Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Cu + NO3-- + H++ = Cu2++ + NO + H2O6Cu + NO3-- + 4H++ = 3Cu2++ + NO + 2H2O
CaF2 + H2SO4 = 2HF + CaSO4CaF2 + H2SO4 = 2HF + CaSO4
C3H6O2S + 5O2 = CO2 + H2O + SO3C3H6O2S + 5O2 = 3CO2 + 3H2O + SO3
CaO + HCl = CaCl2 + H2OCaO + 2HCl = CaCl2 + H2O
Ca + 2SmF3 = Sm + 3CaF23Ca + 2SmF3 = 2Sm + 3CaF2
Cl2 + 2KBr = KCl + Br2Cl2 + 2KBr = 2KCl + Br2
C2H3Br3 + O2 = 2CO + HBrC2H3Br3 + O2 = 2CO + 3HBr
C6H5F + 7O2 = CO2 + H2O + HFC6H5F + 7O2 = 6CO2 + 2H2O + HF
C2H5NSCl + 5O2 = 2CO2 + 2H2O + NO + SO3 + HClC2H5NSCl + 5O2 = 2CO2 + 2H2O + NO + SO3 + HCl
C2H3O2F + 3O2 = 4CO2 + H2O + HF2C2H3O2F + 3O2 = 4CO2 + 2H2O + 2HF
C2H3Cl3 + O2 = CO2 + 3HClC2H3Cl3 + 2O2 = 2CO2 + 3HCl
C2H3Cl3 + 7O2 = 8CO + H2O + Cl24C2H3Cl3 + 7O2 = 8CO + 6H2O + 6Cl2
CBr4 + O2 = CO2 + Br2CBr4 + O2 = CO2 + 2Br2
C2H5NSCl + O2 = 8CO + H2O + 4NO + 4SO2 + Cl24C2H5NSCl + 15O2 = 8CO + 10H2O + 4NO + 4SO2 + 2Cl2
C3H6S + O2 = 3CO2 + H2O + SO3C3H6S + 6O2 = 3CO2 + 3H2O + SO3
C3H6 + O2 = 3CO + 3H2OC3H6 + 3O2 = 3CO + 3H2O
C2H7N + O2 = CO2 + 14H2O + 4NO4C2H7N + 17O2 = 8CO2 + 14H2O + 4NO
C2H7N + O2 = CO2 + 14H2O + 4NO4C2H7N + 17O2 = 8CO2 + 14H2O + 4NO
CF4 + O2 = CO2 + F2CF4 + O2 = CO2 + 2F2
C2H3F3 + O2 = 8CO + 6H2O + F24C2H3F3 + 7O2 = 8CO + 6H2O + 6F2
CCl4 + 2HF = CCl2F2 + 2HClCCl4 + 2HF = CCl2F2 + 2HCl
C2H5NSCl + O2 = CO2 + H2O + 4NO + 4SO2 + 2Cl24C2H5NSCl + 19O2 = 8CO2 + 10H2O + 4NO + 4SO2 + 2Cl2
Ca3P2 + H2O = PH3 + 3Ca(OH)2Ca3P2 + 6H2O = 2PH3 + 3Ca(OH)2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3COOH + NaHCO3 = H2O + CO2 + NaC2H3O2CH3COOH + NaHCO3 = H2O + CO2 + NaC2H3O2
CaC2+H2O+3CO2=CH2CHCO2H+Ca(OH)26CaC2 + 16H2O + 3CO2 = 5CH2CHCO2H + 6Ca(OH)2
CuCl2 + 4KI = CuI + 4KCl + I22CuCl2 + 4KI = 2CuI + 4KCl + I2
Cu(s)+AgNO3(aq)=Cu(NO3)2(aq)+AgCu(s) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2Ag
C6H6OS + O2 = CO2 + H2O + SO2C6H6OS + 8O2 = 6CO2 + 3H2O + SO2
C2H4 + 3O2 = CO2 + 2H2OC2H4 + 3O2 = 2CO2 + 2H2O
C8H18 + O2 = 8CO2 + 9H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H3O2Cl + 7O2 = 8CO2 + H2O + Cl24C2H3O2Cl + 7O2 = 8CO2 + 6H2O + 2Cl2
CO2 + H2O = C6H12O6 + 6O26CO2 + 6H2O = C6H12O6 + 6O2
C6H6 + O2 = 12CO + 6H2O2C6H6 + 9O2 = 12CO + 6H2O
C6H12O6(s)+O2(g)=H2O(l)+CO2C6H12O6(s) + 6O2(g) = 6H2O(l) + 6CO2
Cu + O2 = CuO2Cu + O2 = 2CuO
Cu + O2 = Cu2O4Cu + O2 = 2Cu2O
Cu(s)+AgNO3(aq)=Cu(NO3)2(aq)+AgCu(s) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2Ag
C4H10+O2(g)=H2O(l)+CO22C4H10 + 13O2(g) = 10H2O(l) + 8CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + 5O2 = H2O + 3CO2C3H8 + 5O2 = 4H2O + 3CO2
C2H6(g)+O2(g)=H2O(l)+CO22C2H6(g) + 7O2(g) = 6H2O(l) + 4CO2
Ca3(PO4)2 + 2H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C12H22O11 + O2 = CO2+H2010C12H22O11 + 65O2 = 120CO2 + 11H20
C2H5NSCl + 4O2 = 2CO + H2O + NO2 + SO2 + HClC2H5NSCl + 4O2 = 2CO + 2H2O + NO2 + SO2 + HCl
C2H3O2Br + 7O2 = 8CO2 + H2O + Br24C2H3O2Br + 7O2 = 8CO2 + 6H2O + 2Br2
C2H4Cl2 + O2 = 2CO + H2O + Cl2C2H4Cl2 + 2O2 = 2CO + 2H2O + Cl2
C2H5Cl + O2 = 8CO2 + H2O + 2Cl24C2H5Cl + 13O2 = 8CO2 + 10H2O + 2Cl2
C12H22O11(s)+O2(g)=CO2(g)+H2OC12H22O11(s) + 12O2(g) = 12CO2(g) + 11H2O
C2H3N + 13O2 = CO2 + H2O + 4NO4C2H3N + 13O2 = 8CO2 + 6H2O + 4NO
