Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Br2+O2=Br2O32Br2 + 3O2 = 2Br2O3
Ba(OH)2+FeSO4=BaSO4+Fe(OH)2Ba(OH)2 + FeSO4 = BaSO4 + Fe(OH)2
BCl3+H2O=H3BO3+HClBCl3 + 3H2O = H3BO3 + 3HCl
BCl3+H2O=H3BO3+HClBCl3 + 3H2O = H3BO3 + 3HCl
Ba (C2H3O2)2 + H2SO4 = BaSO4 + CH3COOHBa(C2H3O2)2 + H2SO4 = BaSO4 + 2CH3COOH
BaCl2+Al2(SO4)3=3BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
BaNo3 + NaPO4=NaNo3 +BaPO4BaNo3 + NaPO4 = NaNo3 + BaPO4
BaNo3 + NaPO4=NaNo3 +BaPO4BaNo3 + NaPO4 = NaNo3 + BaPO4
Ba(NO3)2(aq)+KCl(aq) = KNO3(aq) + BaCl2(s)Ba(NO3)2(aq) + 2KCl(aq) = 2KNO3(aq) + BaCl2(s)
Ba(NO3)2(aq)+KCl(aq) = KNO3(aq) + BaCl2(s)Ba(NO3)2(aq) + 2KCl(aq) = 2KNO3(aq) + BaCl2(s)
Ba(s)+Br2(g)=BaBr2(s)Ba(s) + Br2(g) = BaBr2(s)
Ba(s)+Br2(g)=BaBr2(aq)Ba(s) + Br2(g) = BaBr2(aq)
Ba(s)+Br2(g)=BaBr2Ba(s) + Br2(g) = BaBr2
Ba+Br2=BaBr2Ba + Br2 = BaBr2
Ba(s)+HCl(aq)=BaCl+HBa(s) + HCl(aq) = BaCl + H
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Ba(NO3)2+Cr2(SO4)3=BaSO4+Cr(NO3)33Ba(NO3)2 + Cr2(SO4)3 = 3BaSO4 + 2Cr(NO3)3
Br2+KI=I2+KBrBr2 + 2KI = I2 + 2KBr
Ba(OH)2*8H2O(s) + 2 NH4SCN(s) = Ba(SCN)2(s) + 10 H2O(l) + 2 NH3(g)Ba(OH)2*8H2O(s) + 2NH4SCN(s) = Ba(SCN)2(s) + 10H2O(l) + 2NH3(g)
Ba(OH)2 + Li2SO4 = BaSO4 + 2LiOHBa(OH)2 + Li2SO4 = BaSO4 + 2LiOH
Bi+H2O=Bi2O3+H22Bi + 3H2O = Bi2O3 + 3H2
BaCl2(aq)+Na2SO4(aq)=BaSO4(s)+NaCl(aq)BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaCl(aq)
Ba(OH)2(aq)+H2SO4(aq)=BaSO4+2H2OBa(OH)2(aq) + H2SO4(aq) = BaSO4 + 2H2O
BaCl2+Al2 (SO4)3=BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
Br2(aq) + CaCl2(aq) = BrCl2 +CaBr2(aq) + 2CaCl2(aq) = 2BrCl2 + 2Ca
B2H6(l)+O2(g)=B2O3(s)+H2O(l)B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
BaCl+S8=BaS+Cl28BaCl + S8 = 8BaS + 4Cl2
BaCl2+Al2(SO4)3=3BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Ba(NO3)2(aq)+K2SO4(aq)=BaSO4+2KNO3Ba(NO3)2(aq) + K2SO4(aq) = BaSO4 + 2KNO3
BaCl2 + AgNO3 = AgCl + Ba(NO3)2 BaCl2 + 2AgNO3 = 2AgCl + Ba(NO3)2
Br2(g) + LiF(aq) = LiBr(aq) + F2(g)Br2(g) + 2LiF(aq) = 2LiBr(aq) + F2(g)
BaO+O2=BaO22BaO + O2 = 2BaO2
Ba+Na2SO4=BaSO4+NaBa + Na2SO4 = BaSO4 + 2Na
Ba+ S= BaSBa + S = BaS
Bi(OH)3 + Na2SnO2 =Bi + Na2SnO3 + H2O2Bi(OH)3 + 3Na2SnO2 = 2Bi + 3Na2SnO3 + 3H2O
BaO+O2=BaO22BaO + O2 = 2BaO2
Ba(C2H3O2)2(aq) + K2SO4(aq) =BaSO4(s) + KC2H3O2(aq)Ba(C2H3O2)2(aq) + K2SO4(aq) = BaSO4(s) + 2KC2H3O2(aq)
Ba3(PO4)2 + 6HCl = 3BaCl2 + 2H3PO4Ba3(PO4)2 + 6HCl = 3BaCl2 + 2H3PO4
Ba3(PO4)2 + 6HCl = 3BaCl2 + 2H3PO4Ba3(PO4)2 + 6HCl = 3BaCl2 + 2H3PO4
Ba(OH) 2 + HCl =BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
BrF3=Br+FBrF3 = Br + 3F
BaCl2+Na3PO4=Ba3(PO4)2+NaCl3BaCl2 + 2Na3PO4 = Ba3(PO4)2 + 6NaCl
B2O3 + Mg = 3MgO + 2BB2O3 + 3Mg = 3MgO + 2B
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + NaCl(aq)BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaCl(aq)
Ba(OH)2(s) + 2 HCl(aq) = BaCl2(aq) + 2 H2O(l)Ba(OH)2(s) + 2HCl(aq) = BaCl2(aq) + 2H2O(l)
BrO3- + I- + H+ = Br- +I2 = H2OBrO3- + 6I- + 6H+ = Br- + 3I2 + 3H2O
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Br2+NaCO3=NaBr+NaBrO3+CO23Br2 + 6NaCO3 = 4NaBr + 2NaBrO3 + 6CO2
BaO+O2=BaO22BaO + O2 = 2BaO2
BCl3(g)+H2(g)=HCl(g)+B(s)2BCl3(g) + 3H2(g) = 6HCl(g) + 2B(s)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2 + AgNO3 = Ba(NO3)2 + 2AgClBaCl2 + 2AgNO3 = Ba(NO3)2 + 2AgCl
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
Bi + NH3 + H2O = Bi(OH)3 + NH4Bi + 3NH3 + 3H2O = Bi(OH)3 + 3NH4
B2H6(l)+O2(g)=B2O3(s)+H2O(l)B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
Ba(s) + Br2(l) = BaBr2(s)Ba(s) + Br2(l) = BaBr2(s)
