Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CH3CH2CH2CH3+O2=CO2+H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C5H12+O2=H2O+CO2C5H12 + 8O2 = 6H2O + 5CO2
CoSO4(aq) + (NH4)3PO4(aq) = Co3(PO4)2(aq) + (NH4)2SO4(aq)3CoSO4(aq) + 2(NH4)3PO4(aq) = Co3(PO4)2(aq) + 3(NH4)2SO4(aq)
CH3COOH(l)+O2(g)=CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CH3COOH(l)+O2(g)=CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H9OH + O2 = CO2 + H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CO + I2O5 = CO2 + I25CO + I2O5 = 5CO2 + I2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
Cs2SO4 + Hg2(NO3)2 = CsNO3 + Hg2SO4Cs2SO4 + Hg2(NO3)2 = 2CsNO3 + Hg2SO4
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
CO + H2O = CO2 + HCO + H2O = CO2 + 2H
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
CL + H2O = HCL + HCLO36CL + 3H2O = 5HCL + HCLO3
CL + H2O = HCL + HCLO36CL + 3H2O = 5HCL + HCLO3
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Ca(PO4)2 + SiO2 + C = CaSiO3 + CO+ PCa(PO4)2 + SiO2 + 7C = CaSiO3 + 7CO + 2P
C3H6 + O2 = CO2 +H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca + Na2SO4 = CaSO4 + NaCa + Na2SO4 = CaSO4 + 2Na
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C2H5OH+O2=2CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H2 (g) + O2 (g) = CO2 (g) + H2O2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O
CH3CH2CH2CH3 + O2 = CO2 + H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C10H22 + 31O2 = 20CO2 + 22H2O2C10H22 + 31O2 = 20CO2 + 22H2O
Ca2Mg5Si8O22(OH)2+CaMg(CO3)2=Mg2SiO4+CaCO3+H2O+CO2Ca2Mg5Si8O22(OH)2 + 11CaMg(CO3)2 = 8Mg2SiO4 + 13CaCO3 + H2O + 9CO2
Ca2Mg3Al4Si6O22(OH)2+CaCO3+SiO2=CaMgSi2O6+CaAl2Si2O8+H2O+CO2Ca2Mg3Al4Si6O22(OH)2 + 3CaCO3 + 4SiO2 = 3CaMgSi2O6 + 2CaAl2Si2O8 + H2O + 3CO2
Ca2Mg3Al4Si6O22(OH)2+CaCO3+SiO2=CaMgSi2O6+CaAl2Si2O8+H2O+CO2Ca2Mg3Al4Si6O22(OH)2 + 3CaCO3 + 4SiO2 = 3CaMgSi2O6 + 2CaAl2Si2O8 + H2O + 3CO2
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
C2H5NH2+O2=CO2+H20+N220C2H5NH2 + 40O2 = 40CO2 + 7H20 + 10N2
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C3H5NO + O2 = CO2 + NO2 + H2O4C3H5NO + 19O2 = 12CO2 + 4NO2 + 10H2O
C3H5NO + O2 = CO2 + NO2 + H2O4C3H5NO + 19O2 = 12CO2 + 4NO2 + 10H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 =1 CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H6+CoF3=C3F6+HF+CoF2C3H6 + 12CoF3 = C3F6 + 6HF + 12CoF2
C5H12 + O2 = H2O + CO2C5H12 + 8O2 = 6H2O + 5CO2
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
CaCl2+Na2CO3=CaCO3+NaClCaCl2 + Na2CO3 = CaCO3 + 2NaCl
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH5N + O2 = 4CO2 + H2O + 4NO4CH5N + 11O2 = 4CO2 + 10H2O + 4NO
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C6H6O + 4O2 = 6CO + H2OC6H6O + 4O2 = 6CO + 3H2O
Cu2As2O7+Zn+H2SO4=Cu AsH3+ZnSO4+H2OCu2As2O7 + 10Zn + 10H2SO4 = 2CuAsH3 + 10ZnSO4 + 7H2O
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 (aq) + HNO3 (aq) = Ca(NO3)2 (aq) + H2OCa(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O
CO + I2 O5 = CO2 + I25CO + I2O5 = 5CO2 + I2
