Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CH3OH+O2=CH2O+H2O2CH3OH + O2 = 2CH2O + 2H2O
C6H12O6=C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
C2H3N + O2 = CO2 + H2O + NO4C2H3N + 13O2 = 8CO2 + 6H2O + 4NO
C2H3OCl + 5O2 = CO + 6H2O + Cl24C2H3OCl + 5O2 = 8CO + 6H2O + 2Cl2
CuSO4 + KCN = CuCN + K2SO4 + C2N22CuSO4 + 4KCN = 2CuCN + 2K2SO4 + C2N2
Ca3(PO4)2 + H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Ca(NO3)2 = CaO + NO2 + O22Ca(NO3)2 = 2CaO + 4NO2 + O2
C + SiO2 + Cl2 = SiCl4 + CO2C + SiO2 + 2Cl2 = SiCl4 + 2CO
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
Ca3(PO4)2 + H3PO4 = Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
Ca3(PO4)2 + H3PO4 = Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CaCN2 + H2O = CaCO3 + NH3CaCN2 + 3H2O = CaCO3 + 2NH3
Ca3(PO4)2 + SiO2 = CaSiO3 + P2O5Ca3(PO4)2 + 3SiO2 = 3CaSiO3 + P2O5
CaS + H2O + CO2 = Ca(HCO3)2 + H2SCaS + 2H2O + 2CO2 = Ca(HCO3)2 + H2S
Ca(OH)2 + P4O10 + H2O = Ca(H2PO4)22Ca(OH)2 + P4O10 + 2H2O = 2Ca(H2PO4)2
C2H4 + O2 = CO2 +H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Ca(OH)2+2Ag(NO3)=Ca(NO3)2+2Ag(OH)Ca(OH)2 + 2Ag(NO3) = Ca(NO3)2 + 2Ag(OH)
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO+H2O2C3H8 + 7O2 = 6CO + 8H2O
Ca + O2 = CaO2Ca + O2 = 2CaO
CH4 + 2O2 = CO2 + 1H2OCH4 + 2O2 = CO2 + 2H2O
CaF2 + Na2O = CaO + NaFCaF2 + Na2O = CaO + 2NaF
Ca (OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca3 (PO4)2 + SiO2 + C = P4 + CaSiO3 + CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
C6H12O6 + H2O = CH4 + CO2C6H12O6 + 0H2O = 3CH4 + 3CO2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C + H2 =CH4C + 2H2 = CH4
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
C5H12O+O2=CO2+H2O2C5H12O + 15O2 = 10CO2 + 12H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C+H2=CH4C + 2H2 = CH4
CaCrO4 (aq) + K2C2O4 (aq) = CaC2O4 (aq) + K2CrO4 (aq)CaCrO4(aq) + K2C2O4(aq) = CaC2O4(aq) + K2CrO4(aq)
CaCrO4 (aq) + K2C2O4 (aq) = CaC2O4 (s) + K2CrO4 (aq)CaCrO4(aq) + K2C2O4(aq) = CaC2O4(s) + K2CrO4(aq)
CrO3+SO3=Cr(SO4)3CrO3 + 3SO3 = Cr(SO4)3
C9H20+O2=CO2+H2OC9H20 + 14O2 = 9CO2 + 10H2O
CaO+N2O3=Ca(NO2)2CaO + N2O3 = Ca(NO2)2
CdS+Bi2(CO3)5=Cd(CO3)+Bi2S55CdS + Bi2(CO3)5 = 5Cd(CO3) + Bi2S5
CdS+Bi2(CO3)5=Cd(CO3)+Bi2S55CdS + Bi2(CO3)5 = 5Cd(CO3) + Bi2S5
Cl2+CuO=CuCl2+O22Cl2 + 2CuO = 2CuCl2 + O2
Co2O3+H2=Co+H2OCo2O3 + 3H2 = 2Co + 3H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cl2+LiF=LiCl+F2Cl2 + 2LiF = 2LiCl + F2
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu(s)+HCl(aq)=CuCl2+H2Cu(s) + 2HCl(aq) = CuCl2 + H2
C2H6+O2= CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
CaF2+Li2So4=CaSo4+LiFCaF2 + Li2So4 = CaSo4 + 2LiF
CaF2+Li2So4=CaSo4+LiFCaF2 + Li2So4 = CaSo4 + 2LiF
CaF2+Li2So4=CaSo4+LiFCaF2 + Li2So4 = CaSo4 + 2LiF
Ca3(PO4)2+SiO2+C=P4+CaSiO3+CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
C2H4O2+O2=H2O+CO2C2H4O2 + 2O2 = 2H2O + 2CO2
