Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C+HNO3=N2+CO2+H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
Cl2+NaBr=NaCl+Br2Cl2 + 2NaBr = 2NaCl + Br2
CaSO4+Zn=ZnO+SO2+CaOCaSO4 + Zn = ZnO + SO2 + CaO
CO2+H2O=H2CO3CO2 + H2O = H2CO3
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C9H20+HNO3=CO2+N2+H2O5C9H20 + 56HNO3 = 45CO2 + 28N2 + 78H2O
C6H12O6 =6C + 6H2OC6H12O6 = 6C + 6H2O
CaCO3 =3CaO + CO2CaCO3 = CaO + CO2
Cu2SO4 + Zn =ZnSO4 + 2CuCu2SO4 + Zn = ZnSO4 + 2Cu
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
CH3COOH+PCl3= CH3COCl +H3PO33CH3COOH + PCl3 = 3CH3COCl + H3PO3
C2H6OH+O2=CO2+H2O4C2H6OH + 13O2 = 8CO2 + 14H2O
Cr2O3 + KClO3+ KOH = K2Cr2O4 + KCl + H2OCr2O3 + 0KClO3 + 2KOH = K2Cr2O4 + 0KCl + H2O
Cu + HCl +K2Cr2O7 = CuCl2 + CrCl3 + H2O + KCl3Cu + 14HCl + K2Cr2O7 = 3CuCl2 + 2CrCl3 + 7H2O + 2KCl
CaSO4+Zn=ZnO+SO2+CaOCaSO4 + Zn = ZnO + SO2 + CaO
CaSO4+AgNO3=CaNO3+AgSO4CaSO4 + AgNO3 = CaNO3 + AgSO4
CaCl2+H2SO4=CaSO4+2HClCaCl2 + H2SO4 = CaSO4 + 2HCl
C4H10 + O2 = H2O +CO22C4H10 + 13O2 = 10H2O + 8CO2
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C5H8 + O2 = CO2 + H2OC5H8 + 7O2 = 5CO2 + 4H2O
CaCl2 + Na2SO4 = CaSO4 + NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
CuO+C=Cu+CO22CuO + C = 2Cu + CO2
C4H10O + C2H4O2 = C6H12O2 + H2OC4H10O + C2H4O2 = C6H12O2 + H2O
CrCl3+AgNO3=Cr(NO3)3+AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
Ca+C+O2=CaCO32Ca + 2C + 3O2 = 2CaCO3
CaH2 + H2O = H2 + Ca(OH)2CaH2 + 2H2O = 2H2 + Ca(OH)2
CH4 + O2 = CO + H2010CH4 + 5O2 = 10CO + 2H20
CO+Fe3O4=CO2+Fe4CO + Fe3O4 = 4CO2 + 3Fe
Cu+O2=Cu2O4Cu + O2 = 2Cu2O
Cu+O2=CuO2Cu + O2 = 2CuO
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C5H10O5 + O2 = C5H10O7C5H10O5 + O2 = C5H10O7
C3H8+HNO3=CO2+NO+H2O3C3H8 + 20HNO3 = 9CO2 + 20NO + 22H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H12O6+O2=CO2+H205C6H12O6 + 15O2 = 30CO2 + 3H20
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CaO+H3PO4=Ca3(PO4)2+H2O3CaO + 2H3PO4 = Ca3(PO4)2 + 3H2O
CaO+H3PO4=Ca3(PO4)2+H2O3CaO + 2H3PO4 = Ca3(PO4)2 + 3H2O
Cu + H++ NO3- = NO + Cu+2 + H2O3Cu + 8H+ + 2NO3- = 2NO + 3Cu+2 + 4H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C3H8(g)+5O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cr2(SO4)3 + KI + KIO3 + H2O = Cr(OH)3 + K2SO4 + I2Cr2(SO4)3 + 5KI + KIO3 + 3H2O = 2Cr(OH)3 + 3K2SO4 + 3I2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca3(PO4)2+3H2(SO4)=3Ca(SO4)+2H3(PO4)Ca3(PO4)2 + 3H2(SO4) = 3Ca(SO4) + 2H3(PO4)
CA(OH)2+NI(OH)+H2SO4=NICA+H2O+H2SO40CA(OH)2 + 0NI(OH) + H2SO4 = 0NICA + 0H2O + H2SO4
Cu+HCl+H2O2=CuCl2+H2OCu + 2HCl + H2O2 = CuCl2 + 2H2O
Cu+HCl+H2O2=CuCl2+H2OCu + 2HCl + H2O2 = CuCl2 + 2H2O
Cu+HCl=CuCl2+HCu + 2HCl = CuCl2 + 2H
Cu+HCl+H2O2=CuCl2+H2OCu + 2HCl + H2O2 = CuCl2 + 2H2O
Cu+HCl+H2O2=CuCl2+H2OCu + 2HCl + H2O2 = CuCl2 + 2H2O
