Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ca(C2H3O2)2 + Na2CO3(aq) = CaCO3 + Na(C2H3O2)Ca(C2H3O2)2 + Na2CO3(aq) = CaCO3 + 2Na(C2H3O2)
3Ca(C2H3O2)2 + Na2CO3(aq) = CaCO3 + Na(C2H3O2)Ca(C2H3O2)2 + Na2CO3(aq) = CaCO3 + 2Na(C2H3O2)
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3 = Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
3FeCl2 + 4H2O = Fe3O4 + H2 + 6HCl3FeCl2 + 4H2O = Fe3O4 + H2 + 6HCl
3 FeCl2 + 4H2O = Fe3O4 + H2 + 6 HCl3FeCl2 + 4H2O = Fe3O4 + H2 + 6HCl
3 Ag(NO3)2 + Al2 = 2 Al(NO3)3 + 3 Ag3Ag(NO3)2 + Al2 = 2Al(NO3)3 + 3Ag
3Ba(NO3)2 + Cr2(SO4)3= 3BaSO4 + 2Cr(NO3)33Ba(NO3)2 + Cr2(SO4)3 = 3BaSO4 + 2Cr(NO3)3
3Ba(NO3)2(aq) + Cr2(SO4)3(aq) = 3BaSO4(s) + 2Cr(NO3)3(aq)3Ba(NO3)2(aq) + Cr2(SO4)3(aq) = 3BaSO4(s) + 2Cr(NO3)3(aq)
3NaOH(aq)+H3PO4(aq)=Na3PO4(aq)+3H2O(l) 3NaOH(aq) + H3PO4(aq) = Na3PO4(aq) + 3H2O(l)
3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(aq) + 6H2O(l)3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(aq) + 6H2O(l)
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Li3PO4 + 3Al(NO3)3 = 9LiNO3 + Al3(PO4)33Li3PO4 + 3Al(NO3)3 = 9LiNO3 + Al3(PO4)3
3Ba(NO3)2(aq)+2H3PO4(aq)=Ba3(PO4)2(s)+6HNO3(aq)3Ba(NO3)2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6HNO3(aq)
3NaOH(aq)+Fe(NO3)3(aq)=3NaNO3(aq)+Fe(OH)3(s)3NaOH(aq) + Fe(NO3)3(aq) = 3NaNO3(aq) + Fe(OH)3(s)
3Cr(NO3)2(aq) + 2(NH4)3PO4(aq)= Cr3(PO4)2(s) + 6NH4NO3(aq)3Cr(NO3)2(aq) + 2(NH4)3PO4(aq) = Cr3(PO4)2(s) + 6NH4NO3(aq)
3H2+2Cl=HClH2 + 2Cl = 2HCl
3H2 + O2 = 2 H2O2H2 + O2 = 2H2O
3N(g)+I(s)=NI3(s)N(g) + 3I(s) = NI3(s)
3N+I=NI3N + 3I = NI3
3C2H2 + 5O2 = CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
3MnI2(aq) + 2Na3PO4(aq) = Mn3(PO4)2(s) + 6NaI(aq)3MnI2(aq) + 2Na3PO4(aq) = Mn3(PO4)2(s) + 6NaI(aq)
3MnI2(aq) + 2Na3PO4(aq) = Mn3(PO4)2(s) + 6NaI(aq)3MnI2(aq) + 2Na3PO4(aq) = Mn3(PO4)2(s) + 6NaI(aq)
3MnI2(aq) + 2Na3PO4(aq) = Mn3(PO4)2(s) + 6NaI(aq)3MnI2(aq) + 2Na3PO4(aq) = Mn3(PO4)2(s) + 6NaI(aq)
3CaCO3 = 3CaO + CO2CaCO3 = CaO + CO2
3Ba(NO3)2(aq) + 2K3PO4(aq) =Ba3(PO4)2(s) + 6KNO3(aq)3Ba(NO3)2(aq) + 2K3PO4(aq) = Ba3(PO4)2(s) + 6KNO3(aq)
3Ba(NO3)2+ 2K3PO4 =Ba3(PO4)2 + 6KNO33Ba(NO3)2 + 2K3PO4 = Ba3(PO4)2 + 6KNO3
3NO2 (g) + H2O (l) = 2HNO3 (l) + NO (g) 3NO2(g) + H2O(l) = 2HNO3(l) + NO(g)
3H2+3O2=3H2O2H2 + O2 = 2H2O
3H2+2O2=HOH2 + O2 = 2HO
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3H2+2O2= H2O2H2 + O2 = 2H2O
3H2+2O2= H2O2H2 + O2 = 2H2O
3Fe+4H2O=Fe3O4+4H23Fe + 4H2O = Fe3O4 + 4H2
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3AgNO3 (aq) + FeBr3 (aq)= 3AgBr (s) + Fe(NO3)3 (aq)3AgNO3(aq) + FeBr3(aq) = 3AgBr(s) + Fe(NO3)3(aq)
3NO2 + H2O = HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3 Al +6 HCl = 2 AlCl3 +3H22Al + 6HCl = 2AlCl3 + 3H2
3Pb + Fe(NO3)3 = Fe + 3 PbNO33Pb + Fe(NO3)3 = Fe + 3PbNO3
3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 3S + 4 H2O3CuS + 8HNO3 = 3Cu(NO3)2 + 2NO + 3S + 4H2O
3CaS(s) + 8HNO3(aq) = 3CaSO4(s) + 8NO(g) + 4H2O(l)3CaS(s) + 8HNO3(aq) = 3CaSO4(s) + 8NO(g) + 4H2O(l)
3Li + N2 = 2Li3N6Li + N2 = 2Li3N
3HNO3 (aq) + Al(OH)3 (s)= Al(NO3)3 (aq) + 3H2O (l)3HNO3(aq) + Al(OH)3(s) = Al(NO3)3(aq) + 3H2O(l)
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=3Cu(NO3)2+2NO+4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3 (NH4)2CO3 + 2 Fe(NO3)3 = Fe2(CO3)3 + 6 NH4NO33(NH4)2CO3 + 2Fe(NO3)3 = Fe2(CO3)3 + 6NH4NO3
3 (NH4)2CO3 + 2 Fe(NO3)3 = Fe2(CO3)3 + 6 NH4NO33(NH4)2CO3 + 2Fe(NO3)3 = Fe2(CO3)3 + 6NH4NO3
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3K2MnO4 + 2Al =6K + Al2(MnO4)33K2MnO4 + 2Al = 6K + Al2(MnO4)3
3K2O+H2O=6KOHK2O + H2O = 2KOH
3Li + NdCl3 = Nd + 3LiCl3Li + NdCl3 = Nd + 3LiCl
3NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
3NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
3P4O10+H2O=H3PO4P4O10 + 6H2O = 4H3PO4
