Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Ca + P = CaPCa + P = CaP
C+O2=CO2C + O2 = 2CO
ClONO2 = NO3 + ClClONO2 = NO3 + Cl
ClONO2 = NO3 + ClClONO2 = NO3 + Cl
CH3NH2 + O2 = CO2 + N2 + H2O4CH3NH2 + 9O2 = 4CO2 + 2N2 + 10H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cl2 (aq) + KBr (aq) = Br2 (aq) + KCl (aq)Cl2(aq) + 2KBr(aq) = Br2(aq) + 2KCl(aq)
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CaCO3+SO2+O2=CaSO4+CO22CaCO3 + 2SO2 + O2 = 2CaSO4 + 2CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO2+H2O=H2CO3CO2 + H2O = H2CO3
Ca(OH)2 + HClO4 = Ca(ClO4)2 + H2OCa(OH)2 + 2HClO4 = Ca(ClO4)2 + 2H2O
C3H8O3 + O2 = CO2 + H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
CH3OH+O=CO2+H2OCH3OH + 3O = CO2 + 2H2O
C2H4O + O2 = CO2 + H2O2C2H4O + 5O2 = 4CO2 + 4H2O
CH4+O2(g) = H2O+CO2(g)CH4 + 2O2(g) = 2H2O + CO2(g)
C6H10O+NO3=C6H10O4+N2O5C6H10O + 6NO3 = 5C6H10O4 + 3N2O
CuCl2 + Al = Cu + AlCl33CuCl2 + 2Al = 3Cu + 2AlCl3
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cl2(g)+KBr(s) = Br2(l)+KCl(aq)Cl2(g) + 2KBr(s) = Br2(l) + 2KCl(aq)
C6H10+NO3=C6H10O4+N2O5C6H10 + 8NO3 = 5C6H10O4 + 4N2O
C3H6O + HNO3= CO2 + NO2 + H2OC3H6O + 16HNO3 = 3CO2 + 16NO2 + 11H2O
CaCO3+HCl(aq)= CaCl2(aq)+CO2+H2OCaCO3 + 2HCl(aq) = CaCl2(aq) + CO2 + H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C3H8+S8=CS2+H2S4C3H8 + 5S8 = 12CS2 + 16H2S
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C10H22+CL2=C+HCLC10H22 + 11CL2 = -1C + 22HCL
C5H6O(l)+O2(g)=CO2(g)+H2O(g) C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CuSO4 + Zn = Cu2 + ZnSO42CuSO4 + 2Zn = Cu2 + 2ZnSO4
CuSO4 + Zn = Cu +ZnSO4CuSO4 + Zn = Cu + ZnSO4
CACO3=CO2+CAOCACO3 = CO2 + CAO
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO+O2=CO22CO + O2 = 2CO2
Ca(NO3)2 + Na3PO4 = Ca3(PO4)2 + NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
CO + H2 = H2O + CH4CO + 3H2 = H2O + CH4
Cr(NO3)3+KOH=Cr(OH)3+KNO3Cr(NO3)3 + 3KOH = Cr(OH)3 + 3KNO3
C5H8O2+NaH+HCl=C5H12O2+NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
C7H9+HNO3=C7H6(NO2)3+H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
C10H22+O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C4H10O+O2=CO2+H2OC4H10O + 6O2 = 4CO2 + 5H2O
CO2+MgO=MgCO3CO2 + MgO = MgCO3
C2H4+O2=CO+H2OC2H4 + 2O2 = 2CO + 2H2O
CO2+H2O=C6H12O6+O6CO2 + 6H2O = C6H12O6 + 12O
C4H6O3+H2O=C2H4O2C4H6O3 + H2O = 2C2H4O2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CaO + HNO3=Ca(NO3)2+H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
C8H18 + 12O2 = 8CO2 + 9H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CoS+CO+Cu=Co2(CO)8+Cu2S2CoS + 8CO + 4Cu = Co2(CO)8 + 2Cu2S
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
CO2+H2=CH4+H2OCO2 + 4H2 = CH4 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH3(CH2)6CH3 +O2 = CO2+ H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CaCl2 + Al(NO3)3 = Ca(NO3)2 + AlCl33CaCl2 + 2Al(NO3)3 = 3Ca(NO3)2 + 2AlCl3
