Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C4H10(l)+O2(g)=CO2(g)+H2O(g)2C4H10(l) + 13O2(g) = 8CO2(g) + 10H2O(g)
C3H8O3+O2=CO2+H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
CaC2(s)+H2O(l)=Ca(OH)2+C2H2(g)CaC2(s) + 2H2O(l) = Ca(OH)2 + C2H2(g)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H10+O2=CO+H2O2C6H10 + 11O2 = 12CO + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CuS + NaCl2 = CuCl2 + NaSCuS + NaCl2 = CuCl2 + NaS
CuS + NaCl2 = CuCl2 + NaSCuS + NaCl2 = CuCl2 + NaS
CuS + NaCl = CuCl + NaSCuS + NaCl = CuCl + NaS
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
CH3OH(l) + O2(g) = CO2(g) + H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
CuSO4(aq) + NH4OH(aq)= Cu(OH)2(s) + NH3(g) + H2SO4(aq)CuSO4(aq) + 2NH4OH(aq) = Cu(OH)2(s) + 2NH3(g) + H2SO4(aq)
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3(PO4)+SiO2+C=CaSi3+P4+CO4Ca3(PO4) + 36SiO2 + 88C = 12CaSi3 + P4 + 88CO
Ca(NO3)2(aq)+KCl(aq)=CaCl2+2KNO3Ca(NO3)2(aq) + 2KCl(aq) = CaCl2 + 2KNO3
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
C4H8O2 + O2 = CO2 + H2OC4H8O2 + 5O2 = 4CO2 + 4H2O
CaCl2 + Na3PO4 = NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cl2 + NaOH = NaCl + NaClO3 + H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3(CH2)6CH3+O2=CO2+H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CH3OH+ClO3=CO2+H2O+ClO2CH3OH + 3ClO3 = CO2 + 2H2O + 3ClO2
Ca(OH)2+HCl=CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C5H10 + O2 = CO2 + H2O2C5H10 + 15O2 = 10CO2 + 10H2O
C5H10 + O2 = CO2 + H2O2C5H10 + 15O2 = 10CO2 + 10H2O
CH3(CH2)2CH3+O2=CO2+H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CO2+Ba(OH)2=BaCO3+H2O CO2 + Ba(OH)2 = BaCO3 + H2O
C5H10 + O2 = CO2 + H202C5H10 + 10O2 = 10CO2 + H20
C5H10 + O2=CO2 + H202C5H10 + 10O2 = 10CO2 + H20
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
Cl2+NaBr=NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
C2H2+O2= CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca3(PO4)2 + C + SiO2 = P4 + CaSiO3 + CO2Ca3(PO4)2 + 10C + 6SiO2 = P4 + 6CaSiO3 + 10CO
Cr+ Cl2= CrCl32Cr + 3Cl2 = 2CrCl3
Cu(NO3)2 + KOH = KNO3 +Cu(OH)2Cu(NO3)2 + 2KOH = 2KNO3 + Cu(OH)2
CH3(CH2)4CH3+O2=CO2+H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C3H6(g)+O2(g)=CO2(g)+H2O(g)2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
Cu(s) + H2SO4(aq) = CuSO4(aq) + SO2(g) + H2O(l)Cu(s) + 2H2SO4(aq) = CuSO4(aq) + SO2(g) + 2H2O(l)
C2H6O=H2O + CH2C2H6O = H2O + 2CH2
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C5H8 + O2 = 5CO2 + 4H2OC5H8 + 7O2 = 5CO2 + 4H2O
Co+2 + 2NH3 + 2H2O= Co(OH)2+ 2NH4+Co+2 + 2NH3 + 2H2O = Co(OH)2 + 2NH4+
C+H2O=CO+H2C + H2O = CO + H2
C2H8 + O2 = CO2 + H2OC2H8 + 4O2 = 2CO2 + 4H2O
Co(OH)2(s) + KSCN = Co(SCN)2 +KOH(aq)Co(OH)2(s) + 2KSCN = Co(SCN)2 + 2KOH(aq)
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H4+O2=CO2+H2OC3H4 + 4O2 = 3CO2 + 2H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO2(g)+H2O(l)=H2CO3(aq)CO2(g) + H2O(l) = H2CO3(aq)
CaSO4+KOH=Ca(OH)2+K2SO4CaSO4 + 2KOH = Ca(OH)2 + K2SO4
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cl2 + e = Cl33Cl2 + 0e = 2Cl3
Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + NH4C2H3O2Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + 2NH4C2H3O2
Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + NH4C2H3O2Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + 2NH4C2H3O2
C2H5NSCI+O2=CO+H2O+NO2+SO2+HCIC2H5NSCI + 4O2 = 2CO + 2H2O + NO2 + SO2 + HCI
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(NO3)2+(NH4)2S = CaS+NO3NH4Ca(NO3)2 + (NH4)2S = CaS + 2NO3NH4
C2H3NO2S+O2=CO2+H2O+NO2+SO34C2H3NO2S + 17O2 = 8CO2 + 6H2O + 4NO2 + 4SO3
C2H7N+O2=CO2+H2O+NO24C2H7N + 19O2 = 8CO2 + 14H2O + 4NO2
C2H7N+O2=CO2+H2O+NO24C2H7N + 19O2 = 8CO2 + 14H2O + 4NO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + CO2(g) = CaCO3(s) + H2O(l)Ca(OH)2 + CO2(g) = CaCO3(s) + H2O(l)
Ca3(PO4)2+H3PO4 = Ca(H2PO4)2Ca3(PO4)2 + 4H3PO4 = 3Ca(H2PO4)2
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CaC2+H2O=C2H2+Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca + H2O= 2 CaOH + H22Ca + 2H2O = 2CaOH + H2
CuCO3 + H2SO4 = CuSO4 + H2O +CO2CuCO3 + H2SO4 = CuSO4 + H2O + CO2
C2H5OH(l) + O2(g) = CO2(g) + H2O(l) C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
Ca3(PO4)2+SiO2=P4O10+CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
C2H5OH + O2 = CO2 + H2O C2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+O2(g)=CO2(g)+H2O(g)C2H5OH + 3O2(g) = 2CO2(g) + 3H2O(g)
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cu(OH)2(s)+N2H4(aq)=Cu(s)+N2(g)+H2O2Cu(OH)2(s) + N2H4(aq) = 2Cu(s) + N2(g) + 4H2O
C3H8 +O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CrI3 + KOH + Cl2 = H2O + K2CrO4 + KCl + KIO42CrI3 + 64KOH + 27Cl2 = 32H2O + 2K2CrO4 + 54KCl + 6KIO4
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 +O2 =C3 + 2H2OC3H8 + 2O2 = C3 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
Cu(NO3)2 + Na2S = CuS + NaNO3Cu(NO3)2 + Na2S = CuS + 2NaNO3
C3H8(g) + O2(g) = CO2(g) + H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CuCl2+Cd=Cd2Cu+ClCuCl2 + 2Cd = Cd2Cu + 2Cl
Cu(NO3)2 + Na2S = CuS + 2NaNO3Cu(NO3)2 + Na2S = CuS + 2NaNO3
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CH3OH + O2=CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C2H6(g) + O2(g) = CO2(g) + H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
Ca(OH)2(aq) + H3PO4(aq) = Ca3(PO4)2+H2O3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2 + 6H2O
CoCl3(aq) + Na2S(aq) = Co2S3(s) + NaCl(aq)2CoCl3(aq) + 3Na2S(aq) = Co2S3(s) + 6NaCl(aq)
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaO + CO2 = CaCO3CaO + CO2 = CaCO3
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CH4+O2=CH2+H2O2CH4 + O2 = 2CH2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
CuSO4+Fe=Fe2(SO4)3+Cu3CuSO4 + 2Fe = Fe2(SO4)3 + 3Cu
CuSO4+Fe=Fe2(SO4)3+Cu3CuSO4 + 2Fe = Fe2(SO4)3 + 3Cu
C12H22O11+H2O=C2H5OH+CO2C12H22O11 + H2O = 4C2H5OH + 4CO2
C6H8O6 + I3- + H2O = C6H8O7 + I- + H+C6H8O6 + I3- + H2O = C6H8O7 + 3I- + 2H+
Ca(NO3)2 + NH4F = CaF2 + N2O +H2OCa(NO3)2 + 2NH4F = CaF2 + 2N2O + 4H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu+ + O2 + H+ = H2O + Cu++ 4Cu+ + O2 + 4H+ = 2H2O + 4Cu++