CaF2+Li2So4=CaSo4+LiFCaF2 + Li2So4 = CaSo4 + 2LiF
C23H52 + O2 = CO2 + H2OC23H52 + 36O2 = 23CO2 + 26H2O
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H5(NO3)3 = CO2 + N2 +H2O + O24C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
Cu+H2SO4=Cu2(SO4)3+H2O+SO22Cu + 6H2SO4 = Cu2(SO4)3 + 6H2O + 3SO2
Cu+H2SO4=Cu2(SO4)3+H2O+SO4-2Cu + 0H2SO4 = -1Cu2(SO4)3 + 0H2O + 3SO4
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CuCl + NaCO = NaCl + CuCOCuCl + NaCO = NaCl + CuCO
Cu(s) + HNO3- + H2O- (aq) = Cu(NO3)2 (aq) + NO2(g) + H2O(l)-1Cu(s) - 4HNO3- + 4H2O-(aq) = -1Cu(NO3)2(aq) - 2NO2(g) + 2H2O(l)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq) 2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CaF2+Li2So4=CaSo4+LiFCaF2 + Li2So4 = CaSo4 + 2LiF
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + AgNO3 = CuAg2 + NO3Cu + 2AgNO3 = CuAg2 + 2NO3
Ca+Pb(NO3)2=Pb+Ca(NO3)2Ca + Pb(NO3)2 = Pb + Ca(NO3)2
C7H17+O2=CO2+H2020C7H17 + 140O2 = 140CO2 + 17H20
Ca(SO4)+Sr(OH2)=Ca(OH2)+Sr(SO4)Ca(SO4) + Sr(OH2) = Ca(OH2) + Sr(SO4)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 +P4 +CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca+HoF3=Ho+CaF23Ca + 2HoF3 = 2Ho + 3CaF2
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca10F2(PO4)6+H2SO4=Ca(H2PO4)2+CaSO4+HFCa10F2(PO4)6 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
Ca(CH3COO)2 = CaCO3 + (CH3)2COCa(CH3COO)2 = CaCO3 + (CH3)2CO
Ca(CH3COO)2 = CaCO3 + (CH3)2COCa(CH3COO)2 = CaCO3 + (CH3)2CO
Cl2+LiI=LiCl+I2Cl2 + 2LiI = 2LiCl + I2
C2H3OF+O2=CO2+H2O+F24C2H3OF + 9O2 = 8CO2 + 6H2O + 2F2
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C3H8OS+O2=CO2+H2O+SO3C3H8OS + 6O2 = 3CO2 + 4H2O + SO3
C3H8(g)+O2(g) = CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C2H6+O2=CO3+H2010C2H6 + 30O2 = 20CO3 + 3H20
Cu(NO3)2(aq)+NaOH(aq) = Cu(OH)2(s)+NaNO3(aq)Cu(NO3)2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaNO3(aq)
Ca(OH)2+NH4NO3=Ca(NO3)2+NH3+H2OCa(OH)2 + 2NH4NO3 = Ca(NO3)2 + 2NH3 + 2H2O
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C7H8+O2=CO2+H2OC7H8 + 9O2 = 7CO2 + 4H2O
C6H10+O2=CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
C6H12+O2=CO2+H2OC6H12 + 9O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3CH3(g)+O2(g)=CO2(g)+H2O(g)2CH3CH3(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca3(PO4)2(s)+SiO2(s)+C(s)=CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
CH3CH2CH3(g)+O2(g)=CO2(g)+H2O(g)CH3CH2CH3(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cl2(s)+2HF(aq)=H2 + 2ClFCl2(s) + 2HF(aq) = H2 + 2ClF
CH3(CH2)7CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)7CH3(l) + 14O2(g) = 9CO2(g) + 10H2O(g)
CH3(CH2)7CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)7CH3(l) + 14O2(g) = 9CO2(g) + 10H2O(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6O2 + O2 = CO2 + H2O2C2H6O2 + 5O2 = 4CO2 + 6H2O
