Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CH3CH2OH + O2 = H2O + CO2CH3CH2OH + 3O2 = 3H2O + 2CO2
CaCO3 + H3PO4 = CaPO4 + H2 + H2CO32CaCO3 + 2H3PO4 = 2CaPO4 + H2 + 2H2CO3
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C6H10 + O2 = CO2 + H2O2C6H10 + 17O2 = 12CO2 + 10H2O
ClO + S8 = Cl2 + SO2 16ClO + S8 = 8Cl2 + 8SO2
ClO + S8 = Cl2 + SO2 16ClO + S8 = 8Cl2 + 8SO2
C2H4+H2=C6H63C2H4 - 3H2 = C6H6
C12H26 + O2 = CO2 + H2O2C12H26 + 37O2 = 24CO2 + 26H2O
C15H30 + O2 = CO2 + H2O2C15H30 + 45O2 = 30CO2 + 30H2O
Ca+ N2 = Ca3N23Ca + N2 = Ca3N2
C7H6O3 + O2 = CO2 + H2OC7H6O3 + 7O2 = 7CO2 + 3H2O
Ca(OH)2 + NH4Cl = NH4OH + CaCl2Ca(OH)2 + 2NH4Cl = 2NH4OH + CaCl2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CuSO4 * 5 H2O =CuSO4 + H2OCuSO4*5H2O = CuSO4 + 5H2O
Ca(HCO3)2 + Ca(OH)2 = CaCO3 + H2OCa(HCO3)2 + Ca(OH)2 = 2CaCO3 + 2H2O
CH4+S8=CS2+H2S2CH4 + S8 = 2CS2 + 4H2S
Cr2O3+H2SO4 =Cr2(SO4)3 +H2OCr2O3 + 3H2SO4 = Cr2(SO4)3 + 3H2O
CH4+S8=CS2+H2S2CH4 + S8 = 2CS2 + 4H2S
C6H8O7 (aq) + NaHCO3 (aq) = CO2(g) + H2O(l) + CH3COONa(s)4C6H8O7(aq) + 9NaHCO3(aq) = 15CO2(g) + 7H2O(l) + 9CH3COONa(s)
C6H8O7 (aq) + NaHCO3 = CO2(g) + H2O(l) + CH3COONa(s)4C6H8O7(aq) + 9NaHCO3 = 15CO2(g) + 7H2O(l) + 9CH3COONa(s)
CH4+S8=CS2+H2S2CH4 + S8 = 2CS2 + 4H2S
CuSO4+K3PO4=CuPO4+K3SO4CuSO4 + K3PO4 = CuPO4 + K3SO4
C4H10+O2= CO2+H202C4H10 + 8O2 = 8CO2 + H20
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C4H10 (g) + O2 (g) = CO2 (g) +H2O(g) (g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)(g)
CaCO3 + H2SO4 = CaSO4 + H2O + CO2CaCO3 + H2SO4 = CaSO4 + H2O + CO2
Ca+NaOH=CaOH+NaCa + NaOH = CaOH + Na
Cu1+Fe(OH)3=Cu(OH)3+Fe33Cu1 + 3Fe(OH)3 = 3Cu(OH)3 + Fe3
C2H4O2 (l) + C5H12O(l) = C7H14O2 (l) + H2O (l)C2H4O2(l) + C5H12O(l) = C7H14O2(l) + H2O(l)
C2H4O2 (l) + C5H12O(l) = C7H14O2 (l) + H20 (l)3C2H4O2(l) + 10C5H12O(l) = 8C7H14O2(l) + H20(l)
CaCO3 + 2 HCl = CaCl2 + 2 CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C6H12O6 = 6C + 6H2OC6H12O6 = 6C + 6H2O
Cu2SO4 + Zn = ZnSO4 + 2CuCu2SO4 + Zn = ZnSO4 + 2Cu
CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
C + H2 = C2H62C + 3H2 = C2H6
CH3(CH2)CH3 + O3 = CO2 + H2O3CH3(CH2)CH3 + 10O3 = 9CO2 + 12H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
CO+O2=CO22CO + O2 = 2CO2
C3H7OH(l)+O2(g)=CO2(g)+H2O(l)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(l)
C3H8O3+O2=CO2+H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2 H6 +O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4 H8 O +O2=CO2+H2O2C4H8O + 11O2 = 8CO2 + 8H2O
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
C H4 O +O2=CO2+H2O2CH4O + 3O2 = 2CO2 + 4H2O
C2 H6 O +O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C3 H8 +O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH2O+ O2= CO2 + H2OCH2O + O2 = CO2 + H2O
C2H2O2 + O2= CO2 + H2O2C2H2O2 + 3O2 = 4CO2 + 2H2O
C3H8O + O2= CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C2H4O2 + O2= CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C3H6O + O2= CO2 + H2OC3H6O + 4O2 = 3CO2 + 3H2O
C6H12O6 =C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
C6H12O6 =C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
CH4 + 2 O2 = CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 2 O2 = CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