C2H7N + O2 = 8CO + H2O + 4NO4C2H7N + 13O2 = 8CO + 14H2O + 4NO
Ca + 2NdF3 = 2Nd + CaF23Ca + 2NdF3 = 2Nd + 3CaF2
C4H8S2 + 9O2 = CO2 + 4H2O + SO3C4H8S2 + 9O2 = 4CO2 + 4H2O + 2SO3
C6H6O2 + 13O2 = 12CO2 + H2O2C6H6O2 + 13O2 = 12CO2 + 6H2O
C2H3F + O2 = 8CO + H2O + 2F24C2H3F + 7O2 = 8CO + 6H2O + 2F2
C2H5OCl + O2 = CO2 + 10H2O + 2Cl2 4C2H5OCl + 11O2 = 8CO2 + 10H2O + 2Cl2
Cu (NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
Cu (NO2) = CuO + NO2 + O2-2Cu(NO2) = -2CuO - 2NO2 + O2
CF4 + O2 = CO2 + 2F2CF4 + O2 = CO2 + 2F2
CaC2 + N2 = CaCN2 + CCaC2 + N2 = CaCN2 + C
C7H(l)+O2(g)=CO2(g)+H2O(l)4C7H(l) + 29O2(g) = 28CO2(g) + 2H2O(l)
Ca3(PO4)2 + H2SO4 = 2CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
Cl2+NaOH=NaClO3+NaCl+H2030Cl2 + 60NaOH = 20NaClO3 + 40NaCl + 3H20
C9H15S + O2 = CO2 + H2O + SO24C9H15S + 55O2 = 36CO2 + 30H2O + 4SO2
C2H5NSCl + O2 = 2CO2 + H2O + NO2 + SO2 + HClC2H5NSCl + 5O2 = 2CO2 + 2H2O + NO2 + SO2 + HCl
C7H14 = C7H8 + 3H2C7H14 = C7H8 + 3H2
C6H5N2Cl = C6H5Cl + N2C6H5N2Cl = C6H5Cl + N2
C2H5NSCl + 23O2 = CO2 + 10H2O + 4NO2 + SO3 + Cl24C2H5NSCl + 23O2 = 8CO2 + 10H2O + 4NO2 + 4SO3 + 2Cl2
C2H4F2 + 5O2 = 4CO2 + H2O + HF2C2H4F2 + 5O2 = 4CO2 + 2H2O + 4HF
C2H3Br3 + O2 =8CO + 6H2O + Br24C2H3Br3 + 7O2 = 8CO + 6H2O + 6Br2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H6+H2=C6H12C6H6 + 3H2 = C6H12
C2H4(g) + Cl2(g)= C2H4Cl2(g)C2H4(g) + Cl2(g) = C2H4Cl2(g)
C2H6(g) + Cl2(g)=C2H5Cl(g) + HCl(g) C2H6(g) + Cl2(g) = C2H5Cl(g) + HCl(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C5H15O2 + O2 =H2O + CO24C5H15O2 + 31O2 = 30H2O + 20CO2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaS+HCl = CaCl2+H2SCaS + 2HCl = CaCl2 + H2S
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CuSO4+Na4(OH)3=Cu(OH)3+Na4SO4CuSO4 + Na4(OH)3 = Cu(OH)3 + Na4SO4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3COOH + O2 = CO2 +H2OCH3COOH + 2O2 = 2CO2 + 2H2O
CH3COCH3 + O2 = CO2 + H2OCH3COCH3 + 4O2 = 3CO2 + 3H2O
C3H7OH+O2 = CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
CCl4(g)+O2(g) = COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CCl4 + O2= COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
C6H5COOH+O2=CO2+H2O2C6H5COOH + 15O2 = 14CO2 + 6H2O
C6H12O6 = CO2 + H2O + 1 C4H10O211C6H12O6 = 18CO2 + 6H2O + 12C4H10O2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+HNO3 = Cu(NO3)2+H2O+NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu(s)+HNO3(aq)=Cu(NO3)2(aq)+H2O(l)+NO2(g)Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2H2O(l) + 2NO2(g)
Cl2(g)+C2H6(g)=C2HCl5(g)+HCl(g)5Cl2(g) + C2H6(g) = C2HCl5(g) + 5HCl(g)
Ca(OH)2 +H3PO4 = Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CaCO3+C2H4O2=CO2+Ca(OH)+H2O-8CaCO3 - C2H4O2 = -10CO2 - 8Ca(OH) + 2H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CCl4+Fe+H2O=CHCl3+Fe3O4+FeCl28CCl4 + 7Fe + 4H2O = 8CHCl3 + Fe3O4 + 4FeCl2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaF2 + Li2SO4 = CaSO4 + LiFCaF2 + Li2SO4 = CaSO4 + 2LiF
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2=CO2+H205C2H4 + 10O2 = 10CO2 + H20
C+H2=CH4C + 2H2 = CH4
CO2+S8=CS2+SO28CO2 + 3S8 = 8CS2 + 8SO2
CH3OH(g)+O2(g)=CO2(g)+H2O2CH3OH(g) + 3O2(g) = 2CO2(g) + 4H2O
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C+H2=CH4C + 2H2 = CH4