CH3((CH2)7)CH3+O2=CO2+H2OCH3((CH2)7)CH3 + 14O2 = 9CO2 + 10H2O
C3H6O + 4O2=CO2 + 3H2OC3H6O + 4O2 = 3CO2 + 3H2O
CoCO3 +ACAC +H2O2 = Co(ACAC)3 + H2O +CO2CoCO3 + 3ACAC - H2O2 = Co(ACAC)3 - H2O + CO2
CoS2+O2=Co2O3+SO24CoS2 + 11O2 = 2Co2O3 + 8SO2
CoBr3 + CaSO4 = CaBr2 + Co2 (SO4)32CoBr3 + 3CaSO4 = 3CaBr2 + Co2(SO4)3
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CuO + HCl = H2O + CuCl2CuO + 2HCl = H2O + CuCl2
CuO + HCl = H2O + CuCl2CuO + 2HCl = H2O + CuCl2
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cu(OH)2 = CuO + H2OCu(OH)2 = CuO + H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cu(NO3)2 + NaOH = Cu(OH)2 + NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
C5H8O2+NaH+HCl=C5H12O2+NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
CrCl3 + Ag(NO3)3 = Cr(NO3)3 + Ag Cl3CrCl3 + Ag(NO3)3 = Cr(NO3)3 + AgCl3
C4H8 (OH) 2 + O2 = CO2 + H2O2C4H8(OH)2 + 11O2 = 8CO2 + 10H2O
C7H9+HNO3=C7H6(NO2)3+H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
Ca(NO3)2 + Na2SO4 = CaSO4 + NaNO3Ca(NO3)2 + Na2SO4 = CaSO4 + 2NaNO3
Ca3(PO4)2+SiO2+C=CaSiO3+CO+PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
Ca3P2 + H2O = Ca (OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
C+Fe2O3=Fe+CO3C + Fe2O3 = 2Fe + 3CO
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu(OH)2(s)+2HClO4(aq)=Cu(ClO4)2(aq)+H2O(l)Cu(OH)2(s) + 2HClO4(aq) = Cu(ClO4)2(aq) + 2H2O(l)
C2H6+O2=CO+2H2O2C2H6 + 5O2 = 4CO + 6H2O
Ca(s)+HCl(aq)=CaCl + H22Ca(s) + 2HCl(aq) = 2CaCl + H2
Cr+2 + Al = Cr + Al+33Cr+2 + 2Al = 3Cr + 2Al+3
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C4H6 + O2 = CO2 + H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C3H4+O2=CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl2+AlI3=AlCl3+I23Cl2 + 2AlI3 = 2AlCl3 + 3I2
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C+O2=CO2C + O2 = CO2
CH3COOH + NaHCO3 = CH3COONa + CO2 + H2O CH3COOH + NaHCO3 = CH3COONa + CO2 + H2O
C2H6O + O2 = CO2 + H2010C2H6O + 15O2 = 20CO2 + 3H20
C2H6O + O2 = CO2 + H2010C2H6O + 15O2 = 20CO2 + 3H20
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
Cs2S + Be(NO3)2 = 2Cs(NO3) + 2BeSCs2S + Be(NO3)2 = 2Cs(NO3) + BeS
Cu(C2H3O2)2 + Na2CO3= CuCO3 + NaC2H3O2Cu(C2H3O2)2 + Na2CO3 = CuCO3 + 2NaC2H3O2
CuCO3=Cu2O2+CO22CuCO3 = Cu2O2 + 2CO2
CO2 + H20 = C6H12O6 + O230CO2 + 3H20 = 5C6H12O6 + 15O2
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C3H6 + O2 =CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C6H5Cl + SiCl4 + Na = (C6H5)4Si + NaCl4C6H5Cl + SiCl4 + 8Na = (C6H5)4Si + 8NaCl
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu+Cl2=CuCl2Cu + Cl2 = CuCl2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca+AlF3=CaF2+Al3Ca + 2AlF3 = 3CaF2 + 2Al
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
Cu+H2O=CuO+H2Cu + H2O = CuO + H2
C2H8N2+2N2O4=2N2+2CO2+4H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CaC2+2H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C2H4+O2 = CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca(OH)2+Al2(SO4)3 = CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
