Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CO2+NH3=CO(NH2)2+H2OCO2 + 2NH3 = CO(NH2)2 + H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
Cl2O7+H2O=HClO4Cl2O7 + H2O = 2HClO4
C6H6+O3=CO2+H2O2C6H6 + 6O3 = 6CO2 + 3H2O2
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO+Fe3O4=Fe+CO24CO + Fe3O4 = 3Fe + 4CO2
CCl4 + O2 = CO2 + Cl2CCl4 + O2 = CO2 + 2Cl2
CO+Fe3O4=Fe+CO24CO + Fe3O4 = 3Fe + 4CO2
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C5H6+O2=CO2+H2O2C5H6 + 13O2 = 10CO2 + 6H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CU+AgNO3=Ag+CU(NO3)CU + AgNO3 = Ag + CU(NO3)
Ca3N + H2O = NH3 + CaOHCa3N + 3H2O = NH3 + 3CaOH
CuBr2+K3PO4=Cu3(PO4)2+KBr3CuBr2 + 2K3PO4 = Cu3(PO4)2 + 6KBr
CO2+H2O+Fe(NO3)3=Fe2(CO3)3+HNO33CO2 + 3H2O + 2Fe(NO3)3 = Fe2(CO3)3 + 6HNO3
CCl4 + O2 = CO2 + Cl2CCl4 + O2 = CO2 + 2Cl2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaO+SO3=CaSO4CaO + SO3 = CaSO4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH10+O2=CO2+H2O2CH10 + 7O2 = 2CO2 + 10H2O
C2H4O2 + O2= CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C7H6O2 + O2 = H2O + CO22C7H6O2 + 15O2 = 6H2O + 14CO2
Cu+ 4HNO3 = Cu(NO3) + 2NO2 + 2H2OCu + 2HNO3 = Cu(NO3) + NO2 + H2O
Ca3(PO4)2 + H2SO4 + H2O = CaH4P2O8 + CaSO4Ca3(PO4)2 + 2H2SO4 + 0H2O = CaH4P2O8 + 2CaSO4
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH3OH + O2 =CO2 +H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H5 + O2=CO2 + H2O4C2H5 + 13O2 = 8CO2 + 10H2O
CH4 + H2O=3H2+CO2CH4 + 2H2O = 4H2 + CO2
C2H5OH + SO4-- = CH3COO + HS + H+ + H2O7C2H5OH + 5SO4-- = 7CH3COO + 5HS - 10H+ + 13H2O
C36H74 + O2 = CO2 + H2O2C36H74 + 109O2 = 72CO2 + 74H2O
CH3COOH+HOOH+CU = CU(CH3COO)2+H2O2CH3COOH + HOOH + CU = CU(CH3COO)2 + 2H2O
C3H8 + O2 = H2O + CO2C3H8 + 5O2 = 4H2O + 3CO2
CuSo4+LiCl=CuCl2+Li2So4CuSo4 + 2LiCl = CuCl2 + Li2So4
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H18 + O2 = CO2 + H2O2C2H18 + 13O2 = 4CO2 + 18H2O
Ca+2H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C8H18 + N2O = CO2 + H2O + N2C8H18 + 25N2O = 8CO2 + 9H2O + 25N2
CaCO3 = CO2 + CaOCaCO3 = CO2 + CaO
C + H2SO4 = CO2 + H2O + SO2C + 2H2SO4 = CO2 + 2H2O + 2SO2
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + K2SO4 + MnSO4 + H2O + CO25CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + K2SO4 + 2MnSO4 + 8H2O + 10CO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Co+Ni2+=Co3+ +Ni3Co + Ni2+ = Co3+ + 2Ni
Co+Ni2+=Co3+ +Ni3Co + Ni2+ = Co3+ + 2Ni
C3H5N3O4= N2 + CO2 + O2 + H2O4C3H5N3O4 = 6N2 + 12CO2 - 9O2 + 10H2O
Ca3(PO4)2 + H3PO4 = CaHPO4Ca3(PO4)2 + H3PO4 = 3CaHPO4
Ca3(PO4)2 + H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
Ca3(PO4)2 + H2SO4 + H2O = CaHPO4 + SO30Ca3(PO4)2 + H2SO4 - H2O = 0CaHPO4 + SO3
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C+HNO3 = CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C+HNO3 = CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C8H10+O2=CO2+H2O2C8H10 + 21O2 = 16CO2 + 10H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cu+HNO3=CuNO3+NO2+H2OCu + 2HNO3 = CuNO3 + NO2 + H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3 + HCl = CO2 +CaCl2 + H2OCaCO3 + 2HCl = CO2 + CaCl2 + H2O