C3H6 + KMnO4 +H2SO4 = C3H8O2 + MnSO4 + K2SO4 + H2O-5C3H6 - 2KMnO4 - 3H2SO4 = -5C3H8O2 - 2MnSO4 - K2SO4 + 2H2O
CCl4+Fe+H2O=CHCl3+Fe3O4+FeCl28CCl4 + 7Fe + 4H2O = 8CHCl3 + Fe3O4 + 4FeCl2
CCl4+Fe+H2O=CHCl3+Fe3O4+FeCl28CCl4 + 7Fe + 4H2O = 8CHCl3 + Fe3O4 + 4FeCl2
Cr2O3+Na2CO3+KNO3=Na2CrO4+CO2+KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
Cu + HNO3 = Cu(NO3)2 + H2O + NO2Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
Cl2+LiI=LiCl+I2Cl2 + 2LiI = 2LiCl + I2
Cu+AgNo3=Cu(No3)2+AgCu + 2AgNo3 = Cu(No3)2 + 2Ag
C4H10O+ O2= CO2+ H2OC4H10O + 6O2 = 4CO2 + 5H2O
Cu + F2 = CuF2Cu + F2 = 2CuF
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18+O2 = CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3SH + CO = CH3CO(SCH3) + H2S2CH3SH + CO = CH3CO(SCH3) + H2S
Cu + F2 = CuF2Cu + F2 = 2CuF
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
Ca + CO3 = CaO + CO2Ca + CO3 = CaO + CO2
Cu + H2SO4 = CuSO4 + H2O + SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
C2H4+O2=CO2+H205C2H4 + 10O2 = 10CO2 + H20
C3H8O+O2=CO+H205C3H8O + 5O2 = 15CO + 2H20
CaCl2+AgNO3=AgCl+Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
CH4+Br2=CH3Br+HBrCH4 + Br2 = CH3Br + HBr
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CuCO3 + 2HNO3 = Cu(NO3)2 + H2O + CO2CuCO3 + 2HNO3 = Cu(NO3)2 + H2O + CO2
CoSO4 + KI + KIO3 + H2O = Co(OH)2 + K2SO4 + I23CoSO4 + 5KI + KIO3 + 3H2O = 3Co(OH)2 + 3K2SO4 + 3I2
CaO + HNO3 = Ca(NO3)2 + H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
C5H12+O2=CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO2 + H2O = C7H16 + O27CO2 + 8H2O = C7H16 + 11O2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2 + 2HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu(NO3)2 + Na2CO3 = CuCO3 + NaNO3Cu(NO3)2 + Na2CO3 = CuCO3 + 2NaNO3
CaSo4 + Mg(Oh)2 =Ca(Oh)2+MgSo4CaSo4 + Mg(Oh)2 = Ca(Oh)2 + MgSo4
CaSo4 + Mg(Oh)2 =Ca(Oh)2+MgSo4CaSo4 + Mg(Oh)2 = Ca(Oh)2 + MgSo4
Cl2 + H3AsO4 = As4 + HClO2 + H2O10Cl2 + 12H3AsO4 = 3As4 + 20HClO2 + 8H2O
C8H18 + O2 = 8CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6O (l) + O2 = CO2 (g) + H2O (g)C2H6O(l) + 3O2 = 2CO2(g) + 3H2O(g)
Cr2S3+HCl=CrCl3+H2SCr2S3 + 6HCl = 2CrCl3 + 3H2S
C4H10(g)+O2=CO2(g)+H2O(g)2C4H10(g) + 13O2 = 8CO2(g) + 10H2O(g)
Cd + AgNO3 = CdNO3 + AgCd + AgNO3 = CdNO3 + Ag
Cu(OH)2 + HNO3 = CuNO3 + H(OH)2Cu(OH)2 + HNO3 = CuNO3 + H(OH)2
Cd + AgNO3 = CdNO3 + AgCd + AgNO3 = CdNO3 + Ag
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCO3 + H3PO4 = Ca3(PO4)2 + CO2 + H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CaSO4 + Mg(OH)2 = Ca(OH)2 + MgSO4CaSO4 + Mg(OH)2 = Ca(OH)2 + MgSO4
Cu(NO3)2 +NaOH = Cu(OH)2 + NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
Ca5(PO4)3F + SiO2 + C = CO + SiF4 + P4 + 3(CaO)2(SiO2)4Ca5(PO4)3F + 11SiO2 + 30C = 30CO + SiF4 + 3P4 + 10(CaO)2(SiO2)
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
Ca5(PO4)3F + SiO2 + C = CO + SiF4 + P4 + 3(CaO) 2(SiO2)4Ca5(PO4)3F + 11SiO2 + 30C = 30CO + SiF4 + 3P4 + 10(CaO)2(SiO2)
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu+AgNO3=Ag+CuNO3Cu + AgNO3 = Ag + CuNO3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuO=Cu2O+O24CuO = 2Cu2O + O2
CaO+Al=Al2O3+Ca3CaO + 2Al = Al2O3 + 3Ca