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3MnI2(aq) + 2K3PO4(aq) =Mn3(PO4)2(s) + 6KI(aq)3MnI2(aq) + 2K3PO4(aq) = Mn3(PO4)2(s) + 6KI(aq)
3Al(s) + 3NH4ClO4(s) = Al2O3(s) + AlCl3(s) + 3NO(g) + 6H2O3Al(s) + 3NH4ClO4(s) = Al2O3(s) + AlCl3(s) + 3NO(g) + 6H2O
3Al(s) + 3NH4ClO4(s) = Al2O3(s) + AlCl3(s) + 3NO(g) + 6H2O3Al(s) + 3NH4ClO4(s) = Al2O3(s) + AlCl3(s) + 3NO(g) + 6H2O
3CrBr2(aq) + 2K3PO4(aq) = Cr3(PO4)2(s) + 6KBr(aq)3CrBr2(aq) + 2K3PO4(aq) = Cr3(PO4)2(s) + 6KBr(aq)
3Cu+8HNO3=Cu(NO3)2+NO+H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3Si2C2 + 4C = 6Si4C2Si2C2 - 3C = Si4C
3NaCl + 3H2O = 3NaClH2ONaCl + H2O = NaClH2O
3Pb(NO3)2+2CrBr3=3PbBr2+2Cr(NO3)33Pb(NO3)2 + 2CrBr3 = 3PbBr2 + 2Cr(NO3)3
3(CH4) + 3(N2Cl4) = 6(H2) +3(N2)+3(CCl4)(CH4) + (N2Cl4) = 2(H2) + (N2) + (CCl4)
3ZnI2(aq) + 2Na3PO4(aq)=Zn3(PO4)2(s) + 6NaI(aq)3ZnI2(aq) + 2Na3PO4(aq) = Zn3(PO4)2(s) + 6NaI(aq)
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3N + 9H = NH3N + 3H = NH3
3N2 + 9H2 = NH3N2 + 3H2 = 2NH3
3ZnCl2+2Na3PO4=1Zn3(PO4)2+6NaCl3ZnCl2 + 2Na3PO4 = Zn3(PO4)2 + 6NaCl
3 Ca(NO3)2 + 2 H3PO4 = 6 HNO3 + Ca3(PO4)23Ca(NO3)2 + 2H3PO4 = 6HNO3 + Ca3(PO4)2
3CO+3O2=CO22CO + O2 = 2CO2
3Cd + 3H2O + O2 = 3Cd(OH)22Cd + 2H2O + O2 = 2Cd(OH)2
3MnO + PbO2 + 5HNO3 = 3HMnO4 + 5Pb(NO3)2 + H2O2MnO + 5PbO2 + 10HNO3 = 2HMnO4 + 5Pb(NO3)2 + 4H2O
3KOH + MnO2 + H2SO4 = KMnO4 + MnSO4 + H2O2KOH + 5MnO2 + 3H2SO4 = 2KMnO4 + 3MnSO4 + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Mg+ Fe3+=3Mg2+ + Fe2Mg + Fe3+ = Mg2+ + 3Fe
3Cu +8HNO3 = Cu(NO3)2 +NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3O2 + 4H2 = H2O O2 + 2H2 = 2H2O
3 SnO2 + 4 Al = 3 Sn + 2 Al2O33SnO2 + 4Al = 3Sn + 2Al2O3
3Zn+2HCl=ZnCl2+H2Zn + 2HCl = ZnCl2 + H2
3Zn+2HCl=ZnCl2+H2Zn + 2HCl = ZnCl2 + H2
3Cu+8HNO3=3Cu(NO3)2+2NO+4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3NO(g) + 6H2(g) = 3NH3(g) + 3H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
3Cu NO3(aq) + (NH4)3PO4(aq) = 3NH4NO3(aq) +Cu3PO4(s)3CuNO3(aq) + (NH4)3PO4(aq) = 3NH4NO3(aq) + Cu3PO4(s)
3NH4OH+H3PO4=(NH4)3PO4+3H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
3NO2+H2O=HNO3+2NO3NO2 + H2O = 2HNO3 + NO
3NO2+H2O=HNO3+2NO3NO2 + H2O = 2HNO3 + NO
3NO2+H2O=HNO3+2NO3NO2 + H2O = 2HNO3 + NO
3NO2+H2O=HNO3+2NO3NO2 + H2O = 2HNO3 + NO
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3H2So4+2Fe=Fe2(So4)3+3H23H2So4 + 2Fe = Fe2(So4)3 + 3H2
3Fe3O2 + 4Al = 2Al2O3 + 6Fe3Fe3O2 + 4Al = 2Al2O3 + 9Fe
3NO2 + H2O= HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3FeO + 2Al = Al2O3 + 3Fe3FeO + 2Al = Al2O3 + 3Fe
3Zn+2HCl=ZnCl2=H2Zn + 2HCl = ZnCl2 + H2
3C2H5OH + 2K2Cr2O7 + 8H2SO4 = 2Cr2(SO4)3 + 3CH3COOH +2K2SO4 + 11H2O3C2H5OH + 2K2Cr2O7 + 8H2SO4 = 2Cr2(SO4)3 + 3CH3COOH + 2K2SO4 + 11H2O
3C2H5OH + 2K2Cr2O7 + 8H2SO4 = 2Cr2(SO4)3 + 3CH3COOH +2K2SO4 + 11H2O3C2H5OH + 2K2Cr2O7 + 8H2SO4 = 2Cr2(SO4)3 + 3CH3COOH + 2K2SO4 + 11H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)+NO+H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3KI(aq) + AlCl3(aq) = AlI3(aq) + 3KCl (aq)3KI(aq) + AlCl3(aq) = AlI3(aq) + 3KCl(aq)
3Sr(Cl2)+Al2(S04)3 = 3Sr(S04)+2Al(Cl3)3Sr(Cl2) + Al2(S04)3 = 3Sr(S04) + 2Al(Cl3)
3Sr(Cl2)+Al2(S04)3 = 3Sr(S04)+2AlCl33Sr(Cl2) + Al2(S04)3 = 3Sr(S04) + 2AlCl3
3PCl3 + 3H2O = HCl + H3PO3PCl3 + 3H2O = 3HCl + H3PO3
3NH4OH+H3PO4=(NH4)3PO4+3H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
3Fe + 2O2 =Fe3O43Fe + 2O2 = Fe3O4
3(NH4)2CO3 + 2FeCl3 = Fe2(CO3)3 + 6NH4Cl3(NH4)2CO3 + 2FeCl3 = Fe2(CO3)3 + 6NH4Cl
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3NO2 + H2O = HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3NO2 + H2O = HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3H2+ O2 = 3H2O2H2 + O2 = 2H2O
3HCl(aq) + Na3PO4(aq)=H3PO4 + 3NaCl3HCl(aq) + Na3PO4(aq) = H3PO4 + 3NaCl
3NO2 + H2O = HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3Ca + CeF3 = Ce + 3CaF23Ca + 2CeF3 = 2Ce + 3CaF2
3C2+3H2=C6H63C2 + 3H2 = C6H6