Co(s) + H2SO4(aq) = Co2(SO4)3(aq) + H2(g)2Co(s) + 3H2SO4(aq) = Co2(SO4)3(aq) + 3H2(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+O2=CuO2Cu + O2 = 2CuO
CH3COOH+PCl3=CH3COCl+H3PO33CH3COOH + PCl3 = 3CH3COCl + H3PO3
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C7H6O3+CH3OH=C8H8O3+H2OC7H6O3 + CH3OH = C8H8O3 + H2O
CH3CH2NH2 + O2 = CO2 + H2O + N24CH3CH2NH2 + 15O2 = 8CO2 + 14H2O + 2N2
CH4+4O=2H2O+CO2CH4 + 4O = 2H2O + CO2
CH4+2O2=2H2O+CO2CH4 + 2O2 = 2H2O + CO2
CH4+O=CO2 + H2OCH4 + 4O = CO2 + 2H2O
Cu(NO3)2+ (NH4)2CO3= Cu2(CO3)2+NH4NO32Cu(NO3)2 + 2(NH4)2CO3 = Cu2(CO3)2 + 4NH4NO3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(s) + HNO3(aq) = Cu(NO3)2(aq) + NO(g) + H2O(l)3Cu(s) + 8HNO3(aq) = 3Cu(NO3)2(aq) + 2NO(g) + 4H2O(l)
C2H6+ O2=CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+ O2=CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Ca(OH)2 + H3PO4 = Ca(PO4) + O2H2H3Ca(OH)2 + H3PO4 = Ca(PO4) + O2H2H3
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca + P = CaPCa + P = CaP
C6H12O6+O2=6CO2+6H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CaCl2+Na2SO4=CaSO4+NaClCaCl2 + Na2SO4 = CaSO4 + 2NaCl
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(HCO3)2=CuCO3+H2O+CO2Cu(HCO3)2 = CuCO3 + H2O + CO2
Cr + H2(SO4) =Cr2(SO4)3 + H22Cr + 3H2(SO4) = Cr2(SO4)3 + 3H2
CO2+2NH2OH=CO+N2+3H2OCO2 + 2NH2OH = CO + N2 + 3H2O
CuCl2 +AgNO3 = CuNO3 +AgCl2CuCl2 + AgNO3 = CuNO3 + AgCl2
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CuCl2 + NaOH = CuOH + NaCl2CuCl2 + NaOH = CuOH + NaCl2
Ca(NO3)2 + NiCl2 = CaCl2 + Ni(NO3)2Ca(NO3)2 + NiCl2 = CaCl2 + Ni(NO3)2
Co(NO3)2+H2S=CoS+HNO3Co(NO3)2 + H2S = CoS + 2HNO3
Cu2+ + P + H2O = H2PO4- +H+ +Cu5Cu2+ + P + 4H2O = H2PO4- + 6H+ + 10Cu
Ca(NO3)2 + Na2CO3 = CaCO3 + NaNO3Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3
C5H9O+O2 = CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C+O=CO2C + 2O = CO2
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Co(NO3)2+H2S=CoS+HNO3Co(NO3)2 + H2S = CoS + 2HNO3
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C5H9OH + O2 = CO2 + H2OC5H9OH + 7O2 = 5CO2 + 5H2O
C5H10 + O2 = CO2 + H2O2C5H10 + 15O2 = 10CO2 + 10H2O
CuI2(aq) + (NH4)2CO3(aq)= CuCO3(s) + 2NH4I(aq)CuI2(aq) + (NH4)2CO3(aq) = CuCO3(s) + 2NH4I(aq)
CuSO4+Al=Al2(SO4)3+Cu3CuSO4 + 2Al = Al2(SO4)3 + 3Cu
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
Ca(OH)2 +CH3CO2H=Ca(CH3CO2)2 + H2OCa(OH)2 + 2CH3CO2H = Ca(CH3CO2)2 + 2H2O
Cu+ O2 = CuO2Cu + O2 = CuO2
CuSO4+Al=Al2(SO4)3+Cu3CuSO4 + 2Al = Al2(SO4)3 + 3Cu
C6H6+O2=CO+H2O2C6H6 + 9O2 = 12CO + 6H2O
CO2+CaSiO3+H2O=SiO2+Ca (HCO3) 22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
Cu+ O2 = CuO2Cu + O2 = CuO2
Cr2O3+CO=Cr+CO2Cr2O3 + 3CO = 2Cr + 3CO2
C2H8N2+2N2O4=2N2+2CO2+4H205C2H8N2 + 5N2O4 = 10N2 + 10CO2 + 2H20
C5H10+O2=CO2+H2O2C5H10 + 15O2 = 10CO2 + 10H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H8O2+O2=CO2+H2OC4H8O2 + 5O2 = 4CO2 + 4H2O
Ca(OH)2(aq)+HNO3(aq)=Ca(NO3)2(aq)+H2O(l)Ca(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O(l)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5OH(l) + O2(g)=CO2(g) + H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
