Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
BF3 + Li2SO3= B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(NO3)2+Na2SO4=BaSO4+NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
B+K(OH)=K3BO3+H22B + 6K(OH) = 2K3BO3 + 3H2
BF3 + Li2SO3 = B2(SO3)3 +LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BeO + HCl = BeCl2 + H2OBeO + 2HCl = BeCl2 + H2O
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2 + Na2CO3 = BaCO3 + NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
Ba(OH)2 + 2HCl = BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba O + HNO3 = Ba(NO3)2 + H2OBaO + 2HNO3 = Ba(NO3)2 + H2O
BaCO3 +K2SO4 =Ba2SO4 +KCO32BaCO3 + K2SO4 = Ba2SO4 + 2KCO3
Ba(NO3)2 + Na2CO3 = NaNO3 + Ba(CO3)Ba(NO3)2 + Na2CO3 = 2NaNO3 + Ba(CO3)
Ba(NO3)2 + Na2SO4= 2 NaNO3 + BaSO4Ba(NO3)2 + Na2SO4 = 2NaNO3 + BaSO4
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
BrOH+HIO3=BrIO3+H2OBrOH + HIO3 = BrIO3 + H2O
Ba(HCO3)2 (s) = BaCO3 (s) + H2O (g) + CO2 (g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
Br2 + H2O = BrO3- + Br- + H+3Br2 + 3H2O = BrO3- + 5Br- + 6H+
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + 6HNO3 = B(NO3)3 +HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
B2Br6 + 6HNO3 = B(NO3)3 +HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BaS + Na(SO4) = Ba(SO4) + NaSBaS + Na(SO4) = Ba(SO4) + NaS
Ba(OH)2+HNO3 =Ba(NO3)2+ H2OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Br2+NaI =NaBr+I2Br2 + 2NaI = 2NaBr + I2
Bi(NO3)3 +H2S = Bi2S3+HNO32Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3
BaCl2 + Na2SO4 = NaCl + BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
B(NO3)3 +K2SO4 = B2(SO4)3+KNO32B(NO3)3 + 3K2SO4 = B2(SO4)3 + 6KNO3
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
Ba + F2 = BaF2Ba + F2 = BaF2
Br2(l)+KI(aq)=KBr(aq)+I2(s)Br2(l) + 2KI(aq) = 2KBr(aq) + I2(s)
Br- + H2O = Br2 + H2 + OH-2Br- + 2H2O = Br2 + H2 + 2OH-
BaCO3+HI=BaI2+H2O+CO2BaCO3 + 2HI = BaI2 + H2O + CO2
BaCl2*2H2O + Ag(NO3) = Ba(NO3)2 + AgCl + 2H2OBaCl2*2H2O + 2Ag(NO3) = Ba(NO3)2 + 2AgCl + 2H2O
Br2 + OH- = BrO3- + Br- + H2O3Br2 + 6OH- = BrO3- + 5Br- + 3H2O
Ba + H2SO4 = BaSO4 + H2 Ba + H2SO4 = BaSO4 + H2
BaCl2+Li2SO4=BaSO4+LiClBaCl2 + Li2SO4 = BaSO4 + 2LiCl
Ba3N2 + HF = BaF2 + NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BF3(g) + NaH(s) = B2H6(g) + NaF(s)2BF3(g) + 6NaH(s) = B2H6(g) + 6NaF(s)
Ba(NO3)2 + KF = BaF2 + KNO3Ba(NO3)2 + 2KF = BaF2 + 2KNO3
BaSO4+K2CrO4= K2SO4+BaCrO4BaSO4 + K2CrO4 = K2SO4 + BaCrO4
BrCHO + Cr2O72- + H2SO4 = BrCOOH + Cr3+ +H2O+ S3BrCHO + 0Cr2O72- + H2SO4 = 3BrCOOH + 0Cr3+ + H2O + S
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BN + F2 = BF3 + N22BN + 3F2 = 2BF3 + N2
BaCl2+K2SO4=BaSO4+KClBaCl2 + K2SO4 = BaSO4 + 2KCl
B2O3 + C = B4C3 + CO22B2O3 + 6C = B4C3 + 3CO2
Ba(NO3)2 + H2S = BaS + HNO3Ba(NO3)2 + H2S = BaS + 2HNO3
BaI2 + Na2SO4=BaSO4 + NaIBaI2 + Na2SO4 = BaSO4 + 2NaI
BaCl2+H2SO4 = BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaH2+H2O=Ba(OH)2+H2BaH2 + 2H2O = Ba(OH)2 + 2H2
Br2 =2BrBr2 = 2Br
Br2 =2BrBr2 = 2Br
BaI2(aq)+AgNO3(aq)=Ba(NO3)2+AgIBaI2(aq) + 2AgNO3(aq) = Ba(NO3)2 + 2AgI
Ba(OH)2 + K2(SO4) = Ba(SO4) + K2(OH)2Ba(OH)2 + K2(SO4) = Ba(SO4) + K2(OH)2
Ba+H2SO4=BaSO4+H2Ba + H2SO4 = BaSO4 + H2
B2O3 + C = B4C3 + CO22B2O3 + 6C = B4C3 + 3CO2
BaO + O2 = BaO22BaO + O2 = 2BaO2
Br2 + CaI2 = I2 + CaBr2Br2 + CaI2 = I2 + CaBr2
B2O3 + C = B4C3 + CO22B2O3 + 6C = B4C3 + 3CO2
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Ba(OH)2 + H3PO4 = BaHPO4 + H2OBa(OH)2 + H3PO4 = BaHPO4 + 2H2O
Ba(OH)2 = BaO + H2OBa(OH)2 = BaO + H2O
Ba(OH)2 = BaO + H2OBa(OH)2 = BaO + H2O
BaCl2+H2SO4= BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BCl3+H2O=B(OH)3+HClBCl3 + 3H2O = B(OH)3 + 3HCl
BaCl2 + K2CO3 = 2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
