Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
Br + KCl = K + BrClBr + KCl = K + BrCl
Ba + Sn2(CO3)3 = BaSn + CO32Ba + Sn2(CO3)3 = 2BaSn + 3CO3
Ba + Sn2(CO3)3 = Ba(CO3) + Sn3Ba + Sn2(CO3)3 = 3Ba(CO3) + 2Sn
Ba(OH)2+HCl=BaCl2+H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(OH)2(s) + HCl(aq) = BaCl2(aq) + H2O(l)Ba(OH)2(s) + 2HCl(aq) = BaCl2(aq) + 2H2O(l)
BaO2(s) + H2O(l) = Ba(OH)2(aq) + O2(g)2BaO2(s) + 2H2O(l) = 2Ba(OH)2(aq) + O2(g)
Ba(NO3)2 + Na2SO4 = BaSO4 +NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BaCl2+Cs2SO4=BaSO4+CsClBaCl2 + Cs2SO4 = BaSO4 + 2CsCl
BaCl2+Cs2SO4=BaSO4+CsClBaCl2 + Cs2SO4 = BaSO4 + 2CsCl
Ba + Mg(OH)2 = Ba(OH)2 + MgBa + Mg(OH)2 = Ba(OH)2 + Mg
BaCl2 (Ag) + H2SO4 (Ag) = BaSO4 (s) + HCl (Ag) BaCl2(Ag) + H2SO4(Ag) = BaSO4(s) + 2HCl(Ag)
Br2(l)+I2(s)=IBr3(g)3Br2(l) + I2(s) = 2IBr3(g)
Ba(OH)2 + HNO3 =Ba(NO3 ) 2 + H2 OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Ba +O2=BaO2Ba + O2 = 2BaO
Bi(NO3)3(aq)+NaOH(aq)=Bi(OH)3(aq)+NaNO3(aq)Bi(NO3)3(aq) + 3NaOH(aq) = Bi(OH)3(aq) + 3NaNO3(aq)
Bi(NO3)3(aq)+NaOH(aq)=Bi(OH)3(aq)+NaNO3(aq)Bi(NO3)3(aq) + 3NaOH(aq) = Bi(OH)3(aq) + 3NaNO3(aq)
Bi(NO3)3(aq)+NaOH(aq)=Bi(OH)3(aq)+NaNO3(aq)Bi(NO3)3(aq) + 3NaOH(aq) = Bi(OH)3(aq) + 3NaNO3(aq)
Bi(NO3)3(aq)+NaOH(aq)=Bi(OH)3(aq)+NaNO3(aq)Bi(NO3)3(aq) + 3NaOH(aq) = Bi(OH)3(aq) + 3NaNO3(aq)
Ba(CN)2 + F2 = BaF2 + CNBa(CN)2 + F2 = BaF2 + 2CN
Ba+L2=BaL2Ba + L2 = BaL2
Ba+L2=BaL2Ba + L2 = BaL2
Ba(OH)2(s) + HCl(aq) = BaCl2(aq) + H2O(l)Ba(OH)2(s) + 2HCl(aq) = BaCl2(aq) + 2H2O(l)
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BeCl2 + 2AgNo3 = Be (No3)2 + 2AgClBeCl2 + 2AgNo3 = Be(No3)2 + 2AgCl
Ba (OH)2=BaO+H2OBa(OH)2 = BaO + H2O
Br2+KI=I2+KBrBr2 + 2KI = I2 + 2KBr
Br2+KI=I2+KBrBr2 + 2KI = I2 + 2KBr
Ba(OH)2 + HCl = BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(HCO3)2 = BaCO3 + H2O + CO2Ba(HCO3)2 = BaCO3 + H2O + CO2
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BrO3- + I- + H+ = Br- + I2 + 4H2OBrO3- + 6I- + 6H+ = Br- + 3I2 + 3H2O
BaBr2 + Li2SO4= BaLi2 + Br2SO4BaBr2 + Li2SO4 = BaLi2 + Br2SO4
BaCl2 + N2=Ba3N2 + Cl3BaCl2 + N2 = Ba3N2 + 6Cl
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Br2 + H2O + SO2 = HBr + H2SO4Br2 + 2H2O + SO2 = 2HBr + H2SO4
BaO2(s)=BaO(s)+O2(g)2BaO2(s) = 2BaO(s) + O2(g)
Ba(OH)2+H3PO4=BaHPO4+H2OBa(OH)2 + H3PO4 = BaHPO4 + 2H2O
BaCl2 + H2O = Ba(OH)2 + HClBaCl2 + 2H2O = Ba(OH)2 + 2HCl
Ba (HCO3)2 (s)= BaCO3 (s)+H2O (g)+CO2 (g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
B2H6 + H2O = H3BO3 + H2B2H6 + 6H2O = 2H3BO3 + 6H2
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
Ba(CO3) + (SO3) + O2 = Ba(SO4) + CO2Ba(CO3) + (SO3) + 0O2 = Ba(SO4) + CO2
Ba(NO3)2+Na2SO4 = BaSO4+NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BaO2+H2SO4=BaSO4+H2O2BaO2 + H2SO4 = BaSO4 + H2O2
Ba(OH)2+CO2=BaCO3+H2OBa(OH)2 + CO2 = BaCO3 + H2O
Ba + Cl2 = BaCl2Ba + Cl2 = BaCl2
Ba3N2 + H2O = Ba(OH)2 + NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Ba(SO4)+Na2CO3=Na +SO4+Ba(CO3)Ba(SO4) + Na2CO3 = 2Na + SO4 + Ba(CO3)
Br2+NaCl=BrCl+NaBr2 + 2NaCl = 2BrCl + 2Na
BaCO3=BaO+CO2BaCO3 = BaO + CO2
BaCO3=BaO+CO2BaCO3 = BaO + CO2
Br2+O2=Br2O2Br2 + O2 = Br2O2
Ba(C2H3O2)2 + Li3PO4 = Ba3(PO4)2 + LiC2H3O23Ba(C2H3O2)2 + 2Li3PO4 = Ba3(PO4)2 + 6LiC2H3O2
Be + H2SO4 = BeSO4 + H2Be + H2SO4 = BeSO4 + H2
BCl3+ H2O =B(OH)3+ HClBCl3 + 3H2O = B(OH)3 + 3HCl
B+S = BSB + S = BS
Br2 + NaOH = NaBrO3 + NaBr + H2O 3Br2 + 6NaOH = NaBrO3 + 5NaBr + 3H2O
Ba(CO3)+O2=BaO+CO2Ba(CO3) + 0O2 = BaO + CO2
Ba(OH)2 + 2HCl = BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
B2Cl4+H2O=H3BO3+HCl+H2B2Cl4 + 6H2O = 2H3BO3 + 4HCl + H2
BI3+NH3 =B2(NH)3+NH4I2BI3 + 9NH3 = B2(NH)3 + 6NH4I
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
Ba(NO3)2=Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
Ba(NO3)2=Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