CH4(g) + H2O(g) =CO(g) + H2(g)CH4(g) + H2O(g) = CO(g) + 3H2(g)
CH4(g) + H2O(g) =CO(g) + H2(g)CH4(g) + H2O(g) = CO(g) + 3H2(g)
CH4 + NH3 = HCN + H2CH4 + NH3 = HCN + 3H2
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C4H10 + O2 = H2O + CO22C4H10 + 13O2 = 10H2O + 8CO2
CO2+CaO=CaCO3CO2 + CaO = CaCO3
CH3CH2OH + 3O2 = 2CO2 + 3H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C4H8O2(l)+H2(g)=C2H6O(l)C4H8O2(l) + 2H2(g) = 2C2H6O(l)
CaCl2 + KOH = Ca(OH)2 + KClCaCl2 + 2KOH = Ca(OH)2 + 2KCl
Ca(s)+Br2(l)=CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Cl2 + Al = AlCl33Cl2 + 2Al = 2AlCl3
Cl + Al = AlCl33Cl + Al = AlCl3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CuSO4+Zn=Cu+ZnSO4CuSO4 + Zn = Cu + ZnSO4
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuO+H2SO4=CuSO4+HOHCuO + H2SO4 = CuSO4 + HOH
Cr2O3+C=Cr+CO22Cr2O3 + 3C = 4Cr + 3CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+H2=CH4C + 2H2 = CH4
C + O2 = CO2C + O2 = 2CO
C + O = COC + O = CO
Ca(NO3)2=CaO+O2+2NO22Ca(NO3)2 = 2CaO + O2 + 4NO2
C(s) + H2O(g) = CO2(g)+ H2(g)C(s) + 2H2O(g) = CO2(g) + 2H2(g)
C6H5Cl+SiCl4+Na=(C6H5)4Si+NaCl4C6H5Cl + SiCl4 + 8Na = (C6H5)4Si + 8NaCl
CH3COOH + Na2CO3 = CH3COONa + H2O + CO22CH3COOH + Na2CO3 = 2CH3COONa + H2O + CO2
CH3COOH + NaCO3 = CH3COONa + H2O + CO29CH3COOH + 8NaCO3 = 8CH3COONa + 6H2O + 10CO2
Cr2(SO4)3 + RbOH = Cr(OH)3 +Rb2SO4Cr2(SO4)3 + 6RbOH = 2Cr(OH)3 + 3Rb2SO4
Cu2O+O2=CuO2Cu2O + O2 = 4CuO
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
Cl2 + H2 =HClCl2 + H2 = 2HCl
Cr2O3 +CH4= Cr +CO +H2OCr2O3 + CH4 = 2Cr + CO + 2H2O
CrCl3(aq) + Na2CO3(aq) = Cr2(CO3)3(s) + NaCl(aq)2CrCl3(aq) + 3Na2CO3(aq) = Cr2(CO3)3(s) + 6NaCl(aq)
Cr2(SO4)3 + H2SO4 + AgNO3 = Cr(OH)3 + Ag2SO4 + NO2 + H2S-2Cr2(SO4)3 - 3H2SO4 - 24AgNO3 = -4Cr(OH)3 - 12Ag2SO4 - 24NO2 + 3H2S
Cr2(SO4)3 + H2SO4 + AgNO3 = Cr(OH)3 + Ag2SO4 + NO2 + H2S-2Cr2(SO4)3 - 3H2SO4 - 24AgNO3 = -4Cr(OH)3 - 12Ag2SO4 - 24NO2 + 3H2S
Cr2(SO4)3 + H2SO4 + AgNO3 = Cr(OH)3 + Ag2SO4 + NO2 + H2S-2Cr2(SO4)3 - 3H2SO4 - 24AgNO3 = -4Cr(OH)3 - 12Ag2SO4 - 24NO2 + 3H2S
Cr2(SO4)3 + H2SO4 + AgNO3 = Cr(OH)3 + Ag2SO4 + NO2 + H2S-2Cr2(SO4)3 - 3H2SO4 - 24AgNO3 = -4Cr(OH)3 - 12Ag2SO4 - 24NO2 + 3H2S
Cr2(SO4)3 + H2SO4 + AgNO3 = Cr(OH)3 + Ag2SO4 + NO2 + H2S-2Cr2(SO4)3 - 3H2SO4 - 24AgNO3 = -4Cr(OH)3 - 12Ag2SO4 - 24NO2 + 3H2S
Cr2(SO4)3 + H2SO4 + AgNO3 = Cr(OH)3 + Ag2SO4 + NO2 + H2S-2Cr2(SO4)3 - 3H2SO4 - 24AgNO3 = -4Cr(OH)3 - 12Ag2SO4 - 24NO2 + 3H2S
Cr2(SO4)3 + H2SO4 + AgNO3 = Cr(OH)3 + Ag2SO4 + NO2 + H2S-2Cr2(SO4)3 - 3H2SO4 - 24AgNO3 = -4Cr(OH)3 - 12Ag2SO4 - 24NO2 + 3H2S
CH 4 (g)+O 2 (g)=CO 2 (g)+H 2 O(g) CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C6H12O6(s)+O2=CO2(g)+H2O(l)C6H12O6(s) + 6O2 = 6CO2(g) + 6H2O(l)
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 + H2O = C7H12O6 + O27CO2 + 6H2O = C7H12O6 + 7O2
CaCO3(s) = CaO(s)+CO2CaCO3(s) = CaO(s) + CO2
C7H14 + O2 = CO2 + H2O 2C7H14 + 21O2 = 14CO2 + 14H2O
CaCl2 + Na3PO4 = NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cl2+O2=Cl2O32Cl2 + 3O2 = 2Cl2O3
