Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
C7H14+O2=CO2+H2O2C7H14 + 21O2 = 14CO2 + 14H2O
C4H9OH + O2 = CO2 +H2OC4H9OH + 6O2 = 4CO2 + 5H2O
CH3CH2CH2CH3 + O2 = 4CO2 + 5H2O2CH3CH2CH2CH3 + 13O2 = 8CO2 + 10H2O
C2H3Br3 + O2 = 2CO2 + 3HBrC2H3Br3 + 2O2 = 2CO2 + 3HBr
CuS + HNO3 = Cu(NO3)2 + S + NO + H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 2NO + 4H2O
C6H6OS + O2 = 12CO2 + H2O + 2SO32C6H6OS + 17O2 = 12CO2 + 6H2O + 2SO3
Ca3(PO4)2 + 6SiO2 + C = CaSiO3 + P4 + 10CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
C4H9OH + O2 = CO2 + H2OC4H9OH + 6O2 = 4CO2 + 5H2O
C4H9OH + O2 = CO2 + H2OC4H9OH + 6O2 = 4CO2 + 5H2O
Ca + 2YbF3 = 2Yb + CaF23Ca + 2YbF3 = 2Yb + 3CaF2
C7H14 + O2 = CO + H22C7H14 + 7O2 = 14CO + 14H2
CH3NO2 + O2 = CO2 + H2O + N24CH3NO2 + 3O2 = 4CO2 + 6H2O + 2N2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
CH4(g)+O2=CO2+H2OCH4(g) + 2O2 = CO2 + 2H2O
C6H14(l)+O2=CO2+H2O2C6H14(l) + 19O2 = 12CO2 + 14H2O
C2H5NSCl + O2 = CO + H2O + NO + SO2 + HCl2C2H5NSCl + 7O2 = 4CO + 4H2O + 2NO + 2SO2 + 2HCl
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C2H4Cl2 + O2 = CO + H2O + HCl2C2H4Cl2 + 3O2 = 4CO + 2H2O + 4HCl
C2H5NSCl + O2 = CO2 + H2O + NO + SO2 + Cl24C2H5NSCl + 19O2 = 8CO2 + 10H2O + 4NO + 4SO2 + 2Cl2
Cs + H2O = CsOH + H22Cs + 2H2O = 2CsOH + H2
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H3O2Cl + O2 = CO2 + H2O + Cl24C2H3O2Cl + 7O2 = 8CO2 + 6H2O + 2Cl2
C4H8O2 + O2 = CO2 + H2OC4H8O2 + 5O2 = 4CO2 + 4H2O
C7H10N + O2 = CO2 + H2O + NO22C7H10N + 21O2 = 14CO2 + 10H2O + 2NO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + NH3 = HCN + H2CH4 + NH3 = HCN + 3H2
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
C4H8O+O2=CO2+H2O2C4H8O + 11O2 = 8CO2 + 8H2O
CaCO3 + H3PO4 = Ca3(PO4)2 + H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
Cd + H2SO4 = CdSO4 + H2Cd + H2SO4 = CdSO4 + H2
Cd + H2SO4 = CdSO4 + H2Cd + H2SO4 = CdSO4 + H2
Ca + 2H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CH4 + H2O = CO + 3H2CH4 + H2O = CO + 3H2
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cu2S + O2 = Cu + SO2Cu2S + O2 = 2Cu + SO2
Cu+HCl=CuCl2+H2Cu + 2HCl = CuCl2 + H2
Cu +HNO3 = Cu(NO3)2 +H2O +NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
Ca + O2 = CaO2Ca + O2 = 2CaO
Ca+C+O2=CaCO32Ca + 2C + 3O2 = 2CaCO3
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C+O2=CO2C + O2 = 2CO
Ca (OH) 2+2Al2 (SO4) 3= CaSO4+Al (OH) 33Ca(OH)2 + Al2(SO4)3 = 3CaSO4 + 2Al(OH)3
CH4(g)+O2(g)=CO2(g)+H2OCH4(g) + 2O2(g) = CO2(g) + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaCO3+HNO3=Ca(NO3)2+H2O+CO2CaCO3 + 2HNO3 = Ca(NO3)2 + H2O + CO2
Cu2+ + I- = CuI + I2-2Cu2+ - 2I- = -4CuI + I2
CH4(g)+O2(g)=CO2(g)+H20(g)5CH4(g) + 5O2(g) = 5CO2(g) + H20(g)
Cu3(PO4)2+Na2CO3=Na3PO4+CuCO3Cu3(PO4)2 + 3Na2CO3 = 2Na3PO4 + 3CuCO3
CH4+O2=CO2+H205CH4 + 5O2 = 5CO2 + H20
Cu2+ + I- = CuI +I-1Cu2+ - I- = -2CuI + I
C3H8O3+O2=CO2+H2O2C3H8O3 + 7O2 = 6CO2 + 8H2O
C4H10(g) + O2(g) = CO2(g) + H2O(g)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
CuCl2 + Ag2SO4 = 2 AgCl + CuSO4CuCl2 + Ag2SO4 = 2AgCl + CuSO4
