Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CuO+H2=Cu+H2OCuO + H2 = Cu + H2O
CaCl2 + NaHCO3 =CaCO3 + NaCl + H2O + CO2CaCl2 + 2NaHCO3 = CaCO3 + 2NaCl + H2O + CO2
C2H2+O2=4CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cr+3SnBr4=CrBr3+SnBr22Cr + 3SnBr4 = 2CrBr3 + 3SnBr2
C2H4 + O2= 2CO2 + 2H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca(CH3CO2)2(aq) + 2HCl(aq) = CaCl2(aq) + 2HCH3CO2(aq)Ca(CH3CO2)2(aq) + 2HCl(aq) = CaCl2(aq) + 2HCH3CO2(aq)
Ca(CH3CO2)2(aq) + 2HCl(aq) = CaCl2(aq) + 2HCH3CO2(aq)Ca(CH3CO2)2(aq) + 2HCl(aq) = CaCl2(aq) + 2HCH3CO2(aq)
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H+O2=CO2+H2O4C4H + 17O2 = 16CO2 + 2H2O
CH4+Cl2=HCl+CCl4CH4 + 4Cl2 = 4HCl + CCl4
CO + O = CO2CO + O = CO2
CO + O = CO2CO + O = CO2
CO + O = CO2CO + O = CO2
CO + O = CO2CO + O = CO2
CO+O=CO2CO + O = CO2
CO+O=CO2CO + O = CO2
C14H10 + O2 = C14H8O2 + H2O2C14H10 + 3O2 = 2C14H8O2 + 2H2O
C3H8 +H2O =CO+H2C3H8 + 3H2O = 3CO + 7H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(NO3)3(aq)+(NH4)2S(aq)=Ca2S3+NH4NO3(aq)2Ca(NO3)3(aq) + 3(NH4)2S(aq) = Ca2S3 + 6NH4NO3(aq)
CH3COOH(l)+O2(g)=CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CuCO3 + HNO3 = Cu(NO3)2 + H2O + CO2CuCO3 + 2HNO3 = Cu(NO3)2 + H2O + CO2
Cd+C2H4O2=CdC2H2O2+H2Cd + C2H4O2 = CdC2H2O2 + H2
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CO2 (g) + H2O (aq) =H2CO3 (aq)CO2(g) + H2O(aq) = H2CO3(aq)
CaCl2 (aq) + NaNO3 (aq) = Ca(NO3)2(aq) + NaCl(aq)CaCl2(aq) + 2NaNO3(aq) = Ca(NO3)2(aq) + 2NaCl(aq)
Cu(s) + HNO3 (aq) = NO2 + H2O+ Cu(NO3)2Cu(s) + 4HNO3(aq) = 2NO2 + 2H2O + Cu(NO3)2
Ca (s) + HCl (aq) = CaCl2 + H2(g)Ca(s) + 2HCl(aq) = CaCl2 + H2(g)
C6H12O2 + O2 = CO2 + H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
Cr2(SO4)3 + KBr =Cr2Br + K(SO4)3Cr2(SO4)3 + KBr = Cr2Br + K(SO4)3
C3H8O(g) + O2(g) = CO2(g) + H2O(g)2C3H8O(g) + 9O2(g) = 6CO2(g) + 8H2O(g)
Ca + O2 = CaO2Ca + O2 = 2CaO
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
Co(NO3)2 = CoO + NO2 + O22Co(NO3)2 = 2CoO + 4NO2 + O2
CuSO4 + KOH = Cu(OH)2 + K2SO4CuSO4 + 2KOH = Cu(OH)2 + K2SO4
C6H12O6 + O2 = H2O + CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+N2=CaN2Ca + N2 = 2CaN
Ca+Cl2=CaCl2Ca + Cl2 = CaCl2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cr + O2 = Cr3O36Cr + 3O2 = 2Cr3O3
Cr + O2 = Cr2O34Cr + 3O2 = 2Cr2O3
CsO2 + CO2 = Cs2CO3 + O24CsO2 + 2CO2 = 2Cs2CO3 + 3O2
Cl3 + CrBr3 = Br2 + CrCl32Cl3 + 2CrBr3 = 3Br2 + 2CrCl3
Ca(NO3)2+NaCl=CaCl2+Na(NO3)Ca(NO3)2 + 2NaCl = CaCl2 + 2Na(NO3)
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C8H18 + O2 = CO3 + H2O2C8H18 + 33O2 = 16CO3 + 18H2O
C4H10 +O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCl2 + H2SO4 = CaSO4 + 2 HClCaCl2 + H2SO4 = CaSO4 + 2HCl
Cr2(SO4)3 + 6KOH = 2Cr(OH)3 + 3 K2SO4Cr2(SO4)3 + 6KOH = 2Cr(OH)3 + 3K2SO4
CH3COOH(l)+O2(g)=CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CuSO4 +NaOH = CuNa + SO4OHCuSO4 + NaOH = CuNa + SO4OH
CuSO4 +NaOH = CuOH +SO4NaCuSO4 + NaOH = CuOH + SO4Na