Cu++ + S2O3-- = S4O6-- + Cu+ 2Cu++ + 2S2O3-- = S4O6-- + 2Cu+
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
CO2+CaSiO3+H2O= SiO2+Ca(HCO3)22CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 + O2 = CO2 =H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C6H12O6 = CO2 + C2H5OHC6H12O6 = 2CO2 + 2C2H5OH
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO2 + NH3 = OC(NH2)2 +H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C10H16 + Cl2 = C + HClC10H16 + 8Cl2 = 10C + 16HCl
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C2H6+O2= CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2 + H2SO4 = CaH4(PO4)2 + CaSO4Ca3(PO4)2 + 2H2SO4 = CaH4(PO4)2 + 2CaSO4
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
Ca(OH)2 + HI = CaI2 + H2OCa(OH)2 + 2HI = CaI2 + 2H2O
C8H18+O2 = CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu(aq)+OH(aq)=CuOHCu(aq) + OH(aq) = CuOH
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+O2=CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
CH4+Br2=CBr4+HBrCH4 + 4Br2 = CBr4 + 4HBr
CdS + I2 + HCl = CdCl2 + HI + SCdS + I2 + 2HCl = CdCl2 + 2HI + S
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca(OH)2+SO3=CaSO4+H2OCa(OH)2 + SO3 = CaSO4 + H2O
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(CN)2+HBr=CaBr2+HCNCa(CN)2 + 2HBr = CaBr2 + 2HCN
C3H6+O2=CO+H2OC3H6 + 3O2 = 3CO + 3H2O
Cu+HNO3=Cu(NO3)2+ NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH3OH(l)+O2(g)=CO2(g)+H2O(l)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(l)
Cl2+NaOH=NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cr2O3(s)+CCl4(l)=CrCl3(s)+3COCl2(aq)Cr2O3(s) + 3CCl4(l) = 2CrCl3(s) + 3COCl2(aq)
C6H12O6 + 6O2 = 6CO2 + 6H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C2H6O = CH4 + H2 + CO22C2H6O = 3CH4 + 0H2 + CO2
CaO+H2O=CaH+O2CaO + H2O = 2CaH + 3O
C2 H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
C4 H10 O + O2 = CO2+H22C4H10O + 7O2 = 8CO2 + 10H2
CuSO + NaCl = NaSO + CuClCuSO + NaCl = NaSO + CuCl
CuSO + NaCl = NaSO + CuClCuSO + NaCl = NaSO + CuCl
C4H6O3+H2O=C2H4O2C4H6O3 + H2O = 2C2H4O2
CuSO + NaCl = NaSO + CuClCuSO + NaCl = NaSO + CuCl
CuSO4 + NaCl = NaSO4 + CuClCuSO4 + NaCl = NaSO4 + CuCl
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CH4+O=CO2+H2OCH4 + 4O = CO2 + 2H2O
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
C6H12O2+O2=CO2+H205C6H12O2 + 25O2 = 30CO2 + 3H20
CH4 + N2Cl4=N2+CCl4+2H2CH4 + N2Cl4 = N2 + CCl4 + 2H2
CH4(g)+Cl2(g)=CCl4(l)+HCl(g)CH4(g) + 4Cl2(g) = CCl4(l) + 4HCl(g)
Cr(s) + O2(g) =Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
Cl2(g) + KBr(aq) = Br2(l) + KCl(aq)Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl(aq)
CaCl2(aq)+Na3PO4(aq)=Ca3(PO4)2(s)+NaCl(aq)3CaCl2(aq) + 2Na3PO4(aq) = Ca3(PO4)2(s) + 6NaCl(aq)
C5H10O2+O2 = CO2+H202C5H10O2 + 8O2 = 10CO2 + H20
CO(g)+O2(g)=CO2(g)2CO(g) + O2(g) = 2CO2(g)
CuCO3(s)=CuO(s)+CO2(g)CuCO3(s) = CuO(s) + CO2(g)
C + S8 = CS24C + S8 = 4CS2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C4H6 + 4O2 = 4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C4H6 + 11O2=4CO2 + 3H2O2C4H6 + 11O2 = 8CO2 + 6H2O
Ca(OH)2 + CO2 = CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