BaCl2 + K2CO3 = 2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
BaCl2 + K2CO3 = 2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
B2O3+C+Cl2=BCl3+COB2O3 + 3C + 3Cl2 = 2BCl3 + 3CO
Bi2S3+HCl=BiCl3+H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
Ba(ClO3)2(s) =BaCl2(s) +O2(g)Ba(ClO3)2(s) = BaCl2(s) + 3O2(g)
Ba3N2+ HF=3BaF2+2NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BaCl2+(NH4)2CO3=BaCO3+NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
Ba3N2+HF= BaF2+NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2 HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Ba(OH)2 + H2SO4 = H2O + BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2 (aq) + Li2CO3 (aq) =LiCl (aq) + BaCO3 (s) BaCl2(aq) + Li2CO3(aq) = 2LiCl(aq) + BaCO3(s)
Ba3N2 + HF = BaF2 + NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BH4- + H+ + H2O= H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2 HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Be3P2+MgS+CaCl2=BeS+MgCl2+Ca3P2Be3P2 + 3MgS + 3CaCl2 = 3BeS + 3MgCl2 + Ca3P2
BF3+CO2=B2O3+CF44BF3 + 3CO2 = 2B2O3 + 3CF4
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Be2C+Mg3N2+CaO+Sr5B2= Ca3N2+SrO+Mg2C+Be5B215Be2C + 10Mg3N2 + 30CaO + 6Sr5B2 = 10Ca3N2 + 30SrO + 15Mg2C + 6Be5B2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BF3+H2O=B2O3+HF2BF3 + 3H2O = B2O3 + 6HF
Br2 + KOH =KBrO3 + KBr + H2O3Br2 + 6KOH = KBrO3 + 5KBr + 3H2O
BaCl2 +Na2SO4=NaCl+BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
BaCl2 + Ag2SO4 = BaSO4 + AgCl  BaCl2 + Ag2SO4 = BaSO4 + 2AgCl
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
Ba3N2 =Ba + N2Ba3N2 = 3Ba + N2
BH4- + H+ + H2O = H3BO3 + H2 BH4- + H+ + 3H2O = H3BO3 + 4H2
BaCl2+Na2CO3=BaCO3+NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
Bi2O3+OCl = Cl+BiO3Bi2O3 + 3OCl = 3Cl + 2BiO3
Ba(OH)2 + Fe2(SO4)3 = BaSO4 + Fe(OH)33Ba(OH)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(OH)3
BH4- + H+ 3H2O = H3BO3 + H20BH4- + 2H + 0H2O = 0H3BO3 + H2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BaO2(l) = BaO(l) + O2(g)2BaO2(l) = 2BaO(l) + O2(g)
Ba3N2+HF=BaF2+NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
Ba(OH)2 + Na3PO4 = Ba3(PO4)2 + NaOH3Ba(OH)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaOH
Br2 + H2O = BrO3- + Br- + OH--3Br2 + 3H2O = -1BrO3- - 5Br- + 6OH-
Ba(OH)2 + NH4NO3 = Ba(NO3)2 + NH4OHBa(OH)2 + 2NH4NO3 = Ba(NO3)2 + 2NH4OH
Ba(OH)2 + 2NH4NO3 = Ba(NO3)2 + 2NH4OHBa(OH)2 + 2NH4NO3 = Ba(NO3)2 + 2NH4OH
BaCO3 + C2H4O2 = Ba(C2H3O2)2 + H2CO3BaCO3 + 2C2H4O2 = Ba(C2H3O2)2 + H2CO3
Br2(l) + NaI(aq) = NaBr(aq) + I2(s)Br2(l) + 2NaI(aq) = 2NaBr(aq) + I2(s)
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
B2O3+H2O=B(OH)4+H3OB2O3 + 7H2O = 2B(OH)4 + 2H3O
BF3+Li2(SO3)=B2(SO3)3+LiF2BF3 + 3Li2(SO3) = B2(SO3)3 + 6LiF
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BaCl2 + H2SO4 = BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaNO3 + NaF = NaNO3 + BaFBaNO3 + NaF = NaNO3 + BaF
Ba(NO3)2 + NH3 = BaH2 + N(NO3)33Ba(NO3)2 + 2NH3 = 3BaH2 + 2N(NO3)3
Ba (NO3)2 + NH2SO3H + H2O= Ba (NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BaO(s) + H2O(l)=BaH+O2BaO(s) + H2O(l) = 2BaH + 3O
Ba(OH)2+H3PO4=Ba3(PO4)2+H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
B(ClO3)3 = BCl3 + O22B(ClO3)3 = 2BCl3 + 9O2
Ba(NO3)2 + 2NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Bi2O3 = Bi +O22Bi2O3 = 4Bi + 3O2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BrO3- + N2H4+ H+ = Br2 + N2 + H2O4BrO3- + 5N2H4 + 4H+ = 2Br2 + 5N2 + 12H2O
BrO3- + N2H4+ H+ = Br2 + N2 + H2O4BrO3- + 5N2H4 + 4H+ = 2Br2 + 5N2 + 12H2O
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Be2C+H2O=Be(OH)2+CH4 Be2C + 4H2O = 2Be(OH)2 + CH4