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C3H3+O2=CO2+H2O4C3H3 + 15O2 = 12CO2 + 6H2O
CuCO3(s)=CuO+CO2CuCO3(s) = CuO + CO2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Ca + N2 = Ca3N23Ca + N2 = Ca3N2
CaCl2+Na(OH)=Ca(OH)2 + NaClCaCl2 + 2Na(OH) = Ca(OH)2 + 2NaCl
C + O2 =CO2C + O2 = CO2
C2H6+3O2= CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6O(l)+O2(g)=CO2(g)+H2O(g)C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(g)
Ca(OH)2 (aq) +CH3CO2H = Ca(CH3CO2)2 + H2OCa(OH)2(aq) + 2CH3CO2H = Ca(CH3CO2)2 + 2H2O
C(s)+O2=CO2C(s) + O2 = CO2
C2H6(g)+O2(g)=CO2(g)+H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
C8H16+O2=CO2+H2OC8H16 + 12O2 = 8CO2 + 8H2O
C4H6(g)+O2(g)=CO2+H2O2C4H6(g) + 11O2(g) = 8CO2 + 6H2O
CO2+H2 = CO+H2OCO2 + H2 = CO + H2O
CH4 (g) + 2 O2 (g) = CO2 (g) + 2 H2O (g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C2H4 + H2O = CH3CH2OHC2H4 + H2O = CH3CH2OH
Ca(OH)2 +Al2(SO4)3 = CaSO4 + Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
Ca+N2=Ca3N23Ca + N2 = Ca3N2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH2O2 + C2H6O = C3H6O2 + H2OCH2O2 + C2H6O = C3H6O2 + H2O
C6H8O7 + C6H10O5 = C12H18O12 C6H8O7 + C6H10O5 = C12H18O12
Ca(s)+Br2(g)=CaBr2Ca(s) + Br2(g) = CaBr2
CaSO4+AlBr3=CaBr2+Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
CaSO4+AlBr3=CaBr2+Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
CuBr2 (aq) + AlCl3 (aq) = CuCl2 (aq) + AlBr3 3CuBr2(aq) + 2AlCl3(aq) = 3CuCl2(aq) + 2AlBr3
C7H7Cl + KMnO4 = C7H5O2Cl +MnO2 + KOHC7H7Cl + 2KMnO4 = C7H5O2Cl + 2MnO2 + 2KOH
CaCO3 = CaO+CO2CaCO3 = CaO + CO2
CaO+2HCl = CaCl2 + H2OCaO + 2HCl = CaCl2 + H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C20H36O2 + O2 = CO2 + H205C20H36O2 + 95O2 = 100CO2 + 9H20
CaCl2 + AgNO3=AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
Ca(C2H3O2)2(aq) + K3PO4(aq) = Ca3(PO4)2(s) + KC2H3O2(aq)3Ca(C2H3O2)2(aq) + 2K3PO4(aq) = Ca3(PO4)2(s) + 6KC2H3O2(aq)
CrCl3(aq) + Ca(OH)2(aq) = Cr(OH)3(s) + CaCl2(aq)2CrCl3(aq) + 3Ca(OH)2(aq) = 2Cr(OH)3(s) + 3CaCl2(aq)
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co(NO3)2(aq)+H2S(g)=CoS(s)+HNO3(aq)Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
CH4ON2 + O2 = CO2 + NO2 + H2O2CH4ON2 + 7O2 = 2CO2 + 4NO2 + 4H2O
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu+ZnSO4=Zn+CuSO4Cu + ZnSO4 = Zn + CuSO4
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CH2CH2 + 2H = CH3CH3CH2CH2 + 2H = CH3CH3
Cr2(CO3)3 = Cr2O3 + CO2Cr2(CO3)3 = Cr2O3 + 3CO2
Cu + S = Cu2S2Cu + S = Cu2S
CrO3+FeSO4+H2SO4 = Cr2(SO4)3+Fe2(SO4)3+HOH2CrO3 + 6FeSO4 + 6H2SO4 = Cr2(SO4)3 + 3Fe2(SO4)3 + 6HOH
Cl2+AsH3+HOH = As4O6+HCl12Cl2 + 4AsH3 + 6HOH = As4O6 + 24HCl
CaCO3+HCl = CaCl2+CO2+HOHCaCO3 + 2HCl = CaCl2 + CO2 + HOH
Ca + Fe(NO3)3 = Ca(NO3)3 + FeCa + Fe(NO3)3 = Ca(NO3)3 + Fe
CO+O2=CO22CO + O2 = 2CO2
CO + O2=CO22CO + O2 = 2CO2
C+O2=CO2C + O2 = 2CO
C+O2=CO2C + O2 = 2CO
C4H10+O2= CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H6O4+O2=CO2+H2O2C6H6O4 + 11O2 = 12CO2 + 6H2O
CuCl2+Na2S=CuS+NaClCuCl2 + Na2S = CuS + 2NaCl