Ca(OH)2 + CO2 = CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
CuCO3+HNO3= Cu(NO3)2+CO2+H2OCuCO3 + 2HNO3 = Cu(NO3)2 + CO2 + H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
CO2(g)+CaSiO3(s)+H2O(l)=SiO2(s)+Ca(HCO3)2(aq)2CO2(g) + CaSiO3(s) + H2O(l) = SiO2(s) + Ca(HCO3)2(aq)
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Ca3(PO4)2 + H2SO4 = CaH4(PO4)2 + CaSO4Ca3(PO4)2 + 2H2SO4 = CaH4(PO4)2 + 2CaSO4
CuO+CO=Cu+CO2CuO + CO = Cu + CO2
C6H6OS+O2=CO2+H2O+SO32C6H6OS + 17O2 = 12CO2 + 6H2O + 2SO3
C6H6OS+O2=CO2+H2O+SO32C6H6OS + 17O2 = 12CO2 + 6H2O + 2SO3
C12H22O11+O2=CO2+H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C3H5(NO3)3 = N2 + CO2 + O2 + H2O4C3H5(NO3)3 = 6N2 + 12CO2 + O2 + 10H2O
C2H5OH(l)+ O2(g) = CO2(g)+ H2O(l)C2H5OH(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
C2H6 +O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaSiO3(s)+HF(g)=CaF2(aq)+SiF4(g)+H2O(l)CaSiO3(s) + 6HF(g) = CaF2(aq) + SiF4(g) + 3H2O(l)
Cu(s)+AgC2H3O2(aq)=Cu(C2H3O2)2(aq)+Ag(s)Cu(s) + 2AgC2H3O2(aq) = Cu(C2H3O2)2(aq) + 2Ag(s)
Ca3(PO4)2+SiO2+C=P4+CaSiO3+CO2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 6CaSiO3 + 10CO
C2H5COOH + O2 = CO2 + H2O2C2H5COOH + 7O2 = 6CO2 + 6H2O
C2H5COOH + H2O = CO2 + H2O0C2H5COOH + H2O = 0CO2 + H2O
CS2 + CaO = CO2 + CaSCS2 + 2CaO = CO2 + 2CaS
CaC2(s)+H2O(l)=Ca(OH)2(s)+C2H2(g)CaC2(s) + 2H2O(l) = Ca(OH)2(s) + C2H2(g)
CO(NH2)2+HOCl=NCl3+CO2+H2OCO(NH2)2 + 6HOCl = 2NCl3 + CO2 + 5H2O
CuSO4+OH=CuO+H2O+SO2CuSO4 - 2OH = CuO - H2O + SO2
CuSO4+OH=CuO+H2O+SO2CuSO4 - 2OH = CuO - H2O + SO2
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C2H5COOH+ O2 = CO2 + H2O 2C2H5COOH + 7O2 = 6CO2 + 6H2O
Cu(OH)2(s)=CuO(s)+H2OCu(OH)2(s) = CuO(s) + H2O
Cu(s)+HNO3(aq)=Cu(NO3)2(aq)+H2O+NO2(g)Cu(s) + 4HNO3(aq) = Cu(NO3)2(aq) + 2H2O + 2NO2(g)
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + H2O2 = CO2 + H2OCH4 + 4H2O2 = CO2 + 6H2O
C8H18 + O2 = H2O + CO22C8H18 + 25O2 = 18H2O + 16CO2
Cu(OH)2=CuO+H2OCu(OH)2 = CuO + H2O
Ca(s) + H2O(l) = Ca(OH)2(aq) + H2(g)Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
C12H22O11(s) + O2(g) = CO2(g) + H2OC12H22O11(s) + 12O2(g) = 12CO2(g) + 11H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Co(NO3)3+LiCl=LiNO3+CoCl3Co(NO3)3 + 3LiCl = 3LiNO3 + CoCl3
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cr2O3(s)+O2(g)=CrO3(s)2Cr2O3(s) + 3O2(g) = 4CrO3(s)
CuSO4+AgNO3=Ag2SO4+Cu(NO3)2CuSO4 + 2AgNO3 = Ag2SO4 + Cu(NO3)2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
C3H8 + O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
C2H6 + O2 = CO2 + H2010C2H6 + 20O2 = 20CO2 + 3H20
Ca + H2O = H2 + Ca(OH)2Ca + 2H2O = H2 + Ca(OH)2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CuCI + H2S = Cu2S + HCI2CuCI + H2S = Cu2S + 2HCI
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H5(NO3)3 = N2 + CO2 + H2O +O24C3H5(NO3)3 = 6N2 + 12CO2 + 10H2O + O2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C5H10O2+O2=CO2+H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
C12H2O11+H2O=C2H5O+CO211C12H2O11 + 59H2O = 28C2H5O + 76CO2
Cu+H2SO4=CuSO4+H2Cu + H2SO4 = CuSO4 + H2
