Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
3 CuO (s)+2NH3(g)=3 Cu (s)+N2 (g)+3 H2O (g)3CuO(s) + 2NH3(g) = 3Cu(s) + N2(g) + 3H2O(g)
3 Ba(No3)2 + 2 H3PO4 = Ba3(PO4)2 + 6 HNo33Ba(No3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNo3
3 Ba(No3)2 + 2 H3PO4 = Ba3(PO4)2 + 6 HNo33Ba(No3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNo3
3Br2+6Fe=6FeBr33Br2 + 2Fe = 2FeBr3
3C+2O2=3CO2C + O2 = CO2
3H2 + 3Cl2 = HClH2 + Cl2 = 2HCl
3Mg(OH)2+H3PO4=Mg3(PO4)2+6H2O3Mg(OH)2 + 2H3PO4 = Mg3(PO4)2 + 6H2O
3NO2+2H2O=2HNO3+3NO3NO2 + H2O = 2HNO3 + NO
3H2 + 3Cl2 = HClH2 + Cl2 = 2HCl
3K2MnO4 + H2O = KMnO4 + MnO2 + KOH3K2MnO4 + 2H2O = 2KMnO4 + MnO2 + 4KOH
3Li + AlCl3 = 3LiCl + Al3Li + AlCl3 = 3LiCl + Al
3MgO + 2Al = 3Mg + Al2O33MgO + 2Al = 3Mg + Al2O3
3 CuCl2 +2 Al = 3AlCl3+ 3Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
3Ca + AlCl3 = CaCl2 + 2Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
3Li + ErCl3 = Er + LiCl3Li + ErCl3 = Er + 3LiCl
3N2+2O2=3N2O2N2 + O2 = 2N2O
3I2(s) + 10HNO3(aq) = 6HIO3(s) + 10NO(g) + 2H2O(l)3I2(s) + 10HNO3(aq) = 6HIO3(s) + 10NO(g) + 2H2O(l)
3Zn + 2HCl = ZnCl + H22Zn + 2HCl = 2ZnCl + H2
3Zn + HCl = HZn + ClZn + HCl = HZn + Cl
3 Ti + 2 N2 = Ti3N43Ti + 2N2 = Ti3N4
3Ca + LaF3 = 2La + CaF23Ca + 2LaF3 = 2La + 3CaF2
3Li + NdCl3 =Nd + 3LiCl3Li + NdCl3 = Nd + 3LiCl
3Ca + 2DyF3 = Dy + CaF23Ca + 2DyF3 = 2Dy + 3CaF2
3Fe2O3+6Al=6Fe+3Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
3H2 + N2 = NH33H2 + N2 = 2NH3
3Mg(CH3COO)2 + 2K3PO4 = Mg3(PO4)2 + 6KCH3COO3Mg(CH3COO)2 + 2K3PO4 = Mg3(PO4)2 + 6KCH3COO
3CaCl2 + 2NaPO4 = Ca(PO4)2 + 6NaClCaCl2 + 2NaPO4 = Ca(PO4)2 + 2NaCl
3H2 + N2 = 2NH33H2 + N2 = 2NH3
3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq) 3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq)
3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq) 3AgNO3(aq) + GaCl3(aq) = 3AgCl(s) + Ga(NO3)3(aq)
3 Ni + 2AuBr3 = 3NiBr2 + 2Au3Ni + 2AuBr3 = 3NiBr2 + 2Au
3Fe2O3+6Al=6Fe+3Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O
3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O3MoO3 + 2NH3 = N2 + 3MoO2 + 3H2O