CH3CH3 +O2 = CO2+ H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)6CH3 +O2 = CO2+ H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3(CH2)2CH3 +O2 = CO2+ H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)4CH3 +O2 = CO2+ H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H6N6O6 + O2 = H2O + CO2 + N22C3H6N6O6 + 3O2 = 6H2O + 6CO2 + 6N2
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CoS+CO+Cu=Co2(CO)8+Cu2S2CoS + 8CO + 4Cu = Co2(CO)8 + 2Cu2S
Cr+HCl=CrCl2+H2Cr + 2HCl = CrCl2 + H2
CaO+H20=CaOH210CaO + H20 = 10CaOH2
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CO+H2=H2O+CH4CO + 3H2 = H2O + CH4
C8H4O3 + C6H6 = C14H8O2 + H2OC8H4O3 + C6H6 = C14H8O2 + H2O
Cl2O7+H2O=HClO4Cl2O7 + H2O = 2HClO4
Ca3(PO4)2 + SiO2 +C = P4 + CaSiO3 + CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaO + HNO3 = Ca(NO3)2 + H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
C3H8O+O2=CO2+H2010C3H8O + 25O2 = 30CO2 + 4H20
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
Cu + HNO3   =  Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C4H8(g) + O2(g)=CO2(g) + H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C4H9SO+O2=CO2+SO2+H2020C4H9SO + 90O2 = 80CO2 + 20SO2 + 9H20
CaO +C = CaC2 +CO22CaO + 5C = 2CaC2 + CO2
Cr2S3 + Mn(NO3)2 + Na2CO3 =  NO + CO2 + Na2CrO4 + Na2MnO4 + Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
CO(g)+H2(g)=C8H18(l)+H2O8CO(g) + 17H2(g) = C8H18(l) + 8H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3SH(aq) + CO(aq) = CH3COSCH3(aq) + H2S(aq)2CH3SH(aq) + CO(aq) = CH3COSCH3(aq) + H2S(aq)
Cu2CO3(OH)2(s) + C(s) = Cu(s) + CO2(g) + H2O(g)Cu2CO3(OH)2(s) + C(s) = 2Cu(s) + 2CO2(g) + H2O(g)
Cu2CO3(OH)2(s) + C(s) = Cu(s) + CO2(g) + H2O9(g)Cu2CO3(OH)2(s) - 3C(s) = 2Cu(s) - 2CO2(g) + H2O9(g)
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
CaCl2(aq)+AgNO3(aq)=AgCl(s)+Ca(NO3)2(aq)CaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ca(NO3)2(aq)
C5H10O2+O2=CO2+H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C4H10+ O2= CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H5NO2 + O2 = CO2 + H2O + NO24C6H5NO2 + 29O2 = 24CO2 + 10H2O + 4NO2
C6H5NO2 + O2 = CO2 + H2O + NO24C6H5NO2 + 29O2 = 24CO2 + 10H2O + 4NO2
C6H5NO2 + O2 = CO2 + H2O + NO24C6H5NO2 + 29O2 = 24CO2 + 10H2O + 4NO2
CH3NH2(g) + O2(g) = CO2(g) + H2O(g) + N2(g)4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
C6H14 + O2 = H2O + CO22C6H14 + 19O2 = 14H2O + 12CO2
CaCl2(aq) + K2CO3(aq) = KCl(aq) + CaCO3(s)CaCl2(aq) + K2CO3(aq) = 2KCl(aq) + CaCO3(s)
CaCl2(aq) + K2CO3(aq) = KCl(aq) + CaCO3(s)CaCl2(aq) + K2CO3(aq) = 2KCl(aq) + CaCO3(s)
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H14(l) + O2(g) = CO2(g) + H2O(l)2C6H14(l) + 19O2(g) = 12CO2(g) + 14H2O(l)
Ca(OH)2 + H3PO4 = Ca3(PO4)2(g) + H2O(l)3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2(g) + 6H2O(l)
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca3P2(s) + H2O (l) = Ca(OH)2 + PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2 + 2PH3(g)
CoS+CO+Cu=Co2(CO)8+Cu2S2CoS + 8CO + 4Cu = Co2(CO)8 + 2Cu2S
C+O2 =CO2C + O2 = 2CO
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C2H4(g) + O2(g) = CO2(g) + H2O(g) C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C4H6(g) + 6 O2(g) = 4 CO2(g) + 3 H2O(g)2C4H6(g) + 11O2(g) = 8CO2(g) + 6H2O(g)
