Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
BaCl2+H3PO4=Ba3(PO4)2+HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
Br2+KOH=KBr+KBrO3+H2O3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
BrNO=Br2+NO 2BrNO = Br2 + 2NO
B2O3 + Mg = MgO + BB2O3 + 3Mg = 3MgO + 2B
Bi2O3(s) + 3 C(s) = 2 Bi(s) + 3 CO(g)Bi2O3(s) + 3C(s) = 2Bi(s) + 3CO(g)
Bi2O3 + 3 C= 2 Bi + 3 COBi2O3 + 3C = 2Bi + 3CO
Bi2O3(s) + 3 C(s) = 2 Bi(s) + 3 CO(g)Bi2O3(s) + 3C(s) = 2Bi(s) + 3CO(g)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaCl 2 (aq)+ H 3 PO 4 (aq)= Ba 3 ( PO 4 ) 2 (s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Bi2O3+KOH+KClO=KBiO3+H2O+KClBi2O3 + 2KOH + 2KClO = 2KBiO3 + H2O + 2KCl
BaO2 (s)+H2SO4=BaSO4+H2O2BaO2(s) + H2SO4 = BaSO4 + H2O2
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
Br- + N2 + OH- = H2O + Br2 + N2H44Br- + N2 - 4OH- = -4H2O + 2Br2 + N2H4
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BaO + H2O=Ba(OH)2BaO + H2O = Ba(OH)2
B(s)+I(s)=B2I6(s)2B(s) + 6I(s) = B2I6(s)
Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO0Ba(NO3)2 + 0NH2SO3H - H2O = 0BaSO4 - NH4NO3 + 2HNO
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
B2S3 + H2O = H3BO3 + H2SB2S3 + 6H2O = 2H3BO3 + 3H2S
Ba (OH)2 + CO2 =BaCO3 + H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba (OH)2 + CO2 =BaCO3 + H2OBa(OH)2 + CO2 = BaCO3 + H2O
Br2+LiF=LiBr+F2Br2 + 2LiF = 2LiBr + F2
Br2+LiF=LiBr+F2Br2 + 2LiF = 2LiBr + F2
Ba(OH)2 + H2SO4(l) = Ba(SO4) + H2OBa(OH)2 + H2SO4(l) = Ba(SO4) + 2H2O
BaS + CuOH = BaOH + SCuBaS + CuOH = BaOH + SCu
BaCO3 = BaO + CO2BaCO3 = BaO + CO2
B + O2 = B2O34B + 3O2 = 2B2O3
Ba + O2 = BaO2Ba + O2 = 2BaO
Ba(OH)2+H2SO4=Ba(SO4)+H2OBa(OH)2 + H2SO4 = Ba(SO4) + 2H2O
Ba2(OH)2+HCl=H2O+BaClBa2(OH)2 + 2HCl = 2H2O + 2BaCl
Ba(HCO3)2=BaCO3+H2O+CO2Ba(HCO3)2 = BaCO3 + H2O + CO2
BaCl2+Na2(SO4)=NaCl+Ba(SO4)BaCl2 + Na2(SO4) = 2NaCl + Ba(SO4)
BeO + HBr =H2O + BeBr2BeO + 2HBr = H2O + BeBr2
B2S3=B+SB2S3 = 2B + 3S
Ba+HO2 = Ba (OH)2+H2-2Ba - 2HO2 = -2Ba(OH)2 + H2
Ba3(PO4)2(aq) + H3PO4(aq) = Ba(H2PO4)2(aq)Ba3(PO4)2(aq) + 4H3PO4(aq) = 3Ba(H2PO4)2(aq)
BaCl2+Na2SO3=NaCl+BaSO3BaCl2 + Na2SO3 = 2NaCl + BaSO3
BaCl2+Na2SO3=NaCl+BaSO3BaCl2 + Na2SO3 = 2NaCl + BaSO3
Ba(OH)2(aq)+HNO3(aq)=Ba(NO3)2(aq)+H2O(l)Ba(OH)2(aq) + 2HNO3(aq) = Ba(NO3)2(aq) + 2H2O(l)
BaO2(s)= BaO(s)+O2 (g)2BaO2(s) = 2BaO(s) + O2(g)
BaCl2(aq)+K2CO3(aq)=BaCO3(s)+KCl(aq)BaCl2(aq) + K2CO3(aq) = BaCO3(s) + 2KCl(aq)
Ba O2 + HCl = Ba Cl2 +H2 O2BaO2 + 2HCl = BaCl2 + H2O2
BaCl2 + (NH4 )2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
Ba(OH)2+CoCl3=Co(OH)3+BaCl23Ba(OH)2 + 2CoCl3 = 2Co(OH)3 + 3BaCl2
Ba(OH)2 (s) + H2SO4 (aq) = BaSO4 (s) + H2O (aq)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(aq)
Ba(NO3)2 + (NH4)3 PO4 = Ba3(PO4)2 + NH4NO33Ba(NO3)2 + 2(NH4)3PO4 = Ba3(PO4)2 + 6NH4NO3
Ba(NO3)2 + (NH4)3 PO4 = Ba3(PO4)2 + NH4NO33Ba(NO3)2 + 2(NH4)3PO4 = Ba3(PO4)2 + 6NH4NO3
BN + Ca4C2 = B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BN + Ca4C2 = B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BN + Ca4C2 = B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
Ba(NO3)2=Ba3N2+O2+N23Ba(NO3)2 = Ba3N2 + 9O2 + 2N2
BN + Ca4C2 = B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BN + Ca4C2 = B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BaBr2+Na3PO4=Ba3(PO4)2+NaBr3BaBr2 + 2Na3PO4 = Ba3(PO4)2 + 6NaBr
Be2C + H2O = Be(OH)2 + CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Ba(ClO3)2=BaCl2+O2Ba(ClO3)2 = BaCl2 + 3O2
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BeO + HBr = H2O + BeBr2BeO + 2HBr = H2O + BeBr2
BeO + HBr = H2O + BeBr2BeO + 2HBr = H2O + BeBr2
Br2+NaF=Na+FBr2Br2 + NaF = Na + FBr2
Br2+NaF=Na+FBr2Br2 + NaF = Na + FBr2
Br2+NaF=Na2F+Br2Br2 + 0NaF = 0Na2F + Br2
