Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Cu(NO3)2 + C2H6N4O2 = CuO + CO2 + N2 +H2OCu(NO3)2 + C2H6N4O2 = CuO + 2CO2 + 3N2 + 3H2O
Cu(s) + S8(s) = CuS(s)8Cu(s) + S8(s) = 8CuS(s)
CH3COOH(l)+O2(g)=2CO2(g)+2H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CoCl2 + Na2CO2 = CoCO2 + NaClCoCl2 + Na2CO2 = CoCO2 + 2NaCl
C2H8+O2=CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
C3H8(g) + 5O2(g) = 2CO2(g) + H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
Ca3P2+H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca3P2+H2O = Ca(OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca + F = CaF2Ca + 2F = CaF2
C6H10 + KMnO4 = KC6H10 + MnO4C6H10 + KMnO4 = KC6H10 + MnO4
C6H10 + H2O= C2(CH2)4CO + H27C6H10 + 6H2O = 6C2(CH2)4CO + 17H2
C2HO4- + H+ = C2H2O4C2HO4- + H+ = C2H2O4
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Ca(OH)2 + HCl= CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
C + H = C25H5225C + 52H = C25H52
CuSO4+Zn=ZnSO4+CuCuSO4 + Zn = ZnSO4 + Cu
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Cl2 + KOH = KClO3 + KCl + H2O3Cl2 + 6KOH = KClO3 + 5KCl + 3H2O
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + MnSO4 + K2SO4 + CO2 + H2O5CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + 2MnSO4 + K2SO4 + 10CO2 + 8H2O
CaC2O4 + KMnO4 + H2SO4 = CaSO4 + MnSO4 + K2SO4 + CO2 + H2O5CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + 2MnSO4 + K2SO4 + 10CO2 + 8H2O
Ca(OH)2+Na3PO4=Ca3(PO4)2+NaOH3Ca(OH)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaOH
C5H9O + O2 = CO2 + H2O4C5H9O + 27O2 = 20CO2 + 18H2O
Cu2S + HNO3 = Cu(NO3)2 + S + H2O + NO3Cu2S + 16HNO3 = 6Cu(NO3)2 + 3S + 8H2O + 4NO
Cd + HNO3 = Cd(NO3)2 + H2Cd + 2HNO3 = Cd(NO3)2 + H2
Cd + 2HNO3 = Cd(NO3)2 + H2Cd + 2HNO3 = Cd(NO3)2 + H2
Cd + 2HNO3 = Cd(NO3)2 H2Cd + 2HNO3 = Cd(NO3)2H2
C12H22O11 + O2 = CO2 + H2OC12H22O11 + 12O2 = 12CO2 + 11H2O
C12H22O11 + H2O = C2H6O+ CO2C12H22O11 + H2O = 4C2H6O + 4CO2
C12H22O11 + H2O = C2H5O + CO211C12H22O11 - H2O = 48C2H5O + 36CO2
C12H22O11 + H2O = C2H5O + H2O0C12H22O11 + H2O = 0C2H5O + H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C + H + O = C6H8O76C + 8H + 7O = C6H8O7
CuSO4*5H2O = CuSO4 + H2OCuSO4*5H2O = CuSO4 + 5H2O
CH4+N2Cl4=CCl4+N2+H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
CaH2+H2O=Ca(OH)2+H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaCO3+HCl = CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C2H6+O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H5COOH + O2 = CO2 + H2O2C6H5COOH + 15O2 = 14CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H4 + O2 = H2O + CO2C2H4 + 3O2 = 2H2O + 2CO2
CO2 + NaOH = NaHCO3CO2 + NaOH = NaHCO3
CaF2 + H2SO4 = CaSO4 + HFCaF2 + H2SO4 = CaSO4 + 2HF
C2H3O2Cl + O2 = 8CO + 6H2O + Cl24C2H3O2Cl + 3O2 = 8CO + 6H2O + 2Cl2
CaS+HNO3=Ca(NO3)2+H2SCaS + 2HNO3 = Ca(NO3)2 + H2S
CaCO3 + Cl2 = Cl2O + CaCl2 + CO2CaCO3 + 2Cl2 = Cl2O + CaCl2 + CO2
CaCO3 + Cl2 = Cl2O + CaCl + CO22CaCO3 + 3Cl2 = 2Cl2O + 2CaCl + 2CO2
CrCl3 + Na2CO3 = Cr2(CO3)3 + NaCl2CrCl3 + 3Na2CO3 = Cr2(CO3)3 + 6NaCl
C12H22O11 = C + H2O C12H22O11 = 12C + 11H2O
CaCO3(s) + HCl (aq) = CaCl2 (aq) + CO2 (g) + H2O (l)CaCO3(s) + 2HCl(aq) = CaCl2(aq) + CO2(g) + H2O(l)
Cr2O3+H2=Cr+H2OCr2O3 + 3H2 = 2Cr + 3H2O
Cl2+KOH=KClO4+KCl+H2O4Cl2 + 8KOH = KClO4 + 7KCl + 4H2O
CO2+H2O=C6H12O6+O26CO2 + 6H2O = C6H12O6 + 6O2