C8H8+O2=H2O+CO2C8H8 + 10O2 = 4H2O + 8CO2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
CO2+ H2O= C7H6O3+ O27CO2 + 3H2O = C7H6O3 + 7O2
C14H18N2O5 + H2O = C4H7NO4 + C9H11NO2 + HOCH3C14H18N2O5 + 2H2O = C4H7NO4 + C9H11NO2 + HOCH3
C5H11NO2+O2=CO2+H20+CH4N20100C5H11NO2 + 395O2 = 495CO2 + 54H20 + 5CH4N20
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cl+H2+C=CHCl36Cl + H2 + 2C = 2CHCl3
CaCl2 + AgNO3=AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6(g)+ O2(g)= CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C2H4O+ O2 = CO2 + H2O2C2H4O + 5O2 = 4CO2 + 4H2O
C3H8 + 6H2O = 8H2 + CO2C3H8 + 6H2O = 10H2 + 3CO2
Cr2O4+SO2=Cr+SO4Cr2O4 + 2SO2 = 2Cr + 2SO4
C2H2O4+NaOH=Na2C2O4+H2OC2H2O4 + 2NaOH = Na2C2O4 + 2H2O
C6H8O7+NaOH=Na3C6H5O7+H2OC6H8O7 + 3NaOH = Na3C6H5O7 + 3H2O
C5H12 + O2 = CO2 +H2OC5H12 + 8O2 = 5CO2 + 6H2O
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8O3 + 6O2 = 6CO2 + 6H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
Cd + HNO3 = Cd(NO3)2 + HCd + 2HNO3 = Cd(NO3)2 + 2H
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH2=CH2CH2 = CH2
CH2=CH2CH2 = CH2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C7H16 +O2 =CO2 +H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH4 + 2 O2=CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H4 (g) + O2 (g)=2H2O (g) + 3CO2 (g)C3H4(g) + 4O2(g) = 2H2O(g) + 3CO2(g)
Ca(OH)2 + H3PO4=H2O + Ca3(PO4)2 3Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C3H4 (g) + O2 (g)=2H2O (g) + 3CO2 (g)C3H4(g) + 4O2(g) = 2H2O(g) + 3CO2(g)
C2H4O+O2=H2O+CO22C2H4O + 5O2 = 4H2O + 4CO2
CuCl2(aq) + 2 NaOH(aq) = Cu(OH)2(s) + 2 NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CO2+C=COCO2 + C = 2CO
Cl2+HBr=Br2+HClCl2 + 2HBr = Br2 + 2HCl
Cr2O7 2- + AsO3 3- + 8H+ = Cr3+ + AsO4 3- + H2O60Cr2O72- + 427AsO33- + 100H+ = 40Cr3+ + 427AsO43- + 50H2O
Cr2O72- + AsO33- + 8H+ = Cr3+ + AsO43- + H2O60Cr2O72- + 427AsO33- + 100H+ = 40Cr3+ + 427AsO43- + 50H2O
Cl2 + KOH = KCl + KClO3 + H2O3Cl2 + 6KOH = 5KCl + KClO3 + 3H2O
C6H5OH + O2 = CO2 + H2OC6H5OH + 7O2 = 6CO2 + 3H2O
C6H12(l)+O2(g)=HC6H9O3(l)+H2O(l)C6H12(l) + 2O2(g) = HC6H9O3(l) + H2O(l)
CuO+C=Cu+CO2 2CuO + C = 2Cu + CO2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C7H6O + O2 = CO2 + H2OC7H6O + 8O2 = 7CO2 + 3H2O
C7H6O3 + CH4O = C8H8O3 + H20-50C7H6O3 + 30CH4O = -40C8H8O3 + 7H20
C7H6O3 + CH4O = C8H8O3 + H20-50C7H6O3 + 30CH4O = -40C8H8O3 + 7H20
C7H6O3 + CH4O = C8H8O3 + 2H20-50C7H6O3 + 30CH4O = -40C8H8O3 + 7H20
C7H6O3 + CH4O = C8H8O3 + H20-50C7H6O3 + 30CH4O = -40C8H8O3 + 7H20
C7H6O3 + CH4 = C8H8O3 + H2010C7H6O3 + 10CH4 = 10C8H8O3 + H20
Cu + ZnSO4 = Zn + CuSO4Cu + ZnSO4 = Zn + CuSO4
Ca(No3)2(aq) + 2 KCl(aq) = CaCl2 + 2 KNo3Ca(No3)2(aq) + 2KCl(aq) = CaCl2 + 2KNo3
Ca(No3)2 + 2 KCl = CaCl2 + 2 KNo3Ca(No3)2 + 2KCl = CaCl2 + 2KNo3
C2H4 + O2 = CO + 2H2OC2H4 + 2O2 = 2CO + 2H2O
CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
C2H3O2Cl + O2 = 4CO2 + 2H2O + HCl2C2H3O2Cl + 3O2 = 4CO2 + 2H2O + 2HCl
C2H5OH + 6O2 = 4CO2 + 6H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCO3= CaO+CO2CaCO3 = CaO + CO2
CaCO3= CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H5(NO3)3=N2+O2+H2O+CO24C3H5(NO3)3 = 6N2 + O2 + 10H2O + 12CO2
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C12H22 + O2 = CO2 + H2O2C12H22 + 35O2 = 24CO2 + 22H2O