CaCl2+Al2(SO4)3=CaSO4+AlCl33CaCl2 + Al2(SO4)3 = 3CaSO4 + 2AlCl3
Ca+HCl = CaCl+HCa + HCl = CaCl + H
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
Ca+HBr=CaBr2+H2Ca + 2HBr = CaBr2 + H2
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
Cl2+KBr=Br+KClCl2 + 2KBr = 2Br + 2KCl
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CO+O2=CO22CO + O2 = 2CO2
Ca(NO3) 2 + Na2CO3 = CaCO3 + NaNO3Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3
Cr + Cl2 = CrCl32Cr + 3Cl2 = 2CrCl3
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CuSO4+KCl=CuCl+KSO4CuSO4 + KCl = CuCl + KSO4
Ca+HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
Cl2(aq) + Na2S(aq) = S(s) + 2NaCl(aq)Cl2(aq) + Na2S(aq) = S(s) + 2NaCl(aq)
Cr + O2 = Cr2O34Cr + 3O2 = 2Cr2O3
Ca3(PO4)2 + H2SO4 = Ca(H2PO4)2 + CaSO4Ca3(PO4)2 + 2H2SO4 = Ca(H2PO4)2 + 2CaSO4
Cl2 + Na2S = S + 2NaClCl2 + Na2S = S + 2NaCl
Cu + H2SO4 = CuSO4 + H2O + SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
C2H2+O2 = CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H7OH + Na2Cr2O7 +H2SO4 = Cr2(SO4)3 + Na2SO4 + H20 + HCH5O214C3H7OH + 10Na2Cr2O7 + 40H2SO4 = 10Cr2(SO4)3 + 10Na2SO4 - 3H20 + 42HCH5O2
C2H8+O2 = CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
C2H8+O2 = CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
CuS+HNO3=CuNO3+S+NO+H2O3CuS + 4HNO3 = 3CuNO3 + 3S + NO + 2H2O
C12H22O11 = C + H2OC12H22O11 = 12C + 11H2O
C3H7OH + Na2Cr2O7 +H2SO4 = Cr2(SO4)3 + Na2SO4 + H20 + HC2H5O2140C3H7OH + 40Na2Cr2O7 + 160H2SO4 = 40Cr2(SO4)3 + 40Na2SO4 + 9H20 + 210HC2H5O2
C2H9O+O2=CO2+H2O4C2H9O + 15O2 = 8CO2 + 18H2O
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
Ca(OH)2(aq) + H2SO4(aq) = CaSO4 + H2OCa(OH)2(aq) + H2SO4(aq) = CaSO4 + 2H2O
C60H122 + O2 = CO2 + H2O2C60H122 + 181O2 = 120CO2 + 122H2O
C2H9O+O2=CO2+H2O4C2H9O + 15O2 = 8CO2 + 18H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4 + O2 = COC4 + 2O2 = 4CO
C + O = COC + O = CO
CH4+O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2 = COO2+H2O2CH4 + 5O2 = 2COO2 + 4H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4 + Br2 = CH3Br + HBrCH4 + Br2 = CH3Br + HBr
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
Ca+H2SO3 =CaSO3 +H2Ca + H2SO3 = CaSO3 + H2
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
C6H12O6 + O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
Ca+H2SO3 =CaSO3 +H2Ca + H2SO3 = CaSO3 + H2
C6H12O2 +O2 = CO2 + H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CI2+KI = KCI+I2CI2 + KI = KCI + I2
CI2+KI = KCI+I2CI2 + KI = KCI + I2
C6H12O6 +O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C+H2O = CO+H2C + H2O = CO + H2
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CoO + O2 = Co2O34CoO + O2 = 2Co2O3
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C2H5OH + O2= CO2 +H2010C2H5OH + 15O2 = 20CO2 + 3H20
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
C3H7OH+ O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CH4+O2=CO3+2H2010CH4 + 15O2 = 10CO3 + 2H20
CO2 + H2O = C7H8 + O27CO2 + 4H2O = C7H8 + 9O2
CO2 = CO + O22CO2 = 2CO + O2
C4H10+ O2= CO2 +H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6 + O2= CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H5OH + O2 = CO2 +H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H12O6 + O2= CO2+H205C6H12O6 + 15O2 = 30CO2 + 3H20
