Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
C2H4O2 + O2=CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
CoCl2 + NH4SCN=Co(SCN)2 + NH4ClCoCl2 + 2NH4SCN = Co(SCN)2 + 2NH4Cl
C4H10O2+O2=CO2+H2O2C4H10O2 + 11O2 = 8CO2 + 10H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CS2+Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO2(g) + H2(g) = CH4(g) + H2O(l)CO2(g) + 4H2(g) = CH4(g) + 2H2O(l)
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
CH4O+O2=CO2+H2O2CH4O + 3O2 = 2CO2 + 4H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C9H20 (l) + O2 (g) = CO2 (g) + H2O (l) C9H20(l) + 14O2(g) = 9CO2(g) + 10H2O(l)
C7H16 (g) + O2 (g) = CO2 (g) + H2O (l) C7H16(g) + 11O2(g) = 7CO2(g) + 8H2O(l)
C(H)4+2(O)2=C(O)2+2(H)2OC(H)4 + 2(O)2 = C(O)2 + 2(H)2O
C(H)4+2(O)2=C(O)2+2(H)2OC(H)4 + 2(O)2 = C(O)2 + 2(H)2O
C2H6 = C2H4 + H2C2H6 = C2H4 + H2
C7H12 + NaHCO3 = C7H13 + NaCO3C7H12 + NaHCO3 = C7H13 + NaCO3
C7H12 + NaHCO3 = C7H13 + NaCO3C7H12 + NaHCO3 = C7H13 + NaCO3
CaH2+H2O = Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CH4O + O2 =CO2 + H2O2CH4O + 3O2 = 2CO2 + 4H2O
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CdSO4=CdSO3+O22CdSO4 = 2CdSO3 + O2
Ca(OH)2 + HNO3 = Ca(NO3)2 +H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C4H7O2 + O2 = CO2 + H2O4C4H7O2 + 19O2 = 16CO2 + 14H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Ca(OH)2(aq) + CO2(g) = Ca(HCO3)2Ca(OH)2(aq) + 2CO2(g) = Ca(HCO3)2
C5H12(g)+O2(g)=CO2+H2OC5H12(g) + 8O2(g) = 5CO2 + 6H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
Ca3(PO4)2 + Al2(SO4)3 = CaSO4 + AlPO4Ca3(PO4)2 + Al2(SO4)3 = 3CaSO4 + 2AlPO4
CaC+H2O=Ca(OH)2+C2H2+H2O0CaC + H2O = 0Ca(OH)2 + 0C2H2 + H2O
CaC+H2O=Ca(OH)2+C2H2+H2O0CaC + H2O = 0Ca(OH)2 + 0C2H2 + H2O
Ca + AlCl3 = CaCl2 + Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
Ca + AlCl2 = CaCl2 + AlCa + AlCl2 = CaCl2 + Al
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C2H5OH + O2 = CO + H2OC2H5OH + 2O2 = 2CO + 3H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Co + O2 = Co2 O34Co + 3O2 = 2Co2O3
CaO+H2O+Po4=Ca3(Po4)2+OH3CaO + 3H2O + 2Po4 = Ca3(Po4)2 + 6OH
C H3 O H + O2 = C O2 + H2 O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
Cu+H2SO4=Cu(SO4)+2SO2+H2OCu + 2H2SO4 = Cu(SO4) + SO2 + 2H2O
C3H6O +O2 =CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
C3H6O +O2 =CO2 + H2O C3H6O + 4O2 = 3CO2 + 3H2O
CaO+CO2=CaCO3CaO + CO2 = CaCO3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
CaCl2+KNO3=Ca(NO3)2+KClCaCl2 + 2KNO3 = Ca(NO3)2 + 2KCl
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C2H5OH+O2=CO+H2OC2H5OH + 2O2 = 2CO + 3H2O
C10H16+CI2=C+HCIC10H16 + 8CI2 = 2C + 16HCI
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO2 +KOH = K2CO3 + H2OCO2 + 2KOH = K2CO3 + H2O
C10H16+CI2=C+HCIC10H16 + 8CI2 = 2C + 16HCI