Cu+HCl+H2O2=CuCl2+H2OCu + 2HCl + H2O2 = CuCl2 + 2H2O
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+(NH4)2SO4=CaSO4+NH3+H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
Ca(OH)2+(NH4)2SO4=CaSO4+NH3+H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
Cl-+Fe+3=Cl2+Fe+22Cl- + 2Fe+3 = Cl2 + 2Fe+2
Cl-Fe+3=Cl2+Fe+22Cl-Fe+3 = Cl2 + 2Fe+2
CU+O2=CUO2CU + O2 = 2CUO
CuSO4*5H2O = CuSO4 + H2OCuSO4*5H2O = CuSO4 + 5H2O
Co3O4 + CO = Co + CO2Co3O4 + 4CO = 3Co + 4CO2
C3H8 + 2H2O = 3CH4 + O2C3H8 + 2H2O = 3CH4 + O2
C3H8 + 2H2O = 4CH4 + O2C3H8 + 2H2O = 3CH4 + O2
CuO + NH3 = Cu + N2O + H2O4CuO + 2NH3 = 4Cu + N2O + 3H2O
Cr2O3+KClO3+KOH=K2CrO4+KCl+H2OCr2O3 + KClO3 + 4KOH = 2K2CrO4 + KCl + 2H2O
Ca(MnO4)2+K2SO3+KOH=K2MnO4+CaSO4+H2OCa(MnO4)2 + K2SO3 + 2KOH = 2K2MnO4 + CaSO4 + H2O
C2H4O2 + O2 = CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C8H18(g)+O2(g)=CO2(g)+H2O2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O
C3H8(g)+O2(g)=CO2(g)+H2OC3H8(g) + 5O2(g) = 3CO2(g) + 4H2O
CH4(g)+O2(g)=CO2(g)+H2OCH4(g) + 2O2(g) = CO2(g) + 2H2O
Cu2S + FeS2 +HNO3 = CuSO4 +Fe2(SO4)3 + NO2 + H2OCu2S + 2FeS2 + 40HNO3 = 2CuSO4 + Fe2(SO4)3 + 40NO2 + 20H2O
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C7H12O3 + O2 = CO2 + H2O2C7H12O3 + 17O2 = 14CO2 + 12H2O
C12H23O11 +O2=CO2 + H2 O4C12H23O11 + 49O2 = 48CO2 + 46H2O
CI2+O2=CI2O32CI2 + 3O2 = 2CI2O3
Cu+HNO3 = Cu(NO3)2+NO+H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
Cu+HNO3 = Cu(NO3)+NO+H2020Cu + 20HNO3 = 20Cu(NO3) + 0NO + H20
Cu+NHO3 = Cu(NO3)+NO+H2020Cu + 20NHO3 = 20Cu(NO3) + 0NO + H20
Cu + HNO3 = Cu 2(NO3) + H24Cu + 2HNO3 = 2Cu2(NO3) + H2
Cu + HNO3 = Cu 2(NO3) + H24Cu + 2HNO3 = 2Cu2(NO3) + H2
Cu + HNO3 = Cu 2(NO3) + H24Cu + 2HNO3 = 2Cu2(NO3) + H2
Ca Br2 + F2 = Ca + 2F BrCaBr2 + F2 = Ca + 2FBr
C4 H6 O2 + H2O + Na2 CO3 = C5 H8 O6 Na2C4H6O2 + H2O + Na2CO3 = C5H8O6Na2
Ca(OH)2 + H3PO3 = Ca3 (PO3)2 +H2O3Ca(OH)2 + 2H3PO3 = Ca3(PO3)2 + 6H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(MnO4)2+CaI2+H2O=MnO2+Ca(IO3)2+Ca(OH)22Ca(MnO4)2 + CaI2 + 2H2O = 4MnO2 + Ca(IO3)2 + 2Ca(OH)2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8+O2=H2O+ CO2C3H8 + 5O2 = 4H2O + 3CO2
Ca(ClO3)2= 2CaCl2+O2Ca(ClO3)2 = CaCl2 + 3O2
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca3(PO4)2+H3PO4=Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca3(PO4)2+H3PO4=Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
Ca3(PO4)2+H3PO4=Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CO2+H20=C2H6+O220CO2 + 3H20 = 10C2H6 + 20O2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3=CO2+CaOCaCO3 = CO2 + CaO
CuCl2+AgNO3=Cu(NO3)2+AgClCuCl2 + 2AgNO3 = Cu(NO3)2 + 2AgCl
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca2Si+Cl2=CaCl2+SiCl2Ca2Si + 5Cl2 = 4CaCl2 + 2SiCl
CuSCN + KIO4 + HCl = CuSO4 + KCl + HCN + ICl + H2020CuSCN + 20KIO4 + 40HCl = 20CuSO4 + 20KCl + 20HCN + 20ICl + H20
