Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C12H22O11 + H2O = C6H12O6C12H22O11 + H2O = 2C6H12O6
C2H6O + O2 = C2H4O2 + H2OC2H6O + O2 = C2H4O2 + H2O
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
CH3(CH2)6+O2=CO2+H2O4CH3(CH2)6 + 43O2 = 28CO2 + 30H2O
CH3CH3 +O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4+O4=CO2+O2H4CH4 + O4 = CO2 + O2H4
CaSO4+2NaOH=Ca(OH)2+Na2SO4CaSO4 + 2NaOH = Ca(OH)2 + Na2SO4
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH3CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH3(CH2)2CH3(g)+O2(g)=CO2(g)+4H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
CaCO3 = C + CaO + O2CaCO3 = C + CaO + O2
C6H10O2+ O2 = CO2 + H202C6H10O2 + 10O2 = 12CO2 + H20
C6H10+ O2 = CO2 + H202C6H10 + 12O2 = 12CO2 + H20
C6H12+ O2 = CO2 + H205C6H12 + 30O2 = 30CO2 + 3H20
C6H14+ O2 = CO2 + H2010C6H14 + 60O2 = 60CO2 + 7H20
C5H10O+ O2 = CO2 + H202C5H10O + 9O2 = 10CO2 + H20
C5H8+ O2 = CO2 + H205C5H8 + 25O2 = 25CO2 + 2H20
C5H10 + O2 = CO2 + H202C5H10 + 10O2 = 10CO2 + H20
C5H12 + O2 = CO2 + H205C5H12 + 25O2 = 25CO2 + 3H20
CCl4+O2=COCl2+Cl22CCl4 + O2 = 2COCl2 + 2Cl2
CO + HgCl2 = COCl3 + Hg2CO + 3HgCl2 = 2COCl3 + 3Hg
Ca+HOH=Ca(OH)2+H2Ca + 2HOH = Ca(OH)2 + H2
CS2+O2 = CO2 +SO2CS2 + 3O2 = CO2 + 2SO2
CH4+O= CO2+H2OCH4 + 4O = CO2 + 2H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CuO(s)+2HCl(aq)=CuCl2(aq)+H2O(l)CuO(s) + 2HCl(aq) = CuCl2(aq) + H2O(l)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2010C8H18 + 80O2 = 80CO2 + 9H20
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2=CO2+H2010C8H18 + 80O2 = 80CO2 + 9H20
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C3H8(g)+O2(g)=CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C3H8+O2=CO3+H2O2C3H8 + 13O2 = 6CO3 + 8H2O
CO+O2=CO22CO + O2 = 2CO2
CO+O2=CO22CO + O2 = 2CO2
CO+O2=CO22CO + O2 = 2CO2
CaCl2 + Na3PO4= NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
CaCl2 + Na3PO4= NaCl + Ca3(PO4)2=3CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
C2H4 + O2 = CO2+ H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaO + H2O = Ca(OH)2 CaO + H2O = Ca(OH)2
Cu(OH)2+H3O=H2O+CuCu(OH)2 + 2H3O = 4H2O + Cu
CuSO4 + Mg= MgSO4 + CuCuSO4 + Mg = MgSO4 + Cu
C8H18+O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cl2(g) + KBr(aq)= Br2(l ) + KCl (aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H2 + O2 = 4CO2 + 2 H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2 + O2 4 = CO2 + 2 H2O24C2H2 + 5O24 = 48CO2 + 24H2O
CuCl2 +Na2CO3 = NaCl + CuCO3CuCl2 + Na2CO3 = 2NaCl + CuCO3
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cr2O7+Fe3++H=Cr3++Fe+H2O3Cr2O7 + 2Fe3+ + 42H = 2Cr3+ + 6Fe + 21H2O
CrO3+HCl=CrCl2+Cl2+H2OCrO3 + 6HCl = CrCl2 + 2Cl2 + 3H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3CH2COCH3+O2=CO2+H2O2CH3CH2COCH3 + 11O2 = 8CO2 + 8H2O
CH3CH2COCH3+O2=CO2+H2O2CH3CH2COCH3 + 11O2 = 8CO2 + 8H2O
CH3CH2COCH3+O2=CO2+H2O2CH3CH2COCH3 + 11O2 = 8CO2 + 8H2O
C2H8+O2=CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H7N5O16(s) + 19 O2( g)=24 CO2( g)+20 NO2( g) + 14 H2O(g)4C6H7N5O16(s) + 19O2(g) = 24CO2(g) + 20NO2(g) + 14H2O(g)
C4H10( g) + 13 O2( g)=8 CO2( g) + 10 H2O(l )2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
C16H340+O2=CO2+H20C16H340 + 16O2 = 16CO2 + 17H20