Ba(NO3)2=Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
Ba(NO3)2=Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
Ba(NO3)2=Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
Ba(NO3)2 = Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
Ba(NO3)2 = Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
Ba(NO3)2 = Ba+2 + NO3-Ba(NO3)2 = Ba+2 + 2NO3-
BaCl2+F2= BaF+ClF2BaCl2 + 3F2 = 2BaF + 4ClF
B10H18 + O2 = B2O3 + H2OB10H18 + 12O2 = 5B2O3 + 9H2O
B10H18 + O2 = B2O3 + H2OB10H18 + 12O2 = 5B2O3 + 9H2O
Ba(OH)2+ AlBr3= Al(OH)3+ BaBr23Ba(OH)2 + 2AlBr3 = 2Al(OH)3 + 3BaBr2
BaCl2(aq) + Na2SO3(aq) = BaSO3 + NaClBaCl2(aq) + Na2SO3(aq) = BaSO3 + 2NaCl
BaCl2(aq) + Na2SO3(aq) = BaSO3(s) + NaCl(aq)BaCl2(aq) + Na2SO3(aq) = BaSO3(s) + 2NaCl(aq)
Bi+H2SO4=Bi(SO4)3+SO2+H2OBi + 6H2SO4 = Bi(SO4)3 + 3SO2 + 6H2O
Be+O2=BeO2Be + O2 = 2BeO
Ba(OH)2+H2SO4=H2O+BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
BCl3+P4+H2=BP+HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
Ba(C2O4) + K(IO3) = Ba(IO3)2 + K2(C2O4)Ba(C2O4) + 2K(IO3) = Ba(IO3)2 + K2(C2O4)
Ba(ClO3)2 (s)=BaCl2 (s) + 2O2 (g)Ba(ClO3)2(s) = BaCl2(s) + 3O2(g)
Ba(ClO3)2= BaCl2+2O2(g)Ba(ClO3)2 = BaCl2 + 3O2(g)
Br2+ KClO3+H2O=HBrO+KCl3Br2 + KClO3 + 3H2O = 6HBrO + KCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Bi(NO3)3+Al2(SO4)3=Bi2(SO4)3+Al(NO3)32Bi(NO3)3 + Al2(SO4)3 = Bi2(SO4)3 + 2Al(NO3)3
B2O3+H2O=H3BO3B2O3 + 3H2O = 2H3BO3
Ba (OH)2=BaO+H2OBa(OH)2 = BaO + H2O
Ba(OH)2+H3PO4=Ba3(PO4)2+H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
Ba(OH)2 + P2O5 = Ba3(PO4)2 + H2O3Ba(OH)2 + P2O5 = Ba3(PO4)2 + 3H2O
BACl2(aq) + H2SO4(aq) = BASO4(s) + HCl(aq)BACl2(aq) + H2SO4(aq) = BASO4(s) + 2HCl(aq)
Ba3(PO4)2+Na2CO3=BaCO3+Na3PO4Ba3(PO4)2 + 3Na2CO3 = 3BaCO3 + 2Na3PO4
Ba(CH3COO)2 = Ba + 4C + 3H2 + 2O2Ba(CH3COO)2 = Ba + 4C + 3H2 + 2O2
Ba(OH)2=BaH2+OBa(OH)2 = BaH2 + 2O
Ba(NO3)2 + Fe2(SO4)3 = BaSO4 + Fe(NO3)33Ba(NO3)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(NO3)3
Be+F2=BeF2Be + F2 = BeF2
BaF2 + K3PO4 = Ba3(PO4)2 + KF3BaF2 + 2K3PO4 = Ba3(PO4)2 + 6KF
B2(CO3)3 + Mg(NO2)2 = B(NO2)3 + MgCO3B2(CO3)3 + 3Mg(NO2)2 = 2B(NO2)3 + 3MgCO3
B2O3 + H2O (l) = B(OH)3(aq)B2O3 + 3H2O(l) = 2B(OH)3(aq)
Ba(OH)2    +    AlCl3   =      Al(OH)3     +    BaCl23Ba(OH)2 + 2AlCl3 = 2Al(OH)3 + 3BaCl2
BaCl2   +    (NH4)2CO3    =     BaCO3       +    NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BF3+H2O=HBF4+H3BO34BF3 + 3H2O = 3HBF4 + H3BO3
B4H10+O2=B2O3+H2O2B4H10 + 11O2 = 4B2O3 + 10H2O
Br2 + KI = KBr + I2Br2 + 2KI = 2KBr + I2
BaCl2 (aq) + K2CrO4 (aq)=BaCrO4 (s) + 2 KCl (aq)BaCl2(aq) + K2CrO4(aq) = BaCrO4(s) + 2KCl(aq)
BaCl2 (aq) + Na2CO3 (aq)= BaCO3 (s) + 2 NaCl (aq)BaCl2(aq) + Na2CO3(aq) = BaCO3(s) + 2NaCl(aq)
BaCl2 (aq) + K2CrO4 (aq)=BaCrO4 (s) + 2 KCl (aq)BaCl2(aq) + K2CrO4(aq) = BaCrO4(s) + 2KCl(aq)
BaCl2 + Na3PO4=Ba3(PO4)2+NaCl3BaCl2 + 2Na3PO4 = Ba3(PO4)2 + 6NaCl
B2Br6 + HNO3 = B(NO3)3 +HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(C2O4)+K(IO3)=Ba(IO3)2+K2(C2O4)Ba(C2O4) + 2K(IO3) = Ba(IO3)2 + K2(C2O4)
BaCl2 + (NH4)2CO3= BaCO3+ NH4Cl BaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BaCO3 + 2 HClO3 = Ba(ClO3)2 + CO2 + H2OBaCO3 + 2HClO3 = Ba(ClO3)2 + CO2 + H2O
BaCl2+H2SO4=BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2(aq)+H2SO4(aq) = BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BaCl2(aq) + Na3PO4(aq) = Ba3(PO4)2(s) + NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BaCl2(aq)+H2SO4(aq)=BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
BeCl2(aq)+2AgNO3(aq)=Be(NO3)2(aq)+2AgCl(s)BeCl2(aq) + 2AgNO3(aq) = Be(NO3)2(aq) + 2AgCl(s)
Ba(ClO3)2=BaCl2+O2Ba(ClO3)2 = BaCl2 + 3O2
Ba(ClO3)2=BaCl2+O2Ba(ClO3)2 = BaCl2 + 3O2
BaS + NaI = BaI2 + Na2SBaS + 2NaI = BaI2 + Na2S
B2Br6+HNO3=B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BACl2(aq) + H2SO4(aq) = BASO4(s) + HCl(aq)BACl2(aq) + H2SO4(aq) = BASO4(s) + 2HCl(aq)