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2
C3H8+O2=CO+H2O2C3H8 + 7O2 = 6CO + 8H2O
CH3CHO + O2 = CH3COOH2CH3CHO + O2 = 2CH3COOH
Cu+ HSO3 = Cu(SO3)2 + SO2 +H2OCu + 4HSO3 = Cu(SO3)2 + 2SO2 + 2H2O
Cl2 +KI = I2+2KClCl2 + 2KI = I2 + 2KCl
Cu+ HSO3 = Cu(SO3)+ SO2 + H2OCu + 2HSO3 = Cu(SO3) + SO2 + H2O
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C10H15N + O2 = CO2 +H2O + N24C10H15N + 55O2 = 40CO2 + 30H2O + 2N2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca(OH)2(aq)+HNO3(aq)=Ca(NO3)2(aq)+H2O(l)Ca(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O(l)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C+H2=C3H83C + 4H2 = C3H8
C4H8(g)+O2(g)=CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca + O2 = CaO2Ca + O2 = 2CaO
CH3CH2CH3 + 5 O2 = 3 CO2 + 4 H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C + S8 = CS24C + S8 = 4CS2
Ca(ClO4)2+2NaOH=Ca(OH)2+NaClO3+OCa(ClO4)2 + 2NaOH = Ca(OH)2 + 2NaClO3 + 2O
Ca(ClO4)2+2NaOH=Ca(OH)2+NaClO3+O2Ca(ClO4)2 + 2NaOH = Ca(OH)2 + 2NaClO3 + O2
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3H8 + O2 = CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
C4H8 + O2 = CO2 + H20 5C4H8 + 20O2 = 20CO2 + 2H20
C3H6O + O2 = CO2 + H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H6O + O2 = 3CO2 + H2OC3H6O + 4O2 = 3CO2 + 3H2O
CO2 + NaOH = NaHCO3CO2 + NaOH = NaHCO3
CH5N + O2 = 4CO + 10H2O + NO24CH5N + 11O2 = 4CO + 10H2O + 4NO2
C6H5F + O2 = 6CO + H2O + HFC6H5F + 4O2 = 6CO + 2H2O + HF
C2H3OCl + O2 = 2CO + H2O + HClC2H3OCl + O2 = 2CO + H2O + HCl
C2H3OCl + O2 = 2CO + H2O + HClC2H3OCl + O2 = 2CO + H2O + HCl
C6H6S + O2 = CO + 3H2O + SO3C6H6S + 6O2 = 6CO + 3H2O + SO3
C2H5N + O2 = 8CO + H2O + 4NO4C2H5N + 11O2 = 8CO + 10H2O + 4NO
CH4 + H2O = CO + H2CH4 + H2O = CO + 3H2
Ca10F2(PO4)6 + H2SO4 = 3Ca(H2PO4)2 + CaSO4 + 2HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
Ca10F2(PO4)6 + H2SO4 = 3Ca(H2PO4)2 + CaSO4 + 2HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
Ca(OH)2 + H3PO4 = CaHPO4 + H2OCa(OH)2 + H3PO4 = CaHPO4 + 2H2O
C4H10S2 + 19O2 = CO2 + H2O + 4SO32C4H10S2 + 19O2 = 8CO2 + 10H2O + 4SO3
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
CH4 + Cl2 = 4HCl + CCl4CH4 + 4Cl2 = 4HCl + CCl4
CCl4 + O2 = CO2 + 2Cl2CCl4 + O2 = CO2 + 2Cl2
C7H14 = C7H8 + H2C7H14 = C7H8 + 3H2
C2H4Cl2 + O2 = 2CO + 2H2O + Cl2C2H4Cl2 + 2O2 = 2CO + 2H2O + Cl2
C2H3F + 11O2 = CO2 + H2O + 2F24C2H3F + 11O2 = 8CO2 + 6H2O + 2F2
Ca+HNO3=Ca(NO3)2+H2Ca + 2HNO3 = Ca(NO3)2 + H2
Ce(NO3)3 + K2SO4 = Ce2(SO4)3 + KNO32Ce(NO3)3 + 3K2SO4 = Ce2(SO4)3 + 6KNO3
CaCl2(aq)+NaHCO3(s)=CaCO3(s)+NaCl(aq)+CO2(g)+H2O(l)CaCl2(aq) + 2NaHCO3(s) = CaCO3(s) + 2NaCl(aq) + CO2(g) + H2O(l)
CaCl2(aq)+NaHCO3(s)=CaCO3(s)+NaCl(aq)+CO2(g)+H2O(l)CaCl2(aq) + 2NaHCO3(s) = CaCO3(s) + 2NaCl(aq) + CO2(g) + H2O(l)
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
CH4+H2O=CO2+H2CH4 + 2H2O = CO2 + 4H2
Cu2S+ Cu2O= Cu+SO2Cu2S + 2Cu2O = 6Cu + SO2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cl- + (H3O)+ + (Cr2O7)-- = H2O + Cl2 + Cr+++6Cl- + 14(H3O)+ + (Cr2O7)-- = 21H2O + 3Cl2 + 2Cr+++
C12H26+ O2= CO2+H2O2C12H26 + 37O2 = 24CO2 + 26H2O
CoS2 + O2 = Co2O3 + SO24CoS2 + 11O2 = 2Co2O3 + 8SO2
C+O2=CO2C + O2 = CO2