BaO+O2=BaO22BaO + O2 = 2BaO2
BaO+ O2 =BaO22BaO + O2 = 2BaO2
BaO+ O2= BaO22BaO + O2 = 2BaO2
Ba(No3)2+K2Co3=BaCo3+KNo3Ba(No3)2 + K2Co3 = BaCo3 + 2KNo3
Ba(NO3)2+KBr= BaBr2+KNO3Ba(NO3)2 + 2KBr = BaBr2 + 2KNO3
Ba(No3)2+FeCl3=BaCl2+Fe(No3)33Ba(No3)2 + 2FeCl3 = 3BaCl2 + 2Fe(No3)3
B+I=B2I62B + 6I = B2I6
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaO2+ZnCO3=BaCO3+ZnO2BaO2 + ZnCO3 = BaCO3 + ZnO2
BaO2+FeSO4=BaSO4+FeO2BaO2 + FeSO4 = BaSO4 + FeO2
BaO2+B(PO4)=Ba(PO4)+BO2BaO2 + B(PO4) = Ba(PO4) + BO2
B + S8 = B2S316B + 3S8 = 8B2S3
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Be2C+H2O=Be(OH)2+CH4 Be2C + 4H2O = 2Be(OH)2 + CH4
Ba(OH)2(aq) + CO2(g) = BaCO3(s) + H2O(l)Ba(OH)2(aq) + CO2(g) = BaCO3(s) + H2O(l)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Br2 + KOH = KBr + KBrO3 + H2O3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
BaCl2 (aq) + AgNO3 (aq) = AgCl (s) + Ba(NO3)2 (aq)BaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ba(NO3)2(aq)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaO+H2O=Ba(OH)2BaO + H2O = Ba(OH)2
B(OH)3 + H2O = B(OH)4 +H3OB(OH)3 + 2H2O = B(OH)4 + H3O
B(OH)3 + H2O = B(OH)4 +H3OB(OH)3 + 2H2O = B(OH)4 + H3O
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba(NO3)2 + Na2SO4 = BaSO4 + NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BaCO3 + C + H2O = CO + Ba(OH)2BaCO3 + C + H2O = 2CO + Ba(OH)2
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
Bi2S3+ O2 = Bi2O3 + SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
Ba(NO3)2+Li3PO4=Ba3(PO4)2+LiNO33Ba(NO3)2 + 2Li3PO4 = Ba3(PO4)2 + 6LiNO3
B2S3=B+SB2S3 = 2B + 3S
Ba(OH)2(s)+H2SO4(aq)=BaSO4(s)+H2O(l)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
Br+NaI=NaBr+I22Br + 2NaI = 2NaBr + I2
BeO+HNO2=Be (NO2)2+H2OBeO + 2HNO2 = Be(NO2)2 + H2O
Ba (OH)2+H3PO4=Ba3 (PO4)2+H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
Ba(ClO3)2+K2SO4=BaSO4+KClO3Ba(ClO3)2 + K2SO4 = BaSO4 + 2KClO3
Bi(s) + H2O(l) = Bi3O4(s) + H2(g)3Bi(s) + 4H2O(l) = Bi3O4(s) + 4H2(g)
Br2+H2O+SO2=HBr+H2SO4Br2 + 2H2O + SO2 = 2HBr + H2SO4
Ba(OH)2 + H2SO4 = H2O + BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
BaCl2 + H2SO4 = BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
B2S3 + H2O = H3BO3 + H2SB2S3 + 6H2O = 2H3BO3 + 3H2S
Ba(OH)2(s)+H2SO4(aq)=BaSO4(s)+H2O(l)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
Ba(NO3)2(aq) + LiOH(aq) = Ba(OH)2(aq) + Li(NO3)(aq)Ba(NO3)2(aq) + 2LiOH(aq) = Ba(OH)2(aq) + 2Li(NO3)(aq)
Ba(NO3)2(aq) + LiOH(aq) = Ba(OH)2(aq) + Li(NO3)(aq)Ba(NO3)2(aq) + 2LiOH(aq) = Ba(OH)2(aq) + 2Li(NO3)(aq)
Ba(NO3)2(aq) + LiOH(aq) = Ba(OH)2(aq) + Li(NO3)(aq)Ba(NO3)2(aq) + 2LiOH(aq) = Ba(OH)2(aq) + 2Li(NO3)(aq)
BaO+O2=BaO2 2BaO + O2 = 2BaO2
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba(OH)2(s)+H2SO4(aq)=BaSO4(s)+H2O(l)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaO+SO3=BaSO4BaO + SO3 = BaSO4
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(NO3)2 + Na2SO4 = BaSO4 +NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 +NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(s)+CO3(aq)=BaO(aq)+CO2(g)Ba(s) + CO3(aq) = BaO(aq) + CO2(g)
Ba+CO3=BaO+CO2Ba + CO3 = BaO + CO2
Bi(s) + H2O(l) = Bi3O4(s) + H2(g)3Bi(s) + 4H2O(l) = Bi3O4(s) + 4H2(g)
Bi(s) + H2O(l) = Bi3O4(s) + H2(g)3Bi(s) + 4H2O(l) = Bi3O4(s) + 4H2(g)
B+I2 = BI32B + 3I2 = 2BI3
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
B+NaS=Na+B2S32B + 3NaS = 3Na + B2S3
Br2+I2=IBr33Br2 + I2 = 2IBr3
BaCl2 + H2SO4 = BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Br2(l)+I(s)=IBr33Br2(l) + 2I(s) = 2IBr3