C5H6O(l)+O2(g)=CO2(g)+H2O(g)C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(g)
Ca3(PO4)2+H2SO4=CaSO4+H3PO4Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4
CaCl2+I2=CaI2+Cl2CaCl2 + I2 = CaI2 + Cl2
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
Cu(s)+Al(NO3)(aq)=Cu(NO3)(s)+AlCu(s) + Al(NO3)(aq) = Cu(NO3)(s) + Al
C6H6+Br2=C6H5Br+HBrC6H6 + Br2 = C6H5Br + HBr
C6H6+Br2= C6H5Br+HBrC6H6 + Br2 = C6H5Br + HBr
C3H8 + O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
CS2 + H2O = CO2 + H2SCS2 + 2H2O = CO2 + 2H2S
Cl2+O2=Cl2O2Cl2 + O2 = Cl2O2
Cr+O=Cr2O32Cr + 3O = Cr2O3
CS2(l)+O2(g)=CO2(g)+SO2(g)CS2(l) + 3O2(g) = CO2(g) + 2SO2(g)
C2H5+O2=CO2+H2O4C2H5 + 13O2 = 8CO2 + 10H2O
C6H12+O2=CO+H2OC6H12 + 6O2 = 6CO + 6H2O
Cl2 + O2 = Cl2O52Cl2 + 5O2 = 2Cl2O5
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
CCl4+O2=COCl2 + Cl22CCl4 + O2 = 2COCl2 + 2Cl2
Cl2(g)+NaClO2(aq)=ClO2(g)+NaCl(aq)Cl2(g) + 2NaClO2(aq) = 2ClO2(g) + 2NaCl(aq)
Ca 3 P 2 (s)+H 2 O(l)=Ca(OH) 2 (aq)+PH 3 (g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
CuCl2 + NaOH = Cu (OH)2 + NaClCuCl2 + 2NaOH = Cu(OH)2 + 2NaCl
Cu(NO3)2+NH3+H2O=Cu(OH)2+NH4NO3Cu(NO3)2 + 2NH3 + 2H2O = Cu(OH)2 + 2NH4NO3
Cu(NO3)2+NH3+H2O=Cu+NH4NO34Cu(NO3)2 + 10NH3 + 3H2O = 4Cu + 9NH4NO3
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
Ca(OH)2 + HNO3 = Ca(NO3)2 + H2O Ca(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CH3COOH + Li2CO3 = Li2CO + H2O + CO2CH3COOH + 2Li2CO3 = 2Li2CO + 2H2O + 2CO2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CaO + 2HCl = CaCl2 + 2H2OCaO + 2HCl = CaCl2 + H2O
C3H8O3 (g) + O2 (g) = CO2 (g) + H2O2C3H8O3(g) + 7O2(g) = 6CO2(g) + 8H2O
CuSO4+Zn=Cu+ZnSO4CuSO4 + Zn = Cu + ZnSO4
CH3OH+ O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CuO+H2SO4=CuSO4+H2OCuO + H2SO4 = CuSO4 + H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu(H2O)6 + NaOH = Cu(OH)2 + Na + H2OCu(H2O)6 + 2NaOH = Cu(OH)2 + 2Na + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu(NO3)2 + H2O = Cu(H2O)6 +NO3Cu(NO3)2 + 6H2O = Cu(H2O)6 + 2NO3
CaCl2 + AgNO3 = AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
CaCl2 + AgNO3 = AgCl + Ca(NO3)2CaCl2 + 2AgNO3 = 2AgCl + Ca(NO3)2
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O(l)Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O(l)
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaCl2 + 2HNO3 = Ca(NO3)2 + 2HClCaCl2 + 2HNO3 = Ca(NO3)2 + 2HCl
CH3NH2 + O2 = CO2 + H2O + N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
CH3NH2 + O2 = CO2 + H2O + N24CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
Co(NO3)2 + Na3PO4 = Co3(PO4)2 + NaNO33Co(NO3)2 + 2Na3PO4 = Co3(PO4)2 + 6NaNO3
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CuSO4 + NaOH + NH3 = NH3Na2SO4 + Cu(OH)2CuSO4 + 2NaOH + NH3 = NH3Na2SO4 + Cu(OH)2
CaCl2 + CO2 + H2O = Ca(HCO3)2 + HClCaCl2 + 2CO2 + 2H2O = Ca(HCO3)2 + 2HCl
CaCl2 + CO2 + H2O = Ca(HCO3)2 + HClCaCl2 + 2CO2 + 2H2O = Ca(HCO3)2 + 2HCl
C3H8 +O2= CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8 +O2= CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCl2 + CO2 + H2O = Ca(HCO3)2 + HClCaCl2 + 2CO2 + 2H2O = Ca(HCO3)2 + 2HCl
