Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CH4+NH3=HCN+H2CH4 + NH3 = HCN + 3H2
C4H4+6O2=4CO2+4H2OC4H4 + 5O2 = 4CO2 + 2H2O
C7H16 + 11O2 = 7CO2 + 8H2OC7H16 + 11O2 = 7CO2 + 8H2O
CaCO3(s)+CO2(g)+H2O(l)=Ca(HCO3)2(aq)CaCO3(s) + CO2(g) + H2O(l) = Ca(HCO3)2(aq)
CsBr = Cs +BrCsBr = Cs + Br
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CuSO4*5H2O + 2 NaOH = Cu(OH)2 + 5 H2O + Na2SO4CuSO4*5H2O + 2NaOH = Cu(OH)2 + 5H2O + Na2SO4
C2H6(g)+O2(g)=CO2(g)+H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
Cl2(g)+H2O(l)=HClO(aq)+HCl(aq)Cl2(g) + H2O(l) = HClO(aq) + HCl(aq)
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H12O6=2CH3CH2OH+2CO2C6H12O6 = 2CH3CH2OH + 2CO2
C6H12O6=2CH3CH2OH+2CO2C6H12O6 = 2CH3CH2OH + 2CO2
C6H12O6=2(CH3CH2OH)+2(CO2)C6H12O6 = 2(CH3CH2OH) + 2(CO2)
C6H12O6=CH3CH2OH+CO2C6H12O6 = 2CH3CH2OH + 2CO2
C2H2 + O2 =CO2 + H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
C6H12O6 + O2 = CO2 +H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C8H18 + O2 = CO2 +H2010C8H18 + 80O2 = 80CO2 + 9H20
CrCl3+AgNO3=Cr(NO3)3+AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
C+Fe2O3=Fe+CO3C + Fe2O3 = 2Fe + 3CO
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C28H34N2O3+NaClO=CO2+NO2+NaCl+H2OC28H34N2O3 + 74NaClO = 28CO2 + 2NO2 + 74NaCl + 17H2O
Cl2 + KI = KCl + I2Cl2 + 2KI = 2KCl + I2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2+Na=NaClCl2 + 2Na = 2NaCl
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu(NO3)2 + NaOH = Cu(OH)2 + NaNO3Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
C4H10+O2=CO2+H202C4H10 + 8O2 = 8CO2 + H20
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C4H8S(l)+O2 (g)= CO2 (g)+ H2O (g)+ SO2 (g)C4H8S(l) + 7O2(g) = 4CO2(g) + 4H2O(g) + SO2(g)
CaCO3+H2SO4=CaSO4+H2O+CO2CaCO3 + H2SO4 = CaSO4 + H2O + CO2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cr2O3 + KOH + O2 = K2CrO4 + H2O2Cr2O3 + 8KOH + 3O2 = 4K2CrO4 + 4H2O
Ca(OH)(HCO3)=CaCO3+H2OCa(OH)(HCO3) = CaCO3 + H2O
C10H22(g) + O2(g) = CO2(g) + H2O(g) 2C10H22(g) + 31O2(g) = 20CO2(g) + 22H2O(g)
C12H26 + O2 = CO2 + H2O2C12H26 + 37O2 = 24CO2 + 26H2O
Ca(OH)2+CO2=Ca(OH)(HCO3)Ca(OH)2 + CO2 = Ca(OH)(HCO3)
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
C6H5Cl+O2=CO+10H2O+2Cl24C6H5Cl + 17O2 = 24CO + 10H2O + 2Cl2
Cu + HNO3 =Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cs+N2=2Cs3N6Cs + N2 = 2Cs3N
C5H11OH + O2 =CO2 + H2O2C5H11OH + 15O2 = 10CO2 + 12H2O
C4H10 + O2 =CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca + Al(NO3)3 = CaNO3 + Al3Ca + Al(NO3)3 = 3CaNO3 + Al
CH4 + NH3 = H2 + C2N22CH4 + 2NH3 = 7H2 + C2N2
C2H4(g) + O2(g) = CO2(g) + H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3CH2OH+O2=2CO2+3HO2CH3CH2OH + 9O2 = 4CO2 + 12HO
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH4 + NH3 = H2 + C2N22CH4 + 2NH3 = 7H2 + C2N2
CS2 + O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
CS2 + O2 = CO2 + SO2CS2 + 3O2 = CO2 + 2SO2
C6H12O6 +O2=CO2+H205C6H12O6 + 15O2 = 30CO2 + 3H20
C4H10 +O= H2O +CO2C4H10 + 13O = 5H2O + 4CO2
C3H4 + O2 = CO2 + H2OC3H4 + 4O2 = 3CO2 + 2H2O
CaCl2+N2(C2O4)=CaC2O4+N2+Cl2CaCl2 + N2(C2O4) = CaC2O4 + N2 + Cl2
