Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CuO+NH3 = N2+H2O+Cu3CuO + 2NH3 = N2 + 3H2O + 3Cu
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr2O3+Na2CO3+KNO3 = NaCrO4+CO2+KNO2Cr2O3 + Na2CO3 + 4KNO3 = 2NaCrO4 + CO2 + 4KNO2
Cu2O+HNO3 = Cu(NO3)2+NO+H2O3Cu2O + 14HNO3 = 6Cu(NO3)2 + 2NO + 7H2O
C2H2+NO=CO2+H2O+N22C2H2 + 10NO = 4CO2 + 2H2O + 5N2
CrO3+HCl = CrCl3+Cl2+H2O2CrO3 + 12HCl = 2CrCl3 + 3Cl2 + 6H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
ClO+S2O3=Cl+SO45ClO + S2O3 = 5Cl + 2SO4
CaCO3 + HCl = CO2 + CaHClOCaCO3 + HCl = CO2 + CaHClO
C4H10 (g) + O2 (g) = CO2 (g) + H2O (g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CCl4+ O2 =COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
Cu(ClO3)2 + (NH4)3PO4 = CuPO4 + (NH4)3(ClO3)2Cu(ClO3)2 + (NH4)3PO4 = CuPO4 + (NH4)3(ClO3)2
Cu(ClO3)2 + (NH4)3PO4 = CuPO4 + (NH4)3(ClO3)2Cu(ClO3)2 + (NH4)3PO4 = CuPO4 + (NH4)3(ClO3)2
Co2(CO3)3 + H3O+ = H2O + CO2 + Co+++Co2(CO3)3 + 6H3O+ = 9H2O + 3CO2 + 2Co+++
C2H6O + K = C2H5KO + H22C2H6O + 2K = 2C2H5KO + H2
Cl2 + AgNO3 = AgCl + NO3Cl2 + 2AgNO3 = 2AgCl + 2NO3
Cr2O3 + HNO3 + H2O = H2CrO4 + HNO2Cr2O3 + 3HNO3 + 2H2O = 2H2CrO4 + 3HNO2
C8H18(l) +O2(g)=CO2(g) +H2O(g)2C8H18(l) + 25O2(g) = 16CO2(g) + 18H2O(g)
C(s) +H2(g)=CH4(g)C(s) + 2H2(g) = CH4(g)
C2H5OH(l) +O2(g)=CO2(g) + H2O(g)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
C2H4(g) +O2(g)=CO2(g) +H2OC2H4(g) + 3O2(g) = 2CO2(g) + 2H2O
CuCl2(aq) +H2S(g)=CuS(s) +HCl(aq)CuCl2(aq) + H2S(g) = CuS(s) + 2HCl(aq)
Cl2(g) +NaBr(aq)=NaCl(aq) +Br2(l)Cl2(g) + 2NaBr(aq) = 2NaCl(aq) + Br2(l)
CH3OH(g) + O2(g)=CO2(g) +H2O(g)2CH3OH(g) + 3O2(g) = 2CO2(g) + 4H2O(g)
C6H6+H2O2=CO2+H2OC6H6 + 15H2O2 = 6CO2 + 18H2O
C6H6+H2O2=CO2+H2OC6H6 + 15H2O2 = 6CO2 + 18H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cr+CCl4=CrCl3+C4Cr + 3CCl4 = 4CrCl3 + 3C
CL2(Aq)+KL(Aq)=2KCL(Aq)+L2CL2(Aq) + KL(Aq) = KCL(Aq) + L2
Cr2O7+ SO2 + H+ = Cr3+ + HSO4 + H2O-9Cr2O7 - 40SO2 - 6H+ = -6Cr3+ - 40HSO4 + 17H2O
Cr2O72-+ SO2 + H+ = Cr3+ + HSO4- + H2O-6Cr2O72- - 427SO2 + 417H+ = -4Cr3+ - 427HSO4- + 422H2O
Cl2+IO3-+OH- = IO4-+Cl-+H2OCl2 + IO3- + 2OH- = IO4- + 2Cl- + H2O
C4H8 + CrO3+ HCl = C2H4O2 + CrCl3 +H2O3C4H8 + 8CrO3 + 24HCl = 6C2H4O2 + 8CrCl3 + 12H2O
C4H8 + CrO3+ HCl = C2H4O2 + CrCl3 +H2O3C4H8 + 8CrO3 + 24HCl = 6C2H4O2 + 8CrCl3 + 12H2O
C6H6 + H2O2 = CO2+ H2OC6H6 + 15H2O2 = 6CO2 + 18H2O
CaCO3 + H3PO4 = Ca3(PO4)2 + CO2 + H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
C5H10O5 + O2 = CO2 + H2OC5H10O5 + 5O2 = 5CO2 + 5H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Cr2(CO3)3 + H3O = Cr + CO2 + H2OCr2(CO3)3 + 6H3O = 2Cr + 3CO2 + 9H2O
CaBr2+Cl2= CaCl +Br22CaBr2 + Cl2 = 2CaCl + 2Br2
C8H18 + O2 = CO2 + H2010C8H18 + 80O2 = 80CO2 + 9H20
C8H18 + O2 = CO2 + H2010C8H18 + 80O2 = 80CO2 + 9H20
Cl2(aq) + H2S(aq) = S + Cl-(aq) + H+Cl2(aq) + H2S(aq) = S + 2Cl-(aq) + 2H+
CuSO4+Fe = FeSO4+CuCuSO4 + Fe = FeSO4 + Cu
C4H10+O2 = H2O + CO22C4H10 + 13O2 = 10H2O + 8CO2
CuSO4 + Fe = FeSO4+ CuCuSO4 + Fe = FeSO4 + Cu
C4H10+O2 = H2O + CO22C4H10 + 13O2 = 10H2O + 8CO2
CuSO4*5H2O + Na2CO3 = CuCO3 + Na2SO4 + H2OCuSO4*5H2O + Na2CO3 = CuCO3 + Na2SO4 + 5H2O
C3H8O2+O2=CO2+H2OC3H8O2 + 4O2 = 3CO2 + 4H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4+O2+Cl2=HCl+CO2CH4 + O2 + 4Cl2 = 8HCl + 2CO
CH4+O2+Cl=HCl+CO2CH4 + O2 + 8Cl = 8HCl + 2CO