C3H6O + O2 = 6CO + 6H2O2C3H6O + 5O2 = 6CO + 6H2O
Cr+Sn++++=Cr++++Sn++2Cr + 3Sn++++ = 2Cr+++ + 3Sn++
Cr+Sn++++=Cr++++Sn++2Cr + 3Sn++++ = 2Cr+++ + 3Sn++
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca+Cl=CaClCa + Cl = CaCl
Ca+P=CaPCa + P = CaP
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CO2+H20=C2H2+O220CO2 + H20 = 10C2H2 + 20O2
C6H5No2+So3=C6H4No2So3HC6H5No2 + So3 = C6H4No2So3H
CH3COOH+HOOH+CU= C4H6CUO4+H2020CH3COOH + 0HOOH + 10CU = 10C4H6CUO4 + H20
C4H6 + 11O2 = 4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C4H6 + 4O2= 4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
CH3COOH+HOOH+CU= C4H6CUO4+C2-1CH3COOH - HOOH - CU = -1C4H6CUO4 + C2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CO2 + H2O = C2H6 + O24CO2 + 6H2O = 2C2H6 + 7O2
C8H18+O2 = CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18+O2 = CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3COOH+HOOH+2CU= C4H6CUO4+C-1CH3COOH - HOOH - CU = -1C4H6CUO4 + 2C
CH3COOH+HOOH+CU= C4H6CUO4+C-1CH3COOH - HOOH - CU = -1C4H6CUO4 + 2C
C2H4(g) + O2(g) =CO2(g) + H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
CH3COOH+HOOH+2CU= CU(CH3COO)2+O2-2CH3COOH + HOOH - CU = -1CU(CH3COO)2 + O2
CH3COOH+HOOH+CU= CU(CH3COO)2+O2-2CH3COOH + HOOH - CU = -1CU(CH3COO)2 + O2
CH3COOH+HOOH+CU= CU(CH3COO)2+CO-3CH3COOH + 0HOOH - 2CU = -2CU(CH3COO)2 + 2CO
CH3COOH+HOOH+CU= CU(CH3COO)2+C-1CH3COOH - HOOH - CU = -1CU(CH3COO)2 + 2C
CH3COOH+HOOH+CU= CU(CH3COO)2 + O-2CH3COOH + HOOH - CU = -1CU(CH3COO)2 + 2O
CH3COOH+HOOH+CU= CU(CH3COO) + H3O2CH3COOH + HOOH + CU = CU(CH3COO) + H3O2
CH3COOH+HOOH+CU= CU(CH3COO) + H2O2CH3COOH + HOOH + 2CU = 2CU(CH3COO) + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca + HCl = CaCl2 + H2Ca + 2HCl = CaCl2 + H2
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C2H6+O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co + O2=Co2O3 4Co + 3O2 = 2Co2O3
CO2+CaO=CaCO3CO2 + CaO = CaCO3
CO2+CaO=CaCO3CO2 + CaO = CaCO3
CsOH + H2 S O4 = Cs2 S O4 + H2 O2CsOH + H2SO4 = Cs2SO4 + 2H2O
C8H18 (g) + N2O (g) = CO2 (g) + H2O (g) + N2 (g)C8H18(g) + 25N2O(g) = 8CO2(g) + 9H2O(g) + 25N2(g)
C3H8+4H2O=8H2+2CO2C3H8 + 6H2O = 10H2 + 3CO2
CH3CH2OH + C8H18= H2O + CO225CH3CH2OH - 6C8H18 = 21H2O + 2CO2
Ca3(PO4)2 + H2SO4 = CaSO4(aq) + Ca(H2PO4)2(aq)Ca3(PO4)2 + 2H2SO4 = 2CaSO4(aq) + Ca(H2PO4)2(aq)
C3H8 + O2 = H2O + CO2 C3H8 + 5O2 = 4H2O + 3CO2
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Ca(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca(PO4)2 + 2SiO2 + 14C = 2CaSiO3 + P4 + 14CO
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Ca(CH3COO)2 + 2Na3PO4 = Ca(PO4)2 + 2Na3(CH3COO)Ca(CH3COO)2 + 2Na3PO4 = Ca(PO4)2 + 2Na3(CH3COO)
Cu + Pb(NO3)2 = Cu(NO3)2 + PbCu + Pb(NO3)2 = Cu(NO3)2 + Pb
Cu + Pb(NO3)2 = Cu(NO3)2 + PbCu + Pb(NO3)2 = Cu(NO3)2 + Pb
CH4+O2=CH3OH2CH4 + O2 = 2CH3OH
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6 + O2 = CO2 + H2010C2H6 + 20O2 = 20CO2 + 3H20
CH3CH3 + O2 = CO2 + H2010CH3CH3 + 20O2 = 20CO2 + 3H20
C18H34O2 + C10H16 + NaOH = 3NaCOO + C3H8O355C18H34O2 - 88C10H16 - 46NaOH = -46NaCOO + 52C3H8O3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CuSO4 + Fe = FeSO4 + CuCuSO4 + Fe = FeSO4 + Cu
