4O2 = 2CO2 + 4H2O
C4H16 +O2 =CO2 +H2OC4H16 + 8O2 = 4CO2 + 8H2O
CH4 +O2 =CO2 +H205CH4 + 5O2 = 5CO2 + H20
C4H16 +O2 =CO2 +H2OC4H16 + 8O2 = 4CO2 + 8H2O
C2H8 +O2 =CO2 +H2OC2H8 + 4O2 = 2CO2 + 4H2O
CH4 +O2=CO2 +H205CH4 + 5O2 = 5CO2 + H20
C2H4 + HCl + O2 = ClCH2CH2Cl + H2O2C2H4 + 4HCl + O2 = 2ClCH2CH2Cl + 2H2O
C2H8 +O2 =CO2 +H2OC2H8 + 4O2 = 2CO2 + 4H2O
Ca10F2(PO4)6 + H2SO4 = Ca(H2PO4)2 + CaSO4 + HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
Cr2O3+Al=Al2O3+CrCr2O3 + 2Al = Al2O3 + 2Cr
CaF2 + H2SO4 = CaSO4 + 2HFCaF2 + H2SO4 = CaSO4 + 2HF
CaF2 + H2SO4 =CaSO4 + 2HFCaF2 + H2SO4 = CaSO4 + 2HF
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cu(NO3)2 +CsOH =Cu(OH)2 +CsNO3Cu(NO3)2 + 2CsOH = Cu(OH)2 + 2CsNO3
CaCO3 + 2CH3COOH = CO2(g) + H2O(l) + Ca2+ + 2 CH3OO-16CaCO3 + 7CH3COOH = 22CO2(g) + 2H2O(l) + 8Ca2+ + 8CH3OO-
C4H8(g) + O2(g) =  CO2(g) + H2O(l)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(l)
C2H6(g) + O2(g) =  CO2(g) + H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
C4H10(g) + O2(g) =  CO2(g) + H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6(aq) = CH3CH2OH(l) + CO2(g)C6H12O6(aq) = 2CH3CH2OH(l) + 2CO2(g)
C2O4H2+H2SO4=H2O+CO+CO2SO3C2O4H2 + H2SO4 = 2H2O + CO + CO2SO3
CaO(aq) + CO2(g) = CaCO3(s)CaO(aq) + CO2(g) = CaCO3(s)
CaO(aq) + CO2(g) = CaCO3(s)CaO(aq) + CO2(g) = CaCO3(s)
Cr2O3+Al=Al2O3+CrCr2O3 + 2Al = Al2O3 + 2Cr
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
Ca+Al(NO3)3=Al+Ca(NO3)23Ca + 2Al(NO3)3 = 2Al + 3Ca(NO3)2
Ca+Al(NO3)3=Al+Ca(NO3)23Ca + 2Al(NO3)3 = 2Al + 3Ca(NO3)2
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
Ca(OH)2+H2SO4= CaSO4+H2OCa(OH)2 + H2SO4 = CaSO4 + 2H2O
CuSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Cu(NO3)2(aq)CuSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Cu(NO3)2(aq)
C5H10O3N+O2=CO2+H2O+NH34C5H10O3N + 21O2 = 20CO2 + 14H2O + 4NH3
Ca(ClO)2+HCl=CaCl2+H2O+Cl2Ca(ClO)2 + 4HCl = CaCl2 + 2H2O + 2Cl2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH4+O2=CH3OH2CH4 + O2 = 2CH3OH
CO+O2=CO22CO + O2 = 2CO2
CH4+O2= CO+H2O2CH4 + 3O2 = 2CO + 4H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaC2 + H2O= Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Ca + O2 = CaO2Ca + O2 = 2CaO
C5H12 + O2= CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca + Al(NO3)3 = Al + Ca(NO3)23Ca + 2Al(NO3)3 = 2Al + 3Ca(NO3)2
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca(HCO3)2=CaO+CO2+H2OCa(HCO3)2 = CaO + 2CO2 + H2O
CO(g)+Cl2(g)=COCl2(g)CO(g) + Cl2(g) = COCl2(g)
C2H4 (g) + O2(g) = CO2(g) + H2O (l)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(l)
CaCO 3 (s)=3CaO(s)+ CO 2 (g)CaCO3(s) = CaO(s) + CO2(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C8H5O4K + O2 = CO2 + H2O + KO4C8H5O4K + 31O2 = 32CO2 + 10H2O + 4KO
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2 = CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaH2+H2O = Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CrO4+Pb=PbCrO4CrO4 + Pb = PbCrO4
Cs2O+H2O=CsOHCs2O + H2O = 2CsOH
CaC l 2 (aq)+N a 3 P O 4 (aq)=C a 3 (P O 4 ) 2 (s)+NaCl(aq)3CaCl2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaCl(aq)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cr(OH ) 3 (aq)+ H 2 S O 4 (aq)=C r 2 (S O 4 ) 3 (aq)+ H 2 O(l)2Cr(OH)3(aq) + 3H2SO4(aq) = Cr2(SO4)3(aq) + 6H2O(l)
Cu3(PO4)2 + Na2CO3 = Na3PO4 + CuCO3Cu3(PO4)2 + 3Na2CO3 = 2Na3PO4 + 3CuCO3
Cu3(PO4)2 + Na2CO3 = Na3PO4 + CuCO3Cu3(PO4)2 + 3Na2CO3 = 2Na3PO4 + 3CuCO3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C12H22O11(s) + O2(g) = CO2(g) + H2O(g)C12H22O11(s) + 12O2(g) = 12CO2(g) + 11H2O(g)