Be2C+H2O=Be(OH)2+CH4 Be2C + 4H2O = 2Be(OH)2 + CH4
Ba(NO3)2 + Na2SO4 = BaSO4 + NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(OH)2+H2SO4=BaSO4+H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
Br2+2KI=2KBr+I2Br2 + 2KI = 2KBr + I2
Br+KI=KBr+IBr + KI = KBr + I
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
BaO2(s) + H2So4(aq) = BaSo4(s) + H2O2(aq)BaO2(s) + H2So4(aq) = BaSo4(s) + H2O2(aq)
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
BaF2 + K3PO4 = Ba3(PO4)2 + KF3BaF2 + 2K3PO4 = Ba3(PO4)2 + 6KF
Br2+2KI=2KBr+I2Br2 + 2KI = 2KBr + I2
Br2+KI=KBr+I2Br2 + 2KI = 2KBr + I2
Br2+2KI=2KBr+I2Br2 + 2KI = 2KBr + I2
Br+KI=KBr+IBr + KI = KBr + I
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
Ba(OH)2+P4O10=Ba3(PO4)2+H2O6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
Ba(NO3)2 + NH2SO3H + H20 = Ba(NH4SO3)2 + HNO35Ba(NO3)2 + 10NH2SO3H + H20 = 5Ba(NH4SO3)2 + 10HNO3
Ba3N2(s) + HF(aq) =BaF2(aq) +NH3(g)Ba3N2(s) + 6HF(aq) = 3BaF2(aq) + 2NH3(g)
Ba + H2O= Ba(OH)2 + H2Ba + 2H2O = Ba(OH)2 + H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2 BH4- + H+ + 3H2O = H3BO3 + 4H2
Ba(OH)2+H2SO4=BaSO4+H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(NO3)2 + Na2SO4 = BaSO4 + NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BrO3-+ Sn2+ + H+ = Br- + Sn4+ + H2OBrO3- - 12Sn2+ + 6H+ = Br- - 6Sn4+ + 3H2O
B2O3 + H2O = B(OH)4 + H3OB2O3 + 7H2O = 2B(OH)4 + 2H3O
Ba + H2O=Ba2+ + OH- + H24Ba + 2H2O = 2Ba2+ + 2OH- + H2
BaCl2(aq)+H2SO4(aq)=BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Br2(l)+I2(s)=IBr3(g)3Br2(l) + I2(s) = 2IBr3(g)
BH4- + H+  + H2O =  H3BO3 + H2 BH4- + H+ + 3H2O = H3BO3 + 4H2
Ba(NO3)2 + NaOH = BaOH + (NO3)2NaBa(NO3)2 + NaOH = BaOH + (NO3)2Na
BaCO3 + C = BaCO2 + COBaCO3 + C = BaCO2 + CO
B2H6 (l) + O2 = B2O3 (s) + H2O (l)B2H6(l) + 3O2 = B2O3(s) + 3H2O(l)
BaCO3=Ba+CO3BaCO3 = Ba + CO3
BaCO3=Ba+CO3BaCO3 = Ba + CO3
B + KOH = K3BO3 + H22B + 6KOH = 2K3BO3 + 3H2
B + KOH = K3 + BO3 + H22B + 6KOH = 2K3 + 2BO3 + 3H2
Ba+ Al 3+ = Al(s) + Ba 2+2Ba + Al3+ = 3Al(s) + Ba2+
BaCl2(aq) + Na2CO3(aq) = BaCO3(s) + 2NaCl(aq)BaCl2(aq) + Na2CO3(aq) = BaCO3(s) + 2NaCl(aq)
Ba(NO3)2=Ba+2NO3Ba(NO3)2 = Ba + 2NO3
BaCl2 + H2O = HCl + Ba(OH)2BaCl2 + 2H2O = 2HCl + Ba(OH)2
BaCl2+Na2SO4=BaSO4+2NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Bi2S3 + O2 = Bi2O3 + SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
BaO+2HNO3=Ba(NO3)2+H2OBaO + 2HNO3 = Ba(NO3)2 + H2O
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Bi + AgNo3 = Bi(No3)3 + AgBi + 3AgNo3 = Bi(No3)3 + 3Ag
Ba(OH)2 (aq) + Cr2(SO4)3 = BaSO4 (s) + Cr(OH)33Ba(OH)2(aq) + Cr2(SO4)3 = 3BaSO4(s) + 2Cr(OH)3
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(HCO3)2 (s) = BaCO3 (s) + H2O (g) + CO2 (g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
BaCl2 (aq) + Na2SO4 (aq) = NaCl (aq) + BaSO4 (s)BaCl2(aq) + Na2SO4(aq) = 2NaCl(aq) + BaSO4(s)
Ba(HCO3)2 (s) = BaCO3 (s) + H2O (g) + CO2 (g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
Ba + 2HCl= BaCl2 + H2Ba + 2HCl = BaCl2 + H2
Ba + 2HCl= BaCl2 + H2Ba + 2HCl = BaCl2 + H2
BeCO3 = BeO + CO2BeCO3 = BeO + CO2
BeO + C + Cl2 = BeCl2 +COBeO + C + Cl2 = BeCl2 + CO
BeO + C = Be2C + CO22BeO + 2C = Be2C + CO2
BeO + C = Be2C + CO22BeO + 2C = Be2C + CO2
Br2O7 + H2O = Br(OH)7Br2O7 + 7H2O = 2Br(OH)7
BCl3 + P4 + H2 = BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
Br2 + CaI2 = I2 + CaBr2Br2 + CaI2 = I2 + CaBr2
Ba(OH)2(aq)+HNO3(aq)=Ba(NO3)2(aq)+H2O(l)Ba(OH)2(aq) + 2HNO3(aq) = Ba(NO3)2(aq) + 2H2O(l)
Ba(OH)2(aq)+HNO3(aq)=Ba(NO3)2(aq)+H2O(l)Ba(OH)2(aq) + 2HNO3(aq) = Ba(NO3)2(aq) + 2H2O(l)
BaI2(aq)+2AgNO3(aq)=2AgI(s)+Ba(aq)+2NO3(aq)BaI2(aq) + 2AgNO3(aq) = 2AgI(s) + Ba(aq) + 2NO3(aq)
BaI2(aq)+2AgNO3(aq)=2AgI(s)+Ba(aq)+2NO3(aq)BaI2(aq) + 2AgNO3(aq) = 2AgI(s) + Ba(aq) + 2NO3(aq)