CaH2 + 2H2O =Ca(OH)2 + 2H2CaH2 + 2H2O = Ca(OH)2 + 2H2
Ca(OH)2 + H3 P O4 = Ca3 (PO4)2 +H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca(OH)2 + H3 P O4 = Ca3 (PO4)2 +6H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CaH2 + 2H2O =Ca(OH)2 + 2H2CaH2 + 2H2O = Ca(OH)2 + 2H2
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C5H12 (g)+O2 (g)=CO2+H2OC5H12(g) + 8O2(g) = 5CO2 + 6H2O
C3H8 + 5O2 = 3CO2 + 4H205C3H8 + 15O2 = 15CO2 + 2H20
CaCO3+H3PO4=Ca3(PO4)2+CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
C5H12 (g)+O2 (g)=CO2+H2OC5H12(g) + 8O2(g) = 5CO2 + 6H2O
Ca(OH)2 + CO2 = CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
CaH2 + 2H2O =Ca(OH)2 + 2H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+O2=CO2C + O2 = 2CO
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaO + SiO2 = CaSiO3CaO + SiO2 = CaSiO3
CaCl2 + 2AgNo3 = 2AgCl + Ca(No3)2CaCl2 + 2AgNo3 = 2AgCl + Ca(No3)2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C + H2O = CO2 + H2C + 2H2O = CO2 + 2H2
Cs3PO4 + H2O = CsOH + H3PO4Cs3PO4 + 3H2O = 3CsOH + H3PO4
Cu+ HNO3= Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu + 2AgNO3 = Cu(NO3)2 + 2Ag Cu + 2AgNO3 = Cu(NO3)2 + 2Ag
CO2 + Ca(OH)2 = Ca(HCO3)22CO2 + Ca(OH)2 = Ca(HCO3)2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co(OH)3+HNO3=Co(NO3)3+H2OCo(OH)3 + 3HNO3 = Co(NO3)3 + 3H2O
Co(OH)3+HNO3=Co(NO3)3+H2OCo(OH)3 + 3HNO3 = Co(NO3)3 + 3H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H12+O2=H2C6H8O4+H2O2C6H12 + 5O2 = 2H2C6H8O4 + 2H2O
CO2 + NH3 = OC(NH2)2 + H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C10H16 + Cl2 = C + HClC10H16 + 8Cl2 = 10C + 16HCl
CaCO3+KI=K2CO3+CaI2CaCO3 + 2KI = K2CO3 + CaI2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C2H2O4+KMgO4+HCl=CO2+MgCl2+KCl+H2O5C2H2O4 + 2KMgO4 + 6HCl = 10CO2 + 2MgCl2 + 2KCl + 8H2O
CrBr3+Li2C2O4=Cr2(C2O4)3+LiBr2CrBr3 + 3Li2C2O4 = Cr2(C2O4)3 + 6LiBr
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Ca(s)+2H2O(l)=2H2(g)+Ca(OH)2(aq)Ca(s) + 2H2O(l) = H2(g) + Ca(OH)2(aq)
Ca(OH)2 + H2O = Ca(OH2)2 + OHCa(OH)2 + 2H2O = Ca(OH2)2 + 2OH
CO(g) + H2O(l) = CO2(g) + H2(g)CO(g) + H2O(l) = CO2(g) + H2(g)
Ca(HCO3)2 + HCl = CaCl2 + CO2 + H2OCa(HCO3)2 + 2HCl = CaCl2 + 2CO2 + 2H2O
Cu(s) + O2(g) = Cu2O(s)4Cu(s) + O2(g) = 2Cu2O(s)
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(s)+N2(g)=Ca3N2(s)3Ca(s) + N2(g) = Ca3N2(s)
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cl2 + KBr = KCl + Br2Cl2 + 2KBr = 2KCl + Br2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(NO3)2 + Li = LiNO3 + CaCa(NO3)2 + 2Li = 2LiNO3 + Ca
C4H12 + O2 = H2O + CO2C4H12 + 7O2 = 6H2O + 4CO2
C12H22O11+ O2 = CO2 +H2O C12H22O11 + 12O2 = 12CO2 + 11H2O
CuCl2 (aq)+ (NH4)3PO4 (aq) =Cu3(PO4)2 (s)+NH4Cl (aq)3CuCl2(aq) + 2(NH4)3PO4(aq) = Cu3(PO4)2(s) + 6NH4Cl(aq)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Co(OH)3 +H2O2 +H = Co++ +H2O0Co(OH)3 + H2O2 + 2H = 0Co++ + 2H2O
Ca(OH)2+HNO3= Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CaCO3 + C + H2O = CO + Ca(OH)2CaCO3 + C + H2O = 2CO + Ca(OH)2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CaO + P2O5 = Ca3(PO4)23CaO + P2O5 = Ca3(PO4)2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaSiO3+HF=CaF2+SiF4+H2OCaSiO3 + 6HF = CaF2 + SiF4 + 3H2O
CuCl2+KI=CuI+KCl+I22CuCl2 + 4KI = 2CuI + 4KCl + I2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