Cu(OH)2 + H2SO4 = CuSO4 + H2OCu(OH)2 + H2SO4 = CuSO4 + 2H2O
Cu(NO3)2 + NaOH = Cu(OH)2 + NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
CaO+MnI4=MnO2+CaI22CaO + MnI4 = MnO2 + 2CaI2
C6H6+O2=H20+CO210C6H6 + 60O2 = 3H20 + 60CO2
C6H6+O2=H20+CO210C6H6 + 60O2 = 3H20 + 60CO2
C6H6+O2=H20+CO210C6H6 + 60O2 = 3H20 + 60CO2
C3H8+O2=CO+H2O2C3H8 + 7O2 = 6CO + 8H2O
CuSO4+Na2S=CuS+Na2SO4CuSO4 + Na2S = CuS + Na2SO4
C3H6O2 + CO2 = C4H10O + H2O12C3H6O2 - 8CO2 = 7C4H10O + H2O
C3H6O2 + H2O = C4H10O + CO212C3H6O2 - H2O = 7C4H10O + 8CO2
C3H6O2 + CO2 = C2H10O + H2O-8C3H6O2 + 10CO2 = -7C2H10O + 11H2O
C3H6O2 + H2O = C2H10O + CO28C3H6O2 + 11H2O = 7C2H10O + 10CO2
C3H6O2 + H20 = C2H10O + CO230C3H6O2 + 11H20 = 40C2H10O + 10CO2
CH3CHO + O2 = CH3COOH2CH3CHO + O2 = 2CH3COOH
C6H5No2+So3=C6H4No2So3HC6H5No2 + So3 = C6H4No2So3H
Ca(OH)2+HNO3=H2O+Ca(NO3)2Ca(OH)2 + 2HNO3 = 2H2O + Ca(NO3)2
C2H4(g) + O2(g) = CO2(g) + H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C6H12O6 + CO2 = H2O + CC6H12O6 + 0CO2 = 6H2O + 6C
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H4 + 4O2 = 2CO2 + 2H2O2 C2H4 + 4O2 = 2CO2 + 2H2O2
C2H4 + 4O2 = 2CO2 + 2H2O C2H4 + 3O2 = 2CO2 + 2H2O
CO2 (g)+ 2 H2O(l) = CH4 (g)+ 2 OCO2(g) + 2H2O(l) = CH4(g) + 4O
Ca(s)+H3PO4(aq) =Ca3(PO4)2(s)+H2(g)3Ca(s) + 2H3PO4(aq) = Ca3(PO4)2(s) + 3H2(g)
C8H18(g)+ O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C8H18(g) + O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C3H3+O2=CO2+H2O4C3H3 + 15O2 = 12CO2 + 6H2O
C3H3+O2=CO2+H2O4C3H3 + 15O2 = 12CO2 + 6H2O
CH3OH + O2 = H2O + CO22CH3OH + 3O2 = 4H2O + 2CO2
CCH3OH + O2 = H2O + CO22CCH3OH + 5O2 = 4H2O + 4CO2
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
Ca(ClO)2 + H2O + CO2= CaCO3 + HCl + O2Ca(ClO)2 + H2O + CO2 = CaCO3 + 2HCl + O2
Cl2 + Ca(OH)2 = CaCl2 + Ca(CaClO3)2 +H2O4Cl2 + 6Ca(OH)2 = 3CaCl2 + Ca(CaClO3)2 + 6H2O
Cl2 + S + H2O = H2SO4 +HCl3Cl2 + S + 4H2O = H2SO4 + 6HCl
C2H4O + O2 = CO2 + H2O2C2H4O + 5O2 = 4CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca(ClO)2+HCl=CaCl2+Cl2+H2OCa(ClO)2 + 4HCl = CaCl2 + 2Cl2 + 2H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cl2+KOH=KClO3+KCl+H2O3Cl2 + 6KOH = KClO3 + 5KCl + 3H2O
C6H10(g)+O2(g)=CO2(g)+H2O(g)2C6H10(g) + 17O2(g) = 12CO2(g) + 10H2O(g)
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
C3H8 (g)  +  O2 (g)  = CO2 (g)  +  H2O (g)  C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cr(NO3)3+3Ba = 3Ba(NO3)2 + 2Cr2Cr(NO3)3 + 3Ba = 3Ba(NO3)2 + 2Cr
C2H5OH+O2(g)=H2O+CO2(g)C2H5OH + 3O2(g) = 3H2O + 2CO2(g)
C6H14 + O2=CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CaCl2+AgNO3=AgCl+Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CH3 (CH2)5 CH3 + 5O2= CO2 + 8H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca3 (PO4)2 + SiO2 + C= CaSiO3 + P4 +CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C5H9O(l)+O2(g)=CO2(g)+H2O(l)4C5H9O(l) + 27O2(g) = 20CO2(g) + 18H2O(l)
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CaO+NH4Cl=NH3+H2O+CaCl2 CaO + 2NH4Cl = 2NH3 + H2O + CaCl2
CH3NH2+O2=CO2+H2O+N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