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
Cu(SO4) + CaCl2 = CuCl2 + Ca(SO4)Cu(SO4) + CaCl2 = CuCl2 + Ca(SO4)
Cu(SO4) + CaCl2 = CuCl2 + Ca(SO4)Cu(SO4) + CaCl2 = CuCl2 + Ca(SO4)
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CH4+O2=CH3OH2CH4 + O2 = 2CH3OH
CO+O2=CO22CO + O2 = 2CO2
CH4+O2=CO+H2O2CH4 + 3O2 = 2CO + 4H2O
CH4(g) + O2(g) = CO2 (g) + H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
Cl2(g) + KBr(aq) = Br2(l) + KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
Co(s) +S(s)= Co2S3(s)2Co(s) + 3S(s) = Co2S3(s)
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C11H9+O2=CO2+H2O4C11H9 + 53O2 = 44CO2 + 18H2O
Ca(CO3)+Na2SO3=CaSO3+Na2CO3Ca(CO3) + Na2SO3 = CaSO3 + Na2CO3
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C5H11OH+O2=CO2+H2010C5H11OH + 45O2 = 50CO2 + 6H20
C8H16(g)+O2(g)=H2O(g)+CO2C8H16(g) + 12O2(g) = 8H2O(g) + 8CO2
C12H22O11(s) + O2(g) =CO2(g) + H2O(g)C12H22O11(s) + 12O2(g) = 12CO2(g) + 11H2O(g)
Cr + O2 = Cr2O34Cr + 3O2 = 2Cr2O3
CaSiO3(s) + HF(aq) =CaF2(aq) + SiF4(g) + H2O(l)CaSiO3(s) + 6HF(aq) = CaF2(aq) + SiF4(g) + 3H2O(l)
CaO(s) + H2O(l) =Ca(OH)2(s)CaO(s) + H2O(l) = Ca(OH)2(s)
C(s)+H2(g)+O2(g)=C7H16O9(s)14C(s) + 16H2(g) + 9O2(g) = 2C7H16O9(s)
CH3CH2OH + O2 = H20 + CH3COOH10CH3CH2OH + 5O2 = H20 + 10CH3COOH
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
Ca(NO3)2+K3PO4(aq)=Ca3(PO4)2(s)+KNO3(aq)3Ca(NO3)2 + 2K3PO4(aq) = Ca3(PO4)2(s) + 6KNO3(aq)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Ca(OH)2 + CO2= CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
C + O2 = CO2C + O2 = 2CO
C + O2 = CO2C + O2 = 2CO
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C4H10S2 + O2 = CO2 + H2O + SO32C4H10S2 + 19O2 = 8CO2 + 10H2O + 4SO3
C2H3OF + 2O2 = CO2 + H2O + HFC2H3OF + 2O2 = 2CO2 + H2O + HF
Ca3(PO4)2+SiO2+C=CaSiO2+CO+P42Ca3(PO4)2 + 6SiO2 + 16C = 6CaSiO2 + 16CO + P4
Ca3(PO4)2+SiO2+C=CaSiO2+CO+PCa3(PO4)2 + 3SiO2 + 8C = 3CaSiO2 + 8CO + 2P
Ca3(PO4)2+SiO2+C=CaSiO2+CO+PCa3(PO4)2 + 3SiO2 + 8C = 3CaSiO2 + 8CO + 2P
C4H10S2 + O2 = CO2 + H2O + SO32C4H10S2 + 19O2 = 8CO2 + 10H2O + 4SO3
C2H4O2 + O2 = CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C3H6O3 + O2 = CO2 + H2OC3H6O3 + 3O2 = 3CO2 + 3H2O
Ca(OH)2(aq) + 2HCl(aq)=CaCl2(aq) + 2H2O(l)Ca(OH)2(aq) + 2HCl(aq) = CaCl2(aq) + 2H2O(l)
Ca3(PO4)2 + 3H2SO4 = CaSO4 + H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
COCl2 + H2O = CO2 + HClCOCl2 + H2O = CO2 + 2HCl
COCl2 + H2O = CO2 + HClCOCl2 + H2O = CO2 + 2HCl
C6H6OS + 17O2 = CO2 + 6H2O + SO32C6H6OS + 17O2 = 12CO2 + 6H2O + 2SO3
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C10H16O2+O2=CO2+H2OC10H16O2 + 13O2 = 10CO2 + 8H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cr+CuSO4 =Cu+ Cr2(SO4)32Cr + 3CuSO4 = 3Cu + Cr2(SO4)3
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C5H10 + O2 = CO2 + H2O2C5H10 + 15O2 = 10CO2 + 10H2O
Ca+CO3=CaCO3Ca + CO3 = CaCO3