Br2+NaF=NaBr+F2Br2 + 2NaF = 2NaBr + F2
Ba(OH)2+AlCl3=Al(OH)3+BaCl23Ba(OH)2 + 2AlCl3 = 2Al(OH)3 + 3BaCl2
BaCl2+(NH4)2CO3=BaCO3+NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
Bi2O5 + NaClO + NaOH = NaCl + H2O +NaBiO5Bi2O5 + 4NaClO + 2NaOH = 4NaCl + H2O + 2NaBiO5
BaCl2 + Na2CO3 = BaCO3 + NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
BaCl2 + Na2CO3 = BaCO3 + 2NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
Bi(s) + O2(g) = Bi2O7(s)4Bi(s) + 7O2(g) = 2Bi2O7(s)
BaCl = ClBaBaCl = ClBa
Br2 +C2H2= C2H2Br42Br2 + C2H2 = C2H2Br4
Br2 +C2H2= C2H2Br2Br2 + C2H2 = C2H2Br2
BaCl2 (aq) + H2SO4 (aq) = BaSO4 (s) + 2 HCl (aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Br2(l) + KOH(aq) = KBr(aq) + KBrO3(aq) + H2O(l)3Br2(l) + 6KOH(aq) = 5KBr(aq) + KBrO3(aq) + 3H2O(l)
Br + CaI2 = CaBr2 + I22Br + CaI2 = CaBr2 + I2
BaO(s) + HNO3(aq) = Ba(NO3)2(aq) + H2O(l)BaO(s) + 2HNO3(aq) = Ba(NO3)2(aq) + H2O(l)
BaO(s) + HNO3(aq) = Ba(NO3)2(aq) + H2O(l)BaO(s) + 2HNO3(aq) = Ba(NO3)2(aq) + H2O(l)
Ba(NO3)2+Na3(PO4)=Ba3(PO4)2+Na(NO3) 3Ba(NO3)2 + 2Na3(PO4) = Ba3(PO4)2 + 6Na(NO3)
BaI2 + Cl2 = BaCl2 + I2BaI2 + Cl2 = BaCl2 + I2
Ba(OH)2 + NH4Cl = BaCl2 + NH3 + H2OBa(OH)2 + 2NH4Cl = BaCl2 + 2NH3 + 2H2O
Ba(s) + H2O(l) = Ba(OH)2(s) + H2(g)Ba(s) + 2H2O(l) = Ba(OH)2(s) + H2(g)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq) BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
Ba(CN)2+H2SO4=BaSO4+HCNBa(CN)2 + H2SO4 = BaSO4 + 2HCN
Br2+NaI=NaBr+I2Br2 + 2NaI = 2NaBr + I2
Ba+N2= Ba3N23Ba + N2 = Ba3N2
B2S3 = B+SB2S3 = 2B + 3S
B2S3 = B+SB2S3 = 2B + 3S
B2S3 = B+SB2S3 = 2B + 3S
Be(OH)2(Aq)=Be(Aq)+OH(aq)Be(OH)2(Aq) = Be(Aq) + 2OH(aq)
BCl3 +Mg4C2 =B4C3 +MgCl28BCl3 + 3Mg4C2 = 2B4C3 + 12MgCl2
B4C3 +Ca3N2 = BN + Ca4C22B4C3 + 4Ca3N2 = 8BN + 3Ca4C2
Bi(NO3)3 + BaCl2= BiCl3+ Ba(NO3)22Bi(NO3)3 + 3BaCl2 = 2BiCl3 + 3Ba(NO3)2
Bi(NO3)3 + BaCl2= BiCl3+ Ba(NO3)22Bi(NO3)3 + 3BaCl2 = 2BiCl3 + 3Ba(NO3)2
BCl3 +Mg4C2 = B4C3 +MgCl28BCl3 + 3Mg4C2 = 2B4C3 + 12MgCl2
Br2 + KOH = KBr + KBrO3 + H2O3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
B4C3 +Ca3N2 = BN +Ca4C22B4C3 + 4Ca3N2 = 8BN + 3Ca4C2
BCl3 +Mg4C2 = B4C3 +MgCl28BCl3 + 3Mg4C2 = 2B4C3 + 12MgCl2
Ba3(PO4)2 + Na2SO4 = BaSO4 + Na3PO4Ba3(PO4)2 + 3Na2SO4 = 3BaSO4 + 2Na3PO4
BaCl2(aq)+2AgNO3(aq)=Ba(NO3)2+2AgCl(aq)BaCl2(aq) + 2AgNO3(aq) = Ba(NO3)2 + 2AgCl(aq)
BiCl3+H2S=Bi2S3+HCl2BiCl3 + 3H2S = Bi2S3 + 6HCl
BaCl2(aq)+Na2SO4(aq)=BaSO4(s)+NaCl(aq)BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaCl(aq)
Ba3(PO4)2 + Na2SO4 = BaSO4 + Na3PO4Ba3(PO4)2 + 3Na2SO4 = 3BaSO4 + 2Na3PO4
Bi + Fe + H2O = BiO3 + 2Fe2+ + HBi + 0Fe + 3H2O = BiO3 + 0Fe2+ + 6H
Bi + Fe + H2O = BiO3 + 2Fe2+ + HBi + 0Fe + 3H2O = BiO3 + 0Fe2+ + 6H
Bi + Fe + H2O = BiO3 + Fe2+ + HBi + 0Fe + 3H2O = BiO3 + 0Fe2+ + 6H
Br2+NaI=NaBr+I2Br2 + 2NaI = 2NaBr + I2
Br2+H2O+Na2S2O3 = 2NaBr+H2SO4+SBr2 + H2O + Na2S2O3 = 2NaBr + H2SO4 + S
BCl3 +Mg4C2 = B4C3 +MgCl28BCl3 + 3Mg4C2 = 2B4C3 + 12MgCl2
B4C3 +Ca3N2 = BN + Ca4C22B4C3 + 4Ca3N2 = 8BN + 3Ca4C2
B4C3 +Ca3N2 = BN + Ca4C22B4C3 + 4Ca3N2 = 8BN + 3Ca4C2
B4C3 +Ca3N2 = BN +Ca4C22B4C3 + 4Ca3N2 = 8BN + 3Ca4C2
Br2 + 2KI = I2 + KBrBr2 + 2KI = I2 + 2KBr
Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + NaNO33Ba(NO3)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaNO3
BCl3 +Mg4C2 = B4C3 +MgCl28BCl3 + 3Mg4C2 = 2B4C3 + 12MgCl2
BCl3+Mg4C2=B4C3+MgCl28BCl3 + 3Mg4C2 = 2B4C3 + 12MgCl2
B4C3+Ca3N2=BN+Ca4C22B4C3 + 4Ca3N2 = 8BN + 3Ca4C2
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Bi + O2 = Bi2O74Bi + 7O2 = 2Bi2O7
B2H6(l)+O2(g)=B2O3(s)+H2O(l)B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
BaCl2+H3PO4=Ba3(PO4)2+HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
Ba(NO3)2(aq)+Na2SO4(aq)=BaSO4(s)+NaNO3(aq)Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaNO3(aq)