BaI2(aq)+2AgNO3(aq)=2AgI(s)+Ba(aq)+2NO3(aq)BaI2(aq) + 2AgNO3(aq) = 2AgI(s) + Ba(aq) + 2NO3(aq)
BCl3 + P4 + H2 = BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
BaSO+C =BaS+COBaSO + C = BaS + CO
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq) BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq) BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaSO4+K3PO4=Ba3(PO4)2+K2SO43BaSO4 + 2K3PO4 = Ba3(PO4)2 + 3K2SO4
Ba(OH)2 + H3PO4 = BaHPO4 +H2OBa(OH)2 + H3PO4 = BaHPO4 + 2H2O
Be(s) + 2 HBr(aq) = BeBr2(aq) + H2(g) Be(s) + 2HBr(aq) = BeBr2(aq) + H2(g)
BN + 3IF = NI3 + BF3BN + 3IF = NI3 + BF3
Ba(NO3)2 + NH2SO3H + H2O = Ba(NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
Ba(NO3)2+NH2SO3H+H2O=Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BaF2 + K3PO4 = Ba3(PO4)2 + KF3BaF2 + 2K3PO4 = Ba3(PO4)2 + 6KF
Ba + O2 = BaO2Ba + O2 = 2BaO
BiCl3 + H2S = Bi2S3 +HCl2BiCl3 + 3H2S = Bi2S3 + 6HCl
BaCl2 + Al2(SO4)3 = BaSO4 + AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BaCl2+ZnSO4=BaSO4+ZnCl2BaCl2 + ZnSO4 = BaSO4 + ZnCl2
BH4- + H+ + H2O= H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + 3H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
Br2(l) + FeCl3(aq) = BrCl + Fe3Br2(l) + 2FeCl3(aq) = 6BrCl + 2Fe
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Ba(NO3)2+NH2SO3H+H2O=Ba(NH2)2+H2SO4+HNO3Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
BCl3 + P4 + H2= BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
BCl3 + P4 + H2= BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
Ba(NO3)2+NH2SO3H+H2O=Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
Ba(NO3)2+NH2SO3H+H2O=Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
B2S3(s) + H2O(l) = H3BO3(aq) + H2S(g)B2S3(s) + 6H2O(l) = 2H3BO3(aq) + 3H2S(g)
BH4+H+H2O=H3BO3BH4 - 7H + 3H2O = H3BO3
Ba(OH)2 + H2SO4 = H2O + BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
Ba(NO3)2 + NH2SO3H+ H2O= Ba(NH2)2+H2SO4+HNO3Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
Bi2S3+O2=Bi2O3+SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
Ba(NO3)2 + NH2SO3H+ H2O= BaSO4+NH4NO3+HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2 + NH2SO3H+ H2O= Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BeI2 + Sn(NO3)2 = Be(NO3)2 + Sn(I2)BeI2 + Sn(NO3)2 = Be(NO3)2 + Sn(I2)
BH4- + H2O +H+ = H3BO3 + H2BH4- + 3H2O + H+ = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BH4- + H+ H2O = H3BO3 + H2 (g)0BH4- + 2H + 0H2O = 0H3BO3 + H2(g)
Ba(OH)2+HCl=BaCl2+H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
BaS+PtF2=BaF2+PtSBaS + PtF2 = BaF2 + PtS
Be(OH)2 +H2SO3 =BeSO3 +H2OBe(OH)2 + H2SO3 = BeSO3 + 2H2O
Ba(NO3)2 (aq) + Na2PO4 (aq) = BaPO4 (s) + 2NaNO3 (aq)Ba(NO3)2(aq) + Na2PO4(aq) = BaPO4(s) + 2NaNO3(aq)
Ba(C2H3O2) + Na(PO4) = Ba(PO4) + Na (C2H3O2)Ba(C2H3O2) + Na(PO4) = Ba(PO4) + Na(C2H3O2)
Ba(C2H2O2) + Na(PO4) = Ba(PO4) + Na (C2H2O2)Ba(C2H2O2) + Na(PO4) = Ba(PO4) + Na(C2H2O2)
Ba + HgIO3 = Ba(IO3)2 + HgBa + 2HgIO3 = Ba(IO3)2 + 2Hg
Ba Cl+ Na(SO4)=Ba (SO4) +NaClBaCl + Na(SO4) = Ba(SO4) + NaCl
BaO2 = BaO + O22BaO2 = 2BaO + O2
Ba(No3) + Na(Po3) = Ba(Po3) + Na(No3)Ba(No3) + Na(Po3) = Ba(Po3) + Na(No3)
Ba(OH)2+H3PO4=Ba3(PO4)2+H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
BaCO3(s) = BaO(s) + CO2(g)BaCO3(s) = BaO(s) + CO2(g)
BaF2 + K3PO4 = Ba3(PO4)2 + KF3BaF2 + 2K3PO4 = Ba3(PO4)2 + 6KF
BaCl2 + Na2SO4 = NaCl +BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
Ba(NO3)2+MgSO4=BaSO4+Mg(NO3)2Ba(NO3)2 + MgSO4 = BaSO4 + Mg(NO3)2
BaO =Ba+OBaO = Ba + O
Ba(s)+2HBr(aq)=H2(g)+BaBr2(aq)Ba(s) + 2HBr(aq) = H2(g) + BaBr2(aq)
Ba(s)+2HBr(aq)=H2(g)+BaBr2(aq)Ba(s) + 2HBr(aq) = H2(g) + BaBr2(aq)
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BaO2 = BaO + O22BaO2 = 2BaO + O2
Br2+H2O+SO2=HBr+H2SO4Br2 + 2H2O + SO2 = 2HBr + H2SO4