Cu2As2O7 + Zn +H2SO4 = Cu + AsH3 +ZnSO4+ H2OCu2As2O7 + 10Zn + 10H2SO4 = 2Cu + 2AsH3 + 10ZnSO4 + 7H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2+O2=CO2+H2010C2H2 + 20O2 = 20CO2 + H20
C+O2=5CO2C + O2 = CO2
Cr(ClO3)5 = CrCl5 + O22Cr(ClO3)5 = 2CrCl5 + 15O2
C6H14(g)+O2(g)=CO2(g) + H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
C(s) + O2(g) =CO(g)2C(s) + O2(g) = 2CO(g)
C9H20(g)+O2(g)=CO2(g) +H2O(g)C9H20(g) + 14O2(g) = 9CO2(g) + 10H2O(g)
CH4(g) + O2(g) = CO2(g) + H2O(l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
C8H18(l) + O2(g) = CO2(g) + H2O(l)2C8H18(l) + 25O2(g) = 16CO2(g) + 18H2O(l)
C3H8(g) + O2(g) = CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4(g)+O2(g) =CO2+H2OCH4(g) + 2O2(g) = CO2 + 2H2O
Cu +H2O =CuOH+H22Cu + 2H2O = 2CuOH + H2
Cu +H2O =CuOH+H22Cu + 2H2O = 2CuOH + H2
CH4=C +H2CH4 = C + 2H2
CI2 + 2KI = KCI + KI0CI2 + KI = 0KCI + KI
CaCl2+Cr (NO3)3=Ca (NO3)2+CrCl33CaCl2 + 2Cr(NO3)3 = 3Ca(NO3)2 + 2CrCl3
CrCl3+H2SO4=Cr 2(SO4)3+HCl2CrCl3 + 3H2SO4 = Cr2(SO4)3 + 6HCl
C2H5NSCl+O2=CO+H2O+NO+SO2+HCl2C2H5NSCl + 7O2 = 4CO + 4H2O + 2NO + 2SO2 + 2HCl
Ca3(PO4)2 + SiO2 + C=CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca + ScF3 = Sc + CaF23Ca + 2ScF3 = 2Sc + 3CaF2
C2H3NO2S + O2=CO2 + H2O + NO2 + SO34C2H3NO2S + 17O2 = 8CO2 + 6H2O + 4NO2 + 4SO3
CH4 + O2 = CO +H2O2CH4 + 3O2 = 2CO + 4H2O
C2H7N + O2 = CO2 + H2O + NO24C2H7N + 19O2 = 8CO2 + 14H2O + 4NO2
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C2H5F + O2 = CO2 + H2O + F24C2H5F + 13O2 = 8CO2 + 10H2O + 2F2
C6H6S2 + O2 =CO2 + H2O + SO32C6H6S2 + 21O2 = 12CO2 + 6H2O + 4SO3
CH2Br2 + O2 = CO2 + H2O + Br22CH2Br2 + 3O2 = 2CO2 + 2H2O + 2Br2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H6O2S + O2 = CO2 + H2O + SO3C3H6O2S + 5O2 = 3CO2 + 3H2O + SO3
C2H5N + O2 = CO2 + H2O + NO24C2H5N + 17O2 = 8CO2 + 10H2O + 4NO2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H3O2F+O2=CO+H2O+HF2C2H3O2F + O2 = 4CO + 2H2O + 2HF
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4+H2O+CO2=CH3OH3CH4 + 2H2O + CO2 = 4CH3OH
Ca + AlCl3 = CaCl2 + Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
C6H12O6=6C+6H2+3O2C6H12O6 = 6C + 6H2 + 3O2
C6H12O6=6C+6H2+3O2C6H12O6 = 6C + 6H2 + 3O2
CO+O2= CO22CO + O2 = 2CO2
CO2+O2= CO2CO2 + 0O2 = CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + Cl2 = CCl4+ HClCH4 + 4Cl2 = CCl4 + 4HCl
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cu3PO4(aq)+Fe(s) = Cu(s)+FePO4Cu3PO4(aq) + Fe(s) = 3Cu(s) + FePO4
Cu3PO4(aq)+Fe(s) = Cu(s)+FePO4Cu3PO4(aq) + Fe(s) = 3Cu(s) + FePO4
CH4 + O2 = CO2 + HCH4 + O2 = CO2 + 4H
CuO + NH4NO3 = Cu(NO3)2 + NH3 + H2OCuO + 2NH4NO3 = Cu(NO3)2 + 2NH3 + H2O
C3H8 +O2 =CO2 +H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CuO+NH4NO3=Cu(NO3)2+NH3+H2OCuO + 2NH4NO3 = Cu(NO3)2 + 2NH3 + H2O
Cu+HNO3=NO+Cu(NO3)2+H2O3Cu + 8HNO3 = 2NO + 3Cu(NO3)2 + 4H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CuCO3+HCl=CuCl2+H2O+CO2CuCO3 + 2HCl = CuCl2 + H2O + CO2