CH4(g) + Br2(l) = CBr4(s) + HBr(g)CH4(g) + 4Br2(l) = CBr4(s) + 4HBr(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C4H8O2(l) + O2(g) = CO2(g) + H2O(l) C4H8O2(l) + 5O2(g) = 4CO2(g) + 4H2O(l)
CH3CH2CH2CO2H+CH2CH3OH=CH3CH2CH2CO2CH2CH3+H2OCH3CH2CH2CO2H + CH2CH3OH = CH3CH2CH2CO2CH2CH3 + H2O
CH3CH2CH2CO2H+CH2CH3OH=CH3CH2CH2CO2CH2CH3+H2OCH3CH2CH2CO2H + CH2CH3OH = CH3CH2CH2CO2CH2CH3 + H2O
C5H10(l) + O2(g) = CO2(g) + H2O(l)2C5H10(l) + 15O2(g) = 10CO2(g) + 10H2O(l)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaC2(s)+H2O(l)=Ca(OH)2(aq)+C2H2(g)CaC2(s) + 2H2O(l) = Ca(OH)2(aq) + C2H2(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C10H22+O2=CO2+H2010C10H22 + 100O2 = 100CO2 + 11H20
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C6H10+O2 = CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
C7H17+O2=CO2+H2O4C7H17 + 45O2 = 28CO2 + 34H2O
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C6H12O6+O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuO+NH3=Cu+H2O=N3CuO + 2NH3 = 3Cu + 3H2O + 2N
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
C3H7OH + O2 = CO2 + H2010C3H7OH + 25O2 = 30CO2 + 4H20
C3H7OH + O2 = CO2 + H2010C3H7OH + 25O2 = 30CO2 + 4H20
CH4 + O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
CaO+HNO3=Ca(NO3)2+H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
Ca3(PO4)2+2HNO3=Ca(H2PO4)2+Ca(NO3)2Ca3(PO4)2 + 4HNO3 = Ca(H2PO4)2 + 2Ca(NO3)2
CO+O2=CO22CO + O2 = 2CO2
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C5H10O2+O2=CO2+H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
CH3CO2H+C5H12O=C7H14O2+H2OCH3CO2H + C5H12O = C7H14O2 + H2O
Cu + HNO3= Cu(NO3)2 +NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
CO 2 = C + O 2CO2 = C + O2
Cu(OH)2(s) = CuO(s) + H2O(l)Cu(OH)2(s) = CuO(s) + H2O(l)
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4+Br2=CBr4+HBrCH4 + 4Br2 = CBr4 + 4HBr
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
Cr(NO2)2+(NH4)2SO4=CrSO4+NH4NO2Cr(NO2)2 + (NH4)2SO4 = CrSO4 + 2NH4NO2
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CaCO3+H3PO4=Ca3(PO4)2+H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
CuSO4 = CuO + SO2 + O22CuSO4 = 2CuO + 2SO2 + O2
C8H4O3+C6H6=C14H8O2+H2OC8H4O3 + C6H6 = C14H8O2 + H2O
CCI4=C+CICCI4 = -2C + 4CI
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C + F2 = CF4C + 2F2 = CF4
C4H10+O=CO2+H2OC4H10 + 13O = 4CO2 + 5H2O
C+H2=C2H62C + 3H2 = C2H6
Ca(s) + H2O(l) = Ca(OH)2(aq) + H2(g) Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
CH3COOH + NaHCO3 = CO2 + H20 + NaCH3COO15CH3COOH + 10NaHCO3 = 20CO2 + 2H20 + 10NaCH3COO
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H5(NO3)3 = N2 + H2O + CO2 + O24C3H5(NO3)3 = 6N2 + 10H2O + 12CO2 + O2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C+24SO2=CS2+CO5C + 2SO2 = CS2 + 4CO
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C+24SO2=CS2+CO5C + 2SO2 = CS2 + 4CO
C + O2 = CO2C + O2 = CO2
Cu(NO3)2 + K2PO4 = CuPO4 + 2KNO3Cu(NO3)2 + K2PO4 = CuPO4 + 2KNO3
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C9H8O3 + O2 = CO2 + H2010C9H8O3 + 75O2 = 90CO2 + 4H20