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C2O4--+Cr2O7--+H=CO2+Cr+++ +H2O-4C2O4-- + Cr2O7-- + 14H = -8CO2 + 2Cr+++ + 7H2O
C2H6 + O2 = 4CO2 + 6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+S8=CS2+H2S2CH4 + S8 = 2CS2 + 4H2S
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CH2Br2 + 3O2 = CO2 + 2H2O + Br22CH2Br2 + 3O2 = 2CO2 + 2H2O + 2Br2
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
CH2Br2 + 3O2 = CO2 + 2H2O + Br22CH2Br2 + 3O2 = 2CO2 + 2H2O + 2Br2
CH3HSO4 = H2SO4 + (CH3)2SO42CH3HSO4 = H2SO4 + (CH3)2SO4
CH3OH + H2SO4 = (CH3)2SO4 + H2O2CH3OH + H2SO4 = (CH3)2SO4 + 2H2O
CH3OH + H2SO4 = (CH3)2SO4 + H2O2CH3OH + H2SO4 = (CH3)2SO4 + 2H2O
C10H8 + O2 = CO2 + H2OC10H8 + 12O2 = 10CO2 + 4H2O
CH3OH + H2SO4 = (CH3)2SO4 + H2O2CH3OH + H2SO4 = (CH3)2SO4 + 2H2O
CS2 + O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
Ca(OH)2+Cr(NO3)3=Ca(NO3)2+Cr(OH)33Ca(OH)2 + 2Cr(NO3)3 = 3Ca(NO3)2 + 2Cr(OH)3
Ca(OH)+Cr(NO3)=Ca(NO3)+Cr(OH)Ca(OH) + Cr(NO3) = Ca(NO3) + Cr(OH)
CH4 + Br2 = CBr4 + HBrCH4 + 4Br2 = CBr4 + 4HBr
Cl2 + NaI = NaCl + I2Cl2 + 2NaI = 2NaCl + I2
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CS2 + 4O2 = 2CO2 + 2SO2 CS2 + 3O2 = CO2 + 2SO2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H12O6 = CH3CH2OH + CO2C6H12O6 = 2CH3CH2OH + 2CO2
C4H8+6O2=4CO2+4H2C4H8 + 4O2 = 4CO2 + 4H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaC2+H2O+CO2=Ca(OH)2+CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
CaC2+H2O+CO2=Ca(OH)2+CH2CHCO211CaC2 + 26H2O + 8CO2 = 11Ca(OH)2 + 10CH2CHCO2
CaO+CO2=CaCO3CaO + CO2 = CaCO3
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca+N2=Ca3N23Ca + N2 = Ca3N2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca3(PO4)2+SiO2=P4O10+CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
Ca3(PO4)2 + SiO2 + C= CaSiO3 + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
C2H5OH+O2=CO2+ 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C+H2O=CO+H2C + H2O = CO + H2
C5H8N4O12 = CO2 + H2O + N + CC5H8N4O12 = 4CO2 + 4H2O + 4N + C
C2H6 + O2 = CO2 + H2010C2H6 + 20O2 = 20CO2 + 3H20
C2H6 + O2 = CO2 + H2010C2H6 + 20O2 = 20CO2 + 3H20
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CO2+NH3=OC(NH2)2+H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C5H10 + O2=CO2 +H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C5H12 + 8O2 =5CO2 + 6H2OC5H12 + 8O2 = 5CO2 + 6H2O
CuS + HNO3 = Cu(NO3)2 + S + H2O + NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C + HNO3 = N2 + CO2 + H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
CuSO4+KI=CuI+K2SO4+I22CuSO4 + 4KI = 2CuI + 2K2SO4 + I2
C + HNO3 = N2 + CO2 + H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
CuSO4 + Fe= FeCuSO4CuSO4 + Fe = FeCuSO4
C2H6(l) + O2(g) = CO2(g) + H2O(l)2C2H6(l) + 7O2(g) = 4CO2(g) + 6H2O(l)
CuSO4 + Fe= CuSO4FeCuSO4 + Fe = CuSO4Fe
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Co(NO3)3(aq)+(NH4)2S(aq) =Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C8H18 + O2 = H2O + CO22C8H18 + 25O2 = 18H2O + 16CO2
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C6H6+O2 =CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C7H16+O2 = CO2+ H2OC7H16 + 11O2 = 7CO2 + 8H2O
CaO +H2O=2Ca(OH)2CaO + H2O = Ca(OH)2
C12H22O11+O2=CO2 +H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Cl2+NaI=I2+NaClCl2 + 2NaI = I2 + 2NaCl