Bi(OH)3+Na2SnO2=Na2SnO3+Bi+H2O2Bi(OH)3 + 3Na2SnO2 = 3Na2SnO3 + 2Bi + 3H2O
Ba + H2O = Ba(OH)2 + H2Ba + 2H2O = Ba(OH)2 + H2
Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BaCl2(aq)+Na3PO4(aq)=Ba3(PO4)2(s)+NaCl(aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
BaCl2 + Na2SO4 =NaCl + BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
BaCl2 + CuSO4 =CuCl2 + BaSO4BaCl2 + CuSO4 = CuCl2 + BaSO4
Ba3N2 + H2O = Ba (OH)2 + NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
BaSO4 = BaO + O2 + SO22BaSO4 = 2BaO + O2 + 2SO2
BaCl2 (aq)+H2SO4 (aq) = BaSO4 (s)+HCl (aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BaCl2 (aq)+H2SO4 (aq) = BaSO4 (s)+HCl (aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BaPo4+HCl=BaCl+HPo4BaPo4 + HCl = BaCl + HPo4
BaCl2(s) + H2SO4(aq)= BaSO4(s) + 2HCl(aq)BaCl2(s) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BaCl2(s) + H2SO4(aq)= BaSO4(s) + HCl(aq)BaCl2(s) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Br2 + KOH = KBrO3 + KBr + H2030Br2 + 60KOH = 20KBrO3 + 40KBr + 3H20
BaO2 (s) = BaO (s) + O2 (g)2BaO2(s) = 2BaO(s) + O2(g)
Ba(OH)2 + Al(C2H3O2)3 = Al(OH)3 + Ba(C2H3O2)23Ba(OH)2 + 2Al(C2H3O2)3 = 2Al(OH)3 + 3Ba(C2H3O2)2
BaO2(s)+H2SO4 = BaSO4+H2O2BaO2(s) + H2SO4 = BaSO4 + H2O2
BaO2(s) + H2SO4(aq)= BaSO4(s) + H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
Br2 + KI = KBr + I2Br2 + 2KI = 2KBr + I2
Ba Br2 + Na2 SO4 = BaSO4 + Na BrBaBr2 + Na2SO4 = BaSO4 + 2NaBr
Ba(OH)2(s) + 2 HCl(aq) = BaCl2(aq) + 2 H2O(l)Ba(OH)2(s) + 2HCl(aq) = BaCl2(aq) + 2H2O(l)
BaCO3+HCl=BaCl2+H2O+CO2BaCO3 + 2HCl = BaCl2 + H2O + CO2
Ba(OH)2 + Na3PO4 = Ba3(PO4)2 + NaOH3Ba(OH)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaOH
Ba(NO3)2 = Ba+2 + NO3- Ba(NO3)2 = Ba+2 + 2NO3-
Ba+Al(OH)3=Ba(OH)+Al3Ba + Al(OH)3 = 3Ba(OH) + Al
BaCl2 + O2 = Ba(ClO3)2BaCl2 + 3O2 = Ba(ClO3)2
B2Br6+HNO3= B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2 + K2CO3 =2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
BF3+Li2SO3=B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Ba(NO3)2+H3PO4=Ba3(PO4)2+HNO33Ba(NO3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNO3
BaCl2 (aq)+H2SO4 (aq) = BaSO4 (s)+HCl (aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BCl3 + P4 + H2 = BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
BeCO3+Cu2SO4=BeSO4+Cu2CO3BeCO3 + Cu2SO4 = BeSO4 + Cu2CO3
BaCl2(aq) + H2SO4(aq) = BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BCl3+P4+H2=BP+HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
Ba3(PO4)2 + Na2SO4 = BaSO4 + Na3(PO4)Ba3(PO4)2 + 3Na2SO4 = 3BaSO4 + 2Na3(PO4)
BCl3+P4+H2=BP+HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
BaCl2(aq)+H2SO4(aq)= BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BCl3 + P4 + H2 = BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
BaCl2+Al= AlCl3+Ba26BaCl2 + 4Al = 4AlCl3 + 3Ba2
Bi2S3=Bi3+S26Bi2S3 = 4Bi3 + 9S2
BaCl2+Al= AlCl3+Ba3BaCl2 + 2Al = 2AlCl3 + 3Ba
BaCl2+Al= AlCl+BaBaCl2 + 2Al = 2AlCl + Ba
Br2+KCl= K+BrClBr2 + 2KCl = 2K + 2BrCl
Br(l) + Al(s) = AlBrBr(l) + Al(s) = AlBr
Br3(l) + Al2(s) = AlBr2Br3(l) + 3Al2(s) = 6AlBr
BaCl2(aq)+H2SO4(aq) = BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BeSO4 = BeO + SO3BeSO4 = BeO + SO3
BH4- + ClO3- = Cl- + H2BO3- + H2O3BH4- + 4ClO3- = 4Cl- + 3H2BO3- + 3H2O
BaCO3(aq)+H2SO4(aq)=BaSO4+H2CO3BaCO3(aq) + H2SO4(aq) = BaSO4 + H2CO3
BaCl2+H2SO3=BaSO3+HClBaCl2 + H2SO3 = BaSO3 + 2HCl
Ba + HNO3 =BaNO3 +H22Ba + 2HNO3 = 2BaNO3 + H2
BaCl2+H2SO3=BaSO3+HClBaCl2 + H2SO3 = BaSO3 + 2HCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba(OH)2 + Fe2(SO4)3 = BaSO4 + Fe(OH)33Ba(OH)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(OH)3
Ba(OH)2 + H3PO4=H2O + Ba3(PO4)23Ba(OH)2 + 2H3PO4 = 6H2O + Ba3(PO4)2
Ba(OH)2 + H3PO4 = H2O + Ba3(PO4)2 3Ba(OH)2 + 2H3PO4 = 6H2O + Ba3(PO4)2