C16H330H+O2=CO2+H2020C16H330H + 320O2 = 320CO2 + 331H20
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
Ca+O2=CaO2Ca + O2 = 2CaO
CO+Cl2=COCl2CO + Cl2 = COCl2
Ca(NO3)2+NaOH=CaOH+Na(NO3)2Ca(NO3)2 + NaOH = CaOH + Na(NO3)2
Ca(NO3)2+Na2S=CaS+Na2(NO3)2Ca(NO3)2 + Na2S = CaS + Na2(NO3)2
Ca(NO3)2+Na2CO3=CaCO3+Na2(NO3)2Ca(NO3)2 + Na2CO3 = CaCO3 + Na2(NO3)2
C2H6+ O2= CO2+ H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CCl4+ O2= CCl2O+ Cl22CCl4 + O2 = 2CCl2O + 2Cl2
CH3(NO2)+ O2= (NO2) CO2+H2O4CH3(NO2) + 7O2 = 4(NO2)CO2 + 6H2O
Cl2+ KBr= KCl+ BrCl2 + 2KBr = 2KCl + 2Br
CdCO3= CdO+ CO2CdCO3 = CdO + CO2
CdCO3= CdO+ CO2CdCO3 = CdO + CO2
CdCO3= CdO+ CO2CdCO3 = CdO + CO2
CdCO3= CdO+ CO2CdCO3 = CdO + CO2
CdCO3= CdO+ CO2CdCO3 = CdO + CO2
CdCO3= CdO+ CO2CdCO3 = CdO + CO2
C12H22011=C+H2020C12H22011 = 240C + 22011H20
C5H11COOH + H2O = C5H11COOO + H3C5H11COOH + H2O = C5H11COOO + H3
Co(OH)2 + HNO3 = Co + NO3 + H2OCo(OH)2 + 2HNO3 = Co + 2NO3 + 2H2O
Ca(OH)2 (s) = CaO (s) + H2OCa(OH)2(s) = CaO(s) + H2O
CO + H2O = CO2 + H2CO + H2O = CO2 + H2
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Cr2+ +K =Cr + 2K+Cr2+ + K = 2Cr + K+
Cr2+ +K=Cr +2K0Cr2+ + K = 0Cr + K
CH3COOH+Ba(OH)2= BaCH2+CO2+H2OCH3COOH + Ba(OH)2 = BaCH2 + CO2 + 2H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Cu + CO2 + H2O = CuCO3 + Cu(OH)20Cu - CO2 + H2O = -1CuCO3 + Cu(OH)2
Cu + O = CuO2Cu + 2O = CuO2
Cu + O = Cu2O2Cu + O = Cu2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CH4(g) + O2(g) = CO2(g) + H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cl2(g) + KBr(aq) = Br2(l) + KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
CaBr2(aq) + 2AuClO4(aq) = 2AuBr(s) + Ca(ClO4)2(aq)CaBr2(aq) + 2AuClO4(aq) = 2AuBr(s) + Ca(ClO4)2(aq)
Ca (OH)2 + H3PO3 = Ca3 (PO3)2 +H2O3Ca(OH)2 + 2H3PO3 = Ca3(PO3)2 + 6H2O
Ca(HCO3)2 = CaCO3( s) + H2O (l) + CO2 Ca(HCO3)2 = CaCO3(s) + H2O(l) + CO2
CCl4+O2 = COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
C5H8(l)+ O2(g)=5CO2(g)+4H2O(g)C5H8(l) + 7O2(g) = 5CO2(g) + 4H2O(g)
C5H8(l)+ O2=5CO2+4H2OC5H8(l) + 7O2 = 5CO2 + 4H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C7H14+O=CO2+H2OC7H14 + 21O = 7CO2 + 7H2O
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C3H8O3 + K2Cr2O7 + 8 HNO3 = 2 Cr(NO3)3 + 2 KNO3 + C3H2O3 + 7 H2OC3H8O3 + K2Cr2O7 + 8HNO3 = 2Cr(NO3)3 + 2KNO3 + C3H2O3 + 7H2O
CH3(CH2)3CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)3CH3(l) + 8O2(g) = 5CO2(g) + 6H2O(g)
CH3 + O2 = CO2 + H2O4CH3 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = H2O + CO2C3H8 + 5O2 = 4H2O + 3CO2
C3H8 + O2 = H20 + CO25C3H8 + 15O2 = 2H20 + 15CO2
C + O2 = CO2C + O2 = CO2
C57H110O6 + O2 = CO2 + H2O2C57H110O6 + 163O2 = 114CO2 + 110H2O
Ca3(PO4)2 + H2SO4 = H3PO4 + CaSO4Ca3(PO4)2 + 3H2SO4 = 2H3PO4 + 3CaSO4
CrCl3 + Na3PO4 = CrPO4 + NaClCrCl3 + Na3PO4 = CrPO4 + 3NaCl
C2H4 + HCl + O2 = ClCH2CH2Cl + H2O2C2H4 + 4HCl + O2 = 2ClCH2CH2Cl + 2H2O
CCl4 + SbF3 = CCl2F2 + SbCl33CCl4 + 2SbF3 = 3CCl2F2 + 2SbCl3
C2H5SH + O2 = CO2 + H2O + SO22C2H5SH + 9O2 = 4CO2 + 6H2O + 2SO2
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C5H6O(l) + O2(g) = CO2(g) + H2O(l)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(l)
C3H6(g) + O2(g) = CO2(g) + H2O(l) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(l)