3Co(NO3)2(aq)+2(NH4)3PO4(aq)=Co3(PO4)2(s)+6NH4NO3(aq)3Co(NO3)2(aq) + 2(NH4)3PO4(aq) = Co3(PO4)2(s) + 6NH4NO3(aq)
3Cu+8HNO3=3Cu(NO3)2+2NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3(NH4)2CO3(aq)+2Fe(NO3)3(aq) = Fe2(CO3)3(s)+3NH4NO3(aq)3(NH4)2CO3(aq) + 2Fe(NO3)3(aq) = Fe2(CO3)3(s) + 6NH4NO3(aq)
3NO(g) + 6H2(g)= 3NH3(g) + 3H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
3H2SO4+2Fe=Fe2(SO4)3+3H23H2SO4 + 2Fe = Fe2(SO4)3 + 3H2
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3Pb+2H3PO4=3H2+Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
3N2Cl4+3CH4=3CCl4+3N2+6H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
3N2 + 11H2 = NH3N2 + 3H2 = 2NH3
3Mn+2 + 2MnO4- + 2H2O =5MnO2 + 4H+3Mn+2 + 2MnO4- + 2H2O = 5MnO2 + 4H+
3Fe + 2O2 = Fe3O43Fe + 2O2 = Fe3O4
3Fe + 2O2 = Fe3O43Fe + 2O2 = Fe3O4
3CO2 + 4H2O=H2CO3CO2 + H2O = H2CO3
3CH4+3N2Cl4=3CCl4+3N2+6H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
3 CH3OH + 2 KMNO4 = 3 H2CO + 2 KOH + 2 H2O + 2 MNO23CH3OH + 2KMNO4 = 3H2CO + 2KOH + 2H2O + 2MNO2
3C2H5OH + 2K2Cr2O7 +8H2SO4 = 2Cr2(SO4)3 +3CH3COOH +2K2SO4 + H2O3C2H5OH + 2K2Cr2O7 + 8H2SO4 = 2Cr2(SO4)3 + 3CH3COOH + 2K2SO4 + 11H2O
3Pb(NO3)2(aq) + 2K3PO4(aq)= Pb3(PO4)2(s) + 6KNO3(aq)3Pb(NO3)2(aq) + 2K3PO4(aq) = Pb3(PO4)2(s) + 6KNO3(aq)
3Pb(NO3)2(aq) + 2K3PO4(aq)= Pb3(PO4)2(s) + 6KNO3(aq)3Pb(NO3)2(aq) + 2K3PO4(aq) = Pb3(PO4)2(s) + 6KNO3(aq)
3Fe(s)+O2(g)+H+1e- = FeO(OH)(s) Fe(s) + O2(g) + H + 0e- = FeO(OH)(s)
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Fe + 4H2O = Fe3O4 + 4H23Fe + 4H2O = Fe3O4 + 4H2
3Fe + 4H2O = Fe3O4 + 4H23Fe + 4H2O = Fe3O4 + 4H2
3P4 + 10KClO3 = P4O10 + KCl3P4 + 10KClO3 = 3P4O10 + 10KCl
3NO2 + H2O = HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3MnBr2+2K3PO4=Mn3(PO4)2+6KBr3MnBr2 + 2K3PO4 = Mn3(PO4)2 + 6KBr
3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O
3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O
3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O
3CH4 + 3N2Cl4= 3CCl4 + 3N2 + 6H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
3N2 + 6H2 = NH3N2 + 3H2 = 2NH3
3N2 + 6H2 = NH3N2 + 3H2 = 2NH3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3NO2 + H2O = HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3C3H8 + 10O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3N2CL4+3CH4=3CCL4+3N2+6H2N2CL4 + CH4 = CCL4 + N2 + 2H2
3N2CL4+3CH4=3CCL4+3N2+6H2N2CL4 + CH4 = CCL4 + N2 + 2H2
3N2CL4+3CH4=3CCL4+3N2+6H2N2CL4 + CH4 = CCL4 + N2 + 2H2
3Fe2O3 + CO = 2Fe3O4 + CO23Fe2O3 + CO = 2Fe3O4 + CO2
3CuO + 2NH3 = Cu + H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
3Zn+2N=Zn3N23Zn + 2N = Zn3N2
3Ca + 1Na2CO3 = 1CaCO3 + 2NaCa + Na2CO3 = CaCO3 + 2Na
3Ca + 1Na2CO3 = 1CaCO3 + 2NaCa + Na2CO3 = CaCO3 + 2Na
3Zn(NO3)2(aq)+2Li3PO4(aq)= Zn3(PO4)2(s)+6 LiNO3(aq)3Zn(NO3)2(aq) + 2Li3PO4(aq) = Zn3(PO4)2(s) + 6LiNO3(aq)
3Mg + 2O2 = MgO2Mg + O2 = 2MgO
3AgNO3 + AlCl3 = Al(NO3)3 + AgCl3AgNO3 + AlCl3 = Al(NO3)3 + 3AgCl
3Fe2O3(s) + 2Al(s) = 2Fe(s) + Al2O3(s)Fe2O3(s) + 2Al(s) = 2Fe(s) + Al2O3(s)
3Fe2O3(s) + 2Al(s) = 2Fe(s) + Al2O3(s)Fe2O3(s) + 2Al(s) = 2Fe(s) + Al2O3(s)
3Fe+3O2=3Fe2O34Fe + 3O2 = 2Fe2O3
3CO2+4H2O=H2CO3CO2 + H2O = H2CO3
3H2+3Cl=HClH2 + 2Cl = 2HCl
3H2+3Cl=3HClH2 + 2Cl = 2HCl
3F2+2FeI3=3I2+2FeF33F2 + 2FeI3 = 3I2 + 2FeF3
3G4Pp2=G20 + Pp1230G4Pp2 = 6G20 + 5Pp12
3Pb + 2H3PO4 = 3Pb(PO4)2 + 3H2Pb + 2H3PO4 = Pb(PO4)2 + 3H2
3Cu+HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3NO(g) + 6H2(g) = 3NH3(g) + 3H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
3IBr + NH3 = NI3 + NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
3H2 + N2 = NH33H2 + N2 = 2NH3
3 Pb(NO3)2 + 2 H3AsO4 = 6 HNO3 + Pb3(AsO4)23Pb(NO3)2 + 2H3AsO4 = 6HNO3 + Pb3(AsO4)2
3CH4+6O2=3CO2+H2OCH4 + 2O2 = CO2 + 2H2O
3Cu+HNO3= 3 Cu(NO3)2+2NO+ H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3Cu+HNO3=3Cu(NO3)2+2NO+ H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3Ba(ClO3)2+2AlBr3=3BaBr2+2Al(ClO3)33Ba(ClO3)2 + 2AlBr3 = 3BaBr2 + 2Al(ClO3)3