C3H8+O2(g)=CO2(g)+H2OC3H8 + 5O2(g) = 3CO2(g) + 4H2O
Ca + O2 = CaO2Ca + O2 = 2CaO
Cu+O2=CuO2Cu + O2 = 2CuO
Cd(C6H8O7) + (NH2)2CS + OH = CdS + C6H8O7 + (NH2)2CO + H2OCd(C6H8O7) + (NH2)2CS + 2OH = CdS + C6H8O7 + (NH2)2CO + H2O
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
CaCO3(s) + HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CO(g)+H2(g)=H2O(g)+CH4(g) CO(g) + 3H2(g) = H2O(g) + CH4(g)
CaCl2 + HNO3 = Ca(NO3)2 + HClCaCl2 + 2HNO3 = Ca(NO3)2 + 2HCl
C3H6 + O2 = CO2 H2O2C3H6 + 9O2 = 6CO2H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CaCO3 + HCl = CaCl2 + H2CO3CaCO3 + 2HCl = CaCl2 + H2CO3
CaCO3 + HCl = CaCl2 + H2CO3CaCO3 + 2HCl = CaCl2 + H2CO3
CaCO3 + HCl = CaCl2 + H2CO3CaCO3 + 2HCl = CaCl2 + H2CO3
CaCl2 + Na2CO3 = CaCO3 + Na2Cl2CaCl2 + Na2CO3 = CaCO3 + Na2Cl2
C2H6+O2= CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CaCO3=CO2+CaOCaCO3 = CO2 + CaO
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO + O2 = COCO + 0O2 = CO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3(s)+HCl(aq)=CaCl2(aq)+CO2(g)+H2O(l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
C4H8(g) + O2(g)=CO2(g) + H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
C6H12O2(aq)+O2(g)=CO2(g)+H2O(l)C6H12O2(aq) + 8O2(g) = 6CO2(g) + 6H2O(l)
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
CaH2(s)+H2O(l)=Ca(OH)2(aq)+H2CaH2(s) + 2H2O(l) = Ca(OH)2(aq) + 2H2
CoO(s) + O2(g)=Co2O3(s)4CoO(s) + O2(g) = 2Co2O3(s)
Ca(OH)2+H2SO4=CaSO4+H2OCa(OH)2 + H2SO4 = CaSO4 + 2H2O
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca3P2+H2O=Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C2H4(g)+O2(g) = C(s)+H2O(g)C2H4(g) + O2(g) = 2C(s) + 2H2O(g)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CO2 + KOH = K2CO3 + H2OCO2 + 2KOH = K2CO3 + H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Ca + HCl = CaCl + HCa + HCl = CaCl + H
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C4H12 + O2 = CO2 + H2OC4H12 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3COOH + O2= CO2 +H2OCH3COOH + 2O2 = 2CO2 + 2H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cu+O2=CuO2Cu + O2 = 2CuO
C5H12+3O2=5CO2+6H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H6O+O2=CO2+H2OC3H6O + 4O2 = 3CO2 + 3H2O
CH3CO2H + C5H12O = C7H14O2 + H2OCH3CO2H + C5H12O = C7H14O2 + H2O
CaC2(s)+H2O(l)=Ca(OH)2(aq)+C2H2(g)CaC2(s) + 2H2O(l) = Ca(OH)2(aq) + C2H2(g)
Cl2O7 + Ca(OH)2=Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
Cl2O7 + Ca(OH)2=Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
CO2+CaSiO3+H2O=SiO2+Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
C2H5O2N + O2 = CO2 + H2O + N24C2H5O2N + 9O2 = 8CO2 + 10H2O + 2N2
CrCl3+NaNO3+Na2CO3=Na2CrO4+NaClO3+NaNO2+CO22CrCl3 + 21NaNO3 + 5Na2CO3 = 2Na2CrO4 + 6NaClO3 + 21NaNO2 + 5CO2
CaC2(s)+H2O(l)=Ca(OH)2+C2H2CaC2(s) + 2H2O(l) = Ca(OH)2 + C2H2
Ca(OH)2 + H3PO4 = Ca3 (PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cr + H2SO4 = Cr2(SO4)3 + H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
Cl2O7 + Ca(OH)2=Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