3MgO + 2Al = 3Mg + Al2O33MgO + 2Al = 3Mg + Al2O3
3O2 + 4Fe = 2Fe2O33O2 + 4Fe = 2Fe2O3
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3CH3COOH+2O2=2CO2+2H2OCH3COOH + 2O2 = 2CO2 + 2H2O
3CH3COOH+O2=CO2+H2OCH3COOH + 2O2 = 2CO2 + 2H2O
3CH3COOH+O2=CO2+H2OCH3COOH + 2O2 = 2CO2 + 2H2O
3CH4+3N2Cl4=3N2+6H2+3CCl4CH4 + N2Cl4 = N2 + 2H2 + CCl4
3CH4+3N2Cl4=3N2+6H2+3CCl4CH4 + N2Cl4 = N2 + 2H2 + CCl4
3 Li2SO4(aq) + 2 AlCl3(aq)=6 LiCl + Al2(SO4)33Li2SO4(aq) + 2AlCl3(aq) = 6LiCl + Al2(SO4)3
3 H2O = H2 +3 O22H2O = 2H2 + O2
3 CAOCl2 + 2 NH3 = 3 CACl2 + 3 H2O + N23CAOCl2 + 2NH3 = 3CACl2 + 3H2O + N2
3NaBr+H3PO4=2HBr+Na3PO43NaBr + H3PO4 = 3HBr + Na3PO4
3Mg(NO3)2+2K3PO4=Mg3(PO4)2+6KNO33Mg(NO3)2 + 2K3PO4 = Mg3(PO4)2 + 6KNO3
3Pb(NO3)2+2FeCl3=3PbCl2+2Fe(NO3)33Pb(NO3)2 + 2FeCl3 = 3PbCl2 + 2Fe(NO3)3
3O2 + CS2 = CO2 +2SO23O2 + CS2 = CO2 + 2SO2
3H2O=H2+3O22H2O = 2H2 + O2
3 BaCl2 (aq) + 2 Na3PO4 (aq)=Ba3(PO4)2 (s) + 6 NaCl (aq)3BaCl2(aq) + 2Na3PO4(aq) = Ba3(PO4)2(s) + 6NaCl(aq)
3KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
3KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
3Ca(OH)2 + Al2(SO4)3 = 2Al (OH)3 + 3CaSO43Ca(OH)2 + Al2(SO4)3 = 2Al(OH)3 + 3CaSO4
3Fe3O4 + 4Al = 9Fe + 4Al2O33Fe3O4 + 8Al = 9Fe + 4Al2O3
3Ca+O2=CaO2Ca + O2 = 2CaO
3P+5HNO3+2H2O=H3PO4+NO2P + 5HNO3 - H2O = H3PO4 + 5NO2
3P+5HNO3+2H2O=H3PO4+NO2P + 5HNO3 - H2O = H3PO4 + 5NO2
3Ca(OH)2+2H3PO4=Ca3(PO4)2+6H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
3H2O + CO2 = CH4 + O22H2O + CO2 = CH4 + 2O2
3CaSO4+AlCl3=3CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
3CaSO4+AlCl3=CaCl2+Al2(SO4)33CaSO4 + 2AlCl3 = 3CaCl2 + Al2(SO4)3
3NO2(g)+H2O(l)=NO(g)+2HNO3(aq)3NO2(g) + H2O(l) = NO(g) + 2HNO3(aq)
3Al + 3NH4ClO4 = Al2O3 + AlCl3 + 3NO + 6H2O3Al + 3NH4ClO4 = Al2O3 + AlCl3 + 3NO + 6H2O
3PH3 +4HClO3 =3H3PO4 +4HCl3PH3 + 4HClO3 = 3H3PO4 + 4HCl
3 C6H12O6 = 2 H2O + 4 C3H8O + 6 CO23C6H12O6 = 2H2O + 4C3H8O + 6CO2
3Na+AlCl3=Al + 3NaCl3Na + AlCl3 = Al + 3NaCl
3Cu+2AlCl=2Al+3CuClCu + AlCl = Al + CuCl
3NH3 + 5O2 = 4H2O + 3 NO24NH3 + 7O2 = 6H2O + 4NO2