BaCl2+2KIO3=Ba(IO3)2+2KClBaCl2 + 2KIO3 = Ba(IO3)2 + 2KCl
BeF2 + H2O = Be(OH)2 + HFBeF2 + 2H2O = Be(OH)2 + 2HF
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Ba(NO3)2 + Li3PO4 = LiNO3 + Ba3(PO4)2 3Ba(NO3)2 + 2Li3PO4 = 6LiNO3 + Ba3(PO4)2
Br2 + Al = AlBr33Br2 + 2Al = 2AlBr3
Ba(OH)2 + HNO3 = Ba(NO3)2 + H2OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
BaO2 = BaO + O22BaO2 = 2BaO + O2
Ba+Br2= BaBr2Ba + Br2 = BaBr2
BrCl2 +2H2O + NaOH = BrOH + NaCl2BrCl2 + 0H2O + NaOH = BrOH + NaCl2
B(NO3)3 + K2SO4 = B2(SO4)3 + KNO32B(NO3)3 + 3K2SO4 = B2(SO4)3 + 6KNO3
Br2 + H2O + SO2 = HBr + H2SO4Br2 + 2H2O + SO2 = 2HBr + H2SO4
B(OH)3+H2O=B(OH)4+H3OB(OH)3 + 2H2O = B(OH)4 + H3O
Ba(OH)2(s)+H2SO4(aq)=BaSO4(s)+H2O(l)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
Ba(HCO3)2 + 2HCl = BaCl2 + 2H2O + CO2Ba(HCO3)2 + 2HCl = BaCl2 + 2H2O + 2CO2
BaCl2+Na2SO4=BaSO4+ NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(OH)2+Na = NaOH+BaBa(OH)2 + 2Na = 2NaOH + Ba
B2O3=B + O22B2O3 = 4B + 3O2
B + O2 = B2O34B + 3O2 = 2B2O3
BN =B+N22BN = 2B + N2
Ba2+ +2e= 2BaBa2+ + e = 2Ba
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
Ba(NO3)2 + Na2SO4 = BaSO4 + NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(NO3)2+Na2SO4=BaSO4+NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BaCl2 + Na2SO4 = BaSO4 +NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(C2O4) + K(IO3) = Ba(IO3)2 + K2(C2O4)Ba(C2O4) + 2K(IO3) = Ba(IO3)2 + K2(C2O4)
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(CN)2+H2SO4 = BaSO4+HCNBa(CN)2 + H2SO4 = BaSO4 + 2HCN
Ba(CN)2+H2SO4=BaSO4+HCNBa(CN)2 + H2SO4 = BaSO4 + 2HCN
Ba(CN)2+H2SO4=BaSO4+HCNBa(CN)2 + H2SO4 = BaSO4 + 2HCN
Br2(g)+C(s)+H2(g)=CH2Br2(l)Br2(g) + C(s) + H2(g) = CH2Br2(l)
Ba(ClO3)2 = BaCl2 + 3O2Ba(ClO3)2 = BaCl2 + 3O2
BaBr2 (aq)+(NH4)2SO4 (aq)=BaSO4 (s)+2NH4Br (aq)BaBr2(aq) + (NH4)2SO4(aq) = BaSO4(s) + 2NH4Br(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Br2 + KOH = KBr + KBrO3 + H2O3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
BaCl2 + Na2SO4 = BaSO4 + 2NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaI2+AgNO3=BaNO3+AgI2BaI2 + AgNO3 = BaNO3 + AgI2
B2O3 + NaOH = Na3BO3 + H2OB2O3 + 6NaOH = 2Na3BO3 + 3H2O
B2S3=B+SB2S3 = 2B + 3S
Ba(OH)2+AlCl3=Al(OH)3+BaCl23Ba(OH)2 + 2AlCl3 = 2Al(OH)3 + 3BaCl2
B2S3 = B+SB2S3 = 2B + 3S
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(OH)2(s)+H2SO4(aq)=BaSO4(s)+H2O(l)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
BaCl2+H3PO4=Ba3(PO4)2+HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BaI2 + Na3PO4 = Ba3(PO4)2 + NaI3BaI2 + 2Na3PO4 = Ba3(PO4)2 + 6NaI
Ba(OH)2+HNO3 =Ba(NO3)2+H2OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Ba(OH)2+HNO3 =Ba(NO3)2+H2OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Ba(OH)2+HNO3 =Ba(NO3)2+H2OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba3(PO4)2+H3PO4=Ba(H2PO4)2Ba3(PO4)2 + 4H3PO4 = 3Ba(H2PO4)2
Ba(NO3)2 + Na2CrO4= BaCrO4 + NaNO3Ba(NO3)2 + Na2CrO4 = BaCrO4 + 2NaNO3
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF + KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
BaF +KSO4 = KF + BaSO4BaF + KSO4 = KF + BaSO4
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba + O2 = BaO4Ba + 2O2 = BaO4
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba(OH)2 + H2SO4= BaSO4 + 2H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
BaCl2 + H2O2 = BaO2+HClBaCl2 + H2O2 = BaO2 + 2HCl
BaCl2 + H2O2 = BaO2+HClBaCl2 + H2O2 = BaO2 + 2HCl