CaCl2+N2(C2O4)=CaC2O4+2NClCaCl2 + N2(C2O4) = CaC2O4 + 2NCl
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Ca+O2=CaO2Ca + O2 = 2CaO
Ca+O=CaOCa + O = CaO
C10H8 + O2 = CO2 + H2OC10H8 + 12O2 = 10CO2 + 4H2O
CuCl + Zn = ZnCl + CuCuCl + Zn = ZnCl + Cu
C6H14(g)+O2(g)=CO2(g)+H2O(g)2C6H14(g) + 19O2(g) = 12CO2(g) + 14H2O(g)
CaCl2 (aq) + (NH4)2C2O4 (aq) = CaC2O4 (s) + NH4ClCaCl2(aq) + (NH4)2C2O4(aq) = CaC2O4(s) + 2NH4Cl
CuCO2(OH)2+C=Cu+CO2+H2O2CuCO2(OH)2 + C = 2Cu + 3CO2 + 2H2O
CaCO3+ 2HCl= CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CuO + Al = Cu + Al2O3 3CuO + 2Al = 3Cu + Al2O3
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+O2=CaO 2Ca + O2 = 2CaO
Cu(OH)2(s) + H2SO4(aq)= CuSO4(aq) + 2H2O(l)Cu(OH)2(s) + H2SO4(aq) = CuSO4(aq) + 2H2O(l)
Ca( HCO3)2 = CaCO3 + CO2 + H2OCa(HCO3)2 = CaCO3 + CO2 + H2O
Ca( HCO3)2 = CaCO3 + CO2 + H2OCa(HCO3)2 = CaCO3 + CO2 + H2O
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Ca + Cu(NO3)2 = Cu + Ca(NO3)2Ca + Cu(NO3)2 = Cu + 2Ca(NO3)
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca + Cu(NO3)2 = Cu + Ca(NO3)2Ca + Cu(NO3)2 = Cu + 2Ca(NO3)
Cu + AgCl = Ag +CuCl2Cu + 2AgCl = 2Ag + CuCl2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCl2(aq) + HCl(aq) = HCl2(aq) + CaCl2CaCl2(aq) + 0HCl(aq) = 0HCl2(aq) + CaCl2
CaCl2 + Na2CO3 = Ca(CO3) + NaClCaCl2 + Na2CO3 = Ca(CO3) + 2NaCl
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18+O2=CO+H2O2C8H18 + 17O2 = 16CO + 18H2O
CO(g)+O2=CO2(g)2CO(g) + O2 = 2CO2(g)
C5H8O2+NaH+HCl=C5H12O2+NaClC5H8O2 + 2NaH + 2HCl = C5H12O2 + 2NaCl
C7H9+ HNO3= C7H6(NO2)3+H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
CO(g)+2H2(g)=CH3OH(g)CO(g) + 2H2(g) = CH3OH(g)
C3H8(g)+5O2(g)=3CO2(g)+4H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
C5H6O+O2=CO2+H2OC5H6O + 6O2 = 5CO2 + 3H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CO + O2 = CO22CO + O2 = 2CO2
Ca + H2O = CaO2H2 + H2Ca + 2H2O = CaO2H2 + H2
C6H12 + O2 = CO2 + H2OC6H12 + 9O2 = 6CO2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H3N3O9 = CO2 + H2O + N2 +O24C3H3N3O9 = 12CO2 + 6H2O + 6N2 + 3O2
C3H3N + O2 = CO2 + H2O + N312C3H3N + 45O2 = 36CO2 + 18H2O + 4N3
C2H4+KMnO4+H2O=C2H4(OH)2+MnO2+KOH3C2H4 + 2KMnO4 + 4H2O = 3C2H4(OH)2 + 2MnO2 + 2KOH
C3H6(NO3)3 = CO2 + N2 + H2O2C3H6(NO3)3 = 6CO2 + 3N2 + 6H2O
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
Cd+NiO2+H2O=Cd(OH)2+Ni(OH)2Cd + NiO2 + 2H2O = Cd(OH)2 + Ni(OH)2
COF2+NH3=CO(NH2)2+NH4FCOF2 + 4NH3 = CO(NH2)2 + 2NH4F
C4H9SO+O2=CO2+SO2+H2O4C4H9SO + 27O2 = 16CO2 + 4SO2 + 18H2O
CuS+NO3=Cu+NO+S88CuS + 0NO3 = 8Cu + 0NO + S8
CO+O2=CO22CO + O2 = 2CO2
CaSO4 + Na2CO3 = CaCO3 + Na2SO4CaSO4 + Na2CO3 = CaCO3 + Na2SO4
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
CO2+Ba(OH)2=BaCO3+H2OCO2 + Ba(OH)2 = BaCO3 + H2O
C2H4O2 +O2 = CO2 +H20 5C2H4O2 + 5O2 = 10CO2 + H20
CuO(s)+C(s)=CO2(g)+Cu(s)2CuO(s) + C(s) = CO2(g) + 2Cu(s)
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaCO3 + H3PO4 = Ca3(PO4)2 + CO2 + H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
CaCO3(s) + H3PO4(aq) = Ca3(PO4)2(s) + CO2(g) + H2O(l)3CaCO3(s) + 2H3PO4(aq) = Ca3(PO4)2(s) + 3CO2(g) + 3H2O(l)