C7H14+O2=H2O+CO22C7H14 + 21O2 = 14H2O + 14CO2
CrO4-- + SO3-- + H2O = Cr(OH)4- + SO4-- + OH-2CrO4-- + 3SO3-- + 5H2O = 2Cr(OH)4- + 3SO4-- + 2OH-
C3H8O(l) +O2(g)=CO2(g)+H2O(g)2C3H8O(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
CS2+O2=CO2+SO2CS2 + 3O2 = CO2 + 2SO2
C4H10O(l) + O2(g) = CO2(g) + H202C4H10O(l) + 7O2(g) = 8CO2(g) + H20
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CaO+H3PO4=Ca3(PO4)2+H2O3CaO + 2H3PO4 = Ca3(PO4)2 + 3H2O
CaO+H3PO4=Ca3(PO4)2+H2O3CaO + 2H3PO4 = Ca3(PO4)2 + 3H2O
Ca2Si+SbCl3=Si+Sb+CaCl23Ca2Si + 4SbCl3 = 3Si + 4Sb + 6CaCl2
C10H8+O2=CO2+H2OC10H8 + 12O2 = 10CO2 + 4H2O
CoSO4 + NaOH + NaBrO = Co2O3 + NaBr + Na2SO4 + H2O2CoSO4 + 4NaOH + NaBrO = Co2O3 + NaBr + 2Na2SO4 + 2H2O
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH4(g) + O2(g)=CO2(g) + H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
CH3OH(l) + O2(g) = CO2(g) + H2(g)2CH3OH(l) + O2(g) = 2CO2(g) + 4H2(g)
CH3OH(l) = O2(g) = CO2(g) = H2(g)2CH3OH(l) = -1O2(g) + 2CO2(g) + 4H2(g)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH3OH(l) + O2(g ) = CO2( g ) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C4H10(g) + O2(g ) = CO2( g ) + H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
CH3OH( l ) + O2(g ) = CO2( g ) + H2O(l)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(l)
CH 3 OH( l ) + O 2 ( g ) = CO 2 ( g ) + HO 2 (l)2CH3OH(l) + 9O2(g) = 2CO2(g) + 8HO2(l)
Ca(HCO3)2 + HCl = CaCl2 + CO2 + H2OCa(HCO3)2 + 2HCl = CaCl2 + 2CO2 + 2H2O
CO + O2 = CO22CO + O2 = 2CO2
Cu(NO3)2 + Ba(OH)2 = Cu(OH)2 + Ba(NO3)2Cu(NO3)2 + Ba(OH)2 = Cu(OH)2 + Ba(NO3)2
Cu(NO3)2 + Ba(OH2)2 = Cu(OH2)2 + Ba(NO3)2Cu(NO3)2 + Ba(OH2)2 = Cu(OH2)2 + Ba(NO3)2
CuNO3 + BaOH2 = CuOH2 + BaNO3CuNO3 + BaOH2 = CuOH2 + BaNO3
C6H10O5 + O2 = CO2 + H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
C6H10O5 + O2 = CO2 + H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
Cu2NO3 + KOH = Cu2OH+ KNO3Cu2NO3 + KOH = Cu2OH + KNO3
Cu2NO3 + KOH = Cu2OH+ KNO3Cu2NO3 + KOH = Cu2OH + KNO3
CaSiO3+HF=SiF4+CaF2+H2OCaSiO3 + 6HF = SiF4 + CaF2 + 3H2O
CuSO4+KOH=Cu(OH)2+K2SO4CuSO4 + 2KOH = Cu(OH)2 + K2SO4
CCl4+SbF3=CCl2F2+SbCl33CCl4 + 2SbF3 = 3CCl2F2 + 2SbCl3
Cr+ H2SO4 = Cr2(SO4)3+ H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH3CH2OH+O2=CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C2H5SH+O2=CO2+H2O+SO22C2H5SH + 9O2 = 4CO2 + 6H2O + 2SO2
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
Co(NO 3 ) 3 (aq)+(NH 4 ) 2 S(aq)=Co 2 S 3 (s)+NH 4 NO 3 (aq) 2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CH3(CH2)3CH3+ O2= CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
Cu + 2 AgNO3 = 2 Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH+6O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3(CH2)6CH3 + O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C+O2=CO2C + O2 = CO2
CH3OH+H2O=HCO2H+HCH3OH + H2O = HCO2H + 4H
C2H7N + O2 = CO + H2O + NO4C2H7N + 13O2 = 8CO + 14H2O + 4NO
C6H5Cl + O2 = CO2 + H2O + HClC6H5Cl + 7O2 = 6CO2 + 2H2O + HCl
