Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CuBr2 + Li2CO3 = CuCO3 + LiBrCuBr2 + Li2CO3 = CuCO3 + 2LiBr
C2H5OH(l) + O2(g) = CO2(g) + H2O(g)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
C2H5OH(l) + O2(g) = CO2(g) + H2O(g)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
Co2 + SCN = Co(SCN)4Co2 + 8SCN = 2Co(SCN)4
Co(OH)2 + H2SO4 = Co2 + SO4 + H2O2Co(OH)2 + 2H2SO4 = Co2 + 2SO4 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca+HNO3=Ca(NO3)2+N2O+H2O4Ca + 10HNO3 = 4Ca(NO3)2 + N2O + 5H2O
ClNO2+NO=NO2+ClNOClNO2 + NO = NO2 + ClNO
C 3 H 6 + O 2 = CO 2 + H 2 O2C3H6 + 9O2 = 6CO2 + 6H2O
CH3(CH2)5CH3 + O2= CO2 + H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
C + S = CSC + S = CS
C+S=CSC + S = CS
C+S=CSC + S = CS
Ca + OH =Ca(OH)2Ca + 2OH = Ca(OH)2
CuSO4 + NaOH + NaCO3 = Cu(CO3)2 + NaSO4 + Cu(OH)20CuSO4 + 2NaOH - 2NaCO3 = -1Cu(CO3)2 + 0NaSO4 + Cu(OH)2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H5 OH + O2 =CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaCl2 + K3PO4 = Ca3(PO4)2 + KCl3CaCl2 + 2K3PO4 = Ca3(PO4)2 + 6KCl
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C6H12O6+O2 =CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Cr +LiOH +H2O = LiCr(OH)4 + H22Cr + 2LiOH + 6H2O = 2LiCr(OH)4 + 3H2
C6H12O6 + O2 = CO + H2OC6H12O6 + 3O2 = 6CO + 6H2O
C6H12O6 + O2 = CO + H2OC6H12O6 + 3O2 = 6CO + 6H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr + NH4OH = CrOH + NH4Cr + NH4OH = CrOH + NH4
Cr + NH4Cl = CrCl3 + NH4Cr + 3NH4Cl = CrCl3 + 3NH4
C5H12+5O2=5CO2+6H2C5H12 + 5O2 = 5CO2 + 6H2
C14H30 + H2 = C7H14C14H30 - H2 = 2C7H14
C14H30 + H2 = C7H114C14H30 + 99H2 = 2C7H114
C14H30 + H2 = C8H184C14H30 + 3H2 = 7C8H18
C14H30 + H2 = C9H209C14H30 + 5H2 = 14C9H20
C4H8 + 6O2 = 4CO2 + 3H2OC4H8 + 6O2 = 4CO2 + 4H2O
C22H46 + H2 = C7H147C22H46 - 7H2 = 22C7H14
C22H46 + H2 = C8H184C22H46 + 7H2 = 11C8H18
C22H46 + H2 = C9H209C22H46 + 13H2 = 22C9H20
C22H46 + H2 = C4H102C22H46 + 9H2 = 11C4H10
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CaBr2(aq) + 2AuClO4(aq) = 2AuBr(s) + Ca(ClO4)2(aq)CaBr2(aq) + 2AuClO4(aq) = 2AuBr(s) + Ca(ClO4)2(aq)
C+O2=CO2C + O2 = CO2
C6H6O + O2 = CO2 +H2OC6H6O + 7O2 = 6CO2 + 3H2O
C8H16O2 + O2 = CO2 +H2OC8H16O2 + 11O2 = 8CO2 + 8H2O
C5H10 + O2 = CO2 +H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C6H6 + O2 = CO2 +H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H5OCH3(g) + O2(g) = CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
CaF2+H2SO4=CaSO4+HFCaF2 + H2SO4 = CaSO4 + 2HF
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CaSO4 + Al(NO3)3 = Ca(NO3)2 +Al2 (SO4)33CaSO4 + 2Al(NO3)3 = 3Ca(NO3)2 + Al2(SO4)3
C3H8+O2=3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CaCl2 + Na3PO4 = Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
Cu + HCl = CuCl2 + H2Cu + 2HCl = CuCl2 + H2
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca(s)+HNO3(aq)=Ca(NO3)2(aq)+H2(g)Ca(s) + 2HNO3(aq) = Ca(NO3)2(aq) + H2(g)
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C5H8O + H2 = C5H10 + H2OC5H8O + 2H2 = C5H10 + H2O
C8H16O2 + H2 = C14H30 + H2O7C8H16O2 + 18H2 = 4C14H30 + 14H2O
C6H6O + H2 = C6H6 + H2OC6H6O + H2 = C6H6 + H2O
CH3COOH + H2 = C2H6 + H2OCH3COOH + 3H2 = C2H6 + 2H2O
C12H24O2 + H2 = C22H46 + H2O11C12H24O2 + 28H2 = 6C22H46 + 22H2O
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
CO2(g) + H2O(l) =C6H12O6 (aq) + O2(g)6CO2(g) + 6H2O(l) = C6H12O6(aq) + 6O2(g)