C12H22 + O2 = CO2 + H2O2C12H22 + 35O2 = 24CO2 + 22H2O
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
C7H6O2+O2=CO2+H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CH4+O=H2O+CO2CH4 + 4O = 2H2O + CO2
CaCO3+HCl=CO2+CaCl2+H2OCaCO3 + 2HCl = CO2 + CaCl2 + H2O
CuO+HCl=CuCl2+H2OCuO + 2HCl = CuCl2 + H2O
C2H3 + O2 = CO2 + H2O4C2H3 + 11O2 = 8CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6S + O2 = CO2 + H2O + SO22C2H6S + 9O2 = 4CO2 + 6H2O + 2SO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C8 H18+ O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2 + H2S + H2O = H2SO4 + HCl4Cl2 + H2S + 4H2O = H2SO4 + 8HCl
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cr2O3 + OH = CrO4 + H2OCr2O3 + 10OH = 2CrO4 + 5H2O
Cu2S + O2 = Cu2O + SO22Cu2S + 3O2 = 2Cu2O + 2SO2
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
C4H10+H2O=CO2+H2O0C4H10 + H2O = 0CO2 + H2O
Cu2+ + I-=CuI + I2-2Cu2+ - 2I- = -4CuI + I2
Cl2+KOH=KCl+KClO3+HCl3Cl2 + 3KOH = 2KCl + KClO3 + 3HCl
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CO2 + H2O = C2H4 + O22CO2 + 2H2O = C2H4 + 3O2
CO2 + H2O = C2H4 + O22CO2 + 2H2O = C2H4 + 3O2
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
C+ HNO3 = H2CO3 + NO2 + H2OC + 4HNO3 = H2CO3 + 4NO2 + H2O
C + O2 = CO2C + O2 = CO2
CaCO3 + HNO3 = CO2 + Ca(NO3)2 + H2OCaCO3 + 2HNO3 = CO2 + Ca(NO3)2 + H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6 + CO2 + H2O = C2H5OH3C2H6 + 0CO2 + H2O = C2H5OH3
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C21H22NO5+O2=CO2+H2O+N22C21H22NO5 + 48O2 = 42CO2 + 22H2O + N2
Cr(OH)3+HCLO4=Cr(CLO4)3+H2OCr(OH)3 + 3HCLO4 = Cr(CLO4)3 + 3H2O
C3H8 + O2 = CO2 +H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CO2 + H2O = C6H12O6 +O26CO2 + 6H2O = C6H12O6 + 6O2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H18 + O2 = CO2 +H2O2C3H18 + 15O2 = 6CO2 + 18H2O
C7H16+O2=7CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + AgNO3 = Cu(NO3)2 + AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
C2H4 + O2 = CO2 + H205C2H4 + 10O2 = 10CO2 + H20
C2H4 + O2 = CO2 + H205C2H4 + 10O2 = 10CO2 + H20
C6H12O6 + O2 = CO2 + H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CaH2 +H2O = Ca(OH)2 +2H2 CaH2 + 2H2O = Ca(OH)2 + 2H2
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Cu (NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
ClO2 + H2O = HClO2 + HClO32ClO2 + H2O = HClO2 + HClO3
Ca + AlCl3 = CaCl2 + Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
C3H5(NO3)3 = CO2 + H20 + N2 + O24C3H5(NO3)3 = 12CO2 + H20 + 6N2 + 6O2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CaBr2 + Al2O3 = AlBr3 + CaO3CaBr2 + Al2O3 = 2AlBr3 + 3CaO
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C6H6+O2=H2O+CO22C6H6 + 15O2 = 6H2O + 12CO2
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
C8H18(g)+O2(g)=CO2(g)+H2O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
Cl2O7+H2O=HClO4Cl2O7 + H2O = 2HClO4
Cu + HNO3 = Cu(NO3)2 + NO2 + H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
CH3COOH + CH3CH2 = CH3COOCH2CH3 + H2O 6CH3COOH + 4CH3CH2 = 5CH3COOCH2CH3 + 2H2O