CaCl2 + CO2 + H2O = Ca(HCO3)2 + HClCaCl2 + 2CO2 + 2H2O = Ca(HCO3)2 + 2HCl
C3H8(g) + O2(g) = H2O(l) + CO2(g)C3H8(g) + 5O2(g) = 4H2O(l) + 3CO2(g)
CH4 + 2O2 = CO2 + 2H2OCH4 + 2O2 = CO2 + 2H2O
C2H5COOH (l) + O2 (g) = CO2 (g) +H2O2C2H5COOH(l) + 7O2(g) = 6CO2(g) + 6H2O
C2H2 + O2= CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaNO3+(NH4)2HPO4+NH3+H2O=Ca10(PO4)6(OH)2+NH4NO340CaNO3 + 24(NH4)2HPO4 - 18NH3 - 7H2O = 4Ca10(PO4)6(OH)2 + 35NH4NO3
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
Cl2O+H2O=ClOHCl2O + H2O = 2ClOH
Cl2O+H2O=ClH+OCl2O + H2O = 2ClH + 2O
Cl2O+H2O=ClOHCl2O + H2O = 2ClOH
Ca(OH)2(aq) + Na2SO4(aq) = CaSO4(s) + NaOH(aq)Ca(OH)2(aq) + Na2SO4(aq) = CaSO4(s) + 2NaOH(aq)
C25H52+O2=CO2+H2OC25H52 + 38O2 = 25CO2 + 26H2O
C2H6O + O2 = CO2 + H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH4O + O2 = CO2 + H2O2CH4O + 3O2 = 2CO2 + 4H2O
CH4O + C2H6O = CO2 + H23CH4O - C2H6O = CO2 + 3H2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
CH4O + C2H6O = CO2 + H2O2CH4O - C2H6O = 0CO2 + H2O
C2H5COOH + O2 = CO2 +H2O 2C2H5COOH + 7O2 = 6CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CoCl3+KOH=KCl+Co(OH)3CoCl3 + 3KOH = 3KCl + Co(OH)3
C3H6+O2=CO+H2OC3H6 + 3O2 = 3CO + 3H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
CH2 + O2 = CO2 + H2O2CH2 + 3O2 = 2CO2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr2O7 2- + 14H + 6 e- = 2 Cr3 + 7 H2O6Cr2O72- + 864H - 3e- = 4Cr3 + 432H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C4H8(g) + O2(g)=CO2(g) + H2O(g)C4H8(g) + 6O2(g) = 4CO2(g) + 4H2O(g)
Ca3P2 + H2O=Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
CH4O+O2=CO2+H2O2CH4O + 3O2 = 2CO2 + 4H2O
CH4O+O2=CO2+H2O2CH4O + 3O2 = 2CO2 + 4H2O
C2H6O (l) + O2(g) = CO2(g) + H2O(l)C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
CH3NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
CH3NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
C6H12O6(aq) = C2H5OH(l) + CO2(g)C6H12O6(aq) = 2C2H5OH(l) + 2CO2(g)
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Ca(OH)2(aq)+H3PO4(aq)=Ca3(PO4)2(s)+H2O(l)3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(s) + 6H2O(l)
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH40 + O2 = CO2 + H2OCH40 + 11O2 = CO2 + 20H2O
CH40 + O2 = CO2 + H2OCH40 + 11O2 = CO2 + 20H2O
CH40 + O2 = CO2 + H2OCH40 + 11O2 = CO2 + 20H2O
C3H8O+O2=CO2+H2O2C3H8O + 9O2 = 6CO2 + 8H2O
C2H6O+3O2=2CO2+3H2OC2H6O + 3O2 = 2CO2 + 3H2O
CaCO3(s) = CaO(s) + CO2 (g) CaCO3(s) = CaO(s) + CO2(g)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH+O2=CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH4+O2=CH2+H2O2CH4 + O2 = 2CH2 + 2H2O
C4H6O6(aq)+H2O2(aq)=C2H4O2+CO2(g)3C4H6O6(aq) - H2O2(aq) = 4C2H4O2 + 4CO2(g)
CuO + HCl = CuCl2 + H2OCuO + 2HCl = CuCl2 + H2O
CH4(g)+Br2(g)=CBr4(g) + HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
CH4(g)+Br2(g)=CBr4(g) + HBr(g)CH4(g) + 4Br2(g) = CBr4(g) + 4HBr(g)
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Cr(ClO4)3 + K2CO3 = KClO4 + Cr2(CO3)32Cr(ClO4)3 + 3K2CO3 = 6KClO4 + Cr2(CO3)3