Ba+ Al 3+ = Al + Ba 2+2Ba + Al3+ = 3Al + Ba2+
BaCO3 + HBr = BaBr2 + H2O + CO2BaCO3 + 2HBr = BaBr2 + H2O + CO2
B2(CO3)3+NH3+H2O = B(OH)3+(NH4)2CO3B2(CO3)3 + 6NH3 + 6H2O = 2B(OH)3 + 3(NH4)2CO3
BaCl2+H 2 SO4= BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Br + Cl = BrClBr + Cl = BrCl
BCl3 + P4 + H2 = BP + HCl 4BCl3 + P4 + 6H2 = 4BP + 12HCl
BaCl2 + H2SO4 = BaSO4 + HCl BaCl2 + H2SO4 = BaSO4 + 2HCl
Ba+ O2 =BaO2Ba + O2 = 2BaO
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
BiCl3+H2S=Bi2S3+HCl2BiCl3 + 3H2S = Bi2S3 + 6HCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba(HCO3)2 (s) + HCl (aq) = BaCl2 (aq) + H2O (l) + CO2 (g)Ba(HCO3)2(s) + 2HCl(aq) = BaCl2(aq) + 2H2O(l) + 2CO2(g)
Ba(HCO3)2 (s) + HCl (aq) = BaCl2 (aq) + H2O (l) + CO2 (g)Ba(HCO3)2(s) + 2HCl(aq) = BaCl2(aq) + 2H2O(l) + 2CO2(g)
Ba3N2 + 6 H2O = 3 Ba(OH)2 + 2 NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Ba(NO3)2 + K2SO4 = BaSO4 + KNO3Ba(NO3)2 + K2SO4 = BaSO4 + 2KNO3
Br2(l) + KI(aq) = KBr(aq) + I2(g)Br2(l) + 2KI(aq) = 2KBr(aq) + I2(g)
Ba(NO3)2 + CuSO4 = BaSO4 + Cu(NO3)2Ba(NO3)2 + CuSO4 = BaSO4 + Cu(NO3)2
Ba(OH)2(aq) + H3PO4(aq) = Ba3(PO4)2(aq) + H2O(l) 3Ba(OH)2(aq) + 2H3PO4(aq) = Ba3(PO4)2(aq) + 6H2O(l)
Ba2S2+(NH4)3(PO4)=Ba3(PO4)2+(NH4)2S3Ba2S2 + 4(NH4)3(PO4) = 2Ba3(PO4)2 + 6(NH4)2S
B2H6 (l) + 3 O2 (g) = B2O3 (s) + 3 H2O (l)B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
B(ClO2)3 = BCl3 + O2B(ClO2)3 = BCl3 + 3O2
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2+Na2SO4=BaSO4+2NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2+Na2SO4=BaSO4+2NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba3N2 + K=K3N + BaBa3N2 + 6K = 2K3N + 3Ba
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Br + Cl = BrClBr + Cl = BrCl
BaS(aq) + Li2SO4(aq) = BaSO4(s) + Li2S(aq)BaS(aq) + Li2SO4(aq) = BaSO4(s) + Li2S(aq)
BaS(aq) + Li2SO4(aq) = BaSO4(s) + Li2S(aq)BaS(aq) + Li2SO4(aq) = BaSO4(s) + Li2S(aq)
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
Ba(NO3)2+Na3(PO4)=Ba3(PO4)2+Na(NO3)3Ba(NO3)2 + 2Na3(PO4) = Ba3(PO4)2 + 6Na(NO3)
Ba(NO3)2+Na3(PO4)=Ba3(PO4)2+Na(NO3)3Ba(NO3)2 + 2Na3(PO4) = Ba3(PO4)2 + 6Na(NO3)
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
Ba(C2H3O2) +K2CrO4 = Ba2CrO4 +KC2H3O22Ba(C2H3O2) + K2CrO4 = Ba2CrO4 + 2KC2H3O2
Ba(C2H3O2) +CaCl2 = BaCl2 + CaC2H3O2Ba(C2H3O2) + CaCl2 = BaCl2 + CaC2H3O2
Ba(C2H3O2) +CaCl2 = BaCl2 CaC2H3O2Ba(C2H3O2) + CaCl2 = BaCl2CaC2H3O2
BaCl2+Al2(SO4)3=3BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Ba(C2H3O2)= Ba+ C2H3O2Ba(C2H3O2) = Ba + C2H3O2
Ba+H20=BaH20Ba + H20 = BaH20
Ba+H20=BaH20Ba + H20 = BaH20
BaF2 + NaNO3 = Ba(NO3)2 + NaFBaF2 + 2NaNO3 = Ba(NO3)2 + 2NaF
BaCl2+H3PO4=Ba3(PO4)2+HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BaCl2 (aq) + 2KI (aq) = BaI2 + 2KClBaCl2(aq) + 2KI(aq) = BaI2 + 2KCl
BaCO3(s) = BaO(s) + CO2(g)BaCO3(s) = BaO(s) + CO2(g)
BaCO3(s) = BaO(s) + CO2(g)BaCO3(s) = BaO(s) + CO2(g)
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq) 3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq) BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BaCl2+KI=KCl2+BaIBaCl2 + KI = KCl2 + BaI
Br2+KI=I2+2KBrBr2 + 2KI = I2 + 2KBr
B2O3+C=B4C3+CO22B2O3 + 6C = B4C3 + 3CO2
BaCl2(aq)+ KOH(aq) = BaK(s) +Cl2OHBaCl2(aq) + KOH(aq) = BaK(s) + Cl2OH
Ba3N2 + AgNO3 = Ag + BaNO3 +Ba3N2Ba3N2 + 0AgNO3 = 0Ag + 0BaNO3 + Ba3N2
BaCl2(aq) + H2SO4(aq) = BaSO4(s) + HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Ba(OH)2 + NiCl2 = BaCl2 + Ni(OH)2Ba(OH)2 + NiCl2 = BaCl2 + Ni(OH)2
Ba(OH)2(s)+H2SO4(aq)=BaSO4(s)+H2O(l)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BaO2+H2SO4=BaSO4+H2O2BaO2 + H2SO4 = BaSO4 + H2O2
Ba(NO3)2+Na2CrO4=BaCrO4+NaNO3Ba(NO3)2 + Na2CrO4 = BaCrO4 + 2NaNO3