CO(NO3)2+NH4OH=NH4(NO3)2+HCO2CO(NO3)2 + NH4OH = NH4(NO3)2 + HCO2
CuCl2+NH4OH=NH4Cl2+CuOHCuCl2 + NH4OH = NH4Cl2 + CuOH
Cu(NO3)2 + NH4OH = NH4(NO3)2+CuOHCu(NO3)2 + NH4OH = NH4(NO3)2 + CuOH
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C6H12 + 5O2= CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CdSO4(aq) + Sr(NO3)2 (aq) = Cd(NO3)2 (aq) + SO4Sr (aq)CdSO4(aq) + Sr(NO3)2(aq) = Cd(NO3)2(aq) + SO4Sr(aq)
Ca(OH)2+(NH4)2SO4=CaSO4+NH3+H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
C12H22O11(l)+O2(g)=CO2(g)+H2O(l)C12H22O11(l) + 12O2(g) = 12CO2(g) + 11H2O(l)
C12H22O11(l)+O2(g)=CO2(g)+H2O(l)C12H22O11(l) + 12O2(g) = 12CO2(g) + 11H2O(l)
C12H22O11(l)+O2(g)=CO2(g)+H2O(l)C12H22O11(l) + 12O2(g) = 12CO2(g) + 11H2O(l)
Cd(s)+2HCl(aq)=CdCl2+H2(s)Cd(s) + 2HCl(aq) = CdCl2 + H2(s)
Cd(s)+2HCl(aq)=CdCl2+H2Cd(s) + 2HCl(aq) = CdCl2 + H2
CO3Cl+Li(OH)=LiCl+CO3(OH)CO3Cl + Li(OH) = LiCl + CO3(OH)
CuO+CH4=Cu+CO2+2H2O4CuO + CH4 = 4Cu + CO2 + 2H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H8 +O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 +O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3(s) = CO2(g) + CaO(s)CaCO3(s) = CO2(g) + CaO(s)
CH4(g) + O2(g) = CO2(g) + H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CO2(g) + H2O(g) = C2H6(g) + O2(g)4CO2(g) + 6H2O(g) = 2C2H6(g) + 7O2(g)
CH4(g) + O2(g) = CO2(g) + H2O (g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
Cu(CH3COO)2(aq) + Ca(ClO4)2(aq) = Cu(ClO4)2 + Ca(CH3COO)2 Cu(CH3COO)2(aq) + Ca(ClO4)2(aq) = Cu(ClO4)2 + Ca(CH3COO)2
CH4 +O2=CO2 +H2O CH4 + 2O2 = CO2 + 2H2O
CaCO3(s) = CO2(g) + CaO(s)CaCO3(s) = CO2(g) + CaO(s)
C(s) + H2O(g) = CH4(g) + CO2(g)2C(s) + 2H2O(g) = CH4(g) + CO2(g)
CuCl2(aq) + AgNO3(aq) = Cu(NO3)2 (aq) + AgCl(s)CuCl2(aq) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2AgCl(s)
C2H2(g) + O2(g) = CO2(g) +H2O(g)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
Ca2Si(s) + Cl2(g) = CaCl2(g) + SiCl4(g)Ca2Si(s) + 4Cl2(g) = 2CaCl2(g) + SiCl4(g)
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C5H8O2+ NaH+ HCl = C5H12O2+ NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
C7H9+ HNO3 =C7H6(NO2)3+ H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cr2(SO4)3 + KClO3 + KOH = K2CrO4 + KCl + K2SO4 + H2OCr2(SO4)3 + KClO3 + 10KOH = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
C7H16 + O2 =CO2+ H2OC7H16 + 11O2 = 7CO2 + 8H2O
CaF2+H2SO4=CaSO4+HFCaF2 + H2SO4 = CaSO4 + 2HF
C4H10O+ O2 =CO2+ H2OC4H10O + 6O2 = 4CO2 + 5H2O
C2H4+ O2 =CO2+ H2OC2H4 + 3O2 = 2CO2 + 2H2O
C4H6O3+ H2O = C2H4O2C4H6O3 + H2O = 2C2H4O2
Cr2(SO4)3 + KClO3 + KOH = K2CrO4 + KCl + K2SO4 + H2OCr2(SO4)3 + KClO3 + 10KOH = 2K2CrO4 + KCl + 3K2SO4 + 5H2O
Cl2+KI = KCl + I2Cl2 + 2KI = 2KCl + I2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C4H10 + O2= CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C8H18(l) + O2(g) = CO2(g) + H2O(l)2C8H18(l) + 25O2(g) = 16CO2(g) + 18H2O(l)
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CO2 + Na = Na2CO3 + C3CO2 + 4Na = 2Na2CO3 + C
C7H16 (l) + O2 (g) = CO (g) + H2O (g)2C7H16(l) + 15O2(g) = 14CO(g) + 16H2O(g)
CO2 + H2O = CH3OH + H2-1CO2 + H2O = -1CH3OH + 3H2
Cl2+AlBr3=AlCl3+Br23Cl2 + 2AlBr3 = 2AlCl3 + 3Br2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Co(OH)3 + H2O2 + H+ = Co2+ +H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C7H16 + Br2 = C7H15Br + HBrC7H16 + Br2 = C7H15Br + HBr