CH3 CH3 (g) + O2 (g) = CO2 (g) +H2O (g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca+O2=CaO2Ca + O2 = 2CaO
Ca + H2O =CaO + H2Ca + H2O = CaO + H2
Cl2 + NaI =I + NaClCl2 + 2NaI = 2I + 2NaCl
C3H6O + 4O2 = 3CO2 +3H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H6O + 3O2 = 3CO2 +2H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H6 + 3O2 = 3CO2 +2H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cd+HC2H3O2=Cd(C2H3O2)2+H2Cd + 2HC2H3O2 = Cd(C2H3O2)2 + H2
CO(g) + O2(g) = CO2(g)2CO(g) + O2(g) = 2CO2(g)
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CoI3 + Ba(OH)2=Co(OH)3 + BaI22CoI3 + 3Ba(OH)2 = 2Co(OH)3 + 3BaI2
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CuS+HNO3=Cu(NO3)2+S+H2O+NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
CH3(CH2)2CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Cu+HNO3=NO2+H2O+Cu(NO3)2Cu + 4HNO3 = 2NO2 + 2H2O + Cu(NO3)2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C+HNO3=CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C+HNO3=N2+CO2+H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
C+HNO3=CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
Cl2 + KOH = KClO3 + KCl + H2O3Cl2 + 6KOH = KClO3 + 5KCl + 3H2O
Cu + MgSO4(aq) = Mg + CuSO4(aq)Cu + MgSO4(aq) = Mg + CuSO4(aq)
CuS(s) + HNO3 = Cu(NO3)2 + H2O + NO(g) + S(s)3CuS(s) + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO(g) + 3S(s)
C5H10 + MnO3 + H+ = CO + Mn++ + H2OC5H10 + 5MnO3 + 10H+ = 5CO + 5Mn++ + 10H2O
Cu+AgNO3=Cu(NO3)2 +AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C2H4+O2=CO2 +H2OC2H4 + 3O2 = 2CO2 + 2H2O
C + H2O = CH4 + CO22C + 2H2O = CH4 + CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+O2=CuO2Cu + O2 = 2CuO
C12H22O11=C+H2OC12H22O11 = 12C + 11H2O
C2 + H2O = OH + COC2 - 2H2O = -4OH + 2CO
Cr(OH)3(aq)+H2SO4(aq)=Cr2(SO4)3(aq)+H2O(l)2Cr(OH)3(aq) + 3H2SO4(aq) = Cr2(SO4)3(aq) + 6H2O(l)
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Cu + HNO3 = Cu (NO3)2 + NO + H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
C2H2O4 + KMnO4 = KOH + MnO + CO2 + H2O23C2H2O4 + 2KMnO4 = 2KOH + 2MnO + 6CO2 + 2H2O2
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
Cu + HNO3 = Cu (NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CH4(g)+2O2(g)=CO2(g)+2H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CuS + HNO3 = Cu(NO3)2 + S + H2O + NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
Cu + HNO3 = NO2 + H2O + Cu(NO3)2Cu + 4HNO3 = 2NO2 + 2H2O + Cu(NO3)2
C4H10O(l) +O2(g)=CO2(g)+H2O(g) C4H10O(l) + 6O2(g) = 4CO2(g) + 5H2O(g)
C2H6O(l) +O2(g)=CO2(g)+H2O(g) C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
Cu + HNO3 = NO2 + H2O + Cu(NO)2Cu - 4HNO3 = -6NO2 - 2H2O + Cu(NO)2
CuS+NO3-+H+=Cu2++SO42-+NO+H2O6CuS + 167NO3- + 164H+ = 3Cu2+ + 6SO42- + 167NO + 82H2O
Cu + HNO3 = Cu (NO3)2 + NO + H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
Cu(s)+AgC2H3O2(aq)=Cu(C2H3O2)2(aq)+Ag(s) Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C10H8 +H2O = CO + H2C10H8 + 10H2O = 10CO + 14H2
C10H8 +H2O = CO2 + H2C10H8 + 20H2O = 10CO2 + 24H2
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
C2H6OS+O2=H2SO4+CO2+H2O2C2H6OS + 9O2 = 2H2SO4 + 4CO2 + 4H2O
C4H10O(l) +O2(g)=CO2(g)+H2O(g)C4H10O(l) + 6O2(g) = 4CO2(g) + 5H2O(g)
Cl- +H2O+ S=S2- + ClO3-+OH--1Cl- + 3H2O - 12S = -6S2- - ClO3- + 6OH-
CH4O(l) +O2(g)=CO2(g)+H2O(g)2CH4O(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C4H8O+O2=CO2+H2O2C4H8O + 11O2 = 8CO2 + 8H2O