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu(s) + H2SO4(aq) = CuSO4(aq) + SO2(g) + H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
C2H5 + O2 = CO2 + H2O4C2H5 + 13O2 = 8CO2 + 10H2O
CaSO4 + 2 FeO3 = Fe(SO4)3 + CaO3CaSO4 + FeO3 = Fe(SO4)3 + 3CaO
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C3H8O3 + K2Cr2O7 + 8 HNO3 = 2 Cr(NO3)3 + 2 KNO3 + C3H2O3 + 7 H2OC3H8O3 + K2Cr2O7 + 8HNO3 = 2Cr(NO3)3 + 2KNO3 + C3H2O3 + 7H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C4H10O2+CaCO3=CaC+CO3+OH3C4H10O2 + 20CaCO3 = 20CaC + 12CO3 + 30OH
C4H10O2+CaCO3=CaH+CCO3+OH5C4H10O2 + 28CaCO3 = 28CaH + 24CCO3 + 22OH
C4H10O2+CaCO3=Ca+CCO3+OH3C4H10O2 + 28CaCO3 = 28Ca + 20CCO3 + 30OH
C4H10O2+CaCO3=CCa+CO3+OH3C4H10O2 + 20CaCO3 = 20CCa + 12CO3 + 30OH
C4H10O2+CaCO3=CCa+CO3+H2OC4H10O2 + 5CaCO3 = 5CCa + 4CO3 + 5H2O
C4H10O2+CaCO3=Ca+CCO3+H2OC4H10O2 + 6CaCO3 = 6Ca + 5CCO3 + 5H2O
CH3(CH2)6CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3(CH2)6CH3(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
C4H10O2+SIO2=CSI+HOC4H10O2 + 4SIO2 = 4CSI + 10HO
Cr2S3 + Mn (NO3)2 + Na2CO3 = Na2CrO4 + Na2MnO4 + Na2SO4 + NO + CO2Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4 + 30NO + 20CO2
C4H8S2 + O2 = CO2+H2O+SO2C4H8S2 + 8O2 = 4CO2 + 4H2O + 2SO2
C4H8S2 + O2 = CO2+H2O+SOC4H8S2 + 7O2 = 4CO2 + 4H2O + 2SO
Ca(C3H5O3)+Ag(C2H3O2)=Ca(C2H3O2)+Ag(C3H5O3)Ca(C3H5O3) + Ag(C2H3O2) = Ca(C2H3O2) + Ag(C3H5O3)
CS2 + O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
CaC2O4 + Sr3(PO3)2 = Ca(PO3)2 + Sr3(C2O4)CaC2O4 + Sr3(PO3)2 = Ca(PO3)2 + Sr3(C2O4)
CaC2O4 + Sr3(PO3)2 = Ca(PO3)2 + Sr3(C2O4)CaC2O4 + Sr3(PO3)2 = Ca(PO3)2 + Sr3(C2O4)
CaC2O4 + Sr3(PO3)2 = Ca(PO3)2 + Sr3(C2O4)CaC2O4 + Sr3(PO3)2 = Ca(PO3)2 + Sr3(C2O4)
CH4S + 7O2 = 2CO2 + H2O + SO32CH4S + 7O2 = 2CO2 + 4H2O + 2SO3
CH3CH2OH + O2= CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
CH3CH2OH + O2= CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
CH4 + 3O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 3O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C5H12 + O2 = CO2 + H2C5H12 + 5O2 = 5CO2 + 6H2
C2H6O(l)+3O2(g) = 3H2O(l)+3CO2(g) C2H6O(l) + 3O2(g) = 3H2O(l) + 2CO2(g)
CH4(g) + Br2(g) = CBr4(g) + HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
CH3OH(l) + O2(g) = CO2(g) + H2O(l)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(l)
CH3OH(l) + O2(g) = CO2(g) + H2O(l)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(l)
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
Co+PbCl2=CoCl2+PbCo + PbCl2 = CoCl2 + Pb
CH4 + O2 = H2C6H8O4 +H2O12CH4 + 11O2 = 2H2C6H8O4 + 14H2O
CH4(g)+Br2(g)=CBr4(g) + HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
CH3NH2 + O2 = 14H2O + 2N2 + 8CO24CH3NH2 + 9O2 = 10H2O + 2N2 + 4CO2
Ca(OH)2 + H3PO4 = Ca3(PO4)2+ H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C3H5(NO3)3=CO2+H2O+N2+O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
C3H8O3(g)+O2(g)=CO2(g)+H2O(g)2C3H8O3(g) + 7O2(g) = 6CO2(g) + 8H2O(g)
CaCl+ NaHSO4 = Ca(HSO4)2 + Na2ClCaCl + 2NaHSO4 = Ca(HSO4)2 + Na2Cl
C5H7OH + O2 = CO2 + H2010C5H7OH + 45O2 = 50CO2 + 4H20
C5H7OH + O2 = CO2 + H2010C5H7OH + 45O2 = 50CO2 + 4H20
C5H7OH + O2 = CO2 + H2O2C5H7OH + 13O2 = 10CO2 + 8H2O