Ca3(PO4)2+SiO2+C=P4+CaSiO3+CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
CuO (s)=Cu (s) + O2 (g)2CuO(s) = 2Cu(s) + O2(g)
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CaO+NH4Cl=NH3+H2O+CaCl2CaO + 2NH4Cl = 2NH3 + H2O + CaCl2
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
C2H3OF+O2=8CO2+6H2O+F24C2H3OF + 9O2 = 8CO2 + 6H2O + 2F2
C4H10O3+5O2=CO2+H2OC4H10O3 + 5O2 = 4CO2 + 5H2O
CH3CH2CH2CH3 + 13O2=CO2 + 10H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C6H5Cl+O2=CO2+10H2O+2Cl24C6H5Cl + 29O2 = 24CO2 + 10H2O + 2Cl2
C3H6 + O2 = CO + 3H2OC3H6 + 3O2 = 3CO + 3H2O
C2H3O2Br + 3O2=8CO + H2O + Br24C2H3O2Br + 3O2 = 8CO + 6H2O + 2Br2
C5H5N+O2=20CO2+10H2O+NO24C5H5N + 29O2 = 20CO2 + 10H2O + 4NO2
C2H7N + O2=8CO2 + H2O + 4NO24C2H7N + 19O2 = 8CO2 + 14H2O + 4NO2
C6H6OS+5O2= CO+3H2O+SO2C6H6OS + 5O2 = 6CO + 3H2O + SO2
C3H8(g) +O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CaO + NH4Cl = NH3 + H2O + CaCl2CaO + 2NH4Cl = 2NH3 + H2O + CaCl2
CaCO3+HCl=CaCl2 +CO2 +H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3+SO2+O2 =CaSO4 +CO2 2CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CaCO3 + SO2 + O2 = CaSO4 + CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CaCO3 +SO2 +O2 =CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CaCO3 (s) + SO2 (g) + O2 (g) = CaSO4 (s) +CO2 (g)2CaCO3(s) + 2SO2(g) + O2(g) = 2CaSO4(s) + 2CO2(g)
C3H8O(g) + O2(g) = CO2(g) + H2O(g)2C3H8O(g) + 9O2(g) = 6CO2(g) + 8H2O(g)
C7H16O(g) + O2(g) = CO2(g) + H2O(g)2C7H16O(g) + 21O2(g) = 14CO2(g) + 16H2O(g)
C5H12O(g) + O2(g) = CO2(g) + H2O(g)2C5H12O(g) + 15O2(g) = 10CO2(g) + 12H2O(g)
CoCl2 + NH4NO3 = Co(NO3)2 + NH4ClCoCl2 + 2NH4NO3 = Co(NO3)2 + 2NH4Cl
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
C3H4+O2=H2O+CO2C3H4 + 4O2 = 2H2O + 3CO2
Cu+H2SO4=CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CuCO3 = CuO +CO2CuCO3 = CuO + CO2
C2H4(g) + O2(g) = CO2(g) + H2O(l)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(l)
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C+S8=CS24C + S8 = 4CS2
C2H3O2Cl + O2 = CO + H2O + HCl2C2H3O2Cl + O2 = 4CO + 2H2O + 2HCl
CaF2 + H2SO4 = HF + CaSO4CaF2 + H2SO4 = 2HF + CaSO4
C3H6O+NaOH+H2SO4=Na2SO4+C3H8O22C3H6O + 2NaOH + H2SO4 = Na2SO4 + 2C3H8O2
C6H6 + O2 = CO + H2O2C6H6 + 9O2 = 12CO + 6H2O
C2H3Br3 + O2 = CO2 + H2O + Br24C2H3Br3 + 11O2 = 8CO2 + 6H2O + 6Br2
CaS+Fe3(Po4)2=Ca3(Po4)2+FeS3CaS + Fe3(Po4)2 = Ca3(Po4)2 + 3FeS
C3H8+5O2 = 3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaO +PbCl2 = PbO + CaCl2CaO + PbCl2 = PbO + CaCl2
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+H2O=CO2+H2O0C2H4 + H2O = 0CO2 + H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaCl2=Ca+Cl2CaCl2 = Ca + Cl2
CaCO3(s) +SO2(g) +O2 (g)=CaSO4(s) +CO2(g)2CaCO3(s) + 2SO2(g) + O2(g) = 2CaSO4(s) + 2CO2(g)
CaO+NH4Cl=NH3+H2O+CaCl2CaO + 2NH4Cl = 2NH3 + H2O + CaCl2
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CaCO3 + SO2 + O2 = CaSO4 + CO2 2CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8O + 9O2 = CO2 + 8H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C+H2=CH4C + 2H2 = CH4
C2H3Cl + 3O2 = CO + 2H2O + HCl2C2H3Cl + 3O2 = 4CO + 2H2O + 2HCl
C6H6O2 + 13O2 = 12CO2 + H2O2C6H6O2 + 13O2 = 12CO2 + 6H2O