Cu(CNS)=Cu2S+CS2+N2+(CN)28Cu(CNS) = 4Cu2S + 2CS2 + N2 + 3(CN)2
Ca(CH3CO2)2 + LiF = CaF2 + Li(CH3CO2)Ca(CH3CO2)2 + 2LiF = CaF2 + 2Li(CH3CO2)
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C2H5OH +O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2OC5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O
C3H6+O2=CO2+H2010C3H6 + 30O2 = 30CO2 + 3H20
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C2H4(g) + O2(g) = CO2(g) + H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C2H4(g) + O2(g)=CO(g) + H2O(g)C2H4(g) + 2O2(g) = 2CO(g) + 2H2O(g)
C2H4(g) + O2(g)= C(s) + H2O(g)C2H4(g) + O2(g) = 2C(s) + 2H2O(g)
Ca(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O Ca(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CO+O2=CO22CO + O2 = 2CO2
C2 3H + O2 = CO2 + H2O4C23H + 93O2 = 92CO2 + 2H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
C2H6(g)+O2(g)=CO2(g)+H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
CO2+KOH=K2CO3+H2OCO2 + 2KOH = K2CO3 + H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C + O2 = CO2C + O2 = CO2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cu+NH3=Cu(NH3)4Cu + 4NH3 = Cu(NH3)4
C5H10O2(l)+O2(g)=CO2(g)+H2O(g) 2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH3OH +O2 (g) = CO2 + H2O 2CH3OH + 3O2(g) = 2CO2 + 4H2O
CS2+NaOH=Na2CS3+Na2CO3+H2O3CS2 + 6NaOH = 2Na2CS3 + Na2CO3 + 3H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g) 2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C4H4 + O2= CO2 + H2OC4H4 + 5O2 = 4CO2 + 2H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CH2CHCH3 + NH3 + O2 = CH2CHCN+ H2O2CH2CHCH3 + 2NH3 + 3O2 = 2CH2CHCN + 6H2O
CO+O2=CO22CO + O2 = 2CO2
Cr + H3PO4 = CrPO4 + H22Cr + 2H3PO4 = 2CrPO4 + 3H2
Ca(OH)2 + HBr = CaBr2 + H2OCa(OH)2 + 2HBr = CaBr2 + 2H2O
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CS2 + O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l) 3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C2H6O+O2=CO2+H2010C2H6O + 15O2 = 20CO2 + 3H20
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
ClO2+Fe=ClO4+Fe0ClO2 + Fe = 0ClO4 + Fe
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C3H5N3O9(l) = CO2(g) + N2(g) + H2O(g) + O2(g)4C3H5N3O9(l) = 12CO2(g) + 6N2(g) + 10H2O(g) + O2(g)
Ca(OH)2+(NH4)2SO4=CaSO4+NH4OHCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH4OH
Cu + HNO3 = (NO3)2Cu + NO2 + H2OCu + 4HNO3 = (NO3)2Cu + 2NO2 + 2H2O
CH4 + NH3 = H2 + C2N22CH4 + 2NH3 = 7H2 + C2N2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4+CO2+2NH3=C2H2N2+3H2OCH4 + 3CO2 + 4NH3 = 2C2H2N2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2 + SiO2 + C = P + CaSiO3 + COCa3(PO4)2 + 3SiO2 + 5C = 2P + 3CaSiO3 + 5CO
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C4H10 + O2 = H2O + CO22C4H10 + 13O2 = 10H2O + 8CO2
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca + AlCl3 = Al + CaCl23Ca + 2AlCl3 = 2Al + 3CaCl2