Ca3N2+H2O=Ca(OH)2+NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaCl2 + AgNO3=AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CaCl2(aq) + K2CO3(aq) = KCl(aq) + CaCO3(s)CaCl2(aq) + K2CO3(aq) = 2KCl(aq) + CaCO3(s)
Ca(NO3)2(aq) + Na3PO4(aq) = Ca3(PO4)2(s) + NaNO3(aq)3Ca(NO3)2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaNO3(aq)
Ca(ClO4)2 + Li2CO3 = CaCO3 + LiClO4Ca(ClO4)2 + Li2CO3 = CaCO3 + 2LiClO4
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
Cl2+NaBr=Cl2Br+NaCl2 + NaBr = Cl2Br + Na
CuSO4+KOH=KSO4+CuOHCuSO4 + KOH = KSO4 + CuOH
C3H5(NO3)3=N2+O2+CO2+H2O4C3H5(NO3)3 = 6N2 + O2 + 12CO2 + 10H2O
Ca(s)+2HNO3(aq)=Ca(NO3)2(aq)+H2O(l)+N2O(g)4Ca(s) + 10HNO3(aq) = 4Ca(NO3)2(aq) + 5H2O(l) + N2O(g)
CuCl2(aq)+Na2CO3(aq)=CuCO3(aq)+2NaCl(s)CuCl2(aq) + Na2CO3(aq) = CuCO3(aq) + 2NaCl(s)
CuCl2(aq)+Na2CO3(aq)=CuCO3(aq)+NaCl(aq)CuCl2(aq) + Na2CO3(aq) = CuCO3(aq) + 2NaCl(aq)
C6H6+Cl2=C6H4Cl2+HClC6H6 + 2Cl2 = C6H4Cl2 + 2HCl
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
Cs+I2=CsI2Cs + I2 = 2CsI
CS2+Cl2=CCl4+SCl2CS2 + 4Cl2 = CCl4 + 2SCl2
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3H6O2+O2=CO2+H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CO + F2 = COF32CO + 3F2 = 2COF3
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ce(OH)3 + H2SO4 = Ce2(SO4)3 + H2O2Ce(OH)3 + 3H2SO4 = Ce2(SO4)3 + 6H2O
CaCl2 + Li2SO4 = CaSO4 + LiClCaCl2 + Li2SO4 = CaSO4 + 2LiCl
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
ClO4- + H2PO2- + OH- = ClO3- + HPO32- + H2O61ClO4- + 2H2PO2- + 0OH- = 61ClO3- + 2HPO32- + H2O
ClO4- + H2PO2- + OH- = ClO3- + HPO32- + H2O61ClO4- + 2H2PO2- + 0OH- = 61ClO3- + 2HPO32- + H2O
CH4(g) + 2O2(g) = CO2(g) + 2H2OCH4(g) + 2O2(g) = CO2(g) + 2H2O
CaCO3 + HCl = H2O + CO2 + CaCl2CaCO3 + 2HCl = H2O + CO2 + CaCl2
CrO4+N2O=Cr+NOCrO4 + 4N2O = Cr + 8NO
C8H16(l) + O2(g)= CO2(g) + H2O(g)C8H16(l) + 12O2(g) = 8CO2(g) + 8H2O(g)
C8N8O16(s)= CO2(g) + N2(g)C8N8O16(s) = 8CO2(g) + 4N2(g)
C2H5OH +O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH4+O2=H2O+CO2CH4 + 2O2 = 2H2O + CO2
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H16+O2 =CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CH4 + NH3 = H2 + C2N22CH4 + 2NH3 = 7H2 + C2N2
Cl2+H2O=HClO+HClCl2 + H2O = HClO + HCl
Ca(OH)2(aq) + H3PO4 = Ca3(PO4)2(s) + H2O(l)3Ca(OH)2(aq) + 2H3PO4 = Ca3(PO4)2(s) + 6H2O(l)
C4H8 + 6O2= CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
Ca(OH)2+CO2=CaCO3+H2OCa(OH)2 + CO2 = CaCO3 + H2O
C+SO2=CO2+SC + SO2 = CO2 + S
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CH3OH(l)+O2(g)=CO2(g)+H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
CH3OH(l)+O2(g)=CO2(g)+H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
Cu+AgNO3=Cu(NO3)+AgCu + AgNO3 = Cu(NO3) + Ag
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CS2CO3(aq) + Ca(NO3)2(aq) = CS2(NO3)2 + CaCO3CS2CO3(aq) + Ca(NO3)2(aq) = CS2(NO3)2 + CaCO3
CS2CO3(aq) + Ca(NO3)2(aq) = CS2(NO3)2 + Ca CO3CS2CO3(aq) + Ca(NO3)2(aq) = CS2(NO3)2 + CaCO3