Ca+ H2O= Ca(OH)+HCa + H2O = Ca(OH) + H
Ca+ H2O= Ca(OH)+HCa + H2O = Ca(OH) + H
Cl2+P=PCl55Cl2 + 2P = 2PCl5
CH4O + O2 = CO2 + H2O2CH4O + 3O2 = 2CO2 + 4H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
C3H5(NO3)3 = CO2 + N2 + H2O + O24C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
C3H5(NO3)3 = CO2 + N2 + H2O + O24C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca3P2 + 3Mg = Mg3P2 + 3 CaCa3P2 + 3Mg = Mg3P2 + 3Ca
CO + H2O = CO2 + H2CO + H2O = CO2 + H2
Ca3(Po4)2 + 3Mg = 3Mg (Po4)2 + 3CaCa3(Po4)2 + Mg = Mg(Po4)2 + 3Ca
Cu2O(s)+O2(g)=CuO(s)2Cu2O(s) + O2(g) = 4CuO(s)
CoCl3 + Pb(CO3)2 = Co2(CO3)3 + PbCl44CoCl3 + 3Pb(CO3)2 = 2Co2(CO3)3 + 3PbCl4
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C7H12 + Na2CO3=CO2 + NaC7H12 + H2O41C7H12 + 20Na2CO3 = 27CO2 + 40NaC7H12 + 6H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C7H12 + Na2CO3=CO2 + NaC7H12 + H2O41C7H12 + 20Na2CO3 = 27CO2 + 40NaC7H12 + 6H2O
Ca(OH)2(aq) + H3PO4(aq) = Ca3(PO4)2(s) + H2O(l)3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(s) + 6H2O(l)
C2H6 +O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
CH3COCH3 + O2 = CO2 + H2OCH3COCH3 + 4O2 = 3CO2 + 3H2O
Cu(OH)2+HCl=CuCl2+H2OCu(OH)2 + 2HCl = CuCl2 + 2H2O
C3H7OH(l) + O2(g) = CO2(g) + H2O(g)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
Co2(CO3)3 = Co2O3 +CO2Co2(CO3)3 = Co2O3 + 3CO2
C2H5+O2=CO2+H2O4C2H5 + 13O2 = 8CO2 + 10H2O
C2H5+O2=CO2+H2O4C2H5 + 13O2 = 8CO2 + 10H2O
CO+H2O=H2+CO2CO + H2O = H2 + CO2
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
C3H7OH +O2= CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Ca(s)+HCl(aq)=CaCl 2 (aq)+H 2 (g)Ca(s) + 2HCl(aq) = CaCl2(aq) + H2(g)
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C9H6O4 + O2 = CO2 + H2O2C9H6O4 + 17O2 = 18CO2 + 6H2O
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
CO+H2O=H2+CO2CO + H2O = H2 + CO2
CuCO 3 (s)=CuO(s)+CO 2 (g) CuCO3(s) = CuO(s) + CO2(g)
CuCl 2 (aq)+NaOH(aq)=Cu(OH) 2 (s)+NaCl(aq) CuCl2(aq) + 2NaOH(aq) = Cu(OH)2(s) + 2NaCl(aq)
CuCO 3 (s)=CuO(s)+CO 2 (g) CuCO3(s) = CuO(s) + CO2(g)
CH4 + Cl2 = CCl4 +HClCH4 + 4Cl2 = CCl4 + 4HCl
CO + 3H2O = CO2 + H2CO + H2O = CO2 + H2
C9H20+O2=CO2+H2OC9H20 + 14O2 = 9CO2 + 10H2O
Ca2++ NO3- + NH4+ CO3 2- = CaCO3+ NH4+ + NO3-0Ca2+ + NO3- + 0NH4 + 0CO32- = 0CaCO3 + 0NH4+ + NO3-
C8H8O3 + NaOH + H2SO4 = C7H6O3 + CH3OH + NaSO410C8H8O3 + 14NaOH + 14H2SO4 = 9C7H6O3 + 17CH3OH + 14NaSO4
C9H6O4 + O2 = CO2 + H2O2C9H6O4 + 17O2 = 18CO2 + 6H2O
Ca(s)+HNO 3 (aq)=Ca(NO 3 ) 2 (aq)+H 2 (g) Ca(s) + 2HNO3(aq) = Ca(NO3)2(aq) + H2(g)
Cu 2 O(s)+O 2 (g)=CuO(s) 2Cu2O(s) + O2(g) = 4CuO(s)
Ca(s)+HCl(aq)=CaCl2(aq)+H2(g)Ca(s) + 2HCl(aq) = CaCl2(aq) + H2(g)
CrBr3 + NaOH + Cl2 = Na2CrO4 + NaBrO4 + NaCl + H2O2CrBr3 + 64NaOH + 27Cl2 = 2Na2CrO4 + 6NaBrO4 + 54NaCl + 32H2O
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Ca(s)+AgNO3(aq)=Ca(NO3)2(aq)+Ag(s)Ca(s) + 2AgNO3(aq) = Ca(NO3)2(aq) + 2Ag(s)
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H7OH + O2 = CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C3H5(NO3)3=N2+O2+H2O+CO24C3H5(NO3)3 = 6N2 + O2 + 10H2O + 12CO2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H5(NO3)3=N2+O2+H2O+CO24C3H5(NO3)3 = 6N2 + O2 + 10H2O + 12CO2