CaCl2+Na2SO4=NaCl+CaSO4CaCl2 + Na2SO4 = 2NaCl + CaSO4
C25H52+O2=H2O+CO2C25H52 + 38O2 = 26H2O + 25CO2
Ca3(PO4)2 +SiO2 +C=CaSiO3+CO+P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CuSO4*5H2O = CuSO4 + H2OCuSO4*5H2O = CuSO4 + 5H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CaF2 + Al2O3 + HCl = H2O + CaCl2 + AlF33CaF2 + Al2O3 + 6HCl = 3H2O + 3CaCl2 + 2AlF3
CaF2 + Al2O3 + HCl = H2O + CaCl2 + AlF33CaF2 + Al2O3 + 6HCl = 3H2O + 3CaCl2 + 2AlF3
CO2H12O6+O2=CO2 +H2OCO2H12O6 + 0O2 = CO2 + 6H2O
C6H12O6+H2O=CH3COO-+CO2+H2C6H12O6 + 6H2O = 0CH3COO- + 6CO2 + 12H2
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Ca2 + PO4 = Ca3(PO4)2 3Ca2 + 4PO4 = 2Ca3(PO4)2
Ca(NO3)2 = Ca2 + NO32Ca(NO3)2 = Ca2 + 4NO3
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H3F3+O3=CO2+H2O+F26C2H3F3 + 11O3 = 12CO2 + 9H2O + 9F2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu5+O2=2CuO2Cu5 + 5O2 = 10CuO
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H3F3+O3=CO2+H2O+F26C2H3F3 + 11O3 = 12CO2 + 9H2O + 9F2
C2H3F3+O3=CO2+H2O+F26C2H3F3 + 11O3 = 12CO2 + 9H2O + 9F2
Ca(OH)2 + NaHCO3 = CaCO3 + H2O + Na2CO3Ca(OH)2 + 2NaHCO3 = CaCO3 + 2H2O + Na2CO3
Ca(OH)2 + NaHCO3 = CaCO3 + H2O + NaOHCa(OH)2 + NaHCO3 = CaCO3 + H2O + NaOH
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
CuSO4+Fe=FeSO4+CuCuSO4 + Fe = FeSO4 + Cu
Cs+N=Cs3N3Cs + N = Cs3N
Cs+N2=Cs3N6Cs + N2 = 2Cs3N
Cs+N=Cs3N3Cs + N = Cs3N
Cs+N=Cs3N3Cs + N = Cs3N
C4H10+O2 = CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6O+O2 = CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cl2+ NaI= NaCl2+I22Cl2 + 2NaI = 2NaCl2 + I2
C4H12+O2=CO2+H205C4H12 + 20O2 = 20CO2 + 3H20
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8(g) + 5 O2(g) =3 CO2(g) + 4 H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
Cl2(g) + C10H16(l) =C(s) +HCl(g)8Cl2(g) + C10H16(l) = 10C(s) + 16HCl(g)
CH3CO2H+Ni(OH)2=Ni(CH3CO2)2+H2O2CH3CO2H + Ni(OH)2 = Ni(CH3CO2)2 + 2H2O
C4H8O(l) + O2(g) = CO2(g) + H2O(l) 2C4H8O(l) + 11O2(g) = 8CO2(g) + 8H2O(l)
C4H8O(l) + O2(g) = CO2(g) + H2O(l) 2C4H8O(l) + 11O2(g) = 8CO2(g) + 8H2O(l)
C4H10S2 + O2 = CO2 + H2O + SO32C4H10S2 + 19O2 = 8CO2 + 10H2O + 4SO3
C4H10S2 + O2 = CO2 + H2O + SO32C4H10S2 + 19O2 = 8CO2 + 10H2O + 4SO3
CaH2 + H2O = Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Cl2+H2O=HCl+HClO33Cl2 + 3H2O = 5HCl + HClO3
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CH3(CH2)6CH3+O2 = CO2 +H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4+ O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CoBr2(aq) + K2CO3(aq) = CoCO3(s) + 2KBr(aq)CoBr2(aq) + K2CO3(aq) = CoCO3(s) + 2KBr(aq)
C2H6O+ O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca(NO3)2+ Fe2(SO4)3 =CaSO4 + Fe(NO3)33Ca(NO3)2 + Fe2(SO4)3 = 3CaSO4 + 2Fe(NO3)3
C8H10N4O2 (s)+O2 (g) =CO2 (g)+H2O(g)+NO2 (g)2C8H10N4O2(s) + 27O2(g) = 16CO2(g) + 10H2O(g) + 8NO2(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO + H2 = CH3OHCO + 2H2 = CH3OH