3H2+2O2=H2O2H2 + O2 = 2H2O
3Ca(OH)2+2H3PO4= Ca3(PO4)2+6H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
3K2MnO4  +  H2O  = KMnO4  +  MnO2  +  KOH3K2MnO4 + 2H2O = 2KMnO4 + MnO2 + 4KOH
3MnO2 + 4Al = 3Mn + 2Al2O33MnO2 + 4Al = 3Mn + 2Al2O3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ca+2AlPO4=2Al+Ca3(PO4)23Ca + 2AlPO4 = 2Al + Ca3(PO4)2
3Ba(NO3)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(NO3)33Ba(NO3)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(NO3)3
3Ba(NO3)2(aq)+Fe2(SO4)3(aq)=3BaSO4(s)+2Fe(NO3)3(aq)3Ba(NO3)2(aq) + Fe2(SO4)3(aq) = 3BaSO4(s) + 2Fe(NO3)3(aq)
3 Ag + 4 HNO3 = 3 AgNO3 + NO + 2 H2O3Ag + 4HNO3 = 3AgNO3 + NO + 2H2O
3Mg(NO3)2 + 2Na2S = NaNO3 + MgSMg(NO3)2 + Na2S = 2NaNO3 + MgS
3Mg(NO3)2 + 2Na2S = NaNO3 + MgSMg(NO3)2 + Na2S = 2NaNO3 + MgS
3Na2SO4 + 2AlBr3 = AlSO4 + Na2Br3Na2SO4 + AlBr3 = AlSO4 + Na2Br3
3Ca+2DyF3=Dy+CaF23Ca + 2DyF3 = 2Dy + 3CaF2
3Ca + LaF3 = 2La + CaF23Ca + 2LaF3 = 2La + 3CaF2
3CuO + NH3 = Cu + 3H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
3Ca + LaF3 = 2La + CaF23Ca + 2LaF3 = 2La + 3CaF2
3BaCl2 + Al2(SO4)3 = BaSO4 + AlCl33BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
3Mg + 2N2 = Mg3N23Mg + N2 = Mg3N2
3H2+N2=NH33H2 + N2 = 2NH3
3H2+Cl=6HClH2 + 2Cl = 2HCl
3H2+Cl=6HClH2 + 2Cl = 2HCl
3 CaCl2 + Na3PO4 = Ca3(PO4)2 + 6 NaCl3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
3HCl + NH3 = NCl3 + 6H3HCl + NH3 = NCl3 + 6H
3HCl + NH3 = NCl3 + 6H3HCl + NH3 = NCl3 + 6H
3Fe(No3) + C8H12No3Cl = Fe(C8H11No3Cl) +HNo3Fe(No3) + C8H12No3Cl = Fe(C8H11No3Cl) + HNo3
3 Hg(OH)2 + 2 H3PO4 =Hg3(PO4)2 + H2O3Hg(OH)2 + 2H3PO4 = Hg3(PO4)2 + 6H2O
3 NaOH + FeCl3 = Fe(OH)3 + 3NaCl 3NaOH + FeCl3 = Fe(OH)3 + 3NaCl
3 KOH + FeCl3 = 3 KCl + Fe(OH)33KOH + FeCl3 = 3KCl + Fe(OH)3
3 Ba(OH)2 + 2 FeCl3 = 3 BaCl2 + 2 Fe(OH)33Ba(OH)2 + 2FeCl3 = 3BaCl2 + 2Fe(OH)3
3AgNO3 + FeCl3 = 3AgCl + Fe(NO3)33AgNO3 + FeCl3 = 3AgCl + Fe(NO3)3
3 Ba(OH)2 + 2 FeCl3 = 3 BaCl2 + 2 Fe(OH)33Ba(OH)2 + 2FeCl3 = 3BaCl2 + 2Fe(OH)3
3HCl(aq)+Fe(OH)3(s)=FeCl3(s)+3H2O(aq)3HCl(aq) + Fe(OH)3(s) = FeCl3(s) + 3H2O(aq)