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CaO+SO2 +O2 = CaSO42CaO + 2SO2 + O2 = 2CaSO4
C12H22O11(s) +H2O(l) = C2H5OH(aq) +CO2(g)C12H22O11(s) + H2O(l) = 4C2H5OH(aq) + 4CO2(g)
C6H12O6 + 3O2 = 3CO2 + 3H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
Ca(OH)2 +H3PO4=Ca3(PO4)2 +H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H6 + O2=CO2 +H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H5O9N3=CO2+N2+O2+H2O4C3H5O9N3 = 12CO2 + 6N2 + O2 + 10H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca(OH)2+CH3CO2H=CaCO2H+CH3(OH)2Ca(OH)2 + CH3CO2H = CaCO2H + CH3(OH)2
CH4 + Cl2 =CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
C4H10(l)+O2(g)=CO2(g)+H2O(l)2C4H10(l) + 13O2(g) = 8CO2(g) + 10H2O(l)
CrCl3 + Li2O = Cr2O3 + LiCl2CrCl3 + 3Li2O = Cr2O3 + 6LiCl
Ca(OH)2(s) + HCl(g)=CaCl2(s) +H2O(l)Ca(OH)2(s) + 2HCl(g) = CaCl2(s) + 2H2O(l)
C4H10(g) +O2 =CO2(g) + H2O(g)2C4H10(g) + 13O2 = 8CO2(g) + 10H2O(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2 + LiI = LiCl + I2Cl2 + 2LiI = 2LiCl + I2
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cl2 + NaOH = NaCl+ NaClO3+ H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
CH3COONa + H2O + CO2 = CH3COOH + NaHCO3CH3COONa + H2O + CO2 = CH3COOH + NaHCO3
CuCO3 + HCl = CuCl2 + CO2 + H2OCuCO3 + 2HCl = CuCl2 + CO2 + H2O
C4H10O3+O2=CO2+H2OC4H10O3 + 5O2 = 4CO2 + 5H2O
C4H10(l) + O2(g) = CO2(g) + H2O(l) 2C4H10(l) + 13O2(g) = 8CO2(g) + 10H2O(l)
C2H6(g) + O2(g) = CO2(g) + H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CO2(g) + H2O(l) = C6H12O6(s) + O2(g) 6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
C2H6 + O2=CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Co(OH)3 + H2O2 + H+ = Co++ + H2O2Co(OH)3 - H2O2 + 4H+ = 2Co++ + 4H2O
Co(OH)3 + H2O2 + H2 = Co++ + H2O0Co(OH)3 + H2O2 + H2 = 0Co++ + 2H2O
Co(OH)3 + H2O2+ H2 = Co++ + H2O0Co(OH)3 + H2O2 + H2 = 0Co++ + 2H2O
Co(OH)3 + H2O2+ H2 = Co++ +H2O0Co(OH)3 + H2O2 + H2 = 0Co++ + 2H2O
C4H8 + O2 = H2O + CO2C4H8 + 6O2 = 4H2O + 4CO2
Ca3P2 + H2O = 3 Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C3H5N3O9 = N2 + CO2 + O2 + H2O4C3H5N3O9 = 6N2 + 12CO2 + O2 + 10H2O
Ca + 2SmF3 = Sm + 3CaF23Ca + 2SmF3 = 2Sm + 3CaF2
CH3COOH + O2 = H2O + CO2CH3COOH + 2O2 = 2H2O + 2CO2
CaH2 + H2O = Ca(OH)2 + 2H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C2H3F3 + O2 = CO2 + 6H2O + 6F24C2H3F3 + 11O2 = 8CO2 + 6H2O + 6F2
C2H3F3 + O2 = CO2 + 6H2O + 6F24C2H3F3 + 11O2 = 8CO2 + 6H2O + 6F2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH4 + Br2 = CBr4 + HBrCH4 + 4Br2 = CBr4 + 4HBr
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H2 + Cl2 = C + HClC2H2 + Cl2 = 2C + 2HCl
C+S8=CS24C + S8 = 4CS2
Cu(NO3)2(aq)+(NH4)2S(aq)=CuS(s)+2NH4NO3(aq)Cu(NO3)2(aq) + (NH4)2S(aq) = CuS(s) + 2NH4NO3(aq)
Cu(NO3)2(aq)+(NH4)2S(aq)=CuS(s)+2NH4NO3(aq)Cu(NO3)2(aq) + (NH4)2S(aq) = CuS(s) + 2NH4NO3(aq)
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C4H9OH(g)+O2(g)=4CO2(g)+5H2O(l)C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
C4H9OH(g)+O2(g)=4CO2(g)+5H2O(l)C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
C4H9OH(g)+O2(g)=CO2(g)+5H2O(l) C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H4(g) + O2(g) = CO2(g) + H2O(g) C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaCl2+Fe2(SO4)3=CaSO4+FeCl33CaCl2 + Fe2(SO4)3 = 3CaSO4 + 2FeCl3