CH2CHCHO +O2 = CO2 + H2O2CH2CHCHO + 7O2 = 6CO2 + 4H2O
Ca(NO3)2 + Al(OH)3 = Ca(OH)2 + Al(NO3)33Ca(NO3)2 + 2Al(OH)3 = 3Ca(OH)2 + 2Al(NO3)3
Ca(NO3)2 + Al(OH)3 = Ca(OH)2 + Al(NO3)33Ca(NO3)2 + 2Al(OH)3 = 3Ca(OH)2 + 2Al(NO3)3
CCl4(aq) + HCl = CHCl3(aq) + Cl2CCl4(aq) + HCl = CHCl3(aq) + Cl2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
ClO+HNO2=HNO3+ClClO + HNO2 = HNO3 + Cl
ClO+HNO2=HNO3+ClClO + HNO2 = HNO3 + Cl
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H202C4H10 + 8O2 = 8CO2 + H20
CO + IO2 = I2 + CO24CO + 2IO2 = I2 + 4CO2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2=CO+H2OC2H4 + 2O2 = 2CO + 2H2O
C2H4+O2=C+H2OC2H4 + O2 = 2C + 2H2O
CuO + NH3 = N2 + H2O + Cu3CuO + 2NH3 = N2 + 3H2O + 3Cu
Cl2 + Na2CO3 + H2O = NaHCO3 + NaCl + Cl2O 2Cl2 + 2Na2CO3 + H2O = 2NaHCO3 + 2NaCl + Cl2O
Cu+2H2SO4=CuSO4+SO2+2H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CaOH+FePO4=FeOH+CaPO4CaOH + FePO4 = FeOH + CaPO4
CaOH+FePO4=FeOH+CaPO4CaOH + FePO4 = FeOH + CaPO4
Cu2O+O2=CuO2Cu2O + O2 = 4CuO
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C+O2=CO2C + O2 = CO2
C+2H2O=2H2+CO2C + 2H2O = 2H2 + CO2
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C5H10O2 + O2 = 5CO2 + 5H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CO + O2 = CO22CO + O2 = 2CO2
Cu(II)Cl + NaNOH = Cu(II)NOH +NaClCu(II)Cl + NaNOH = Cu(II)NOH + NaCl
CuCl2+NaNO3=Cu(NO3)2+NaClCuCl2 + 2NaNO3 = Cu(NO3)2 + 2NaCl
CuCl2+NaNO3=Cu(NO3)2+NaClCuCl2 + 2NaNO3 = Cu(NO3)2 + 2NaCl
CS2+Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
CaCl2+Cr(NO3)3=Ca(NO3)2+CrCl33CaCl2 + 2Cr(NO3)3 = 3Ca(NO3)2 + 2CrCl3
CuO+NH3=Cu+H2O+N23CuO + 2NH3 = 3Cu + 3H2O + N2
CrCl3+H2SO4=Cr2(SO4)3+HCl2CrCl3 + 3H2SO4 = Cr2(SO4)3 + 6HCl
C4H10 +O2 =CO2 +H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + HBr=CaBr2 + H2OCa(OH)2 + 2HBr = CaBr2 + 2H2O
C3H3+O2=CO2+H2020C3H3 + 60O2 = 60CO2 + 3H20
C4H8S +7O2=4CO2 +4H2O+SO2C4H8S + 7O2 = 4CO2 + 4H2O + SO2
C4H8S +O2=CO2 +H2O+SO2C4H8S + 7O2 = 4CO2 + 4H2O + SO2
C4H8S +O2=CO2 +H2O+SO2C4H8S + 7O2 = 4CO2 + 4H2O + SO2
C3H8+O2=CO2+H205C3H8 + 15O2 = 15CO2 + 2H20
C5H10 +O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C6H14O +O2 = CO2 +H2OC6H14O + 9O2 = 6CO2 + 7H2O
C6H14O +O2 = CO2 +H2OC6H14O + 9O2 = 6CO2 + 7H2O
CaCO3+HCl = CO2+CaCl2+H2OCaCO3 + 2HCl = CO2 + CaCl2 + H2O
CaCO3+HCl = CO2+CaCl2+H2OCaCO3 + 2HCl = CO2 + CaCl2 + H2O
C6H10O5+O2=CO2+H2OC6H10O5 + 6O2 = 6CO2 + 5H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
C6H1206+O2=H2O=CO22C6H1206 + 615O2 = 1206H2O + 12CO2
CH3CH2OC+O2=H2O+CH3COOH4CH3CH2OC + 3O2 = -2H2O + 6CH3COOH
CH3CH2OC+O2=H2O+CH3COOH4CH3CH2OC + 3O2 = -2H2O + 6CH3COOH
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaO+2HCl=CaCl2+H2OCaO + 2HCl = CaCl2 + H2O
Cu + O = CuOCu + O = CuO
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl+H=HClCl + H = HCl