C2H6+ O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
C+O=CO2C + 2O = CO2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H6(g)+O2(g)=CO2 + 4H2O2C2H6(g) + 7O2(g) = 4CO2 + 6H2O
C2 H6+O2=CO2+4H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu2O+C=Cu+COCu2O + C = 2Cu + CO
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Cl2(g)+H2O(l) =HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Ca(C2H3O2)2+(NH4)2CO3=CaCO3+NH4C2H3O2Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + 2NH4C2H3O2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu+AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Ca3(PO4)2 + SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H6(g) + O2(g) = CO2(g) + H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
Cu+H2SO4=CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
Ca(OH)2+2H3PO4=Ca3(PO4)2+3H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca + Na3N = Ca3N2 + Na 3Ca + 2Na3N = Ca3N2 + 6Na
CaO+2H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+2H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H5(NO3)3=CO2+N2+H2O+O24C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH4 + O2 = H2O +CO2CH4 + 2O2 = 2H2O + CO2
CH3OH+O2=CO2=H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu+HNO3=Cu (NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2 = CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C4H6+3O2=2CO2+3H23O23C4H6 + 95O2 = 92CO2 + 6H23O
CH3Cl+O2=CO2+H2O+Cl24CH3Cl + 7O2 = 4CO2 + 6H2O + 2Cl2
C2H5NSCl+O2 =CO2+H2O+NO2+SO3+HCl2C2H5NSCl + 11O2 = 4CO2 + 4H2O + 2NO2 + 2SO3 + 2HCl
Ca(OH)2 + CO2 = CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
Co(C2H3O2)2(H2O)4 + 2 NaOH = Co(OH)2 + 2 NaC2H3O2 + 4 H2O Co(C2H3O2)2(H2O)4 + 2NaOH = Co(OH)2 + 2NaC2H3O2 + 4H2O
C 5 H 6 O(l)+O 2 (g)=CO 2 (g)+H 2 O(g) C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C2H5OH + 3O2 = 2CO2 + 2H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + 3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH + 2O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C 3 H 6 (g)+O 2 (g)=CO 2 (g)+H 2 O(g) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CuSO4 + NaH2 = CuH2 + SO4 + NaCuSO4 + NaH2 = CuH2 + SO4 + Na
CuSO4 + NaH2 = CuNa + H2SO4CuSO4 + NaH2 = CuNa + H2SO4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H16O2(s)+O2(g)=8CO2+8H2OC8H16O2(s) + 11O2(g) = 8CO2 + 8H2O
CuS + HCN = CuCN + HSCuS + HCN = CuCN + HS
CuS + 2HCN = Cu(CN)2 + H2SCuS + 2HCN = Cu(CN)2 + H2S
C3H8 + 3O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+C=COCO2 + C = 2CO
C2H6O2 + O2 = CO2 + H2O2C2H6O2 + 5O2 = 4CO2 + 6H2O
Cd + HBr = CdBr + H22Cd + 2HBr = 2CdBr + H2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H10+O2=CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
CH4+2O2 = CO + 2H2O2CH4 + 3O2 = 2CO + 4H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
Cl + KO= KCl + O22Cl + 2KO = 2KCl + O2
Ca(OH)2+HNO3=HOH+Ca(NO3)2Ca(OH)2 + 2HNO3 = 2HOH + Ca(NO3)2
CaCO3 = CaO + 2CO2CaCO3 = CaO + CO2