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Ca(ClO)2 + H2S = CaCl2 + CaSO4 + HCl 2Ca(ClO)2 + H2S = CaCl2 + CaSO4 + 2HCl
Ca(ClO)2 + H2S +H2O = CaCl2 + CaSO4 + HCl 2Ca(ClO)2 + H2S + 0H2O = CaCl2 + CaSO4 + 2HCl
CaClO2 + H2S +H2O = CaCl2 + CaSO4 + HCl -8CaClO2 - 3H2S + 4H2O = -5CaCl2 - 3CaSO4 + 2HCl
Ca(ClO)2 + H2S +H2O = CaCl2 + CaSO4 + HCl 2Ca(ClO)2 + H2S + 0H2O = CaCl2 + CaSO4 + 2HCl
CO2+H2O=C2H12O6+O22CO2 + 6H2O = C2H12O6 + 2O2
Cu2S + HNO3 = Cu(NO3)2 + H2O + NO + S3Cu2S + 16HNO3 = 6Cu(NO3)2 + 8H2O + 4NO + 3S
C3H6+O2=CO+H2C3H6 + 3O2 = 6CO + 12H
Cr2S3 + Mn(NO3)2 + Na2CO3 = Na2CrO4 + Na2SO4 + NaMnO4 + CO2 + NOCr2S3 + 30Mn(NO3)2 + 20Na2CO3 = 2Na2CrO4 + 3Na2SO4 + 30NaMnO4 + 20CO2 + 60NO
Cr+O2=Cr2O34Cr + 3O2 = 2Cr2O3
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cr(OH)3 + NaClO + Na2CO3 = Na2CrO4 + NaCl + CO2 + H2O2Cr(OH)3 + 3NaClO + 2Na2CO3 = 2Na2CrO4 + 3NaCl + 2CO2 + 3H2O
Ca(OH)2 + 2HI = CaI2 + 2H2OCa(OH)2 + 2HI = CaI2 + 2H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca3(PO4)2 + C = Ca3P2 + COCa3(PO4)2 + 8C = Ca3P2 + 8CO
CH3COOH + O2 = CO2 + H2OCH3COOH + 2O2 = 2CO2 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C6 + HNO3 = CO2 + H2O + NO2C6 + 24HNO3 = 6CO2 + 12H2O + 24NO2
Cr(OH)3 + NaClO + Na2CO3 = NaCrO4 + NaCl + CO2 + H2O2Cr(OH)3 + 4NaClO + Na2CO3 = 2NaCrO4 + 4NaCl + CO2 + 3H2O
Ca(ClO)2 + KI + HCl = I2 + CaCl2 + KCl + H2OCa(ClO)2 + 4KI + 4HCl = 2I2 + CaCl2 + 4KCl + 2H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CuS + HNO3 = Cu(NO3)2 + H2O + S + NO3CuS + 8HNO3 = 3Cu(NO3)2 + 4H2O + 3S + 2NO
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu + HNO3 = Cu(NO3)2 + H2O + NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CrO2+ClO=CrO4+ClCrO2 + 2ClO = CrO4 + 2Cl
Cl2+NH3 = N2H4 + NH4ClCl2 + 4NH3 = N2H4 + 2NH4Cl
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
CaO+C= CaC2+CO22CaO + 5C = 2CaC2 + CO2
Cr2+H4=Cr38H7619Cr2 + 19H4 = Cr38H76
C+H2SO4=CO2 +SO2+ H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
C + H + O = C6H12O66C + 12H + 6O = C6H12O6
C + H = C8H188C + 18H = C8H18
C + H + O = C3H6O3C + 6H + O = C3H6O
C + H + O = C2H4O22C + 4H + 2O = C2H4O2
Cd+HSO4=CdSO4 +H22Cd + 2HSO4 = 2CdSO4 + H2
Cu+HNO3=Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu + 2HgCl = CuCl2 + 2HgCu + 2HgCl = CuCl2 + 2Hg
CuSO4 + KCNS + H2SO3 + H2O = CuCN + K2SO4 + H2SO4-2CuSO4 - 2KCNS + 5H2SO3 - 3H2O = -2CuCN - K2SO4 + 2H2SO4
C4H9OH+O2=CO2+H2OC4H9OH + 6O2 = 4CO2 + 5H2O
Cu(OH)2+H3PO4=Cu3(PO4)2+H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
CaCO3+H2SO4=CaSO4+CO2+H2OCaCO3 + H2SO4 = CaSO4 + CO2 + H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CaCO3=CaO+CO2CaCO3 = CaO + CO2
CuSO4 + KCNS + H2SO3 + H2O = CuCN + K2SO4 + H2SO2CuSO4 + 2KCNS - 2H2SO3 + 3H2O = 2CuCN + K2SO4 + H2SO
Ca (OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
C + H2O = CO + H2C + H2O = CO + H2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6O=O2=CO2+H2OC2H6O = -3O2 + 2CO2 + 3H2O
CaCl2 + H2 = HCl + CaCaCl2 + H2 = 2HCl + Ca
C3H4(g)+O2(g)=CO2(g)+H2O(g)C3H4(g) + 4O2(g) = 3CO2(g) + 2H2O(g)
CO2 = CO + O22CO2 = 2CO + O2
Ca + O2 = CaO2Ca + O2 = 2CaO
CH3CH3+O2=CO2+H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3COOH+NaHCO3=CO2+H2O+NaCH3COOCH3COOH + NaHCO3 = CO2 + H2O + NaCH3COO
Ca + H3PO4 = Ca3(PO4)2 + H23Ca + 2H3PO4 = Ca3(PO4)2 + 3H2