C8H18 + 12O2 = 8CO2 + 9H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca+HCl=CaCl+H22Ca + 2HCl = 2CaCl + H2
C8H18O2 + O2 = CO2+H2O2C8H18O2 + 23O2 = 16CO2 + 18H2O
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
C8H18 + 12O2= 8CO2 + 9H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C10H18 + O2 = H2O + CO22C10H18 + 29O2 = 18H2O + 20CO2
C10H18 + O2 = H2O + CO22C10H18 + 29O2 = 18H2O + 20CO2
C3H4 + O2 = H2O + CO2C3H4 + 4O2 = 2H2O + 3CO2
C7H12 + O2 = H2O + CO2C7H12 + 10O2 = 6H2O + 7CO2
Cl2O7 + Ca(OH)2=Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
C6H12O6+ Cu(OH)2= C6H12O7 +Cu2O +H2OC6H12O6 + 2Cu(OH)2 = C6H12O7 + Cu2O + 2H2O
CaCO3 + 2HCl = CO2 + CaCl2 + H2OCaCO3 + 2HCl = CO2 + CaCl2 + H2O
Ca(OH)2 +H3PO4 = Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CaCO3(s)=CaO(s)+CO2(s)CaCO3(s) = CaO(s) + CO2(s)
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C5H10O2 + O2 =CO2 + H2O(g)2C5H10O2 + 13O2 = 10CO2 + 10H2O(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H+O2=CO2+H2O4C2H + 9O2 = 8CO2 + 2H2O
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CaCO3 + HCl = CaCl2 + CO2 +H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H4+O2 = CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
CaSO4 + AlCl3 = CaCl2 + Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
CH4 + O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2(g)+MgBr2(s)= Br2(s)+ClMg(s)Cl2(g) + 2MgBr2(s) = 2Br2(s) + 2ClMg(s)
CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g) 4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
CH4 + O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Ca2Fe3+H2O=Ca2O+H2Fe3Ca2Fe3 + H2O = Ca2O + H2Fe3
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C7H6O2+O2 =CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C7H8 + C2H6O = CO2 + H2O-1C7H8 + 3C2H6O = -1CO2 + 5H2O
C3H4 +N2Cl4 =C3Cl4 +N3 + H123C3H4 + 3N2Cl4 = 3C3Cl4 + 2N3 + H12
C4H10+O2=H2O+CO22C4H10 + 13O2 = 10H2O + 8CO2
C5H9O+O2=CO2+H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C3H5N3O9=N2+CO2+H2O+O24C3H5N3O9 = 6N2 + 12CO2 + 10H2O + O2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
CH3CH2OH + O2 = H2O + CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C2H6 + O2 = CO2 + H2O2C2H6 + 5O2 = 2CO2 + 3H2O2
C5H6O+O2=CO2+H2O C5H6O + 6O2 = 5CO2 + 3H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8 + O2 = CO + H22C3H8 + 3O2 = 6CO + 8H2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH3CH2OH + O2 = H2O + (CHCOOH)2CH3CH2OH + 3O2 = 4H2O + 2(CHCOOH)
CaSO 4 +AlCl 3 =CaCl 2 +Al 2 (SO 4 ) 3 3CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cl2 + NaI = NaCl + I2Cl2 + 2NaI = 2NaCl + I2
Ca3(PO4)2+SiO2+C2=P+CaO4Si+COCa3(PO4)2 + 3SiO2 + C2 = 2P + 3CaO4Si + 2CO
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
CH3COOH + Al(OH)3 = Al(C2H3O2)3 + H2O3CH3COOH + Al(OH)3 = Al(C2H3O2)3 + 3H2O
CH4(g) + 4 Cl2(g) = CCl4(l) + 4 HCl(g) CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