BaO+Al=Al2O3+Ba3BaO + 2Al = Al2O3 + 3Ba
Ba(OH)2 + HCl = BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(NO3)2(aq) + NaCl (aq) = BaNa2 + NO3ClBa(NO3)2(aq) + 2NaCl(aq) = BaNa2 + 2NO3Cl
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BeSO4 + NH4OH = Be(OH)2 + (NH4)2SO4BeSO4 + 2NH4OH = Be(OH)2 + (NH4)2SO4
BN + Ca4C2 =B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BN + Ca4C2 =B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BN + Ca4C2 =B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BN + Ca4C2=B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BN + Ca4C2 =B4C3+Ca3N28BN + 3Ca4C2 = 2B4C3 + 4Ca3N2
BaCl2 +2H2SO4=2BaSO4 +4 HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2 +2H2SO4=2BaSO4 +4 HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2 +2H2SO4=2BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Ba(NO3)+(NH4)(CO3)=(NH4)(NO3)+Ba(CO3)Ba(NO3) + (NH4)(CO3) = (NH4)(NO3) + Ba(CO3)
Ba(NO3)+(NH4)(PO4)=(NH4)(NO3)+Ba(PO4)Ba(NO3) + (NH4)(PO4) = (NH4)(NO3) + Ba(PO4)
Ba(OH)2(aq) + HCl(aq) = BaCl2(aq) + H2O (g)Ba(OH)2(aq) + 2HCl(aq) = BaCl2(aq) + 2H2O(g)
Ba(OH)2(aq) + HCl(aq) = BaCl2(aq) + H2O (g)Ba(OH)2(aq) + 2HCl(aq) = BaCl2(aq) + 2H2O(g)
Bi (s) + O2 (g)= Bi2O3 (s)4Bi(s) + 3O2(g) = 2Bi2O3(s)
Ba(OH)2(aq)+H2SO4(s)=BaSO4(s)+H2O(l)Ba(OH)2(aq) + H2SO4(s) = BaSO4(s) + 2H2O(l)
Ba + H2SO4 = H2 + BaSO4Ba + H2SO4 = H2 + BaSO4
Ba(OH)2(aq)+H2SO4(s)=BaSO4(s)+H2O(l)Ba(OH)2(aq) + H2SO4(s) = BaSO4(s) + 2H2O(l)
BaO 2 (s)+ H 2 S O 4 (aq)= BaSO 4 (s)+ H 2 O 2 (aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCl2+Al2(SO4)3=3BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BaSO4 + K3PO4=Ba3(PO4)2 + K2SO43BaSO4 + 2K3PO4 = Ba3(PO4)2 + 3K2SO4
Br2(l) + KI(aq)=I2(aq) + KBr(aq)Br2(l) + 2KI(aq) = I2(aq) + 2KBr(aq)
BaCl2+Na2SO4=NaCl+BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba(C2O4) + K(IO3) = Ba(IO3)2 + K2(C2O4)Ba(C2O4) + 2K(IO3) = Ba(IO3)2 + K2(C2O4)
Bi2(So4)3(aq) + 6 NH4OH(aq) = 2 Bi(OH)3 + 3 (NH4)2So4Bi2(So4)3(aq) + 6NH4OH(aq) = 2Bi(OH)3 + 3(NH4)2So4
Bi2(So4)3 + 6 NH4OH = 2 Bi(OH)3 + 3 (NH4)2So4Bi2(So4)3 + 6NH4OH = 2Bi(OH)3 + 3(NH4)2So4
BaCl2(aq)+ Na3PO4(aq)= Ba3(PO4)2(s) + NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BCl3(s)+ H2O(l)= H3BO3(aq) + HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
Ba(NO3)2+Fe2(SO4)3=BaSO4+Fe(NO3)33Ba(NO3)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(NO3)3
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
BaCl2+H2So4=BaSo4+HClBaCl2 + H2So4 = BaSo4 + 2HCl
Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
BeSO4(s) = BeO(s) + SO3(g)BeSO4(s) = BeO(s) + SO3(g)
Bi2S3 + HCl = BiCl3 + H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
BeBr2 + H3PO4 = HBr +Be3(PO4)23BeBr2 + 2H3PO4 = 6HBr + Be3(PO4)2
Bi2+ + S3- = Bi2S3Bi2+ + S3- = Bi2S3
Ba(OH)2(s)+H2SO4(aq)=BaSO4(s)+H2O(l)Ba(OH)2(s) + H2SO4(aq) = BaSO4(s) + 2H2O(l)
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BaNO3+KSO4=BaSO4+KNO3BaNO3 + KSO4 = BaSO4 + KNO3
B2H6(l)+O2(g)=B2O3(s)+H2O(l)B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
BaCl2+Al2(SO4)3=3BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BaCl2 + Na2(SO4) = Ba(SO4) + NaClBaCl2 + Na2(SO4) = Ba(SO4) + 2NaCl
B+KOH= K3BO3+ H22B + 6KOH = 2K3BO3 + 3H2
B r 2 (l)+KCl O 3 (aq)+ H 2 O(l)=HBr O 3 (aq)+KCl(aq)3Br2(l) + 5KClO3(aq) + 3H2O(l) = 6HBrO3(aq) + 5KCl(aq)
BaCl2(aq)+Al2(SO4)3(aq)=3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
Ba(CN)2 + H2SO4 = BaSO4 + HCNBa(CN)2 + H2SO4 = BaSO4 + 2HCN
BaCl2(aq)+Al2(SO4)3(aq)=3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
Ba(OH)2+H2SO4=BaSO4+H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(OH)2+H2SO4=BaSO4+H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba3N2 + NaNO3 = Ba(NO3)2 + Na3NBa3N2 + 6NaNO3 = 3Ba(NO3)2 + 2Na3N
BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
Ba(ClO4)2 (aq) + Na2SO4 (aq) = NaClO4 (aq) + BaSO4 (aq) Ba(ClO4)2(aq) + Na2SO4(aq) = 2NaClO4(aq) + BaSO4(aq)
Ba(ClO4)2 (aq) + Na2SO4 (aq) = NaClO4 (aq) + BaSO4 (s) Ba(ClO4)2(aq) + Na2SO4(aq) = 2NaClO4(aq) + BaSO4(s)
BaO2(s) + H2So4(aq) = BaSo4(s) + H2O2(aq)BaO2(s) + H2So4(aq) = BaSo4(s) + H2O2(aq)
BaBr2 + FeSO4 = BaSO4 + FeBr2BaBr2 + FeSO4 = BaSO4 + FeBr2
Ba(NO3)2 + AlBr3 = BaBr2 + Al(NO3)33Ba(NO3)2 + 2AlBr3 = 3BaBr2 + 2Al(NO3)3
Ba(NO3)2+NaCl=BaCl2+NaNO3Ba(NO3)2 + 2NaCl = BaCl2 + 2NaNO3
Ba(OH)2 +Pb(ClO)4 = Ba(ClO)2+Pb(OH)42Ba(OH)2 + Pb(ClO)4 = 2Ba(ClO)2 + Pb(OH)4
Ba+HCl=H+BaClBa + HCl = H + BaCl
Ba (C2H3O2)2 + Pb = Ba (OH)2 + HC2H3O2 + Pb0Ba(C2H3O2)2 + Pb = 0Ba(OH)2 + 0HC2H3O2 + Pb
BaCl2 + Na3PO4 = Ba3(PO4)2 + NaCl3BaCl2 + 2Na3PO4 = Ba3(PO4)2 + 6NaCl
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCO3 + HNO3 = Ba(NO3)2 + H2CO3BaCO3 + 2HNO3 = Ba(NO3)2 + H2CO3
BaCO3 + HNO3 = Ba(NO3)2 + H2CO3BaCO3 + 2HNO3 = Ba(NO3)2 + H2CO3
Ba+H2SO4(aq)=H2+BaSO4Ba + H2SO4(aq) = H2 + BaSO4
Ba+H2SO4(aq)=H2+BaSO4Ba + H2SO4(aq) = H2 + BaSO4
Ba+H2SO4(aq)=H2+BaSO4Ba + H2SO4(aq) = H2 + BaSO4
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
Br2+KI=I2+2KBrBr2 + 2KI = I2 + 2KBr
Br2+KI=I2+2KBrBr2 + 2KI = I2 + 2KBr
Ba(NO3)2+K2SO4=BaSO4+KNO3Ba(NO3)2 + K2SO4 = BaSO4 + 2KNO3
Br2 + 12OH- = BrO3- + Br- + 6H2O3Br2 + 6OH- = BrO3- + 5Br- + 3H2O
B2O3+Fe (NO3)2=FeO+B (NO3)3B2O3 + 3Fe(NO3)2 = 3FeO + 2B(NO3)3
Ba(NO3)2+K2SO4=BaSO4+KNO3Ba(NO3)2 + K2SO4 = BaSO4 + 2KNO3
B2S3=B+SB2S3 = 2B + 3S
BaN2O6 + Na3PO4 = BaPO4 + Na3N2O6BaN2O6 + Na3PO4 = BaPO4 + Na3N2O6
BaN2O6 + Na3PO4 = BaPO4 + Na3N2O6BaN2O6 + Na3PO4 = BaPO4 + Na3N2O6
Br2+LiF= LiBr+F2Br2 + 2LiF = 2LiBr + F2
BaCl2(aq)+Al2(SO4)3(aq)=3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
BrF3=Br2+F22BrF3 = Br2 + 3F2
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCl2(aq)+2AgNO3(aq)=Ba(NO3)2(s)+2AgCl(s)BaCl2(aq) + 2AgNO3(aq) = Ba(NO3)2(s) + 2AgCl(s)
Ba(OH)2(aq)+Na3PO4(aq)= Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BaO + NH4Cl= BaCl + NH4OBaO + NH4Cl = BaCl + NH4O
BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
B2H6+O2=H2O+B2O3B2H6 + 3O2 = 3H2O + B2O3
Br2+2V3+ +2H2O=2VO2+ + 4H+ + 2Br-7Br2 + V3+ + 6H2O = 3VO2+ + 12H+ + 14Br-
Ba2 + O2= BaOBa2 + O2 = 2BaO
Br2+KI=I2+KBrBr2 + 2KI = I2 + 2KBr
BaCl 2 + H 3 PO 4= Ba 3 ( PO 4 ) 2 +HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BaCl2(aq)+H2SO4(aq)=BaSO4(aq)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(aq) + 2HCl(aq)
Ba3(PO4)2 + KC2H3O2 = Ba(C2H3O2)2 + K3PO4Ba3(PO4)2 + 6KC2H3O2 = 3Ba(C2H3O2)2 + 2K3PO4
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BrCl3 + H2O = HCl + HBrO2BrCl3 + 2H2O = 3HCl + HBrO2
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BF3(g)+H2O(l)=HF(aq)+H3BO3(aq)BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaCl2(aq) + Na2SO4(aq) = 2NaCl(aq) + BaSO4(s) BaCl2(aq) + Na2SO4(aq) = 2NaCl(aq) + BaSO4(s)
Br+OCl=BrO+ClBr + OCl = BrO + Cl
Be2C + H2O = Be (OH)2 + CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Br2(l)+KI(aq)=I2(s)+2KBr(aq)Br2(l) + 2KI(aq) = I2(s) + 2KBr(aq)
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2+Na2SO4=NaCl+BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BaCl2+Al2S3= BaS+AlCl33BaCl2 + Al2S3 = 3BaS + 2AlCl3
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(OH)2+H2O+P=Ba3(PO4)2+PH39Ba(OH)2 + 6H2O + 16P = 3Ba3(PO4)2 + 10PH3
Ba(OH)2+H2O+P4=Ba3(PO4)2+PH39Ba(OH)2 + 6H2O + 4P4 = 3Ba3(PO4)2 + 10PH3
Ba(OH)2+H2O+P=Ba3(PO4)2+PH39Ba(OH)2 + 6H2O + 16P = 3Ba3(PO4)2 + 10PH3
BF3+H2O=HF+H3BO3BF3 + 3H2O = 3HF + H3BO3
B2O3 + Mg =MgO + BB2O3 + 3Mg = 3MgO + 2B
BF3 + H2O = HF + H3BO3BF3 + 3H2O = 3HF + H3BO3