C8H18+O2=CO2+H2O2C8H18 + 25O2 = 16CO2 + 18H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C4H9OH+ O2 = CO2 + H202C4H9OH + 7O2 = 8CO2 + H20
C4H9OH+ O2 = CO2 + H202C4H9OH + 7O2 = 8CO2 + H20
Ca(OH)2 + HCl = H2O + CaCl2 Ca(OH)2 + 2HCl = 2H2O + CaCl2
Cu + HNO3 = NO + H2O+ Cu(NO3)23Cu + 8HNO3 = 2NO + 4H2O + 3Cu(NO3)2
Cu + HNO3 = NO2 + H2O+ Cu(NO3)2Cu + 4HNO3 = 2NO2 + 2H2O + Cu(NO3)2
Co(NO3)2(aq)+H2S(g) =CoS(s)+HNO3(aq)Co(NO3)2(aq) + H2S(g) = CoS(s) + 2HNO3(aq)
Cs + H2O = CsOH + HCs + H2O = CsOH + H
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C5H2 + O2 = CO2 + H2O2C5H2 + 11O2 = 10CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu+O2=2CuO2Cu + O2 = 2CuO
C7H6O3+H2SO4+HNO3=C7H6N2O5+S-1C7H6O3 + H2SO4 - 2HNO3 = -1C7H6N2O5 + S
C2H5 + O2 = CO2 + H2O4C2H5 + 13O2 = 8CO2 + 10H2O
Ca + 2HCl=H2 + CaCl2Ca + 2HCl = H2 + 2CaCl
Cu+Cl2=CuCl2Cu + Cl2 = CuCl2
CaBr2+AgNO3=AgBr+Ca(NO3)2CaBr2 + 2AgNO3 = 2AgBr + Ca(NO3)2
C2H2 + AgNO3 + NH4OH = Ag2C2 + NH4NO3 + H2OC2H2 + 2AgNO3 + 2NH4OH = Ag2C2 + 2NH4NO3 + 2H2O
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+O2=CO2+H2010C2H5OH + 15O2 = 20CO2 + 3H20
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2+H3PO4=H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
CH+O=CO+HOCH + 2O = CO + HO
C4H16+O2=CO2+H2OC4H16 + 8O2 = 4CO2 + 8H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
C10H22 + O2 = CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
CO2+ 4H2= CH4+ 2H2OCO2 + 4H2 = CH4 + 2H2O
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Cu+Cl2=CuCl2Cu + Cl2 = CuCl2
CaBr2+AgNO3=AgBr=Ca(NO3)2CaBr2 + 2AgNO3 = 2AgBr + Ca(NO3)2
C2H5OH+O2=CO2+H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C16H32O2 + O2 = CO2 + H2OC16H32O2 + 23O2 = 16CO2 + 16H2O
C4H9OH +O2 = C4H7O2H + H2OC4H9OH + O2 = C4H7O2H + H2O
CO2+ H2O =H2CO3CO2 + H2O = H2CO3
CaCl2+K2Co3 = CaCo3+KClCaCl2 + K2Co3 = CaCo3 + 2KCl
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CO + H2 = CH3OHCO + 2H2 = CH3OH
CO(g) + O2(g) =CO2(g)2CO(g) + O2(g) = 2CO2(g)
C2H2(g) +O2(g) = CO2(g) + H2O(g)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
Cl(g) + KI2(aq) = I(s) +KCl(aq)Cl(g) + KI2(aq) = 2I(s) + KCl(aq)
Cl(g) + KI2(aq) = I(s) +KClCl(g) + KI2(aq) = 2I(s) + KCl
C3H8+5O2=3CO2+4HC3H8 + 3O2 = 3CO2 + 8H
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CrCl3(aq) + Na2CO3(aq) = Cr2(CO3)3(s) + NaCl(aq)2CrCl3(aq) + 3Na2CO3(aq) = Cr2(CO3)3(s) + 6NaCl(aq)
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H3Cl1+O2=CO2+H2O+2HCl2C2H3Cl1 + 5O2 = 4CO2 + 2H2O + 2HCl
Cr2S3 + HCl=CrCl3 + H2SCr2S3 + 6HCl = 2CrCl3 + 3H2S
C2H2 + O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Ca(OH)2 + HCl = CaCl2 + H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
Ca(OH)2 + Na2SO4 = CaSO4 + NaOHCa(OH)2 + Na2SO4 = CaSO4 + 2NaOH
Ca(OH)2 + Na2SO4 = CaSO4 + NaOHCa(OH)2 + Na2SO4 = CaSO4 + 2NaOH
Ca(OH)2 + Na2SO4 = CaSO4 + NaOHCa(OH)2 + Na2SO4 = CaSO4 + 2NaOH
C+H2=C2H62C + 3H2 = C2H6
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CS2 + Cl2 = CCl4 + S2Cl2CS2 + 3Cl2 = CCl4 + S2Cl2
Ca+HCl=H2+CaCl2Ca + 2HCl = H2 + 2CaCl
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca(NO3)2 + Na3PO4 = Ca3(PO4)2 + NaNO33Ca(NO3)2 + 2Na3PO4 = Ca3(PO4)2 + 6NaNO3
C5H6O + O2 = CO2 + H2OC5H6O + 6O2 = 5CO2 + 3H2O
Cr(OH)3 + HClO4 = Cr(ClO4)3 + H2OCr(OH)3 + 3HClO4 = Cr(ClO4)3 + 3H2O
C5H10O2 + O2 = CO2 + H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