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Ba(NO3)2 + Na3PO4 = Ba3(PO4)2 + NaNO33Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaNO3
BaF2 + H3PO4 = Ba3(PO4)2 + HF3BaF2 + 2H3PO4 = Ba3(PO4)2 + 6HF
Ba(s)+ H 2 O(l)=BaOH+H22Ba(s) + 2H2O(l) = 2BaOH + H2
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(CH3CO2)2 + CaCl2 = BaCl2 + Ca(CH3CO2)2 Ba(CH3CO2)2 + CaCl2 = BaCl2 + Ca(CH3CO2)2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BaI2+Na2SO4=BaSO4+NaIBaI2 + Na2SO4 = BaSO4 + 2NaI
BaCl2 + K2SO3 = BaSO3 + KClBaCl2 + K2SO3 = BaSO3 + 2KCl
BH4- + H+ + H2O= H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BH4- + H+  + H2O =  H3BO3 + H2 BH4- + H+ + 3H2O = H3BO3 + 4H2
BaC O 3 (s)=BaO(s)+C O 2 (g)BaCO3(s) = BaO(s) + CO2(g)
Ba(OH ) 2 (aq)+HN O 3 (aq) = Ba(N O 3 ) 2 (aq)+ H 2 O(l)Ba(OH)2(aq) + 2HNO3(aq) = Ba(NO3)2(aq) + 2H2O(l)
BH4- + H+ H2O =H3BO3 + H2 (g)0BH4- + 2H + 0H2O = 0H3BO3 + H2(g)
Bi2S3 + HCl = BiCl3 + H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
BaCrO4= Ba+ CrO4BaCrO4 = Ba + CrO4
B2S3+H2O = H3BO3 + H2SB2S3 + 6H2O = 2H3BO3 + 3H2S
Bi2S3 + HCl = BiCl3 + H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
BBr3+MgSO4=MgBr2+B2(SO4)32BBr3 + 3MgSO4 = 3MgBr2 + B2(SO4)3
BH4-+H++H2O=H3BO3+2H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Bi2S3 + O2 = Bi2O3 + SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
Bi + HNO3 + H2O = Bi(NO3)3*5H2O + NOBi + 4HNO3 + 3H2O = Bi(NO3)3*5H2O + NO
Ba(CH3CO2)2 + Ag2SO4 = BaSO4 + AgCH3CO2Ba(CH3CO2)2 + Ag2SO4 = BaSO4 + 2AgCH3CO2
Ba(CH3CO2)2 + Ag2SO4 = BaSO4 + Ag2(CH3CO2)2Ba(CH3CO2)2 + Ag2SO4 = BaSO4 + Ag2(CH3CO2)2
B2S3(s) + H2O(l) = H3BO3(aq) + H2S(g)B2S3(s) + 6H2O(l) = 2H3BO3(aq) + 3H2S(g)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BN(s) + IF(s) = NI3(g) + BF3(s)BN(s) + 3IF(s) = NI3(g) + BF3(s)
BN(s) + IF(s) = NI3(g) + BF3(s)BN(s) + 3IF(s) = NI3(g) + BF3(s)
Ba3N2+BF3=BaF2+BNBa3N2 + 2BF3 = 3BaF2 + 2BN
BeO+F2=BeF2+O22BeO + 2F2 = 2BeF2 + O2
BeO+Co=CoO+BeOBeO + 0Co = 0CoO + BeO
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
B2O3+ H2O= B(OH)3B2O3 + 3H2O = 2B(OH)3
BaCl2 + Al2 (SO4)3 = BaSO4 + AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Ba2 + 2OH + H3PO4 =Ba3(PO4)2 + H2O(l) 3Ba2 + 12OH + 4H3PO4 = 2Ba3(PO4)2 + 12H2O(l)
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Br2 + P4 = P2Br55Br2 + P4 = 2P2Br5
BaCl2 (aq) + AgNO3 (aq) = AgCl (s) + Ba(NO3)2 (aq)BaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ba(NO3)2(aq)
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H + H2O = H3BO3 + H20BH4- + 2H + 0H2O = 0H3BO3 + H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BaCl2+Al2(SO4)3=3BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
Ba(NO3)2+NH2SO3H+H2O= Ba(NH2)2+H2SO4+HNO3Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
Ba(NO3)2+NH2SO3H+H2O= BaSO4+NH4NO3+HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2+NH2SO3H+H2O= BaSO4+NH4NO3+HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2+NH2SO3H+H2O= Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
Ba(NO3)2+NH2SO3H+H2O=Ba(NH2)2+H2SO4+HNO3Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
Ba(NO3)2+NH2SO3H+H2O=BaSO4+NH4NO3+HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2+NH2SO3H+H2O=Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BH4- + H+ H2O = H3BO3 +H2 (g)0BH4- + 2H + 0H2O = 0H3BO3 + H2(g)
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
Br2 + P4= P2Br55Br2 + P4 = 2P2Br5
BaO2=BaO+O22BaO2 = 2BaO + O2
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2(aq)+H2SO4(aq) = BaSO4(s) + 2HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Ba+C2H3O2=Ba(C2H3O2)Ba + C2H3O2 = Ba(C2H3O2)
Ba(NO2)2 + Na3(PO3) = Na(NO2) + Ba3(PO3)23Ba(NO2)2 + 2Na3(PO3) = 6Na(NO2) + Ba3(PO3)2