CH2F2 + 3O2 = CO2 + 2H2O + F22CH2F2 + 3O2 = 2CO2 + 2H2O + 2F2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO(g) + H2(g)= C8H18 +H2O8CO(g) + 17H2(g) = C8H18 + 8H2O
Cl2+NaBr=NaCl+Br2Cl2 + 2NaBr = 2NaCl + Br2
Cu+2HNO3=Cu(NO3)2+3H2Cu + 2HNO3 = Cu(NO3)2 + H2
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2
C4H12+O2=H2O+CO2C4H12 + 7O2 = 6H2O + 4CO2
C8H18+O2=CO+H2O2C8H18 + 17O2 = 16CO + 18H2O
C5H12+O2=CO+H2O2C5H12 + 11O2 = 10CO + 12H2O
C2H6+O2=CO+H2O2C2H6 + 5O2 = 4CO + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cl2 + KOH = KCl + KClO3 + H2O3Cl2 + 6KOH = 5KCl + KClO3 + 3H2O
Ca(H2PO4)2 + NaHCO3 = CaHPO4 + Na2HPO4 + H2O + CO2Ca(H2PO4)2 + 2NaHCO3 = CaHPO4 + Na2HPO4 + 2H2O + 2CO2
CaCl2(aq) + 2NaCO3(aq) =Ca(CO3)2(aq) + 2NaCl(aq)CaCl2(aq) + 2NaCO3(aq) = Ca(CO3)2(aq) + 2NaCl(aq)
Co + AgNO3 = Ag + Co(NO3)2Co + 2AgNO3 = 2Ag + Co(NO3)2
Ca3(PO4)2+H2SO4=H3PO4+CaSO4Ca3(PO4)2 + 3H2SO4 = 2H3PO4 + 3CaSO4
Ca(NO3)2 + K2CO3 = KNO3 + CaCO3Ca(NO3)2 + K2CO3 = 2KNO3 + CaCO3
CuCl2(l) + Zn(s) =Cu + ZnCl2CuCl2(l) + Zn(s) = Cu + ZnCl2
C2H6+O2=CH3COOH+H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CuO+NH3=N2+Cu+H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
CaCO3 +SO2+O2 = CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CaCO3 +SO2+O2 = CaSO4+CO3CaCO3 + SO2 + O2 = CaSO4 + CO3
C14H18N2O5+2H2O=C4H7NO4+CH3OH+C9H11NO2C14H18N2O5 + 2H2O = C4H7NO4 + CH3OH + C9H11NO2
C6H10O + H2O = C6H10OC6H10O + 0H2O = C6H10O
CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
C10H20O2+O2=CO2+H2OC10H20O2 + 14O2 = 10CO2 + 10H2O
C + SO2 = CS2 + CO5C + 2SO2 = CS2 + 4CO
CH3NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
Ca3(PO4)2(s)+SiO2(s)+C(s)=P4 (g)+CaSiO3 (s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = P4(g) + 6CaSiO3(s) + 10CO(g)
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C4H8 + 6O2 = 4CO2 + 4H2OC4H8 + 6O2 = 4CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaO(s)+NH4Cl(s)=NH3 (g)+H2O(g)+CaCl2 (s)CaO(s) + 2NH4Cl(s) = 2NH3(g) + H2O(g) + CaCl2(s)
CaCO3(s)+HCl(aq)=CaCl2 (aq)+CO2 (g)+H2O(l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
CaCl2 + CuSO4 = CaSO4 + CuCl2CaCl2 + CuSO4 = CaSO4 + CuCl2
CuSO4 + KI = CuI + KSO4CuSO4 + KI = CuI + KSO4
C8H18+O2=CO+H2O2C8H18 + 17O2 = 16CO + 18H2O
C5H12+O2=CO+H2O2C5H12 + 11O2 = 10CO + 12H2O
Cu + S = CuSCu + S = CuS
Ca + O = CaOCa + O = CaO
CuSO4 + NH3 = CuH3 + NSO4CuSO4 + NH3 = CuH3 + NSO4
CaCl2 + NH3 = CaH3 + NCl2CaCl2 + NH3 = CaH3 + NCl2
CrCl3 + H2O = Cr2O3 + HCl2CrCl3 + 3H2O = Cr2O3 + 6HCl
CuSO4 + FeCl3 = CuCl3 + FeSO4CuSO4 + FeCl3 = CuCl3 + FeSO4
C3H8 + 5O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CH4+O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+5O2=3H2O+3CO2C3H8 + 5O2 = 4H2O + 3CO2
CH4 + H2O= CH3OH+ H2CH4 + H2O = CH3OH + H2
C3H8 + 3O2= 3CO2 + 4H205C3H8 + 15O2 = 15CO2 + 2H20
CH2O2+C3H8O=C4H8O2+H2OCH2O2 + C3H8O = C4H8O2 + H2O
CH4(g) + H2O(g) = CO(g) + H2(g)CH4(g) + H2O(g) = CO(g) + 3H2(g)
CH4(g) + O2(g) = CO2(g) + H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaH2+H2O=H2+CaO2H2CaH2 + 2H2O = 2H2 + CaO2H2