CH4 + Br2 = CBr4 + HBrCH4 + 4Br2 = CBr4 + 4HBr
CO + O2 = CO22CO + O2 = 2CO2
CO2 + KOH = K2CO3 + H2OCO2 + 2KOH = K2CO3 + H2O
CH3OH + O2 =CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca+HBr=CaBr2+H2Ca + 2HBr = CaBr2 + H2
CO+O2=CO22CO + O2 = 2CO2
Ca3 P2 + H2O = Ca (OH)2 + PH3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
Ca(OH)2+H3PO4=H2O+Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C5H10O + O2 = CO2 + H2O C5H10O + 7O2 = 5CO2 + 5H2O
C5 H10 O + O2 = CO2 + H2O C5H10O + 7O2 = 5CO2 + 5H2O
C5 H10 O + O2 =CO2 +H2OC5H10O + 7O2 = 5CO2 + 5H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C2H6+O2=CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6+O2=CO3+H2O2C2H6 + 9O2 = 4CO3 + 6H2O
C5H5N + 3 H2 = C5H10NHC5H5N + 3H2 = C5H10NH
CuO+CO=CuCO+O22CuO + 2CO = 2CuCO + O2
Ca+N2=2CaN2Ca + N2 = 2CaN
Ca3(PO4)2 + SiO2 + C = CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
CCl4(g)+O2(g)=COCl2(g) + Cl2(g)2CCl4(g) + O2(g) = 2COCl2(g) + 2Cl2(g)
Ca+HBr=CaBr+H22Ca + 2HBr = 2CaBr + H2
C4H8 + Br2 = C4H8Br2C4H8 + Br2 = C4H8Br2
C3H8 + Br2 = C3H7Br + HBrC3H8 + Br2 = C3H7Br + HBr
C2H6 + Cl2 = C2Cl6 + HClC2H6 + 6Cl2 = C2Cl6 + 6HCl
C+O2=CO2C + O2 = CO2
CH3CH2OH + O2 = CO2 + H2O CH3CH2OH + 3O2 = 2CO2 + 3H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3OH(l)+O2(g)=CO2(g)+H2O(l)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(l)
C6H12O6=C2H6O+CO2C6H12O6 = 2C2H6O + 2CO2
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
Cu + AgNO3 = Ag + Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
Cu+AgNO3=Ag+Cu(NO3)2Cu + 2AgNO3 = 2Ag + Cu(NO3)2
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CoCl2+NaOH+NaClO3=NaCl+Co2O3+H2O6CoCl2 + 12NaOH + NaClO3 = 13NaCl + 3Co2O3 + 6H2O
C2H6+7O2=4CO2+H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH3 + O2= CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CH3CH3 + O2= CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
CaCO3+H3PO4=Ca3(PO4)2=CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
Ca(OH)2+H3PO=Ca3(PO4)2+H2015Ca(OH)2 + 10H3PO = 5Ca3(PO4)2 + 3H20
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Cu+AgNO3=Cu(NO3)2+AgCu + 2AgNO3 = Cu(NO3)2 + 2Ag
CaO + C = CO + CaC2CaO + 3C = CO + CaC2
C + H2O = C O + H2C + H2O = CO + H2
CO2 + H2O = H2CO3CO2 + H2O = H2CO3
C + O2 = CO2C + O2 = 2CO
CH3CH2OH + O2 = CH3OOH + H2O-1CH3CH2OH - O2 = -2CH3OOH + H2O
CH3CH2OH + O2 = CH3OOH + H2O-1CH3CH2OH - O2 = -2CH3OOH + H2O
C2H8 + O2=CO2 + H2OC2H8 + 4O2 = 2CO2 + 4H2O
CH3CH3 + O2 = CO2 +H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
C+H2SO4=CO2+SO2+H2OC + 2H2SO4 = CO2 + 2SO2 + 2H2O
CuSO4(aq)+Pb(s)=PbSO4(aq)+Cu(s)CuSO4(aq) + Pb(s) = PbSO4(aq) + Cu(s)
C2H6 + Cl2 = C2H4Cl2 + HClC2H6 + 2Cl2 = C2H4Cl2 + 2HCl
Ca + Cl2 = CaCl2Ca + Cl2 = 2CaCl
CH3OH + O2= CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca + O2 = 2CaO2Ca + O2 = 2CaO
C6H6 + O2 = CO2 + H2O2C6H6 + 15O2 = 12CO2 + 6H2O
CuCl2 + H2 = Cu + HCl CuCl2 + H2 = Cu + 2HCl
C + H2 = CH4C + 2H2 = CH4
C2H6 + O2 = CO+H2O2C2H6 + 5O2 = 4CO + 6H2O
C+O2=CO32C + 3O2 = 2CO3
CO+Fe2O3=Fe+CO23CO + Fe2O3 = 2Fe + 3CO2
C+HNO3=CO2+NO2+H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
C+HNO3=N2+CO2+H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
Ca(OH)2+H3PO4=Ca3(PO4)2+6H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
CH4+Cl2=CHCl3+HClCH4 + 3Cl2 = CHCl3 + 3HCl