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3 = CaO +CO2CaCO3 = CaO + CO2
CaCO3 = CaO +CO2CaCO3 = CaO + CO2
Ca(OH)2 + H2SO4 = HOH + CaSO4 Ca(OH)2 + H2SO4 = 2HOH + CaSO4
C2H6+O2= H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CO+NO2=CO2+NOCO + NO2 = CO2 + NO
Ca(s) + H2O(l)= H2(g) + Ca(OH)2(aq)Ca(s) + 2H2O(l) = H2(g) + Ca(OH)2(aq)
Cl2(aq) + NaI(aq)= I2(aq) + NaCl(aq)Cl2(aq) + 2NaI(aq) = I2(aq) + 2NaCl(aq)
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + 3O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
CaCO 3 (s)=CaO(s)+CO 2 (g) CaCO3(s) = CaO(s) + CO2(g)
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CsOH+H2CO3=H2O+Cs2CO32CsOH + H2CO3 = 2H2O + Cs2CO3
C3H8 + 5O2 = 2CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
Cu(OH)2+HNO3=H2O+Cu(NO3)2Cu(OH)2 + 2HNO3 = 2H2O + Cu(NO3)2
Cr(s) + Fe(NO3)2 (aq) = Fe(s) + Cr(NO3)32Cr(s) + 3Fe(NO3)2(aq) = 3Fe(s) + 2Cr(NO3)3
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuCl2 + Na2SO3 + H2O = CuCl + Na2SO4 + H2O0CuCl2 + 0Na2SO3 + H2O = 0CuCl + 0Na2SO4 + H2O
CuCl2 + Na2SO3 + H2O = CuCl + Na2SO4 + HCl2CuCl2 + Na2SO3 + H2O = 2CuCl + Na2SO4 + 2HCl
CaSO4 + AlBr3 = CaBr2 + Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
Co(OH)3 + H2O2 + H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
Co(OH)3 + H2O2 + H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
Co(OH)3 + H2O2 + H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
Cr2(SO4)3(aq) + Al(s) = Al2(SO4)3(aq) + Cr(s)Cr2(SO4)3(aq) + 2Al(s) = Al2(SO4)3(aq) + 2Cr(s)
Cr(SO4)3 + NaOH + H2O2 = Na2Cr2O4 + Na2SO4 + H2O20Cr(SO4)3 + 0NaOH + H2O2 = 0Na2Cr2O4 + 0Na2SO4 + H2O2
Cr(OH)3 + NaOH = Na3Cr(OH)6Cr(OH)3 + 3NaOH = Na3Cr(OH)6
Cr2O3 + Mn(NO3)2 + Na2CO3 = NO + CO2 + Na2CrO4 + Na2MnO4Cr2O3 + 3Mn(NO3)2 + 5Na2CO3 = 6NO + 5CO2 + 2Na2CrO4 + 3Na2MnO4
C2H5O+H2S=H2SO4+C2H54C2H5O + H2S = H2SO4 + 4C2H5
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CuO + HNO3 = Cu(NO3)2 + H2OCuO + 2HNO3 = Cu(NO3)2 + H2O
C9H8O3+O2=CO2+H2O2C9H8O3 + 19O2 = 18CO2 + 8H2O
C5H10O5+O2=CO2+H2OC5H10O5 + 5O2 = 5CO2 + 5H2O
C5H12O2 + O2 = CO2 + H2OC5H12O2 + 7O2 = 5CO2 + 6H2O
Co(OH)3+H2SO4=Co2(SO4)3+H2O2Co(OH)3 + 3H2SO4 = Co2(SO4)3 + 6H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cu(OH)2+HBr=CuBr2+H2OCu(OH)2 + 2HBr = CuBr2 + 2H2O
Co(OH)3 + H2O2 + H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
CDSO4 + NA2S = CDS +NA2SO4CDSO4 + NA2S = CDS + NA2SO4
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO(NH2)2(aq)+H2O(l)=(NH4)2CO3(aq)CO(NH2)2(aq) + 2H2O(l) = (NH4)2CO3(aq)
CO(NH2)2(aq)+H2O(l)=(NH4)2CO3(aq)CO(NH2)2(aq) + 2H2O(l) = (NH4)2CO3(aq)
C10H18O9+O2 =CO2+H2OC10H18O9 + 10O2 = 10CO2 + 9H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C12H22O11=C+H2OC12H22O11 = 12C + 11H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
Cu2++NaOH+C2H5NS=Cu(OH)2+Na++C2H5NS0Cu2+ + 0NaOH + C2H5NS = 0Cu(OH)2 + 0Na+ + C2H5NS
C6H12O6 + H2O = CH3CH2OH + CO2 C6H12O6 + 0H2O = 2CH3CH2OH + 2CO2
Co(OH)3 + H2O2 +H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
Co(OH)3 + H2O2 +H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
C4H10 + O2 = CO2 + H202C4H10 + 8O2 = 8CO2 + H20