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuCO3=CuO+CO2CuCO3 = CuO + CO2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Ca + HCl = CaCl2 + H2Ca + 2HCl = CaCl2 + H2
C2H4O2 + O2 = CO2 + H205C2H4O2 + 5O2 = 10CO2 + H20
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
Ca + O2 = CaO2Ca + O2 = 2CaO
C3H8 + 5O2 = 3CO + 4H2O2C3H8 + 7O2 = 6CO + 8H2O
CaSO4+NaOH+O2 = Ca2O3+Na2SO4+H2O4CaSO4 + 8NaOH + O2 = 2Ca2O3 + 4Na2SO4 + 4H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Cu+ O2 = 2CuO2Cu + O2 = 2CuO
Cu+ O2 = 2CuO2Cu + O2 = 2CuO
Cu+H2SO4=CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu(NO3)2(aq)+NaOH(aq)=Cu(OH)2+NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2 + 2NaNO3(aq)
Cu(NO3)2(aq)+NaOH(aq)=Cu(OH)2+NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2 + 2NaNO3(aq)
Cd(NO3)2+Na2SO4=NaNO3+CdSO4Cd(NO3)2 + Na2SO4 = 2NaNO3 + CdSO4
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cl2+F2=ClF3Cl2 + 3F2 = 2ClF3
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
Cu + H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C7H6O3 +O2 = CO2 + H2OC7H6O3 + 7O2 = 7CO2 + 3H2O
C12H26 +O2 = CO2 + H2O2C12H26 + 37O2 = 24CO2 + 26H2O
Cd(NO3)2 + Na2SO4 = NaNO3 + CdSO4Cd(NO3)2 + Na2SO4 = 2NaNO3 + CdSO4
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4O2 + C8H16O = C10H2O2 + H2O39C2H4O2 - C8H16O = 7C10H2O2 + 63H2O
CO+H2O=CO2+H2O0CO + H2O = 0CO2 + H2O
C7H17+O2=CO2+H2O4C7H17 + 45O2 = 28CO2 + 34H2O
C2H4(g) + O2(g) = CO2(g) + H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
CaO+MnI4=MnO2+CaI22CaO + MnI4 = MnO2 + 2CaI2
C+H2=C3H83C + 4H2 = C3H8
CO+O2=CO22CO + O2 = 2CO2
Ca(OH)2(aq)+HCl(aq)=CaCl2(aq)+H2O(l)Ca(OH)2(aq) + 2HCl(aq) = CaCl2(aq) + 2H2O(l)
Ca(OH)2(aq)+HCl(aq)=CaCl2(aq)+H2O(l)Ca(OH)2(aq) + 2HCl(aq) = CaCl2(aq) + 2H2O(l)
C3H4+O2=H2O+CO2C3H4 + 4O2 = 2H2O + 3CO2
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
Ca(OH)2 + HF = CaF2 + H2OCa(OH)2 + 2HF = CaF2 + 2H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CO2=C3O63CO2 = C3O6
CO2=C3O63CO2 = C3O6
Cu2S + Cu2O = Cu + SO2Cu2S + 2Cu2O = 6Cu + SO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CASIO3 + HF = H2SIF6 + CAF2 + H2OCASIO3 + 8HF = H2SIF6 + CAF2 + 3H2O
CH4= C2H2+H22CH4 = C2H2 + 3H2
CO+O2=CO22CO + O2 = 2CO2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CH2 + O2 = CO2 + H2O2CH2 + 3O2 = 2CO2 + 2H2O
CH2 + O2 = CO2 + H2O2CH2 + 3O2 = 2CO2 + 2H2O
CH2 + O2 = CO2 + H2O2CH2 + 3O2 = 2CO2 + 2H2O
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C7H14 + O2 = CO2 + H2010C7H14 + 70O2 = 70CO2 + 7H20
C7H9+HNO3=C7H6(NO2)3+H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
C5H12 + O2 = CO2 + 6H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCO3+NHO3=Ca(NO3)2+CO2+H2OCaCO3 + 2NHO3 = Ca(NO3)2 + CO2 + H2O
Ca3(PO4)2+3Na2SO4=3CaSO4+2Na3PO4Ca3(PO4)2 + 3Na2SO4 = 3CaSO4 + 2Na3PO4