BaCl2(aq)+AgNO3(aq)=Ba(NO3)2(s)+2AgCl(s)BaCl2(aq) + 2AgNO3(aq) = Ba(NO3)2(s) + 2AgCl(s)
BaCl2 + Na2SO4= BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2(aq)+Al2(SO4)3(aq)=3BaSO4(s)+AlCl3(aq)3BaCl2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2AlCl3(aq)
BaCl2 +H2SO4=BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2 + K2SO4 = BaSO4 +KClBaCl2 + K2SO4 = BaSO4 + 2KCl
BCl3 + H2 = B + HCl 2BCl3 + 3H2 = 2B + 6HCl
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Ba+O2=BaO2Ba + O2 = 2BaO
BCl3(g) + H2O(l) = B(OH)3(aq) + HCl(aq)BCl3(g) + 3H2O(l) = B(OH)3(aq) + 3HCl(aq)
Ba(NO3)2 + Na2SO4 = NaNO3 + BaSO4Ba(NO3)2 + Na2SO4 = 2NaNO3 + BaSO4
BaCl2 + Na2CO3 = BaCO3 + NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
BF3 + Li2CO3 = LiF + B2(CO3)32BF3 + 3Li2CO3 = 6LiF + B2(CO3)3
BaO2 = BaO + O22BaO2 = 2BaO + O2
Ba(NO3)2 + NH4IO3 = Ba(IO3)2 +NH4NO3Ba(NO3)2 + 2NH4IO3 = Ba(IO3)2 + 2NH4NO3
BaCl2+AgNO3=AgCl+Ba(NO3)2BaCl2 + 2AgNO3 = 2AgCl + Ba(NO3)2
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Br2(aq) + 2KL(aq) = 2KBr + L2Br2(aq) + 2KL(aq) = 2KBr + L2
Br2 + 2KL= 2KBr + L2Br2 + 2KL = 2KBr + L2
BaCl2 + H2SO4 = BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Ba(NO3)2 + MgSO4 = Mg(NO3)2 + BaSO4 Ba(NO3)2 + MgSO4 = Mg(NO3)2 + BaSO4
Ba(NO3)2 + Na2CO3 = BaCO3 + 2NaNO3 Ba(NO3)2 + Na2CO3 = BaCO3 + 2NaNO3
Ba(OH)2 + MgCl2 = Mg(OH)2 + BaCl2 Ba(OH)2 + MgCl2 = Mg(OH)2 + BaCl2
Ba(OH)2 + MgSO4 =BaSO4 + Mg(OH)2 Ba(OH)2 + MgSO4 = BaSO4 + Mg(OH)2
Ba(OH)2 + SrCl2 = BaCl2 + Sr(OH)2Ba(OH)2 + SrCl2 = BaCl2 + Sr(OH)2
Be (OH)2 + Tl(NO3)3 = Be(NO3)2 + Tl (OH)33Be(OH)2 + 2Tl(NO3)3 = 3Be(NO3)2 + 2Tl(OH)3
BF3+Li2SO3 = B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6+HNO3 = B(NO3)3+HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(NO3)2+Fe2(SO4)3=BaSO4+Fe(NO3)33Ba(NO3)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(NO3)3
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
Ba+H2O=H2+Ba(OH)2Ba + 2H2O = H2 + Ba(OH)2
Ba3N2+6HF=3BaF2+2NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BaCO3(s)=CO2(s)+BaO(s)BaCO3(s) = CO2(s) + BaO(s)
BiCl3 + 3H2S = Bi2S3 + 6HCl2BiCl3 + 3H2S = Bi2S3 + 6HCl
Ba(OH)2(aq) + MgCl2(aq) = BaCl2 + Mg(OH)2Ba(OH)2(aq) + MgCl2(aq) = BaCl2 + Mg(OH)2
Ba(s) + H2O(l) = Ba(OH)2(aq) + H2(g)Ba(s) + 2H2O(l) = Ba(OH)2(aq) + H2(g)
Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + KNO3(aq)Ba(NO3)2(aq) + K2SO4(aq) = BaSO4(s) + 2KNO3(aq)
Ba(s) + H2O(l)=Ba(OH)2(aq) + H2(g)Ba(s) + 2H2O(l) = Ba(OH)2(aq) + H2(g)
BaCl2 + K2O(aq)=BaO(s) + KCl(aq)BaCl2 + K2O(aq) = BaO(s) + 2KCl(aq)
BaCl2 + K2O(aq)=BaO(s) + KCl(aq)BaCl2 + K2O(aq) = BaO(s) + 2KCl(aq)
BaCl2(aq)+H2SO4(aq)=BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
B + S = B2S32B + 3S = B2S3
Be + Br =BeBr2Be + 2Br = BeBr2
Br2 + H2 +2OH- = 2Br- + 2H2OBr2 + H2 + 2OH- = 2Br- + 2H2O
Br2 + H2 +2OH- = 2Br- + 2H2OBr2 + H2 + 2OH- = 2Br- + 2H2O
BaCO3 = BaO + CO2BaCO3 = BaO + CO2
Br2 + LiI = LiBr + I2Br2 + 2LiI = 2LiBr + I2
Bi + Br2 = BiBr32Bi + 3Br2 = 2BiBr3
B2Br6 + 6HNO3 = 2B(NO3)3 + 6HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
B2Br6 + 6HNO3 = 2B(NO3)3 + 6HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BCl3 + H2O = B(OH)3 + HClBCl3 + 3H2O = B(OH)3 + 3HCl
BaI2 + CuSO4 = BaSO4 + CuI2BaI2 + CuSO4 = BaSO4 + CuI2
BaI2 + CuSO4 = BaSO4 + CuI2BaI2 + CuSO4 = BaSO4 + CuI2
BaI2 + CuSO4 = BaSO4 + CuI2BaI2 + CuSO4 = BaSO4 + CuI2
Ba+P = BaPBa + P = BaP
Bi2S3 + HCl =BiCl3 + H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
BaCl2(aq)+H2SO4(aq)=BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Ba(SCN)2+Ag2(C2O4)=Ba2(C2O4)2+Ag(SCN)2Ba(SCN)2 + 2Ag2(C2O4) = Ba2(C2O4)2 + 4Ag(SCN)
Bi2S3 + H2O = OH +Bi + SBi2S3 + 0H2O = 0OH + 2Bi + 3S
Bi2S3 + 6HCl = 2BiCl3 + 3H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