C2H4 + O2 =CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Ca3(PO4)2+H2SO4=CaSO4+H3O4PCa3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3O4P
C2H9O+O2=CO2+H2O4C2H9O + 15O2 = 8CO2 + 18H2O
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
Cu2S+H(NO3)=Cu(NO3)2+Cu(SO4)+NO2+H2OCu2S + 12H(NO3) = Cu(NO3)2 + Cu(SO4) + 10NO2 + 6H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
Cl2O7 + Ba(OH)2 = Ba(ClO4)2 + H2OCl2O7 + Ba(OH)2 = Ba(ClO4)2 + H2O
Cl2O7 + Ba(OH)2 = Ba(ClO4)2 + H2OCl2O7 + Ba(OH)2 = Ba(ClO4)2 + H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H4O2+O2=CO2+H2OC2H4O2 + 2O2 = 2CO2 + 2H2O
Cu(NO3)2=CuO+NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CuS2+O2=CuO +S2CuS2 + O2 = 2CuO + 4S
C3H5(NO3)3=CO2+H2O+N2+O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CaCO3 + HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca3(PO4)2(s) + SiO2(s) + C(s) = CaSiO3(s) + CO(g) + P4(s)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + 10CO(g) + P4(s)
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
CH3OH + N2O = CO2 + H2O + N2CH3OH + 3N2O = CO2 + 2H2O + 3N2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H7OH + O2 = CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Cu2S + HNO3 = Cu(NO3)2 + S + NO + H2O3Cu2S + 16HNO3 = 6Cu(NO3)2 + 3S + 4NO + 8H2O
Cl2 + KOH = KCl + KClO3 +HCl3Cl2 + 3KOH = 2KCl + KClO3 + 3HCl
Ca(OH)2 + (NH4)2SO4=CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
C2H6 + O2 = H2O + CO22C2H6 + 7O2 = 6H2O + 4CO2
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
Ca(HCO3)2+Na2CO3=CaCO3+NaHCO3Ca(HCO3)2 + Na2CO3 = CaCO3 + 2NaHCO3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
CaCl2=Ca+ClCaCl2 = Ca + 2Cl
C5H12 + O2 = CO2 + 5H2OC5H12 + 8O2 = 5CO2 + 6H2O
Ca(NO3)2 + Fe3(PO4)3 = Ca3(PO4)2 + Fe(NO3)39Ca(NO3)2 + 2Fe3(PO4)3 = 3Ca3(PO4)2 + 6Fe(NO3)3
C4H9OH + O2 = CO2 + H2OC4H9OH + 6O2 = 4CO2 + 5H2O
Cu(NO3)2 (aq) + 2KI (aq) =CuI2 (aq) + 2K(NO3) (aq)Cu(NO3)2(aq) + 2KI(aq) = CuI2(aq) + 2K(NO3)(aq)
C2H4O2+H2=C2H4O+H2OC2H4O2 + H2 = C2H4O + H2O
C12H22O11 +KClO3 = CO2 +H2O +KClC12H22O11 + 8KClO3 = 12CO2 + 11H2O + 8KCl
Ca(NO3)2 + Fe3(PO4)3 = Ca3(PO4)2 + Fe(NO3)39Ca(NO3)2 + 2Fe3(PO4)3 = 3Ca3(PO4)2 + 6Fe(NO3)3
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H6+H2=C6H12C6H6 + 3H2 = C6H12
CuO+C=Cu+CO22CuO + C = 2Cu + CO2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C5H8+O2=CO2+H2OC5H8 + 7O2 = 5CO2 + 4H2O
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C(s)+O2(g)=CO2C(s) + O2(g) = CO2
C2H6+ O2= H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C12H22O11= C + H2OC12H22O11 = 12C + 11H2O
Cu2O + C = Cu + CO22Cu2O + C = 4Cu + CO2
C5H12O + O2 = CO2 + H2010C5H12O + 45O2 = 50CO2 + 6H20
CO(g)+H2O(g)=H2(g)+CO2(g)CO(g) + H2O(g) = H2(g) + CO2(g)
C3H8+O2=CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C14H30 + O3 = CO2 + H2O3C14H30 + 43O3 = 42CO2 + 45H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C(s)+S(s)=CS2(l) C(s) + 2S(s) = CS2(l)
C2H2+O2=H2O+CO22C2H2 + 5O2 = 2H2O + 4CO2
Ca3(PO4)2+Na2CO3=Na3PO4+CaCO3Ca3(PO4)2 + 3Na2CO3 = 2Na3PO4 + 3CaCO3