CuNO2+Mg(CIO4)2=CuCIO4+Mg(NO2)22CuNO2 + Mg(CIO4)2 = 2CuCIO4 + Mg(NO2)2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C2H6 + 7O2 = 2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 + O3 = CO2 + H2O3CH4 + 4O3 = 3CO2 + 6H2O
CH3CH2OH+K2Cr2O7+H2SO4=CH3CHO+K2SO4+Cr2(SO4)3+H2O3CH3CH2OH + K2Cr2O7 + 4H2SO4 = 3CH3CHO + K2SO4 + Cr2(SO4)3 + 7H2O
CH3CH2OH+K2Cr2O7+H2SO4=CH3CHO+K2SO4+Cr(SO4)3+H2O0CH3CH2OH + K2Cr2O7 + 7H2SO4 = 0CH3CHO + K2SO4 + 2Cr(SO4)3 + 7H2O
CH3CH2OH+K2Cr2O7+H2SO4=CH3CHO+K2SO4+Cr(SO4)3+H2O0CH3CH2OH + K2Cr2O7 + 7H2SO4 = 0CH3CHO + K2SO4 + 2Cr(SO4)3 + 7H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CCl4 + 6 NaOH = Na2CO3 + 4 NaCl + 3 H2OCCl4 + 6NaOH = Na2CO3 + 4NaCl + 3H2O
CH3CH2OH+K2Cr2O7+H2SO4=CH3CHO+K2SO4+Cr2(SO4)+H2O5CH3CH2OH + K2Cr2O7 + 2H2SO4 = 5CH3CHO + K2SO4 + Cr2(SO4) + 7H2O
CrI3+Cl2+Na(OH)=Na2CrO4+NaIO4+NaCl+H2O2CrI3 + 27Cl2 + 64Na(OH) = 2Na2CrO4 + 6NaIO4 + 54NaCl + 32H2O
C3H8+O2=CO2+H2C3H8 + 3O2 = 3CO2 + 4H2
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H4(g) + H2(g) = C2H6(g)C2H4(g) + H2(g) = C2H6(g)
CO2+H2O=H+HCO3CO2 + H2O = H + HCO3
CO2+H2O=H+HCO3CO2 + H2O = H + HCO3
CaF2 + Na2CO3 + HCl = CaCl + CO2 + NaOH+HF +H2O0CaF2 - Na2CO3 + 0HCl = 0CaCl - CO2 - 2NaOH + 0HF + H2O
CaF2 + Na2CO3 + HCl = CaCl + CO2 + NaOH + HF +H2O0CaF2 - Na2CO3 + 0HCl = 0CaCl - CO2 - 2NaOH + 0HF + H2O
C8H18 + O2= CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaF2 + Na2CO3 + HCl = CaCl + CO2 + NaOH + HF + H2O0CaF2 - Na2CO3 + 0HCl = 0CaCl - CO2 - 2NaOH + 0HF + H2O
CS+2Cl=2CCl+SClCS + 2Cl = CCl + SCl
C2H3OCI+O2=8CO+H2O+2CI22C2H3OCI + 3O2 = 5CO + 3H2O + CI2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca(OH)2 + HBr = CaBr2 +H2OCa(OH)2 + 2HBr = CaBr2 + 2H2O
C2H4(g) + O2(g) = CO2 + H2OC2H4(g) + 3O2(g) = 2CO2 + 2H2O
C2H4(g) + O2(g) = CO + H2OC2H4(g) + 2O2(g) = 2CO + 2H2O
C2H4(g) + O2(g) = C + H2OC2H4(g) + O2(g) = 2C + 2H2O
C2H4(g) + O2(g) = CO + H2OC2H4(g) + 2O2(g) = 2CO + 2H2O
C2H4(g) + O2(g) = CO2 + H2OC2H4(g) + 3O2(g) = 2CO2 + 2H2O
Ca(s) + H2O(l) =Ca(OH)2(aq) +H2Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2 + O2 = CO2 + H2(g)C2H2 + 2O2 = 2CO2 + H2(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H4(NH2)2+H2O+HNO3=C2H10N2O6+NH34C2H4(NH2)2 + 9H2O + 5HNO3 = 4C2H10N2O6 + 5NH3
CH2H4(NH2)2+HNO3=C2H10N4O6+NH3+H2O8CH2H4(NH2)2 + 11HNO3 = 4C2H10N4O6 + 11NH3 + 9H2O
CH2H4(NH2)2+HNO3+H2O=C2H10N4O6+NH38CH2H4(NH2)2 + 11HNO3 - 9H2O = 4C2H10N4O6 + 11NH3
CH2H4(NH2)2+HNO3+H2O=C2H10N4O6+N210CH2H4(NH2)2 + 22HNO3 - 36H2O = 5C2H10N4O6 + 11N2
C2H4+O2 = CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cl2 +KI= KCl + I2Cl2 + 2KI = 2KCl + I2
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Cu(NO3)2(aq) + NaOH(aq) = Cu(OH)2(s) + NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Ca3(PO4)2+H2SO4=CaSO4+H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cr++ + Br2 = Cr+++ + Br-2Cr++ + Br2 = 2Cr+++ + 2Br-
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H10O4+4NH3+4H2=C6H16N2+2H2OC6H10O4 + 2NH3 + 4H2 = C6H16N2 + 4H2O
Cr2O3(s) + 2Al(s) = 2Cr(l) +Al2O3(s)Cr2O3(s) + 2Al(s) = 2Cr(l) + Al2O3(s)
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C6H14O4 + O2 = H2O + CO22C6H14O4 + 15O2 = 14H2O + 12CO2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CCl4 + O2 = COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