CuCl2 + 2AgNO3 = 2AgCl + Cu(NO3)2CuCl2 + 2AgNO3 = 2AgCl + Cu(NO3)2
C10H16+CI2=C+HCIC10H16 + 8CI2 = 2C + 16HCI
CO2 +KOH = K2CO3 + H2OCO2 + 2KOH = K2CO3 + H2O
CH4 (g) + O2 (g) = CO2 (g) + H2O (l)CH4(g) + 2O2(g) = CO2(g) + 2H2O(l)
C10H16+CI2=C+HCIC10H16 + 8CI2 = 2C + 16HCI
Cd + NiO2 + H2O = Cd(OH)2 + Ni(OH)2Cd + NiO2 + 2H2O = Cd(OH)2 + Ni(OH)2
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C2H5NH2+O2=CO2+N2+H2O4C2H5NH2 + 15O2 = 8CO2 + 2N2 + 14H2O
C10 H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CaO+CO2=CaCO3CaO + CO2 = CaCO3
Ca+O2=CaO2Ca + O2 = 2CaO
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+Pb(NO3)2=Pb+Ca(NO3)2Ca + Pb(NO3)2 = Pb + Ca(NO3)2
CuSO4 + NaOH = Cu(OH)2 + Na2SO4CuSO4 + 2NaOH = Cu(OH)2 + Na2SO4
Ca(OH)2 + NaHCO3 = Ca(HCO3)2 + Na(OH)2 + CO2-1Ca(OH)2 + 0NaHCO3 = -1Ca(HCO3)2 + 0Na(OH)2 + 2CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CuCl2 + K2CO3 = CuCO3 + KClCuCl2 + K2CO3 = CuCO3 + 2KCl
CuSO4 + (NH4)2CO3 = CuCO3 + (NH4)2 SO4CuSO4 + (NH4)2CO3 = CuCO3 + (NH4)2SO4
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
Cu(OH)2 + HC2H3O2 = Cu(C2H3O2)2 + H2OCu(OH)2 + 2HC2H3O2 = Cu(C2H3O2)2 + 2H2O
Cu(NO3)2(aq)+(NH4)2S(aq)=CuS(s)+2NH4NO3(aq)Cu(NO3)2(aq) + (NH4)2S(aq) = CuS(s) + 2NH4NO3(aq)
CH3CO2H + NH4OH = NH4CH3CO2 + H2OCH3CO2H + NH4OH = NH4CH3CO2 + H2O
CH3CO2H + NH4OH = NH4CH3CO2 + H2OCH3CO2H + NH4OH = NH4CH3CO2 + H2O
CH3CO2H + NH4OH = NH4CH3CO2 + H2OCH3CO2H + NH4OH = NH4CH3CO2 + H2O
Ca(s)+O2(g)=CaO(s)2Ca(s) + O2(g) = 2CaO(s)
Co(NO3)2 + NaI = CoI2 + NaNO3Co(NO3)2 + 2NaI = CoI2 + 2NaNO3
Ca(HCO3)2 + HNO3 = CO2 + Ca(NO3)2 + H2OCa(HCO3)2 + 2HNO3 = 2CO2 + Ca(NO3)2 + 2H2O
Ce(IO3)4+H2C2O4=Ce2(C2O4)3+I2+CO2+H2O2Ce(IO3)4 + 24H2C2O4 = Ce2(C2O4)3 + 4I2 + 42CO2 + 24H2O
Ce(IO3)4+H2C2O4=Ce(C2O4)3+I2+CO2+H2OCe(IO3)4 + 12H2C2O4 = Ce(C2O4)3 + 2I2 + 18CO2 + 12H2O
C2H5OH + O2 = C2H5OHO2C2H5OH + O2 = C2H5OHO2
CH3(CH2)3CH3+ O2= CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CrI3(aq) + (NH4)3PO4(aq) = CrPO4(s) + 3NH4I(aq)CrI3(aq) + (NH4)3PO4(aq) = CrPO4(s) + 3NH4I(aq)
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CO + Cl2 = COCl2CO + Cl2 = COCl2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CH4 + O2 = CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO2 + KOH = K2CO3 + H2OCO2 + 2KOH = K2CO3 + H2O
Ca3(PO4)2+H2SO4=CaSO4+H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CaF2+Li2SO4=CaSO4+LiFCaF2 + Li2SO4 = CaSO4 + 2LiF
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2+C+SiO2=CaSiO3+CO+P42Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + 10CO + P4
Ca3(PO4)2+C+SiO2=CaSiO3+CP+P40Ca3(PO4)2 - 4C + 0SiO2 = 0CaSiO3 - 4CP + P4
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C2H2 +H2 = C2H6C2H2 + 2H2 = C2H6
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaO + MnI4 = MnO2 + CaI22CaO + MnI4 = MnO2 + 2CaI2