Ca3(PO4)2+C=Ca3P2+COCa3(PO4)2 + 8C = Ca3P2 + 8CO
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
C3H8+O2 =CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu2S+O2=Cu2O+SO22Cu2S + 3O2 = 2Cu2O + 2SO2
CH4+Cl2=CHCl3+HClCH4 + 3Cl2 = CHCl3 + 3HCl
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
CH3CH2OH + O2 = CH3COOH + H2OCH3CH2OH + O2 = CH3COOH + H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaCl2+HNO3=CaNO3+HCl2CaCl2 + HNO3 = CaNO3 + HCl2
CaCl2+H2SO4=CaSO4+H2Cl2CaCl2 + H2SO4 = CaSO4 + H2Cl2
CuCl2+HNO3=CuNO3+HCl2CuCl2 + HNO3 = CuNO3 + HCl2
CuSO4+H2S=CuS+H2SO4CuSO4 + H2S = CuS + H2SO4
CuSO4+H2S=CuS+H2SO4CuSO4 + H2S = CuS + H2SO4
CO2 + H2O = C6 H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C8H18+O2=H2O+CO22C8H18 + 25O2 = 18H2O + 16CO2
CaCO3+HCl= CaCl2+H2CO3CaCO3 + 2HCl = CaCl2 + H2CO3
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + O2= CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaCO3= CaO + CO2CaCO3 = CaO + CO2
C3H7OH+O2=CO2+H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
C3H7OH+O2=C2+H2O2C3H7OH + 3O2 = 3C2 + 8H2O
CO2(g)+H2O(l)=C6H12O6(s)+O2(g)6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
Cl2 + H2O = HCl + HClO33Cl2 + 3H2O = 5HCl + HClO3
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H4O + O2 = CO2 + H2O2C2H4O + 5O2 = 4CO2 + 4H2O
CaCl2+Na3PO4=Ca3(PO4)2+NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
CO + O2=CO22CO + O2 = 2CO2
C2H4O2 + Al(OH)3 = H2O + Al(CH3OO)33C2H4O2 + 2Al(OH)3 = 0H2O + 2Al(CH3OO)3
C6H14 (l) + O2 (g) = CO2 (g) + H2O (g)2C6H14(l) + 19O2(g) = 12CO2(g) + 14H2O(g)
CaCl2 (aq) + Na2CO3 (aq)= NaCl (aq) + CaCO3CaCl2(aq) + Na2CO3(aq) = 2NaCl(aq) + CaCO3
C2H2Cl4 + Ca(OH)2 = C2HCl3 + CaCl2 + H2O2C2H2Cl4 + Ca(OH)2 = 2C2HCl3 + CaCl2 + 2H2O
Ca+2H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C7H16+O2=CO2+H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H6O2 + O2 = CO2 + H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CO + O2 = CO22CO + O2 = 2CO2
CO2 + NH3 = OC(NH2)2 + H2OCO2 + 2NH3 = OC(NH2)2 + H2O
C6H10+O2=CO2+H2O2C6H10 + 17O2 = 12CO2 + 10H2O
CH4Br + NaOH = NaBr + CH4OHCH4Br + NaOH = NaBr + CH4OH
C4H8O + O2 = CO2 + H2O2C4H8O + 11O2 = 8CO2 + 8H2O
C4H8O + O2 = CO2 + H2O2C4H8O + 11O2 = 8CO2 + 8H2O
CaBr2 + Mg(NO3)2 = Ca(NO3)2 + MgBr2CaBr2 + Mg(NO3)2 = Ca(NO3)2 + MgBr2
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = CO2
Ca + CuF2 = CaF2 + CuCa + CuF2 = CaF2 + Cu
C2H4O2 + O2 = CO2 + H205C2H4O2 + 5O2 = 10CO2 + H20
C2H2(g) + O2(g) = CO2(g) +H2O(g)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
C + O2 = CO2C + O2 = CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H2+O2=CO+H2O2C2H2 + 3O2 = 4CO + 2H2O
Ca3(PO4)2+SiO2+C=CaSiO3+P+COCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 2P + 5CO
C6H8O7 + 3NaHCO3 = H2O + 3CO2 + Na3C6H5O7C6H8O7 + 3NaHCO3 = 3H2O + 3CO2 + Na3C6H5O7
C6H8O7 + 3NaHCO3 = H2O + 3CO2 + Na3C6H5O7C6H8O7 + 3NaHCO3 = 3H2O + 3CO2 + Na3C6H5O7
Ca3N2+H2O=Ca(OH)2+NH3Ca3N2 + 6H2O = 3Ca(OH)2 + 2NH3
CuSO4+PH3=Cu3P2+H2SO43CuSO4 + 2PH3 = Cu3P2 + 3H2SO4