CaCO3(s)+2HCl(aq)=H2O(l)+CO2(g)+CaCl2(aq)CaCO3(s) + 2HCl(aq) = H2O(l) + CO2(g) + CaCl2(aq)
C2H5OH+O2= CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cr(ClO4)3+K2CO3=KClO4+Cr2(CO3)32Cr(ClO4)3 + 3K2CO3 = 6KClO4 + Cr2(CO3)3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH3SH(l) + CO(g) = CH3CO(SCH3)(l) + H2S(g)2CH3SH(l) + CO(g) = CH3CO(SCH3)(l) + H2S(g)
Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l)3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
Cu2CO3(OH)2(s) = CuO(s) + CO2(g) + H2O(g)Cu2CO3(OH)2(s) = 2CuO(s) + CO2(g) + H2O(g)
Cu2O(s) + Cu2S(s) = Cu(s) + SO2(g)2Cu2O(s) + Cu2S(s) = 6Cu(s) + SO2(g)
Cu2O(s) + C(s) = Cu(s) + CO2(g)2Cu2O(s) + C(s) = 4Cu(s) + CO2(g)
C4H10(l)+O2(g)=CO2(g)+H2O2C4H10(l) + 13O2(g) = 8CO2(g) + 10H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = 2CO2 + 3H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + P42Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
Cu2O + Cu2S =Cu +SO22Cu2O + Cu2S = 6Cu + SO2
CuO + Cu2S =Cu +SO22CuO + Cu2S = 4Cu + SO2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
Cu(CO3)=CuO+CO2Cu(CO3) = CuO + CO2
Cu2O+C=Cu+CO22Cu2O + C = 4Cu + CO2
Cu2CO3(OH)2=CuO+CO2+H2OCu2CO3(OH)2 = 2CuO + CO2 + H2O
CH3(CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
C7H8O2+O2=CO2+H2OC7H8O2 + 8O2 = 7CO2 + 4H2O
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
C3H7OH + Na=C3H7ONa + H22C3H7OH + 2Na = 2C3H7ONa + H2
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C2H5OH + Na=C2H5ONa + H22C2H5OH + 2Na = 2C2H5ONa + H2
C8H18+O2=CO2+H2010C8H18 + 80O2 = 80CO2 + 9H20
CH3OH + Na=CH3ONa + H22CH3OH + 2Na = 2CH3ONa + H2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
Ca(NO3)2+Na3PO4=Ca3(PO4)2+3NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
Cr + S8 = Cr2S316Cr + 3S8 = 8Cr2S3
Ca (s)+H2O (l)=Ca (OH) 2 (aq)+H2 (g)Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
Cu(NO3)2 + Ni = Cu + Ni(NO3)2Cu(NO3)2 + Ni = Cu + Ni(NO3)2
Cu(NO3)2 + Ni = Cu + Ni(NO3)2Cu(NO3)2 + Ni = Cu + Ni(NO3)2
Cu(NO3)2 + Ni = Cu + Ni(NO3)2Cu(NO3)2 + Ni = Cu + Ni(NO3)2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3 +HCl = CaCl2 +H2O +CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P + COCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 2P + 5CO
C2H6+O2=CO2+2H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C6H14 + O2 = CO2 + H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CuNO3(aq) + BeS(aq) = CuS + BeNO3CuNO3(aq) + BeS(aq) = CuS + BeNO3
C4H14 + O2 = CO2 + H2O2C4H14 + 15O2 = 8CO2 + 14H2O
Ca+Cl2 =CaCl2Ca + Cl2 = CaCl2
C7H8O2(l)+O2(g)=CO2(g)+H2O(g)C7H8O2(l) + 8O2(g) = 7CO2(g) + 4H2O(g)
Ca+H2O = Ca(OH)+H22Ca + 2H2O = 2Ca(OH) + H2
C2H4(g)+O2(g)=CO2(g)+H2O(g)C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
C5H10O2(l)+O2(g)=CO2(g)+H2O(g)2C5H10O2(l) + 13O2(g) = 10CO2(g) + 10H2O(g)
Cr(NO2)2+(NH4)2SO3=CrSO3+NH4NO2Cr(NO2)2 + (NH4)2SO3 = CrSO3 + 2NH4NO2
CO2 + NH3 = OC(NH2)2 + H2OCO2 + 2NH3 = OC(NH2)2 + H2O
CaCO3+H3PO4=Ca3(PO4)2+H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
CaCO3+H3PO4=Ca3(PO4)2+H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