C6H6 + O2 = CO2 + H2O2C6H6 + 9O2 = 6CO2 + 3H2O2
C + H2 = C3H83C + 4H2 = C3H8
C6H6 + O2 =CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H6 + O2 =CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+2AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu2O(s)+C(s)=Cu(s)+CO(g) Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
C+Cl2=CCl4C + 2Cl2 = CCl4
CoBr3+ CaSO4= CaBr2+ Co2(SO4)32CoBr3 + 3CaSO4 = 3CaBr2 + Co2(SO4)3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2+AlI3=AlCl3+I23Cl2 + 2AlI3 = 2AlCl3 + 3I2
Cr(NO3)3(aq)+3LiOH(aq)=Cr(OH)3(s)+3LiNO3(aq)Cr(NO3)3(aq) + 3LiOH(aq) = Cr(OH)3(s) + 3LiNO3(aq)
Cu2O(s)+O2(g)=CuO(s)2Cu2O(s) + O2(g) = 4CuO(s)
Cu+HgNO3=Cu (NO3)2+HgCu + 2HgNO3 = Cu(NO3)2 + 2Hg
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+H2O=Ca (OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C(s)+S(s)=CS2(l)C(s) + 2S(s) = CS2(l)
C7H14 + O2 = CO2 + H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CaO+P2O5=Ca3 (PO4)23CaO + P2O5 = Ca3(PO4)2
Ca+Pb(NO3)2=Pb+Ca(NO3)2Ca + Pb(NO3)2 = Pb + Ca(NO3)2
C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
Cu+AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Cu+HgNO3=Cu (NO3)2+HgCu + 2HgNO3 = Cu(NO3)2 + 2Hg
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+HgNO3= Cu (NO3)2+HgCu + 2HgNO3 = Cu(NO3)2 + 2Hg
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca+H2O= Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Ca+H2O=Ca (OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CO2+H2O=H2CO3CO2 + H2O = H2CO3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCl + HNO3 = CaNO3 + HClCaCl + HNO3 = CaNO3 + HCl
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C6H6+O2=CO2=H2O2C6H6 + 9O2 = 6CO2 + 3H2O2
C4H10+O2=CO+H2O2C4H10 + 7O2 = 4CO + 5H2O2
C4H10+O2=CO+H2O2C4H10 + 7O2 = 4CO + 5H2O2
CuCl2 + NH4OH = CuOH NH4Cl2CuCl2 + NH4OH = CuOHNH4Cl2
CuCl2 + NH4OH = CuOH + NH4Cl2CuCl2 + NH4OH = CuOH + NH4Cl2
CuCl2 + NH4OH = CuOH NH4Cl2CuCl2 + NH4OH = CuOHNH4Cl2
CH3COOH + NaHCO3 = NaCH3COO + H2O + CO2CH3COOH + NaHCO3 = NaCH3COO + H2O + CO2
CuS+O2=CuO+SO22CuS + 3O2 = 2CuO + 2SO2
CH4 + NH3 + O2 = HCN + H2O 2CH4 + 2NH3 + 3O2 = 2HCN + 6H2O
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C3H3N3O9(l)=CO2(g)+H2O(g)+N2(g)+O2(g)4C3H3N3O9(l) = 12CO2(g) + 6H2O(g) + 6N2(g) + 3O2(g)
C6H14(l) + O2(g) = CO2(g) + H2O(g)2C6H14(l) + 19O2(g) = 12CO2(g) + 14H2O(g)
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CO2+CaSiO3+H2O=SiO2+Ca (HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H9OH + O2 = CO2 + H2OC4H9OH + 6O2 = 4CO2 + 5H2O
Cu2O+C=Cu+COCu2O + C = 2Cu + CO
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co+O2=Co2O34Co + 3O2 = 2Co2O3