3Be(ClO4)2 + Fe3(Po4)2 = Be3(Po4)2 + Fe3(ClO4)63Be(ClO4)2 + Fe3(Po4)2 = Be3(Po4)2 + Fe3(ClO4)6
3 H2 + N2 = 2 NH33H2 + N2 = 2NH3
3 H2 + N2 = 2 NH33H2 + N2 = 2NH3
3 H2 + N2 = 2 NH33H2 + N2 = 2NH3
3Zn Cl2 + 2Al = 2AlCl3 + 3Zn3ZnCl2 + 2Al = 2AlCl3 + 3Zn
3Zn + 2 AlPO4= Zn3(PO4)2 + 2Al3Zn + 2AlPO4 = Zn3(PO4)2 + 2Al
3KOH+H3PO4=K3PO4+3H2O3KOH + H3PO4 = K3PO4 + 3H2O
34NH3+17O2=17NO+17H2O4NH3 + 5O2 = 4NO + 6H2O
3CaCl2+2Na3Po4=Ca3(Po4)2+6NaCl3CaCl2 + 2Na3Po4 = Ca3(Po4)2 + 6NaCl
3AgCl = 3AgClAgCl = AgCl
3K + Cl2 = 2KCl2K + Cl2 = 2KCl
3ASH3+8HNO3=3H3ASO4+8NO+4H2O3ASH3 + 8HNO3 = 3H3ASO4 + 8NO + 4H2O
3ASH3+8HNO3=3H3ASO4+8NO+4H2O3ASH3 + 8HNO3 = 3H3ASO4 + 8NO + 4H2O
3Fe2O3+6Al = 6Fe+3Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
3Zn(OH)2+2H3PO4=Zn3(PO4)2+3H2O3Zn(OH)2 + 2H3PO4 = Zn3(PO4)2 + 6H2O
3Pb(N3)2+2Cr (MnO4)2 = Cr2O3+MnO2+Pb3O4+NO15Pb(N3)2 + 44Cr(MnO4)2 = 22Cr2O3 + 88MnO2 + 5Pb3O4 + 90NO
3Li + P = Li3P3Li + P = Li3P
3 NH4NO2 + 4 NaOH = 4 NaNO2 + 2 NH3 + 5 H2O NH4NO2 + NaOH = NaNO2 + NH3 + H2O
30NO2 + 4H20 = HNO3 + NO40NO2 + H20 = 20HNO3 + 20NO
3CH4+3N2Cl4=3CCl4+6H2+3N2CH4 + N2Cl4 = CCl4 + 2H2 + N2
3CuCl2+2(NH4)3PO4=6NH4Cl+Cu3(PO4)23CuCl2 + 2(NH4)3PO4 = 6NH4Cl + Cu3(PO4)2
3CuCl2 + 2Al = 2AlCl3 + 3Cu3CuCl2 + 2Al = 2AlCl3 + 3Cu
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3N2+4H2=NH3N2 + 3H2 = 2NH3
3NO = N2O + NO23NO = N2O + NO2
3PbO2=3PbO+O22PbO2 = 2PbO + O2
3K+N=K3N3K + N = K3N
3K+N=K3N3K + N = K3N
3Ca+N2=Ca3N23Ca + N2 = Ca3N2
3Ca+N2=Ca3N23Ca + N2 = Ca3N2
3Al(s) + Ag+ = Ag(s) + Al3+3Al(s) + Ag+ = Ag(s) + Al3+
3 Fe(NO 3 ) 2 + 2 Na 3 PO 4 =1 Fe 3 ( PO 4 ) 2 + 6 NaNO 33Fe(NO3)2 + 2Na3PO4 = Fe3(PO4)2 + 6NaNO3
3HBr + 1Al(OH)3 = 3H2O + 1AlBr33HBr + Al(OH)3 = 3H2O + AlBr3
3(H2O) + 2C = (C2H6) + (O3)3(H2O) + 2C = (C2H6) + (O3)
3(H2O) + 3C = (C2H6) + (O3)3(H2O) + 2C = (C2H6) + (O3)
3 Mg + Fe2(So4)3 = 3 MgSo4 + 2 Fe3Mg + Fe2(So4)3 = 3MgSo4 + 2Fe
3CO2+4H2O=H2CO3CO2 + H2O = H2CO3
3CaCO3=1CaO+1CO2CaCO3 = CaO + CO2
3CS2 + 4Cl2 = CCl4 + 2SCl2 CS2 + 4Cl2 = CCl4 + 2SCl2
3 Cu(NO3)2 + 2 K3PO4 = Cu3(PO4)2 + 6 KNO33Cu(NO3)2 + 2K3PO4 = Cu3(PO4)2 + 6KNO3