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu2NO3 + N2O + H2O16Cu + 10HNO3 = 8Cu2NO3 + N2O + 5H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
Ca(NO3)2 + Na2 C2 O4=Ca C2 O4 +Na NO3Ca(NO3)2 + Na2C2O4 = CaC2O4 + 2NaNO3
Ca(NO3)2 + Na2C2O4=CaC2O4 +NaNO3Ca(NO3)2 + Na2C2O4 = CaC2O4 + 2NaNO3
C8H18 + O2 = CO + H2O2C8H18 + 17O2 = 16CO + 18H2O
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C5H9O+9O2=6CO2+6H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C8H18 + O2 = CO + H2010C8H18 + 40O2 = 80CO + 9H20
C8H18 + O2 = CO + H2010C8H18 + 40O2 = 80CO + 9H20
C+O2=CO2C + O2 = CO2
Ca(NO3)2 + Na2C2O4=CaO4 + Na2C2(NO3)2Ca(NO3)2 + Na2C2O4 = CaO4 + Na2C2(NO3)2
CaO +H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO +H20 = CaOH20CaO + H20 = 20CaOH
CO2+C=COCO2 + C = 2CO
CO2+C=COCO2 + C = 2CO
CaCl2 + 2AgNO3 = Ca(NO3)2 + 2AgClCaCl2 + 2AgNO3 = Ca(NO3)2 + 2AgCl
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C12H22O11+H2O=C12H22O11C12H22O11 + 0H2O = C12H22O11
C+O2=CO2C + O2 = CO2
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
C10H18+O2=CO2+H2O2C10H18 + 29O2 = 20CO2 + 18H2O
C6H6O2+O2=CO2+H2O2C6H6O2 + 13O2 = 12CO2 + 6H2O
C3H8O+Na2Cr2O7+H2SO4=Cr2(SO4)3+NaSO4+C3H6O2+H2OC3H8O + Na2Cr2O7 + 5H2SO4 = Cr2(SO4)3 + 2NaSO4 + C3H6O2 + 6H2O
C3H8O+Na2Cr2O7+H2SO4=Cr2(SO4)3+NaSO4+C3H6O2+H2OC3H8O + Na2Cr2O7 + 5H2SO4 = Cr2(SO4)3 + 2NaSO4 + C3H6O2 + 6H2O
C2(OH)3+NaIO+NaOH=NaI+Na2C2O4+H2O2C2(OH)3 + 3NaIO + 4NaOH = 3NaI + 2Na2C2O4 + 5H2O
C2(OH)3+NaIO+NaOH=NaI+Na2C2O4+H2O2C2(OH)3 + 3NaIO + 4NaOH = 3NaI + 2Na2C2O4 + 5H2O
Ca(OH)2 + SO2 = CaSO3 + H2OCa(OH)2 + SO2 = CaSO3 + H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+O2=CO3+H2O2C3H8 + 13O2 = 6CO3 + 8H2O
Ca(OH)2 + H3PO3 = Ca3(PO3)2 + H2O3Ca(OH)2 + 2H3PO3 = Ca3(PO3)2 + 6H2O
C4H8O2 +C2H6O=C8H12O2 + H2O2C4H8O2 + 0C2H6O = C8H12O2 + 2H2O
C4H8O2 +C2H6O=C8H12O2 + H2O2C4H8O2 + 0C2H6O = C8H12O2 + 2H2O
CaSO4(aq) + Ba(C2H3O2)2(aq) = BaSO4(s) + Ca(C2H3O2)2(aq)CaSO4(aq) + Ba(C2H3O2)2(aq) = BaSO4(s) + Ca(C2H3O2)2(aq)
CO2+H2O=C6H12O6+H2-6CO2 + 6H2O = -1C6H12O6 + 12H2
CaBr2 + Ag(NO3) = AgBr + Ca(NO3)2CaBr2 + 2Ag(NO3) = 2AgBr + Ca(NO3)2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=3CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CuCl2 + H2S = CuS + 2 HClCuCl2 + H2S = CuS + 2HCl
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H12+O2=CO2+H2OC8H12 + 11O2 = 8CO2 + 6H2O
CeO2+ KI+HCl=KCl+CeCl3+H2O+I22CeO2 + 2KI + 8HCl = 2KCl + 2CeCl3 + 4H2O + I2
C + S8 = CS24C + S8 = 4CS2
CO+NO=CO2+N22CO + 2NO = 2CO2 + N2
Ca + 2O2 = 2CaO2Ca + O2 = CaO2
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H12O6+ O2= CO2+ H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CI2 + KI = KCI + I2CI2 + KI = KCI + I2
C3H6O2S+O2=CO2+H2O+SO3C3H6O2S + 5O2 = 3CO2 + 3H2O + SO3
Ca+O2=CaO2Ca + O2 = 2CaO