B4H10+KMnO4+H2SO4=B(OH)3+MnSO4+K2SO4+H2O5B4H10 + 22KMnO4 + 33H2SO4 = 20B(OH)3 + 22MnSO4 + 11K2SO4 + 28H2O
B4H10+KMnO4+H2SO4=H3BO3+MnSO4+K2SO4+H2O5B4H10 + 22KMnO4 + 33H2SO4 = 20H3BO3 + 22MnSO4 + 11K2SO4 + 28H2O
B4H10+KMnO4+H2SO4=H3BO3+MnSO4+K2SO4+H2O5B4H10 + 22KMnO4 + 33H2SO4 = 20H3BO3 + 22MnSO4 + 11K2SO4 + 28H2O
BF3 + H2O = HF + H3BO3BF3 + 3H2O = 3HF + H3BO3
Bi2S3 + O2 = Bi2O3 + SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba + H2O =Ba(OH)2 + H2Ba + 2H2O = Ba(OH)2 + H2
BaCl2 + Na2CO3 = BaCO3 + 2NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
Ba(OH)2(aq)+Na3PO4(aq) = Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Ba3N2 + H2O= Ba(OH)2+ NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
BaO 2 ( s ) = BaO ( s ) + O 2 ( g )2BaO2(s) = 2BaO(s) + O2(g)
Ba(OH)2 + Na3PO4 = Ba3(PO4)2 + NaOH3Ba(OH)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaOH
BeO + C = Be2C + CO22BeO + 2C = Be2C + CO2
BaCO3=BaO+CO2BaCO3 = BaO + CO2
BaO2=BaO+O22BaO2 = 2BaO + O2
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Ba + Ca(NO3)2 = Ba(NO3)2 + CaBa + Ca(NO3)2 = Ba(NO3)2 + Ca
BaCl+NaOH=BaOH + NaClBaCl + NaOH = BaOH + NaCl
BaO2 = BaO + O22BaO2 = 2BaO + O2
Ba(NO3)2 + NaClO3 = Ba(ClO3)2+NaNO3Ba(NO3)2 + 2NaClO3 = Ba(ClO3)2 + 2NaNO3
Ba(NO3)2(aq) + Na2CO3(aq)= BaCO3(s)+NaNO3(aq)Ba(NO3)2(aq) + Na2CO3(aq) = BaCO3(s) + 2NaNO3(aq)
Bi2O3 +H2SO4 = Bi2(SO4)3 + 3H2OBi2O3 + 3H2SO4 = Bi2(SO4)3 + 3H2O
Bi2O3 +H2SO4 = Bi2(SO4)3 + 3H2OBi2O3 + 3H2SO4 = Bi2(SO4)3 + 3H2O
BaCl2(aq)+(NH4)2S(aq)=Ba(NH4)2+SCl2BaCl2(aq) + (NH4)2S(aq) = Ba(NH4)2 + SCl2
BaCl2(aq)+(NH4)2S(aq)=Ba(NH4)2+SCl2BaCl2(aq) + (NH4)2S(aq) = Ba(NH4)2 + SCl2
Ba(OH)2 + HClO2 = Ba(ClO2)2 +H2OBa(OH)2 + 2HClO2 = Ba(ClO2)2 + 2H2O
BaO2 (s) = BaO (s) + O2 (g)2BaO2(s) = 2BaO(s) + O2(g)
BaCl2+Na2CO3=NaCl+BaCO3BaCl2 + Na2CO3 = 2NaCl + BaCO3
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Br- +OCl - + H+ = Cl- +Br +H2O2Br- + OCl- + 2H+ = Cl- + 2Br + H2O
Ba(OH)2 + H2SO3 = H2O + BaSO3Ba(OH)2 + H2SO3 = 2H2O + BaSO3
BaCl2+K2SO4=BaSO4+KClBaCl2 + K2SO4 = BaSO4 + 2KCl
Bi(OH)3(s) + H2SO4(aq)=Bi2(SO4)3 + HOH2Bi(OH)3(s) + 3H2SO4(aq) = Bi2(SO4)3 + 6HOH
BaI2 + FeCl3 = BaCl2 + FeCl2 +I2BaI2 + 2FeCl3 = BaCl2 + 2FeCl2 + I2
BaI2 +FeCl3 = BaCl2 +FeCl2 +I2BaI2 + 2FeCl3 = BaCl2 + 2FeCl2 + I2
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
Ba(s) + HCl(aq)=BaCl2(aq) + H2(g)Ba(s) + 2HCl(aq) = BaCl2(aq) + H2(g)
B2H6+H2O=B2O3 +H2O2-1B2H6 + 9H2O = -1B2O3 + 6H2O2
B2H6+H2O=B2O3 +H2O2-1B2H6 + 9H2O = -1B2O3 + 6H2O2
BF3(g) + H2O(l) = HF(aq) + H3BO3(aq)BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
BaCO3 = BaO +CO2BaCO3 = BaO + CO2
BaCO3 = BaO +CO2BaCO3 = BaO + CO2
BaO(aq)+H3PO4(aq)=(Ba3)(PO4)2+H2O3BaO(aq) + 2H3PO4(aq) = (Ba3)(PO4)2 + 3H2O
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCl2 + H2SO4 = 2HCl + BaSO4BaCl2 + H2SO4 = 2HCl + BaSO4
BaO2(s)+ H2SO4(AQ)=BaSO4(s)+H2O2(AQ)BaO2(s) + H2SO4(AQ) = BaSO4(s) + H2O2(AQ)
BaO2+H2SO4=BaSO4+H2O2BaO2 + H2SO4 = BaSO4 + H2O2
BF3(g) + NaH(s) = B2H6(g) + NaF(s)2BF3(g) + 6NaH(s) = B2H6(g) + 6NaF(s)
Ba + CrO4 +HCl = BaCrO2 +H2O +ClBa + CrO4 + 4HCl = BaCrO2 + 2H2O + 4Cl
B+ O2 = B2O34B + 3O2 = 2B2O3
Bi(s)+O2(g)=Bi2O7(s)4Bi(s) + 7O2(g) = 2Bi2O7(s)
Bi(s)+O2(g)=Bi2O7(s)4Bi(s) + 7O2(g) = 2Bi2O7(s)
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
Ba(OH)2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaOH(aq)3Ba(OH)2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaOH(aq)
BaCl2+MgSO4= BaSO4+MgCl2BaCl2 + MgSO4 = BaSO4 + MgCl2
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCl2(aq)+Al2(SO4)3(aq)=3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
Ba(NO3)2+2NaCl(aq)=BaCl2+NaNO3Ba(NO3)2 + 2NaCl(aq) = BaCl2 + 2NaNO3