3Ba + Al2(SO4)3 = 2Al + 3Ba(SO4)3Ba + Al2(SO4)3 = 2Al + 3Ba(SO4)
3Fe3+9NH4OH = 3Fe(OH)3 + 9NH4Fe3 + 9NH4OH = 3Fe(OH)3 + 9NH4
3Li + H3PO4 = H2 + Li3PO46Li + 2H3PO4 = 3H2 + 2Li3PO4
3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + H2O3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
3KOH + H3PO4 = K3PO4 + 3H2O3KOH + H3PO4 = K3PO4 + 3H2O
3FeS2 + 11O2 = Fe3O4 + 6SO33FeS2 + 11O2 = Fe3O4 + 6SO3
3Al+3CuO=Al2O3+3Cu2Al + 3CuO = Al2O3 + 3Cu
3Ca + 2YbF3 = Yb + CaF23Ca + 2YbF3 = 2Yb + 3CaF2
3Ca + 2YbF3 = Yb + CaF23Ca + 2YbF3 = 2Yb + 3CaF2
3Li + TbCl3 = Tb + LiCl3Li + TbCl3 = Tb + 3LiCl
3Ca + N2 = Ca3N23Ca + N2 = Ca3N2
3Fe + 4H2O = Fe3O4 + H23Fe + 4H2O = Fe3O4 + 4H2
3Pb(NO3)2 (aq) + 2FeBr3 (aq) = 3PbBr2 (s) + 2Fe(NO3)3 (aq)3Pb(NO3)2(aq) + 2FeBr3(aq) = 3PbBr2(s) + 2Fe(NO3)3(aq)
3IBr + 4NH3 = NI3 + NH4Br3IBr + 4NH3 = NI3 + 3NH4Br
3 Ag2S + 2 Al + 4 Na2CO3 + 8 H2O = 6 Ag + 2 Na(Al(OH)4) + 3 Na2S + 4 H2CO3 3Ag2S + 2Al + 4Na2CO3 + 8H2O = 6Ag + 2Na(Al(OH)4) + 3Na2S + 4H2CO3
3 Ag2S + 2 Al + 4 Na2CO3 + 8 H2O = 6 Ag + 2 NaAl(OH)4 + 3 Na2S + 4 H2CO3 3Ag2S + 2Al + 4Na2CO3 + 8H2O = 6Ag + 2NaAl(OH)4 + 3Na2S + 4H2CO3
3 H2 + N2= NH33H2 + N2 = 2NH3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Rb + P= Rb3P3Rb + P = Rb3P
3Zn + 2CoCl2 = 3 ZnCl2 + 2 CoZn + CoCl2 = ZnCl2 + Co
3Ca + AlCl3 = 3CaCl2 + 2Al3Ca + 2AlCl3 = 3CaCl2 + 2Al
3Ca+4O2=CaO2Ca + O2 = 2CaO
3Ca+4O2=CaO2Ca + O2 = 2CaO
3Mn(NO3)2 + 2Al = 2Al(NO3)3 + 3Mn3Mn(NO3)2 + 2Al = 2Al(NO3)3 + 3Mn
3H2 + N2 = 2NH33H2 + N2 = 2NH3
3H2 + 3N2 = 2NH33H2 + N2 = 2NH3
3MgO + 6H + 2PO4= Mg3(PO4)2 + 3H2O3MgO + 6H + 2PO4 = Mg3(PO4)2 + 3H2O
3BrCHO + Cr2O72- + 8H2SO4 = 3BrCOOH + 2Cr3+ +4H2O+ S3BrCHO + 0Cr2O72- + H2SO4 = 3BrCOOH + 0Cr3+ + H2O + S
3 NH3 + 6 NO = 5 N2 + 6 H2O4NH3 + 6NO = 5N2 + 6H2O
3NH4OH+3H3PO4=3(NH4)3PO4+5H2O3NH4OH + H3PO4 = (NH4)3PO4 + 3H2O
3I2+10KNO3+4HCl=6KIO3+10NO+2H2O+4KCl3I2 + 10KNO3 + 4HCl = 6KIO3 + 10NO + 2H2O + 4KCl
3Mg(s)+2AlCl3 (aq) = 2Al(s)+3MgCl2 (aq)3Mg(s) + 2AlCl3(aq) = 2Al(s) + 3MgCl2(aq)
3 HI + Al2(CO3)3 = 3 HCO3 + Al2I33HI + Al2(CO3)3 = 3HCO3 + Al2I3