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C2H5OH + H2SO4 = (C2H5)2O + H2SO4 H2O2C2H5OH + H2SO4 = (C2H5)2O + H2SO4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CS2 + O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
CS2 + O2 = CO + SO22CS2 + 5O2 = 2CO + 4SO2
C7H16+11O2 = 7CO2+8H2OC7H16 + 11O2 = 7CO2 + 8H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CaCO3 + C2H2O4 = CaC2O2 + H2O + CO2CaCO3 + 3C2H2O4 = CaC2O2 + 3H2O + 5CO2
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
CrCl 3 + NaClO 3 + NaOH = Na 2 CrO 4 + NaCl + H 2 O2CrCl3 + NaClO3 + 10NaOH = 2Na2CrO4 + 7NaCl + 5H2O
C48H100O6+O2=CO2+H2OC48H100O6 + 70O2 = 48CO2 + 50H2O
CH3CH2OH+O2 = CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2(aq) + H2SO4(aq)=CaSO4(s) + H2O(l)Ca(OH)2(aq) + H2SO4(aq) = CaSO4(s) + 2H2O(l)
C2H7N + 19O2=8CO2 + H2O + NO24C2H7N + 19O2 = 8CO2 + 14H2O + 4NO2
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2010C2H6 + 20O2 = 20CO2 + 3H20
C2H5OH +O2 = CO2 +H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH4+O2=CH3OH2CH4 + O2 = 2CH3OH
CO+O2=CO22CO + O2 = 2CO2
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
C6H12O6 + O2 = CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6 + O2 = CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C4H10+O2 = CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2+H3PO4=Ca3 (PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C4H10(g)+O2=CO2(g)+H2O(g)2C4H10(g) + 13O2 = 8CO2(g) + 10H2O(g)
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CcR2 + Ch2R= Cc6Ch12R6 + R26CcR2 + 6Ch2R = Cc6Ch12R6 + 6R2
CcG2 + Or2R= CcR2 + GOr2CcG2 + 2Or2R = CcR2 + 2GOr2
CcOr4 + CcCh4= ChOr + CcCcOr4 + CcCh4 = 4ChOr + 2Cc
CcOr4 + CcCh4= ChOr + CcCcOr4 + CcCh4 = 4ChOr + 2Cc
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaBr+K(PO4)=Ca(PO4)+KBrCaBr + K(PO4) = Ca(PO4) + KBr
Ca + O2 = CaO2Ca + O2 = 2CaO
Ca + O2 = CaO2Ca + O2 = 2CaO
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4(g) = C2H2(g) + H2(g)2CH4(g) = C2H2(g) + 3H2(g)
CuCl2+Al=AlCl3+Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+H2SO4 = CuSO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = C2O2 + H2O12C2H6 + 5O2 = 2C2O2 + 6H2O1
CH4 + 2O2 = H20 + H+ + HCO320CH4 + 30O2 = 3H20 + 0H+ + 20HCO3
Ca3(PO4)2+3Na2SO4=3CaSO4+2Na3PO4Ca3(PO4)2 + 3Na2SO4 = 3CaSO4 + 2Na3PO4
C6H12O6 + O2 = CO + H2OC6H12O6 + 3O2 = 6CO + 6H2O
Ca(OH)2 + Na2CO3 = NaOH + CaCO3Ca(OH)2 + Na2CO3 = 2NaOH + CaCO3
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C8H18 + O2 = CO + H2O 2C8H18 + 17O2 = 16CO + 18H2O
CuO +2NH3 =3Cu +H2O +N23CuO + 2NH3 = 3Cu + 3H2O + N2
CO2 + H20 = C6H12O6 + O230CO2 + 3H20 = 5C6H12O6 + 15O2
C3H6 +3O2 =CO +3H2OC3H6 + 3O2 = 3CO + 3H2O
C2H3O2Br +3O2 =CO +H2O +2Br24C2H3O2Br + 3O2 = 8CO + 6H2O + 2Br2
C2H4O2 +O2 =CO2 +2H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CrCl2 + NaOH + H2O2 = Na2CrO4 + NaCl + H2OCrCl2 + 4NaOH + 2H2O2 = Na2CrO4 + 2NaCl + 4H2O