C2H4+4O2=3CO2+2H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca3(PO4)2+H2SO4=H3PO4+CaSO4Ca3(PO4)2 + 3H2SO4 = 2H3PO4 + 3CaSO4
CuO+H3PO4=Cu3(PO4)2+H2O3CuO + 2H3PO4 = Cu3(PO4)2 + 3H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C + H2O = CO + H2C + H2O = CO + H2
Ca(OH)2 + Na2CO3= 2 NaOH + CaCO3Ca(OH)2 + Na2CO3 = 2NaOH + CaCO3
CH4(g) + O2(g) =CO2(g) +H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C4H10+O2=CO+H2O2C4H10 + 9O2 = 8CO + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H4 + O2= CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2= CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cr2O3 + Br2 = CrBr3 + O22Cr2O3 + 6Br2 = 4CrBr3 + 3O2
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cu+ HNO = Cu(NO3)2+NO+H2O-1Cu + 8HNO = -1Cu(NO3)2 + 10NO + 4H2O
CH3OH + O2 = H2O + CO22CH3OH + 3O2 = 4H2O + 2CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+3O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H6 + O2 = H2O + CO22C6H6 + 15O2 = 6H2O + 12CO2
C2H12O6+KClO3=CO2 + H2O +KCl3C2H12O6 + 4KClO3 = 6CO2 + 18H2O + 4KCl
Co2(SO4)3+2Na3PO4=2CoPO4+3Na2SO4Co2(SO4)3 + 2Na3PO4 = 2CoPO4 + 3Na2SO4
C4H10 + SO2 = CO2 + H2O + S8 16C4H10 + 104SO2 = 64CO2 + 80H2O + 13S8
C3H8+ O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C+O2=CO2C + O2 = CO2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca10F2(PO4)6 + H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
CH2Br2 + 3O2 = 2CO2 + H2O + Br22CH2Br2 + 3O2 = 2CO2 + 2H2O + 2Br2
C10H22 + 31O2 = 20CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H6OS + 8O2 = 6CO2 + H2O + SO2C6H6OS + 8O2 = 6CO2 + 3H2O + SO2
C2H4O2+Ba(OH)2(H2O)=Ba(C2H3O2)2+H2O2C2H4O2 + Ba(OH)2(H2O) = Ba(C2H3O2)2 + 3H2O
C2H3OF + 5O2 = CO + H2O + 2F24C2H3OF + 5O2 = 8CO + 6H2O + 2F2
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca + 2H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C8H8O3 + BH4- + 4 H2O = C8H10O3 + H3BO3 + OH-4C8H8O3 + BH4- + 4H2O = 4C8H10O3 + H3BO3 + OH-
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CuCl2(aq)+NaOH(aq)=Cu(OH)2(s)+NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Cu + ZnSO4 = Zn + CuSO4Cu + ZnSO4 = Zn + CuSO4
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
CuCl2(aq)+NaOH(aq)=Cu(OH)2(s)+NaCl(aq)CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
CO2(g)+H2O(l)=C6H12O6(s)+O2(g)6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
Cd(NO3)2 + TeO2 + H2O = CdTe + (NO3)2 +H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + H2O = CdTe + (NO3)2 +H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +4H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 + 4H2O = CdTe + (NO3)2 +H20-5Cd(NO3)2 - 5TeO2 + 10H2O = -5CdTe - 5(NO3)2 + H20
Cd(NO3)2 + TeO2 = CdTe + (NO3)2 +O2Cd(NO3)2 + TeO2 = CdTe + (NO3)2 + O2
Cd(NO3)2 + TeO2 = CdTe + (NO3)2 +O2Cd(NO3)2 + TeO2 = CdTe + (NO3)2 + O2
CuCl2 (aq) +Mg (s) =MgCl2 (aq) + Cu (s) CuCl2(aq) + Mg(s) = MgCl2(aq) + Cu(s)
C4H8 (g) + O2 (g) = CO2 (g) + H2O (g) C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
C3H6 (g) + O2 (g) =H2O (g) + CO2 (g) 2C3H6(g) + 9O2(g) = 6H2O(g) + 6CO2(g)
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Co3O4 + 2C = Co + 2CO2 Co3O4 + 2C = 3Co + 2CO2