CH4 + O2 = 2CO2 + 4H2OCH4 + 2O2 = CO2 + 2H2O
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C4H10+ O2 =CO2+ H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaO + 2?H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5+O2=CO2+H2O4C2H5 + 13O2 = 8CO2 + 10H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CrCl3 + H2O + NaOH = NaCrO4 + NaCl + H2O0CrCl3 + H2O + 0NaOH = 0NaCrO4 + 0NaCl + H2O
C4H8(g) + O2(g) =  CO2(g) + H2O(l)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(l)
Ca(OH)2(s) + HCl(aq) = CaCl2(aq) + H2O(l)Ca(OH)2(s) + 2HCl(aq) = CaCl2(aq) + 2H2O(l)
C6H12O6(aq) =  CH3CH2OH(l) + CO2(g)C6H12O6(aq) = 2CH3CH2OH(l) + 2CO2(g)
C6H12O6(aq) =  CH3CH2OH(l) + CO2(g)C6H12O6(aq) = 2CH3CH2OH(l) + 2CO2(g)
C12H26+O2=CO2+H2O2C12H26 + 37O2 = 24CO2 + 26H2O
CoCl2 + Na3PO4= CoPO4 + Na3Cl2CoCl2 + Na3PO4 = CoPO4 + Na3Cl2
Cu(NO3)2+K2CO3= CuCO3 + K2(NO3)2Cu(NO3)2 + K2CO3 = CuCO3 + K2(NO3)2
C12H22O11 + H2O = CO2 + C2H5OHC12H22O11 + H2O = 4CO2 + 4C2H5OH
C2H2O4 + H2O2 = CO2 + H2OC2H2O4 + H2O2 = 2CO2 + 2H2O
C6H12O6 + H2O = C3H8O3 + CO27C6H12O6 + 6H2O = 12C3H8O3 + 6CO2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cr2(CO3)3 + HNO3 = Cr(NO3)3 + H2O + CO2Cr2(CO3)3 + 6HNO3 = 2Cr(NO3)3 + 3H2O + 3CO2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H6O3 + O2 = CO2 + H2OC3H6O3 + 3O2 = 3CO2 + 3H2O
C3H6O3 = O2 = CO2 + H2OC3H6O3 = -3O2 + 3CO2 + 3H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C3H8+5O2=3CO2+9H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18(g)+O2(g)=CO2+H2O2C8H18(g) + 25O2(g) = 16CO2 + 18H2O
CuCO3 = CuO + CO2CuCO3 = CuO + CO2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C16H34 + O2 = CO2 + H2O2C16H34 + 49O2 = 32CO2 + 34H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C3H5(OH)3 + HNO3 = C3H5(NO3)3 + H2OC3H5(OH)3 + 3HNO3 = C3H5(NO3)3 + 3H2O
CO2 + NH3 = NH2CONH2 + H2OCO2 + 2NH3 = NH2CONH2 + H2O
CO2 + H2O + CaSiO3 = CaCO3 + H4SiO4CO2 + 2H2O + CaSiO3 = CaCO3 + H4SiO4
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CO2+NH3=NH2CONH2+H2OCO2 + 2NH3 = NH2CONH2 + H2O
C3H8+ O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Ca (OH)2 + H3PO4 = Ca3 (PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C + H2 = CH4C + 2H2 = CH4
CH3COOH(l)+O2(g)=2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cl2+KOH=KCl+KClO3+H2O3Cl2 + 6KOH = 5KCl + KClO3 + 3H2O
CuO(s) + NH3(g) = Cu(s) + N2(g) + H2O(l)3CuO(s) + 2NH3(g) = 3Cu(s) + N2(g) + 3H2O(l)
CrCl3+MnO2+H2O=MnCl2+H2CrO42CrCl3 + 3MnO2 + 2H2O = 3MnCl2 + 2H2CrO4
Cl2O7(l) + H2O(l) = HClO4(aq)Cl2O7(l) + H2O(l) = 2HClO4(aq)
Ca(C2H3O2)2(aq) + K3PO4(aq) = Ca3(PO4)2(s) + KC2H3O2(aq)3Ca(C2H3O2)2(aq) + 2K3PO4(aq) = Ca3(PO4)2(s) + 6KC2H3O2(aq)
CH5N+O2=CO2+H2O+NO24CH5N + 13O2 = 4CO2 + 10H2O + 4NO2
CH5N+O2=CO2+H20+NO24CH5N + 8O2 = 4CO2 + H20 + 4NO2
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CCl4+HF=CCl2F2+HClCCl4 + 2HF = CCl2F2 + 2HCl
C2H3O2Cl+O2=CO+H2O+Cl24C2H3O2Cl + 3O2 = 8CO + 6H2O + 2Cl2
Cl2+H2S+H2O=HCl+H2SO44Cl2 + H2S + 4H2O = 8HCl + H2SO4