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaCl2 (aq) + 2NaHCO3(aq) = Ba(HCO3)2 (aq)+ 2NaCl(s)BaCl2(aq) + 2NaHCO3(aq) = Ba(HCO3)2(aq) + 2NaCl(s)
BaCl2 (aq) + 2NaHCO3(aq) = Ba(HCO3)2 (s)+ 2NaCl(aq)BaCl2(aq) + 2NaHCO3(aq) = Ba(HCO3)2(s) + 2NaCl(aq)
Be2C + H2O = Be(OH)2 + CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Ba(NO3)2(aq)+Na2SO4(aq) = BaSO4(s)+NaNO3(aq)Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaNO3(aq)
Bi2(SO4)5 + As4C3 = As2(SO4)3+Bi4C5 6Bi2(SO4)5 + 5As4C3 = 10As2(SO4)3 + 3Bi4C5
Bi + H2O = Bi3O4 + H23Bi + 4H2O = Bi3O4 + 4H2
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq) Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
Ba(OH)2 + HNO3 =Ba(NO3)2 + H2OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq) Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaBr2 +MgSO4 = BaSO4 + Br2MgBaBr2 + MgSO4 = BaSO4 + Br2Mg
BaBr2 +MgSO4 = BaSO4 Br2MgBaBr2 + MgSO4 = BaSO4Br2Mg
Br2 + N2O + H2O = HNO3 + BrBr2 + 0N2O + 0H2O = 0HNO3 + 2Br
BaCl2(aq)+Al2(SO4)3(aq)=3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
BN=B+N22BN = 2B + N2
BN=B+N22BN = 2B + N2
BN=B+N22BN = 2B + N2
BN=B+NBN = B + N
BaCl2(aq)+Na2SO4(aq)=BaSO4(s)+NaCl(aq)BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaCl(aq)
Br2+NH3+NaOH=NaBr+N2+H2O3Br2 + 2NH3 + 6NaOH = 6NaBr + N2 + 6H2O
Ba(NO3)2 + Na3PO4 = Ba3(PO4)2 + 6NaNO33Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaNO3
Bi(NO3)3*5 H2O + H2O2 + RuCl3 +NaOH = Bi2Ru2O7 + NaNO3 + NaCl + H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Bi(NO3)3*5 H2O + H2O2 + RuCl3 +NaOH = Bi2Ru2O7 + NaNO3 + NaCl + H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaCO3(s)=BaO(s)+CO2(g)BaCO3(s) = BaO(s) + CO2(g)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Be2C  +  H2O  =  Be(OH)2  +  CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Be2C  +  H2O  = Be(OH)2  +  CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
BaCl2(aq)+K2SO4(aq)=KCl(aq)+BaSO4(s)BaCl2(aq) + K2SO4(aq) = 2KCl(aq) + BaSO4(s)
Ba3P2 = Ba + P42Ba3P2 = 6Ba + P4
BaCl2+H3PO4=Ba3(PO4)2+HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BaCl2 + Na2SO4 = NaCl + BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
B(OH)3(aq) + 3 HCl(aq) = BCl3(aq) + 3 H2O(l)B(OH)3(aq) + 3HCl(aq) = BCl3(aq) + 3H2O(l)
Bi(s) + H2O(l) = Bi3O4(s) + H2(g)3Bi(s) + 4H2O(l) = Bi3O4(s) + 4H2(g)
Ba(OH)2+H3PO4=Ba3(PO4)2+H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(NO3)2 (aq) + Na2SO4 (aq) = BaSO4 (s) + 2 NaNO3 (aq)Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaNO3(aq)
Bi(NO3)3 + KI = BiI3 + KNO3Bi(NO3)3 + 3KI = BiI3 + 3KNO3
Bi2O3+NaOH+NaClO=NaBiO3+NaCl+H2OBi2O3 + 2NaOH + 2NaClO = 2NaBiO3 + 2NaCl + H2O
Ba(NO3)2+H2O=Ba(OH)2+HNO3Ba(NO3)2 + 2H2O = Ba(OH)2 + 2HNO3
Bi(NO3)3+H2S=Bi2S3+HNO32Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3
Ba(OH)2 (aq)+ 2HCl (aq) = BaCl2 + 2H2OBa(OH)2(aq) + 2HCl(aq) = BaCl2 + 2H2O
Bi2(SO4)3 + Ca(CrO4) = Ca(SO4) + Bi2(CrO4)3Bi2(SO4)3 + 3Ca(CrO4) = 3Ca(SO4) + Bi2(CrO4)3
BaCl 2 (aq)+ H 3 PO 4 (aq)=Ba 3 ( PO 4 ) 2 (s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Br2 + Cl2 = BrClBr2 + Cl2 = 2BrCl
Br + Cl = BrClBr + Cl = BrCl
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2(aq) + K2SO4(aq)= BaSO4(s)+ 2KCl(aq)BaCl2(aq) + K2SO4(aq) = BaSO4(s) + 2KCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(NO3)2+H2 SO4=BaSO4+HNO3Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
B2O3+C=B4C+CO2B2O3 + 7C = B4C + 6CO
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2 + Na2SO4 = NaCl + BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