CO2 + H2 O= C6 H12 O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C5H10 + O2 = CO2 + H2O2C5H10 + 15O2 = 10CO2 + 10H2O
CuSo4+K2Co3=CuCo3+K2So4CuSo4 + K2Co3 = CuCo3 + K2So4
Cl2 + NaI = I2 + NaClCl2 + 2NaI = I2 + 2NaCl
Cu + S = Cu2S2Cu + S = Cu2S
CaCO 3 (s)+2HCl(aq)=H 2 O(l)+CO 2 (g)+CaCl 2 (aq) CaCO3(s) + 2HCl(aq) = H2O(l) + CO2(g) + CaCl2(aq)
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
C6H6O + O2 = CO2 + H2OC6H6O + 7O2 = 6CO2 + 3H2O
Cu+AgNo3=Cu(No3)2+AgCu + 2AgNo3 = Cu(No3)2 + 2Ag
C4H10O + O2 = CO2 +H2OC4H10O + 6O2 = 4CO2 + 5H2O
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CO(g) + H2(g) = C8H18(l) + H2O8CO(g) + 17H2(g) = C8H18(l) + 8H2O
Cu2O+O2=CuO2Cu2O + O2 = 4CuO
Cu2+O2=CuOCu2 + O2 = 2CuO
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaCl2 + F2 = CaF2 + Cl2CaCl2 + F2 = CaF2 + Cl2
CH4+O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
Cl2+O2=Cl2O32Cl2 + 3O2 = 2Cl2O3
CH3COOH + (CH3)2CHCH2CH2OH = CH3COOCH2CH2CH(CH3)2 + H2OCH3COOH + (CH3)2CHCH2CH2OH = CH3COOCH2CH2CH(CH3)2 + H2O
CCl4(l ) + SbF3(s) =CCl2F2(g) + SbCl3(s)3CCl4(l) + 2SbF3(s) = 3CCl2F2(g) + 2SbCl3(s)
CCl4(l ) + SbF3(s) =CCl2F2(g) + SbCl3(s)3CCl4(l) + 2SbF3(s) = 3CCl2F2(g) + 2SbCl3(s)
CH3COOH + (CH3)2CHCH2CH2OH = CH7H14O2 + H2O75CH3COOH - 34(CH3)2CHCH2CH2OH = -20CH7H14O2 + 156H2O
C2H4O2 + O2 = OH + CO2C2H4O2 + 3O2 = 4OH + 2CO2
C2H4O2 + 3O2 = OH + CO2C2H4O2 + 3O2 = 4OH + 2CO2
C2H4O2 + 3O2 = 4OH + 2CO2C2H4O2 + 3O2 = 4OH + 2CO2
Ca(HCO3)2 + HCl = 3CO2 + CaCl2 + H2OCa(HCO3)2 + 2HCl = 2CO2 + CaCl2 + 2H2O
C2H5SH(l ) + O2(g) = CO2(g) + H2O(l ) + SO2(g)2C2H5SH(l) + 9O2(g) = 4CO2(g) + 6H2O(l) + 2SO2(g)
Ca (C2H3O2)2 + AlCl3 = CaCl2 + Al (C2H3O2)33Ca(C2H3O2)2 + 2AlCl3 = 3CaCl2 + 2Al(C2H3O2)3
Cu2O + O2= CuO2Cu2O + O2 = 4CuO
C4H9OH + O2 = H2O + CO2C4H9OH + 6O2 = 5H2O + 4CO2
Cu +HNO3= Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Co(NO3)2 +K2CrO4 = KNO3 + CoCrO4Co(NO3)2 + K2CrO4 = 2KNO3 + CoCrO4
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = CO2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cu(NO3)2 + Li = Li(NO3)2 + CuCu(NO3)2 + Li = Li(NO3)2 + Cu
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(NO3)2 + HCl = CaCl2 + HNO3Ca(NO3)2 + 2HCl = CaCl2 + 2HNO3
Cl2O7+H2O=HClO4Cl2O7 + H2O = 2HClO4
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H8(g) +O2(g) = CO2(g)+H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
C4H10+ O2 =H2O +CO22C4H10 + 13O2 = 10H2O + 8CO2
Ca(OH)2 + H3PO4 =Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C4H10(g)+O2(g)=CO2(g)+H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C3H4+ O2 =H2O +CO2C3H4 + 4O2 = 2H2O + 3CO2
CrI3 + NaOH = Cr(OH)3 + NaICrI3 + 3NaOH = Cr(OH)3 + 3NaI
Ca(ClO3)2 + Al(CH3COO)3 = Ca(CH3COO)2 + Al(ClO3)33Ca(ClO3)2 + 2Al(CH3COO)3 = 3Ca(CH3COO)2 + 2Al(ClO3)3
C5H12+ O2 = H2O + CO2C5H12 + 8O2 = 6H2O + 5CO2
CaCl2(aq)+(NH4)2 CO3(aq)= CaCO3(s)+NH4Cl(aq)CaCl2(aq) + (NH4)2CO3(aq) = CaCO3(s) + 2NH4Cl(aq)
Cu + ZnSO4 = CuSO4 + ZnCu + ZnSO4 = CuSO4 + Zn
CuCl2+2KI=CuI2+2KClCuCl2 + 2KI = CuI2 + 2KCl