Co (OH)3 + H2O2+H=Co2++H2O0Co(OH)3 + H2O2 + 2H = 0Co2+ + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H8O2 + H2 = C2 H6 OC4H8O2 + 2H2 = 2C2H6O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CuSO4+AgNO3= Cu(NO3)2+Ag2SO4CuSO4 + 2AgNO3 = Cu(NO3)2 + Ag2SO4
CH3+O2=CO2+H2O4CH3 + 7O2 = 4CO2 + 6H2O
Cu+S=Cu2S2Cu + S = Cu2S
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(C2H3O2)2+KOH=KC2H3O2+Ca(OH)2Ca(C2H3O2)2 + 2KOH = 2KC2H3O2 + Ca(OH)2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuCO3=CuO+CO2CuCO3 = CuO + CO2
Co(OH)3 + H2O2 + H+ = Co2+ + H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
Ca(OH)2 + H2SO4 = CaSO4 + H2(OH)2Ca(OH)2 + H2SO4 = CaSO4 + H2(OH)2
CrO-- + ClO- = CrO4-- + Cl-CrO-- + 3ClO- = CrO4-- + 3Cl-
Ca+O2=CaO2Ca + O2 = 2CaO
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CaCl2+H3PO4=Ca3(PO4)2+HCl3CaCl2 + 2H3PO4 = Ca3(PO4)2 + 6HCl
C4H8O2(l)+H2(g)=C2H6O(l)C4H8O2(l) + 2H2(g) = 2C2H6O(l)
CCl4 + O2 = COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
CO + 2H2 = CH3OHCO + 2H2 = CH3OH
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CuSCN + KIO3 + HCl = CuSO4 + KCl + HCN + ICl + H2O4CuSCN + 7KIO3 + 14HCl = 4CuSO4 + 7KCl + 4HCN + 7ICl + 5H2O
C2H2 + O2 = CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C4H6(g)+O2(g)=CO2+H2O2C4H6(g) + 11O2(g) = 8CO2 + 6H2O
C4H6(g)+O2(g)=CO+H2O2C4H6(g) + 7O2(g) = 8CO + 6H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(OH)(HCO3) = CaCO3 + H2OCa(OH)(HCO3) = CaCO3 + H2O
C5H12 + O2 = CO2 = H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCl2 + AgNO3 = AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2 + H2 = CH4 + H2OCO2 + 4H2 = CH4 + 2H2O
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuS+HNO3 = Cu(NO3)2+S+H2O+NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H5Cl + SiCl4 + Na = (C6H5)4Si + NaCl4C6H5Cl + SiCl4 + 8Na = (C6H5)4Si + 8NaCl
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C4H4O4 + NaOH = H2O + NaC4H3O4C4H4O4 + NaOH = H2O + NaC4H3O4
C4H4O4 + NaOH = H2O + NaC4H3O4C4H4O4 + NaOH = H2O + NaC4H3O4
C4H4O4 + NaOH = H2O + NaC4H3O4C4H4O4 + NaOH = H2O + NaC4H3O4
CH4 + O2 = CH3OH2CH4 + O2 = 2CH3OH
CO(g)+SO2(g)=S(s)+CO2(g) 2CO(g) + SO2(g) = S(s) + 2CO2(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+2 + Zn = Zn+2 + CuCu+2 + Zn = Zn+2 + Cu
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 (aq) + H3PO4 (aq) = H2O (l) + Ca3(PO4 )2 (s)3Ca(OH)2(aq) + 2H3PO4(aq) = 6H2O(l) + Ca3(PO4)2(s)
C10H16 + C4H10O3 + C2H6O = C10H18O5C10H16 + C4H10O3 + 3C2H6O = 6C10H18O
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cu + 3AgNO3 = Cu(NO3)3 + 3AgCu + 3AgNO3 = Cu(NO3)3 + 3Ag
CO2+LiOH=Li2CO3+H2OCO2 + 2LiOH = Li2CO3 + H2O
C+O2=CO2C + O2 = CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(OH)(HCO3) = CaCO3 + H2OCa(OH)(HCO3) = CaCO3 + H2O
C57H104O6 + CH4O = C3H8O3 + C19H38O22C57H104O6 + 15CH4O = 5C3H8O3 + 6C19H38O2
CH3CCH + O2 = CO2 + H2OCH3CCH + 4O2 = 3CO2 + 2H2O
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CH2O2+CH4O=CH4O2+H2O-1CH2O2 - CH4O = -2CH4O2 + H2O
CuS + HNO3 = Cu(NO3)2 + NO2 + H2O + SCuS + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O + S
CuS + HNO3 = Cu(NO3) + NO2 + H2O + SCuS + 2HNO3 = Cu(NO3) + NO2 + H2O + S
CH4 + Cl2 = CHCl3 + HClCH4 + 3Cl2 = CHCl3 + 3HCl
Ca(s) + CuCl(aq) = Cu(s) + CaCl(aq)Ca(s) + CuCl(aq) = Cu(s) + CaCl(aq)