CaC2+H2O+CO2=Ca(OH)2+CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
CCl4 + O2 = COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
CO2(g)+H2O=H2CO3(aq)CO2(g) + H2O = H2CO3(aq)
Cu+ O2= CuO2Cu + O2 = 2CuO
Cu+ O2= CuO2Cu + O2 = 2CuO
CH3CH2OOH+H2O=CH3COOH+CH3OH2CH3CH2OOH + 0H2O = CH3COOH + 2CH3OH
CIO2 + H2O= HCIO3+HCI6CIO2 + 3H2O = 5HCIO3 + HCI
C6H1206 + H2SO4 = CO2 + SO2+ H2OC6H1206 + 615H2SO4 = 6CO2 + 615SO2 + 1218H2O
C6H1206 + H2SO4 = CO2 + SO2+ H2OC6H1206 + 615H2SO4 = 6CO2 + 615SO2 + 1218H2O
C6H1206 + H2SO4 = C + SO2+ H2OC6H1206 + 603H2SO4 = 6C + 603SO2 + 1206H2O
C6H1206 + H2SO4 = CO2 + SO2 + H2OC6H1206 + 615H2SO4 = 6CO2 + 615SO2 + 1218H2O
Cl- + MnO4- = Mn++ + Cl2 + O-6Cl- + 2MnO4- = 2Mn++ - 3Cl2 + 8O
C + H2SO4 = CO2 + SO2 + H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
CCl4 + O2=COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
CaCO3 + H3PO4 = Ca3(PO4)2 + H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
CrCl3(aq) + Pb(C2H3O2)2(aq) = Cr(C2H3O2)3(aq) + PbCl2(s)=2CrCl3(aq) + 3Pb(C2H3O2)2(aq) = 2Cr(C2H3O2)3(aq) + 3PbCl2(s)
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6O(g) + O2(g) = CO2(g) + H2O(g)C2H6O(g) + 3O2(g) = 2CO2(g) + 3H2O(g)
C5H12(g) + O2(g) = CO2(g) + H2O(l)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(l)
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO + H2O = H2 + CO2CO + H2O = H2 + CO2
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
C2H6(g)+O2(g) =H2O(g)+CO2(g)2C2H6(g) + 7O2(g) = 6H2O(g) + 4CO2(g)
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
Co(s)+O2(g)=Co2O3(s)4Co(s) + 3O2(g) = 2Co2O3(s)
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C + HNO3 = CO2 + NO2 + H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C2H2 + O2 = CO2 + H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H8(g)+O2(g)=CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
CuCl2(aq)+NaOH(aq)=Cu(OH)2(s)+NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CO2 (s) =CO2 (g)CO2(s) = CO2(g)
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H5OH(l)+O2(g)=2CO2(g)+3H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
C2H5OH(l)+O2(g)=CO2(g)+3H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Cu(NO3)2 + Sr(OH)2 = Cu(OH)2 + Sr(NO3)2Cu(NO3)2 + Sr(OH)2 = Cu(OH)2 + Sr(NO3)2
Cr2O3 + Li2SO4 = Cr2(SO4)3 + Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CO+O2=CO22CO + O2 = 2CO2
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuSO4 + NH3= Cu(NH3)4 + SO4CuSO4 + 4NH3 = Cu(NH3)4 + SO4
Cl2O7 +Na2O= NaClO4Cl2O7 + Na2O = 2NaClO4
C3H8+O2=CO2 +H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8O3 + K2Cr2O7 + HNO3 = KNO3 + Cr(NO3)3 + CO2 + H2O 3C3H8O3 + 7K2Cr2O7 + 56HNO3 = 14KNO3 + 14Cr(NO3)3 + 9CO2 + 40H2O
CH4+O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CaOH+Na2O=CaO+NaH+H22CaOH + 0Na2O = 2CaO + 0NaH + H2
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C+H2SO4=CO2+SO2+H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C4H10(g) +O2(g)= CO2(g) + H2O(l) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10(g) + O2(g) = CO2(g) + H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CrCl3 (aq) + Na2CO3 (aq) = Cr2(CO3)3(s) + NaCl(aq)2CrCl3(aq) + 3Na2CO3(aq) = Cr2(CO3)3(s) + 6NaCl(aq)