3CaCl2(aq) + Al2(SO4)3(aq) = 3CaSO4(aq) + 2AlCl3(aq)3CaCl2(aq) + Al2(SO4)3(aq) = 3CaSO4(aq) + 2AlCl3(aq)
3Al + 4Br2 = AlBr32Al + 3Br2 = 2AlBr3
3Ag + (PO4)3 = 3AgPO43Ag + (PO4)3 = 3AgPO4
3Pb(NO3)2 (aq) + 2AlBr3 (aq) = 3PbBr2 (s) + 2Al(NO3)3 (aq)3Pb(NO3)2(aq) + 2AlBr3(aq) = 3PbBr2(s) + 2Al(NO3)3(aq)
3NH4OH+H3PO4=(NH4)3PO4+3H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
3CuBr2(aq)+2K3PO4(aq)=Cu3(PO4)2(s)+6KBr(aq)3CuBr2(aq) + 2K3PO4(aq) = Cu3(PO4)2(s) + 6KBr(aq)
3Ca + 2SmF3 = Sm + 3CaF23Ca + 2SmF3 = 2Sm + 3CaF2
3Li + LuCl3 =Lu + LiCl3Li + LuCl3 = Lu + 3LiCl
3N2Cl4+3CH4=3CCl4+6H2+3N2N2Cl4 + CH4 = CCl4 + 2H2 + N2
3N2Cl4+3CH4=3CCl4+6H2+3N2N2Cl4 + CH4 = CCl4 + 2H2 + N2
3ZnCl2 + 2(NH4)3 PO4 = Zn3(PO4)2 + 6 NH4Cl3ZnCl2 + 2(NH4)3PO4 = Zn3(PO4)2 + 6NH4Cl
3NO2 + H2O = HNO3 + 2NO3NO2 + H2O = 2HNO3 + NO
3N2CL4+3CH4=3CCL4+6H2+3N2N2CL4 + CH4 = CCL4 + 2H2 + N2
3NO2 +H2O=2HNO3+3NO3NO2 + H2O = 2HNO3 + NO
3N2 + 2H2O = NH3 + O22N2 + 6H2O = 4NH3 + 3O2
3SO2 + 2H2 = S + H2OSO2 + 2H2 = S + 2H2O
3H+P+4O=H3PO43H + P + 4O = H3PO4
3H+P+4O=H3PO73H + P + 7O = H3PO7
3H+P+4O=H3PO43H + P + 4O = H3PO4
3 CO2 + 12 H2 = C3H6O3 + 3 H2O3CO2 + 6H2 = C3H6O3 + 3H2O
3N2CL4+3CH4=3CCL4+6H2+3N2N2CL4 + CH4 = CCL4 + 2H2 + N2
3 Fe(s) + 4 H2O(g) = Fe3O4(s) + 4 H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + HNO3 =3Cu(NO3)2 + NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ca + GdF3 = 2Gd + CaF23Ca + 2GdF3 = 2Gd + 3CaF2
3NH4OH+H3PO4=(NH4)3PO4+3H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
3Mg(s) + N2(g) = Mg3N2(s)3Mg(s) + N2(g) = Mg3N2(s)
3AgNO3 (aq) + FeBr3 (aq) =3AgBr (s) + Fe(NO3)3 (aq)3AgNO3(aq) + FeBr3(aq) = 3AgBr(s) + Fe(NO3)3(aq)
3CH4=2C3H8+2H23CH4 = C3H8 + 2H2
3Cl2 + 2AlI3 = 2AlCl3 + 3I2 3Cl2 + 2AlI3 = 2AlCl3 + 3I2
3Mg + N2 = MgN2Mg + N2 = MgN2
3Mg + N2 = MgN2Mg + N2 = MgN2
3 Mg + N2 = MgN2Mg + N2 = MgN2
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)
3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)
3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)
3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)
3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)
3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)
3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)3Zn(NO3)2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KNO3(aq)
3ZnBr2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KBr(aq)3ZnBr2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KBr(aq)
3ZnBr2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KBr(aq)3ZnBr2(aq) + 2K3PO4(aq) = Zn3(PO4)2(s) + 6KBr(aq)
3F2(g) + Cl2 = 2Cl2F2(g)F2(g) + Cl2 = Cl2F2(g)
3Ca + 2YbF3 = Yb + CaF23Ca + 2YbF3 = 2Yb + 3CaF2
3Co(NO3)2(aq) + 2K3PO4(aq)=Co3(PO4)2(s) + 6KNO3(aq)3Co(NO3)2(aq) + 2K3PO4(aq) = Co3(PO4)2(s) + 6KNO3(aq)
3Mg(OH)2 +2K3N= 6KOH+Mg3N23Mg(OH)2 + 2K3N = 6KOH + Mg3N2
3Cu + 8 HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ca + 2YbF3 = Yb + CaF23Ca + 2YbF3 = 2Yb + 3CaF2
3Ca + AlCl3 = CaCl2 + 2Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
3Cl2 + 2AlI3 = 2AlCl3 + I23Cl2 + 2AlI3 = 2AlCl3 + 3I2
3NH3+3NO=N2+3H2O4NH3 + 6NO = 5N2 + 6H2O
3SbCl3 (aq) + 3H2SO4 (aq) = 3Sb(SO4) (s) + 3H2Cl3 (aq)SbCl3(aq) + H2SO4(aq) = Sb(SO4)(s) + H2Cl3(aq)
3SbCl3 (aq) + 3H2SO4 (aq) = 3Sb(SO4) (s) + 3H2Cl3 (aq)SbCl3(aq) + H2SO4(aq) = Sb(SO4)(s) + H2Cl3(aq)
3Ca + N2 =Ca3N23Ca + N2 = Ca3N2
3Ca + N2 =CaN2Ca + N2 = 2CaN
3FeCl2(aq) + 2(NH4)3PO4(aq) = Fe3(PO4)2(s) + 6NH4Cl(aq)3FeCl2(aq) + 2(NH4)3PO4(aq) = Fe3(PO4)2(s) + 6NH4Cl(aq)
3FeCl2(aq) + 2(NH4)3PO4(aq) = Fe3(PO4)2(s) + 6NH4Cl(aq)3FeCl2(aq) + 2(NH4)3PO4(aq) = Fe3(PO4)2(s) + 6NH4Cl(aq)
3Fe3O4+4Al=9Fe+4Al2O33Fe3O4 + 8Al = 9Fe + 4Al2O3
3NH4OH + H3PO4 = (NH4)3PO4 + H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