CaCO3=CaO + CO2CaCO3 = CaO + CO2
CaCO3=CaO + CO2CaCO3 = CaO + CO2
CaCO3=CaO + CO2CaCO3 = CaO + CO2
Ca3(PO4)2 + SiO2 + C = CaSiO3 + CO + PCa3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
Cl+SO2+H2O =HCl+H2SO42Cl + SO2 + 2H2O = 2HCl + H2SO4
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C6H12O6 + O2= CO2 +H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C6H12O6 + O2= CO2 +HO2C6H12O6 + 15O2 = 6CO2 + 12HO2
CaCO3 + H3O = Ca + H2O + CO2 CaCO3 + 2H3O = Ca + 3H2O + CO2
C2H6O + O2 = 2CO + 3H2OC2H6O + 2O2 = 2CO + 3H2O
CuSO4*5H2O + PH3 = Cu3P2 + H2SO4 + H2O3CuSO4*5H2O + 2PH3 = Cu3P2 + 3H2SO4 + 15H2O
Ca(HCO3)2 + 2NH3 = CaCO3 + (NH4)2CO3Ca(HCO3)2 + 2NH3 = CaCO3 + (NH4)2CO3
CO2+H2O=C6H2O6+O212CO2 + 2H2O = 2C6H2O6 + 7O2
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2 + H2SO4 = CaSO4 + H2O = Ca(OH)2 + H2SO4 = CaSO4 + 2H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C + H2 = CH4C + 2H2 = CH4
Cu + H2SO4 = CuSO4 + H2 =Cu + H2SO4 = CuSO4 + H2
CuCl2 + H2S = CuS + HClCuCl2 + H2S = CuS + 2HCl
Ca + HCl = CaCl2 + H2 =Ca + 2HCl = CaCl2 + H2
Cl2 + NaBr = NaCl + Br2Cl2 + 2NaBr = 2NaCl + Br2
Ca + O2 = CaO2Ca + O2 = 2CaO
C12 + NaBr = NaC1 + Br2C12 + 12NaBr = 12NaC1 + 6Br2
Cu + O2 = CuO2Cu + O2 = 2CuO
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
C2H5OH+Na=C2H5ONa+H22C2H5OH + 2Na = 2C2H5ONa + H2
C + O2 = CO2C + O2 = CO2
Ca+H2O=Ca(OH)2+H2Ca + 2H2O = Ca(OH)2 + H2
C2H2+H2=C4H82C2H2 + 2H2 = C4H8
C+O2=CO2C + O2 = 2CO
C2H60(aq) + KMnO4(aq)+ HCl(aq)= C2H4O2(aq) + MnCl2(aq) + KCl(aq) + H2O(l)C2H60(aq) + 12KMnO4(aq) + 36HCl(aq) = C2H4O2(aq) + 12MnCl2(aq) + 12KCl(aq) + 46H2O(l)
Ca(OH)2 + H3PO4 = H2O + Ca3(PO4)23Ca(OH)2 + 2H3PO4 = 6H2O + Ca3(PO4)2
C3H6 + NH3 + O2 = C3H3N + H2O2C3H6 + 2NH3 + 3O2 = 2C3H3N + 6H2O
Ca(OH)2(s)+H3PO4(aq)=Ca3(PO4)2(s)+H2O(l)3Ca(OH)2(s) + 2H3PO4(aq) = Ca3(PO4)2(s) + 6H2O(l)
CS2(l)+Cl2(g)=CCl4(s)+S2Cl2(g)CS2(l) + 3Cl2(g) = CCl4(s) + S2Cl2(g)
CaCl2 + NaOH = NaCl + Ca(OH)2CaCl2 + 2NaOH = 2NaCl + Ca(OH)2
C2H60(aq) + KMnO4(aq)+ HCl(aq) = C2H4O2(aq) + MnCl2(aq) + KCl(aq) + H2O(l)C2H60(aq) + 12KMnO4(aq) + 36HCl(aq) = C2H4O2(aq) + 12MnCl2(aq) + 12KCl(aq) + 46H2O(l)
C2H60(aq) + KMnO4(aq)+ HCl(aq) = C2H4O2(aq) + MnCl2(aq) + KCl(aq) + H2O(l)C2H60(aq) + 12KMnO4(aq) + 36HCl(aq) = C2H4O2(aq) + 12MnCl2(aq) + 12KCl(aq) + 46H2O(l)
C4H10 + O2 = CO2 +H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cr + Fe(NO3)2 = Cr ( NO3) + Fe2Cr + Fe(NO3)2 = 2Cr(NO3) + Fe
Cr + Fe(NO3)3 = Cr ( NO3) + Fe3Cr + Fe(NO3)3 = 3Cr(NO3) + Fe
CuCl2 + Na(NO3) = Cu(NO3)2 + NaClCuCl2 + 2Na(NO3) = Cu(NO3)2 + 2NaCl
CaCO3 + H2SO4 = CaSO4+ CO2 + H2OCaCO3 + H2SO4 = CaSO4 + CO2 + H2O
CH4+ Cl2 = CHCl3 + HClCH4 + 3Cl2 = CHCl3 + 3HCl
CuCi2+H2=Cu+HCiCuCi2 + H2 = Cu + 2HCi
Cu+NaNO3+H2SO4=NaHSO4+Cu(NO3)2+H2O+NO2Cu + 4NaNO3 + 4H2SO4 = 4NaHSO4 + Cu(NO3)2 + 2H2O + 2NO2
Cu+NaNO3+H2SO4=NaHSO4+Cu(NO3)2+H2O+NO2Cu + 4NaNO3 + 4H2SO4 = 4NaHSO4 + Cu(NO3)2 + 2H2O + 2NO2
Ca3(PO4)2 + SiO2 + C = CaSiO3 +CO +P Ca3(PO4)2 + 3SiO2 + 5C = 3CaSiO3 + 5CO + 2P
CaCO3 +H2SO4 = CaSO4+ CO2 + H2OCaCO3 + H2SO4 = CaSO4 + CO2 + H2O
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
CaCO3 +HCl = CaCl2+ H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
CO+O2=CO22CO + O2 = 2CO2
C3H7OH + O2 = CO2 + H2O 2C3H7OH + 9O2 = 6CO2 + 8H2O
CA + H2O = CA(OH)2 + H2CA + 2H2O = CA(OH)2 + H2
C3 H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