BaCl2 + H2O2 + SO2 = BaSO4 + HClBaCl2 + H2O2 + SO2 = BaSO4 + 2HCl
B(OH)3 + Na2O = Na2B4O7 + H2O4B(OH)3 + Na2O = Na2B4O7 + 6H2O
B(OH)3+Na2O=Na2B4O7+H2O4B(OH)3 + Na2O = Na2B4O7 + 6H2O
B5H9+H2O=B(OH)3+H2B5H9 + 15H2O = 5B(OH)3 + 12H2
BaCO3+C+H2O=CO+Ba(OH)2BaCO3 + C + H2O = 2CO + Ba(OH)2
BaCO3 + HNO3 = Ba(NO3)2 + H2CO3BaCO3 + 2HNO3 = Ba(NO3)2 + H2CO3
Ba(OH)2 = BaO+H2OBa(OH)2 = BaO + H2O
BaO2+H2O=Ba(OH)2+O22BaO2 + 2H2O = 2Ba(OH)2 + O2
Br2 + S2O32- + H2O = Br1- + SO42- + H+103Br2 + 2S2O32- + 104H2O = 206Br1- + 4SO42- + 208H+
BaO2+H2SO4=BaSO4+H2O2BaO2 + H2SO4 = BaSO4 + H2O2
BaO2(s) + H2SO4(aq) =BaSO4(s) + H2O2(aq)BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4 + NaNO3(aq)Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4 + 2NaNO3(aq)
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Br2(l)+I2(s)=IBr3(g)3Br2(l) + I2(s) = 2IBr3(g)
BaCl2+KOH=KCl+Ba(OH)2BaCl2 + 2KOH = 2KCl + Ba(OH)2
BaCl2+KOH=KCl+Ba(OH)2BaCl2 + 2KOH = 2KCl + Ba(OH)2
BaCl+NaOH=BaOH+NaClBaCl + NaOH = BaOH + NaCl
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaO2 + HCl = BaCl2 + H2O2BaO2 + 2HCl = BaCl2 + H2O2
Ba3P2+LiF=BaF2+Li3PBa3P2 + 6LiF = 3BaF2 + 2Li3P
BCl3 + H2O = B(OH)3 + HClBCl3 + 3H2O = B(OH)3 + 3HCl
Bi2(CO3)3 + HC2H3O2 = Bi(C2H3O2)3 + H2CO3Bi2(CO3)3 + 6HC2H3O2 = 2Bi(C2H3O2)3 + 3H2CO3
BCl3 + H2O = B(OH)3 + HClBCl3 + 3H2O = B(OH)3 + 3HCl
BCl3(g) + H2O(l) = B(OH)3(aq) + HCl(aq)BCl3(g) + 3H2O(l) = B(OH)3(aq) + 3HCl(aq)
Ba3N2+H2O=Ba(OH)2+NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Ba3N2+H2O = Ba(OH)2+NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
BaO2 = 2BaO + O22BaO2 = 2BaO + O2
Bi2O3+H2=Bi+H2OBi2O3 + 3H2 = 2Bi + 3H2O
BaCl2 (aq) + H2SO4(aq) = BaSO4(s) + HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Ba3N2 + H2O = Ba(OH)2 + NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Ba3N2 + H2O = Ba(OH)2 + NH3Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
BaCl2+H3PO4=Ba3(PO4)2+HCl3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BaCl2 + H2SO4 = BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
Br + CaCO3 + H2O = CaBr3 + CO2 + H2O0Br + 0CaCO3 + H2O = 0CaBr3 + 0CO2 + H2O
B2O3(s) + NaOH(aq) = Na3BO3(aq) + H2O(l)B2O3(s) + 6NaOH(aq) = 2Na3BO3(aq) + 3H2O(l)
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
Ba(s) +H2O= BaO +H2Ba(s) + H2O = BaO + H2
Ba(NO3)2(aq) + Na2SO4(aq)=BaSO4 + NaNO3(aq)Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4 + 2NaNO3(aq)
BCl3(g) + H2O(l) = B(OH)3(aq) + HCl(aq) BCl3(g) + 3H2O(l) = B(OH)3(aq) + 3HCl(aq)
BCl3(g)+H2O(g) =B(OH)3(aq) +HCl (aq)BCl3(g) + 3H2O(g) = B(OH)3(aq) + 3HCl(aq)
BaCl2+Al2(SO4)3=BaSO4+AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BaCl2 + K2CO3 = 2BaCO3 + KCl BaCl2 + K2CO3 = BaCO3 + 2KCl
BaCl2 + K2CO3 = 2BaCO3 + KCl BaCl2 + K2CO3 = BaCO3 + 2KCl
BaCl2 + K2CO3 = 2BaCO3 + KCl BaCl2 + K2CO3 = BaCO3 + 2KCl
Ba + FeCl2 = BaCl2 + FeBa + FeCl2 = BaCl2 + Fe
Ba + FeCl2 = BaCl2 + FeBa + FeCl2 = BaCl2 + Fe
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaCl2 (aq) + 2NaOH (aq) = Ba(OH)2 (s) + 2NaCl (aq) BaCl2(aq) + 2NaOH(aq) = Ba(OH)2(s) + 2NaCl(aq)
BF3 + Li2SO3= B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba(NO3)2+Na2SO4=BaSO4+NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
B+K(OH)=K3BO3+H22B + 6K(OH) = 2K3BO3 + 3H2
BF3 + Li2SO3 = B2(SO3)3 +LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BeO + HCl = BeCl2 + H2OBeO + 2HCl = BeCl2 + H2O
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2 + Na2CO3 = BaCO3 + NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
Ba(OH)2 + 2HCl = BaCl2 + H2OBa(OH)2 + 2HCl = BaCl2 + 2H2O
Ba O + HNO3 = Ba(NO3)2 + H2OBaO + 2HNO3 = Ba(NO3)2 + H2O
BaCO3 +K2SO4 =Ba2SO4 +KCO32BaCO3 + K2SO4 = Ba2SO4 + 2KCO3
Ba(NO3)2 + Na2CO3 = NaNO3 + Ba(CO3)Ba(NO3)2 + Na2CO3 = 2NaNO3 + Ba(CO3)
Ba(NO3)2 + Na2SO4= 2 NaNO3 + BaSO4Ba(NO3)2 + Na2SO4 = 2NaNO3 + BaSO4