Co(OH)3+H2O2+H+=Co2++H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
C7H13ON+O2=CO2+H2O+N24C7H13ON + 39O2 = 28CO2 + 26H2O + 2N2
CH3CH2OH+O2=CH3COOH+H2OCH3CH2OH + O2 = CH3COOH + H2O
CH3CH2OH+O2=CH3COOH+H2010CH3CH2OH + 5O2 = 10CH3COOH + H20
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3CH3+O2=CO2+H2010CH3CH3 + 20O2 = 20CO2 + 3H20
CH3CH3+O2=CO2+H2010CH3CH3 + 20O2 = 20CO2 + 3H20
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C6H12O6(s) = C2H5OH(l) + CO2(g)C6H12O6(s) = 2C2H5OH(l) + 2CO2(g)
C 6H 12O 6 + 6 O 2 = 6 CO 2 + 6 H2 OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6 + O2 = H2O + C2O2C6H12O6 + 3O2 = 12H2O + 6C2O
C6H12O6 + O2 = H20 + C2O10C6H12O6 - 15O2 = 6H20 + 30C2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H8O3 + BH4- + 4 H2O = C8H10O3 + H3BO3 + OH-4C8H8O3 + BH4- + 4H2O = 4C8H10O3 + H3BO3 + OH-
CH4 + NH3 + O2 = HCN + H2O2CH4 + 2NH3 + 3O2 = 2HCN + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaMg(CO3)2 + CH3CO2H = CO2 + CaCO3 + Mg + H2O4CaMg(CO3)2 + CH3CO2H = 6CO2 + 4CaCO3 + 4Mg + 2H2O
CO2 = CO + O22CO2 = 2CO + O2
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cu+HNO3=Cu(NO3)2+H2O+HO-1Cu - 2HNO3 = -1Cu(NO3)2 - 2H2O + 2HO
Cu + HNO3=Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+Fe=CuFeCu + Fe = CuFe
Cu+Ca=CuCaCu + Ca = CuCa
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C2H5NH2+H2O=C2H5NH3+OHC2H5NH2 + H2O = C2H5NH3 + OH
Co(OH)3 + H2O2 + H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
Co(H2O)6 + SCN = Co(SCN)4 + H2OCo(H2O)6 + 4SCN = Co(SCN)4 + 6H2O
Ca3(PO4)(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)4Ca3(PO4)(s) + 12SiO2(s) + 4C(s) = 12CaSiO3(s) + P4(s) + 4CO(g)
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca(OH)2(aq) + HCl(aq) = CaCl2(aq) + H2O(l)Ca(OH)2(aq) + 2HCl(aq) = CaCl2(aq) + 2H2O(l)
CH3OOH + O3 = CO2 + H2O3CH3OOH + 2O3 = 3CO2 + 6H2O
C3H6O2 + O2=CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3+O2=CO2+H2O4CH3 + 7O2 = 4CO2 + 6H2O
C3H5(NO3)3 = N2 + O2 + H2O + CO24C3H5(NO3)3 = 6N2 + O2 + 10H2O + 12CO2
CCl4+HF=CCl2F2+HClCCl4 + 2HF = CCl2F2 + 2HCl
CaCO3= CaO+CO2CaCO3 = CaO + CO2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CCl4+HF=CCl2F2+HClCCl4 + 2HF = CCl2F2 + 2HCl
CS2+Cl2=CCl4+SCl2CS2 + 4Cl2 = CCl4 + 2SCl2
Ca2Br2+NaCo3=CaCo3+NaBrCa2Br2 + 2NaCo3 = 2CaCo3 + 2NaBr
Ca2Br2+NaCo3=CaCo3+NaBrCa2Br2 + 2NaCo3 = 2CaCo3 + 2NaBr
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H8N2+N2O4=N2+CO2+H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
Co(NO3)3+(NH4)2 S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
CO3(PO4)2 + Na= Na(PO4)2 + CO3CO3(PO4)2 + Na = Na(PO4)2 + CO3
CO3(PO4)2+Na= Na(PO4)2+CO3CO3(PO4)2 + Na = Na(PO4)2 + CO3
CO2+ CaSiO3+ H2O= SiO2+ Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
CHCl3 + K2Cr2O7 + H2SO4 = Cr2(SO4)3 + K2SO4+ Cl2+ H2O +CO26CHCl3 + 5K2Cr2O7 + 20H2SO4 = 5Cr2(SO4)3 + 5K2SO4 + 9Cl2 + 23H2O + 6CO2
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CaSO3+O2=CaSO42CaSO3 + O2 = 2CaSO4
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C+SO2=CS2+CO5C + 2SO2 = CS2 + 4CO
Co(OH)3+H2O2+H+=Co2++H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
Co(OH)3+H2O2+H+=Co2++H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CuSO4 + NaOH = Cu(OH)2 + Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