3NH3 + 6NO=5N2 + 6H2O4NH3 + 6NO = 5N2 + 6H2O
3H2+15O2=H2O2H2 + O2 = 2H2O
3H2+15O2=H2O2H2 + O2 = 2H2O
3H2+15O2=H2O2H2 + O2 = 2H2O
3K(NO3)2 + 2Al(OH)3= Al(NO3)2+K(OH)3K(NO3)2 + Al(OH)3 = Al(NO3)2 + K(OH)3
3NH3+H3PO4=N3H12PO43NH3 + H3PO4 = N3H12PO4
3Mg+O2=MgO2Mg + O2 = 2MgO
3ZnSo4 + Na3C6H5O7 = Zn3(C6H5O7) + 3NaSo43ZnSo4 + Na3C6H5O7 = Zn3(C6H5O7) + 3NaSo4
3Mg + Mn2O3 = MgO + 2Mn3Mg + Mn2O3 = 3MgO + 2Mn
3H2SO4 (aq) + 2Al(OH)3 (aq) = Al2(SO4)3 (aq) + 6H2O (l)3H2SO4(aq) + 2Al(OH)3(aq) = Al2(SO4)3(aq) + 6H2O(l)
3H2SO4 (aq) + 2Al(OH)3 (aq) = Al2(SO4)3 (aq) + 6H2O (l)3H2SO4(aq) + 2Al(OH)3(aq) = Al2(SO4)3(aq) + 6H2O(l)
3H2SO4+KIO3+8KI=K2SO4+KI3+H2O3H2SO4 + KIO3 + 8KI = 3K2SO4 + 3KI3 + 3H2O
3H2SO4+KIO3+8KI=K2SO4+I3+H2O3H2SO4 + KIO3 + 5KI = 3K2SO4 + 2I3 + 3H2O
3Mg + Mn2O3 = 3MgO + Mn3Mg + Mn2O3 = 3MgO + 2Mn
3Ca + 2ScF3 = 2Sc + CaF23Ca + 2ScF3 = 2Sc + 3CaF2
3NaOH(aq) + AlCl3(aq) = Al(OH)3(s) + 3 NaCl(aq)3NaOH(aq) + AlCl3(aq) = Al(OH)3(s) + 3NaCl(aq)
3Ag (s) + PO4 (aq) = 3AgPO4Ag(s) + PO4(aq) = AgPO4
3NO2+H2O = HNO3+NO3NO2 + H2O = 2HNO3 + NO
3Ca+2CeF3 = Ce+ CaF23Ca + 2CeF3 = 2Ce + 3CaF2
3N2Cl4 + 3CH4 = 6H2 + 3N2 + 3CCl4N2Cl4 + CH4 = 2H2 + N2 + CCl4
3Li2CrO4 (aq) + 2AlCl3 (aq) = 6LiCl + Al2(CrO4)3 (s)3Li2CrO4(aq) + 2AlCl3(aq) = 6LiCl + Al2(CrO4)3(s)
3 Fe + 3 Br = 3FeBr2Fe + 2Br = FeBr2
3Zn(OH)2 + H3PO4 = Zn3(PO4)2 + 6H2O3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O
3CaCO3 = CaO + CO2CaCO3 = CaO + CO2
3Li + NdCl3 = Nd + LiCl3Li + NdCl3 = Nd + 3LiCl
3O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
3CaO + Al = Al2O3 + 3Ca3CaO + 2Al = Al2O3 + 3Ca
3MnI2(aq)+2(NH4)3PO4(aq)=Mn3(PO4)2(s)+6NH4I(aq)3MnI2(aq) + 2(NH4)3PO4(aq) = Mn3(PO4)2(s) + 6NH4I(aq)
3K2MnO4+2Al=8K +Al2(MnO4)33K2MnO4 + 2Al = 6K + Al2(MnO4)3
3K2MnO4+2Al=8K +Al2(MnO4)33K2MnO4 + 2Al = 6K + Al2(MnO4)3
3Mg+2AlCl3=2Al+3MgCl23Mg + 2AlCl3 = 2Al + 3MgCl2
3Mg+2AlCl3=2Al+3MgCl23Mg + 2AlCl3 = 2Al + 3MgCl2
3H2S +HNO3 = S + 2NO + 4H2O3H2S + 2HNO3 = 3S + 2NO + 4H2O
3Fe + 4H2O = Fe3O4 + 4H23Fe + 4H2O = Fe3O4 + 4H2
3H2S + HNO3 = S + 2NO + 4H2O3H2S + 2HNO3 = 3S + 2NO + 4H2O
3Fe + 4H2O = Fe3O4 + 4H23Fe + 4H2O = Fe3O4 + 4H2
3 HClO3 + Fe(OH)3 = 3 H2O + Fe(ClO3)33HClO3 + Fe(OH)3 = 3H2O + Fe(ClO3)3
3Ba(NO3)2 +Na2SO4 = BaSO4+NaNO3Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
3Mg(NO3)2 + 2K3PO4 = Mg3(PO4)2 + 6KNO33Mg(NO3)2 + 2K3PO4 = Mg3(PO4)2 + 6KNO3
3SO2 + 2O2 = SO32SO2 + O2 = 2SO3
3Al+2CuCl2=2AlCl3+2Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
3Al+2CuCl2=2AlCl3+2Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
3Zn(OH)2*2ZnCO3 = ZnO + CO2 +H2OZn(OH)2*2ZnCO3 = 3ZnO + 2CO2 + H2O
3Zn(OH)2*2ZnCO3 = ZnO + CO2 +H2OZn(OH)2*2ZnCO3 = 3ZnO + 2CO2 + H2O
3NH4OH+H3PO4=(NH4)3PO4+3H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
3AgNO3 + Na3PO4 = Ag3PO4 + 3NaNO3 3AgNO3 + Na3PO4 = Ag3PO4 + 3NaNO3
3Cu + 8HNO3 = 3Cu (NO3)2 + 8NO +4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 8HNO3 = 3Cu (NO3) + 8NO +4H2O3Cu + 4HNO3 = 3Cu(NO3) + NO + 2H2O
3 CuCl2 (aq) + 2 Na3AsO4 (aq) =Cu3(AsO4)2 (s) + 6 NaCl (aq) 3CuCl2(aq) + 2Na3AsO4(aq) = Cu3(AsO4)2(s) + 6NaCl(aq)
3 Zn(OH)2 + 2 H3Po4 = Zn3(Po4)2 + 6 H2O3Zn(OH)2 + 2H3Po4 = Zn3(Po4)2 + 6H2O
3NaOCl+KI=NaIO+2NaCl+KClNaOCl + KI = NaIO + 0NaCl + KCl
3Cr(NO3)2(aq) + 2Na3PO4(aq) = Cr3(PO4)2(s) + 6NaNO3(aq)3Cr(NO3)2(aq) + 2Na3PO4(aq) = Cr3(PO4)2(s) + 6NaNO3(aq)
3Zn(OH)2+2H3PO4 = Zn3(PO4)2+3H2O3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O
3Ca3P2+7H2O=Ca3O+H2P2Ca3P2 + H2O = Ca3O + H2P2
3Ca3P2+7H2O=Ca3O+H2P2Ca3P2 + H2O = Ca3O + H2P2
3Ca3P2+7H2O=Ca3O+H2P2Ca3P2 + H2O = Ca3O + H2P2
3Ca3P2+7H2O=Ca3O+H2P2Ca3P2 + H2O = Ca3O + H2P2
3Ca3P2+7H2O=Ca3O+H2P2Ca3P2 + H2O = Ca3O + H2P2
3Ca3P2+7H2O=Ca3O+H2P2Ca3P2 + H2O = Ca3O + H2P2
3Ca3P2+H2O=Ca3O+H2P2Ca3P2 + H2O = Ca3O + H2P2
3BaO + 2Al = 3Ba + Al2O33BaO + 2Al = 3Ba + Al2O3
3 FeSO4 + 6 AgNO3 = 6 Ag + 2 Fe(NO3)3 + Fe(SO4)33FeSO4 + 6AgNO3 = 6Ag + 2Fe(NO3)3 + Fe(SO4)3