C6H13OH+O2 = CO2+H2OC6H13OH + 9O2 = 6CO2 + 7H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuCl2 + Al = AlCl3 + Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CuCl2(aq) + MgSO4(s) = Cu(SO4) + MgCl2CuCl2(aq) + MgSO4(s) = Cu(SO4) + MgCl2
CaCl2+(NH4)3PO4=CaPO4+(NH4)3Cl2CaCl2 + (NH4)3PO4 = CaPO4 + (NH4)3Cl2
CuS + O2 = CuO + SO22CuS + 3O2 = 2CuO + 2SO2
CuCl2(aq)+NaOH(aq)=Cu(OH)2(s)+NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
Cr2+ + Al = Cr + Al3+Cr2+ + 3Al = 2Cr + Al3+
CuSO4 + Zn(NO3)2 = Cu(NO3)2 + ZnSO4CuSO4 + Zn(NO3)2 = Cu(NO3)2 + ZnSO4
CrCl2 + Li2CO3 = CrCO3 + Li2Cl2CrCl2 + Li2CO3 = CrCO3 + Li2Cl2
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C8H18(l)+O2=CO2(g)+H2O(g)2C8H18(l) + 25O2 = 16CO2(g) + 18H2O(g)
C8H18(l)+O2=CO2(g)+H2O(g)2C8H18(l) + 25O2 = 16CO2(g) + 18H2O(g)
Ca(OH)2(aq)+Na3PO4(aq)=Ca3(PO4)2(s)+NaOH(aq)3Ca(OH)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
CH4 + 2O2= CO2 +2H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 2O2= CH4O4CH4 + 2O2 = CH4O4
CH4 + 2O2= C + H4O4CH4 + 2O2 = C + H4O4
Cr2O3(s)+CO(g)=Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
C8H18(l) + O2(g) = CO2(g) + H2O(g)2C8H18(l) + 25O2(g) = 16CO2(g) + 18H2O(g)
C15H32+O2=CO2+H2OC15H32 + 23O2 = 15CO2 + 16H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
Cl2+Al=AlCl33Cl2 + 2Al = 2AlCl3
Ca(OH)2(aq)+Na3PO4(aq) = Ca3(PO4)2(s)+NaOH(aq)3Ca(OH)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
Cr2O3(s)+CO(g) = Cr(s)+CO2(g)Cr2O3(s) + 3CO(g) = 2Cr(s) + 3CO2(g)
Cu + H2O = Cu(OH)2 + H2Cu + 2H2O = Cu(OH)2 + H2
CoBr2 + KOH = KBr + Co(OH)2CoBr2 + 2KOH = 2KBr + Co(OH)2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CuCO3=CuO+CO2CuCO3 = CuO + CO2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu + H2O = Cu(OH)2 + H2Cu + 2H2O = Cu(OH)2 + H2
Ca + Zn(No3)2 = Ca(No3) + Zn2Ca + Zn(No3)2 = 2Ca(No3) + Zn
CH4(g) + 4 Br2(g)= CBr4(s) + 4 HBr(g)CH4(g) + 4Br2(g) = CBr4(s) + 4HBr(g)
C2H2OH(l)+O2(g)=H2O(l)+CO2(g)4C2H2OH(l) + 9O2(g) = 6H2O(l) + 8CO2(g)
CoSO4+Pb(NO3)2=PbSO4+Co+NO3CoSO4 + Pb(NO3)2 = PbSO4 + Co + 2NO3
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C5H12 +O2= CO2 +H2O C5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2=CO2 + H2O C5H12 + 8O2 = 5CO2 + 6H2O
C5H12 +O2= CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 +O2= CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2= CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2= CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH3CHO + O2 = CO2 + H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
C+H2=C2H62C + 3H2 = C2H6
C+H=C2H62C + 6H = C2H6
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+ 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
Cu + HNO3= Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaSO4+Al(CO3)3=Ca(CO3)2+Al2(SO4)33CaSO4 + 2Al(CO3)3 = 3Ca(CO3)2 + Al2(SO4)3
C3H5N3O9 = CO2 + N2 + O2 + H204C3H5N3O9 = 12CO2 + 6N2 + 6O2 + H20
C6H14(g)+O2(g)=CO2(g)+H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C3H8OS+6O2 =3CO2+4H2O+SO3C3H8OS + 6O2 = 3CO2 + 4H2O + SO3
C5H5OH + 3O2 = CO2 + 3H2OC5H5OH + 6O2 = 5CO2 + 3H2O
C2H6O(l) +O2(g)=CO2(g)+H2O(g)C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
Ca + 2CeF3 = 2Ce + 3CaF23Ca + 2CeF3 = 2Ce + 3CaF2
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
C5H12 + O2 = CO2 + H2O C5H12 + 8O2 = 5CO2 + 6H2O
CO + O2 = CO22CO + O2 = 2CO2
C+H3PO4=PO2+CO2+H2OC + 4H3PO4 = 4PO2 + CO2 + 6H2O
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.