Be(s) + 2 HCl(aq) = BeCl2(aq) + H2(g) Be(s) + 2HCl(aq) = BeCl2(aq) + H2(g)
Be(s) + 2 HCl(aq) = BeCl2(aq) + H2(g) Be(s) + 2HCl(aq) = BeCl2(aq) + H2(g)
Ba(ClO3)2=BaCl2+O2Ba(ClO3)2 = BaCl2 + 3O2
Br2+KI=KBr+I2Br2 + 2KI = 2KBr + I2
BaCl2+NaI=NaCl+BaI2BaCl2 + 2NaI = 2NaCl + BaI2
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Br- + MnO2 + H+ = Mn++ + Br2 + H2O2Br- + MnO2 + 4H+ = Mn++ + Br2 + 2H2O
Br- + MnO2 + H+ = Mn++ + Br2 + H2O2Br- + MnO2 + 4H+ = Mn++ + Br2 + 2H2O
BN(s) + IF(s) = NI3(g) + BF3(s)BN(s) + 3IF(s) = NI3(g) + BF3(s)
Bi(s) + O2(g) = Bi2O3(s) 4Bi(s) + 3O2(g) = 2Bi2O3(s)
BiCl3 + H2S = Bi2S3 + 6HCl2BiCl3 + 3H2S = Bi2S3 + 6HCl
Ba + O2 = 2BaO2Ba + O2 = 2BaO
Ba + O2 = 2BaO2Ba + O2 = 2BaO
BaCl2 + MgSO4 = MgCl2 + BaSO4BaCl2 + MgSO4 = MgCl2 + BaSO4
Ba + (CO)3 + Cl + K = BaCO3 + KCl0Ba + 0(CO)3 + Cl + K = 0BaCO3 + KCl
BN+IF=NI3+BF3BN + 3IF = NI3 + BF3
BN(s) + IF(s) = NI3(g) + BF3(s)BN(s) + 3IF(s) = NI3(g) + BF3(s)
BaS + PtF2 = BaF2 + PtSBaS + PtF2 = BaF2 + PtS
BaCl2(aq) + H2SO4(aq) = BaSO4(s) + HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
B2S3+Be(BrO)2 = BeS+B(BrO)3B2S3 + 3Be(BrO)2 = 3BeS + 2B(BrO)3
B2S3+Be(BrO)2 = BeS+B(BrO)3B2S3 + 3Be(BrO)2 = 3BeS + 2B(BrO)3
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2 (aq) + MgSO4 (aq)= BaSO4 + MgCl2BaCl2(aq) + MgSO4(aq) = BaSO4 + MgCl2
BaCl2 (aq) + HCl(aq)= BaCl(aq) +HCl2(aq)BaCl2(aq) + HCl(aq) = BaCl(aq) + HCl2(aq)
BaCl2 (aq) + HCl= BaCl +HCl2BaCl2(aq) + HCl = BaCl + HCl2
Ba+2H3AsO4=3H2+Ba3(AsO4)23Ba + 2H3AsO4 = 3H2 + Ba3(AsO4)2
Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaNO33Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaNO3
Ba(NO3) + Cu(SO4) = Ba(SO4) + Cu(NO3)Ba(NO3) + Cu(SO4) = Ba(SO4) + Cu(NO3)
Ba(NO3) + Cu(SO4) = Ba(SO4) + Cu(NO3)Ba(NO3) + Cu(SO4) = Ba(SO4) + Cu(NO3)
BF3 + H2O = B2O3 + HF2BF3 + 3H2O = B2O3 + 6HF
Br2 + I2 = IBr33Br2 + I2 = 2IBr3
Br2+KOH=KBrO3+KBr+H2O3Br2 + 6KOH = KBrO3 + 5KBr + 3H2O
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaO2=BaO+O22BaO2 = 2BaO + O2
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + KNO3(aq)Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + 2KNO3(aq)
Ba(OH)2(aq) + Na3PO4 (aq)=Ba3(PO4)2(s)+NaOH(aq) 3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + HNO3+ NH4NO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + HNO3 + NH4NO3
BaCl 2 (aq)+ H 3 PO 4 (aq)= Ba 3 ( PO 4 ) 2 (s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCO3 + C + H2O = Ba(OH)2 + COBaCO3 + C + H2O = Ba(OH)2 + 2CO
BaCl2 + Li2SO4 = BaSO4 + LiClBaCl2 + Li2SO4 = BaSO4 + 2LiCl
BaCl2 + Na2SO4 =BaSO4+ NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Br2(l) + FeCl3(aq) = FeBr2 (aq) + Cl2 (g)2Br2(l) + 2FeCl3(aq) = 2FeBr2(aq) + 3Cl2(g)
Ba (ClO3)2 = BaCl2 + O2Ba(ClO3)2 = BaCl2 + 3O2
Ba3+O2=BaO2Ba3 + 3O2 = 6BaO
Ba3+O2=Ba3O2Ba3 + O2 = Ba3O2
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2+ NH2SO3H+ H2O= Ba(NH2)2+ H2SO4+ HNO3Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
Ba(NO3)2+ NH2SO3H+ H2O= BaSO4+ NH4NO3+ HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2+ NH2SO3H+ H2O= Ba(NH2SO3)2+ HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
Ba(NO3)2+NH2SO3H+H20=Ba(NH2)2+H2SO4+HNO310Ba(NO3)2 + 15NH2SO3H + 2H20 = 10Ba(NH2)2 + 15H2SO4 + 15HNO3
Ba(NO3)2+NH2SO3H+H20=BaSO4+NH4NO3+HNO315Ba(NO3)2 + 15NH2SO3H + 2H20 = 15BaSO4 + 20NH4NO3 + 5HNO3
Ba(NO3)2+NH2SO3H+H20=Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH2SO3H + 0H20 = Ba(NH2SO3)2 + 2HNO3
BaO+H2O=Ba(OH)2BaO + H2O = Ba(OH)2
Bi2O5+Mn3(PO4)7=Mn2O7+Bi3(PO4)521Bi2O5 + 10Mn3(PO4)7 = 15Mn2O7 + 14Bi3(PO4)5
Bi2O3+H3PO4=BiPO4+H2OBi2O3 + 2H3PO4 = 2BiPO4 + 3H2O
Ba(OH)2(aq)+H2SO4(aq)=H2O(l)+BaSO4(s)Ba(OH)2(aq) + H2SO4(aq) = 2H2O(l) + BaSO4(s)
Br2(g) +H2O(l) + SO2(g) = HBr(aq) + H2SO4(aq)Br2(g) + 2H2O(l) + SO2(g) = 2HBr(aq) + H2SO4(aq)