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C5H9O + O2=CO2 +H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C3H8+ O2=CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H8S2 (l) + O2 (g) = CO2 (g) + H2O (g) + SO2 (g)C4H8S2(l) + 8O2(g) = 4CO2(g) + 4H2O(g) + 2SO2(g)
C4H8S2 (l) + O2 (g) = CO2 (g) + H2O (g) + SO2 (g)C4H8S2(l) + 8O2(g) = 4CO2(g) + 4H2O(g) + 2SO2(g)
Ca + Mg(NO3)2 = Ca(NO3)2 +MgCa + Mg(NO3)2 = Ca(NO3)2 + Mg
CH4 (g)+ O2 (g) = CO2 (g) + H2O (l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cd (NO3)2 + H2S = CdS + HNO3Cd(NO3)2 + H2S = CdS + 2HNO3
Cu (NO3)2 + H2S = CuS + HNO3Cu(NO3)2 + H2S = CuS + 2HNO3
Co(NO3)2 + H2S = CoS + HNO3Co(NO3)2 + H2S = CoS + 2HNO3
C12H22O11 + NH3 = C10H17O6N + CO2 + H2O7C12H22O11 + 8NH3 = 8C10H17O6N + 4CO2 + 21H2O
C6H12O6 + NH3 + O2 = C10H17O6N + CO2-7C6H12O6 - 6NH3 + 21O2 = -6C10H17O6N + 18CO2
C6H12O6+ NH3 = C10H17O6N + CO2 + H2O7C6H12O6 + 4NH3 = 4C10H17O6N + 2CO2 + 14H2O
Cl2 + NaOH = NaCl + NaClO + H2OCl2 + 2NaOH = NaCl + NaClO + H2O
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
Cl2 + KOH = KCl + KClO3 + H2O3Cl2 + 6KOH = 5KCl + KClO3 + 3H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cu(s) + Au(NO3)3 (aq) = Cu(NO3)2 + Au3Cu(s) + 2Au(NO3)3(aq) = 3Cu(NO3)2 + 2Au
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4(g)+Br2(g)=CBr4(g)+HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
CH4(g)+Br2(g)=CBr4(g)+HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
CCl4 +O2 = COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca+Al(NO3)3 =Al+ Ca(NO3)23Ca + 2Al(NO3)3 = 2Al + 3Ca(NO3)2
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
CoNO3+NH4=Co2+NH4NO32CoNO3 + 2NH4 = Co2 + 2NH4NO3
C3H8 + O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl2+NaBr=Br2+NaClCl2 + 2NaBr = Br2 + 2NaCl
Cl2+P=PCl33Cl2 + 2P = 2PCl3
C+4H2=CH4C + 2H2 = CH4
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C3H8(g)+5O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cr2O3 + K(NO3) + Na2CO3 = Na2(CrO4) + KNO2 + CO2Cr2O3 + 3K(NO3) + 2Na2CO3 = 2Na2(CrO4) + 3KNO2 + 2CO2
Cr2O3 + K(NO3) + Na2CO3 = Na2(CrO4) + KNO2 + CO2Cr2O3 + 3K(NO3) + 2Na2CO3 = 2Na2(CrO4) + 3KNO2 + 2CO2
CH3(CH2)5 CH3(l) + O2(g) = CO2(g) + H2O(g)CH3(CH2)5CH3(l) + 11O2(g) = 7CO2(g) + 8H2O(g)
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
CH3 CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H5OCH3(g) + O2(g) = CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
Ca + HF = CaF2 + H2Ca + 2HF = CaF2 + H2
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C7H13OH + O2 = CO2+ H2OC7H13OH + 10O2 = 7CO2 + 7H2O
Cr2O3 + Si = Cr + SiO2 2Cr2O3 + 3Si = 4Cr + 3SiO2
CO+H2CO3=C27H54O7+O20CO + 27H2CO3 = C27H54O7 + 37O2
Cl2O7+2H3PO4=P2O5+HClO43Cl2O7 + 2H3PO4 = P2O5 + 6HClO4
CaSO + O = CaSO4CaSO + 3O = CaSO4
CaSO + 3O = CaSO4CaSO + 3O = CaSO4
CaSO + O2 = CaSO42CaSO + 3O2 = 2CaSO4
CaO + SO2 = CaSO3CaO + SO2 = CaSO3
CoI3 + Li2S = Co2S3 + LiI2CoI3 + 3Li2S = Co2S3 + 6LiI
Cl2 + KBr2 = 2KCl + Br2Cl2 + 2KBr2 = 2KCl + 2Br2
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CCl 4 (g)+O 2 (g)=COCl 2 (g) + Cl 2 (g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C27H54O7+O2=CO+H2CO3C27H54O7 + 37O2 = 0CO + 27H2CO3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H12O6 + O2 = H2+ CO2 C6H12O6 + 3O2 = 6H2 + 6CO2