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
BrOH+HIO3=BrIO3+H2OBrOH + HIO3 = BrIO3 + H2O
Ba(HCO3)2 (s) = BaCO3 (s) + H2O (g) + CO2 (g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
Br2 + H2O = BrO3- + Br- + H+3Br2 + 3H2O = BrO3- + 5Br- + 6H+
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + 6HNO3 = B(NO3)3 +HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
B2Br6 + 6HNO3 = B(NO3)3 +HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2 + (NH4)2CO3 = BaCO3 + NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
BaS + Na(SO4) = Ba(SO4) + NaSBaS + Na(SO4) = Ba(SO4) + NaS
Ba(OH)2+HNO3 =Ba(NO3)2+ H2OBa(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Br2+NaI =NaBr+I2Br2 + 2NaI = 2NaBr + I2
Bi(NO3)3 +H2S = Bi2S3+HNO32Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3
BaCl2 + Na2SO4 = NaCl + BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
B(NO3)3 +K2SO4 = B2(SO4)3+KNO32B(NO3)3 + 3K2SO4 = B2(SO4)3 + 6KNO3
BaO2+HCl=BaCl2+H2O2BaO2 + 2HCl = BaCl2 + H2O2
Ba + F2 = BaF2Ba + F2 = BaF2
Br2(l)+KI(aq)=KBr(aq)+I2(s)Br2(l) + 2KI(aq) = 2KBr(aq) + I2(s)
Br- + H2O = Br2 + H2 + OH-2Br- + 2H2O = Br2 + H2 + 2OH-
BaCO3+HI=BaI2+H2O+CO2BaCO3 + 2HI = BaI2 + H2O + CO2
BaCl2*2H2O + Ag(NO3) = Ba(NO3)2 + AgCl + 2H2OBaCl2*2H2O + 2Ag(NO3) = Ba(NO3)2 + 2AgCl + 2H2O
Br2 + OH- = BrO3- + Br- + H2O3Br2 + 6OH- = BrO3- + 5Br- + 3H2O
Ba + H2SO4 = BaSO4 + H2 Ba + H2SO4 = BaSO4 + H2
BaCl2+Li2SO4=BaSO4+LiClBaCl2 + Li2SO4 = BaSO4 + 2LiCl
Ba3N2 + HF = BaF2 + NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BF3(g) + NaH(s) = B2H6(g) + NaF(s)2BF3(g) + 6NaH(s) = B2H6(g) + 6NaF(s)
Ba(NO3)2 + KF = BaF2 + KNO3Ba(NO3)2 + 2KF = BaF2 + 2KNO3
BaSO4+K2CrO4= K2SO4+BaCrO4BaSO4 + K2CrO4 = K2SO4 + BaCrO4
BrCHO + Cr2O72- + H2SO4 = BrCOOH + Cr3+ +H2O+ S3BrCHO + 0Cr2O72- + H2SO4 = 3BrCOOH + 0Cr3+ + H2O + S
B5H9 + O2 = B2O3 + H2O2B5H9 + 12O2 = 5B2O3 + 9H2O
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BN + F2 = BF3 + N22BN + 3F2 = 2BF3 + N2
BaCl2+K2SO4=BaSO4+KClBaCl2 + K2SO4 = BaSO4 + 2KCl
B2O3 + C = B4C3 + CO22B2O3 + 6C = B4C3 + 3CO2
Ba(NO3)2 + H2S = BaS + HNO3Ba(NO3)2 + H2S = BaS + 2HNO3
BaI2 + Na2SO4=BaSO4 + NaIBaI2 + Na2SO4 = BaSO4 + 2NaI
BaCl2+H2SO4 = BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaH2+H2O=Ba(OH)2+H2BaH2 + 2H2O = Ba(OH)2 + 2H2
Br2 =2BrBr2 = 2Br
Br2 =2BrBr2 = 2Br
BaI2(aq)+AgNO3(aq)=Ba(NO3)2+AgIBaI2(aq) + 2AgNO3(aq) = Ba(NO3)2 + 2AgI
Ba(OH)2 + K2(SO4) = Ba(SO4) + K2(OH)2Ba(OH)2 + K2(SO4) = Ba(SO4) + K2(OH)2
Ba+H2SO4=BaSO4+H2Ba + H2SO4 = BaSO4 + H2
B2O3 + C = B4C3 + CO22B2O3 + 6C = B4C3 + 3CO2
BaO + O2 = BaO22BaO + O2 = 2BaO2
Br2 + CaI2 = I2 + CaBr2Br2 + CaI2 = I2 + CaBr2
B2O3 + C = B4C3 + CO22B2O3 + 6C = B4C3 + 3CO2
BF3+Li2SO3=B2(SO3)3+LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Ba(OH)2 + H3PO4 = BaHPO4 + H2OBa(OH)2 + H3PO4 = BaHPO4 + 2H2O
Ba(OH)2 = BaO + H2OBa(OH)2 = BaO + H2O
Ba(OH)2 = BaO + H2OBa(OH)2 = BaO + H2O
BaCl2+H2SO4= BaSO4+HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BCl3+H2O=B(OH)3+HClBCl3 + 3H2O = B(OH)3 + 3HCl
BaCl2 + K2CO3 = 2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
BaCl2 + K2CO3 = 2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
BaCl2 + K2CO3 = 2BaCO3 + KClBaCl2 + K2CO3 = BaCO3 + 2KCl
B2O3+C+Cl2=BCl3+COB2O3 + 3C + 3Cl2 = 2BCl3 + 3CO
Bi2S3+HCl=BiCl3+H2SBi2S3 + 6HCl = 2BiCl3 + 3H2S
Ba(ClO3)2(s) =BaCl2(s) +O2(g)Ba(ClO3)2(s) = BaCl2(s) + 3O2(g)
Ba3N2+ HF=3BaF2+2NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BaCl2+(NH4)2CO3=BaCO3+NH4ClBaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
Ba3N2+HF= BaF2+NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH = Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2 HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Ba(OH)2 + H2SO4 = H2O + BaSO4Ba(OH)2 + H2SO4 = 2H2O + BaSO4