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H5CH3(l)+O2(g)= C6H5CH3O2C6H5CH3(l) + O2(g) = C6H5CH3O2
Ca3P2+H2O= Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CuBr2(aq)+LiOH(aq)=CuOH +LiBr2CuBr2(aq) + LiOH(aq) = CuOH + LiBr2
CuBr2 +LiOH=CuOH +LiBr2CuBr2 + LiOH = CuOH + LiBr2
Cl2O + NH3 = N2 + NH4Cl + H2O3Cl2O + 10NH3 = 2N2 + 6NH4Cl + 3H2O
CH4 + NO = CO2 + N2 + H2OCH4 + 4NO = CO2 + 2N2 + 2H2O
Cr2S3 + HNO3 = H2CrO4 + S + H2O + NOCr2S3 + 4HNO3 = 2H2CrO4 + 3S + 0H2O + 4NO
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
C5H12 + 5O2 = 5CO2 + 6H2C5H12 + 5O2 = 5CO2 + 6H2
C4H8 + 6O2 = 4CO2 + 3H2OC4H8 + 6O2 = 4CO2 + 4H2O
C4H8 + O02 = 4CO2 + 3H2OC4H8 + 6O02 = 4CO2 + 4H2O
CaCl2(aq)+AgNO3(aq)=Ca(NO3)2(aq)+AgCl(s)CaCl2(aq) + 2AgNO3(aq) = Ca(NO3)2(aq) + 2AgCl(s)
C8H8O2+O2=CO2+H2OC8H8O2 + 9O2 = 8CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(H2PO4)2(s) +NaHCO3(s) = CO2(g) + H2O(g) +CaHPO4+ Na2HPO4Ca(H2PO4)2(s) + 2NaHCO3(s) = 2CO2(g) + 2H2O(g) + CaHPO4 + Na2HPO4
Ca(C2H3O2)2 + K2SO4 = 2KC2H3O2 + CaSO4Ca(C2H3O2)2 + K2SO4 = 2KC2H3O2 + CaSO4
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C3H8+O2 =CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2 =CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
CaOCl2 + H2SO4 = CaCl2 + CaSO4 + HClO2CaOCl2 + H2SO4 = CaCl2 + CaSO4 + 2HClO
Cu + H2O + CO2 + O2 = CuCO3Cu(OH)22Cu + H2O + CO2 + O2 = CuCO3Cu(OH)2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
CH3COOH + Na2CO3 = CH3COONa + H2O + CO22CH3COOH + Na2CO3 = 2CH3COONa + H2O + CO2
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C2H4 + 3O2 = 2CO2 + 2H2OC2H4 + 3O2 = 2CO2 + 2H2O
CS2+NH3=H2S+NH4SCNCS2 + 2NH3 = H2S + NH4SCN
CUFES2+O2=SO2+CUO+FEOCUFES2 + 3O2 = 2SO2 + CUO + FEO
CUFES2+O2=SO2+CUO+FEOCUFES2 + 3O2 = 2SO2 + CUO + FEO
C6H12O6(s)+O2=CO2(g)+H2O(l)C6H12O6(s) + 6O2 = 6CO2(g) + 6H2O(l)
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cr2S3+HNO3=H2CrO4+S+H2O+NOCr2S3 + 4HNO3 = 2H2CrO4 + 3S + 0H2O + 4NO
Ca+2 + C-4 = Ca2 + C-40Ca+2 + C-4 = 0Ca2 + C-4
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Ca3(PO4)2 + PbO2 = CaO + Pb3 (PO4)42Ca3(PO4)2 + 3PbO2 = 6CaO + Pb3(PO4)4
C2H5OCH3(g) + O2(g) = CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
C2H2O2+O2=CO2+H2010C2H2O2 + 10O2 = 20CO2 + H20
C2H6 + O2= CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2= CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C6H6O6 + O2 = CO2 + H2O2C6H6O6 + 9O2 = 12CO2 + 6H2O
C2H5OH + 3O2 = CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + 2O2 =2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + 3O2 = 2CO2 + 2H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu (NO3)2 + Ag2CO3 = CuCO3 + AgNO3Cu(NO3)2 + Ag2CO3 = CuCO3 + 2AgNO3
CO2 (g) + CaSiO3 (s) + H2O (l) = SiO2 (s) + Ca(HCO3)2 (aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Ca+Br2=CaBr2Ca + Br2 = CaBr2
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CH3CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C22H46+O2=CO2+H2O2C22H46 + 67O2 = 44CO2 + 46H2O
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
Ca + Al3+ = Ca2+ +Al3+0Ca + Al3+ = 0Ca2+ + Al3+
Ca5(PO4)3OH + H+ = Ca++ + H2PO4- + OH2Ca5(PO4)3OH + 7H+ = 5Ca++ + 3H2PO4- + OH2
Ca5(PO4)3OH + H+ = Ca++ + H2PO4- + OH-Ca5(PO4)3OH + 6H+ = 5Ca++ + 3H2PO4- + OH-
Ca5(PO4)3OH + H+ = Ca++ + H2PO4- + H2OCa5(PO4)3OH + 7H+ = 5Ca++ + 3H2PO4- + H2O
C4H10+O2 =CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cr2S3 + HNO3 = H2CrO4 + S + H2O + NOCr2S3 + 4HNO3 = 2H2CrO4 + 3S + 0H2O + 4NO