Ca(OH)2+H2SO4=CaSO4+H2OCa(OH)2 + H2SO4 = CaSO4 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaCl2 + NH4Cl = CaCl + NH4Cl0CaCl2 + NH4Cl = 0CaCl + NH4Cl
Cl2 + H2S = HCl + SCl2 + H2S = 2HCl + S
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca + O2 = CaO2Ca + O2 = 2CaO
CrO7 2- + I- + H+ = Cr3+ + I2 + H2O3CrO72- + 428I- + 432H+ = Cr3+ + 214I2 + 216H2O
CrO7 2- + I- + H+ = Cr3+ + I2 + H2O3CrO72- + 428I- + 432H+ = Cr3+ + 214I2 + 216H2O
CuO + NH3 = Cu + H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
CH4(g) + Cl2(g) = CCl4(g) + HCl(g)CH4(g) + 4Cl2(g) = CCl4(g) + 4HCl(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cl2+LiF=F2+LiClCl2 + 2LiF = F2 + 2LiCl
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H5OH + 3O2 =2 CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CO+O2=CO22CO + O2 = 2CO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CaH2 + H2O = H2 + Ca(OH) 2CaH2 + 2H2O = 2H2 + Ca(OH)2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C10H6 + Cl2 = C + HCl C10H6 + 3Cl2 = 10C + 6HCl
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Ca(OH)2+H2=Ca+HOHCa(OH)2 + H2 = Ca + 2HOH
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO + H2O = CO2 + H2CO + H2O = CO2 + H2
C2H4F2 + O2 = CO + H2O + HF2C2H4F2 + 3O2 = 4CO + 2H2O + 4HF
C2H3Br3 + O2 = CO2 + H2O + Br24C2H3Br3 + 11O2 = 8CO2 + 6H2O + 6Br2
Ca + GdF3 = Gd + CaF23Ca + 2GdF3 = 2Gd + 3CaF2
C2H3OF + O2 = CO2 + H2O + HFC2H3OF + 2O2 = 2CO2 + H2O + HF
C6H6O2 + O2 = CO2 + H2O2C6H6O2 + 13O2 = 12CO2 + 6H2O
CH3NH2(g) + O2(g) = CO2 (g) + H2O (g) + N2(g)4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
C6H5Cl + O2 = CO + H2O + Cl24C6H5Cl + 17O2 = 24CO + 10H2O + 2Cl2
C3H6O + O2 = CO2 + 3H2OC3H6O + 4O2 = 3CO2 + 3H2O
Ca3(PO4)2 (s) + SiO2(s) + C(s) = P4(g) + CaSiO3(s) + CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = P4(g) + 6CaSiO3(s) + 10CO(g)
C6H6S2 + O2 = CO + 6H2O + 4SO32C6H6S2 + 15O2 = 12CO + 6H2O + 4SO3
CaCO3 + 2HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaCl2 + AgNO3 = AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
C6H5Cl + O2 = CO2 + H2O + HClC6H5Cl + 7O2 = 6CO2 + 2H2O + HCl
Ca + LuF3 = Lu + CaF23Ca + 2LuF3 = 2Lu + 3CaF2
C2H3Cl3 + O2 = CO2 + HClC2H3Cl3 + 2O2 = 2CO2 + 3HCl
C2H3Br3 + O2 = CO2 + H2O + Br24C2H3Br3 + 11O2 = 8CO2 + 6H2O + 6Br2
Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C4H10O2 + O2 = CO2 + H2O2C4H10O2 + 11O2 = 8CO2 + 10H2O
Cu +HNO3= Cu(NO3)2+NO+ H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca(OH)2+H3PO4 = CaHPO4 +H2OCa(OH)2 + H3PO4 = CaHPO4 + 2H2O
C2H3OCl + O2 = CO2 + H2O + Cl24C2H3OCl + 9O2 = 8CO2 + 6H2O + 2Cl2
C2H3O2F + O2 = CO2 + H2O + F24C2H3O2F + 7O2 = 8CO2 + 6H2O + 2F2
Cu + HCl = CuCl2 + H2Cu + 2HCl = CuCl2 + H2
CH4 + Cl2 = HCl + CCl4CH4 + 4Cl2 = 4HCl + CCl4
Ca(OH)2 + H3PO4 = CaHPO4 + H2OCa(OH)2 + H3PO4 = CaHPO4 + 2H2O
Ca(OH)2 + H3PO4 = CaHPO4 + H2OCa(OH)2 + H3PO4 = CaHPO4 + 2H2O
CuS + O2 = CuSO4CuS + 2O2 = CuSO4
CuS + O2 = CuSO4CuS + 2O2 = CuSO4
C3H6O2S + O2 = CO2 + H2O + SO3C3H6O2S + 5O2 = 3CO2 + 3H2O + SO3
C2H3O2Br + O2 = CO2 + H2O + Br24C2H3O2Br + 7O2 = 8CO2 + 6H2O + 2Br2
C2H5NSCl + O2 = CO2 + H2O + NO2 + SO3 + Cl24C2H5NSCl + 23O2 = 8CO2 + 10H2O + 4NO2 + 4SO3 + 2Cl2