CaC2+H2O+CO2=CH2CHCO2H+Ca(OH)26CaC2 + 16H2O + 3CO2 = 5CH2CHCO2H + 6Ca(OH)2
C2H6+O2 = CO2+ H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 +O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H2C4H10 + 4O2 = 4CO2 + 5H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca+H2O=Ca (OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu2O + Cu2S = Cu + SO22Cu2O + Cu2S = 6Cu + SO2
Cu2O + Cu2S = Cu + SO22Cu2O + Cu2S = 6Cu + SO2
C7H16+11O2= 7CO2 + 8H2OC7H16 + 11O2 = 7CO2 + 8H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2C2H6 + 2O2 = 2CO2 + 3H2
C2H6+O2=CO2+H2C2H6 + 2O2 = 2CO2 + 3H2
CaO+ClNH4=Cl2Ca+H2O+NH3CaO + 2ClNH4 = Cl2Ca + H2O + 2NH3
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO(NH2)2 + 3 H2SO4 = CO2 + 2 SO + H2O + (NH4)2SO4CO(NH2)2 + H2SO4 = CO2 + 0SO - H2O + (NH4)2SO4
CO(NH2)2 + 3 H2SO4 = CO2 (g) + 2 SO (g) + H2O (g) + (NH4)2SO4 (aq)CO(NH2)2 + H2SO4 = CO2(g) + 0SO(g) - H2O(g) + (NH4)2SO4(aq)
CuO2+CaH2=Cu+CaO+H2CuO2 + 2CaH2 = Cu + 2CaO + 2H2
CuO2+CaH2=Cu+CaO+H2CuO2 + 2CaH2 = Cu + 2CaO + 2H2
CuO2+CaH2=Cu+CaO+H2CuO2 + 2CaH2 = Cu + 2CaO + 2H2
C8H18+O2 = CO2 +H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu(OH)2 + HCl = CuCl2 + H2OCu(OH)2 + 2HCl = CuCl2 + 2H2O
CH3CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
CH3(CH2)7CH3+O2=CO2+H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
Ca+H2O = CaO+H2Ca + H2O = CaO + H2
CaCO3 (s) = CaO(s) + CO2 (s)CaCO3(s) = CaO(s) + CO2(s)
Cd(s) + 2 HClO4(aq) = Cd(ClO4)2(aq) + H2(g) Cd(s) + 2HClO4(aq) = Cd(ClO4)2(aq) + H2(g)
C6H14 + O2 = CO2 + H2010C6H14 + 60O2 = 60CO2 + 7H20
C6H14 + O2 = CO2 + H2010C6H14 + 60O2 = 60CO2 + 7H20
C4H10(g) + O2(g) = CO2(g) + H2O (g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C4H10(g) + O2(g) = CO2(g) + H2O (g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C4H10(g) + O2(g) = CO2(g) + H2O (g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Cr(OH)3 + CHNO = CrN + H2O + CO2Cr(OH)3 + CHNO = CrN + 2H2O + CO2
C12H22O11+KClO=CO2+H2O+KClC12H22O11 + 24KClO = 12CO2 + 11H2O + 24KCl
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C5H8 + 9O2=8H2O + 5CO2C5H8 + 7O2 = 4H2O + 5CO2
C5H8 + O2=8H2O + 5CO2C5H8 + 7O2 = 4H2O + 5CO2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CaF2 + H2SO4 = HF + CaSO4CaF2 + H2SO4 = 2HF + CaSO4
CaF2 + H2SO4 = HF + CaSO4CaF2 + H2SO4 = 2HF + CaSO4
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C8H18+O2=CO2=H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cl2 + MgBr2=MgCl + Br2Cl2 + 2MgBr2 = 2MgCl + 2Br2
Cl2 + MgBr2=MgCl + BrCl2 + 2MgBr2 = 2MgCl + 4Br
CaCO3+O2=CO2+Ca2CaCO3 - O2 = 2CO2 + 2Ca
C2H6+7O2=6H2O+4CO22C2H6 + 7O2 = 6H2O + 4CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO2+H20=C3H8+O215CO2 + 2H20 = 5C3H8 + 15O2
Cu(s) + 2AgNO3(aq) = Cu(s)O3 + 2AgNCu(s) + AgNO3(aq) = Cu(s)O3 + AgN
C2H6(g)+O2(g)=CO2+H2O2C2H6(g) + 7O2(g) = 4CO2 + 6H2O
Ca(OH)2 + H2SO4 = CaSO4 + H2OCa(OH)2 + H2SO4 = CaSO4 + 2H2O
C + HNO 3 = CO 2 + NO 2 + H 2 OC + 4HNO3 = CO2 + 4NO2 + 2H2O
CO + Fe2O 3 =Fe + COCO + 0Fe2O3 = 0Fe + CO
C H 4 (g)+B r 2 (g)=CB r 4 (g) + HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
C + O2 = CO2C + O2 = CO2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.