C3H8 + O2 = CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
Cr2S3 + HNO3= H2CrO4 + S + H2O + NOCr2S3 + 4HNO3 = 2H2CrO4 + 3S + 0H2O + 4NO
CaCl2+NaHSO4=Ca(HSO4)2+NaClCaCl2 + 2NaHSO4 = Ca(HSO4)2 + 2NaCl
CaCl2+NaHSO4=Ca(HSO4)2+NaClCaCl2 + 2NaHSO4 = Ca(HSO4)2 + 2NaCl
Cu(NO3)2+ZnCl2=CuCl2+Zn(NO3)2Cu(NO3)2 + ZnCl2 = CuCl2 + Zn(NO3)2
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C+HBr=CBr4+H2C + 4HBr = CBr4 + 2H2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C + O2 = CO2C + O2 = CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(PO4)2+BaF2=CaF2+Ba(PO4)2Ca(PO4)2 + BaF2 = CaF2 + Ba(PO4)2
Ca + 2H2O = Ca(OH)2 + HCa + 2H2O = Ca(OH)2 + 2H
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
Ca(OH)2 + CO2 = Ca(OH)(HCO3)Ca(OH)2 + CO2 = Ca(OH)(HCO3)
C4H10+O2 = CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cs2CrO4 + Rb2O = Cs2O + Rb2CrO4Cs2CrO4 + Rb2O = Cs2O + Rb2CrO4
CrBr2 + Li2C2O4 = CrC2O4 + LiBrCrBr2 + Li2C2O4 = CrC2O4 + 2LiBr
CsOH + H2C2O4 = Cs2C2O4 + H2O2CsOH + H2C2O4 = Cs2C2O4 + 2H2O
Ca(OH)2 + SO4+ 2H2O = CaSO4 + 3H2O0Ca(OH)2 + 0SO4 + H2O = 0CaSO4 + H2O
Ca(OH)2 + SO4+ 2H2O = CaSO4 + 3H2O0Ca(OH)2 + 0SO4 + H2O = 0CaSO4 + H2O
C2H6+ O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+ O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3SO3H + NaOH = H2O + NaCH3SO3CH3SO3H + NaOH = H2O + NaCH3SO3
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cu5FeS4 + S2=Cu5FeS6Cu5FeS4 + S2 = Cu5FeS6
CuFe2S3 + S2=CuFeS2+FeS22CuFe2S3 + S2 = 2CuFeS2 + 2FeS2
CuFeS2 + S2=Cu5FeS4+FeS25CuFeS2 + S2 = Cu5FeS4 + 4FeS2
C + HNO3 = CO2 + N02 + H2O5C + 4HNO3 = 5CO2 + 2N02 + 2H2O
C + HNO3 = CO2 + N02 + H2O5C + 4HNO3 = 5CO2 + 2N02 + 2H2O
CuO + Mg = MgO + CuCuO + Mg = MgO + Cu
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8 + O2 =CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H15COOH + H2 = C14H30 + H2O7C7H15COOH + 18H2 = 4C14H30 + 14H2O
C6H5OH + H2 = C6H6 + H2OC6H5OH + H2 = C6H6 + H2O
CH3COOH + H2 = C2H6 + H2OCH3COOH + 3H2 = C2H6 + 2H2O
C11H23COOH + H2 = C22H46 + H2O11C11H23COOH + 28H2 = 6C22H46 + 22H2O
C5H8O + H2 = C6H10 + H2O6C5H8O + 7H2 = 5C6H10 + 6H2O
C5H8O + H2 = C5H10 + H2OC5H8O + 2H2 = C5H10 + H2O
C5H8O + H2 = C4H10 + H2O4C5H8O + 13H2 = 5C4H10 + 4H2O
C6H5OH + H2 = C6H6 + H2OC6H5OH + H2 = C6H6 + H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CH3CH3 + O2 = CO2 + H2010CH3CH3 + 20O2 = 20CO2 + 3H20
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CaO+3C=CaC2+COCaO + 3C = CaC2 + CO
CH4O + O2 = CO2 + H2O2CH4O + 3O2 = 2CO2 + 4H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(HCO3)2+HCl=CaCl2+CO2+H2OCa(HCO3)2 + 2HCl = CaCl2 + 2CO2 + 2H2O
CO+O2=CO22CO + O2 = 2CO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu + HNO3= Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca CO3 + H3 PO4 = Ca3 (PO4)2 + CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
C2H4O2 +O2 = CO2 +H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
CH3CH2OH = CH4 + CO22CH3CH2OH = 3CH4 + CO2
C4 H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
CaCl2+H2=HCl+CaCaCl2 + H2 = 2HCl + Ca
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cr(OH)3+K(IO3)+K(OH)=KI+K2CrO4+H2O2Cr(OH)3 + K(IO3) + 4K(OH) = KI + 2K2CrO4 + 5H2O
Ca(s)+HNO3(aq)=Ca(NO3)2(aq)+H2(g)Ca(s) + 2HNO3(aq) = Ca(NO3)2(aq) + H2(g)
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C4H9OH(l)+O2(g)=CO2(g)+H2O(l)C4H9OH(l) + 6O2(g) = 4CO2(g) + 5H2O(l)
CH3CHO + O2 = HC2H3O22CH3CHO + O2 = 2HC2H3O2