Cu2+AgNO3=Cu(NO3)2+AgCu2 + 4AgNO3 = 2Cu(NO3)2 + 4Ag
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu2O(s)+O2(g)=CuO(s)2Cu2O(s) + O2(g) = 4CuO(s)
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
Cu2CO3(OH)2+HCOOH+H2O=Cu(O2CH)2*4H2O+CO2Cu2CO3(OH)2 + 4HCOOH + 5H2O = 2Cu(O2CH)2*4H2O + CO2
CS2+Cl2=CCl4+S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
C+Fe2O3=Fe+CO3C + Fe2O3 = 2Fe + 3CO
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cr+H2SO4=Cr2(SO4)3+H22Cr + 3H2SO4 = Cr2(SO4)3 + 3H2
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C2H4F2+O2=HF+CO+H2O2C2H4F2 + 3O2 = 4HF + 4CO + 2H2O
CS2 + Cl2 = CCl3 + S2CS2 + 3Cl2 = 2CCl3 + 4S
CS2 + Cl = CCl3 + SCS2 + 3Cl = CCl3 + 2S
C8H12 + O2 = CO2 + H2OC8H12 + 11O2 = 8CO2 + 6H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
CaO + H20 = CaOH2 10CaO + H20 = 10CaOH2
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Ca(C2H3O2)2 + H2SO4 = CaSO4 + HC2H3O2Ca(C2H3O2)2 + H2SO4 = CaSO4 + 2HC2H3O2
CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CrI3 + Na3PO4 = CrPO4 + 3NaICrI3 + Na3PO4 = CrPO4 + 3NaI
CrI3(aq) + Na3PO4(aq) = CrPO4(s) + 3NaI(aq)CrI3(aq) + Na3PO4(aq) = CrPO4(s) + 3NaI(aq)
CrI3(aq) + Na3PO4(aq) = CrPO4(s) + 3NaI(aq)CrI3(aq) + Na3PO4(aq) = CrPO4(s) + 3NaI(aq)
C2H6+O2=H20+CO210C2H6 + 20O2 = 3H20 + 20CO2
Cu(NO3)2(aq) + 4NH4OH(aq) = Cu(NH3)4(s) + 2NO3(aq) + 4H2O(l)Cu(NO3)2(aq) + 4NH4OH(aq) = Cu(NH3)4(s) + 2NO3(aq) + 4H2O(l)
Cu(NO3)2(aq) + 4NH4OH(aq) = Cu(NH3)4(s) + 2NO3(aq) + 4H2O(l)Cu(NO3)2(aq) + 4NH4OH(aq) = Cu(NH3)4(s) + 2NO3(aq) + 4H2O(l)
Cu(NO3)2(aq) + 4NH4OH(aq) = Cu(NH3)4(s) + 2NO3(aq) + 4H2O(l)Cu(NO3)2(aq) + 4NH4OH(aq) = Cu(NH3)4(s) + 2NO3(aq) + 4H2O(l)
C6H10O5 + H2O= C6H12O6C6H10O5 + H2O = C6H12O6
Cu+FeCl3 = CuCl+ Fe3Cu + FeCl3 = 3CuCl + Fe
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
Ca+H2O=H2+CaOH2Ca + 2H2O = H2 + 2CaOH
C2H5OH+3O2=2CO2+3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaS2O3 + CuF2 = CaF2 + CuS2O3CaS2O3 + CuF2 = CaF2 + CuS2O3
C2H6O+O2=H2O+CO2C2H6O + 3O2 = 3H2O + 2CO2
C2H6O(l)+3O2(g)=3H2O(g)+2CO2(g)C2H6O(l) + 3O2(g) = 3H2O(g) + 2CO2(g)
C5H12(g)+O2(g)=CO2(g)+H2O(g)C5H12(g) + 8O2(g) = 5CO2(g) + 6H2O(g)
C2O4 + MnO4 = Mn + CO2C2O4 + 0MnO4 = 0Mn + 2CO2
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
C7H9+HNO3=C7H6(NO2)3+H2OC7H9 + 3HNO3 = C7H6(NO2)3 + 3H2O
C7H10N+O2=CO2+H2O+NO22C7H10N + 21O2 = 14CO2 + 10H2O + 2NO2
Ca3(PO4)2+C=Ca3P2+COCa3(PO4)2 + 8C = Ca3P2 + 8CO
C4H4+6O2=4CO2+4H2OC4H4 + 5O2 = 4CO2 + 2H2O
Ca (s) + 2 HNO3 (aq) = Ca(NO3)2 (aq) + H2 (g)Ca(s) + 2HNO3(aq) = Ca(NO3)2(aq) + H2(g)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12(l)+O2(g)=CO2(g)+H2O(g)C5H12(l) + 8O2(g) = 5CO2(g) + 6H2O(g)
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C9H20 + O2 = CO2 + H2OC9H20 + 14O2 = 9CO2 + 10H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C8H16+O2=CO2+H2OC8H16 + 12O2 = 8CO2 + 8H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CH2+H2O2CH4 + O2 = 2CH2 + 2H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca3P2+12H2O = Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca3P2+12H2O = Ca(OH)2+PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Cu+FeCl3=CuCl3+FeCu + FeCl3 = CuCl3 + Fe