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C10H8N2 +N2O = CO2 + H2O + N2C10H8N2 + 24N2O = 10CO2 + 4H2O + 25N2
C6H5NO2 + O2 = CO2 + H2O + N24C6H5NO2 + 25O2 = 24CO2 + 10H2O + 2N2
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CH3OH+O2=H2CO+H2010CH3OH + 0O2 = 10H2CO + H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+H2=CH4C + 2H2 = CH4
C2H6+O2=CO2+H2010C2H6 + 20O2 = 20CO2 + 3H20
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+Cl=CaClCa + Cl = CaCl
C6H6 + KMnO4 + H2O = C3H8O2 + KOH + MnO2-3C6H6 + 2KMnO4 - 14H2O = -6C3H8O2 + 2KOH + 2MnO2
CrCl + NaCO3 = CrCO3 + NaClCrCl + NaCO3 = CrCO3 + NaCl
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C8 H18 + O2 = CO2 + H20 10C8H18 + 80O2 = 80CO2 + 9H20
CH3OH + 6O2 = 2CO2 + 4H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH + 6O2 = 2CO2 + 4H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
Cr(s)+5O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H8O2(l)+H2(g)=C2H6O(l)C4H8O2(l) + 2H2(g) = 2C2H6O(l)
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)4CH3 +O2 = CO2 + H2010CH3(CH2)4CH3 + 60O2 = 60CO2 + 7H20
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3 = CO2 + CaOCaCO3 = CO2 + CaO
CuCl2 + AgNO3 = Cu(NO3)2 + AgClCuCl2 + 2AgNO3 = Cu(NO3)2 + 2AgCl
CH3(CH2)2CH3 +O2 = CO2 + H202CH3(CH2)2CH3 + 8O2 = 8CO2 + H20
Ca2Si + Cl2 = CaCl2 + SiCl4Ca2Si + 4Cl2 = 2CaCl2 + SiCl4
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8+ O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu2S+ O2= Cu2O+ SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C3H8 + O2 = CO3 + H2O2C3H8 + 13O2 = 6CO3 + 8H2O
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CuSO4 + KI = CuI + I2 + K2SO42CuSO4 + 4KI = 2CuI + I2 + 2K2SO4
C+H2O=C12H22O1112C + 11H2O = C12H22O11
CH4+ 2 O2= CO2+ 2 H2OCH4 + 2O2 = CO2 + 2H2O
C4H6 + O2 = CO2 + H2O2C4H6 + 11O2 = 8CO2 + 6H2O
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C2H4O2S + 7O2 = CO2 + 4H2O + SO32C2H4O2S + 7O2 = 4CO2 + 4H2O + 2SO3
C6H6OS + 5O2 = CO + H2O + SO2C6H6OS + 5O2 = 6CO + 3H2O + SO2
Ca + O2 = CaO 2Ca + O2 = 2CaO
Cu(NO3)2=CuO+NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CaSO4+LiOH=Ca(OH)2+Li2SO4CaSO4 + 2LiOH = Ca(OH)2 + Li2SO4
C2 + H2 = CH4C2 + 4H2 = 2CH4
Ca(HCO3)2=CaO+CO2+H2OCa(HCO3)2 = CaO + 2CO2 + H2O
C+O2=CO2C + O2 = CO2
C4H10 (g) + O2 (l) = H2O(g) + CO2(g) 2C4H10(g) + 13O2(l) = 10H2O(g) + 8CO2(g)
Ca(ClO3)2(aq)=CaCl2(aq) + O2(g)Ca(ClO3)2(aq) = CaCl2(aq) + 3O2(g)
CrCl3 + MnO2 + H2O = MnCl2 + H2CrO42CrCl3 + 3MnO2 + 2H2O = 3MnCl2 + 2H2CrO4
Ca(NO3)2+Na2CO3=CaCO3+NaNO3Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8+H2O=H2+CO2C3H8 + 6H2O = 10H2 + 3CO2
C(s) + O2(g) = CO(g)2C(s) + O2(g) = 2CO(g)
C2H5OH+O2=2CO2+3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu+O2=Cu2O4Cu + O2 = 2Cu2O
CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C2H6+O2 = CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H3O2+BaOH2=H2O+BaC2H3O2 C2H3O2 + BaOH2 = H2O + BaC2H3O2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C4H10+ O2 =CO2 +H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C2H6(g)+O2(g)=CO2(g)+H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