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CaCO3 + HCl + H2O = CaCl + CO2 + H2O0CaCO3 + 0HCl + H2O = 0CaCl + 0CO2 + H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCO3 + HCl + H2O = CaCl + CO2 + H2O0CaCO3 + 0HCl + H2O = 0CaCl + 0CO2 + H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C5H10OH + O2 = CO2 + H2O4C5H10OH + 29O2 = 20CO2 + 22H2O
Cl2+2KBr=2KCl+Br2Cl2 + 2KBr = 2KCl + Br2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CH4 + O2 = 2CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H8+6O2=4CO2+4H2OC4H8 + 6O2 = 4CO2 + 4H2O
Co2O3 + C = CO2 + Co2Co2O3 + 3C = 3CO2 + 4Co
Co2O3 + C = CO2 + Co2Co2O3 + 3C = 3CO2 + 4Co
C2H2 + O2 = H2O + CO22C2H2 + 5O2 = 2H2O + 4CO2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CaH2(s) + H2O(l) =Ca(OH)2(aq) + H2(g)CaH2(s) + 2H2O(l) = Ca(OH)2(aq) + 2H2(g)
C6H6(g) + Cl2(g) = C6H4Cl2(g) + HCl(g)C6H6(g) + 2Cl2(g) = C6H4Cl2(g) + 2HCl(g)
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
CaO(s) + CO2(g)= CaCO3(s)CaO(s) + CO2(g) = CaCO3(s)
Co2S(s) + S8(s)=CoS(s)8Co2S(s) + S8(s) = 16CoS(s)
Cs(s) + I2(s) =CsI(s)2Cs(s) + I2(s) = 2CsI(s)
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H2+O=CO2+H2OC2H2 + 5O = 2CO2 + H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CS2(g) + Cl2(g) = CCl4(g) + SCl2(g)CS2(g) + 4Cl2(g) = CCl4(g) + 2SCl2(g)
Cu + HCl =CuCl2 + H2Cu + 2HCl = CuCl2 + H2
CS2(g) + O2(g) = CO2(g) + SO2(g)CS2(g) + 3O2(g) = CO2(g) + 2SO2(g)
CO2+CaSiO3+H2O=SiO2+Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H5SH(l) + O2(g) = CO2(g) + H2O(l) + SO2(g)2C2H5SH(l) + 9O2(g) = 4CO2(g) + 6H2O(l) + 2SO2(g)
CH3(CH2)3CH3(l)+O2(g)=CO2(g)+H2O(g)CH3(CH2)3CH3(l) + 8O2(g) = 5CO2(g) + 6H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CCl4(l) + SbF3(s) = CCl2F2(g) + SbCl3(s)3CCl4(l) + 2SbF3(s) = 3CCl2F2(g) + 2SbCl3(s)
Cl2(g) + CH4(g) + O2(g) = HCl(g) + CO(g)4Cl2(g) + 2CH4(g) + O2(g) = 8HCl(g) + 2CO(g)
CuS+O2 = Cu +SO2CuS + O2 = Cu + SO2
C6H14(l) + O2(g) = CO2(g) + H2O(l)2C6H14(l) + 19O2(g) = 12CO2(g) + 14H2O(l)
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C8H18O3+O2=H2O+CO2C8H18O3 + 11O2 = 9H2O + 8CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C7H8O2 + O2 = CO2 + H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
C7H16 + NO = N2 +CO2 + H2C7H16 + 14NO = 7N2 + 7CO2 + 8H2
C7H16 + NO = N +CO2 + H2C7H16 + 14NO = 14N + 7CO2 + 8H2
C7H16 + NO = N +CO2 + H2OC7H16 + 22NO = 22N + 7CO2 + 8H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Ca (s) + Al(NO3)3 (aq) = Ca(NO3)2 (aq) + Al (s)3Ca(s) + 2Al(NO3)3(aq) = 3Ca(NO3)2(aq) + 2Al(s)
Cu+O2= CuO2Cu + O2 = 2CuO
C6H4Cl2 + O2 = CO + H2O + HCl2C6H4Cl2 + 7O2 = 12CO + 2H2O + 4HCl
CO+ O2= CO22CO + O2 = 2CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO2(g)+CaSiO3(s)+H2O=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O = SiO2(s) + Ca(HCO3)2(aq)
Cu+ S8= CuS8Cu + S8 = 8CuS