Ca(OH)2+ H3PO3=Ca3(PO3)2 + H2O3Ca(OH)2 + 2H3PO3 = Ca3(PO3)2 + 6H2O
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
CuO + H2 = Cu + H2OCuO + H2 = Cu + H2O
CuS + HNO3 = Cu(NO3)2 + S + H2O + NO3CuS + 8HNO3 = 3Cu(NO3)2 + 3S + 4H2O + 2NO
Cu + HNO3 = NO2 + H2O + Cu(NO3)2Cu + 4HNO3 = 2NO2 + 2H2O + Cu(NO3)2
C2H4 + O2 = CO2 + H2OC2H4 + 3O2 = 2CO2 + 2H2O
Cu + HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
CO + Fe2O3 = Fe + CO23CO + Fe2O3 = 2Fe + 3CO2
C + HNO3 = N2 + CO2 + H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
C + HNO3 = N2 + CO2 + H2O5C + 4HNO3 = 2N2 + 5CO2 + 2H2O
C + HNO3 = CO2 + NO2 +H2OC + 4HNO3 = CO2 + 4NO2 + 2H2O
Cr2S3 + Mn(NO3)2 + Na2CO3 = NO + CO2 + Na2CrO4 + Na2MnO4 + Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4 + 2O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
C2H4O2 + C5H12O = C7H14O2 + H2OC2H4O2 + C5H12O = C7H14O2 + H2O
C3H8(g)+O2(g) = CO2(g)+H2O(g)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(g)
CH3COOH(l)+O2(g) = CO2(g)+H2O(l)CH3COOH(l) + 2O2(g) = 2CO2(g) + 2H2O(l)
CaO + HCl = CaCl2 + H2OCaO + 2HCl = CaCl2 + H2O
C3H5N6O9 = CO2 + N2 + H2O + O24C3H5N6O9 = 12CO2 + 12N2 + 10H2O + O2
Ca + HOH = Ca(OH) + H22Ca + 2HOH = 2Ca(OH) + H2
CrCl3 + KOH + KClO3 = KCl + K2CrO4 + H2O2CrCl3 + 10KOH + KClO3 = 7KCl + 2K2CrO4 + 5H2O
CrCl3 + KOH + K + KClO3 + = KCl + K2CrO4 + H2OCrCl3 + 8KOH - 3K + 0KClO3+ = 3KCl + K2CrO4 + 4H2O
CrCl3 + KOH + K + KClO3 + = KCl + K2CrO4 + H2OCrCl3 + 8KOH - 3K + 0KClO3+ = 3KCl + K2CrO4 + 4H2O
Cu + H2SO2=CuSO4 + SO2 + H2O -1Cu + 2H2SO2 = -1CuSO4 + 3SO2 + 2H2O
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C6H12O6 = C2H6O + CO2C6H12O6 = 2C2H6O + 2CO2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
Cl2 + Fl2 =Cl2Fl2Cl2 + Fl2 = Cl2Fl2
CaCl2 + 2Na=2NaCl + CaCaCl2 + 2Na = 2NaCl + Ca
Cu + HNO3 = Cu(NO3)2 +NO+ H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C9H10Cl2N2O + H2O2 = H2O + CO2 + Cl + NC9H10Cl2N2O + 22H2O2 = 27H2O + 9CO2 + 2Cl + 2N
C2H6 + O2 = H2O = CO22C2H6 + 7O2 = 6H2O + 4CO2
C2H8+O2=C02+H2OC2H8 + 2O2 = C02 + 4H2O
C6H14+O2=CO2+H2O2C6H14 + 19O2 = 12CO2 + 14H2O
CuO+HNO3=Cu(NO3)2+H2OCuO + 2HNO3 = Cu(NO3)2 + H2O
CO2(g)+4H2(g)=CH4(g)+2H2O(g)CO2(g) + 4H2(g) = CH4(g) + 2H2O(g)
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
Ca(OH)2+HNO3=Ca(NO3)2+H2OCa(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
C(s) + O2(g) = CO(g)2C(s) + O2(g) = 2CO(g)
C2H5OH+3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H5OH+3O2 = 2CO2 + 3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
C2H6+O2=H2O+CO22C2H6 + 7O2 = 6H2O + 4CO2
Ca3 P2 + H2 O = Ca (O H)2 + P H3Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
C4 H10 O + O2 = C O2 + H2 OC4H10O + 6O2 = 4CO2 + 5H2O
C4 H10 O + O2 = C O2 + H2 OC4H10O + 6O2 = 4CO2 + 5H2O
C3H8 + O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 +O2 =H2O(g)+CO2(g)2C2H6 + 7O2 = 6H2O(g) + 4CO2(g)
Ca+HCl=CaCl2+H2Ca + 2HCl = CaCl2 + H2
C5H12+O2=CO2+H2OC5H12 + 8O2 = 5CO2 + 6H2O
C+O2=CO2C + O2 = CO2
C+O2=CO2C + O2 = CO2
CaO + C = CaC2 + CO22CaO + 5C = 2CaC2 + CO2
Ca(HCO3)2+Ca(OH)2=CaCO3+H2OCa(HCO3)2 + Ca(OH)2 = 2CaCO3 + 2H2O
Cu + O2 = CuO2Cu + O2 = CuO2
C3H6 + O2 = CO2 + H2O2C3H6 + 9O2 = 6CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
Cu + H2SO4 = CuSO4 + H2O + SO2Cu + 2H2SO4 = CuSO4 + 2H2O + SO2