C2H2 + H2 = C2H6C2H2 + 2H2 = C2H6
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
C4H10+O2=CO2+H202C4H10 + 8O2 = 8CO2 + H20
C6H6 + O2 = H2O + CO22C6H6 + 15O2 = 6H2O + 12CO2
Ca + H2O = H2 + Ca2+ + OH-4Ca + 2H2O = H2 + 2Ca2+ + 2OH-
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CrCl2 + Ba(OH)2 = BaCl2 + Cr(OH)2CrCl2 + Ba(OH)2 = BaCl2 + Cr(OH)2
CaCl2 + Li2SO4 = CaSO4 + LiClCaCl2 + Li2SO4 = CaSO4 + 2LiCl
Cu + HNO 3 = Cu(NO 3 ) 2 + H 2 O + NO 3 -1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
Ca+CuF2=CaF2+CuCa + CuF2 = CaF2 + Cu
C3H8 +O2=CO2 +H2OC3H8 + 5O2 = 3CO2 + 4H2O
C+O2=CO2C + O2 = 2CO
C+O2=CO2C + O2 = 2CO
Ca + CuF2 = CaF2 + CuCa + CuF2 = CaF2 + Cu
CaI2+H2O=CaO+H2I2CaI2 + H2O = CaO + H2I2
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H8N2 + N2O4=N2+CO2+H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCl2(aq) + Na2SO4(aq) = CaSO4(s) + NaCl(aq)CaCl2(aq) + Na2SO4(aq) = CaSO4(s) + 2NaCl(aq)
CuCl2(aq) + Ba(NO3)2(aq) = Cu(NO3)2 + BaCl2CuCl2(aq) + Ba(NO3)2(aq) = Cu(NO3)2 + BaCl2
CaCl2+KOH=CaO2H2+KClCaCl2 + 2KOH = CaO2H2 + 2KCl
CuCl2(aq) + AgNO3(aq) = AgCl + Cu(NO3)2CuCl2(aq) + 2AgNO3(aq) = 2AgCl + Cu(NO3)2
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Cu2O+C=Cu+COCu2O + C = 2Cu + CO
CuO + NH3 = Cu + H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
CUCO3 =CUO+CO2CUCO3 = CUO + CO2
Cu2O + NH3 = Cu + H2O + N23Cu2O + 2NH3 = 6Cu + 3H2O + N2
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
Ca+Cd(NO3)2=Ca(NO3)2+CdCa + Cd(NO3)2 = Ca(NO3)2 + Cd
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H6 +O2 = CO2 +H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CuCl2+(NH4)3 PO4 =CuPO4+ (NH4)3Cl2CuCl2 + (NH4)3PO4 = CuPO4 + (NH4)3Cl2
Cl2+NaBr=NaCl+Br2Cl2 + 2NaBr = 2NaCl + Br2
CuCl2+H2S=CuS+HClCuCl2 + H2S = CuS + 2HCl
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CaCO3+CO2+H2O=Ca(HCO3)2CaCO3 + CO2 + H2O = Ca(HCO3)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuCl2+NH4OH=Cu(OH)2+NH4ClCuCl2 + 2NH4OH = Cu(OH)2 + 2NH4Cl
C+H2=CH4C + 2H2 = CH4
C7H16+O2=CO+H2O2C7H16 + 15O2 = 14CO + 16H2O
C6H14+O2=CO+H2O2C6H14 + 13O2 = 12CO + 14H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C11H8N2O3S2 + O2 + C10H16N5O13P3 = C10H6N2O2S2 + CO2 + C10H14N5O7P + PO4-2C11H8N2O3S2 + O2 + 2C10H16N5O13P3 = -2C10H6N2O2S2 - 2CO2 + 2C10H14N5O7P + 4PO4
C2 H6 + 3O2 = 3CO2 + 4H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H6O + HCOOH = C3H7OH + H2O3C2H6O + 0HCOOH = 2C3H7OH + H2O
C2H6O + HCOOH = C2H7OH + HCO7C2H6O + 2HCOOH = 5C2H7OH + 6HCO
C2H6O + HCOOH = C2H6OH + HCO2C2H6O + HCOOH = C2H6OH + HCO2
C5H12+O2 = CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca + HCl = Cl +CaHCa + HCl = Cl + CaH
Co(NO3)2 + NaOH = NaNO3 +Co(OH)2Co(NO3)2 + 2NaOH = 2NaNO3 + Co(OH)2
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu + Fe(NO3)2 = Fe + Cu(NO3)2Cu + Fe(NO3)2 = Fe + Cu(NO3)2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2
Cr(Cl)2+Ba(OH)2=Ba(Cl)2+Cr(OH)2Cr(Cl)2 + Ba(OH)2 = Ba(Cl)2 + Cr(OH)2