C2H6+O2= CO2=H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+ O2= CO2=H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H6+ O2= CO2+ H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCO3+SO4+H=CaSO4+HCO3CaCO3 + SO4 + H = CaSO4 + HCO3
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C2H4 + O2 =CO2 +H2OC2H4 + 3O2 = 2CO2 + 2H2O
C+ SO2= CS2+ CO5C + 2SO2 = CS2 + 4CO
CuCl2 + AgNO3 = Cu(NO3)2 + AgClCuCl2 + 2AgNO3 = Cu(NO3)2 + 2AgCl
CrS + O2 = Cr2O3 + SO24CrS + 7O2 = 2Cr2O3 + 4SO2
CH4 +Cl2=HCl +CCl4CH4 + 4Cl2 = 4HCl + CCl4
CO2 + H2O =O2 + C3H83CO2 + 4H2O = 5O2 + C3H8
Cl2 + N2 = NCl33Cl2 + N2 = 2NCl3
CrCl3(aq)+H2S(g)=Cr2S3(s)+HCl(aq)2CrCl3(aq) + 3H2S(g) = Cr2S3(s) + 6HCl(aq)
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C5H12 +8O2 =5CO2 +6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCl + H2 = Ca + HCl2CaCl + H2 = 2Ca + 2HCl
Cu+HNO3+H2SO4+H2O= CuSO4*5H20+NO2-1Cu + 98HNO3 - H2SO4 - 98H2O = -1CuSO4*5H20 + 98NO2
Cu+HNO3+H2SO4+H2O= (CuSO4)5H20+NO2-5Cu + 10HNO3 - 5H2SO4 - 10H2O = -1(CuSO4)5H20 + 10NO2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C2H2+O=CO2+H2O2C2H2 + 6O = 2CO2 + H2O2
C2H2+O=CO2+H2OC2H2 + 5O = 2CO2 + H2O
C2H2+5O=2CO2+H2OC2H2 + 5O = 2CO2 + H2O
Cl2 + H2O = HClO + HClCl2 + H2O = HClO + HCl
CO + H2 = CH3OHCO + 2H2 = CH3OH
CO(g)+H(g)=CH4(g)+H2O(l)CO(g) + 6H(g) = CH4(g) + H2O(l)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Cl2Hg+Zn=Cl2Zn+HgCl2Hg + Zn = Cl2Zn + Hg
COCl2(g)+H2O(l)=HCl(aq)+CO2(g)COCl2(g) + H2O(l) = 2HCl(aq) + CO2(g)
C2H6+O2 = H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
CH3CH2OH= O2+CO2+H2OCH3CH2OH = -3O2 + 2CO2 + 3H2O
CH3CH2OH + O2 = CO2 + H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C19H36O2 + O2 = H2O + CO2C19H36O2 + 27O2 = 18H2O + 19CO2
CS2(l) + H2O2 (l) = CO2 (l) + H2O (l) + SO2 (l)CS2(l) + 6H2O2(l) = CO2(l) + 6H2O(l) + 2SO2(l)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaI2+K2Cr2O7+H2SO4=CaSO4+Cr2(SO4)3+K2SO4+I2+H2O3CaI2 + K2Cr2O7 + 7H2SO4 = 3CaSO4 + Cr2(SO4)3 + K2SO4 + 3I2 + 7H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaSO4+AlF3=Al2(SO4)3+CaF23CaSO4 + 2AlF3 = Al2(SO4)3 + 3CaF2
CO(g)+H2(g)=C8H18+H2O8CO(g) + 17H2(g) = C8H18 + 8H2O
Ca(PO4)2 = Ca + P4 + O22Ca(PO4)2 = 2Ca + P4 + 8O2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CuCO3(OH)2 + C = CO2 + H2O + CuCuCO3(OH)2 + C = 2CO2 + H2O + Cu
CuCO3 = CuO + CO2CuCO3 = CuO + CO2
C7H14+O3 = CO + H2O3C7H14 + 14O3 = 21CO + 21H2O
Cu(NO3)2 + NH3 = Cu(NH3)4 + NO3Cu(NO3)2 + 4NH3 = Cu(NH3)4 + 2NO3
CuFeS2 + HNO3 = Cu(NO3)2 + Fe(NO3)3 + H2O + H2SO4 + NO2CuFeS2 + 22HNO3 = Cu(NO3)2 + Fe(NO3)3 + 9H2O + 2H2SO4 + 17NO2
C4H9OH + O2 = C4H7O2H + H2OC4H9OH + O2 = C4H7O2H + H2O
Ca+Br2=CaBr2Ca + Br2 = CaBr2
CoF3 = CoF2 + F22CoF3 = 2CoF2 + F2
CoS+CO+Cu=Co2(CO)8+Cu2S2CoS + 8CO + 4Cu = Co2(CO)8 + 2Cu2S
C2H8+O2=CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