Ca + 2 H2O =Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CU+HNO3=CU(NO3)2+H2O+NO3-1CU + 0HNO3 = -1CU(NO3)2 + 0H2O + 2NO3
CU+HNO3=CU(NO3)2+H2O+NO3-1CU + 0HNO3 = -1CU(NO3)2 + 0H2O + 2NO3
C2H2 +O2=CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
CuO + NH3 = N2 + Cu + H2O3CuO + 2NH3 = N2 + 3Cu + 3H2O
CH3COOH +O2 = CO2 + H2OCH3COOH + 2O2 = 2CO2 + 2H2O
CH3OH + O2 = H2 + COCH3OH + 0O2 = 2H2 + CO
CoS+HNO3=Co(NO3)2+NO+S+H2O3CoS + 8HNO3 = 3Co(NO3)2 + 2NO + 3S + 4H2O
CoS+HNO3=Co(NO3)2+NO+S+H2CoS + 2HNO3 = Co(NO3)2 + 0NO + S + H2
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CaH2 + H2O = Ca(OH)2 + H2CaH2 + 2H2O = Ca(OH)2 + 2H2
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
Ca + HNO3 = Ca(NO3)2 + H2Ca + 2HNO3 = Ca(NO3)2 + H2
CaO + H2O = Ca(OH)2CaO + H2O = Ca(OH)2
CH4(g)+O2(g)=CO2(g)+H2O(g)CH4(g) + 2O2(g) = CO2(g) + 2H2O(g)
Cu+HNO3= Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3= Cu(NO3)2+NO2+H2OCu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
Cu+HNO3= Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
C3H8(g)+5O2(g)=2CO2(g)+H2O(l)C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
C6H4OH+7O2= 6CO3+2H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+7O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+O2= CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+7O2= 6CO3+2H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
C6H4OH+7O2= 6CO3+H2O4C6H4OH + 39O2 = 24CO3 + 10H2O
CaCO3 = CaO + CO2CaCO3 = CaO + CO2
Cu + 4NO4NO3 + 2NO = 5Cu(NO3)25Cu + 4NO4NO3 + 2NO = 5Cu(NO3)2
C6H6+O2=CO2+H2O2C6H6 + 15O2 = 12CO2 + 6H2O
C12H22O11 = C + H2O C12H22O11 = 12C + 11H2O
Cr2S3+Mn(NO3)2+Na2CO3=NO+CO2+Na2CrO4+Na2MnO4+Na2SO4Cr2S3 + 15Mn(NO3)2 + 20Na2CO3 = 30NO + 20CO2 + 2Na2CrO4 + 15Na2MnO4 + 3Na2SO4
Ca(s) + HNO3 = CaNO3 (aq) + H (g)Ca(s) + HNO3 = CaNO3(aq) + H(g)
CH3(CH2)4CH3 + O2 = CO2 + H2010CH3(CH2)4CH3 + 60O2 = 60CO2 + 7H20
ClCH2CO2H + O2 = CO + H2O + Cl24ClCH2CO2H + 3O2 = 8CO + 6H2O + 2Cl2
CuCl2+H2=Cu+HClCuCl2 + H2 = Cu + 2HCl
CuCl2+H2=Cu+HClCuCl2 + H2 = Cu + 2HCl
C6H12O6 = C2H5OH + CO2C6H12O6 = 2C2H5OH + 2CO2
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CrI3+KOH+Cl2=K2CrO4+KIO4+KCl+H2O2CrI3 + 64KOH + 27Cl2 = 2K2CrO4 + 6KIO4 + 54KCl + 32H2O
CrI3+NaOH+Cl2=NaIO4+Na2CrO4+NaCl+H2O2CrI3 + 64NaOH + 27Cl2 = 6NaIO4 + 2Na2CrO4 + 54NaCl + 32H2O
C2H6 + 4O2 =2CO2 + 6H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Co++ + BrO- + H+ = Co+++ + Br2 + H2O2Co++ + 2BrO- + 4H+ = 2Co+++ + Br2 + 2H2O
CdS+L2+HCL=CdCL2+HL+SCdS + L2 + HCL = CdCL2 + HL + S
CdS+L2+HCL=CdCL2+HL+SCdS + L2 + HCL = CdCL2 + HL + S
CaC2O4+KMnO4+H2SO4=CaSO4+K2SO4+MnSO4+H2O+CO25CaC2O4 + 2KMnO4 + 8H2SO4 = 5CaSO4 + K2SO4 + 2MnSO4 + 8H2O + 10CO2
Cu+HNO3=Cu(NO3)2+H2O+NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
C4 H 10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CoCl2 + Cl2 = CoCl32CoCl2 + Cl2 = 2CoCl3
CH3 + S8 = CS2 + HS8CH3 + 5S8 = 8CS2 + 24HS
CH3COOH( aq) + NaOH( aq) =H2O (l) + NaCH3CO2( aq)CH3COOH(aq) + NaOH(aq) = H2O(l) + NaCH3CO2(aq)
Co(NO3)2 + Na2CO3 = NaNO3 + CoCO3Co(NO3)2 + Na2CO3 = 2NaNO3 + CoCO3
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
CH4 + O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
CH4 + O2 = CO + H2O2CH4 + 3O2 = 2CO + 4H2O
CuSO4+Zn=Cu+ZnSO4CuSO4 + Zn = Cu + ZnSO4
C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
C4H10 + H2O = CO2 + H2O0C4H10 + H2O = 0CO2 + H2O