C2H5Cl + O2 = CO + H2O + Cl24C2H5Cl + 9O2 = 8CO + 10H2O + 2Cl2
CaO (s) + NH4Cl(s) = NH3 (g) + H2O(g) + CaCl2(s)CaO(s) + 2NH4Cl(s) = 2NH3(g) + H2O(g) + CaCl2(s)
C2H5NSCl + O2 = CO2 + H2O + NO + SO2 + Cl24C2H5NSCl + 19O2 = 8CO2 + 10H2O + 4NO + 4SO2 + 2Cl2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca10F2(PO4)6 + H2SO4 = Ca(H2PO4)2 + CaSO4 + HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
Cu+H2SO4=2CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
C6H4Cl2 + O2 = CO2 + H2O + Cl2C6H4Cl2 + 7O2 = 6CO2 + 2H2O + Cl2
CaCO3(s) + HCl (aq) = CaCl2 (aq) + CO2 (g) + H2O(l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
Cl2(g)+LiL(aq)=LiCl(aq)+L2(g)Cl2(g) + 2LiL(aq) = 2LiCl(aq) + L2(g)
CaH2 + H2O = Ca (OH)2 +H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CO2(g)+H2O(l)=C6H12O6(s)+O2(g)6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
CaCO3(s)+HCl(aq)=CaCl2 (aq)+CO2 (g)+H2O(l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
CaCl2(aq)+Na2SO4(aq)=CaSO4+NaCl(aq)CaCl2(aq) + Na2SO4(aq) = CaSO4 + 2NaCl(aq)
CH3COOH+O2=CO2+H2OCH3COOH + 2O2 = 2CO2 + 2H2O
CaCO3 (s) + SO2(g) + O2 (g) = CaSO4 (s) + CO2 (g)2CaCO3(s) + 2SO2(g) + O2(g) = 2CaSO4(s) + 2CO2(g)
CaCO3(s) +SO2(g) + O2 (g)=CaSO4 (s) + CO2 (g)2CaCO3(s) + 2SO2(g) + O2(g) = 2CaSO4(s) + 2CO2(g)
CaCO3 (s) + HCl (aq) = CaCl2 (aq) + CO2 (g) + H2O(l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
C8H16+O2=H2O+CO2C8H16 + 12O2 = 8H2O + 8CO2
C8H16+O2=H2O+CO2C8H16 + 12O2 = 8H2O + 8CO2
Cu2S + O2 = SO2 + Cu2O2Cu2S + 3O2 = 2SO2 + 2Cu2O
CaCO3(s) + SO2(g) + O2 (g) = CaSO4(s) + CO2(g)2CaCO3(s) + 2SO2(g) + O2(g) = 2CaSO4(s) + 2CO2(g)
CaO+NH4Cl=NH3+H2O+CaCl2CaO + 2NH4Cl = 2NH3 + H2O + CaCl2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca+ H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C2H3Br3 + O2 = CO2 + H2O + Br24C2H3Br3 + 11O2 = 8CO2 + 6H2O + 6Br2
CS2+4H2=CH4=2H2SCS2 + 4H2 = CH4 + 2H2S
C6H12O6 + NO3 - + H+ = CO2 + NH4 + + H2OC6H12O6 + 3NO3- + 6H+ = 6CO2 + 3NH4+ + 3H2O
Cu + H2SO4 = Cu SO4 + SO2 + H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C5H12+O2=CO+H2O2C5H12 + 11O2 = 10CO + 12H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C8H18 +O2 =CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CoCl2(C3H8O)2 + H2O = Co(H2O)6 + Cl + C3H8OCoCl2(C3H8O)2 + 6H2O = Co(H2O)6 + 2Cl + 2C3H8O
CaC2(s) + H2O(l) = C2H2(g) + Ca(OH)2(s)CaC2(s) + 2H2O(l) = C2H2(g) + Ca(OH)2(s)
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O = CO2 + H2OC8H18 + 25O = 8CO2 + 9H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4 + O = CO2 + H2OCH4 + 4O = CO2 + 2H2O
C3H4 + O2 = CO2 + H2OC3H4 + 4O2 = 3CO2 + 2H2O
Cu + AgNO3 = Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CuCl2+Na3PO4=Cu3(PO4)2+NaCl3CuCl2 + 2Na3PO4 = Cu3(PO4)2 + 6NaCl
Ca(ClO3)2 = CaCl2 + OCa(ClO3)2 = CaCl2 + 6O
C3H4 + O2 = CO2 + H2OC3H4 + 4O2 = 3CO2 + 2H2O
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
C3H4 + O2 = CO2 + H2OC3H4 + 4O2 = 3CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3(PO4)2+C+SiO2 = CaSiO3+CO+P42Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + 10CO + P4
C3H8(g) + O2(g) = CO2(g) + H2OC3H8(g) + 5O2(g) = 3CO2(g) + 4H2O