C6H12O6 + O2 = H2+ CO2C6H12O6 + 3O2 = 6H2 + 6CO2
C6H12O6 + O2 = CH4 + CO2C6H12O6 + 0O2 = 3CH4 + 3CO2
C6H12O6 + O2 = CH4 + CO2C6H12O6 + 0O2 = 3CH4 + 3CO2
C7H8O2(l)+O2(g) = CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g) = CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C2H2+H2 =C4H82C2H2 + 2H2 = C4H8
C2H2+H2 =C4H82C2H2 + 2H2 = C4H8
CaCO3+HCl=CO2+CaCl2+H2OCaCO3 + 2HCl = CO2 + CaCl2 + H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cr2O3 + CO = Cr + CO2Cr2O3 + 3CO = 2Cr + 3CO2
CO + O2 = CO22CO + O2 = 2CO2
CO + O2 = CO22CO + O2 = 2CO2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C + Cl2 = CCl4C + 2Cl2 = CCl4
C + O2 = CO2C + O2 = CO2
CaO + SO2 + O2= CaSO42CaO + 2SO2 + O2 = 2CaSO4
Ca3P2(s)+ 6H2O(l)= 3Ca(OH)2(aq)+ 2PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Cu+1 + Au+3 = Cu+2 + Au3Cu+1 + Au+3 = 3Cu+2 + Au
CH + O2 = CO2 + H2O4CH + 5O2 = 4CO2 + 2H2O
CH3NHCH3+O2=CO2+NO2+H2O4CH3NHCH3 + 19O2 = 8CO2 + 4NO2 + 14H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C4H10 + O2= CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
ClO3- + Zn + 2OH- = ZnO2-- + ClO2- + H2OClO3- + Zn + 2OH- = ZnO2-- + ClO2- + H2O
Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CaF2 + H2SO4 =2HF + CaSO4CaF2 + H2SO4 = 2HF + CaSO4
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6=C2H6O+CO2C6H12O6 = 2C2H6O + 2CO2
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CaCl2 + (NH4)2CO3 = CaCO3 + NH4ClCaCl2 + (NH4)2CO3 = CaCO3 + 2NH4Cl
CaCl2 + (NH4)2CO3 = CaCO3 + NH4ClCaCl2 + (NH4)2CO3 = CaCO3 + 2NH4Cl
CH3(CH2)7CH3(l) + 14 O2(g) = 9 CO2(g) + 10 H2O(l)CH3(CH2)7CH3(l) + 14O2(g) = 9CO2(g) + 10H2O(l)
CH3(CH2)7CH3 + 14 O2 = 9 CO2 + 10 H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
Ca3(PO4)2+H2SO4=CaSO4=H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
C3H8O + O2 = CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
Ca3(PO4)2 + HNO3=Ca(NO3)2 + H3PO4 Ca3(PO4)2 + 6HNO3 = 3Ca(NO3)2 + 2H3PO4
CuO(s) = Cu(s) + O2(g) 2CuO(s) = 2Cu(s) + O2(g)
C2H6O2 + 5O2 = 4CO2 + 6H2O2C2H6O2 + 5O2 = 4CO2 + 6H2O
Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CaF2 + H2SO4 = 2HF + CaSO4CaF2 + H2SO4 = 2HF + CaSO4
CuCl2+H2=Cu+HClCuCl2 + H2 = Cu + 2HCl
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H5OH + O2 = CO2+ H2OC3H5OH + 4O2 = 3CO2 + 3H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10(g) + O2(g)= CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C2H6(g) +O2(g) = H2O(g) + CO2(g)2C2H6(g) + 7O2(g) = 6H2O(g) + 4CO2(g)
C5H9O +O2 = CO2 +H2O4C5H9O + 27O2 = 20CO2 + 18H2O
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca3(PO4)2+KNO3=Ca(NO3)2+K3PO4Ca3(PO4)2 + 6KNO3 = 3Ca(NO3)2 + 2K3PO4
Ca3(PO4)2+KNO3=Ca(NO3)2+K3PO4Ca3(PO4)2 + 6KNO3 = 3Ca(NO3)2 + 2K3PO4
CrCl3 + IK + KOH = K2CrO4 + KIO3 + KCl + H2O2CrCl3 - IK + 10KOH = 2K2CrO4 - KIO3 + 6KCl + 5H2O
CrCl3 + KClO3 +KOH = K2CrO4 + KCl + H2O2CrCl3 + KClO3 + 10KOH = 2K2CrO4 + 7KCl + 5H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cr2O3 + H2 = Cr + H2OCr2O3 + 3H2 = 2Cr + 3H2O
C3H4 + O2 = CO2 + H2OC3H4 + 4O2 = 3CO2 + 2H2O
Ca + Br2 =CaBr2Ca + Br2 = CaBr2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+H2O=C6H12O6+O66CO2 + 6H2O = C6H12O6 + 2O6