CrCl2 + NaOH + H2O2 = Na2CrO4 + NaCl + H2O20CrCl2 + 0NaOH + H2O2 = 0Na2CrO4 + 0NaCl + H2O2
C5H8+O2=8H2O+5CO2C5H8 + 7O2 = 4H2O + 5CO2
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C4H6 + 11O2 = 4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Ca(OH)2 + H3PO3 = Ca3 (PO3)2 + H2O3Ca(OH)2 + 2H3PO3 = Ca3(PO3)2 + 6H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C4H6 + 4O2 = 4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Cl2+KI=I2+KClCl2 + 2KI = I2 + 2KCl
Cl2O5+CO=Cl2+CO2Cl2O5 + 5CO = Cl2 + 5CO2
Co( OH)3 = Co+++ + OH-Co(OH)3 = Co+++ + 3OH-
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H6+O2=CO2+H2O2C5H6 + 13O2 = 10CO2 + 6H2O
CaCO3 +HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Cl2O5+CO=Cl2+CO2Cl2O5 + 5CO = Cl2 + 5CO2
CO+O2=CO22CO + O2 = 2CO2
C+H+O=C3H7OH3C + 8H + O = C3H7OH
C2H6+O6=CO2+H2O6C2H6 + 7O6 = 12CO2 + 18H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+H2=CH4C + 2H2 = CH4
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
CH3CH2OH+K2Cr2O7+H2SO4=CH3COOH+Cr2(SO4)3+K2SO4+H2O3CH3CH2OH + 2K2Cr2O7 + 8H2SO4 = 3CH3COOH + 2Cr2(SO4)3 + 2K2SO4 + 11H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8+O2= CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6O + O2 = CO2 +H2OC2H6O + 3O2 = 2CO2 + 3H2O
CO+H2=C8H18+H2O8CO + 17H2 = C8H18 + 8H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2+NaOH=NaCl+NaOClO3+H2O4Cl2 + 8NaOH = 7NaCl + NaOClO3 + 4H2O
Cl2+NaOH=NaCl+NaOCl+H2OCl2 + 2NaOH = NaCl + NaOCl + H2O
C+H2SO4=CO2+SO2+H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
Cl2+H2O=HCl+HOClCl2 + H2O = HCl + HOCl
Ca+ CuF2= CaF2+ CuCa + CuF2 = CaF2 + Cu
C2H4O2+ O2= CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
Ca+H2O=CaOH+H22Ca + 2H2O = 2CaOH + H2
C+CO2=COC + CO2 = 2CO
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Cl2 + KNO3 + H2O = KClO3 + KCl + HNO33Cl2 + 6KNO3 + 3H2O = KClO3 + 5KCl + 6HNO3
CaCl2 + Na2SO4 = CaSO4 + NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
Cu + O2 = CuO2Cu + O2 = 2CuO
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaCl2+K3PO4=Ca3(PO4)2+KCl3CaCl2 + 2K3PO4 = Ca3(PO4)2 + 6KCl
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaSO4 + NaOH + O2 = Ca2O3 + Na2SO4 + H2O4CaSO4 + 8NaOH + O2 = 2Ca2O3 + 4Na2SO4 + 4H2O
C2H4 + HCl + O2 = ClCH2CH2Cl + H2O2C2H4 + 4HCl + O2 = 2ClCH2CH2Cl + 2H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CoS + NaOH + H2O2 = Co(OH)2 + Na2SO4 + H2OCoS + 2NaOH + 4H2O2 = Co(OH)2 + Na2SO4 + 4H2O
CCl4+O2=COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
CO+O2=CO22CO + O2 = 2CO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl- + NO3- + H2 = NO +Cl2 +H2O-2Cl- + 2NO3- + 4H2 = 2NO - Cl2 + 4H2O
C3H8 +O2 = CO3 +H2O2C3H8 + 13O2 = 6CO3 + 8H2O
Cl- +NO3- + H2= NO + Cl2 +H2O-2Cl- + 2NO3- + 4H2 = 2NO - Cl2 + 4H2O