Cr + SnCl4 =CrCl3 + Sn4Cr + 3SnCl4 = 4CrCl3 + 3Sn
CaSiO3 +HF=CaF2 + SiF4 +H2OCaSiO3 + 6HF = CaF2 + SiF4 + 3H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Cr+S8=Cr2S316Cr + 3S8 = 8Cr2S3
Cu+S8=Cu2S16Cu + S8 = 8Cu2S
C8H18+O2=CO2=H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H10O3 + C15H12O = C21H19O3 + H2O5C6H10O3 - 2C15H12O = 0C21H19O3 + 13H2O
CH3CH2CH2CH3+O2=CO2+H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
CaO+C=CaC2+COCaO + 3C = CaC2 + CO
C2H5OH+O2=CO2+H2010C2H5OH + 15O2 = 20CO2 + 3H20
C+O2=CO2C + O2 = CO2
C6H10O3 + C15H12O = C21H19O3 + H2O5C6H10O3 - 2C15H12O = 0C21H19O3 + 13H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H5OH+O2=CO2+H2010C2H5OH + 15O2 = 20CO2 + 3H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3COOH + K2CO3 = CH3COOK + H2CO32CH3COOH + K2CO3 = 2CH3COOK + H2CO3
C3H8 +O2= CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
C2H6 + 7O2 = 6H2+4CO2C2H6 + 2O2 = 3H2 + 2CO2
Ca3(PO4)2 +SiO2 + C =CaSiO3 +P4 +CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
C2H6+7O2=6H20+4CO210C2H6 + 20O2 = 3H20 + 20CO2
C2H6+7O2=6H20+4CO210C2H6 + 20O2 = 3H20 + 20CO2
C2H6+7O2=6H20+4CO210C2H6 + 20O2 = 3H20 + 20CO2
Ca(OH)2+ H3PO4=H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C+S8=CS24C + S8 = 4CS2
Cr(NO3)3 = Cr + NO3Cr(NO3)3 = Cr + 3NO3
Ca5(PO4)3F + SiO2 + C = Ca3O3Si2O4 + CO + P4 + SiF412Ca5(PO4)3F + 43SiO2 + 90C = 20Ca3O3Si2O4 + 90CO + 9P4 + 3SiF4
Ca5(PO4)3 + C = 3Ca + CO + P44Ca5(PO4)3 + 48C = 20Ca + 48CO + 3P4
C3H6(OH)2+O2=CO2+H2OC3H6(OH)2 + 4O2 = 3CO2 + 4H2O
CuCl2 + AgNO3 = Cu(NO3)2 + AgClCuCl2 + 2AgNO3 = Cu(NO3)2 + 2AgCl
C12H22O11 + H2O2 = CO2 + H2OC12H22O11 + 24H2O2 = 12CO2 + 35H2O
C6H12O8 + O2 = CO2 + H2OC6H12O8 + 5O2 = 6CO2 + 6H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu + S8 = Cu2S16Cu + S8 = 8Cu2S
C6H12O6= C + H2OC6H12O6 = 6C + 6H2O
CrCl3+(NH4)2CO3=Cr2(CO3)3+NH4Cl2CrCl3 + 3(NH4)2CO3 = Cr2(CO3)3 + 6NH4Cl
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H4+O2= CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(HCO3)2 + Na2CO3= CaCO3 +NaHCO3Ca(HCO3)2 + Na2CO3 = CaCO3 + 2NaHCO3
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C16H34 +O2 = CO2 + H2O2C16H34 + 49O2 = 32CO2 + 34H2O
Ca(NO3)2 = Ca(NO2)2 + O2Ca(NO3)2 = Ca(NO2)2 + O2
CoS2 + O2 = Co2O3 + SO24CoS2 + 11O2 = 2Co2O3 + 8SO2
CO(g)+H2(g)=C8H18(g)+H2O8CO(g) + 17H2(g) = C8H18(g) + 8H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CO2 + H2O = 4C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C2H14 + O2= H2O +CO22C2H14 + 11O2 = 14H2O + 4CO2
Ca + CuCl = Cu + CaCl2Ca + 2CuCl = 2Cu + CaCl2
Ca + AlCl3 =CaCl2 + Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
CH3COOH + Na2CO3 = CH3COONa + CO2 + H2O2CH3COOH + Na2CO3 = 2CH3COONa + CO2 + H2O
Ca(NO3)2 = Ca(NO2)2 + O2Ca(NO3)2 = Ca(NO2)2 + O2
CO+O2=CO22CO + O2 = 2CO2
Ca3(PO4)2 + SiO2 + C = P4 + CO + CaSiO32Ca3(PO4)2 + 6SiO2 + 10C = P4 + 10CO + 6CaSiO3
Ca(OH)2 + CO2 = Ca(OH)2CO2Ca(OH)2 + CO2 = Ca(OH)2CO2
Ca3(PO4)2 + SiO2 + C = P4 + CO + CaSiO32Ca3(PO4)2 + 6SiO2 + 10C = P4 + 10CO + 6CaSiO3