3N2O4(g)+2H2O(l)=4HNO3(aq)+2NO(g)3N2O4(g) + 2H2O(l) = 4HNO3(aq) + 2NO(g)
3CA(OH)2+1Al2(SO4)3=3CASO4+2Al(OH)33CA(OH)2 + Al2(SO4)3 = 3CASO4 + 2Al(OH)3
3Cr+4O2=CrO2Cr + O2 = 2CrO
3Cr(SO3)2 + Cu(NO4) = Cu + Cr(SO3)3 + Cr2(NO4)6Cr(SO3)2 + Cu(NO4) = Cu + 4Cr(SO3)3 + Cr2(NO4)
3CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
3CO+FeO=2Fe+3COCO + 0FeO = 0Fe + CO
3Pb(NO3)2 + 2FeCl3 = 3PbCl2 + 2Fe(NO3)33Pb(NO3)2 + 2FeCl3 = 3PbCl2 + 2Fe(NO3)3
3C+2Fe2O3=3CO2+4Fe3C + 2Fe2O3 = 3CO2 + 4Fe
3HNO2=HNO3+2NO+H2O3HNO2 = HNO3 + 2NO + H2O
3CuI2(aq) + 2K3PO4(aq) = Cu3(PO4)2(s) + 6KI(aq)3CuI2(aq) + 2K3PO4(aq) = Cu3(PO4)2(s) + 6KI(aq)
3 Fe (s) + 4 H2O (g) = 4 H2 (g) + Fe3O4 (s)3Fe(s) + 4H2O(g) = 4H2(g) + Fe3O4(s)
3Al + 3CuCl2 = 3Cu + 2AlCl32Al + 3CuCl2 = 3Cu + 2AlCl3
3NH3 + 3O2 = 3NO + 3H2O4NH3 + 5O2 = 4NO + 6H2O
3Ca = Ca33Ca = Ca3
3AgNO3+FeCl3= 3AgCl+ Fe(NO3)33AgNO3 + FeCl3 = 3AgCl + Fe(NO3)3
3H2+3Cl2=HClH2 + Cl2 = 2HCl
3Sn(SO4)2+4K3PO4=Sn3(PO4)4+6K2SO43Sn(SO4)2 + 4K3PO4 = Sn3(PO4)4 + 6K2SO4
3Sn(SO4)2+4K3PO4=Sn3(PO4)4+6K2SO43Sn(SO4)2 + 4K3PO4 = Sn3(PO4)4 + 6K2SO4
3CaCl2 + 2Al(OH)3 = 3Ca(OH)2 + 2AlCl33CaCl2 + 2Al(OH)3 = 3Ca(OH)2 + 2AlCl3
3 K3PO4 + 3 Al(NO3)3 = 9 KNO3 + Al3(PO4)3 3K3PO4 + 3Al(NO3)3 = 9KNO3 + Al3(PO4)3
3XeF4+6H2O=2XeO3+Xe+12HF3XeF4 + 6H2O = 2XeO3 + Xe + 12HF
3XeF4+7H2O=2XeO3+Xe+12HF3XeF4 + 6H2O = 2XeO3 + Xe + 12HF
3XeF4+6H2O=2XeO3+Xe+12HF3XeF4 + 6H2O = 2XeO3 + Xe + 12HF
3 CuSO4 +2 Al =3 Cu + 1 Al2(SO4)33CuSO4 + 2Al = 3Cu + Al2(SO4)3
3Pb(NO3)2(s) + 2Na3PO4(l) = Pb3(PO4)2(g)+ 6NaNO3(l)3Pb(NO3)2(s) + 2Na3PO4(l) = Pb3(PO4)2(g) + 6NaNO3(l)
3Pb(NO3)2(l) + 2Na3PO4(l) = Pb3(PO4)2(g)+ 6NaNO3(l)3Pb(NO3)2(l) + 2Na3PO4(l) = Pb3(PO4)2(g) + 6NaNO3(l)
3CuCl2 + 2Al = 2AlCl3 +3Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
3 (NH4)2SO4 + 2 K3PO4 + 6 H2O = 6 NH4OH + 2 H3PO4 + 3 K2SO43(NH4)2SO4 + 2K3PO4 + 6H2O = 6NH4OH + 2H3PO4 + 3K2SO4
3CH4+3N2Cl4=3N2+6H2+3CCl4CH4 + N2Cl4 = N2 + 2H2 + CCl4
3 Na + AlCl3 = 3 NaCl + Al3Na + AlCl3 = 3NaCl + Al
3Ca+2Al(NO3)3 = 2Al+ 3Ca(NO3)23Ca + 2Al(NO3)3 = 2Al + 3Ca(NO3)2
3Zn + 2K3P04 = Zn3(P04)2+6K3Zn + 2K3P04 = Zn3(P04)2 + 6K
3Zn +2K3Po4 = Zn3 (Po4) 2+6K3Zn + 2K3Po4 = Zn3(Po4)2 + 6K
3LiNO3 + Sb = Sb(NO3)3 +3 Li3LiNO3 + Sb = Sb(NO3)3 + 3Li
3H2SO4 + 2Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3H2SO4+MnO2+2KBr=MnSO4+Br2+2KHSO4+2H2O3H2SO4 + MnO2 + 2KBr = MnSO4 + Br2 + 2KHSO4 + 2H2O
3H2SO4+MnO2+2KBr=MnSO4+Br2+2KHSO4+2H2O3H2SO4 + MnO2 + 2KBr = MnSO4 + Br2 + 2KHSO4 + 2H2O
3Ca + LuF3 = Lu + 3CaF23Ca + 2LuF3 = 2Lu + 3CaF2
3 Mg + 2 H3PO4 = Mg3(PO4)2 + 3 H23Mg + 2H3PO4 = Mg3(PO4)2 + 3H2
3H3+N2=2NH32H3 + N2 = 2NH3
3NaOCl (aq)+KI (aq) = NaIO3 (aq)+2NaC l(aq)+KCl (aq)3NaOCl(aq) + KI(aq) = NaIO3(aq) + 2NaCl(aq) + KCl(aq)
3NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
3IBr + 4NH3 = NI3 + NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
3Mg + Al2(SO4)3 = 3MgSO4 + 2Al3Mg + Al2(SO4)3 = 3MgSO4 + 2Al
3N2 + 11H2 = NH3N2 + 3H2 = 2NH3
3Li + LaCl3 = La + LiCl3Li + LaCl3 = La + 3LiCl
3K2MnO4 + 2Al = 6K + Al2(MnO4)33K2MnO4 + 2Al = 6K + Al2(MnO4)3
3C2H6+O2=CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
3CaCO3+2H3PO4=Ca3(PO4)2+3CO2+3H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
3CH4 + 3N2Cl4 = 3CCl4 + 3N2 + 6H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
3 O2 + CS2 = CO2 + 2 SO23O2 + CS2 = CO2 + 2SO2
3N2 + 18H2 = NH3N2 + 3H2 = 2NH3
3N2 + 6H2 = NH3N2 + 3H2 = 2NH3
3N2 + 6H2 = 2NH3N2 + 3H2 = 2NH3
3CuCl + 2Al =2AlCl + 3CuCuCl + Al = AlCl + Cu
3NaOCl + KI = NaIO3 + 2NaCl + KCl3NaOCl + KI = NaIO3 + 2NaCl + KCl
3 Pb + 2 H3PO4 =3 H2 + 1 Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
3Al+4Br2=AlBr32Al + 3Br2 = 2AlBr3
3Al+4Br2=AlBr32Al + 3Br2 = 2AlBr3
3Al+4Br2=AlBr32Al + 3Br2 = 2AlBr3
3H2 + N2 = 2 NH33H2 + N2 = 2NH3
3PbO2 + 4AlCl3 = 3PbCl4 + 2Al2O33PbO2 + 4AlCl3 = 3PbCl4 + 2Al2O3
3CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)23CaCl2 + 2Na3PO4 = 6NaCl + Ca3(PO4)2
3IBr + 4NH3 = NI3 + NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
3CaO + 2Al = Al2O3 + 3Ca3CaO + 2Al = Al2O3 + 3Ca
3K2Cr2O7 + KBr + H2SO4 = Br2 + Cr2(SO4)3 + H2O + K2SO4K2Cr2O7 + 6KBr + 7H2SO4 = 3Br2 + Cr2(SO4)3 + 7H2O + 4K2SO4
3 Pb + 2 H3PO4 = 3 H2 + 1 Pb3(PO4)23Pb + 2H3PO4 = 3H2 + Pb3(PO4)2
3 CuO (s)+2NH3(g)=3 Cu (s)+N2 (g)+3 H2O (g)3CuO(s) + 2NH3(g) = 3Cu(s) + N2(g) + 3H2O(g)
3 Ba(No3)2 + 2 H3PO4 = Ba3(PO4)2 + 6 HNo33Ba(No3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNo3
3 Ba(No3)2 + 2 H3PO4 = Ba3(PO4)2 + 6 HNo33Ba(No3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNo3
3Br2+6Fe=6FeBr33Br2 + 2Fe = 2FeBr3
3C+2O2=3CO2C + O2 = CO2
3H2 + 3Cl2 = HClH2 + Cl2 = 2HCl
3Mg(OH)2+H3PO4=Mg3(PO4)2+6H2O3Mg(OH)2 + 2H3PO4 = Mg3(PO4)2 + 6H2O
3NO2+2H2O=2HNO3+3NO3NO2 + H2O = 2HNO3 + NO
3H2 + 3Cl2 = HClH2 + Cl2 = 2HCl
3K2MnO4 + H2O = KMnO4 + MnO2 + KOH3K2MnO4 + 2H2O = 2KMnO4 + MnO2 + 4KOH
3Li + AlCl3 = 3LiCl + Al3Li + AlCl3 = 3LiCl + Al
3MgO + 2Al = 3Mg + Al2O33MgO + 2Al = 3Mg + Al2O3
3 CuCl2 +2 Al = 3AlCl3+ 3Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
3Ca + AlCl3 = CaCl2 + 2Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
3Li + ErCl3 = Er + LiCl3Li + ErCl3 = Er + 3LiCl
3N2+2O2=3N2O2N2 + O2 = 2N2O
3I2(s) + 10HNO3(aq) = 6HIO3(s) + 10NO(g) + 2H2O(l)3I2(s) + 10HNO3(aq) = 6HIO3(s) + 10NO(g) + 2H2O(l)
3Zn + 2HCl = ZnCl + H22Zn + 2HCl = 2ZnCl + H2
3Zn + HCl = HZn + ClZn + HCl = HZn + Cl
3 Ti + 2 N2 = Ti3N43Ti + 2N2 = Ti3N4
3Ca + LaF3 = 2La + CaF23Ca + 2LaF3 = 2La + 3CaF2
3Li + NdCl3 =Nd + 3LiCl3Li + NdCl3 = Nd + 3LiCl
3Ca + 2DyF3 = Dy + CaF23Ca + 2DyF3 = 2Dy + 3CaF2
3Fe2O3+6Al=6Fe+3Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
3H2 + N2 = NH33H2 + N2 = 2NH3
3Mg(CH3COO)2 + 2K3PO4 = Mg3(PO4)2 + 6KCH3COO3Mg(CH3COO)2 + 2K3PO4 = Mg3(PO4)2 + 6KCH3COO
3CaCl2 + 2NaPO4 = Ca(PO4)2 + 6NaClCaCl2 + 2NaPO4 = Ca(PO4)2 + 2NaCl
3H2 + N2 = 2NH33H2 + N2 = 2NH3
3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq) 3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq)
3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq) 3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq)
3 Ni + 2AuBr3 = 3NiBr2 + 2Au3Ni + 2AuBr3 = 3NiBr2 + 2Au
3Fe2O3+6Al=6Fe+3Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O
3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O
3MgO + 2Al = 3Mg + Al2O33MgO + 2Al = 3Mg + Al2O3
3O2 + 4Fe = 2Fe2O33O2 + 4Fe = 2Fe2O3
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3CH3COOH+2O2=2CO2+2H2OCH3COOH + 2O2 = 2CO2 + 2H2O
3CH3COOH+O2=CO2+H2OCH3COOH + 2O2 = 2CO2 + 2H2O
3CH3COOH+O2=CO2+H2OCH3COOH + 2O2 = 2CO2 + 2H2O
3CH4+3N2Cl4=3N2+6H2+3CCl4CH4 + N2Cl4 = N2 + 2H2 + CCl4
3CH4+3N2Cl4=3N2+6H2+3CCl4CH4 + N2Cl4 = N2 + 2H2 + CCl4
3 Li2SO4(aq) + 2 AlCl3(aq)=6 LiCl + Al2(SO4)33Li2SO4(aq) + 2AlCl3(aq) = 6LiCl + Al2(SO4)3
3 H2O = H2 +3 O22H2O = 2H2 + O2
3 CAOCl2 + 2 NH3 = 3 CACl2 + 3 H2O + N23CAOCl2 + 2NH3 = 3CACl2 + 3H2O + N2
3NaBr+H3PO4=2HBr+Na3PO43NaBr + H3PO4 = 3HBr + Na3PO4
3Mg(NO3)2+2K3PO4=Mg3(PO4)2+6KNO33Mg(NO3)2 + 2K3PO4 = Mg3(PO4)2 + 6KNO3
3Pb(NO3)2+2FeCl3=3PbCl2+2Fe(NO3)33Pb(NO3)2 + 2FeCl3 = 3PbCl2 + 2Fe(NO3)3
3O2 + CS2 = CO2 +2SO23O2 + CS2 = CO2 + 2SO2
3H2O=H2+3O22H2O = 2H2 + O2
3 BaCl2 (aq) + 2 Na3PO4 (aq)=Ba3(PO4)2 (s) + 6 NaCl (aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
3KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
3KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
3Ca(OH)2 + Al2(SO4)3 = 2Al (OH)3 + 3CaSO43Ca(OH)2 + Al2(SO4)3 = 2Al(OH)3 + 3CaSO4
3Fe3O4 + 4Al = 9Fe + 4Al2O33Fe3O4 + 8Al = 9Fe + 4Al2O3
3Ca+O2=CaO2Ca + O2 = 2CaO
3P+5HNO3+2H2O=H3PO4+NO2P + 5HNO3 - H2O = H3PO4 + 5NO2
3P+5HNO3+2H2O=H3PO4+NO2P + 5HNO3 - H2O = H3PO4 + 5NO2
3Ca(OH)2+2H3PO4=Ca3(PO4)2+6H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