C2H17+O2=CO2+H2O4C2H17 + 25O2 = 8CO2 + 34H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C3H8 + O2 =CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CH3CH2CH3+O2=CO2+H2OCH3CH2CH3 + 5O2 = 3CO2 + 4H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca(PO4)2 + 2SiO2 + 14C = 2CaSiO3 + P4 + 14CO
C + 2 Cl2 = CCl4C + 2Cl2 = CCl4
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C + O2 = CO2C + O2 = CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = H2O + CO2C3H8 + 5O2 = 4H2O + 3CO2
C + 2 Cl2=CCl4C + 2Cl2 = CCl4
C2H5NH2+O2=CO2+H2O+N24C2H5NH2 + 15O2 = 8CO2 + 14H2O + 2N2
C 8 H 18 (g)+O 2 (g)=CO 2 (g)+H 2 O2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O
Cu(NO3)2(aq)+KOH(aq)=Cu(OH)2(s)+KNO3Cu(NO3)2(aq) + 2KOH(aq) = Cu(OH)2(s) + 2KNO3
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH3((CH2)6)CH3 + O2 = CO2 + H2O2CH3((CH2)6)CH3 + 25O2 = 16CO2 + 18H2O
CH3((CH2)6)CH3 + O2 = CO2 + H2O2CH3((CH2)6)CH3 + 25O2 = 16CO2 + 18H2O
C5H12+O= CO2+H2OC5H12 + 16O = 5CO2 + 6H2O
CaSiO3(s)+HF(g)=SiF4(g)+H2O(l)+CaF2CaSiO3(s) + 6HF(g) = SiF4(g) + 3H2O(l) + CaF2
Ca(OH)2 + CO2 = CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6+O2 = CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+H2SO4=Cu(SO3)2+SO2+H2OCu + 2H2SO4 = Cu(SO3)2 + 0SO2 + 2H2O
Ca(C2H3O2)2+(NH4)2CO3=CaCO3+NH4C2H3O2Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + 2NH4C2H3O2
Cl2+AlBr3=AlCl3+Br23Cl2 + 2AlBr3 = 2AlCl3 + 3Br2
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca(C2H3O2)2+(NH4)2CO3=CaCO3+NH4C2H3O2Ca(C2H3O2)2 + (NH4)2CO3 = CaCO3 + 2NH4C2H3O2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C2H5NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g)4C2H5NH2(g) + 15O2(g) = 8CO2(g) + 14H2O(g) + 2N2(g)
Cu3(OH)2(CO3)2 + H = Cu + H2O + HCO3Cu3(OH)2(CO3)2 + 4H = 3Cu + 2H2O + 2HCO3
Cu3(OH)2(CO3)2+H=Cu+H2O+HCO3Cu3(OH)2(CO3)2 + 4H = 3Cu + 2H2O + 2HCO3
Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g)Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
Cr(NO3) + Na(CO3) = Cr(CO3) + Na(NO3)Cr(NO3) + Na(CO3) = Cr(CO3) + Na(NO3)
CrNO3 + NaCO3 = CrCO3 + NaNO3CrNO3 + NaCO3 = CrCO3 + NaNO3
CO2+C=COCO2 + C = 2CO
CO+O2=CO22CO + O2 = 2CO2
Cr+3OH=Cr(OH)3Cr + 3OH = Cr(OH)3
CrI3+Pb(CH3COO)2=Cr(CH3COO)3+PbI22CrI3 + 3Pb(CH3COO)2 = 2Cr(CH3COO)3 + 3PbI2
CH3SH(l)+CO(g)=CH3CO(SCH3)(l)+H2S(g)2CH3SH(l) + CO(g) = CH3CO(SCH3)(l) + H2S(g)
C+O2=CO2C + O2 = 2CO
C+O2=CO2C + O2 = 2CO
CaCN2+H2O = CaCO3+NH3CaCN2 + 3H2O = CaCO3 + 2NH3
C+O2=CO2C + O2 = CO2
CrI3+Pb(NO3)2=Cr(NO3)3+PbI22CrI3 + 3Pb(NO3)2 = 2Cr(NO3)3 + 3PbI2
C3H6+O2=CO+H2OC3H6 + 3O2 = 3CO + 3H2O
C2H3CL+ 7O2 = CO + H2O + 2CL4C2H3CL + 7O2 = 8CO + 6H2O + 4CL
C6H6+O2=H2O+CO22C6H6 + 15O2 = 6H2O + 12CO2
Ca(s)+Br2(l)=CaBr2(s)Ca(s) + Br2(l) = CaBr2(s)
C+O2=CO2C + O2 = CO2
C + O2 = CO2C + O2 = CO2
Cl2+FeCl2=FeCl3Cl2 + 2FeCl2 = 2FeCl3
C3H6+O2=CO+H2OC3H6 + 3O2 = 3CO + 3H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
Ca+H2O=Ca(OH)+H22Ca + 2H2O = 2Ca(OH) + H2
CH3OH+O2= CO2+H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H2 + Br = C2H2Br2C2H2 + 2Br = C2H2Br2
C2H2 + 2Br = C2H2BrC2H2 + Br = C2H2Br

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.