C3H6+O2=3CO+3H2OC3H6 + 3O2 = 3CO + 3H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Co(s)+HgCl2(aq)=CoCl3(aq)+Hg(l)2Co(s) + 3HgCl2(aq) = 2CoCl3(aq) + 3Hg(l)
Cl2O+H2O=ClH+OCl2O + H2O = 2ClH + 2O
C3H8 + O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 =H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
C3H8 + O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H7OH (l) + O2 (g) =CO2 (g) +H2O (g)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18 + NO = CO2 + H2O + NC8H18 + 25NO = 8CO2 + 9H2O + 25N
CaO + K3PO4 = K2O + Ca3(PO4)23CaO + 2K3PO4 = 3K2O + Ca3(PO4)2
CaO +K3PO4 =K2O + Ca3(PO4)23CaO + 2K3PO4 = 3K2O + Ca3(PO4)2
C4H10 + O2 = CO2 + HC4H10 + 4O2 = 4CO2 + 10H
C6H6+O2=CO2+3H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H8O7 + NaHCO3 = H2O + CO2 + Na3C6H5O7C6H8O7 + 3NaHCO3 = 3H2O + 3CO2 + Na3C6H5O7
Ca3N2 + H2O= Ca(OH)2 + NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
Cu(NO3)2+ NH4OH= Cu(OH)2 + (NH4)(NO3)Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2(NH4)(NO3)
CaCl2 + H2CO3 = CaCO3 + HClCaCl2 + H2CO3 = CaCO3 + 2HCl
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(s)+Pb(NO3)2(aq)=Pb(s)+Ca(NO3)2(aq)Ca(s) + Pb(NO3)2(aq) = Pb(s) + Ca(NO3)2(aq)
Cl- + BaCl2 = Ba + Cl0Cl- + BaCl2 = Ba + 2Cl
Cl2+AlI3=AlCl3+I23Cl2 + 2AlI3 = 2AlCl3 + 3I2
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
Ca(OH)2(aq)+HNO3(aq)=Ca(NO3)2(aq)+H2O(l)Ca(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O(l)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4 + H2 =C2H6C2H4 + H2 = C2H6
CH4 + O2 = H2O + CO2CH4 + 2O2 = 2H2O + CO2
CuCl2 + 2Al = 2Al2Cl3 + Cu3CuCl2 + 4Al = 2Al2Cl3 + 3Cu
CH4 + 6O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CH4 + 6O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
CO + H2O = CO2 + H2CO + H2O = CO2 + H2
CO + H2O = CO2 + H2CO + H2O = CO2 + H2
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CoSO4 = Co + SO4CoSO4 = Co + SO4
Ca(OH)2 +H3PO4 =Ca3(PO4)2 +H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CH3CCOOH(aq) + NaOH(aq) = CH3COONa(aq) + H2O(l)2CH3CCOOH(aq) + 3NaOH(aq) = 3CH3COONa(aq) + H2O(l)
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CuSO4 + NaHSO3 + H2O = Cu + H2SO4 + NaHSO4CuSO4 + NaHSO3 + H2O = Cu + H2SO4 + NaHSO4
CuSO4 + NaHSO3 + H2O = Cu + H2SO4 + NaHSOS-5CuSO4 + NaHSO3 - 6H2O = -5Cu - 6H2SO4 + NaHSOS
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C3H6+O2=3CO+3H2OC3H6 + 3O2 = 3CO + 3H2O
Cr(s)+HNO3(aq) = Cr(NO3) 3(aq)+NO(g)+H 2 O(l)Cr(s) + 4HNO3(aq) = Cr(NO3)3(aq) + NO(g) + 2H2O(l)
CuSO4 + AgNO3 = Ag2SO4 + Cu(NO3) 2CuSO4 + 2AgNO3 = Ag2SO4 + Cu(NO3)2
C7H6O2 +15O2=CO2+6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Cr(s)+HNO3(aq) = Cr(NO3) 3(aq)+NO(g)+H2O(l)Cr(s) + 4HNO3(aq) = Cr(NO3)3(aq) + NO(g) + 2H2O(l)
CaCO3 + H2SO4 = CaSO4 + H2O + CO2CaCO3 + H2SO4 = CaSO4 + H2O + CO2
CrI3 + KOH +Cl2 =K2CrO4 +KIO4 +KCl +H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C2H5SH(g) + O2(g) = CO2(g) + H2O (g) + SO2(g)2C2H5SH(g) + 9O2(g) = 4CO2(g) + 6H2O(g) + 2SO2(g)
C+Al2O3=AlC3+CO9C + Al2O3 = 2AlC3 + 3CO
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuSO4(aq) + NH4OH(aq) = Cu(OH)2(s) + (NH4)2SO4(aq) CuSO4(aq) + 2NH4OH(aq) = Cu(OH)2(s) + (NH4)2SO4(aq)
C8H8(l) + 12O2(g) =8CO2(g) + 4H2O(g)C8H8(l) + 10O2(g) = 8CO2(g) + 4H2O(g)