3H2O + CO2 = CH4 + O22H2O + CO2 = CH4 + 2O2
3CaSO4+AlCl3=3CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
3CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
3NO2(g)+H2O(l)=NO(g)+2HNO3(aq)3NO2(g) + H2O(l) = NO(g) + 2HNO3(aq)
3Al + 3NH4ClO4 = Al2O3 + AlCl3 + 3NO + 6H2O3Al + 3NH4ClO4 = Al2O3 + AlCl3 + 3NO + 6H2O
3PH3 +4HClO3 =3H3PO4 +4HCl3PH3 + 4HClO3 = 3H3PO4 + 4HCl
3 C6H12O6 = 2 H2O + 4 C3H8O + 6 CO23C6H12O6 = 2H2O + 4C3H8O + 6CO2
3Na+AlCl3=Al + 3NaCl3Na + AlCl3 = Al + 3NaCl
3Cu+2AlCl=2Al+3CuClCu + AlCl = Al + CuCl
3NH3 + 5O2 = 4H2O + 3 NO24NH3 + 7O2 = 6H2O + 4NO2
3H2+2O2=H2O2H2 + O2 = 2H2O
3Ca(OH)2+2H3PO4= Ca3(PO4)2+6H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
3K2MnO4  +  H2O  = KMnO4  +  MnO2  +  KOH3K2MnO4 + 2H2O = 2KMnO4 + MnO2 + 4KOH
3MnO2 + 4Al = 3Mn + 2Al2O33MnO2 + 4Al = 3Mn + 2Al2O3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ca+2AlPO4=2Al+Ca3(PO4)23Ca + 2AlPO4 = 2Al + Ca3(PO4)2
3Ba(NO3)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(NO3)33Ba(NO3)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(NO3)3
3Ba(NO3)2(aq)+Fe2(SO4)3(aq)=3BaSO4(s)+2Fe(NO3)3(aq)3Ba(NO3)2(aq) + Fe2(SO4)3(aq) = 3BaSO4(s) + 2Fe(NO3)3(aq)
3 Ag + 4 HNO3 = 3 AgNO3 + NO + 2 H2O3Ag + 4HNO3 = 3AgNO3 + NO + 2H2O
3Mg(NO3)2 + 2Na2S = NaNO3 + MgSMg(NO3)2 + Na2S = 2NaNO3 + MgS
3Mg(NO3)2 + 2Na2S = NaNO3 + MgSMg(NO3)2 + Na2S = 2NaNO3 + MgS
3Na2SO4 + 2AlBr3 = AlSO4 + Na2Br3Na2SO4 + AlBr3 = AlSO4 + Na2Br3
3Ca+2DyF3=Dy+CaF23Ca + 2DyF3 = 2Dy + 3CaF2
3Ca + LaF3 = 2La + CaF23Ca + 2LaF3 = 2La + 3CaF2
3CuO + NH3 = Cu + 3H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
3Ca + LaF3 = 2La + CaF23Ca + 2LaF3 = 2La + 3CaF2
3BaCl2 + Al2(SO4)3 = BaSO4 + AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
3Mg + 2N2 = Mg3N23Mg + N2 = Mg3N2
3H2+N2=NH33H2 + N2 = 2NH3
3H2+Cl=6HClH2 + 2Cl = 2HCl
3H2+Cl=6HClH2 + 2Cl = 2HCl
3 CaCl2 + Na3PO4 = Ca3(PO4)2 + 6 NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
3HCl + NH3 = NCl3 + 6H3HCl + NH3 = NCl3 + 6H
3HCl + NH3 = NCl3 + 6H3HCl + NH3 = NCl3 + 6H
3Fe(No3) + C8H12No3Cl = Fe(C8H11No3Cl) +HNo3Fe(No3) + C8H12No3Cl = Fe(C8H11No3Cl) + HNo3
3 Hg(OH)2 + 2 H3PO4 =Hg3(PO4)2 + H2O3Hg(OH)2 + 2H3PO4 = Hg3(PO4)2 + 6H2O
3 NaOH + FeCl3 = Fe(OH)3 + 3NaCl 3NaOH + FeCl3 = Fe(OH)3 + 3NaCl
3 KOH + FeCl3 = 3 KCl + Fe(OH)33KOH + FeCl3 = 3KCl + Fe(OH)3
3 Ba(OH)2 + 2 FeCl3 = 3 BaCl2 + 2 Fe(OH)33Ba(OH)2 + 2FeCl3 = 3BaCl2 + 2Fe(OH)3
3AgNO3 + FeCl3 = 3AgCl + Fe(NO3)33AgNO3 + FeCl3 = 3AgCl + Fe(NO3)3
3 Ba(OH)2 + 2 FeCl3 = 3 BaCl2 + 2 Fe(OH)33Ba(OH)2 + 2FeCl3 = 3BaCl2 + 2Fe(OH)3
3HCl(aq)+Fe(OH)3(s)=FeCl3(s)+3H2O(aq)3HCl(aq) + Fe(OH)3(s) = FeCl3(s) + 3H2O(aq)
3Be(ClO4)2 + Fe3(Po4)2 = Be3(Po4)2 + Fe3(ClO4)63Be(ClO4)2 + Fe3(Po4)2 = Be3(Po4)2 + Fe3(ClO4)6
3 H2 + N2 = 2 NH33H2 + N2 = 2NH3
3 H2 + N2 = 2 NH33H2 + N2 = 2NH3
3 H2 + N2 = 2 NH33H2 + N2 = 2NH3
3Zn Cl2 + 2Al = 2AlCl3 + 3Zn3ZnCl2 + 2Al = 2AlCl3 + 3Zn
3Zn + 2 AlPO4= Zn3(PO4)2 + 2Al3Zn + 2AlPO4 = Zn3(PO4)2 + 2Al
3KOH+H3PO4=K3PO4+3H2O3KOH + H3PO4 = K3PO4 + 3H2O
34NH3+17O2=17NO+17H2O4NH3 + 5O2 = 4NO + 6H2O
3CaCl2+2Na3Po4=Ca3(Po4)2+6NaCl3CaCl2 + 2Na3Po4 = Ca3(Po4)2 + 6NaCl
3AgCl = 3AgClAgCl = AgCl
3K + Cl2 = 2KCl2K + Cl2 = 2KCl
3ASH3+8HNO3=3H3ASO4+8NO+4H2O3ASH3 + 8HNO3 = 3H3ASO4 + 8NO + 4H2O
3ASH3+8HNO3=3H3ASO4+8NO+4H2O3ASH3 + 8HNO3 = 3H3ASO4 + 8NO + 4H2O
3Fe2O3+6Al = 6Fe+3Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
3Zn(OH)2+2H3PO4=Zn3(PO4)2+3H2O3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O
3Pb(N3)2+2Cr (MnO4)2 = Cr2O3+MnO2+Pb3O4+NO15Pb(N3)2 + 44Cr(MnO4)2 = 22Cr2O3 + 88MnO2 + 5Pb3O4 + 90NO
3Li + P = Li3P3Li + P = Li3P
3 NH4NO2 + 4 NaOH = 4 NaNO2 + 2 NH3 + 5 H2O NH4NO2 + NaOH = NaNO2 + NH3 + H2O
30NO2 + 4H20 = HNO3 + NO40NO2 + H20 = 20HNO3 + 20NO
3CH4+3N2Cl4=3CCl4+6H2+3N2CH4 + N2Cl4 = CCl4 + 2H2 + N2

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.