Cl+H=HClCl + H = HCl
Cl+H=HClCl + H = HCl
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4 + NH3 = H2 + C2N22CH4 + 2NH3 = 7H2 + C2N2
CS2+Cl=CCl4+S2Cl2CS2 + 6Cl = CCl4 + S2Cl2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2 + O2 = CO2 +H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CS2+Cl=CCl4+S2Cl2CS2 + 6Cl = CCl4 + S2Cl2
CO2=C+OCO2 = C + 2O
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
Cu+HNO3= Cu (NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3COOH + Li2CO3 = Li2CO + H2O + CO2CH3COOH + 2Li2CO3 = 2Li2CO + 2H2O + 2CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O = CO2 + H2OC4H10 + 13O = 4CO2 + 5H2O
CH3(CH2)2CH3+O2=CO2+H202CH3(CH2)2CH3 + 8O2 = 8CO2 + H20
CaCl2+NaHCO3=NaCl+CaCO3+CO2+H2OCaCl2 + 2NaHCO3 = 2NaCl + CaCO3 + CO2 + H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu+HNO3=CuN2O6+NO+H2O3Cu + 8HNO3 = 3CuN2O6 + 2NO + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CI+KI=KCI+I22CI + 2KI = 2KCI + I2
CO(g)+H2(g)=C8H18(l)+H2O8CO(g) + 17H2(g) = C8H18(l) + 8H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
Ca+O2=CaO2Ca + O2 = 2CaO
C5H6O+ O2 = CO2 +H2OC5H6O + 6O2 = 5CO2 + 3H2O
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
Cu+HNO3=Cu(NO3)2+NO2+HCu + 2HNO3 = Cu(NO3)2 + 0NO2 + 2H
C(s) + H2(g) + O2(g) = CH2O(l) 2C(s) + 2H2(g) + O2(g) = 2CH2O(l)
C2H60 + O2 = CO2 + H2OC2H60 + 17O2 = 2CO2 + 30H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)7CH3 + O2 = CO2 + H2OCH3(CH2)7CH3 + 14O2 = 9CO2 + 10H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cl2(g) +C10H16(l) =C(s) +HCl(g)8Cl2(g) + C10H16(l) = 10C(s) + 16HCl(g)
CrF3(aq) + Ba(MnO4)2(aq) =BaF2(aq) +Cr(MnO4)3(s) 2CrF3(aq) + 3Ba(MnO4)2(aq) = 3BaF2(aq) + 2Cr(MnO4)3(s)
CH3(CH2)CH3 + O2 = CO2 + H2OCH3(CH2)CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2OH(l)+O2(g)=CH3CHO(aq)+H2O(l)2CH3CH2OH(l) + O2(g) = 2CH3CHO(aq) + 2H2O(l)
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
C4H8+O2=CO2+H2OC4H8 + 6O2 = 4CO2 + 4H2O
Cu +H2SO4 = Cu2(SO4)2 + H2O + SO22Cu + 4H2SO4 = Cu2(SO4)2 + 4H2O + 2SO2
C2H5O+O2=CO2+H2O4C2H5O + 11O2 = 8CO2 + 10H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuS+HNO3=Cu(NO3)2+S+H2O+NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CaCO3 +H3PO4 = Ca3(PO4)2 + CO2 +3H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CaSO4 + AlBr3 = CaBr2 + Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CaSO4 + AlBr3=CaBr2 + Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
CaCO3 + H2SO4 = CaSO4 + H2O +CO2CaCO3 + H2SO4 = CaSO4 + H2O + CO2
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CO2+H2O=H2CO3CO2 + H2O = H2CO3
Ca + SbCl2 = CaCl2 + SbCa + SbCl2 = CaCl2 + Sb
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C2H2+H2=C2H6C2H2 + 2H2 = C2H6
Cl2 + Al = AlCl33Cl2 + 2Al = 2AlCl3
Ca + O2 = CaO2Ca + O2 = 2CaO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.