Ca3(PO4)2+H3PO4 = Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CS4+Cl2=CCl4+S2Cl2CS4 + 4Cl2 = CCl4 + 2S2Cl2
Cs2SO4 + MgCl2 = CsCl + MgSO4Cs2SO4 + MgCl2 = 2CsCl + MgSO4
Cs2SO4 + MgCl2 = CsCl + MgSO4Cs2SO4 + MgCl2 = 2CsCl + MgSO4
Cs2SO4 + MgCl2 = CsCl + MgSO4Cs2SO4 + MgCl2 = 2CsCl + MgSO4
C3H5(NO3)3 = N + CO2 + H2O + O24C3H5(NO3)3 = 12N + 12CO2 + 10H2O + O2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaBr2+K3PO4 = Ca3(PO4)2+KBr3CaBr2 + 2K3PO4 = Ca3(PO4)2 + 6KBr
CH3CH2CH3+O2=CO2+H205CH3CH2CH3 + 15O2 = 15CO2 + 2H20
CH3(CH2)5CH3+O2=CO2+H205CH3(CH2)5CH3 + 35O2 = 35CO2 + 4H20
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Ca3(PO4)2+SiO2+C= CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CaC2+H2O=C2H2 + Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
Cu+HNO3=Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
Cu+HNO3=Cu(NO3)2+H2O+NO3-1Cu + 0HNO3 = -1Cu(NO3)2 + 0H2O + 2NO3
Ca(OH)2(aq) + HCl(aq) = H2O(l) + CaCl2(aq)Ca(OH)2(aq) + 2HCl(aq) = 2H2O(l) + CaCl2(aq)
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
COF2 + NH3 = NH4F +CO(NH2)2COF2 + 4NH3 = 2NH4F + CO(NH2)2
C2H4+O2=CO2+H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H4+O2=CO26H2OC2H4 + 27O2 = 2CO26H2O
C4H8+CrO3+HCL= C2H4O2 + CrCL3 + H2O-3C4H8 - 8CrO3 - 24HCL = -14C2H4O2 - 8CrCL3 + 4H2O
Ca(OH)2+Al2(SO4)3=CaSO4+Al(OH)33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
CaCO3 + HCl = CaCl2 + H2CO3CaCO3 + 2HCl = CaCl2 + H2CO3
C4H8O+O2=CO2+H2O2C4H8O + 11O2 = 8CO2 + 8H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
CH4+O2 =CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCo3+HCl=CaCl3 + HCoCaCo3 + 3HCl = CaCl3 + 3HCo
Co(H2O)6 + 4Cl=CoCl4+ 6H2OCo(H2O)6 + 4Cl = CoCl4 + 6H2O
COF2 + NH3 = NH4F + CO(NH2)2COF2 + 4NH3 = 2NH4F + CO(NH2)2
C10H22(g) + O2(g) = CO2(g) + H2O(g) 2C10H22(g) + 31O2(g) = 20CO2(g) + 22H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Ca3(PO4)2+C+SiO2=CaSiO3+CO+PCa3(PO4)2 + 5C + 3SiO2 = 3CaSiO3 + 5CO + 2P
Ca2(PO4)2+C+SiO=CaSiO3+CO+PCa2(PO4)2 + 4C + 2SiO = 2CaSiO3 + 4CO + 2P
C12H22O11+O2=CO2=H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Cu + AgNO3 = Cu(NO3)2 +AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Ca(OH)2 + H2SO4 = HOH + CaSO4Ca(OH)2 + H2SO4 = 2HOH + CaSO4
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu(NO3)2 + NaOH = CuOH + (NO3)2NaCu(NO3)2 + NaOH = CuOH + (NO3)2Na
C4H4 + 6O2 = 4CO2 + 4H02OC4H4 + 5O2 = 4CO2 + 2H02O
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C7H16 + 11O2 = 7CO2 + 8H2O C7H16 + 11O2 = 7CO2 + 8H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C+O2=CO2C + O2 = CO2
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O = CO2 + H2OC6H14 + 19O = 6CO2 + 7H2O
Co(NO3)2 + 2AgCl4 = CoCl4 + Ag(NO3)2 Co(NO3)2 + AgCl4 = CoCl4 + Ag(NO3)2
CaSO4 + KOH = Ca(OH)2 + K2SO4CaSO4 + 2KOH = Ca(OH)2 + K2SO4
C14H10O2 + CH4N2O = C15H12N2O2 + 2H2OC14H10O2 + CH4N2O = C15H12N2O2 + H2O
C14H10O2 + CH4N2O = C15H12N2O2 + H2OC14H10O2 + CH4N2O = C15H12N2O2 + H2O