BaCl2 (aq) + Al2(SO4)3 (aq) = 3BaSO4(s) + 2AlCl3 (aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaBr2(aq) + (NH4)2CO3(aq) = BaCO3(s) + 2NH4Br(aq)BaBr2(aq) + (NH4)2CO3(aq) = BaCO3(s) + 2NH4Br(aq)
BeCO3 + 2HCl = BeCl2 + H2O + CO2BeCO3 + 2HCl = BeCl2 + H2O + CO2
BaCl 2 (aq)+ H 3 PO 4 (aq)=Ba 3 ( PO 4 ) 2 (s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaO 2 (s)+ H 2 S O 4 (aq)= BaSO 4 (s)+ H 2 O 2 (aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
Ba(OH)2(aq)+MgSO4(aq)=BaSO4(s)+Mg(OH)2(s)Ba(OH)2(aq) + MgSO4(aq) = BaSO4(s) + Mg(OH)2(s)
Br2(l)+K(s)=KBrBr2(l) + 2K(s) = 2KBr
BaCl + NaCO3 = NaCl BaCO3BaCl + NaCO3 = NaClBaCO3
Br2+KI=I2+KBrBr2 + 2KI = I2 + 2KBr
BaCl2(aq)+AgNO3(aq) = BaNO3 (aq) +AgCl2 (aq)BaCl2(aq) + AgNO3(aq) = BaNO3(aq) + AgCl2(aq)
Ba(N O 3 ) 2 +N a 2 S O 4 =BaS O 4 +2NaN O 3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BaCl2(aq)+Al2(SO4)3(aq)=3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
BaCl2(aq)+Al2(SO4)3(aq) = 3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
Ba(OH)2 + Na3PO4 = Ba3(PO4)2 + NaOH3Ba(OH)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaOH
Br2(g)=Br2(l)Br2(g) = Br2(l)
Br2(g)=Br2(l)Br2(g) = Br2(l)
B +KI=BI3 + KB + 3KI = BI3 + 3K
BF3 + H2 = B+HF2BF3 + 3H2 = 2B + 6HF
Ba(NO3)2 + (NH4)2CO3 = BaCO3 + 2NH4NO3Ba(NO3)2 + (NH4)2CO3 = BaCO3 + 2NH4NO3
Ba(OH)2+2HCl=BaCl2+2H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(OH)2+2HCl=BaCl2+2H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(OH)2+2HCl=BaCl2+2H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(OH)2+2HCl=BaCl2+2H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(OH)2+2HCl=BaCl2+2H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(OH)2+2HCl=BaCl2+2H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BaCl2+K=KCl+BaBaCl2 + 2K = 2KCl + Ba
BaO2=BaO+O22BaO2 = 2BaO + O2
BaO2=BaO+O22BaO2 = 2BaO + O2
B(OH)3+H3PO4=BPO4+H2OB(OH)3 + H3PO4 = BPO4 + 3H2O
BaSO4 + NaOH = Ba(OH)2 + Na2SO4BaSO4 + 2NaOH = Ba(OH)2 + Na2SO4
B(OH)3+H3PO4=BPO4+H2OB(OH)3 + H3PO4 = BPO4 + 3H2O
B(OH)3+H3PO4=BPO4+H2OB(OH)3 + H3PO4 = BPO4 + 3H2O
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(N O 3 ) 2 +N a 2 S O 4 =BaS O 4 +2NaN O 3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
B2H6+O=B2O3+H2OB2H6 + 6O = B2O3 + 3H2O
BF3+NaBH4=NaBF4+B2H64BF3 + 3NaBH4 = 3NaBF4 + 2B2H6
Bi2S3(s)+O2(g)=Bi2O3(s)+SO2(g)2Bi2S3(s) + 9O2(g) = 2Bi2O3(s) + 6SO2(g)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BeCl2(s)+LiH(s)=BeH2(s)+LiCl(s)BeCl2(s) + 2LiH(s) = BeH2(s) + 2LiCl(s)
BaCl2+2NaOH=2NaCl+Ba(OH)2BaCl2 + 2NaOH = 2NaCl + Ba(OH)2
Ba(OH)2+FeCl3=BaCl2+Fe(OH)33Ba(OH)2 + 2FeCl3 = 3BaCl2 + 2Fe(OH)3
Ba(OH)2+H2SO4=BaSO4+2H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
BCl2 + Na2SO4 = NaCl + BSO4BCl2 + Na2SO4 = 2NaCl + BSO4
Ba(OH)2+H3PO4=BaHPO4+H2OBa(OH)2 + H3PO4 = BaHPO4 + 2H2O
Ba(NO3)2+Na2SO4=BaSO4+NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(NO3)2+H2SO4 = BaSO4+HNO3Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
Ba(NO3)2 + Na2CO3 = BaCO3 + NaNO3Ba(NO3)2 + Na2CO3 = BaCO3 + 2NaNO3
Ba(NO3)2 + H2SO4 = BaSO4(s) + HNO3Ba(NO3)2 + H2SO4 = BaSO4(s) + 2HNO3
Ba(NO 3 ) 2 ( aq ) + H 2 SO 4 ( aq ) = BaSO 4 ( s ) + HNO 3 ( aq )Ba(NO3)2(aq) + H2SO4(aq) = BaSO4(s) + 2HNO3(aq)
Ba + CH3CHOH = (C2H5O)2BaBa + 2CH3CHOH = (C2H5O)2Ba
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BCl3(s)+H2O(l)=H3BO3(aq)+HCl(aq)BCl3(s) + 3H2O(l) = H3BO3(aq) + 3HCl(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BeI2 + SrSo4=BeSo4+SrI2BeI2 + SrSo4 = BeSo4 + SrI2
BeI2 + SrSo4=BeSo4+SrI2BeI2 + SrSo4 = BeSo4 + SrI2
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B + H2 = BH2B + H2 = BH2
B + H2 = BH2B + H2 = BH2
B + H2 = BH2B + H2 = 2BH
B + H2 = B2H4B + H2 = 2B2H
Ba(NO3)2+Na2CO3=BaCO3+NaNO3Ba(NO3)2 + Na2CO3 = BaCO3 + 2NaNO3