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)5CH3+O2=CO2+H2OCH3(CH2)5CH3 + 11O2 = 7CO2 + 8H2O
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CO2+NH3=H2O+CON2H4CO2 + 2NH3 = H2O + CON2H4
CO2 +HO2 = C6H12O6 +O26CO2 + 12HO2 = C6H12O6 + 15O2
Ca+O2=CaO2Ca + O2 = 2CaO
CH3CHO + O2 = CO2 + H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
Ca(HCO3)2 + HBr = CaBr2 + H2O + CO2Ca(HCO3)2 + 2HBr = CaBr2 + 2H2O + 2CO2
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C2H6+O=CO2+H2OC2H6 + 7O = 2CO2 + 3H2O
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
Cr2S3 + HNO3 = H2CrO4 + S + H2O + NOCr2S3 + 4HNO3 = 2H2CrO4 + 3S + 0H2O + 4NO
Cr2S3 + HNO3 = H2CrO4 + S2 + H2O + NO2Cr2S3 + 8HNO3 = 4H2CrO4 + 3S2 + 0H2O + 8NO
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
Ca+Cr(NO3)3=Cr+Ca(NO3)23Ca + 2Cr(NO3)3 = 2Cr + 3Ca(NO3)2
C3H7OH(l) + O2(g) = CO2(g) + H2O(g)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
C3H8(g) + O2(g) = 3CO2(g) + 4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Ca(HCO3)2 + HBr = CaBr2 + H2O + CO2Ca(HCO3)2 + 2HBr = CaBr2 + 2H2O + 2CO2
Cs3AsO4 + K2SO3 = Cs2SO3 + K3AsO42Cs3AsO4 + 3K2SO3 = 3Cs2SO3 + 2K3AsO4
Cu+HNO3=Cu(NO3)2+H2O+NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
C2H6 + Cl2 = C2H4Cl2 + HClC2H6 + 2Cl2 = C2H4Cl2 + 2HCl
C2H6 (g) + O2 (g) = CO2 (g) + H2O (l) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
C4H10 (g) + O2 (g) = CO2 (g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
Ca+Br2=CaBr2Ca + Br2 = CaBr2
Ca3(PO4)2 + SiO2 + CO3 = CaSiO3 + P4 + CO-2Ca3(PO4)2 - 6SiO2 + 5CO3 = -6CaSiO3 - P4 + 5CO
CaCl2 + AgNO3 = Ca(NO3)2 + AgClCaCl2 + 2AgNO3 = Ca(NO3)2 + 2AgCl
C3H8+5O2=2CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu2S+HNO3=Cu(NO3)2+SO2+H2O+NO3Cu2S + 20HNO3 = 6Cu(NO3)2 + 3SO2 + 10H2O + 8NO
C3H8 + O2 = CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
C3H8O3 + HNO3 + K2Cr2O7 = Cr(NO3)3 + CO2 + H2O + KNO33C3H8O3 + 56HNO3 + 7K2Cr2O7 = 14Cr(NO3)3 + 9CO2 + 40H2O + 14KNO3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H4 + 2H2 = 2C2H6C2H4 + H2 = C2H6
C6H14O = C6H12 + H2OC6H14O = C6H12 + H2O
C6H14O + H3PO4 = C6H12 + H20 +PO-60C6H14O + 20H3PO4 = -60C6H12 - 3H20 + 20PO
CaCO3(s) + 2NaOH(aq)=Ca(OH)2+H2CO3+Na2OCaCO3(s) + 4NaOH(aq) = Ca(OH)2 + H2CO3 + 2Na2O
CaO(s) + CO2(g) =CaCO3(s)CaO(s) + CO2(g) = CaCO3(s)
Ca+HNO3=Ca(NO3)2+N2O+H2O4Ca + 10HNO3 = 4Ca(NO3)2 + N2O + 5H2O
Ca(ClO4)2(aq) + K2CO3(aq) = CaCO3(s) + KClO4(aq)Ca(ClO4)2(aq) + K2CO3(aq) = CaCO3(s) + 2KClO4(aq)
Cu(CH3COO)2 + NaOH = Cu(OH)2 + NaCH3COOCu(CH3COO)2 + 2NaOH = Cu(OH)2 + 2NaCH3COO
CaCO3(s) = CaO(s) + CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C5H12 + O2= CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Cl2 + LiI = LiCl + I2Cl2 + 2LiI = 2LiCl + I2
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Ca3(PO4)2 + H3PO4 + H2O = Ca2(HPO4)22Ca3(PO4)2 + 2H3PO4 + 0H2O = 3Ca2(HPO4)2
CaCO3+NaCl+H2SO4= CaSO4+HCl+NaHCO3CaCO3 + NaCl + H2SO4 = CaSO4 + HCl + NaHCO3
CaCO3+NaCl+H2SO4= CaSO4+HCl+NaHCO3CaCO3 + NaCl + H2SO4 = CaSO4 + HCl + NaHCO3
C6H5COCH3 + NaClO = C6H5CO2H + NaCl + CH2C6H5COCH3 + NaClO = C6H5CO2H + NaCl + CH2
C12H22O11(s) +H2O(l) = C2H5OH(aq) +CO2(g)C12H22O11(s) + H2O(l) = 4C2H5OH(aq) + 4CO2(g)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3COOH+K2SO3=CH3CO2K+H2O+SO22CH3COOH + K2SO3 = 2CH3CO2K + H2O + SO2
CH3COOH+K2+SO3=CH3CO2K+H2O+SO22CH3COOH + K2 + SO3 = 2CH3CO2K + H2O + SO2