CH3COOH + NaHCO3 = CO2 + H2O + CH3COONaCH3COOH + NaHCO3 = CO2 + H2O + CH3COONa
CH3COOH + NaHCO3 = CO2 + H2O + CH3COONaCH3COOH + NaHCO3 = CO2 + H2O + CH3COONa
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl2+PbI4=PbCl4+I22Cl2 + PbI4 = PbCl4 + 2I2
C + H2 = CH4C + 2H2 = CH4
CuCl2 + H2S = CuS + HClCuCl2 + H2S = CuS + 2HCl
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6+CO2+H2O=C2H5OH6C2H6 + 2CO2 + 3H2O = 7C2H5OH
Cu+O2=CuO2Cu + O2 = 2CuO
C2H5OH + O2 = H2O + CO2C2H5OH + 3O2 = 3H2O + 2CO2
C2H6(g) + O2(g) =CO2(g) + H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
Cu + AgNO3 = Ag + CuNO3Cu + AgNO3 = Ag + CuNO3
C2H4+O2=CO2+H2O C2H4 + 3O2 = 2CO2 + 2H2O
Cu2(CO3)2+(H2SO4)=Cu2(SO4)2+(H2CO3)Cu2(CO3)2 + 2(H2SO4) = Cu2(SO4)2 + 2(H2CO3)
C2H4+O2=CO2+3H2O C2H4 + 3O2 = 2CO2 + 2H2O
Ca+N2=Ca3N23Ca + N2 = Ca3N2
Cu(NO3)2 + H2SO4 = CuSO4 + H2(NO3)2Cu(NO3)2 + H2SO4 = CuSO4 + H2(NO3)2
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CaCO3+H3PO4=Ca3(PO4)2+CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
CuCl2(aq) + K2S(aq) = CuS(s) + 2 KCl(aq)CuCl2(aq) + K2S(aq) = CuS(s) + 2KCl(aq)
CuCl2(aq) + K2S(aq) = CuS(s) + 2 KCl(aq)CuCl2(aq) + K2S(aq) = CuS(s) + 2KCl(aq)
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
CaC2+H2O=C2H2Ca(OH)2CaC2 + 2H2O = C2H2Ca(OH)2
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca+I2=CaI2Ca + I2 = CaI2
C+CO2 = CO7-5C + 7CO2 = 2CO7
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CO2+O2+N2+H2O=C3H5(NO3)312CO2 + O2 + 6N2 + 10H2O = 4C3H5(NO3)3
C02+O2+N2+H2O=C3H5(NO3)36C02 + 13O2 + 6N2 + 10H2O = 4C3H5(NO3)3
C02+O2+N2+H20=C3H5(NO3)36C02 + 18O2 + 6N2 + H20 = 4C3H5(NO3)3
CoCl2+NaOH=CoOH+NaCl2CoCl2 + NaOH = CoOH + NaCl2
C9H20 +O2 =CO2 +H2OC9H20 + 14O2 = 9CO2 + 10H2O
C2H2 + O2 = H2O + CO22C2H2 + 5O2 = 2H2O + 4CO2
C6H12O + NO3 = CO2 + H2O + N26C6H12O + 34NO3 = 36CO2 + 36H2O + 17N2
C6H12O + NO3 = CO2 + H2O + N26C6H12O + 34NO3 = 36CO2 + 36H2O + 17N2
C2 H5 OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CaI2 + (NH4)3PO4 = Ca3(PO4)2 + NH4I3CaI2 + 2(NH4)3PO4 = Ca3(PO4)2 + 6NH4I
C+H2=C3H83C + 4H2 = C3H8
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C6H12O6 = CH3CH2OH + CO2C6H12O6 = 2CH3CH2OH + 2CO2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(s)+H2O(l)=Ca(OH)2(aq)+H2(g)Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
C4H10+O2 = CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCO3(s) + HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
CO(g)+H2(g)=H2O(g)+CH4(g)CO(g) + 3H2(g) = H2O(g) + CH4(g)
C2H4O(g)+O2(g)=CO2(g)+H2O(g)2C2H4O(g) + 5O2(g) = 4CO2(g) + 4H2O(g)
C3H8O3(g)+O2(g)=CO2(g)+H2O(g)2C3H8O3(g) + 7O2(g) = 6CO2(g) + 8H2O(g)
Cl2+NaI = I+NaClCl2 + 2NaI = 2I + 2NaCl
Cu(NO3)2 + Na3PO4 = Cu3(PO4)2+ NaNO33Cu(NO3)2 + 2Na3PO4 = Cu3(PO4)2 + 6NaNO3
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H6 + O2 = CO + H2OC3H6 + 3O2 = 3CO + 3H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6=C2H5OH+CO2C6H12O6 = 2C2H5OH + 2CO2
Ca(OH)2+H3PO4=H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
Cu(OH)2 + NaClO + NaOH = CuO + NaCl + H2OCu(OH)2 + 0NaClO + 0NaOH = CuO + 0NaCl + H2O
C2H4 + KMnO4 + H2O = C2H6O2 + MnO2 + KOH3C2H4 + 2KMnO4 + 4H2O = 3C2H6O2 + 2MnO2 + 2KOH