C10H16 + C4H10O3 + C2H6O = 6C10H18O5C10H16 + C4H10O3 + 3C2H6O = 6C10H18O
C10H16 + C4H10O3 + C2H6O = C10H18O5C10H16 + C4H10O3 + 3C2H6O = 6C10H18O
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C10H16 + C4H10O3 + C2H6O = 6C10H18O5C10H16 + C4H10O3 + 3C2H6O = 6C10H18O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CH3(CH2)3CH3 + O2 = CO2 + H2O CH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
CH3(CH2)3CH3 + O2 = CO2 + H2O CH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
Cu+HNO3=Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
C4H10 (g) + O2 (g) = CO2 (g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C4H8O2 + C3H8O = C7H14O2 + H2OC4H8O2 + C3H8O = C7H14O2 + H2O
CH3OH+O2=CO2+H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
Cr(NO3)3 + K2CO3 = KNO3 + Cr2(CO3)32Cr(NO3)3 + 3K2CO3 = 6KNO3 + Cr2(CO3)3
CaBr2+Mg(NO3)2 = Ca(NO3)2+MgBr2CaBr2 + Mg(NO3)2 = Ca(NO3)2 + MgBr2
Ca5(PO4)3F+C+SiO2=CaSiO3+P4+CaF2+CO4Ca5(PO4)3F + 30C + 18SiO2 = 18CaSiO3 + 3P4 + 2CaF2 + 30CO
C5H12 + 3O2 = 5CO2 + 6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + 8O2 = 5CO2 + 6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + 3O2 = 5CO2 + 6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C6H5OH+O2=CO2+H2010C6H5OH + 55O2 = 60CO2 + 3H20
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CO2+C=COCO2 + C = 2CO
CrSO4+KOH+KClO3=K2Cr2O4+K2SO4+KCl+H2O6CrSO4 + 18KOH + KClO3 = 3K2Cr2O4 + 6K2SO4 + KCl + 9H2O
Cl2O3+NO2CO3+KNO3=CO2+NO2ClO4+KNO2Cl2O3 + 2NO2CO3 + 3KNO3 = 2CO2 + 2NO2ClO4 + 3KNO2
C2H4Cl2 + 2O2 = CO + H2O + Cl2C2H4Cl2 + 2O2 = 2CO + 2H2O + Cl2
CuCl2 + 4KI = CuI + KCl + I22CuCl2 + 4KI = 2CuI + 4KCl + I2
Ca(NO3)2 + H3PO4 = Ca3(PO4)2 + HNO33Ca(NO3)2 + 2H3PO4 = Ca3(PO4)2 + 6HNO3
Cu+AgNO3=Cu (NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C2H4O3 + HNO3 = CO2 + N2O + H2O4C2H4O3 + 6HNO3 = 8CO2 + 3N2O + 11H2O
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
C + H2SO4 = CO2 + SO2 + H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
C + H2SO4 = CO2 + SO2 + H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
C2H2+ O2= CO2 +H2C2H2 + 2O2 = 2CO2 + H2
C3H6O + O2 = CO2 + H2OC3H6O + 4O2 = 3CO2 + 3H2O
C4H10(g)+O2=CO2(g)+H2O(g)2C4H10(g) + 13O2 = 8CO2(g) + 10H2O(g)
C2H6+O2=CO2+3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = CO2
C4H8S + O2 = CO2 + H2O + SO2 C4H8S + 7O2 = 4CO2 + 4H2O + SO2
C4H8S(l)+O2(g)=CO2(g)+H2O(l)+SO2(g)C4H8S(l) + 7O2(g) = 4CO2(g) + 4H2O(l) + SO2(g)
C4H10(g)+O2(g)=CO2(g)+H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
C4H8S + O2=CO2+H2O+SO2C4H8S + 7O2 = 4CO2 + 4H2O + SO2
C6H8S+O2 = CO2+H2O+SO4C6H8S + 10O2 = 6CO2 + 4H2O + SO4
Cr(s) + O2(g) = Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
CuSO4+ NaOH = Cu(OH)2 + Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
Ca+ H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
C2H3OH(l) + O2(g)=2CO2(g)+H2O(l)2C2H3OH(l) + 5O2(g) = 4CO2(g) + 4H2O(l)
C6H14 + O2 = CO + H2O2C6H14 + 13O2 = 12CO + 14H2O
CH4(g) +O2(g)=CO2(g) +H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cl2(g) +KBr(aq)=Br2(l) +KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
CH4+F2=CHF3+HFCH4 + 3F2 = CHF3 + 3HF
CH4+F2=CHF3+HFCH4 + 3F2 = CHF3 + 3HF
CH4+F2=CHF3+HFCH4 + 3F2 = CHF3 + 3HF
Ca3(PO4)2+SiO2=P4O10+CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
Cu+Fe(CN)6=Cu2Fe(CN)62Cu + Fe(CN)6 = Cu2Fe(CN)6