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BF3 + Li2SO3 = B2(SO3)3 + LiF2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBrB2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BaCl2 (aq) + Li2CO3 (aq) =LiCl (aq) + BaCO3 (s) BaCl2(aq) + Li2CO3(aq) = 2LiCl(aq) + BaCO3(s)
Ba3N2 + HF = BaF2 + NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
BH4- + H+ + H2O= H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2 HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
Be3P2+MgS+CaCl2=BeS+MgCl2+Ca3P2Be3P2 + 3MgS + 3CaCl2 = 3BeS + 3MgCl2 + Ca3P2
BF3+CO2=B2O3+CF44BF3 + 3CO2 = 2B2O3 + 3CF4
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Be2C+Mg3N2+CaO+Sr5B2= Ca3N2+SrO+Mg2C+Be5B215Be2C + 10Mg3N2 + 30CaO + 6Sr5B2 = 10Ca3N2 + 30SrO + 15Mg2C + 6Be5B2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BF3+H2O=B2O3+HF2BF3 + 3H2O = B2O3 + 6HF
Br2 + KOH =KBrO3 + KBr + H2O3Br2 + 6KOH = KBrO3 + 5KBr + 3H2O
BaCl2 +Na2SO4=NaCl+BaSO4BaCl2 + Na2SO4 = 2NaCl + BaSO4
BaCl2 + Ag2SO4 = BaSO4 + AgCl  BaCl2 + Ag2SO4 = BaSO4 + 2AgCl
BaO + H2O = Ba(OH)2BaO + H2O = Ba(OH)2
Ba3N2 =Ba + N2Ba3N2 = 3Ba + N2
BH4- + H+ + H2O = H3BO3 + H2 BH4- + H+ + 3H2O = H3BO3 + 4H2
BaCl2+Na2CO3=BaCO3+NaClBaCl2 + Na2CO3 = BaCO3 + 2NaCl
Bi2O3+OCl = Cl+BiO3Bi2O3 + 3OCl = 3Cl + 2BiO3
Ba(OH)2 + Fe2(SO4)3 = BaSO4 + Fe(OH)33Ba(OH)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(OH)3
BH4- + H+ 3H2O = H3BO3 + H20BH4- + 2H + 0H2O = 0H3BO3 + H2
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BaO2(l) = BaO(l) + O2(g)2BaO2(l) = 2BaO(l) + O2(g)
Ba3N2+HF=BaF2+NH3Ba3N2 + 6HF = 3BaF2 + 2NH3
Ba(OH)2 + Na3PO4 = Ba3(PO4)2 + NaOH3Ba(OH)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaOH
Br2 + H2O = BrO3- + Br- + OH--3Br2 + 3H2O = -1BrO3- - 5Br- + 6OH-
Ba(OH)2 + NH4NO3 = Ba(NO3)2 + NH4OHBa(OH)2 + 2NH4NO3 = Ba(NO3)2 + 2NH4OH
Ba(OH)2 + 2NH4NO3 = Ba(NO3)2 + 2NH4OHBa(OH)2 + 2NH4NO3 = Ba(NO3)2 + 2NH4OH
BaCO3 + C2H4O2 = Ba(C2H3O2)2 + H2CO3BaCO3 + 2C2H4O2 = Ba(C2H3O2)2 + H2CO3
Br2(l) + NaI(aq) = NaBr(aq) + I2(s)Br2(l) + 2NaI(aq) = 2NaBr(aq) + I2(s)
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
B2O3+H2O=B(OH)4+H3OB2O3 + 7H2O = 2B(OH)4 + 2H3O
BF3+Li2(SO3)=B2(SO3)3+LiF2BF3 + 3Li2(SO3) = B2(SO3)3 + 6LiF
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BaCl2 + H2SO4 = BaSO4 + HClBaCl2 + H2SO4 = BaSO4 + 2HCl
BaNO3 + NaF = NaNO3 + BaFBaNO3 + NaF = NaNO3 + BaF
Ba(NO3)2 + NH3 = BaH2 + N(NO3)33Ba(NO3)2 + 2NH3 = 3BaH2 + 2N(NO3)3
Ba (NO3)2 + NH2SO3H + H2O= Ba (NH2SO3)2 + HNO3Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2 + 2HNO3
BaO(s) + H2O(l)=BaH+O2BaO(s) + H2O(l) = 2BaH + 3O
Ba(OH)2+H3PO4=Ba3(PO4)2+H2O3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
BH4- + H+ + H2O = H3BO3 + H2 (g)BH4- + H+ + 3H2O = H3BO3 + 4H2(g)
B(ClO3)3 = BCl3 + O22B(ClO3)3 = 2BCl3 + 9O2
Ba(NO3)2 + 2NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3Ba(NO3)2 + NH2SO3H + H2O = BaSO4 + NH4NO3 + HNO3
Be2C+H2O=Be(OH)2+CH4Be2C + 4H2O = 2Be(OH)2 + CH4
Bi2O3 = Bi +O22Bi2O3 = 4Bi + 3O2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BrO3- + N2H4+ H+ = Br2 + N2 + H2O4BrO3- + 5N2H4 + 4H+ = 2Br2 + 5N2 + 12H2O
BrO3- + N2H4+ H+ = Br2 + N2 + H2O4BrO3- + 5N2H4 + 4H+ = 2Br2 + 5N2 + 12H2O
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
Be2C+H2O=Be(OH)2+CH4 Be2C + 4H2O = 2Be(OH)2 + CH4
Be2C+H2O=Be(OH)2+CH4 Be2C + 4H2O = 2Be(OH)2 + CH4
Ba(NO3)2 + Na2SO4 = BaSO4 + NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(OH)2+H2SO4=BaSO4+H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
Br2+2KI=2KBr+I2Br2 + 2KI = 2KBr + I2
Br+KI=KBr+IBr + KI = KBr + I
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
BaO2(s) + H2So4(aq) = BaSo4(s) + H2O2(aq)BaO2(s) + H2So4(aq) = BaSo4(s) + H2O2(aq)
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
BaF2 + K3PO4 = Ba3(PO4)2 + KF3BaF2 + 2K3PO4 = Ba3(PO4)2 + 6KF