CuO+ C= Cu+ CO22CuO + C = 2Cu + CO2
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CuO+NH3=N2+Cu+H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca+AlPO4=Al+Ca3(PO4)23Ca + 2AlPO4 = 2Al + Ca3(PO4)2
Ca+AlPO4=Al+Ca3(PO4)23Ca + 2AlPO4 = 2Al + Ca3(PO4)2
C4H10(g)+O2=CO2(g)+H2O(g)2C4H10(g) + 13O2 = 8CO2(g) + 10H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCl2+AgNO3=AgCl+Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
Ca + O2 = CaO2Ca + O2 = 2CaO
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
CH5N+O2 = CO2+H2O+NO24CH5N + 13O2 = 4CO2 + 10H2O + 4NO2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
CO2 + H2O = C6H12O6 + O6CO2 + 6H2O = C6H12O6 + 12O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
C+Cr2O3=Cr+CO23C + 2Cr2O3 = 4Cr + 3CO2
C6H12O6+6O2=6CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CO + H2 = C8H18 + H2O8CO + 17H2 = C8H18 + 8H2O
C2H6O + O2= CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C + O2 = 6CO2C + O2 = CO2
C + O2 = 6CO2C + O2 = CO2
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
CO2(g) + H2O(l)= C6H12O6(s) + O2(g) 6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
CH3(CH2)4CH3 + O2 = CO2 + H2O 2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C2H4+O2=H20+CO25C2H4 + 10O2 = H20 + 10CO2
C2H5OH+3O2=2CO2+6HO2C2H5OH + 9O2 = 4CO2 + 12HO
CH3CH3 + O2 = CO2 + H2O 2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
CH2 + O2 = CO2 + H2CH2 + O2 = CO2 + H2
CsOH+H2CO3=H2O+Cs2CO32CsOH + H2CO3 = 2H2O + Cs2CO3
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaCO3+HNO3=Ca(NO3)2+H2CO3CaCO3 + 2HNO3 = Ca(NO3)2 + H2CO3
C8H18+ 2O2= 4CO2+9HO2C8H18 + 26O2 = 8CO2 + 18HO2
CH3OH+O2=CO2+4HO2CH3OH + 5O2 = 2CO2 + 8HO
CH4 + O2 = CO2 +2H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+H2O=C2H2+O24CO2 + 2H2O = 2C2H2 + 5O2
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl+ KOH = KClO3 + KCl + H2O6Cl + 6KOH = KClO3 + 5KCl + 3H2O
Cl+ KOH = KClO3 + KCl + H2O6Cl + 6KOH = KClO3 + 5KCl + 3H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cr + H2SO4 =Cr2(SO4)3 + H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H8+CO2=H2+COC3H8 + 3CO2 = 4H2 + 6CO
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C7H6O3+O2 = CO2+H2010C7H6O3 + 55O2 = 70CO2 + 3H20
C6H14O4 + O2 = CO2 + H2O2C6H14O4 + 15O2 = 12CO2 + 14H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C7H9+HNO3=C7H6(NO2)3+H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
C5H8O2+NaH+HCl=C5H12O2+NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C4H6O3+H2O=C2H4O2C4H6O3 + H2O = 2C2H4O2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C2H6O + O2 = CO2 + H2010C2H6O + 15O2 = 20CO2 + 3H20
CH4+2Cl2=CCl4+4HClCH4 + 4Cl2 = CCl4 + 4HCl
CH4+2Cl2=CCl4*4HClCH4 + 4Cl2 = CCl4*4HCl