Br2(g) +H2O(l) + SO2(g) = HBr(aq) + H2SO4(aq)Br2(g) + 2H2O(l) + SO2(g) = 2HBr(aq) + H2SO4(aq)
Ba(NO3)2=BaO+NO2+O22Ba(NO3)2 = 2BaO + 4NO2 + O2
Ba(NO3)2=BaO+NO2+O22Ba(NO3)2 = 2BaO + 4NO2 + O2
Ba(NO3)2 + NH2SO3H + H2O = Ba(NH2)2 + H2SO4 + HNO3Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
Ba(NO3)2 + NH2SO3H + H2O = Ba(NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BaS + HCl = BaCl2 + H2SBaS + 2HCl = BaCl2 + H2S
Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + HNO3+ NH4NO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + HNO3 + NH4NO3
Ba(NO3)2 + NH2SO3H = Ba(NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H = Ba(NH2SO3)2 + 2HNO3
Ba(NO3)2 + NH2SO3H + H2O = Ba(NH2SO3)2 + H2SO4 + HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 0H2SO4 + 2HNO3
Ba(OH)2 + HCl = BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(NO3)2(aq)+K2SO4(aq)=BaSO4(s)+KNO3(aq)Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + 2KNO3(aq)
Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + KNO3(aq)Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + 2KNO3(aq)
BCl3(g) + H2O(l) = H3BO3(s) + HCl(g)BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
B2O3 + NaOH = Na3BO3 +H2OB2O3 + 6NaOH = 2Na3BO3 + 3H2O
BaCl2 +Al2(SO4)3 =BaSO4 + AlCl3 3BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCO3 = BaO + CO2BaCO3 = BaO + CO2
BaCO3 = BaO + CO2BaCO3 = BaO + CO2
BrO3- + N2H4 + H+ = Br2 + N2 + H2O4BrO3- + 5N2H4 + 4H+ = 2Br2 + 5N2 + 12H2O
BaO2 = BaO = O22BaO2 = 2BaO + O2
Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + KNO3(aq)Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + 2KNO3(aq)
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
B+O2 = B2 O34B + 3O2 = 2B2O3
BaCl2 +Al2(SO4)3 =BaSO4 + AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Ba(NO3)2+K2SO4=BaSO4+KNO3Ba(NO3)2 + K2SO4 = BaSO4 + 2KNO3
Ba(ClO3)2=BaCl2+O2Ba(ClO3)2 = BaCl2 + 3O2
BaCl2+K3PO4=Ba3(PO4)2+KCl3BaCl2 + 2K3PO4 = Ba3(PO4)2 + 6KCl
BaCl 2 (aq)+ H 3 PO 4 (aq)= Ba 3 ( PO 4 ) 2 (s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Br2(l)+I2(s)=IBr3(g)3Br2(l) + I2(s) = 2IBr3(g)
Ba(NO3)2 + Na2CO3= BaCO3 + NaNO3Ba(NO3)2 + Na2CO3 = BaCO3 + 2NaNO3
Br2+FeI3= I2+ FeBr33Br2 + 2FeI3 = 3I2 + 2FeBr3
Ba(OH ) 2 (aq)+N a 3 P O 4 (aq)=B a 3 (P O 4 ) 2 (s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
Br+Al2O3 = AlBr3 +O212Br + 2Al2O3 = 4AlBr3 + 3O2
BaCl2 + MnSO4= BaSO4 +MnCl2BaCl2 + MnSO4 = BaSO4 + MnCl2
BaCl2 + 2 KIO3 = Ba(IO3)2 + 2 KClBaCl2 + 2KIO3 = Ba(IO3)2 + 2KCl
Ba+2HCO3=Ba(HCO3)2 Ba + 2HCO3 = Ba(HCO3)2
B10H18+O2=B2O3+H2OB10H18 + 12O2 = 5B2O3 + 9H2O
BaS(aq)+2KCl(aq)=BaCl2(s)+K2S(aq)BaS(aq) + 2KCl(aq) = BaCl2(s) + K2S(aq)
Ba(NO3)2(aq)+(NH4)2SO4(aq)=BaSO4(s)+2NH4NO3(aq)Ba(NO3)2(aq) + (NH4)2SO4(aq) = BaSO4(s) + 2NH4NO3(aq)
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2+Na2SO4=NaCl+BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
BaCl2+NaBr=BaBr+NaCl2BaCl2 + NaBr = BaBr + NaCl2
Br2 (l) + 2 KCl (s) = Cl2 (l) + 2 KBr (s)Br2(l) + 2KCl(s) = Cl2(l) + 2KBr(s)
BaO2=BaO+O22BaO2 = 2BaO + O2
Ba(NO3)2(s) = BaO(s) + N2(g) + O2 (g)2Ba(NO3)2(s) = 2BaO(s) + 2N2(g) + 5O2(g)
Ba(OH)2 + H3PO4 = Ba3(PO4)2 + H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
Ba3N2 + H2S = BaS + H3NBa3N2 + 3H2S = 3BaS + 2H3N
Ba(OH)2+H3PO4=Ba3(PO4)2+6H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
BaBr2+Na3PO4=Ba3(PO4)2+NaBr3BaBr2 + 2Na3PO4 = Ba3(PO4)2 + 6NaBr
Ba + N2 = Ba3N23Ba + N2 = Ba3N2
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BF3+Li2SO3 = B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Br2 + H2O + SO2 = HBr + H2SO4Br2 + 2H2O + SO2 = 2HBr + H2SO4
Ba + H2O = Ba2O2 + H22Ba + 2H2O = Ba2O2 + 2H2