Ba(NO3)2+H2SO4=BaSO4+HNO3Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
Br2 + H2O + SO2 = HBr + H2SO4Br2 + 2H2O + SO2 = 2HBr + H2SO4
BaSO4 + C6H12 = Ba + H2O + C + S3BaSO4 + 2C6H12 = 3Ba + 12H2O + 12C + 3S
B2H6 + O2 = B2O3 +H2OB2H6 + 3O2 = B2O3 + 3H2O
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
B2H6+O2=B2O3+H2OB2H6 + 3O2 = B2O3 + 3H2O
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BF3 + Li2 SO3 = B2 ( SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
BaCl2(aq)+Na2SO4(aq)= BaSO4(s)+NaCl(aq)BaCl2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaCl(aq)
BH4+CH3OH=B(OCH3)4+H2BH4 + 4CH3OH = B(OCH3)4 + 4H2
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
Br2+I2=IBr33Br2 + I2 = 2IBr3
BaO2(s)=BaO(s)+O2(g)2BaO2(s) = 2BaO(s) + O2(g)
B2H6 (l) + O2 (g) = B2O3 (s) + H2O (l )B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
Ba(OH)2+H3+PO4=Ba3(PO4)2+H2O3Ba(OH)2 + 2H3 + 2PO4 = Ba3(PO4)2 + 6H2O
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba(NO3)2(aq) + Na2SO4(aq)=BaSO4(s)+NaNO3(aq)Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4(s) + 2NaNO3(aq)
BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq) BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq) BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
Ba3N2 + H2O = Ba(OH)2 + NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Br2 + KOH = KBr + KBrO3 + H2O3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
Ba(NO3)2 + K2CO3 = BaCO3+ KNO3Ba(NO3)2 + K2CO3 = BaCO3 + 2KNO3
BaCl2 + 2NaOH = 2NaCl + Ba(OH)2BaCl2 + 2NaOH = 2NaCl + Ba(OH)2
BaCl2 + 2NaOH = 2NaCl + Ba(OH)2BaCl2 + 2NaOH = 2NaCl + Ba(OH)2
Ba(OH)2+HCl=BaCl2+H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
BaO2 + H2SO4 = H2O + BaSO4 + O22BaO2 + 2H2SO4 = 2H2O + 2BaSO4 + O2
Be2C(s) + H2O(l) = Be(OH)2(s) + CH4(g)Be2C(s) + 4H2O(l) = 2Be(OH)2(s) + CH4(g)
Ba3(PO4)2(aq)+Zn(NO3)2(aq)=Zn3(PO4)2(s)+Ba(NO3)2(aq)Ba3(PO4)2(aq) + 3Zn(NO3)2(aq) = Zn3(PO4)2(s) + 3Ba(NO3)2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
BaS+MnSO4=BaSO4+MnSBaS + MnSO4 = BaSO4 + MnS
Be(ClO3)2=BeCl2+3O2Be(ClO3)2 = BeCl2 + 3O2
BaO2+H2SO4=BaSO4+H2O2BaO2 + H2SO4 = BaSO4 + H2O2
Be(s) + H2SO4(aq) = BeSO4(aq) + H2(g) Be(s) + H2SO4(aq) = BeSO4(aq) + H2(g)
Be(s) + H2SO4(aq) = BeSO4(aq) + H2(g)Be(s) + H2SO4(aq) = BeSO4(aq) + H2(g)
Ba(ClO3)2=BaCl2+O2Ba(ClO3)2 = BaCl2 + 3O2
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
BaCl2 + Na2SO4 = BaSO4 + NaCl BaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(s) +H2O(l) = H2(g) +Ba(OH) 2(aq) Ba(s) + 2H2O(l) = H2(g) + Ba(OH)2(aq)
Ba(OH)2 + H2SO4 = H2O +BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2(aq) + 2NaF(aq) = 2NaCl(aq) + BaF2(s)BaCl2(aq) + 2NaF(aq) = 2NaCl(aq) + BaF2(s)
BaCl2(aq) + 2NaF(aq) = 2NaCl(aq) + BaF2(s)BaCl2(aq) + 2NaF(aq) = 2NaCl(aq) + BaF2(s)
BaCl 2 (aq)+ H 3 PO 4 (aq)= Ba 3 ( PO 4 ) 2 (s)+HCl(aq)3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HCl(aq)
B2S3 = B+SB2S3 = 2B + 3S
B2S3 = B+SB2S3 = 2B + 3S
B2S3 = B+SB2S3 = 2B + 3S
BaCl + NaOH = BaOH + NaClBaCl + NaOH = BaOH + NaCl
Ba+H2SO4=BaSO4+SO2+H2OBa + 2H2SO4 = BaSO4 + SO2 + 2H2O
Ba(OH)2+HCl=BaCl2+H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
B2H6(l)+O2(g)=B2O3(s)+H2O(l)B2H6(l) + 3O2(g) = B2O3(s) + 3H2O(l)
Ba(s) + AgNO3(aq) = Ba(NO3)2(aq) + Ag(s)Ba(s) + 2AgNO3(aq) = Ba(NO3)2(aq) + 2Ag(s)
Ba(s) + AgNO3(aq) = Ba(NO3)2(aq) + Ag(s)Ba(s) + 2AgNO3(aq) = Ba(NO3)2(aq) + 2Ag(s)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
Ba(NO3)2(s) = Ba(NO2)2(s) + O2(g)Ba(NO3)2(s) = Ba(NO2)2(s) + O2(g)
BaSO4(s) = BaO(s) + SO3(g)BaSO4(s) = BaO(s) + SO3(g)
BA + H2SO4 = BASO4 + H2BA + H2SO4 = BASO4 + H2
BA + H2SO4 = BASO4 + H2BA + H2SO4 = BASO4 + H2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.