Cu2CO3(OH)2 = CuO + CO2 + H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C57H98O6 + CH4O = C3H8O3 + C19H34O2C57H98O6 + 3CH4O = C3H8O3 + 3C19H34O2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cu(s) + H2SO4(aq) = CuSO4(aq) + SO2(g) + H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
Cu (NO3)2 + CH3SNH2 = CuS2 + CH3NH2NO3Cu(NO3)2 + 2CH3SNH2 = CuS2 + 2CH3NH2NO3
C57H98O6 + CH4O = C3H8O + C19H34O24C57H98O6 - 13CH4O = -17C3H8O + 14C19H34O2
C6H12O6=C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
CuCO3 = CuO + CO2CuCO3 = CuO + CO2
CuCO3 = CuO + CO2CuCO3 = CuO + CO2
CoS+CO+Cu=Co2(CO)8+Cu2S2CoS + 8CO + 4Cu = Co2(CO)8 + 2Cu2S
CuO +HCl = CuCl2 + H2OCuO + 2HCl = CuCl2 + H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H8O2 + O2 = CO2 + H2OC4H8O2 + 5O2 = 4CO2 + 4H2O
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
C4H16O16+O2=H2O+CO2C4H16O16 + 0O2 = 8H2O + 4CO2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
C4H16O16=H2O+CO2C4H16O16 = 8H2O + 4CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
CaI2 + (NH4)3PO4 = Ca3(PO4)2 + NH4I3CaI2 + 2(NH4)3PO4 = Ca3(PO4)2 + 6NH4I
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C + HNO3 =CO2 + NO2 + H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C6H12O6 +O2=H2O+CO2C6H12O6 + 6O2 = 6H2O + 6CO2
CoO+O2=Co2O34CoO + O2 = 2Co2O3
Cr2O3+Na2CO3+KNO3=Na2CrO4+CO2+KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C + O2 =CO2C + O2 = CO2
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
CaCO3+HCl=H2O+CaCl2+CO2CaCO3 + 2HCl = H2O + CaCl2 + CO2
CaC2+H2O=Ca(OH)2+C2H2CaC2 + 2H2O = Ca(OH)2 + C2H2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C57H110O6+O2 = CO2+H2O2C57H110O6 + 163O2 = 114CO2 + 110H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C5H10O2(l) +O2(g) = CO2(g) + H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cu2S+HNO3=Cu(NO3)2+S+NO+H2O3Cu2S + 16HNO3 = 6Cu(NO3)2 + 3S + 4NO + 8H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CoCl2+ KOH+KClO3 = Co2O3+ KCl+ H2O6CoCl2 + 12KOH + KClO3 = 3Co2O3 + 13KCl + 6H2O
C2H5NH2 + O2 = CO2 + H2O + N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
CO2 + C =COCO2 + C = 2CO
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO + H2OC2H4 + 2O2 = 2CO + 2H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H4 + O2 = C + H2OC2H4 + O2 = 2C + 2H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4 + O2 = CO + H2OC2H4 + 2O2 = 2CO + 2H2O
CH3SH + CO = CH3COSCH3 + H2S2CH3SH + CO = CH3COSCH3 + H2S
CuCO3(OH)2 + C= Cu + CO2 + H2OCuCO3(OH)2 + C = Cu + 2CO2 + H2O
C2H5NH2 + O2 = CO2 + H2O + N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
CH3NH2 +O2 = CO2 + N2+ H204CH3NH2 + 4O2 = 4CO2 + 2N2 + H20
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H17+O2=CO2+H2O4C7H17 + 45O2 = 28CO2 + 34H2O
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3 +2HCl = CaCl2 + CO2 +H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Cu(s) + H2SO4(aq)=CuSO4(aq) + SO2(g) + H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
CH3CHOHCH3+O2=H2O+CO22CH3CHOHCH3 + 9O2 = 8H2O + 6CO2
C4H8(g) + O2(g)=CO2(g) + H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu(OH)2 = CuO + H2OCu(OH)2 = CuO + H2O