Ca + 2 H2O=Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CH3CH2OH + O2= H20 = CH3COOH10CH3CH2OH + 5O2 = H20 + 10CH3COOH
C4H8+6O2= 4CO2+4H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H8+6O2= 4CO2+4H2OC4H8 + 6O2 = 4CO2 + 4H2O
Co(NO3)2 + HNO2 = NO + Co(NO3)3 + H2OCo(NO3)2 + 4HNO2 = 3NO + Co(NO3)3 + 2H2O
Cd(NO3)2 + NH4Cl = CdCl + (NO3)2NH4Cd(NO3)2 + NH4Cl = CdCl + (NO3)2NH4
CrCl3 + KClO3 + KOH = KCl + K2CrO4 + H2O2CrCl3 + KClO3 + 10KOH = 7KCl + 2K2CrO4 + 5H2O
CaNO3 + Co2(SO4)3 = CaSO4 + Co2(NO3)33CaNO3 + Co2(SO4)3 = 3CaSO4 + Co2(NO3)3
C5H12 (g)12 (g)+ 8 O2 (g) =5 CO2 (g) +6 H2O (g)C5H12(g)12(g) + 308O2(g) = 5CO2(g) + 606H2O(g)
C6H12O6+O=H2O+CO2C6H12O6 + 12O = 6H2O + 6CO2
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu + HNO3 = Cu(NO3)2 + NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H5OH + O2 = CO2+ H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca(NO3)2 + Fe2(SO4)3 = Ca(SO4) + Fe(NO3)33Ca(NO3)2 + Fe2(SO4)3 = 3Ca(SO4) + 2Fe(NO3)3
Ca(NO3)2 + Fe2(SO4)3 = Ca(SO4) + Fe(NO3)33Ca(NO3)2 + Fe2(SO4)3 = 3Ca(SO4) + 2Fe(NO3)3
CaCl2+ Na3PO4 = Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CrI + Cl2 + KOH = K2CrO4 + KIO2 + KCl + H2O2CrI + 9Cl2 + 24KOH = 2K2CrO4 + 2KIO2 + 18KCl + 12H2O
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
CH4 + S8 = CS2 + 8HS4CH4 + 3S8 = 4CS2 + 16HS
CrI2 + Cl2 + KOH = K2CrO4 + KIO2 + KClO3 + H2O5CrI2 - 6Cl2 + 8KOH = 5K2CrO4 + 10KIO2 - 12KClO3 + 4H2O
CrI2 + Cl2 + KOH = K2CrO4 + KIO2 + KClO3 + H2O5CrI2 - 6Cl2 + 8KOH = 5K2CrO4 + 10KIO2 - 12KClO3 + 4H2O
Ca + HF = CaF2 + H2Ca + 2HF = CaF2 + H2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H6(g) + O2(g) = CO2(g) + H2O(l)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(l)
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaCO3= Ca + CO3CaCO3 = Ca + CO3
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C7H8+O2=CO2+H2OC7H8 + 9O2 = 7CO2 + 4H2O
C4H8 + 6O2=4CO2 + 4H2OC4H8 + 6O2 = 4CO2 + 4H2O
C7H8+O2=CO2+H205C7H8 + 35O2 = 35CO2 + 2H20
C2H6 + 3O2=2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CoS + NOCl = Co2+ +Cl- + NO + S2CoS + NOCl = Co2+ + Cl- + NO + 2S
C3H6 + 3O2=3CO2 + 3H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CaO(s) + H2O(l)= Ca(OH)2CaO(s) + H2O(l) = Ca(OH)2
C6N6FeK4+H2SO4+H2O=K2SO4+FeSO4+(NH4)2SO4+COC6N6FeK4 + 6H2SO4 + 6H2O = 2K2SO4 + FeSO4 + 3(NH4)2SO4 + 6CO
C6N6FeK4+KMnO4+H2SO4=KHSO3+Fe2(SO4)3+MnSO4+HNO3+CO2+H2O14C6N6FeK4 + 106KMnO4 + 289H2SO4 = 162KHSO3 + 7Fe2(SO4)3 + 106MnSO4 + 84HNO3 + 84CO2 + 166H2O
Ca + H2O = H2 + Ca+2 + OH-Ca + 2H2O = H2 + Ca+2 + 2OH-
Ca + H2O = H2 + Ca2+ + OH-4Ca + 2H2O = H2 + 2Ca2+ + 2OH-
Cr + HClO4= Cr(ClO4)3 + H22Cr + 6HClO4 = 2Cr(ClO4)3 + 3H2
C + S8 = CS24C + S8 = 4CS2
Ca + H2O = H2 + Ca(OH)2Ca + 2H2O = H2 + Ca(OH)2
C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH2+OH=CO2+H2OCH2 + 6OH = CO2 + 4H2O
CO2+H2O=(C6H10O5)+O26CO2 + 5H2O = (C6H10O5) + 6O2
C2H7N+O2=CO2+H2O+N24C2H7N + 15O2 = 8CO2 + 14H2O + 2N2
C4H8O2+O2=CO2+H2OC4H8O2 + 5O2 = 4CO2 + 4H2O
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C2H3O+O2=CO2+H2O4C2H3O + 9O2 = 8CO2 + 6H2O
CaSIO3+HF=SIF4+CaF2+H2OCaSIO3 + 6HF = SIF4 + CaF2 + 3H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca+H2=CaH2Ca + H2 = CaH2
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.