C6H12O6+O2 = CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6(s) + O2(g) = CO2(g) + H2O(l)C6H12O6(s) + 6O2(g) = 6CO2(g) + 6H2O(l)
Ca10F2(PO4)6 +H2SO4=Ca(H2PO4)2 + CaSO4 +HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
C2H6+O2 =CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3(CH2)3 CH3+O2 = CO2+H205CH3(CH2)3CH3 + 25O2 = 25CO2 + 3H20
Ca(OH)2 + (NH4)2SO4= CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH2O + NO3 = N2 + CO2 + H2O3CH2O + 2NO3 = N2 + 3CO2 + 3H2O
CH3CH3 + O2 = CO2 + H2010CH3CH3 + 20O2 = 20CO2 + 3H20
CH3CH3 + O2 = CO2 + H2010CH3CH3 + 20O2 = 20CO2 + 3H20
CaC2+H2O = Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C2H6+O2 = H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3
Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3
Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3
Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2NH4NO3
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CuO + H2 = H2O + CuCuO + H2 = H2O + Cu
CaBr2 + I2 = 2IBr + CaCaBr2 + I2 = 2IBr + Ca
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3(s)=CaO(s) + CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H6O+O2=CO2+H2010C2H6O + 15O2 = 20CO2 + 3H20
CH4(g) = C2H2(g) + H2(g)2CH4(g) = C2H2(g) + 3H2(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H12+O=CO2+H2OC5H12 + 16O = 5CO2 + 6H2O
C2H6+O2=CO2+H2010C2H6 + 20O2 = 20CO2 + 3H20
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C6H12O6(s) + O2(g) = CO2(g) + H2O(l)C6H12O6(s) + 6O2(g) = 6CO2(g) + 6H2O(l)
CH5N + O2 = CO + H2O + NO4CH5N + 9O2 = 4CO + 10H2O + 4NO
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C6H6S2 + O2 = CO + H2O + SO32C6H6S2 + 15O2 = 12CO + 6H2O + 4SO3
Ca + CeF3 = Ce + CaF23Ca + 2CeF3 = 2Ce + 3CaF2
CH2Br2 + O2 = CO2 + H2O + Br22CH2Br2 + 3O2 = 2CO2 + 2H2O + 2Br2
CBr4 + O2 = CO2 + Br2CBr4 + O2 = CO2 + 2Br2
CuI + K2CO3 = 2KI + Cu2O + CO22CuI + K2CO3 = 2KI + Cu2O + CO2
CO + 2H2O + HF = C2H3O2F + O24CO + 2H2O + 2HF = 2C2H3O2F + O2
C + H2O = CO + H2C + H2O = CO + H2
CH4S + 7O2 = CO2 + 4H2O + SO32CH4S + 7O2 = 2CO2 + 4H2O + 2SO3
C6H12O6=C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
Cu(SO4)+ Na3(PO4) = Na2(SO4) + Cu3(PO4)2 3Cu(SO4) + 2Na3(PO4) = 3Na2(SO4) + Cu3(PO4)2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H4 + O2 =2 CO + H2OC2H4 + 2O2 = 2CO + 2H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C+H2+O2 = C6H12O66C + 6H2 + 3O2 = C6H12O6
Cr(C2H3O2)6 + Mn2(SO4)5 = Cr(SO4)3 + Mn(C2H3O2)55Cr(C2H3O2)6 + 3Mn2(SO4)5 = 5Cr(SO4)3 + 6Mn(C2H3O2)5
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Ca10F2(PO4)6+H2SO4=HF+Ca(H2PO4)2+CaSO4Ca10F2(PO4)6 + 7H2SO4 = 2HF + 3Ca(H2PO4)2 + 7CaSO4
CaOH + HCl =CaCl + H2OCaOH + HCl = CaCl + H2O
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C12H22O11(s) +H2O(l)=C2H5OH(aq) + CO2(g)C12H22O11(s) + H2O(l) = 4C2H5OH(aq) + 4CO2(g)
C12H22O11(s) +H2O(l)=C2H5OH(aq) + CO2(g)C12H22O11(s) + H2O(l) = 4C2H5OH(aq) + 4CO2(g)
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H5N3O9 = N2 + CO2 + O2 + H2O4C3H5N3O9 = 6N2 + 12CO2 + O2 + 10H2O
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.