CH3COOH+NaHCO3=CH3COONa+H2O+CO2CH3COOH + NaHCO3 = CH3COONa + H2O + CO2
CH3CH2CH3(g)+O2(g)=CO2(g)+H2O(g)CH3CH2CH3(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cu + O2 = CuO2Cu + O2 = 2CuO
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Ca(s)+O2(g)+C(s)=CaCO3(s)2Ca(s) + 3O2(g) + 2C(s) = 2CaCO3(s)
C2H5OH(l)+O2(g)=2CO2(g)+H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Cu(SO4) + Zn +H2(SO4) = CuS + Zn(SO4) + H20Cu(SO4) + Zn + H2(SO4) = 0CuS + Zn(SO4) + H2
Cu(SO4) + Zn +H2(SO4) = CuS + Zn(SO4) + H20Cu(SO4) + Zn + H2(SO4) = 0CuS + Zn(SO4) + H2
CH3CHO + 3O2 = 2CO2 + 2H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
C2H6 (g) + O2 (g) = CO2 (g) + H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
CuSO4+K2CrO4=K2SO4+CuCrO4CuSO4 + K2CrO4 = K2SO4 + CuCrO4
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CH4=C2H2+ H22CH4 = C2H2 + 3H2
Ca(OH)2(aq)+ HNO3(aq) = Ca(NO3)2(aq) + H2O(l)Ca(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O(l)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C5H8 + O2= CO2 +H2OC5H8 + 7O2 = 5CO2 + 4H2O
CuCl2(aq) +H2S(aq)=CuS + 2HClCuCl2(aq) + H2S(aq) = CuS + 2HCl
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
C4H8(g)+O2(g)=CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
Ca(NO3)2+Na3PO4=Ca3(PO4)2+NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
Cu+AgN=2CuN + AgCu + AgN = CuN + Ag
CH4(g) + O2(g) = CO2(g) + H2OCH4(g) + 2O2(g) = CO2(g) + 2H2O
Ca(HCO3)2 = CaCO3 + CO2 + H2OCa(HCO3)2 = CaCO3 + CO2 + H2O
C + O2 = CO2C + O2 = CO2
CO2 = C + O2CO2 = C + O2
Cl2(g)+KBr(aq)=Br2(l)+KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
CH3CHO+3O2=2CO2+2H2O2CH3CHO + 5O2 = 4CO2 + 4H2O
C+O2=CO2C + O2 = 2CO
C+O2=+CO2C + O2 = 2CO
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C2H5OH + SeO4-- H+ = C5H7O2 + CO2 + SeO3-- + H2O23C2H5OH + 0SeO4--H+ = 12C5H7O2 - 14CO2 + 0SeO3-- + 27H2O
C2H5OH + SeO4-- H+ = C5H7O2 + CO2 + SeO3-- + H2O23C2H5OH + 0SeO4--H+ = 12C5H7O2 - 14CO2 + 0SeO3-- + 27H2O
C + H2SO4 = CO2 + H2O + SO2C + 2H2SO4 = CO2 + 2H2O + 2SO2
CH4(g)+O2(g)=CO2(g)+H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cl2(g)+KBr(aq)=Br2(l)+KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
Ce2(SO4)3 + Cl2 + 8KOH = 2Ce(OH)4 + 2KCl + 3K2SO4Ce2(SO4)3 + Cl2 + 8KOH = 2Ce(OH)4 + 2KCl + 3K2SO4
Cu + AgNO3 = Cu(NO3)2 + Ag Cu + 2AgNO3 = Cu(NO3)2 + 2Ag
C6H12O6 + O2 = CO2 + H2O C6H12O6 + 6O2 = 6CO2 + 6H2O
C3H8 + O2 =CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
C2H5OH(l)+O2(g)=2CO2(g)+H2OC2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O
C3H8 + O2 = CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
C10H5OH(l)+O2(g)=2CO2(g)+H2OC10H5OH(l) + 11O2(g) = 10CO2(g) + 3H2O
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
C5H10 + 8O2 = 5CO2 + 5H2O2C5H10 + 15O2 = 10CO2 + 10H2O
CaCO3 = CaO+CO2CaCO3 = CaO + CO2
Ca(OH)2+Na3PO4=Ca3(PO4)2+NaOH3Ca(OH)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaOH
Cr2(SO4)3 + 6KOH = 2Cr(OH)3 + 3 K2SO4Cr2(SO4)3 + 6KOH = 2Cr(OH)3 + 3K2SO4
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
Ca(s)+HNO3(aq)=Ca(NO3)2(aq)+H2(g)Ca(s) + 2HNO3(aq) = Ca(NO3)2(aq) + H2(g)
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)4CH3+O2=CO2+ H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH3(CH2)3CH3+O2=CO2+ H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
CH3(CH2)3+O2=CO2+ H2O4CH3(CH2)3 + 25O2 = 16CO2 + 18H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