C+O2=CO2C + O2 = CO2
Cu + HNO3 + H2SO4 = CuSO4 + NO + H2O3Cu + 2HNO3 + 3H2SO4 = 3CuSO4 + 2NO + 4H2O
CH4+Cl2=CCl4+HClCH4 + 4Cl2 = CCl4 + 4HCl
CO2 + C = COCO2 + C = 2CO
CO(g) + H2O(g) = CO2(g) + H2(g)CO(g) + H2O(g) = CO2(g) + H2(g)
Cu2CO3(OH)2(s) + C(s) = Cu(s) + CO2(g) + H2O(g)Cu2CO3(OH)2(s) + C(s) = 2Cu(s) + 2CO2(g) + H2O(g)
CH3CH3 + O2 = CO2 + H2O2CH3CH3 + 7O2 = 4CO2 + 6H2O
Cu2O(s) + Cu2S(s) = Cu(s) + SO2(g)2Cu2O(s) + Cu2S(s) = 6Cu(s) + SO2(g)
CH3(CH2)2CH3 + O2 = CO2 + H2O2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
Cu2O(s) + C(s) = Cu(s) + CO2(g)2Cu2O(s) + C(s) = 4Cu(s) + CO2(g)
CO(g) + H2O(g) = CO2(g) + H2(g)CO(g) + H2O(g) = CO2(g) + H2(g)
C2H6O+O2=CO2+H2OC2H6O + 3O2 = 2CO2 + 3H2O
C2H6+O=CO+H2OC2H6 + 5O = 2CO + 3H2O
CaCO3 + H3PO4 = CaHPO4 + CO2 + H2OCaCO3 + H3PO4 = CaHPO4 + CO2 + H2O
CH3COOC2H5 = CH3CH2OH + C2H5OH0CH3COOC2H5 = -1CH3CH2OH + C2H5OH
CaCO3 + HCl = CaCl2 + H2O + CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
Cl2 + KI = KCl + ICl2 + 2KI = 2KCl + 2I
CaCO3 + H3PO4 = CO2 + H2O + Ca3(PO4)23CaCO3 + 2H3PO4 = 3CO2 + 3H2O + Ca3(PO4)2
C3H8+ O2 = CO2 + H205C3H8 + 15O2 = 15CO2 + 2H20
CaCO3 +HCl = CaCl2 + CO2 +H2O=CaCO3 + 2HCl = CaCl2 + CO2 + H2O
C + H2 + O = CH2OC + H2 + O = CH2O
CH4 + 2 O2 = CO2 + 2 H2OCH4 + 2O2 = CO2 + 2H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CaCO3+2HCl =CaCl2 +H2O +CO2CaCO3 + 2HCl = CaCl2 + H2O + CO2
CO2 + H2O = C6H12O6 + O26CO2 + 6H2O = C6H12O6 + 6O2
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
CH3CH2OH + 3O2=2CO2+3H2OCH3CH2OH + 3O2 = 2CO2 + 3H2O
C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
CH3OH + O2 = CO2 + H2O2CH3OH + 3O2 = 2CO2 + 4H2O
Ca + O2= CaO2Ca + O2 = 2CaO
CH4 + O2 = CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
Cu2O=Cu+O22Cu2O = 4Cu + O2
CO2+H2=CH4+H2OCO2 + 4H2 = CH4 + 2H2O
CaCO3=CaO + CO2CaCO3 = CaO + CO2
C6H12O6+O2=CO2+H2OC6H12O6 + 6O2 = 6CO2 + 6H2O
C3H8+O2=CO2+H2OC3H8 + 5O2 = 3CO2 + 4H2O
CaCl2+(NH4)2CO3=CaCO3+NH4ClCaCl2 + (NH4)2CO3 = CaCO3 + 2NH4Cl
CaCO3+H3PO4=Ca3(PO4)2+CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
Ca+O2=CaO2Ca + O2 = 2CaO
C2H6 + O2 = CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
C4H10+O2=CO2+H2O2C4H10 + 13O2 = 8CO2 + 10H2O
CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
Cl2(g) + KOH(aq) = KClO3(aq) + KCl(aq) + H2O(l)3Cl2(g) + 6KOH(aq) = KClO3(aq) + 5KCl(aq) + 3H2O(l)
Ca + 2 H2O = Ca(OH)2 + H2Ca + 2H2O = Ca(OH)2 + H2
CO2+H=H2O+CCO2 + 4H = 2H2O + C
C2H2 + O2 =H2O + CO22C2H2 + 5O2 = 2H2O + 4CO2
Cu + 2H2SO4 = CuSO4 + SO2 + 2H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
C+H2SO4=CO2+H2O+SO2C + 2H2SO4 = CO2 + 2H2O + 2SO2
C3H3(NO3)3 = CO2 + H2O + N2 + O24C3H3(NO3)3 = 12CO2 + 6H2O + 6N2 + 3O2
Cu(NO3)2 = CuO + NO2 + O22Cu(NO3)2 = 2CuO + 4NO2 + O2
CrCl3 + AgNO3 = Cr(NO3)3 + AgClCrCl3 + 3AgNO3 = Cr(NO3)3 + 3AgCl
C + Fe2O3 = Fe + CO3C + Fe2O3 = 2Fe + 3CO
C + Fe2O3=Fe + CO3C + Fe2O3 = 2Fe + 3CO
C + Fe2O3=Fe + CO3C + Fe2O3 = 2Fe + 3CO
CaCO3 +(NH4)2HPO4 + H2O = Ca10(PO4)6(OH)2+(NH4)2+ CO2+H2O0CaCO3 + 0(NH4)2HPO4 + H2O = 0Ca10(PO4)6(OH)2 + 0(NH4)2 + 0CO2 + H2O
CH3COOH+NaHCO3= Na(CH3COO)2 +H2O +CO215CH3COOH + 8NaHCO3 = 8Na(CH3COO)2 + 10H2O + 6CO2
Cu + HNO3 = Cu(NO3)2 + NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
CH3OOH + Mg = MgCH3OO + H22CH3OOH + 2Mg = 2MgCH3OO + H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.