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cl2+KI=KCl+I2Cl2 + 2KI = 2KCl + I2
CH4 + O2 = CO + H2O 2CH4 + 3O2 = 2CO + 4H2O
CH3 + Ca(NO3)2 = CO2 + H2O + CaO + N210CH3 + 7Ca(NO3)2 = 10CO2 + 15H2O + 7CaO + 7N2
CH4 + H2O = 2H + CH3OHCH4 + H2O = 2H + CH3OH
C15H32COOH + O2 = CO2+H2O4C15H32COOH + 93O2 = 64CO2 + 66H2O
C15H32COOH + O2 = CO2+H2O4C15H32COOH + 93O2 = 64CO2 + 66H2O
C15H32COOH + O2 = CO2+H2O4C15H32COOH + 93O2 = 64CO2 + 66H2O
CuS + HL = CuL2 + H2SCuS + 2HL = CuL2 + H2S
CH3 (CH2)3CH3+O2=CO2+H2OCH3(CH2)3CH3 + 8O2 = 5CO2 + 6H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2=CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C5H12 + O2=CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
CaCO3+HCl=CaCl2+H2O+CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
C+S8=CS24C + S8 = 4CS2
CuSO4 + Fe = Fe2(SO4)3 + Cu3CuSO4 + 2Fe = Fe2(SO4)3 + 3Cu
C4H10 + O2= CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
C6H12O2+O2=CO2+H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
CaCO3+HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CH5H10O+O2=CO2+H2O4CH5H10O + 17O2 = 4CO2 + 30H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH4 + H2O = H2 + COCH4 + H2O = 3H2 + CO
C2H4 + O2 = CO2 + H2O C2H4 + 3O2 = 2CO2 + 2H2O
C + H2O = CH4 + CO2 2C + 2H2O = CH4 + CO2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C6H12(OH) + O2 = CO2 + H2O4C6H12(OH) + 35O2 = 24CO2 + 26H2O
C2H3Cl3 + 2O2 = CO2 + 3HClC2H3Cl3 + 2O2 = 2CO2 + 3HCl
C2H3Br3 + O2 = 2CO + HBrC2H3Br3 + O2 = 2CO + 3HBr
CaC2 + 2H2O = C2H2 + Ca(OH)2CaC2 + 2H2O = C2H2 + Ca(OH)2
C2H3O2Br + O2 = 4CO + H2O + HBr2C2H3O2Br + O2 = 4CO + 2H2O + 2HBr
C3H8+ O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CH5H10+O2=CO2+H2O4CH5H10 + 19O2 = 4CO2 + 30H2O
CH4 + Cl2 = CCl4 + HClCH4 + 4Cl2 = CCl4 + 4HCl
CH3(CH2)6CH3 + O2 = CO2 + H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
CO2 + H2O=C6H12O6 +O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu+Al2(SO4)3=Cu(SO4)+Al3Cu + Al2(SO4)3 = 3Cu(SO4) + 2Al
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Ca3(PO4)2 + Al2(SO4)3 = CaSO4 + AlPO4Ca3(PO4)2 + Al2(SO4)3 = 3CaSO4 + 2AlPO4
Ca + AlCl3 = CaCl2 + Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
Ca(ClO3)2 = CaCl2 + O2Ca(ClO3)2 = CaCl2 + 3O2
C +O2 =CO 2C + O2 = 2CO
C7H16(l) + 11O2(g) =7CO2(g) + 8H2O(l)C7H16(l) + 11O2(g) = 7CO2(g) + 8H2O(l)
C2H6 + O2 = CO2 +H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Ca(OH)2 + (NH4)2SO4 = CaSO4 + NH3 + H2OCa(OH)2 + (NH4)2SO4 = CaSO4 + 2NH3 + 2H2O
Ca+H2O=CaH2+OCa + H2O = CaH2 + O
C6H10+O2=CO2+H202C6H10 + 12O2 = 12CO2 + H20
C2H2 + O2 = CO2 + H2010C2H2 + 20O2 = 20CO2 + H20
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H2+O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
C3H7OH+O2=CO2+H2010C3H7OH + 25O2 = 30CO2 + 4H20
Cl2(g) + KBr(aq) = Br2(l) + KCl Cl2(g) + 2KBr(aq) = Br2(l) + 2KCl
Cu+Al2(SO4)3=Cu(SO4)+Al3Cu + Al2(SO4)3 = 3Cu(SO4) + 2Al
C7H8+O2=HCO3+H2O4C7H8 + 43O2 = 28HCO3 + 2H2O
CH3CH2CH2CH(CH3CH2)C(CH2CH3CH3)CH2CH3 + O2 = CO2 + H2010CH3CH2CH2CH(CH3CH2)C(CH2CH3CH3)CH2CH3 + 120O2 = 120CO2 + 13H20