C7H6N2O3 + Cl2 +NaOH = O2NC6H4NH2 + Na2CO3 + H2O + NaClC7H6N2O3 + Cl2 + 4NaOH = O2NC6H4NH2 + Na2CO3 + 2H2O + 2NaCl
CaCl2 + (NH4)2SO4 = CaSO4 + ClNH4CaCl2 + (NH4)2SO4 = CaSO4 + 2ClNH4
CO + H2 =C3H8 + O26CO + 8H2 = 2C3H8 + 3O2
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Ca(HO)2+HNO3=Ca(NO3)2+H2OCa(HO)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Ca2 H6 +O2 = Ca2 + H2O2Ca2H6 + 3O2 = 2Ca2 + 6H2O
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
Ca(s)+H2O(l)=H2(g)+Ca(OH)2(s)Ca(s) + 2H2O(l) = H2(g) + Ca(OH)2(s)
C5H11NH2 + O2 = CO2 + H2O + NO24C5H11NH2 + 37O2 = 20CO2 + 26H2O + 4NO2
Cu2S + O2 + H+ = Cu+2 + SO4-2 + H2O2Cu2S + 5O2 + 4H+ = 4Cu+2 + 2SO4-2 + 2H2O
C4H10 + O2 = H2O10 + C2O4C4H10 + 29O2 = 5H2O10 + 2C2O4
Cu2S + O2 + H+ = Cu2+ + SO4-2 + H2O-4Cu2S - 7O2 + 4H+ = -4Cu2+ - 4SO4-2 + 2H2O
Cl2(g)+I-(aq)=I2(s)+Cl-(aq)Cl2(g) + 2I-(aq) = I2(s) + 2Cl-(aq)
CH + Cl2 = CH3Cl + HCl-2CH + Cl2 = -2CH3Cl + 4HCl
CrCl3+ AgNO3 = AgCl + Cr(NO3)3CrCl3 + 3AgNO3 = 3AgCl + Cr(NO3)3
Ca + H2O = Ca(OH)2+ H2Ca + 2H2O = Ca(OH)2 + H2
Cr2O3 + C = Cr + CO22Cr2O3 + 3C = 4Cr + 3CO2
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Ca(s)+O2(g)+C(s)=CaCO3(s)2Ca(s) + 3O2(g) + 2C(s) = 2CaCO3(s)
C2H5OH+ O2= CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Co(NO3)2 + H2S= CoS + 2HNO3Co(NO3)2 + H2S = CoS + 2HNO3
CuSO4 + H2O = Cu(OH)2 + H2SO4 CuSO4 + 2H2O = Cu(OH)2 + H2SO4
C4H9N+O2=CO2+H2O+NO24C4H9N + 29O2 = 16CO2 + 18H2O + 4NO2
Ca + O2 = Ca2O22Ca + O2 = Ca2O2
Cu+HNO3 = Cu (NO3)2 +H2O +NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
C6H12 + O2 = H2O + C2O4C6H12 + 9O2 = 6H2O + 3C2O4
CuCl2*5H2O = CuCl2 + H2OCuCl2*5H2O = CuCl2 + 5H2O
C2H5OH+O=2CO2+H2OC2H5OH + 6O = 2CO2 + 3H2O
CoCl2 + Fe(NO3)3 = Co(NO3)2 + FeCl33CoCl2 + 2Fe(NO3)3 = 3Co(NO3)2 + 2FeCl3
CoS + H2O = Co(OH)2 + H2SCoS + 2H2O = Co(OH)2 + H2S
CO + O2 = CO22CO + O2 = 2CO2
C + O2 = CO2C + O2 = 2CO
CaBr2 + Na3PO4 = Ca3(PO4)2 + NaBr3CaBr2 + 2Na3PO4 = Ca3(PO4)2 + 6NaBr
CaCO3+C=CaC2+CO22CaCO3 + 5C = 2CaC2 + 3CO2
CH4(g) + 3I2(g) = 3HI(g) + CHI3(g)CH4(g) + 3I2(g) = 3HI(g) + CHI3(g)
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CaCl2 +Na3PO4 = Ca3(PO4)2 + NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
CuS + HNO3 = Cu(NO3)2 + NO2 + S8 + H2O8CuS + 32HNO3 = 8Cu(NO3)2 + 16NO2 + S8 + 16H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+HCl=CaCl+HCa + HCl = CaCl + H
CrCL3+KOH+K+KCLO3 = KCL+K2CrO4+H2O0CrCL3 + 6KOH - 6K - KCLO3 = -1KCL + 0K2CrO4 + 3H2O
CrCL3 + KOH + K + KCLO3 = KCL + K2CrO4 + H2O0CrCL3 + 6KOH - 6K - KCLO3 = -1KCL + 0K2CrO4 + 3H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cd(MnO4)2+K = KMnO4 +CdCd(MnO4)2 + 2K = 2KMnO4 + Cd
Cr2(SO3)3+H2SO4=Cr2(SO4)3+SO2+H2OCr2(SO3)3 + 3H2SO4 = Cr2(SO4)3 + 3SO2 + 3H2O
CH4 + O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
Ca3(AsO4)2 + Na2CO3 = CaCO3 + Na3AsO4Ca3(AsO4)2 + 3Na2CO3 = 3CaCO3 + 2Na3AsO4
CrCL3 + KOH + K + KCLO3 = KCL + K2CrO4 + H2O0CrCL3 + 6KOH - 6K - KCLO3 = -1KCL + 0K2CrO4 + 3H2O