Co(NO3)3+(NH4)2S=Co2S3+NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
Cu(NO3)2 + NaOH = Cu(OH)2 + NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
C4H8O2+H2=C2H6OC4H8O2 + 2H2 = 2C2H6O
CuCO3 = Cu + CO3CuCO3 = Cu + CO3
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CaO + HNO3 = Ca(NO3)2 + H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cu2CO3(OH)2=CuO+CO2+H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cu2O+Cu2S=Cu+SO22Cu2O + Cu2S = 6Cu + SO2
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
CaCl2+AgNO3=AgCl+Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
CH3S H+CO=CH3CO(SCH3)+H2S2CH3SH + CO = CH3CO(SCH3) + H2S
CH3SH+CO=CH3CO(SCH3)+H2S2CH3SH + CO = CH3CO(SCH3) + H2S
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3SH+CO=CH3CO(SCH3)+H2S2CH3SH + CO = CH3CO(SCH3) + H2S
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
C3H6 + O2 = H2O + CO22C3H6 + 9O2 = 6H2O + 6CO2
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C7H14 + O2 = H2O + CO22C7H14 + 21O2 = 14H2O + 14CO2
C2H4 + O2 = H2O + CO2C2H4 + 3O2 = 2H2O + 2CO2
C9H18 + O2 = H2O + CO22C9H18 + 27O2 = 18H2O + 18CO2
C6H12 + O2 = H2O + CO2C6H12 + 9O2 = 6H2O + 6CO2
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cu(s) + H2SO4(aq) = CuSO4(aq) + SO2(g) + H2O(l) Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C+ H2O = COH+ H22C + 2H2O = 2COH + H2
C4H10 (g) + O2 (g) = CO2 (g) + H2O (g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
C57H110O6 + O2 = CO2 + H2O2C57H110O6 + 163O2 = 114CO2 + 110H2O
CaC2(s)+H2O=C2H2(aq)+Ca(OH)2CaC2(s) + 2H2O = C2H2(aq) + Ca(OH)2
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cl2 + BaF2 = BaCl2 + F2Cl2 + BaF2 = BaCl2 + F2
CaC2(s)+H2O=CaO(aq)+C2H2(g)CaC2(s) + H2O = CaO(aq) + C2H2(g)
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaC2(s)+H2O=C2H2(aq)+CaOCaC2(s) + H2O = C2H2(aq) + CaO
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl2 + BaF2 = Cl2BaF2Cl2 + BaF2 = Cl2BaF2
CaCO3 + SO4 + O2 = CaSO4 + CO22CaCO3 + 2SO4 - O2 = 2CaSO4 + 2CO2
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C4H6(g)+O2(g) = CO2 + H2O2C4H6(g) + 11O2(g) = 8CO2 + 6H2O
Cr + S8 = Cr2S316Cr + 3S8 = 8Cr2S3
CaC2+H2O+CO2=Ca(OH)2+CH2CHCO2H6CaC2 + 16H2O + 3CO2 = 6Ca(OH)2 + 5CH2CHCO2H
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C2H4O + O2 = CO2 + H2O2C2H4O + 5O2 = 4CO2 + 4H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CH4 +O2 = CH2 + H2O2CH4 + O2 = 2CH2 + 2H2O
CaC2(s)+H2O(l)=Ca(OH)2(aq)=+C2H2(aq)CaC2(s) + 2H2O(l) = Ca(OH)2(aq) + C2H2(aq)
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Cr2O3+Na2CO3+KNO3=Na2CrO4+CO2+KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2Na2CrO4 + 2CO2 + 3KNO2
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C4H6 + C2H6 = C6H142C4H6 + 5C2H6 = 3C6H14
C4H6 + C2H6 = C6H142C4H6 + 5C2H6 = 3C6H14
C4H6 + C2H6 = C6H142C4H6 + 5C2H6 = 3C6H14
C3H8 + O2 = CH2O + H2OC3H8 + 2O2 = 3CH2O + H2O
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CuCl3+Zn=Cu+ZnCl22CuCl3 + 3Zn = 2Cu + 3ZnCl2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.