CaCO3 + H3PO4 = Ca3(PO4)2 + H2CO33CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3H2CO3
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CoCl+KOH= CoOH+KClCoCl + KOH = CoOH + KCl
CO(g)+H2(g)=C8H18(l)+H2O8CO(g) + 17H2(g) = C8H18(l) + 8H2O
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H4+O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
C2N2+NaOH=NaCN+NaOCN+H2OC2N2 + 2NaOH = NaCN + NaOCN + H2O
CuSO4+KI=CuI+K2SO4+I22CuSO4 + 4KI = 2CuI + 2K2SO4 + I2
Cr(NO3)3 + H2O = Cr(OH)3 + (HNO3)Cr(NO3)3 + 3H2O = Cr(OH)3 + 3(HNO3)
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C10H16+Cl2=C+HClC10H16 + 8Cl2 = 10C + 16HCl
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4 H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C8 H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C3H8+4O2=2CO2+4H2OC3H8 + 5O2 = 3CO2 + 4H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
C7H16 + O2 = CO2 + H2OC7H16 + 11O2 = 7CO2 + 8H2O
CaCO3 + H3PO4 = Ca3(PO4)2 + CO2 + H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
CuO+C=Cu+CO22CuO + C = 2Cu + CO2
CF4+O2=CO2+F2CF4 + O2 = CO2 + 2F2
C2H5F+O2=CO2+H2O+F24C2H5F + 13O2 = 8CO2 + 10H2O + 2F2
C2H3OF+O2=CO+H2O+F24C2H3OF + 5O2 = 8CO + 6H2O + 2F2
CuO+H2=Cu+H2OCuO + H2 = Cu + H2O
C4H10O + O2 = CO2 + H2OC4H10O + 6O2 = 4CO2 + 5H2O
CaBr2(aq)+AgNO3(aq)=CaNO3+AgBr2CaBr2(aq) + AgNO3(aq) = CaNO3 + AgBr2
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaO + HNO3 = Ca(NO3)2 + H2OCaO + 2HNO3 = Ca(NO3)2 + H2O
CaSO4+AlBr3=CaBr2+Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
Ca3(PO4)2+H2SO4=CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2+NaOH=NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
CaCl2+2Na3PO4=Ca3(PO4)2+6NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
C3 H8 +5 O2=3 CO2 +4 H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H8+H2O=C3OH10C3H8 + H2O = C3OH10
CoBr3+CaSO4=CaBr2+Co2(SO4)32CoBr3 + 3CaSO4 = 3CaBr2 + Co2(SO4)3
C+S=CS2C + 2S = CS2
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
Cr2O3+Na2CO3+KNO3=CO2+Na2CrO4+KNO2Cr2O3 + 2Na2CO3 + 3KNO3 = 2CO2 + 2Na2CrO4 + 3KNO2
CH3CH2OH+O2=H2O+CH3COOHCH3CH2OH + O2 = H2O + CH3COOH
C + SO2 = CS2 + CO23C + 2SO2 = CS2 + 2CO2
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H6O12Zn5=ZnO+CO2+H2OC2H6O12Zn5 = 5ZnO + 2CO2 + 3H2O
C5H12+O2=CO+H2010C5H12 + 25O2 = 50CO + 6H20
C6H6 + 7O2=6CO2 +H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C3H8+O2= CO2+ H2OC3H8 + 5O2 = 3CO2 + 4H2O
C3H7OH + O2 = CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
Ca(CO3)= CaO+ CO2Ca(CO3) = CaO + CO2
CH3(CH2)4CH3 + O2 = CO2 + H2O2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca(OH)2 + H3PO4 = CaHPO4 + H2OCa(OH)2 + H3PO4 = CaHPO4 + 2H2O
Cl+O=ClOCl + O = ClO
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H2 + O2 = CO2 + H2010C2H2 + 20O2 = 20CO2 + H20
C2H4 +O2 = CO2 +H2OC2H4 + 3O2 = 2CO2 + 2H2O
C6H14 + O2 = CO2 +H2010C6H14 + 60O2 = 60CO2 + 7H20
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H8 + O2 = CO2 +H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H8 + O2 = O2H8 + C3C3H8 + O2 = O2H8 + C3