Ca(OH)2(aq)+Na3PO4(aq)=Ca3(PO4)2(s)+NaOH(aq)3Ca(OH)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaOH(aq)
C2H5OCH3(g) + O2(g) = CO2(g) + H2O(l)2C2H5OCH3(g) + 9O2(g) = 6CO2(g) + 8H2O(l)
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CU(NO3)2=CUO+NO2+O22CU(NO3)2 = 2CUO + 4NO2 + O2
C3H8(g) +5O2(g)= 2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH4(g)=C2H2(g) + H2(g)2CH4(g) = C2H2(g) + 3H2(g)
CaL2+AgNO3=Ca(NO3)2+AgLCaL2 + 2AgNO3 = Ca(NO3)2 + 2AgL
C2H4 + O2 = CO2 + H2O C2H4 + 3O2 = 2CO2 + 2H2O
C4H10S+O2=CO2+H2O +SOC4H10S + 7O2 = 4CO2 + 5H2O + SO
Ca + 0Cl2 = CaCl2Ca + Cl2 = CaCl2
Ca +Cl2 = CaCl2Ca + Cl2 = CaCl2
CH4(g)+2O(g)=CO2(g)+2H2O(g)CH4(g) + 4O(g) = CO2(g) + 2H2O(g)
Cu((NH3)4)+H2O=Cu+NH4+OHCu((NH3)4) + 4H2O = Cu + 4NH4 + 4OH
Cu((NH3)4)+N2H4+OH=Cu+NH4OHCu((NH3)4) - N2H4 + 2OH = Cu + 2NH4OH
Cu((NH3)4)+N2H4+OH=Cu+NH4OHCu((NH3)4) - N2H4 + 2OH = Cu + 2NH4OH
Cu((NH3)4)+N2H4+OH=Cu+NH4OHCu((NH3)4) - N2H4 + 2OH = Cu + 2NH4OH
Cu+NH3+H2O=Cu(NH4)+NH4OH0Cu + NH3 + H2O = 0Cu(NH4) + NH4OH
Cu+NH3+H2O=Cu(NH4)+NH4OH0Cu + NH3 + H2O = 0Cu(NH4) + NH4OH
Cu+NH3+H2O=Cu(NH4)+NH4OH0Cu + NH3 + H2O = 0Cu(NH4) + NH4OH
Cu+NH3+H2O=Cu(NH4)+OHCu + NH3 + H2O = Cu(NH4) + OH
Cu+C3H5O((COONa)3)+OH=Cu(C3H5O(COO)3)+NaOHCu + C3H5O((COONa)3) + 3OH = Cu(C3H5O(COO)3) + 3NaOH
Cu+C3H5O((COONa)3)=Cu(C3H5O(COO)3)+NaOH+OH-1Cu - C3H5O((COONa)3) = -1Cu(C3H5O(COO)3) - 3NaOH + 3OH
Cu+C3H5O((COONa)3)+H2O=Cu(C3H5O(COO)3)+NaOH+OH-1Cu - C3H5O((COONa)3) + 0H2O = -1Cu(C3H5O(COO)3) - 3NaOH + 3OH
Cu+C3H5O((COONa)3)+H2O=Cu(C3H5O(COO)3)+NaOH+OH-1Cu - C3H5O((COONa)3) + 0H2O = -1Cu(C3H5O(COO)3) - 3NaOH + 3OH
Cu+C3H5O(COONa)3+H2O=Cu(C3H5O(COO)3)+NaOH+OH-1Cu - C3H5O(COONa)3 + 0H2O = -1Cu(C3H5O(COO)3) - 3NaOH + 3OH
Cu+C3H5O(COONa)3+H2O=Cu(C3H5O(COO))3+NaOH+OHCu + 2C3H5O(COONa)3 + 10H2O = Cu(C3H5O(COO))3 + 6NaOH + 9OH
Cu+C3H5O(COONa)3+H2O+N2H4=Cu(C3H5O(COO))3+NaOH+NO24Cu + 8C3H5O(COONa)3 + 16H2O + 3N2H4 = 4Cu(C3H5O(COO))3 + 24NaOH + 6NO2
Cu+C3H5O(COONa)3+H2O=Cu(C3H5O(COO))3+ NaOH + OHCu + 2C3H5O(COONa)3 + 10H2O = Cu(C3H5O(COO))3 + 6NaOH + 9OH
Cu+C3H5O(COONa)3+OH=Cu(C3H5O(COO))3+ NaOH + H2O-1Cu - 2C3H5O(COONa)3 + 9OH = -1Cu(C3H5O(COO))3 - 6NaOH + 10H2O
CoCl2 + NaClO4 + H2SO4= Co(ClO3)3 +Na2SO4 + NaClO3 + H2O2CoCl2 + 13NaClO4 + H2SO4 = 2Co(ClO3)3 + Na2SO4 + 11NaClO3 + H2O
C6H12O6+6O2=6CO2+6H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CH3CH3 + O2 = CO2 +H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)2CH3 + O2 =CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Cu+2AgCl=2Ag+CuCl2Cu + 2AgCl = 2Ag + CuCl2
C2H4(g)+3O2(g)=2CO2(g)+2H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3 (CH2)6 CH3 +O2= CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CrCl3(aq) + Na2CO3(aq) = Cr2(CO3)3(s) + NaCl(aq)2CrCl3(aq) + 3Na2CO3(aq) = Cr2(CO3)3(s) + 6NaCl(aq)
C2H5 + O2 =CO2 + H2O4C2H5 + 13O2 = 8CO2 + 10H2O
Ca+HOH=Ca(OH)2+H2Ca + 2HOH = Ca(OH)2 + H2
Cl2+KBr=KCl+ Br2Cl2 + 2KBr = 2KCl + Br2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CaCl2 + 2AgNO3 = Ca(NO3)2+ 2AgClCaCl2 + 2AgNO3 = Ca(NO3)2 + 2AgCl
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6+H6=C6H6C6 + H6 = C6H6
C6+H6=C6H6C6 + H6 = C6H6
C4H8O2 + H2 = CH4 + CO2C4H8O2 + 2H2 = 3CH4 + CO2
Cu(NH3)2+N2H4+OH-=Cu+NH4OH+NO2-8Cu(NH3)2 + 7N2H4 + 0OH- = -8Cu - 4NH4OH + 2NO2
Cu(NH4)+N2H4+OH-=Cu+NH4OH+NO2-8Cu(NH4) + 3N2H4 + 0OH- = -8Cu - 4NH4OH + 2NO2
Cu(NH4)+N2H4+OH-=Cu+NH4OH+NO2-8Cu(NH4) + 3N2H4 + 0OH- = -8Cu - 4NH4OH + 2NO2
Cu(NH3)+N2H4+OH-=Cu+H2O+NO2-12Cu(NH3) + 7N2H4 + 0OH- = -12Cu - 4H2O + 2NO2