Br2+2KI=2KBr+I2Br2 + 2KI = 2KBr + I2
Br2+KI=KBr+I2Br2 + 2KI = 2KBr + I2
Br2+2KI=2KBr+I2Br2 + 2KI = 2KBr + I2
Br+KI=KBr+IBr + KI = KBr + I
Bi+O2=Bi2O34Bi + 3O2 = 2Bi2O3
Ba(OH)2+P4O10=Ba3(PO4)2+H2O6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
Ba(NO3)2 + NH2SO3H + H20 = Ba(NH4SO3)2 + HNO35Ba(NO3)2 + 10NH2SO3H + H20 = 5Ba(NH4SO3)2 + 10HNO3
Ba3N2(s) + HF(aq) =BaF2(aq) +NH3(g)Ba3N2(s) + 6HF(aq) = 3BaF2(aq) + 2NH3(g)
Ba + H2O= Ba(OH)2 + H2Ba + 2H2O = Ba(OH)2 + H2
BH4- + H+ + H2O = H3BO3 + H2BH4- + H+ + 3H2O = H3BO3 + 4H2
BH4- + H+ + H2O = H3BO3 + H2 BH4- + H+ + 3H2O = H3BO3 + 4H2
Ba(OH)2+H2SO4=BaSO4+H2OBa(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(NO3)2 + Na2SO4 = BaSO4 + NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BrO3-+ Sn2+ + H+ = Br- + Sn4+ + H2OBrO3- - 12Sn2+ + 6H+ = Br- - 6Sn4+ + 3H2O
B2O3 + H2O = B(OH)4 + H3OB2O3 + 7H2O = 2B(OH)4 + 2H3O
Ba + H2O=Ba2+ + OH- + H24Ba + 2H2O = 2Ba2+ + 2OH- + H2
BaCl2(aq)+H2SO4(aq)=BaSO4(s)+HCl(aq)BaCl2(aq) + H2SO4(aq) = BaSO4(s) + 2HCl(aq)
BaCl2+Na2SO4=BaSO4+NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Br2(l)+I2(s)=IBr3(g)3Br2(l) + I2(s) = 2IBr3(g)
BH4- + H+  + H2O =  H3BO3 + H2 BH4- + H+ + 3H2O = H3BO3 + 4H2
Ba(NO3)2 + NaOH = BaOH + (NO3)2NaBa(NO3)2 + NaOH = BaOH + (NO3)2Na
BaCO3 + C = BaCO2 + COBaCO3 + C = BaCO2 + CO
B2H6 (l) + O2 = B2O3 (s) + H2O (l)B2H6(l) + 3O2 = B2O3(s) + 3H2O(l)
BaCO3=Ba+CO3BaCO3 = Ba + CO3
BaCO3=Ba+CO3BaCO3 = Ba + CO3
B + KOH = K3BO3 + H22B + 6KOH = 2K3BO3 + 3H2
B + KOH = K3 + BO3 + H22B + 6KOH = 2K3 + 2BO3 + 3H2
Ba+ Al 3+ = Al(s) + Ba 2+2Ba + Al3+ = 3Al(s) + Ba2+
BaCl2(aq) + Na2CO3(aq) = BaCO3(s) + 2NaCl(aq)BaCl2(aq) + Na2CO3(aq) = BaCO3(s) + 2NaCl(aq)
Ba(NO3)2=Ba+2NO3Ba(NO3)2 = Ba + 2NO3
BaCl2 + H2O = HCl + Ba(OH)2BaCl2 + 2H2O = 2HCl + Ba(OH)2
BaCl2+Na2SO4=BaSO4+2NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Bi2S3 + O2 = Bi2O3 + SO22Bi2S3 + 9O2 = 2Bi2O3 + 6SO2
BaO+2HNO3=Ba(NO3)2+H2OBaO + 2HNO3 = Ba(NO3)2 + H2O
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Bi + AgNo3 = Bi(No3)3 + AgBi + 3AgNo3 = Bi(No3)3 + 3Ag
Ba(OH)2 (aq) + Cr2(SO4)3 = BaSO4 (s) + Cr(OH)33Ba(OH)2(aq) + Cr2(SO4)3 = 3BaSO4(s) + 2Cr(OH)3
BaCl2 + Na2SO4 = BaSO4 + NaClBaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(HCO3)2 (s) = BaCO3 (s) + H2O (g) + CO2 (g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
BaCl2 (aq) + Na2SO4 (aq) = NaCl (aq) + BaSO4 (s)BaCl2(aq) + Na2SO4(aq) = 2NaCl(aq) + BaSO4(s)
Ba(HCO3)2 (s) = BaCO3 (s) + H2O (g) + CO2 (g)Ba(HCO3)2(s) = BaCO3(s) + H2O(g) + CO2(g)
Ba + 2HCl= BaCl2 + H2Ba + 2HCl = BaCl2 + H2
Ba + 2HCl= BaCl2 + H2Ba + 2HCl = BaCl2 + H2
BeCO3 = BeO + CO2BeCO3 = BeO + CO2
BeO + C + Cl2 = BeCl2 +COBeO + C + Cl2 = BeCl2 + CO
BeO + C = Be2C + CO22BeO + 2C = Be2C + CO2
BeO + C = Be2C + CO22BeO + 2C = Be2C + CO2
Br2O7 + H2O = Br(OH)7Br2O7 + 7H2O = 2Br(OH)7
BCl3 + P4 + H2 = BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
Br2 + CaI2 = I2 + CaBr2Br2 + CaI2 = I2 + CaBr2
Ba(OH)2(aq)+HNO3(aq)=Ba(NO3)2(aq)+H2O(l)Ba(OH)2(aq) + 2HNO3(aq) = Ba(NO3)2(aq) + 2H2O(l)
Ba(OH)2(aq)+HNO3(aq)=Ba(NO3)2(aq)+H2O(l)Ba(OH)2(aq) + 2HNO3(aq) = Ba(NO3)2(aq) + 2H2O(l)
BaI2(aq)+2AgNO3(aq)=2AgI(s)+Ba(aq)+2NO3(aq)BaI2(aq) + 2AgNO3(aq) = 2AgI(s) + Ba(aq) + 2NO3(aq)
BaI2(aq)+2AgNO3(aq)=2AgI(s)+Ba(aq)+2NO3(aq)BaI2(aq) + 2AgNO3(aq) = 2AgI(s) + Ba(aq) + 2NO3(aq)
BaI2(aq)+2AgNO3(aq)=2AgI(s)+Ba(aq)+2NO3(aq)BaI2(aq) + 2AgNO3(aq) = 2AgI(s) + Ba(aq) + 2NO3(aq)
BCl3 + P4 + H2 = BP + HCl4BCl3 + P4 + 6H2 = 4BP + 12HCl
BaSO+C =BaS+COBaSO + C = BaS + CO
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq) BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaO2(s)+H2SO4(aq)=BaSO4(s)+H2O2(aq) BaO2(s) + H2SO4(aq) = BaSO4(s) + H2O2(aq)
BaSO4+K3PO4=Ba3(PO4)2+K2SO43BaSO4 + 2K3PO4 = Ba3(PO4)2 + 3K2SO4

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.