CuSO4(aq) + NH4OH(aq) = Cu(OH)2(s) + (NH4)2SO4(aq) CuSO4(aq) + 2NH4OH(aq) = Cu(OH)2(s) + (NH4)2SO4(aq)
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CoCl2(aq) + Na2SO3(aq) = CoSO3(s) + NaCl(aq)CoCl2(aq) + Na2SO3(aq) = CoSO3(s) + 2NaCl(aq)
CH3Cl + C2H5Cl + 2Na = 2NaCl + C3H8CH3Cl + C2H5Cl + 2Na = 2NaCl + C3H8
CS+O2=CO2+SCS + O2 = CO2 + S
CS+O2=CO2+SCS + O2 = CO2 + S
C12H22O11+H2O=CH3C02OH+CO27C12H22O11 - 29H2O = 24CH3C02OH + 12CO2
CaCl2+Na3PO4=Ca3(PO4)2+6NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
CS+O2=CO2+SCS + O2 = CO2 + S
CaCO3 + SO2 + O2 = CaSO4 + CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Ca(OH)2+HCl=H2O+CaCl2Ca(OH)2 + 2HCl = 2H2O + CaCl2
CaOH + CO2 = CaCO3 + H2020CaOH + 20CO2 = 20CaCO3 + H20
ClO2 + HPO2 + H2O = HCl + H3PO4 2ClO2 + 5HPO2 + 6H2O = 2HCl + 5H3PO4
Co3O4=CoO+O22Co3O4 = 6CoO + O2
CrCl2+LiNO3=LiCl+Cr(NO3)2CrCl2 + 2LiNO3 = 2LiCl + Cr(NO3)2
CrCl2+LiNO3=LiCl+Cr(NO3)2CrCl2 + 2LiNO3 = 2LiCl + Cr(NO3)2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuS + Hg = HgS + CuCuS + Hg = HgS + Cu
C4H10S + O2 = CO2+H2O+SO22C4H10S + 15O2 = 8CO2 + 10H2O + 2SO2
C5H11NH2 + O2 = CO2+H2O+NO24C5H11NH2 + 37O2 = 20CO2 + 26H2O + 4NO2
CaCl2 + Al(NO3)3 = Ca(NO3)3 + AlCl2CaCl2 + Al(NO3)3 = Ca(NO3)3 + AlCl2
Cu3(PO4)2 + 4NH3 = Cu(NH3)4 + 2PO4Cu3(PO4)2 + 12NH3 = 3Cu(NH3)4 + 2PO4
C3H8O + C4H6O3 = C7H14O2 + H2O10C3H8O + 3C4H6O3 = 6C7H14O2 + 7H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu(s) + H2SO4(aq) = CuSO4(aq) + SO2(g) + H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C2H5OH(l) + O2(g) = CO2(g) + H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Ca+O2=CaO2Ca + O2 = 2CaO
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2CH2CH3+O2=CO2+H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
CuO + H2 = Cu + H2O CuO + H2 = Cu + H2O
C6H5Cl+SiCl4+Na=(C6H5)4Si+NaCl4C6H5Cl + SiCl4 + 8Na = (C6H5)4Si + 8NaCl
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH3CH2OH+O2=H2O+CH3OOHCH3CH2OH + O2 = -1H2O + 2CH3OOH
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca+O2=CaO2Ca + O2 = 2CaO
CaBr2+H2SO4=HBr+CaSO4CaBr2 + H2SO4 = 2HBr + CaSO4
CaCO3+LiCl=CaCl2+Li2CO3CaCO3 + 2LiCl = CaCl2 + Li2CO3
Cu+H2SO4=CuSO4+H2Cu + H2SO4 = CuSO4 + H2
CH3SH+CO=CH3CO(SCH3) +H2S2CH3SH + CO = CH3CO(SCH3) + H2S
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CH3SH+CO=CH3CO(SCH3) +H2S2CH3SH + CO = CH3CO(SCH3) + H2S
CuHCO3=Cu2CO3+H2O+CO22CuHCO3 = Cu2CO3 + H2O + CO2
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CACO3=CAO+CO2CACO3 = CAO + CO2
CACO3=CAO+CO2CACO3 = CAO + CO2
C4 H10+O2= CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCl2 (aq) + Na2SO4 (aq) = CaSO4 (s) + NaCl (aq)CaCl2(aq) + Na2SO4(aq) = CaSO4(s) + 2NaCl(aq)
Cu(NO3)2+NaOH=Cu(OH)2+NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C5H10O3N + O2 = CO2 + H2O +NH34C5H10O3N + 21O2 = 20CO2 + 14H2O + 4NH3
CrO2-4 + HSnO2- + H2O=CrO2- + HSnO3- + OH-2CrO2-4 - 3HSnO2- + 3H2O = 2CrO2- - 3HSnO3- + 6OH-
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CuCO3+O2 = Cu2CO3+ CO24CuCO3 - O2 = 2Cu2CO3 + 2CO2
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CuO + HCl = CuCl2 + H2O CuO + 2HCl = CuCl2 + H2O