Cu(NH3)+N2H4+OH-=Cu+NH4OH+NO2-16Cu(NH3) + 7N2H4 + 0OH- = -16Cu - 4NH4OH + 2NO2
Cu(NH3)+N2H4+OH-=Cu+NH4OH+NH3Cu(NH3) + 0N2H4 + 0OH- = Cu + 0NH4OH + NH3
Cu(NH4)+N2H4+OH-=Cu+NH4OH+N2-2Cu(NH4) + 2N2H4 + 0OH- = -2Cu + 0NH4OH + N2
Cu(NH3)+N2H4+OH-=Cu+NH4OH+N2-4Cu(NH3) + 3N2H4 + 0OH- = -4Cu + 0NH4OH + N2
Cu(NH3)+N2H4+OH-=Cu+NH4OH+NO2-16Cu(NH3) + 7N2H4 + 0OH- = -16Cu - 4NH4OH + 2NO2
Cu(NH3)+N2H4+OH-=Cu+NH4OH+N2-4Cu(NH3) + 3N2H4 + 0OH- = -4Cu + 0NH4OH + N2
Cu(C3H5O(COO)3)3+N2H4+OH=Cu++ OHC(COOH)(CH2COOH)+N2+H2O0Cu(C3H5O(COO)3)3 + N2H4 + 4OH = 0Cu+ + 0OHC(COOH)(CH2COOH) + N2 + 4H2O
Cu(C3H5O(COO)3)3+N2H4+OH-=Cu++ OHC(COOH)(CH2COOH)+N2+H2O-8Cu(C3H5O(COO)3)3 - 7N2H4 + 8OH- = -8Cu+ - 36OHC(COOH)(CH2COOH) - 7N2 + 20H2O
Cu(C3H5O(COO)3)3-+N2H4+OH-=Cu++ OHC(COOH)(CH2COOH)+N2+H2O-8Cu(C3H5O(COO)3)3- - 5N2H4 + 16OH- = -8Cu+ - 36OHC(COOH)(CH2COOH) - 5N2 + 28H2O
Cu(NH4)+N2H4+OH=Cu++NH4OH+NO20Cu(NH4) + 3N2H4 + 8OH = 0Cu+ + 4NH4OH + 2NO2
CO+O2=CO22CO + O2 = 2CO2
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CO+O2=CO22CO + O2 = 2CO2
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
Cr2O3+Na2CO3+KNO3=Na2CrO4+CO2+KNO30Cr2O3 + 0Na2CO3 + KNO3 = 0Na2CrO4 + 0CO2 + KNO3
C8H8+O2=CO2+H2OC8H8 + 10O2 = 8CO2 + 4H2O
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C2H4 + 3O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2 + Ca(HCO3)2(aq)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CO2 + H2O = C6 H12 O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6 + O2 = H20 + CO210C2H6 + 20O2 = 3H20 + 20CO2
Cl2 + O2 = Cl2 O32Cl2 + 3O2 = 2Cl2O3
Cl2 + O2 = ClOCl2 + O2 = 2ClO
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C4H9OH(g)+O2(g)=CO2(g)+H2O(l) C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
Ca(HCO3)2+Na2CO3 = CaCO3+NaHCO3Ca(HCO3)2 + Na2CO3 = CaCO3 + 2NaHCO3
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CoCl2 + Na3PO4 = Co3(PO4)2 + NaCl3CoCl2 + 2Na3PO4 = Co3(PO4)2 + 6NaCl
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH4(g)+O2(g) = CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH3(CH2)2CH3(g)+O2 = CO2(g)+H2O(g)2CH3(CH2)2CH3(g) + 13O2 = 8CO2(g) + 10H2O(g)
Ca(HCO3)2+Ca(OH)2=CaCO3+H2OCa(HCO3)2 + Ca(OH)2 = 2CaCO3 + 2H2O
C2H5OH + 3O2 =2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CoCl2 + NaClO4 + H2SO4 = Co(ClO3)3 + Na2SO4 + NaClO3 + H2O2CoCl2 + 13NaClO4 + H2SO4 = 2Co(ClO3)3 + Na2SO4 + 11NaClO3 + H2O
CoCl2 + NaClO4 + H2SO4 = Co(ClO3)3 + Na2SO4 + NaClO3 + H2O2CoCl2 + 13NaClO4 + H2SO4 = 2Co(ClO3)3 + Na2SO4 + 11NaClO3 + H2O
CoCl2 + NaClO4 + H2SO4 = Co(ClO3)3 + Na2SO4 + NaClO3 + H2O2CoCl2 + 13NaClO4 + H2SO4 = 2Co(ClO3)3 + Na2SO4 + 11NaClO3 + H2O
CoCl2 + NaClO4 + H2SO4 = Co(ClO3)3 + NaSO4 + NaClO3 + H2OCoCl2 + 7NaClO4 + H2SO4 = Co(ClO3)3 + NaSO4 + 6NaClO3 + H2O
Cl2 + F2 = ClF3Cl2 + 3F2 = 2ClF3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu(s) + HCl(aq) = CuCl2(Aq) + H2(g)Cu(s) + 2HCl(aq) = CuCl2(Aq) + H2(g)
C7H3 + KMnO4 + H2O = C7H5O2 +KOH + MnO23C7H3 + 2KMnO4 + 4H2O = 3C7H5O2 + 2KOH + 2MnO2
C7H6 + KMnO4 + H2O = C7H5O2 +KOH + MnO23C7H6 + 5KMnO4 + H2O = 3C7H5O2 + 5KOH + 5MnO2
C7H6 + KMnO4 + H2O = C7H8O2 +KOH + MnO23C7H6 + 2KMnO4 + 4H2O = 3C7H8O2 + 2KOH + 2MnO2
C7H3 + O2 = CO2 + H2O4C7H3 + 31O2 = 28CO2 + 6H2O
C7H6 + O2 = CO2 + H2O2C7H6 + 17O2 = 14CO2 + 6H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca+Cl=CaCl2Ca + 2Cl = CaCl2