Ba(OH)2 + HPO3 = Ba(H2PO4)2Ba(OH)2 + 2HPO3 = Ba(H2PO4)2
Bi(C2H3O2)5+H2Co3=Bi2(Co3)5+HC2H3O22Bi(C2H3O2)5 + 5H2Co3 = Bi2(Co3)5 + 10HC2H3O2
BaCl2 + Na2SO4 = BaSO4 + NaCl BaCl2 + Na2SO4 = BaSO4 + 2NaCl
B2S3=B+SB2S3 = 2B + 3S
B2S3=B+SB2S3 = 2B + 3S
BCl3(g) + H2O(l) = B(OH)3(aq) + HCl(aq)BCl3(g) + 3H2O(l) = B(OH)3(aq) + 3HCl(aq)
BaCO3+H2SO4=BaSO4+H2CO3BaCO3 + H2SO4 = BaSO4 + H2CO3
Ba(OH)2(aq) + 2 HCl(aq) = BaCl2(aq) + 2 H2O(l)Ba(OH)2(aq) + 2HCl(aq) = BaCl2(aq) + 2H2O(l)
Bi2S3 + HNO3 = Bi(NO3)3 + SO2 + NO + H2OBi2S3 + 12HNO3 = 2Bi(NO3)3 + 3SO2 + 6NO + 6H2O
BaCl2+Al2(SO4)3=BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Bi + NH3 + H2O = Bi(OH)3 + NH4Bi + 3NH3 + 3H2O = Bi(OH)3 + 3NH4
B(OH)3(s) + CH3OH(l) = B(OCH3)3(s) + H2O(l)B(OH)3(s) + 3CH3OH(l) = B(OCH3)3(s) + 3H2O(l)
B(OH)3(s) + CH3OH(l) = B(OCH3)3(s) + H2O(l)B(OH)3(s) + 3CH3OH(l) = B(OCH3)3(s) + 3H2O(l)
B2Br6+12HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(ClO3)2(aq) + Na2S(aq) = BaS(s) + NaClO3(aq)Ba(ClO3)2(aq) + Na2S(aq) = BaS(s) + 2NaClO3(aq)
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2(aq) + CuSO4 (aq) = BaSO4 (s) + CuCl2(aq)BaCl2(aq) + CuSO4(aq) = BaSO4(s) + CuCl2(aq)
BaCl2 (aq) + SrI2 (aq) = BaI2 (aq) + SrCl2 (aq)BaCl2(aq) + SrI2(aq) = BaI2(aq) + SrCl2(aq)
BaO2 + 2 HCl = BaCl2 + H2O2BaO2 + 2HCl = BaCl2 + H2O2
Be2C + H2O = CH4 + Be(OH)2Be2C + 4H2O = CH4 + 2Be(OH)2
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(NO3)2+H2SO4=BaSO4+HNO3Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
BeCl2(aq)+2AgNO3(aq) = Be(NO3)2 (aq)+ 2AgCl (s)BeCl2(aq) + 2AgNO3(aq) = Be(NO3)2(aq) + 2AgCl(s)
BaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ba(NO3)2(aq)BaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ba(NO3)2(aq)
B2O6 + NaBH4 = Na3B12H12 + O29B2O6 + 6NaBH4 = 2Na3B12H12 + 27O2
BaO2 + HCl = BaCl2 + H2O2BaO2 + 2HCl = BaCl2 + H2O2
Ba(OH)2=BaO+H2OBa(OH)2 = BaO + H2O
Bi(NO3)3 + H2S = Bi2S3 + HNO32Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3
Br2 (l)+I2 (s)=IBr3 (g)3Br2(l) + I2(s) = 2IBr3(g)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaO+SO2=BaSO3BaO + SO2 = BaSO3
Br2+O2=Br2O52Br2 + 5O2 = 2Br2O5
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba3P2 + NaBrO3 = Na3P + Ba(BrO3)2Ba3P2 + 6NaBrO3 = 2Na3P + 3Ba(BrO3)2
Ba+NO3=BaNO3Ba + NO3 = BaNO3
BCl3+H2O=B(OH)3+HClBCl3 + 3H2O = B(OH)3 + 3HCl
Ba(OH)2=BaO + HOHBa(OH)2 = BaO + HOH
Be(SCN)2 + Pb3(PO4)2= Pb(SCN)2 + Be3(PO4)23Be(SCN)2 + Pb3(PO4)2 = 3Pb(SCN)2 + Be3(PO4)2
Ba(C2O4)+K(IO3)= Ba(IO3)2+ K2(C2O4)Ba(C2O4) + 2K(IO3) = Ba(IO3)2 + K2(C2O4)
Ba+Cl= BaClBa + Cl = BaCl
BiPO + Au = AuO + PBiBiPO + Au = AuO + PBi
BiPO + Au = AuO + PBiBiPO + Au = AuO + PBi
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaCl2(aq)+Na2SO4(aq)=BaSO4(s)+NaCl(aq)BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaCl(aq)
B5H9+O2 = B2O3+H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
BaO+H2O=Ba(OH)2BaO + H2O = Ba(OH)2
BeF + H2 = HF + Be2BeF + H2 = 2HF + 2Be
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(OH) + HCl = BaCl + H2OBa(OH) + HCl = BaCl + H2O
BaCO3 + H2SO4= BaSO4 + H2CO3BaCO3 + H2SO4 = BaSO4 + H2CO3
Ba(OH)2(aq)+Fe2(SO4)3(aq)=Fe(OH)3(s)+BaSO4(s)3Ba(OH)2(aq) + Fe2(SO4)3(aq) = 2Fe(OH)3(s) + 3BaSO4(s)
Ba(OH)2 + HI = BaI2 + H2OBa(OH)2 + 2HI = BaI2 + 2H2O
Br2+NaI= NaBr+ I2Br2 + 2NaI = 2NaBr + I2
BCl3 + H2O = B(OH)3 + HClBCl3 + 3H2O = B(OH)3 + 3HCl
Ba(s)+HCl(aq)=BaCl2(aq)+H2(g)Ba(s) + 2HCl(aq) = BaCl2(aq) + H2(g)
BaCl2(aq) + Na2SO4 = 2NaCl(aq) + BaSO4(s)BaCl2(aq) + Na2SO4 = 2NaCl(aq) + BaSO4(s)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(OH)2 (aq)+H2SO4 (aq)=BaSO4+H2OBa(OH)2(aq) + H2SO4(aq) = BaSO4 + 2H2O
Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Bi +NH3 + H2O = Bi(OH)3 + NH4Bi + 3NH3 + 3H2O = Bi(OH)3 + 3NH4
Ba(ClO4)2 + Na2S= BaS +NaCl +O2Ba(ClO4)2 + Na2S = BaS + 2NaCl + 4O2
Ba + H2O = BaOH + H22Ba + 2H2O = 2BaOH + H2
Ba(OH)2 + H2SO4= 2H2O+ BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
Ba(OH)2 + H2SO4= 2H2O+ BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Be2C + H2O = Be(OH)2 + CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Be2C + H2O = Be(OH)2 + CH4Be2C + 4H2O = 2Be(OH)2 + CH4
BaCO3(aq) + HNO3(aq) = Ba(NO3)2(s) + CO2(g)+ H2O(l)BaCO3(aq) + 2HNO3(aq) = Ba(NO3)2(s) + CO2(g) + H2O(l)
BaCl2(aq)+K2CrO4(aq)=BaCrO4(s)+2KCl(aq)BaCl2(aq) + K2CrO4(aq) = BaCrO4(s) + 2KCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(NO3)2+H3PO4 = Ba3(PO4)2+HNO33Ba(NO3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNO3
BaBr2(aq)+H2SO4(aq)=BaSO4(s)+2HBr(aq)BaBr2(aq) + H2SO4(aq) = BaSO4(s) + 2HBr(aq)
Ba + O2 = BaO2Ba + O2 = 2BaO
BaO +HNO3 = Ba(NO3)2 + H2OBaO + 2HNO3 = Ba(NO3)2 + H2O
BaCl2(aq) + AgNO3(aq) = AgCl(s) + Ba(NO3)2(aq)BaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ba(NO3)2(aq)
BaS+Na2SO4=BaSO4+Na2SBaS + Na2SO4 = BaSO4 + Na2S
Br2 + KI = I2 + KBrBr2 + 2KI = I2 + 2KBr
BaO +Fe(MnO4)3 =Fe2O3 + Ba(MnO4)23BaO + 2Fe(MnO4)3 = Fe2O3 + 3Ba(MnO4)2
BaO2= BaO+ O22BaO2 = 2BaO + O2
BaO2 + HCl = BaCl2 + H2O2BaO2 + 2HCl = BaCl2 + H2O2
Ba(OH)2 + H3Po4 = Ba3(Po4)2 + H2O3Ba(OH)2 + 2H3Po4 = Ba3(Po4)2 + 6H2O
Ba(OH)2 + H3Po4 = Ba3(Po4)2 + H2O3Ba(OH)2 + 2H3Po4 = Ba3(Po4)2 + 6H2O
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BrO3- + 6H3O+ + 2S2O3- = Br- + 9H2O + S4O6-BrO3- + 6H3O+ + 12S2O3- = Br- + 9H2O + 6S4O6-
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba3P2 + NaBrO3 = Na3P + Ba(BrO3)2Ba3P2 + 6NaBrO3 = 2Na3P + 3Ba(BrO3)2
Bi + NH3 + H2O = Bi(OH)3 + NH4Bi + 3NH3 + 3H2O = Bi(OH)3 + 3NH4
BaCO3(aq) + HNO3(aq) = Ba(NO3)2(s) + CO2(g)+ H2O(l)BaCO3(aq) + 2HNO3(aq) = Ba(NO3)2(s) + CO2(g) + H2O(l)
BaCl2 (aq) + SrI2 (aq) = BaI2 (aq) + SrCl2 (aq)BaCl2(aq) + SrI2(aq) = BaI2(aq) + SrCl2(aq)
Ba(OH)2(aq)+K2SO4(aq)=KOH(aq)+BaSO4(s)Ba(OH)2(aq) + K2SO4(aq) = 2KOH(aq) + BaSO4(s)
Ba3N2 + HF = BaF2 + NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BaSO4 + K3PO4 = Ba3(PO4)2 + K2SO43BaSO4 + 2K3PO4 = Ba3(PO4)2 + 3K2SO4
Br2(l) + KI(aq) = I2(aq) + KBr(aq)Br2(l) + 2KI(aq) = I2(aq) + 2KBr(aq)
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba(OH)2(aq)+K2SO4(aq)=KOH(aq)+BaSO4(s)Ba(OH)2(aq) + K2SO4(aq) = 2KOH(aq) + BaSO4(s)
Br+ZnI2=ZnBr2+I2Br + ZnI2 = ZnBr2 + 2I
Br+ZnI2=ZnBr2+I2Br + ZnI2 = ZnBr2 + 2I
Be + H2O = BeOH + H22Be + 2H2O = 2BeOH + H2
Ba(s) + HCl(aq) = BaCl2(aq) + H2(g)Ba(s) + 2HCl(aq) = BaCl2(aq) + H2(g)
B2O3 + 3Mg = MgO + 2BB2O3 + 3Mg = 3MgO + 2B
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BrO=Br2+O22BrO = Br2 + O2
BrO=Br2+O22BrO = Br2 + O2
Bi2S3+O2=Bi2O3+3SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
Ba(OH)2+HI=BaI2+H2OBa(OH)2 + 2HI = BaI2 + 2H2O
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba(s) + O2(g)= 2BaO2Ba(s) + O2(g) = 2BaO
Ba + S = BaSBa + S = BaS
B2O3 + C = B4C3 + CO22B2O3 + 6C = B4C3 + 3CO2
Ba+H2O=Ba(OH)2+H2Ba + 2H2O = Ba(OH)2 + H2
Ba(ClO3)2=BaCl2+O2Ba(ClO3)2 = BaCl2 + 3O2
Ba(OH)2(aq)+K2SO4(aq)=KOH(aq)+BaSO4(s)Ba(OH)2(aq) + K2SO4(aq) = 2KOH(aq) + BaSO4(s)
Br2 + H2O + SO2 = HBr + H2SO4Br2 + 2H2O + SO2 = 2HBr + H2SO4
B2O3(s) + NaOH(aq) = Na3BO3(aq) + H2O(l)B2O3(s) + 6NaOH(aq) = 2Na3BO3(aq) + 3H2O(l)