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCl2+Li2O=CaO+LiClCaCl2 + Li2O = CaO + 2LiCl
CH4+O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
Cu(NO3)2 + NH4S2 = CuS2 + NH4(NO3)2Cu(NO3)2 + NH4S2 = CuS2 + NH4(NO3)2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuSO4(aq) + Ba(NO3)2(aq) = Cu(NO3)2 + BaSO4CuSO4(aq) + Ba(NO3)2(aq) = Cu(NO3)2 + BaSO4
CuSO4(aq) + AgNO3(aq) = Ag2SO4 + Cu(NO3)2CuSO4(aq) + 2AgNO3(aq) = Ag2SO4 + Cu(NO3)2
CuSO4(aq) + KCl(aq) = CuCl2 + K2SO4CuSO4(aq) + 2KCl(aq) = CuCl2 + K2SO4
CO + H2 = CH4 +H2OCO + 3H2 = CH4 + H2O
CS2 + O2 = SO3 + CO2CS2 + 4O2 = 2SO3 + CO2
Cu2S+ O2 = Cu2O +SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CO2+2NH3= NH2CONH2+H2OCO2 + 2NH3 = NH2CONH2 + H2O
C2 H 2 (g) +O 2 (g) = CO 2 (g) + H 2 O (g)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CrSO4 + NH4CO3= Cr(CO3)2 + (NH4)2SO4CrSO4 + 2NH4CO3 = Cr(CO3)2 + (NH4)2SO4
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
Co(NO3)2(aq)+H2S(g)=CoS(s)+HNO3(aq) Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CS2+Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C2H6 + O2 = H20 +CO210C2H6 + 20O2 = 3H20 + 20CO2
C3H8 + O2= CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2= CO2 + H2C3H8 + 3O2 = 3CO2 + 4H2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = H20 +CO210C2H6 + 20O2 = 3H20 + 20CO2
CO2 + H2O = C2H2 + O24CO2 + 2H2O = 2C2H2 + 5O2
CO2 + H2O = C2H2 + O24CO2 + 2H2O = 2C2H2 + 5O2
CO2 + H2O = C2H5OH + O22CO2 + 3H2O = C2H5OH + 3O2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
Cu+AgNo3=Cu(No3)2+AgCu + 2AgNo3 = Cu(No3)2 + 2Ag
C2H6 + 5O2 = 2CO2 + 3H2O2C2H6 + 5O2 = 2CO2 + 3H2O2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CO2 + NH3 = NH2CONH2 + H2OCO2 + 2NH3 = NH2CONH2 + H2O
C4H9OH + 5O2 = 4CO2 + 4H2OC4H9OH + 6O2 = 4CO2 + 5H2O
CuBr2+Mg(OH)2 = MgBr2+ Cu(OH)2CuBr2 + Mg(OH)2 = MgBr2 + Cu(OH)2
CuBr2+Mg(OH)2 = MgBr2+ Cu(OH)2CuBr2 + Mg(OH)2 = MgBr2 + Cu(OH)2
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
Cu2S + HNO3 = Cu(NO3)2 + NO + H2O + CuSO43Cu2S + 16HNO3 = 3Cu(NO3)2 + 10NO + 8H2O + 3CuSO4
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH4 + O2 =CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cr(NO3)3 + Fe2(SO4)2 = Fe(NO3)2 + Cr2(SO4)34Cr(NO3)3 + 3Fe2(SO4)2 = 6Fe(NO3)2 + 2Cr2(SO4)3
Cr(NO3)3 + Fe2(SO4)2 = Fe(NO3)2 + Cr2(SO4)34Cr(NO3)3 + 3Fe2(SO4)2 = 6Fe(NO3)2 + 2Cr2(SO4)3
CO2 + NH3 = NH2CONH2 +H2OCO2 + 2NH3 = NH2CONH2 + H2O
CO2 + NH3 = NH2CONH2 + H2OCO2 + 2NH3 = NH2CONH2 + H2O
Cr2O3+H2=Cr +H2OCr2O3 + 3H2 = 2Cr + 3H2O
C3H4+O2=CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
CO(NH2)2=HNCO +NH3CO(NH2)2 = HNCO + NH3
Cr(NO3)3 + Fe2(SO4)2 = Fe(NO3)2 + Cr2(SO4)34Cr(NO3)3 + 3Fe2(SO4)2 = 6Fe(NO3)2 + 2Cr2(SO4)3
C5H12 + O2= CO + H2C5H12 + 5O2 = 10CO + 24H
CaSO4=CaS+O2CaSO4 = CaS + 2O2
CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca(OH)2(s) = CaO(s) + 4H2O(g)Ca(OH)2(s) = CaO(s) + H2O(g)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.