BaCl2 (aq) + AgNO3 (aq) = AgCl (s) + Ba(NO3)2 (aq)BaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ba(NO3)2(aq)
BF3 + H2O= H3BO3 + HBF44BF3 + 3H2O = H3BO3 + 3HBF4
Bi2S3 + O2 = Bi2O3 + SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
BeCl2 + LiH = BeH2 + LiClBeCl2 + 2LiH = BeH2 + 2LiCl
BaCl2 (aq) + AgNO3 (aq) = AgCl (s) + Ba(NO3)2 (aq)BaCl2(aq) + 2AgNO3(aq) = 2AgCl(s) + Ba(NO3)2(aq)
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Bi2S3+ HCl= BiCl3+ H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
BaCl2+ H2SO4= BaSO4+ HClBaCl2 + H2SO4 = BaSO4 + 2HCl
B2H6(l)+O2(g)=B2O3(s)+H2O(l)B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
Ba(OH)2(aq) + CO2(g)= BaCO3(s) + H2O(l)Ba(OH)2(aq) + CO2(g) = BaCO3(s) + H2O(l)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
BaO2(s) + H2O(l) = Ba(OH)2(aq) + O2(g)2BaO2(s) + 2H2O(l) = 2Ba(OH)2(aq) + O2(g)
BaCl2 + K2CO3 = 2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
BaS + O3 = Ba + SO23BaS + 2O3 = 3Ba + 3SO2
BaCl2 (aq) + Na2SO4 (aq) = BaSO4 (s) + NaCl (aq)BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaCl(aq)
BaCl2 + Fe2(SO4)3 = BaSO4 + FeCl33BaCl2 + Fe2(SO4)3 = 3BaSO4 + 2FeCl3
Ba3(PO4)2+KC2H3O2=Ba(C2H3O2)2+K3PO4Ba3(PO4)2 + 6KC2H3O2 = 3Ba(C2H3O2)2 + 2K3PO4
Ba3(PO4)2+KC2H3O2=Ba(C2H3O2)2+K3PO4Ba3(PO4)2 + 6KC2H3O2 = 3Ba(C2H3O2)2 + 2K3PO4
BaCl2+SO4 = BaSO4 +ClBaCl2 + SO4 = BaSO4 + 2Cl
BaCl2+SO4 = BaSO4 +Cl2BaCl2 + SO4 = BaSO4 + Cl2
BaCl2 H2O = BaCl2 +H2OBaCl2H2O = BaCl2 + H2O
BaCl2 H2O = BaCl2 +H2OBaCl2H2O = BaCl2 + H2O
Ba(OH)2 = BaO = H2OBa(OH)2 = BaO + H2O
Ba(NO3)2 + NH2SO3H + H2O = Ba(NH2)2 + H2SO4 + HNO3Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
Ba(NO3)2 + NH2SO3H +H2O = BaSO4 + NH4NO3 + HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Be(NO3)2(aq) + Na3PO4(aq) = Be3(PO4)2(s) + NaNO3(aq)3Be(NO3)2(aq) + 2Na3PO4(aq) = Be3(PO4)2(s) + 6NaNO3(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(NO3)2 + NH2SO3H = Ba(NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H = Ba(NH2SO3)2 + 2HNO3
Bi(s) + F2(g) = BiF3 (s)2Bi(s) + 3F2(g) = 2BiF3(s)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl2 +Al2(SO4)3 = 3BaSO4 + AlCl3 3BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Ba(C2H3O2)2 + 2 K2CO3 = Ba(CO3)2 + 2 K2 + 2 C2H3O2Ba(C2H3O2)2 + 2K2CO3 = Ba(CO3)2 + 2K2 + 2C2H3O2
Bi + PO4 = BiPO4Bi + PO4 = BiPO4
Bi + PO4 = BiPO4Bi + PO4 = BiPO4
BaCl2 (aq)+Al2 (SO4)3 (aq)= 3BaSO4 (s)+AlCl3 (aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
BaCO3 (s) + HCl (aq) = BaCl + HCO3BaCO3(s) + HCl(aq) = BaCl + HCO3
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
B2 O3 + H2O= H3 BO3B2O3 + 3H2O = 2H3BO3
Ba(OH)2 + HCl = BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(NO3)2 + NH2SO3H + H2O = Ba(NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BaO+KCl=BaK+ClOBaO + KCl = BaK + ClO
Ba+P= Ba3P23Ba + 2P = Ba3P2
Ba+P= BaPBa + P = BaP
BaCl2+K= BaK+ClBaCl2 + K = BaK + 2Cl
Ba(NO3)2+Na2SO4=BaSO4+2NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(NO3)2+H2SO4=BaSO4 + HNO3Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
BaI2(aq) + AgNO3(aq) = BaNO3 + AgI2BaI2(aq) + AgNO3(aq) = BaNO3 + AgI2
Ba(NO3)2 + NH2SO3H + H2O = Ba(NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BeSO4 + NH4OH = Be(OH)2 + (NH4)2SO4BeSO4 + 2NH4OH = Be(OH)2 + (NH4)2SO4
B2O3 + H2O= B(OH)3B2O3 + 3H2O = 2B(OH)3
Ba(OH)2+H2SO4=BaSO4+H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(NO3)2 + NH3SO3+H2O=Ba(NH2)2+H2SO4+HNO3Ba(NO3)2 + 2NH3SO3 + 2H2O = Ba(NH2)2 + 2H2SO4 + 2HNO3
Ba(NO3)2 + NH3SO3+H2O=BaSO4+NH4NO3+HNO3Ba(NO3)2 + NH3SO3 + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2 + NH3SO3+H2O=Ba(NH2SO3)2+HNO3Ba(NO3)2 + 2NH3SO3 + 0H2O = Ba(NH2SO3)2 + 2HNO3
B2O3+H2O=H3BO3B2O3 + 3H2O = 2H3BO3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.