BaO+H2SO4=BaSO4+H2OBaO + H2SO4 = BaSO4 + H2O
Ba(OH)2(aq) + H2SO4(aq) = BaSO4(s) + H2O(l)Ba(OH)2(aq) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
Br2 + CaI2 = CaBr2 + I2 Br2 + CaI2 = CaBr2 + I2
Ba(HCO3)2  = BaCO3  +  H2O  +  CO2Ba(HCO3)2 = BaCO3 + H2O + CO2
BCl3(g) + H2O(l) = B(OH)3(aq) + HCl(aq)BCl3(g) + 3H2O(l) = B(OH)3(aq) + 3HCl(aq)
B+O2=B2O34B + 3O2 = 2B2O3
Ba(NO3)2+K2SO4=KNO3+BaSO4Ba(NO3)2 + K2SO4 = 2KNO3 + BaSO4
Ba(OH)2+H3PO4=BaHPO4+H2OBa(OH)2 + H3PO4 = BaHPO4 + 2H2O
B2S3+H2O=H3BO3+H2SB2S3 + 6H2O = 2H3BO3 + 3H2S
Br2 + PbO2 = PbBr4 + O22Br2 + PbO2 = PbBr4 + O2
Bi(NO3)3+NaOH=Bi(OH)3+NaNO3Bi(NO3)3 + 3NaOH = Bi(OH)3 + 3NaNO3
BaCl2+H3PO4=Ba3(PO4)2+HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BaBr2 = Ba + BrBaBr2 = Ba + 2Br
BaSO4+K3PO4=Ba3(PO4)2+K2SO43BaSO4 + 2K3PO4 = Ba3(PO4)2 + 3K2SO4
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2(s)+O2(g)=Ba(ClO3)2(s)BaCl2(s) + 3O2(g) = Ba(ClO3)2(s)
Ba(OH)2 + H2SO4 = H2O + BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
BaCl2 + NaOH= Ba(OH)2+NaClBaCl2 + 2NaOH = Ba(OH)2 + 2NaCl
B5H9+O2=B2O3+H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BeCl + BaSO3 = BeSO3 + BaClBeCl + BaSO3 = BeSO3 + BaCl
Br+LiI=LiBr+IBr + LiI = LiBr + I
BaSO4 + Li = Li2SO4 + Ba22BaSO4 + 4Li = 2Li2SO4 + Ba2
BaSO4 + Li = LiSO4 + Ba22BaSO4 + 2Li = 2LiSO4 + Ba2
Ba + Br = BaBr2Ba + 2Br = BaBr2
Ba + Br = BaBr2Ba + 2Br = BaBr2
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba + 2H2O = Ba(OH)2 + H2Ba + 2H2O = Ba(OH)2 + H2
Ba(OH)2(aq) + H2SO4(aq) = BaSO4(s) + 2 H2O(l)Ba(OH)2(aq) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
Be+NaOH=Be(OH)2+NaBe + 2NaOH = Be(OH)2 + 2Na
Ba(NO3)2 + Mg = Ba(NO)2 + MgOBa(NO3)2 + 4Mg = Ba(NO)2 + 4MgO
Ba(NO3)2+2NH2SO3H+2H20=1Ba(NH2)2+2H2SO4+2HNO310Ba(NO3)2 + 15NH2SO3H + 2H20 = 10Ba(NH2)2 + 15H2SO4 + 15HNO3
Ba3P2+LiBr=BaBr2+Li3PBa3P2 + 6LiBr = 3BaBr2 + 2Li3P
Ba3P2+LiBr=BaBr2+Li3PBa3P2 + 6LiBr = 3BaBr2 + 2Li3P
Ba3P2+LiBr=BaBr2+Li3PBa3P2 + 6LiBr = 3BaBr2 + 2Li3P
Ba(OH)2+H3PO4=H2O+Ba+PO43Ba(OH)2 + 2H3PO4 = 6H2O + 3Ba + 2PO4
Ba(OH)2 + H3PO4 = H2O + Ba2 + PO43162Ba(OH)2 + 4H3PO4 = 168H2O + 81Ba2 + 4PO43
Ba(OH)2+H3PO4=H2O+Ba+PO43Ba(OH)2 + 2H3PO4 = 6H2O + 3Ba + 2PO4
Bi + Cu3(PO4)2=Bi3(PO4)3 + Cu36Bi + 3Cu3(PO4)2 = 2Bi3(PO4)3 + 3Cu3
Bi + Cu3(PO4)2=Bi(PO4)+ Cu32Bi + Cu3(PO4)2 = 2Bi(PO4) + Cu3
Bi + Cu3(PO4)2=Bi3(PO4)3 + Cu36Bi + 3Cu3(PO4)2 = 2Bi3(PO4)3 + 3Cu3
Ba(OH)2+H3PO4=H2O+Ba+PO43Ba(OH)2 + 2H3PO4 = 6H2O + 3Ba + 2PO4
Ba(OH)2+H3PO4=H2O+Ba+PO43Ba(OH)2 + 2H3PO4 = 6H2O + 3Ba + 2PO4
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2+Na2SO4=NaCl+BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
Ba +Sn(SO4)2 = BaSO4 + Sn2Ba + Sn(SO4)2 = 2BaSO4 + Sn
Ba +Sn(SO4)2 = BaSO4 + Sn2Ba + Sn(SO4)2 = 2BaSO4 + Sn
Ba(NO2)2+Pb(SO4)2=Ba(SO4)2+Pb(NO2)2Ba(NO2)2 + Pb(SO4)2 = Ba(SO4)2 + Pb(NO2)2
Ba + Pb(NO3)2=Pb + Ba(NO3)2 Ba + Pb(NO3)2 = Pb + Ba(NO3)2
Ba(OH)2 + H3PO4= H2O + Ba + PO43Ba(OH)2 + 2H3PO4 = 6H2O + 3Ba + 2PO4
BaBr2 + K2CO3 = BaCO3 + 2KBrBaBr2 + K2CO3 = BaCO3 + 2KBr
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(OH)2(aq)+H3PO4(aq)=H2O(l)+Ba(aq)+PO4(aq)3Ba(OH)2(aq) + 2H3PO4(aq) = 6H2O(l) + 3Ba(aq) + 2PO4(aq)
Ba(OH)2(aq) + H3PO4(aq) = H2O(l) + Ba(aq) + PO4(aq)3Ba(OH)2(aq) + 2H3PO4(aq) = 6H2O(l) + 3Ba(aq) + 2PO4(aq)
Ba(ClO4)2 = BaCl2 + O2Ba(ClO4)2 = BaCl2 + 4O2
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
Ba(OH)2+2H3PO4=H2O+Ba+PO43Ba(OH)2 + 2H3PO4 = 6H2O + 3Ba + 2PO4
BaBr2+Mg=Ba+MgBr2BaBr2 + Mg = Ba + MgBr2
BF3 + NaH = NaBF4 + B2H68BF3 + 6NaH = 6NaBF4 + B2H6