C4H10 + O2 = CO2 + H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10(g) + O2(g) = CO2(g)+ H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C8H18 + O2 = CO2 + H2010C8H18 + 80O2 = 80CO2 + 9H20
C+SO2=CS2+CO5C + 2SO2 = CS2 + 4CO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CU(NO3)2 = CUO + NO2 + O22CU(NO3)2 = 2CUO + 4NO2 + O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C 3 H 8 (g)+O 2 (g)=CO 2 (g)+H 2 O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CaF2+Li2SO4=CaSO4+LiFCaF2 + Li2SO4 = CaSO4 + 2LiF
CH 3 COOH(l)+O 2 (g)=2CO 2 (g)+2H 2 O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CoBr3+CaSO4=CaBr2+Co2(SO4)32CoBr3 + 3CaSO4 = 3CaBr2 + Co2(SO4)3
C2H5SH + O2 = CO2 + H2O + SO22C2H5SH + 9O2 = 4CO2 + 6H2O + 2SO2
CH3NO2 + O2 = CO2 + H2O + NO24CH3NO2 + 7O2 = 4CO2 + 6H2O + 4NO2
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H2+ O2 = 2CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2+ O2 = 2CO2 + H2010C2H2 + 20O2 = 20CO2 + H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H + O2 = 2CO2 + 3H2O4C2H + 9O2 = 8CO2 + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
CU+HNO3 = CU ( NO3 )2+H2O+NO3-1CU + 0HNO3 = -1CU(NO3)2 + 0H2O + 2NO3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuSO4+NH4Cl=CuCl+NH4SO4CuSO4 + NH4Cl = CuCl + NH4SO4
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Co2(CO3)3+CH3COOH=Co(C2H3O2)3+H2CO3Co2(CO3)3 + 6CH3COOH = 2Co(C2H3O2)3 + 3H2CO3
Co2(CO3)3+CH3COOH=Co(C2H3O2)3+H2CO3Co2(CO3)3 + 6CH3COOH = 2Co(C2H3O2)3 + 3H2CO3
CU+HNO3 = CU(NO3)2+H2O+NO3-1CU + 0HNO3 = -1CU(NO3)2 + 0H2O + 2NO3
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Ca(HCO3)2 + HBr = CaBr2 + H2O + CO2Ca(HCO3)2 + 2HBr = CaBr2 + 2H2O + 2CO2
CO2+H2O = C6H12O6+O66CO2 + 6H2O = C6H12O6 + 2O6
Cu+S8=Cu2S16Cu + S8 = 8Cu2S
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H4O2 + O2 = CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C3H5(NO3)3 = O2 + N2 + H2O + CO24C3H5(NO3)3 = O2 + 6N2 + 10H2O + 12CO2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CH4 +N2Cl4 = 3CCl4 + 3N2 + 6H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CH4 + O2 = H2O + CCH4 + O2 = 2H2O + C
C6H6O+O2=CO2+H2OC6H6O + 7O2 = 6CO2 + 3H2O
C2H3F + O2 = CO+H2O+F24C2H3F + 7O2 = 8CO + 6H2O + 2F2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu + Ag2CO3 = CuCO3 + 2AgCu + Ag2CO3 = CuCO3 + 2Ag
Cl2(g) + MgBr2(aq) = MgCl2(aq) + Br2(aq)Cl2(g) + MgBr2(aq) = MgCl2(aq) + Br2(aq)
Cl2(g) + MgBr2(aq) = MgCl2(aq) + Br2(aq)Cl2(g) + MgBr2(aq) = MgCl2(aq) + Br2(aq)
Cu+HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cl2 + NaBr = NaCl + Br2 Cl2 + 2NaBr = 2NaCl + Br2
Cl2 + NaBr = NaCl + Br2 Cl2 + 2NaBr = 2NaCl + Br2
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 + H2O = CO + H2CH4 + H2O = CO + 3H2
CH3 CH2 OH+O2=CO2+H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
Cu + HNO3 = H2O + NO2 + Cu(NO3)2Cu + 4HNO3 = 2H2O + 2NO2 + Cu(NO3)2
CH4 + H2O = CO + H2CH4 + H2O = CO + 3H2