C4H6+O2=CO2+H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CO2 + H2O = C6H12O6 +O26CO2 + 6H2O = C6H12O6 + 6O2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C7H8+O2=CO2+H2OC7H8 + 9O2 = 7CO2 + 4H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CuCl2 +Na3PO4 = Cu3(PO4)2 + NaCl3CuCl2 + 2Na3PO4 = Cu3(PO4)2 + 6NaCl
CuCl2 + H2SO4 = CuSO4 + HClCuCl2 + H2SO4 = CuSO4 + 2HCl
Ca + O= CaOCa + O = CaO
CrCl2*6H2O + HCl = CrCl3*4H2O+ H2O+ HCl0CrCl2*6H2O + HCl = 0CrCl3*4H2O + 0H2O + HCl
CrCl*6H2O + HCl = CrCl3*4H2O+ H2O+ HCl0CrCl*6H2O + HCl = 0CrCl3*4H2O + 0H2O + HCl
CH4+H2O=CO+H2CH4 + H2O = CO + 3H2
C3H8 + 5O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3N2 + 6H2O = Ca(OH)2 + 2NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
C5H8 + O2 = 5CO2 + 4H2OC5H8 + 7O2 = 5CO2 + 4H2O
Ca + O2= CaO2Ca + O2 = 2CaO
CaCO3(s) = CaO(s) + CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CO(g) + 2H2(g) = CH3OH(g) CO(g) + 2H2(g) = CH3OH(g)
C2H4+O2= CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4+NH3=H2+C2N22CH4 + 2NH3 = 7H2 + C2N2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
Cu+2AgNO3=2Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C3H6 + 3O2 = 3CO2 + 3H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca3P2 + H2SO4 + H2O = PH3 + CaSO4 H2OCa3P2 + 3H2SO4 + 3H2O = 2PH3 + 3CaSO4H2O
CH4+O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CaH2 + H2O = Ca(OH)2 + HCaH2 + 2H2O = Ca(OH)2 + 4H
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CH3CH2CH3 + O2 = CO2 + H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
Cl + Na = NaCl22Cl + Na = NaCl2
Cd(NO3)2+Na2S=CdS+NaNO3Cd(NO3)2 + Na2S = CdS + 2NaNO3
CH3(CH2)2CH3 + O2 = CO2 +H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C2H6O + 3 O2 = 2 CO2 + 3 H2O C2H6O + 3O2 = 2CO2 + 3H2O
C2H4O2 + H2O2 + Cu = Cu(C2H3O2)2 + H2O2C2H4O2 + H2O2 + Cu = Cu(C2H3O2)2 + 2H2O
C12H22O11 + H2O = CO2 + H2O0C12H22O11 + H2O = 0CO2 + H2O
C12H22O11 + H2O = CO2 + H2O0C12H22O11 + H2O = 0CO2 + H2O
CH4 (g) + O2 (g) = CO2 (g) + H2O (l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cl2 (g) + KBr (aq) = Br2 (l) + KCl (aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
Cl2+P=PCl33Cl2 + 2P = 2PCl3
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
CH4+O2=H2O+CO2CH4 + 2O2 = 2H2O + CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C(s)+ Fe2O3(s) = Fe(s) +CO2(g)3C(s) + 2Fe2O3(s) = 4Fe(s) + 3CO2(g)
CH3CHO+ O2 = CH3COOH2CH3CHO + O2 = 2CH3COOH
Cu(s) + HNO3(aq)= Cu(NO3)2(s) + NO2(g) + H2O(l)Cu(s) + 4HNO3(aq) = Cu(NO3)2(s) + 2NO2(g) + 2H2O(l)
C2H6(g)+O2(g)=CO2(g)+H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca3(PO4)2 + H2SO4= Ca(H2PO4)2+CaSO4Ca3(PO4)2 + 2H2SO4 = Ca(H2PO4)2 + 2CaSO4
C3H10 + O2 = CO2 + H2O2C3H10 + 11O2 = 6CO2 + 10H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C12H22O11 + H2O = C2H6O + CO2C12H22O11 + H2O = 4C2H6O + 4CO2
C2H3NaO2 + HNO3 = NaNO3 + C2H4O2C2H3NaO2 + HNO3 = NaNO3 + C2H4O2
C15H32(g) + O2(g) = CO2(g) + H2OC15H32(g) + 23O2(g) = 15CO2(g) + 16H2O
Cl2 + 2NaBr = Br2 + 2NaClCl2 + 2NaBr = Br2 + 2NaCl
C3H6+O2 = CO + H22C3H6 + 3O2 = 6CO + 6H2
C H+2 O =C O+2 H OCH + 2O = CO + HO
CH+2O =CO+2HOCH + 2O = CO + HO
C H+2 O =C O+2 H OCH + 2O = CO + HO
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cu+H2SO4=SO2+CuSO4+H2OCu + 2H2SO4 = SO2 + CuSO4 + 2H2O
CaC2+H2O+CO2=C3H4O2 + Ca(OH)26CaC2 + 16H2O + 3CO2 = 5C3H4O2 + 6Ca(OH)2
Ca(NO3)2(s) =Ca(NO2)2(s) + O2(g)Ca(NO3)2(s) = Ca(NO2)2(s) + O2(g)
C4H10(g) = C(s) + H2(g)C4H10(g) = 4C(s) + 5H2(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.