CH4+O2=C2+H2O2CH4 + 2O2 = C2 + 4H2O
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C2H6 + Cl2 = C2H4Cl2 + HClC2H6 + 2Cl2 = C2H4Cl2 + 2HCl
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + H2O = CO + H2C3H8 + 3H2O = 3CO + 7H2
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca(OH)2+HBr=CaBr2+H2OCa(OH)2 + 2HBr = CaBr2 + 2H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca3(PO4)2 + SiO2 +C = CaSiO + CO + PCa3(PO4)2 + 3SiO2 + 11C = 3CaSiO + 11CO + 2P
Co(C2H3O2)2 + NaOH = CoOH + Na(C2H3O2)2Co(C2H3O2)2 + NaOH = CoOH + Na(C2H3O2)2
Co(C2H3O2)2 + NaOH = CoOH + Na(C2H3O2)2Co(C2H3O2)2 + NaOH = CoOH + Na(C2H3O2)2
CrCl3 + KMnO4 + H2O= H2CrO4 + MnO2+ KCl + HClCrCl3 + KMnO4 + 2H2O = H2CrO4 + MnO2 + KCl + 2HCl
C3H8O + CrO7-- + H+ = C3H6O + Cr--- + H2O15C3H8O + 2CrO7-- - 2H+ = 15C3H6O + 2Cr--- + 14H2O
Ca+Fe(NO3)3=2Ca(NO3)3+3FeCa + Fe(NO3)3 = Ca(NO3)3 + Fe
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CO+O2=CO22CO + O2 = 2CO2
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Co(C2H3O2)2 + NaOH = CoOH + Na(C2H3O2)2Co(C2H3O2)2 + NaOH = CoOH + Na(C2H3O2)2
C6H5COOH + O2 = CO2 + H2O2C6H5COOH + 15O2 = 14CO2 + 6H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
Ca + O2 = CaO2Ca + O2 = 2CaO
C22H46+O2=CO2+H2O2C22H46 + 67O2 = 44CO2 + 46H2O
CaSiO3+HF=H2SiF6+CaF2+H2OCaSiO3 + 8HF = H2SiF6 + CaF2 + 3H2O
C6H5CH3 + O2 = CO + C6H5COOH6C6H5CH3 + O2 = -14CO + 8C6H5COOH
C6H5CH3 + O2 = CO + C6H5COOH6C6H5CH3 + O2 = -14CO + 8C6H5COOH
Cr2O3+Al=Al2O3+CrCr2O3 + 2Al = Al2O3 + 2Cr
CuFeS2+O2=SO2+CuO+FeOCuFeS2 + 3O2 = 2SO2 + CuO + FeO
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8 + 5O2 = 3CO2 + 4H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CO + 2H2 = CH3OHCO + 2H2 = CH3OH
CH3Cl+O2=CO2+H2O+Cl24CH3Cl + 7O2 = 4CO2 + 6H2O + 2Cl2
C12H22O11(aq) +H2O(l) = C2H5OH(aq) +CO2(g)C12H22O11(aq) + H2O(l) = 4C2H5OH(aq) + 4CO2(g)
Ca(HCO3)2+Ca(OH)2=CaCO3+H2OCa(HCO3)2 + Ca(OH)2 = 2CaCO3 + 2H2O
CaCl2+HNO3=Ca(NO3)2+HClCaCl2 + 2HNO3 = Ca(NO3)2 + 2HCl
CaO + CO2 = CaCO3CaO + CO2 = CaCO3
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CrI3 + KOH + Cl2 = K2CrO4 + KIO4 + KCl + H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CuS + HNO3 = Cu(NO3)2 + NO + H2O + S3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O + 3S
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H5COOH+O2=CO2+H2O2C6H5COOH + 15O2 = 14CO2 + 6H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu2S + O2 = Cu2 + SO2Cu2S + O2 = Cu2 + SO2
Cu(NO3)2+Na2CO3=CuCO3+NaNO3Cu(NO3)2 + Na2CO3 = CuCO3 + 2NaNO3
C+O2=CO2C + O2 = 2CO
CuNO3+Na2CO3=Cu2CO3+NaNO32CuNO3 + Na2CO3 = Cu2CO3 + 2NaNO3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+HNO3=CuNO3+NO+H2O3Cu + 4HNO3 = 3CuNO3 + NO + 2H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O8=CO2+H2O4C3H8 + 5O8 = 12CO2 + 16H2O