Cu(OH)2+NH3=Cu(NH3)4+OHCu(OH)2 + 4NH3 = Cu(NH3)4 + 2OH
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Cr(OH)3+OH=Cr(OH)4Cr(OH)3 + OH = Cr(OH)4
Cr(OH)2+OH=Cr(OH)4Cr(OH)2 + 2OH = Cr(OH)4
Cr(OH)3+OH=Cr(OH)4Cr(OH)3 + OH = Cr(OH)4
Cr+NH3+H2O=Cr(OH)3+NH4Cr + 3NH3 + 3H2O = Cr(OH)3 + 3NH4
Cu+NH3+H2O=Cu(OH)2+NH4Cu + 2NH3 + 2H2O = Cu(OH)2 + 2NH4
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCO3 =CaO+CO2CaCO3 = CaO + CO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CH4 = C2H2 + H22CH4 = C2H2 + 3H2
CH4 = C2H2 + H22CH4 = C2H2 + 3H2
CH4 = C2H2 + H22CH4 = C2H2 + 3H2
C10H16 + C4H10O3 + C2H6O = C10H18O5C10H16 + C4H10O3 + 3C2H6O = 6C10H18O
C2H3OF + O2 = CO + H2O + F24C2H3OF + 5O2 = 8CO + 6H2O + 2F2
C6H6 +O2=H2O +CO22C6H6 + 15O2 = 6H2O + 12CO2
CO + 2H2 = CH3OHCO + 2H2 = CH3OH
CH4 = C2H2 + H22CH4 = C2H2 + 3H2
Co(OH)3 + H2O2 + H+ = Co++ + H2O2Co(OH)3 - H2O2 + 4H+ = 2Co++ + 4H2O
Co(OH)3 + H2O2 + H+ = Co++ + H2O2Co(OH)3 - H2O2 + 4H+ = 2Co++ + 4H2O
CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
Co(H2O)6++ + SCN- = Co(SCN)4-- + H2OCo(H2O)6++ + 4SCN- = Co(SCN)4-- + 6H2O
Ca3(PO4)2 + SiO2 = P4O10 + 6CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
C2H3Br3 + 11O2 = 8CO2 + H2O + Br24C2H3Br3 + 11O2 = 8CO2 + 6H2O + 6Br2
CoCl2 + Ag2SO4 = CoSO4 + AgClCoCl2 + Ag2SO4 = CoSO4 + 2AgCl
CH4+O2=CH4O2CH4 + O2 = 2CH4O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+ H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H5OH + 3 O2 = 2 CO2 + 3 H2O C2H5OH + 3O2 = 2CO2 + 3H2O
CO+O2=CO22CO + O2 = 2CO2
CaSO4+AlBr3= CaBr2+Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
CaO+P2O5 = Ca3(PO4)23CaO + P2O5 = Ca3(PO4)2
Co(OH)3+H2O2+H+=Co2++H2O4Co(OH)3 - 5H2O2 + 2H+ = 2Co2+ + 2H2O
C4H10+O=CO2+HC4H10 + 8O = 4CO2 + 10H
C2H8N2+2N2O4= 2N2+2CO2+4H205C2H8N2 + 5N2O4 = 10N2 + 10CO2 + 2H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
ClO2+H2O=HClO3+HCl6ClO2 + 3H2O = 5HClO3 + HCl
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H6 + O2 = CO2 +H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
C2H3Cl+O2=CO2+H2O+HCl2C2H3Cl + 5O2 = 4CO2 + 2H2O + 2HCl
C2H3Cl+O2=CO2+H2O+HCl2C2H3Cl + 5O2 = 4CO2 + 2H2O + 2HCl
CH3 + O2 = CO2 + H2O4CH3 + 7O2 = 4CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cl2+CH4=CCl4+H22Cl2 + CH4 = CCl4 + 2H2
C4H10 (g) + O2 (g) = CO2 (g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C2H6+ O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C7H6O3 + CH4 = C8H8O3 + H2O15C7H6O3 + 7CH4 = 14C8H8O3 + 3H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
C7H6O3 + CH4 = C2H6O3 + H2O-2C7H6O3 + 0CH4 = -7C2H6O3 + 15H2O
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Cl2O7+H2O=HClO4Cl2O7 + H2O = 2HClO4
Cu+2L=CuL2Cu + 2L = CuL2
Ca+S=CaSCa + S = CaS
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 = C2H2 + H22CH4 = C2H2 + 3H2
C5H8O2 + Al2(SO4)3 + NH3 = Al(C5H7O2)3 + NH4 + SO46C5H8O2 + Al2(SO4)3 + 6NH3 = 2Al(C5H7O2)3 + 6NH4 + 3SO4
C6H6(l)+O2=H2O(l)+CO2(g)2C6H6(l) + 15O2 = 6H2O(l) + 12CO2(g)
CuCl2 + H2 = Cu + HCl CuCl2 + H2 = Cu + 2HCl
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CoCl3 +K2S = CoS + K2Cl3CoCl3 + K2S = CoS + K2Cl3
CaCl2 + AgNO3 = AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
C2H4 +O2= CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CuCl2 + H2 = Cu + HClCuCl2 + H2 = Cu + 2HCl