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3=Cu(NO3)+NO2+H2OCu + 2HNO3 = Cu(NO3) + NO2 + H2O
CH4+O2=H2O+CO2CH4 + 2O2 = 2H2O + CO2
Cu(OH)2 + K2SO4 = KOH + CuSO4Cu(OH)2 + K2SO4 = 2KOH + CuSO4
Cu(OH)2 + K2SO4 = KOH + CuSO4Cu(OH)2 + K2SO4 = 2KOH + CuSO4
C4H10(g) + O2(g) = CO2(g) + H2O 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O
CO2+H2O=H2CO3CO2 + H2O = H2CO3
CO(g)+H2(g)=C8H18+H2O8CO(g) + 17H2(g) = C8H18 + 8H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu(NO3)2(s)=CuO(s)+NO2(g)+O2(g)2Cu(NO3)2(s) = 2CuO(s) + 4NO2(g) + O2(g)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C+O2=CO2C + O2 = CO2
Ca3P2+H2O=Ca(OH)2+2PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CS2 +Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Ca2C + H2 = CH2 + CaCa2C + H2 = CH2 + 2Ca
C2H5NH2 + O2 = CO2 + H2O + N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C4H8+O2 = CO2+ H205C4H8 + 20O2 = 20CO2 + 2H20
CuCl2 + Zn = ZnCl2 + CuCuCl2 + Zn = ZnCl2 + Cu
CoCl3+Na2S(aq)=Co2S3+NaCl2CoCl3 + 3Na2S(aq) = Co2S3 + 6NaCl
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
Cu+HNO3=Cu(NO3)2+H2O+NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
C6H8 + O2 = H2O + CO2C6H8 + 8O2 = 4H2O + 6CO2
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + MnSO4 + K2SO4 + CO2 + H2O5CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + 2MnSO4 + K2SO4 + 10CO2 + 8H2O
C6H5OH + O2 = CO2 +H2OC6H5OH + 7O2 = 6CO2 + 3H2O
C14H10 + O2 = CO2 +H2O2C14H10 + 33O2 = 28CO2 + 10H2O
CO(NH2)2 + NO2- + H+ = CO2 + N2 + H2OCO(NH2)2 + 2NO2- + 2H+ = CO2 + 2N2 + 3H2O
CaCO3 + H2SO4 = CaSO4 + CO2 + HOHCaCO3 + H2SO4 = CaSO4 + CO2 + HOH
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CH3CH2CH2CH3+O2=CO2+H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C6H12O6=CO2+CH3CH2OHC6H12O6 = 2CO2 + 2CH3CH2OH
Ca3(PO4)2+SiO2+C=Ca3SiO3+CO+PCa3(PO4)2 + SiO2 + 7C = Ca3SiO3 + 7CO + 2P
Ca(OH)2+SO2=CaSO3+H2OCa(OH)2 + SO2 = CaSO3 + H2O
C6H10+O2=CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
Ca(H2PO4)2=P2O5+Ca3(PO4)2+H2O3Ca(H2PO4)2 = 2P2O5 + Ca3(PO4)2 + 6H2O
C+SO2=CS2+CO5C + 2SO2 = CS2 + 4CO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2CH2CH3+O2=CO2+H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C10H22+O2=CO2+H2010C10H22 + 100O2 = 100CO2 + 11H20
C6H6+O2=CO2+H2010C6H6 + 60O2 = 60CO2 + 3H20
C3H6 + O2 =CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C3H6 + O2 =CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CO + H2 = CH3OHCO + 2H2 = CH3OH
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaS + 2HBr = CaBr2 + H2SCaS + 2HBr = CaBr2 + H2S
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C25H52 + O2 = CO2 + H2OC25H52 + 38O2 = 25CO2 + 26H2O
Ca(OH)2+NH4Cl=CaCl2 +NH3 +H2OCa(OH)2 + 2NH4Cl = CaCl2 + 2NH3 + 2H2O
CuCl2 + Na2CO3 = CuCO3 + NaClCuCl2 + Na2CO3 = CuCO3 + 2NaCl

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.