BF3 + NaH = NaBF4 + B2H68BF3 + 6NaH = 6NaBF4 + B2H6
Ba(C2O4) + K(IO3) = Ba(IO3)2 + K2(C2O4)Ba(C2O4) + 2K(IO3) = Ba(IO3)2 + K2(C2O4)
Ba(OH)2 + H3PO4 = BaHPO4 + H2OBa(OH)2 + H3PO4 = BaHPO4 + 2H2O
BaCl2 + 2NaHCO3 = Ba(HCO3)2 + 2NaClBaCl2 + 2NaHCO3 = Ba(HCO3)2 + 2NaCl
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2 (s) + K2SO4 (aq) = BaSO4 (s) + KClBaCl2(s) + K2SO4(aq) = BaSO4(s) + 2KCl
Be +P=BePBe + P = BeP
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
BiCl3 + 3H2S = Bi2S3 + HCl2BiCl3 + 3H2S = Bi2S3 + 6HCl
BrO3 + SO3 =SO4 + Br22BrO3 + 6SO3 = 6SO4 + Br2
Ba(NO3)2+Na3PO4=Ba3(PO4)2+NaNO33Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaNO3
Ba(NO3)2+Na3PO4=Ba3(PO4)2+NaNO33Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaNO3
Ba(OH)2 ( aq ) + H2SO4 ( aq ) = BaSO4 ( s ) + 2 H2O ( l )Ba(OH)2(aq) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
Ba(OH)2(aq)+H2SO4(aq) = BaSO4(s)+H2O(l)Ba(OH)2(aq) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
Ba(OH)2(aq)+H2SO4(aq) = BaSO4(s)+H2O(l)Ba(OH)2(aq) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
B+S=B2S32B + 3S = B2S3
Ba(OH)2 + P4O10 = Ba3(PO4)2 + H2O6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
Ba(OH)2 + P4O10 = Ba3(PO4)2 + H2O6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
BaO(s)+ CO2(g)=BaCO3(s)BaO(s) + CO2(g) = BaCO3(s)
Ba(OH)2+H3PO4=H20+Ba+PO40Ba(OH)2 + 20H3PO4 = 3H20 + 0Ba + 20PO4
Ba(OH)2+H3PO4=Ba3(PO4)2+H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
Br2+NaI=NaIBrBr2 + 2NaI = 2NaIBr
BaO+O2=BaO22BaO + O2 = 2BaO2
Ba3N2 + H2O = Ba(OH)2 + NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
BaCl2(aq) + 2 NaHCO3 = Ba(HCO3)2(s) + 2 NaCl(aq)BaCl2(aq) + 2NaHCO3 = Ba(HCO3)2(s) + 2NaCl(aq)
Br2+H2S+4H2O=Br-+(SO4)2-+H+19Br2 + 4H2S + 16H2O = 38Br- + 2(SO4)2- + 40H+
Br2+H2S+4H2O=Br-+SO42-+H+85Br2 + 2H2S + 84H2O = 170Br- + 2SO42- + 172H+
B5H9+O2=B2O3+H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
Br2 + 2 H2O + SO2 = H2SO4 + 2 HBrBr2 + 2H2O + SO2 = H2SO4 + 2HBr
Ba(HCO3)2(s)=BaCO3(s)+H2O(g)+CO2(g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
Br2(g)+CaF2(aq)=CaBr4+F22Br2(g) + CaF2(aq) = CaBr4 + F2
BaCl2+K3PO4=Ba3(PO4)2+KCl3BaCl2 + 2K3PO4 = Ba3(PO4)2 + 6KCl
BaCr2O7(s) + 2 KCl(aq) + 2 NaOH = K2CrO4 + H2O + 2 NaCl + BaCrO4BaCr2O7(s) + 2KCl(aq) + 2NaOH = K2CrO4 + H2O + 2NaCl + BaCrO4
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BF3 + Li2SO3 =B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
BCl2 + P4 + H2 = BP + HCl4BCl2 + P4 + 4H2 = 4BP + 8HCl
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq) 3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaO + O2 = Ba2O22BaO + 0O2 = Ba2O2
BaO + O2 = Ba2O22BaO + 0O2 = Ba2O2
Ba(NO3)2(aq)+Na2SO4=BaSO4(s)+NaNO3(aq)Ba(NO3)2(aq) + Na2SO4 = BaSO4(s) + 2NaNO3(aq)
Ba(NO3)2(aq)+Na2SO4=BaSO4(s)+NaNO3(aq)Ba(NO3)2(aq) + Na2SO4 = BaSO4(s) + 2NaNO3(aq)
Ba(NO3)2(aq)+Na2SO4=BaSO4(s)+NaNO3(aq)Ba(NO3)2(aq) + Na2SO4 = BaSO4(s) + 2NaNO3(aq)
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
BaO + H3PO4 = H2O + Ba3(PO4)23BaO + 2H3PO4 = 3H2O + Ba3(PO4)2
Be(OH)2 + HCl = BeCl2 + H2OBe(OH)2 + 2HCl = BeCl2 + 2H2O
Ba+H2SO4 = BaSO4+SO2+H2OBa + 2H2SO4 = BaSO4 + SO2 + 2H2O
BaO + SO2 =BaSO3 BaO + SO2 = BaSO3
BaCl2+LiC2H3O2=Ba(C2H3O2)2+LiClBaCl2 + 2LiC2H3O2 = Ba(C2H3O2)2 + 2LiCl
B5H9+O2=B2O3+H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
BaCl2 + Al2(SO4)3 = 3BaSO4 + AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Ba + O2 = BaO2Ba + O2 = 2BaO

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.