CuCl2 + H2 = Cu + HClCuCl2 + H2 = Cu + 2HCl
C3H8 +O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+Ag3NO=Cu3NO+Ag3Cu + Ag3NO = Cu3NO + 3Ag
CuCl2 + H2 = Cu + HClCuCl2 + H2 = Cu + 2HCl
Cu+AgNO3=CuNO3+AgCu + AgNO3 = CuNO3 + Ag
Ca + ScF3=2Sc + 3CaF23Ca + 2ScF3 = 2Sc + 3CaF2
C2H3O2Cl + 7O2 =8CO2 + H2O + Cl24C2H3O2Cl + 7O2 = 8CO2 + 6H2O + 2Cl2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
Cr2O3+Li2SO4=Cr2(SO4)3+Li2OCr2O3 + 3Li2SO4 = Cr2(SO4)3 + 3Li2O
C5H12+O 2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCl2+KOH=Ca(OH)2+KClCaCl2 + 2KOH = Ca(OH)2 + 2KCl
CaCO3+HCL=CaCL+HCO3CaCO3 + HCL = CaCL + HCO3
CO+H2=CH2OH 2CO + 3H2 = 2CH2OH
C6H12O6 = 3C2H5OH + 2CO2 C6H12O6 = 2C2H5OH + 2CO2
CH3CHO + O2 = CO2 + H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H8O2 + O2 = H2O + CO2C4H8O2 + 5O2 = 4H2O + 4CO2
CaCO3(s) = CaO(s) + CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s) = CaO(s) + CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Cr + H2SO4 = Cr2O3 + S + H2O2Cr + H2SO4 = Cr2O3 + S + H2O
C+S8=CS24C + S8 = 4CS2
C6H12O + O2 = CO2 + H2O2C6H12O + 17O2 = 12CO2 + 12H2O
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
Cl+SO+H2O=HCl+H2SO44Cl + SO + 3H2O = 4HCl + H2SO4
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CuCl2 + NaOH = Cu(OH)2 + NaClCuCl2 + 2NaOH = Cu(OH)2 + 2NaCl
C10H16 + Cl2 = C + HClC10H16 + 8Cl2 = 10C + 16HCl
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3+H2SO4=CaSO4+H2O+CO2CaCO3 + H2SO4 = CaSO4 + H2O + CO2
Ca(OH)2+CO2=Ca(OH)(HCO3)Ca(OH)2 + CO2 = Ca(OH)(HCO3)
Cr2(CO3)3 + Ca(OH)2 = Cr(OH)3 + CaCO3Cr2(CO3)3 + 3Ca(OH)2 = 2Cr(OH)3 + 3CaCO3
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CuSO4 +Fe =FeSO4 +Cu CuSO4 + Fe = FeSO4 + Cu
C2H5NH2 + CO2 + H2O = N2 + C3H10O4C2H5NH2 + CO2 + H2O = 2N2 + 3C3H10O
Ca3P2 + H2O = PH3 + Ca(OH)2Ca3P2 + 6H2O = 2PH3 + 3Ca(OH)2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cr + O2 = Cr2O34Cr + 3O2 = 2Cr2O3
Cl2 + 2KBr = Br2 + 2KClCl2 + 2KBr = Br2 + 2KCl
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C4H10+O2=CO2+H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2+Ca(OH)2=CaCl2+Ca(ClO3)2+H2O6Cl2 + 6Ca(OH)2 = 5CaCl2 + Ca(ClO3)2 + 6H2O
Cl2+AlBr3=AlCl3+Br23Cl2 + 2AlBr3 = 2AlCl3 + 3Br2
C2H5OH + 3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + 3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H3O2Br+O2=CO+H2O+HBr2C2H3O2Br + O2 = 4CO + 2H2O + 2HBr
C2H2O2Br+O2=CO+H2O+HBr4C2H2O2Br + O2 = 8CO + 2H2O + 4HBr
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H7N + O2 = CO + 14H2O + 4NO24C2H7N + 15O2 = 8CO + 14H2O + 4NO2
Ca2Si + Cl2 =CaCl2 +SiCl2Ca2Si + 5Cl2 = 4CaCl2 + 2SiCl
C7H16(l)+O2(g)=CO2(g)+H2O(g)C7H16(l) + 11O2(g) = 7CO2(g) + 8H2O(g)
Cu + AgNO3 =Cu (NO3)2 + Ag Cu + 2AgNO3 = Cu(NO3)2 + 2Ag
C4H10 + O2 = CO2 +H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 +H2O =C6H12O6 +O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6 +O2=CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5OH + O2 = CO2 + H2010C2H5OH + 15O2 = 20CO2 + 3H20
C4H9OH + O2 = CO2 + H202C4H9OH + 7O2 = 8CO2 + H20
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12O2(l) + 7 O2(g) = 5 CO2(g) + 6 H2O(l)C5H12O2(l) + 7O2(g) = 5CO2(g) + 6H2O(l)
CaSO4 + AlBr3 = CaBr2 = Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.