C3H8 + O2 = O2H8 C3C3H8 + O2 = O2H8C3
CH4 +O2 = CO2 +H2OCH4 + 2O2 = CO2 + 2H2O
CaBr2 +KOH = Ca(OH)2 +KBrCaBr2 + 2KOH = Ca(OH)2 + 2KBr
CrO3+SO2=Cr(SO3)3CrO3 + 3SO2 = Cr(SO3)3
Ca(OH)2 + H3PO4 = Ca3(PO4)2 +H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Cu(OH)2+H3PO4=Cu3(PO4)2+H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
Cu(OH)2 + HC2H3O2 = Cu(C2H3O2)2 +H2OCu(OH)2 + 2HC2H3O2 = Cu(C2H3O2)2 + 2H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C4H8+O2=CO+H2OC4H8 + 4O2 = 4CO + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaSO4 + AlBr3 = CaBr2 + Al2(SO4)33CaSO4 + 2AlBr3 = 3CaBr2 + Al2(SO4)3
CH4 + O2 = CO2 + H205CH4 + 5O2 = 5CO2 + H20
Ca(HCO3)2 + Na2CO3 = CaCO3 + NaHCO3Ca(HCO3)2 + Na2CO3 = CaCO3 + 2NaHCO3
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH3(CH2)6CH3 + O2 = CO2 +H2O2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C3H5(NO3)3 = CO2 + H2O + N2 + O24C3H5(NO3)3 = 12CO2 + 10H2O + 6N2 + O2
C5H11OH+O2=CO2+H2O2C5H11OH + 15O2 = 10CO2 + 12H2O
C8H18+O2=H2O+CO22C8H18 + 25O2 = 18H2O + 16CO2
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cl2 + NaI = NaCl + I2Cl2 + 2NaI = 2NaCl + I2
Ca + H2O = CaO + H2Ca + H2O = CaO + H2
Ca3N2+HNO3=Ca(NO3)2+NH4NO3Ca3N2 + 8HNO3 = 3Ca(NO3)2 + 2NH4NO3
CH3NO+O2=CO2+H2O+N24CH3NO + 5O2 = 4CO2 + 6H2O + 2N2
C8H14+O2=H2O+CO22C8H14 + 23O2 = 14H2O + 16CO2
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
CH4+2O2=CO2+2H2OCH4 + 2O2 = CO2 + 2H2O
CO2 + 2H2O = CH2O + O2CO2 + H2O = CH2O + O2
CO2 + H2O = CH2O + O2CO2 + H2O = CH2O + O2
C3H8O + O2 = CO2 + H2O2C3H8O + 9O2 = 6CO2 + 8H2O
Cu(NO3)2 + Na2CO3 = CuCO3 + Na2(NO3)2Cu(NO3)2 + Na2CO3 = CuCO3 + Na2(NO3)2
CuS + HNO3 = Cu(NO3)2 + S + NO + H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 2NO + 4H2O
Cu(NO3)2 + Na2CO3 = CuCO3 + NaNO3Cu(NO3)2 + Na2CO3 = CuCO3 + 2NaNO3
Ca(NO3)2 + Na2CO3 = CaCO3 + 2 NaNO3Ca(NO3)2 + Na2CO3 = CaCO3 + 2NaNO3
C2H4+H20=C2H610C2H4 + H20 = 10C2H6
C4H10+KMnO4+H2SO4=CH3COOH+K2SO4+MnSO4+H2OC4H10 + 2KMnO4 + 3H2SO4 = 2CH3COOH + K2SO4 + 2MnSO4 + 4H2O
C2H5OH+K2CrO7+H2SO4=CH3COOH+Cr2(SO4)3+K2SO4+H2O9C2H5OH + 4K2CrO7 + 10H2SO4 = 9CH3COOH + 2Cr2(SO4)3 + 4K2SO4 + 19H2O
CH3-CH+KMnO4+KOH=CH3COOH+MnO2+K2CO3+H2O0CH3-CH + 8KMnO4 + 4KOH = -3CH3COOH + 8MnO2 + 6K2CO3 + 8H2O
C6H5CH3+KMnO4=C6H5COOK+MnO2+KOH+H2OC6H5CH3 + 2KMnO4 = C6H5COOK + 2MnO2 + KOH + H2O
C2H4+KMnO4+H2O=C2H6O2+MnO2+KOH3C2H4 + 2KMnO4 + 4H2O = 3C2H6O2 + 2MnO2 + 2KOH
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Ca3P2 + H2O = PH3 + Ca(OH)2Ca3P2 + 6H2O = 2PH3 + 3Ca(OH)2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cl2=ClCl2 = 2Cl
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
CH3OH + O2 = CO2 + H2 O 2CH3OH + 3O2 = 2CO2 + 4H2O
C10H16 + Cl2= C + HClC10H16 + 8Cl2 = 10C + 16HCl
C5H12 + O2 = CO2 + H2OC5H12 + 8O2 = 5CO2 + 6H2O
C3H5N3O9 =N2 + CO2 + H2O + O24C3H5N3O9 = 6N2 + 12CO2 + 10H2O + O2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaH2 + 2H2O = Ca(OH)2 + 2H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H8 + O2 = CO2 + H2OC5H8 + 7O2 = 5CO2 + 4H2O