Ca(NO3)2+Na3PO4=Ca3(PO4)2+NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
Ca3(PO4)2+H2SO4=H3PO4+CaSO4Ca3(PO4)2 + 3H2SO4 = 2H3PO4 + 3CaSO4
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCl2 + Na3PO4 = Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C8H18O+O2=CO2+H2OC8H18O + 12O2 = 8CO2 + 9H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
C27H48O20+ H2O = C27H48O2=HO2013C27H48O20 + 6H2O = 13C27H48O2 + 12HO20
CO+O2=CO22CO + O2 = 2CO2
CO+O2=CO22CO + O2 = 2CO2
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
CO + O2 = CO22CO + O2 = 2CO2
CH4+O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H12O6=CH3CH2OH+CO2C6H12O6 = 2CH3CH2OH + 2CO2
CF4+Br2=CBr4+F2CF4 + 2Br2 = CBr4 + 2F2
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
CaO+MnI4=MnO2+CaI22CaO + MnI4 = MnO2 + 2CaI2
C+H2=C3H83C + 4H2 = C3H8
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
CO2 + H2O = C2 H5 OH + O22CO2 + 3H2O = C2H5OH + 3O2
C2H6 + O2 = CH3COOH + H2O2C2H6 + 3O2 = 2CH3COOH + 2H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CuO + CuS=Cu + SO22CuO + CuS = 3Cu + SO2
CuO + NH3 = N2 + Cu + H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
CH4 + S = CS + H2SCH4 + 3S = CS + 2H2S
CaCO3 + SO2 + O2 = CaSO4 + CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CH4 + O2 = CH3OH2CH4 + O2 = 2CH3OH
CO + O2 =CO22CO + O2 = 2CO2
CO + O2 =CO22CO + O2 = 2CO2
CaCO3 =CaO +CO2CaCO3 = CaO + CO2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C8H8O3 + NaBH4 + NaOH + H2O = C8H10O3 + Na3BO34C8H8O3 + NaBH4 + 2NaOH + H2O = 4C8H10O3 + Na3BO3
CaCO3 + O2 = CO2 + CaOCaCO3 + 0O2 = CO2 + CaO
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CuCO3 + H2SO4 = H2O + CO2 + CuSO4CuCO3 + H2SO4 = H2O + CO2 + CuSO4
Cu + AlCl3 = CuCl + Al3Cu + AlCl3 = 3CuCl + Al
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4 +O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
C16H32O2 + O2 = CO2 + H2OC16H32O2 + 23O2 = 16CO2 + 16H2O
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
CH4 +O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C5H12O+O2=CO2+H2O2C5H12O + 15O2 = 10CO2 + 12H2O
C(s)+4HNO3(aq)=CO2(g)+4NO2(g)+2H2O(l)C(s) + 4HNO3(aq) = CO2(g) + 4NO2(g) + 2H2O(l)
Ca+H3PO4=Ca3(PO4)2+H23Ca + 2H3PO4 = Ca3(PO4)2 + 3H2
CaCl+Na(OH2)=Ca(OH2)+NaClCaCl + Na(OH2) = Ca(OH2) + NaCl
CH4 + O2=CO2 + H205CH4 + 5O2 = 5CO2 + H20
CaCO 3 = CaO + CO 2CaCO3 = CaO + CO2
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH4 + Cl2 = CCl4 + HCl CH4 + 4Cl2 = CCl4 + 4HCl
C(s) + Fe2O3(l) = Fe(l) + CO(g)3C(s) + Fe2O3(l) = 2Fe(l) + 3CO(g)
C12H22O11+O2 = CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Cl2O7(g) + Ca(OH)2(aq) = Ca(ClO4)2(aq) + H2O(l)Cl2O7(g) + Ca(OH)2(aq) = Ca(ClO4)2(aq) + H2O(l)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH4 + Cl2 = CCl4 + HCl CH4 + 4Cl2 = CCl4 + 4HCl
C(s) + Fe2O3(l) = Fe(l) + CO(g)3C(s) + Fe2O3(l) = 2Fe(l) + 3CO(g)
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
CH3(CH2)2CH3(g) + O2(g) = CO2(g) + H2O(g)2CH3(CH2)2CH3(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CaSiO3 + HF = CaF2 + SiF4 + H2OCaSiO3 + 6HF = CaF2 + SiF4 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cr + H2SO4 = Cr2(SO4)3 + H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.