Ca(OH)2 +HBr = CaBr2 + H2OCa(OH)2 + 2HBr = CaBr2 + 2H2O
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
C5H10O3N + O2 = CO2 + H2O + NH34C5H10O3N + 21O2 = 20CO2 + 14H2O + 4NH3
C + S = CS2C + 2S = CS2
C + S = CS2C + 2S = CS2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH3OH+O2 =CO2 +H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C+O2=CO2C + O2 = CO2
CO+O2=CO22CO + O2 = 2CO2
CO+O2=CO22CO + O2 = 2CO2
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C+O2=CO2C + O2 = CO2
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
CaCO3 + HNO3 = Ca(NO3)2 + CO2 + H2OCaCO3 + 2HNO3 = Ca(NO3)2 + CO2 + H2O
Cd + HI = CdHI Cd + HI = CdHI
C4H6 + O2 = CO2 + H2O2C4H6 + 11O2 = 8CO2 + 6H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+H2SO4=CuSO4+H2O+SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
Cs + N2=Cs3N6Cs + N2 = 2Cs3N
CrCO3=CrO+CO2CrCO3 = CrO + CO2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Cu+Cl2=CuCl2Cu + Cl2 = CuCl2
Cl2+KBr=Br+KClCl2 + 2KBr = 2Br + 2KCl
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C6H12+O2=H20+CO25C6H12 + 30O2 = 3H20 + 30CO2
C2H5NO2+O2=CO2+H2O+N24C2H5NO2 + 9O2 = 8CO2 + 10H2O + 2N2
CuSO4+KI=CuI+I2+KSO4CuSO4 + KI = CuI + 0I2 + KSO4
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuSO4+KI=CuI+I2+KSO4CuSO4 + KI = CuI + 0I2 + KSO4
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CaSlO3 + HF = SlF4 + CaF2 + H2OCaSlO3 + 6HF = SlF4 + CaF2 + 3H2O
CrCl2+K2Cr2O7+HCl=CrCl3+KCl+H2O6CrCl2 + K2Cr2O7 + 14HCl = 8CrCl3 + 2KCl + 7H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+H2O=Cu1O+H2Cu + H2O = Cu1O + H2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+O2 = CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CuSO4+Al(NO3)3=Cu(NO3) 2+Al2 (SO4)33CuSO4 + 2Al(NO3)3 = 3Cu(NO3)2 + Al2(SO4)3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CaO + CO2 = Ca CO3CaO + CO2 = CaCO3
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C8H18O3 + O2 = H2O + CO2C8H18O3 + 11O2 = 9H2O + 8CO2
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CsHCO3 = CO2 + Cs2CO3 + H2O2CsHCO3 = CO2 + Cs2CO3 + H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cu2O + O2 = CuO2Cu2O + O2 = 4CuO
CO(g) + I2O5(s) = I2(s) + CO2(g)5CO(g) + I2O5(s) = I2(s) + 5CO2(g)
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C6H6 + O2 = H2O + CO22C6H6 + 15O2 = 6H2O + 12CO2
C6H5OH+O2=CO2+H2OC6H5OH + 7O2 = 6CO2 + 3H2O
Cu + HCl = CuCl2 + H2Cu + 2HCl = CuCl2 + H2
CH3SH + CO = CH3CO(SCH3) + H2S2CH3SH + CO = CH3CO(SCH3) + H2S
C2H2O4 + O2 = H2O + CO22C2H2O4 + O2 = 2H2O + 4CO2
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
Cr+Pb(NO2)2 = Cr(NO2)3+Pb2Cr + 3Pb(NO2)2 = 2Cr(NO2)3 + 3Pb
CuSO4(aq)+AgNO3(aq)=Ag2SO4(s)+Cu(NO3)2(aq)CuSO4(aq) + 2AgNO3(aq) = Ag2SO4(s) + Cu(NO3)2(aq)
Cu(NO3)2 + Na3PO4 = Cu3(PO4)2 + NaNO33Cu(NO3)2 + 2Na3PO4 = Cu3(PO4)2 + 6NaNO3
CO(g)+SO2(g)=S(s)+CO2(g)2CO(g) + SO2(g) = S(s) + 2CO2(g)
C5H10O2+ O2= CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CH4 + Br2= CBr4 + HBrCH4 + 4Br2 = CBr4 + 4HBr
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.