C5H8 + O2 = H2O + CO2C5H8 + 7O2 = 4H2O + 5CO2
C2H8N2 + N2O4 = N2 + CO2 + H2OC2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
CaH2 + HNO3 = H2 + Ca(NO3)2CaH2 + 2HNO3 = 2H2 + Ca(NO3)2
CaBr2 + Pb(NO3)2 = Ca(NO3)2 + PbBr2CaBr2 + Pb(NO3)2 = Ca(NO3)2 + PbBr2
C3 H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Ca + H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C2H2 + H2 = C2H6C2H2 + 2H2 = C2H6
Cu+H2SO4=CuSO4+SO2+H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
Cl2+NaOH= NaCl+NaClO3+H2O3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
Cs + O = Cs2O2Cs + O = Cs2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H6 + O2 = CO2 + H2O2C4H6 + 11O2 = 8CO2 + 6H2O
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
Cu(NO3)2+NaHCO3= CuCO3+CO2+NaNO3+H2OCu(NO3)2 + 2NaHCO3 = CuCO3 + CO2 + 2NaNO3 + H2O
C3H6+O2=CO2+H2O2C3H6 + 9O2 = 6CO2 + 6H2O
Cl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2OCl2O7 + Ca(OH)2 = Ca(ClO4)2 + H2O
C3H6O2 + O2 = CO2 + H2O2C3H6O2 + 7O2 = 6CO2 + 6H2O
Cu2+AgNO3=Ag+Cu2NO3Cu2 + AgNO3 = Ag + Cu2NO3
Cu2O(s)+C(s)=Cu(s)+CO(g)Cu2O(s) + C(s) = 2Cu(s) + CO(g)
Ca3P2 + H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C(s)+O2(g)=CO(g)2C(s) + O2(g) = 2CO(g)
Co(NO3)3(aq)+(NH4)2S(aq)=Co2S3(s)+NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
Ca+2H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
CO2(g)+H2O(l) = C6H12O6(s)+O2(g) 6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
CO2(g)+H2O(l) = C6H12O6(s)+O2(g) 6CO2(g) + 6H2O(l) = C6H12O6(s) + 6O2(g)
Ca+N2= CaN2Ca + N2 = 2CaN
CuCO3 (s) = CuO(s) + CO2 (g)CuCO3(s) = CuO(s) + CO2(g)
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
CaC03 (s) + HCl (aq) =CaCl2 (aq) + H20 (l) + C02 (g)10CaC03(s) + 20HCl(aq) = 10CaCl2(aq) + H20(l) + 15C02(g)
C3H4 (g) + H2 (g) = C3H8 (g)C3H4(g) + 2H2(g) = C3H8(g)
Cu2As2O7+Zn+H2SO4=Cu+AsH3+ZnSO4+H2OCu2As2O7 + 10Zn + 10H2SO4 = 2Cu + 2AsH3 + 10ZnSO4 + 7H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
Ca(CN)2+HBr=CaBr2+HCNCa(CN)2 + 2HBr = CaBr2 + 2HCN
Ca(OH)2+NH4Cl=NH4OH+CaCl2Ca(OH)2 + 2NH4Cl = 2NH4OH + CaCl2
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H5Cl + O2 = CO + H2O + Cl24C2H5Cl + 9O2 = 8CO + 10H2O + 2Cl2
C2H2+O2=H2O+CO22C2H2 + 5O2 = 2H2O + 4CO2
Ca(NO3)2+Na3PO4=Ca3(PO4)2+NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cu+H(NO)3=H2O+ NO2 +Cu(NO)37Cu + 6H(NO)3 = 3H2O - 3NO2 + 7Cu(NO)3
Cu+H(NO)3=H2O+NO2+Cu(NO)37Cu + 6H(NO)3 = 3H2O - 3NO2 + 7Cu(NO)3
C8H18 +O2 = CO2 +H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CrI3 + K(OH) + Cl2 = K(CrO4) + K(IO4) + KCl + H2OCrI3 + 32K(OH) + 14Cl2 = K(CrO4) + 3K(IO4) + 28KCl + 16H2O
CrI3 + K(OH) + Cl = K(CrO4) + K(IO4) + KCl + H2OCrI3 + 32K(OH) + 28Cl = K(CrO4) + 3K(IO4) + 28KCl + 16H2O
CrI3 + K(OH) + Cl2 = K(CrO4) + K(IO4) + KCl + H2OCrI3 + 32K(OH) + 14Cl2 = K(CrO4) + 3K(IO4) + 28KCl + 16H2O
Ca + 2H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CuS+ HNO3 = CuSO4 + NO + H2O3CuS + 8HNO3 = 3CuSO4 + 8NO + 4H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.