Cl2+ C6H6+ NaI= NaCl+ HI+CCl6Cl2 + C6H6 + 6NaI = 6NaCl + 6HI + 6CCl
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H12+O2=C5O2+H12O2C5H12 + 2O2 = C5O2 + H12O2
C5H12+O2=C5O2+H12O2C5H12 + 2O2 = C5O2 + H12O2
Cr + Cl2 = CrCl32Cr + 3Cl2 = 2CrCl3
C3H8 + O2 = CO + H2O2C3H8 + 7O2 = 6CO + 8H2O
Cu(s) + 2H2SO4(Aq) = CuSO4(Aq) + 2H2O(l) + SO2(g)Cu(s) + 2H2SO4(Aq) = CuSO4(Aq) + 2H2O(l) + SO2(g)
Cu(NO3)2 (aq) + 2 Ag (s) = Cu (s) + 2 AgNO3 (aq)Cu(NO3)2(aq) + 2Ag(s) = Cu(s) + 2AgNO3(aq)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cl2O7 + H2O = HClO4Cl2O7 + H2O = 2HClO4
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca10(PO4)6(OH)2+HCl=CaCl2+H3PO4+H2OCa10(PO4)6(OH)2 + 20HCl = 10CaCl2 + 6H3PO4 + 2H2O
CuO2 + NH4 = Cu + N2 + H2O2CuO2 + 2NH4 = 2Cu + N2 + 4H2O
C+S=CS2C + 2S = CS2
CH3(CH2)2 CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Cu(NO3)2+Na3PO4=Cu3(PO4)2+NaNO33Cu(NO3)2 + 2Na3PO4 = Cu3(PO4)2 + 6NaNO3
C2H5OH+O2=CO2+H2010C2H5OH + 15O2 = 20CO2 + 3H20
Cu(NO3)2+Na2S=CuS+NaNO3Cu(NO3)2 + Na2S = CuS + 2NaNO3
Cu(NO3)2+NaOH=Cu(OH)2+NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
Cu(NO3)2+NaCl=CuCl2+NaNO3Cu(NO3)2 + 2NaCl = CuCl2 + 2NaNO3
Cu(NO3)2+K2CrO4=CuCrO4+KNO3Cu(NO3)2 + K2CrO4 = CuCrO4 + 2KNO3
CaCN2 + H2O = CaCO3 + NH3CaCN2 + 3H2O = CaCO3 + 2NH3
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+O2 = 3CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCI2+HCI=CaHCI=CI2CaCI2 + HCI = CaHCI + CI2
C2H6 + O2 =CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuSO4(aq) + Zn(s) =Cu(s) + ZnSO4(aq)CuSO4(aq) + Zn(s) = Cu(s) + ZnSO4(aq)
Ca+Na(NO3)=Ca(NO3)2+NaCa + 2Na(NO3) = Ca(NO3)2 + 2Na
Ca(OH)2=H2O+CaOCa(OH)2 = H2O + CaO
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12+O=CO2+H2OC5H12 + 16O = 5CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H9OH(g)+O2(g)=CO2(g)+5H2O(l)C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C4H9OH(g)+O2(g)=CO2(g)+H2O(l)C4H9OH(g) + 6O2(g) = 4CO2(g) + 5H2O(l)
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Cu+AgNo3=Ag+Cu(No3)2Cu + 2AgNo3 = 2Ag + Cu(No3)2
CrI3+KOH+Cl2=K2CrO4+KIO4+KCl+H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
Cr(C2H3O2)3=Cr+C2H3O2Cr(C2H3O2)3 = Cr + 3C2H3O2
Cs+P=CsPCs + P = CsP
CH3CH3+O2=CO2+H2010CH3CH3 + 20O2 = 20CO2 + 3H20
Ca+N2=CaN2Ca + N2 = 2CaN
C2H2+O2=H2O+CO22C2H2 + 5O2 = 2H2O + 4CO2
Ca+2O2 = 2CaO2Ca + O2 = CaO2
Ca+O2 = CaO2Ca + O2 = CaO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C3H7OH(l) + O2(g)= CO2(g)+ H2O2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O
C2H6O + SOCl2 = C2H5Cl + H2SO32C2H6O + SOCl2 = 2C2H5Cl + H2SO3
Cu + HNO3 = CuNO3 + N2O3 +H2O4Cu + 6HNO3 = 4CuNO3 + N2O3 + 3H2O
C2H6 + O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8(g)+O2(g)=CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C + H2 = CH4C + 2H2 = CH4