CuS + HNO3 = Cu(NO3)2 + NO2 + S8 + H2O8CuS + 32HNO3 = 8Cu(NO3)2 + 16NO2 + S8 + 16H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C2H6O3+ C2H3O2 = C9H8O4 + H2O9C2H6O3 + 0C2H3O2 = 2C9H8O4 + 19H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H4O+H2O=C2H6O2C2H4O + H2O = C2H6O2
CH3CH2CH2CH3+O2=CO2+H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C10H22+O2=CO2+H2O2C10H22 + 31O2 = 20CO2 + 22H2O
Cr+ O2 = Cr2O34Cr + 3O2 = 2Cr2O3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H8O7 + KOH = K3C6H5O7 + H2OC6H8O7 + 3KOH = K3C6H5O7 + 3H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3 + HCl = CaCl2 +CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 +H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CuO+NH3=N2+Cu+H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
Ca(OH)2(aq)+HNO3(aq)=Ca(NO3)2(aq)+H2O(l)Ca(OH)2(aq) + 2HNO3(aq) = Ca(NO3)2(aq) + 2H2O(l)
Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
C4H4+6O2=4CO2+4H2OC4H4 + 5O2 = 4CO2 + 2H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
Cu+4HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Ca(s)+Br2(l)=CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
CS2+O=CO2+SO2CS2 + 6O = CO2 + 2SO2
Ca(s)+HCl(aq)=CaCl2(aq)+H2(g)Ca(s) + 2HCl(aq) = CaCl2(aq) + H2(g)
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2+CaSiO3+H2O=SiO2+Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
Ca(s)+AgNO3(aq)=Ca(NO3)2(aq)+Ag(s)Ca(s) + 2AgNO3(aq) = Ca(NO3)2(aq) + 2Ag(s)
CaCO3(s)=CaO(s)+CO2(g)CaCO3(s) = CaO(s) + CO2(g)
C2H6 +O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H2 +O2 = CO + H2O2C2H2 + 3O2 = 4CO + 2H2O
CH4(g) + 3I2(g) = 3HI(g) + CHI3(g)CH4(g) + 3I2(g) = 3HI(g) + CHI3(g)
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
C3H8+O2=H2O+CO2C3H8 + 5O2 = 4H2O + 3CO2
Ca3 (PO4)2 + C + SiO2 = CaSiO3 + CO + P42Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + 10CO + P4
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H8OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)4C2H8OH(l) + 15O2(g) = 8CO2(g) + 18H2O(g)
C2H8OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)4C2H8OH(l) + 15O2(g) = 8CO2(g) + 18H2O(g)
C2H8OH(l) + 3O2(g) = 2CO2(g) + 3H2O(g)4C2H8OH(l) + 15O2(g) = 8CO2(g) + 18H2O(g)
Ca + O2 = CaO2Ca + O2 = 2CaO
C5H11OH+O2=CO2+H2O2C5H11OH + 15O2 = 10CO2 + 12H2O
C6H12O6(s) = C2H6O(l) + CO2(g)C6H12O6(s) = 2C2H6O(l) + 2CO2(g)
C4H4+6O2=4CO2+4H2OC4H4 + 5O2 = 4CO2 + 2H2O
Ca(OH)2 +H3PO4 = Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CS2 + IF5 = CF4 + S8 + I220CS2 + 16IF5 = 20CF4 + 5S8 + 8I2
C3H8O + C3H80 + 0 = CO2 + H20-30C3H8O + 25C3H80+0 = -15CO2 + 88H20
Cu(OH)2 + NH3 = Cu(NH3)4++ +OH-Cu(OH)2 + 4NH3 = Cu(NH3)4++ + 2OH-
C3H8O + C3H80 = CO2 + H20-30C3H8O + 25C3H80 = -15CO2 + 88H20
CH4 = C2H2 + H22CH4 = C2H2 + 3H2
CaO + SO2 + O2 = CaSO42CaO + 2SO2 + O2 = 2CaSO4
CoI2(aq) + Na2CO3(aq) =CoCO3(s) + 2NaI(aq)CoI2(aq) + Na2CO3(aq) = CoCO3(s) + 2NaI(aq)
CaF2 + H2SO4 = 2HF + CaSO4CaF2 + H2SO4 = 2HF + CaSO4
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaBr2 + (NH4)2S = NH4Br + CaSCaBr2 + (NH4)2S = 2NH4Br + CaS
C2H3N + 9O2 = CO + 6H2O + NO4C2H3N + 9O2 = 8CO + 6H2O + 4NO
C5H12 + O2= CO2+ H2OC5H12 + 8O2 = 5CO2 + 6H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.