Cl2 + NaOH = H2O + NaClO + NaClCl2 + 2NaOH = H2O + NaClO + NaCl
Cl+P=PCl33Cl + P = PCl3
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CuCO3 = CuO + CO2CuCO3 = CuO + CO2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
C3H8 +H2O = CO + H2C3H8 + 3H2O = 3CO + 7H2
Co(NO3)2 + Na2CO3 = CoCO3 + Na2(NO3)2Co(NO3)2 + Na2CO3 = CoCO3 + Na2(NO3)2
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C + H + O = CHOC + H + O = CHO
C+O2=CO2C + O2 = 2CO
C6H14 + O2 = CO2 + H2C6H14 + 6O2 = 6CO2 + 7H2
C6H8O6 + I3- + H2O = C6H6O6 + 3 I- + 2 H+C6H8O6 + I3- + 0H2O = C6H6O6 + 3I- + 2H+
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
CaC2+H2O+CO2=CH2CHCO2H + Ca(OH)26CaC2 + 16H2O + 3CO2 = 5CH2CHCO2H + 6Ca(OH)2
Ca+Br2=CaBr2Ca + Br2 = CaBr2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cl2(g) + CH4(g) + O2(g) = HCl(g) + CO(g)4Cl2(g) + 2CH4(g) + O2(g) = 8HCl(g) + 2CO(g)
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C4H8 + O2 = CO2 + H2OC4H8 + 6O2 = 4CO2 + 4H2O
CaH2(s) + H2O(l) = Ca(OH)2(aq) + H2(g)CaH2(s) + 2H2O(l) = Ca(OH)2(aq) + 2H2(g)
CH3+KMnO4+H2SO4=COOH+K2SO4+MnSO4+H2O5CH3 + 6KMnO4 + 9H2SO4 = 5COOH + 3K2SO4 + 6MnSO4 + 14H2O
CaCl2+Na3PO4=NaCl+Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
CaC2 + H2O = Ca(OH)2 + C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C4H7OH(l) + O2(g) =CO2(g) + H2O(g)2C4H7OH(l) + 11O2(g) = 8CO2(g) + 8H2O(g)
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
C3H5(NO3)3 = O2 + CO2 + H2O + N24C3H5(NO3)3 = O2 + 12CO2 + 10H2O + 6N2
Cl2(g) + CH4(g) + O2(g) = HCl(g) + CO(g)4Cl2(g) + 2CH4(g) + O2(g) = 8HCl(g) + 2CO(g)
C8H18O + 12O2 = 8CO2 + 9H2OC8H18O + 12O2 = 8CO2 + 9H2O
Ca(HCO3)2(s)+2HCl(aq)=CaCl2(aq)+H2O(l)+CO2(g)Ca(HCO3)2(s) + 2HCl(aq) = CaCl2(aq) + 2H2O(l) + 2CO2(g)
C3H8 +H2O = CO + H2C3H8 + 3H2O = 3CO + 7H2
CrS + O2 = CrO3 + SO22CrS + 5O2 = 2CrO3 + 2SO2
CrS+O2=CrO3+SO22CrS + 5O2 = 2CrO3 + 2SO2
CuCl2 + Al = AlCl3 + Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
CuCl2 + Al = AlCl3 + Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
CuO + HCl = CuCl2 +H2OCuO + 2HCl = CuCl2 + H2O
Cu(OH)2 = CuO +H2OCu(OH)2 = CuO + H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Cu(NO3)2 + NaOH = Cu(OH)2 + NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
C2H4O2 + O2 = CO2 + H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
C2H4+O2=CH3CHO2C2H4 + O2 = 2CH3CHO
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
Ca (s) + O2 (g) = CaO (s)2Ca(s) + O2(g) = 2CaO(s)
C12H22O3 (l) + O2 (g) = CO2 (g) + H2O (g)C12H22O3(l) + 16O2(g) = 12CO2(g) + 11H2O(g)
C5H10(l) + O2 (g) = CO2(g) + H20 (g)2C5H10(l) + 10O2(g) = 10CO2(g) + H20(g)
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
C4H10O + O2 = 4CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.