3 TiO2 + 4 Al =2 Al2O3 + 3 Ti 3TiO2 + 4Al = 2Al2O3 + 3Ti
3Fe2O3 + C = 2Fe3O4 + CO3Fe2O3 + C = 2Fe3O4 + CO
3Fe2O3 + C = 2Fe3O4 + CO3Fe2O3 + C = 2Fe3O4 + CO
3Li + ErCl3 = Er + 3LiCl3Li + ErCl3 = Er + 3LiCl
3 (NH4)2 + 2 CO2 + 4 NAOH = 2 NA2CO3 + 8 NH3 + 2 H2O3(NH4)2 + 2CO2 + 4NAOH = 2NA2CO3 + 8NH3 + 2H2O
3FeBr2(aq) + 2Na3PO4(aq)= Fe3(PO4)2(s) + 6NaBr(aq)3FeBr2(aq) + 2Na3PO4(aq) = Fe3(PO4)2(s) + 6NaBr(aq)
3Mg+2N=1Mg3N23Mg + 2N = Mg3N2
3 H2SO4 + 2Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
30CO2 + 3H20 = 5C6H12O6 + 15O230CO2 + 3H20 = 5C6H12O6 + 15O2
3 Co(s) + 9 HNO3(aq) = 3 Co(NO3)2(aq) + 2 NO(g) + 4 H2O(l) 3Co(s) + 8HNO3(aq) = 3Co(NO3)2(aq) + 2NO(g) + 4H2O(l)
3 Co(s) + 9 HNO3(aq) = 3 Co(NO3)2(aq) + 2 NO(g) + 4 H2O(l)3Co(s) + 8HNO3(aq) = 3Co(NO3)2(aq) + 2NO(g) + 4H2O(l)
3 H2SO4 + 2Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3 H2SO4 + 2Al=Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3 H2SO4(aq) + 2 Al(OH)3(s) = 3 H2O(l) + Al2(SO4)3(aq)3H2SO4(aq) + 2Al(OH)3(s) = 6H2O(l) + Al2(SO4)3(aq)
3N2H4(l) = 4NH3(g) + N2(g)3N2H4(l) = 4NH3(g) + N2(g)
3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)3NO2(g) + H2O(l) = 2HNO3(aq) + NO(g)
3Fe + 4H2O = Fe3O4 + 4H23Fe + 4H2O = Fe3O4 + 4H2
3Ba(NO3)2 + 2H3(PO4) = Ba3(PO4)2 + 6HNO33Ba(NO3)2 + 2H3(PO4) = Ba3(PO4)2 + 6HNO3
3Cu+8HNO3=Cu(NO3)2+NO+H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3BaO + As2O5 = Ba3(AsO4)23BaO + As2O5 = Ba3(AsO4)2
3CuSO4+2Al=Al2(SO4)3+3Cu3CuSO4 + 2Al = Al2(SO4)3 + 3Cu
3CuSO4+2Al=Al2(SO4)3+3Cu3CuSO4 + 2Al = Al2(SO4)3 + 3Cu
3CuSO4+2Al=Al2(SO4)3+3Cu3CuSO4 + 2Al = Al2(SO4)3 + 3Cu
3 MnCl2 + 2 KClO3 + 12 KOH = 3 K2MnO4 + 8 KCl + 6 H2O3MnCl2 + 2KClO3 + 12KOH = 3K2MnO4 + 8KCl + 6H2O
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3H2S + 2H+ + 2NO3 - = 3S + 2NO + 4H2H2S + 0H+ + 0NO3- = S + 0NO + H2
3Cu + 8HNO3= Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3 CuCl2*6H2O + 2 Al = 2 AlCl3 + 3 Cu + 18 H2O3CuCl2*6H2O + 2Al = 2AlCl3 + 3Cu + 18H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3 H2S(aq) + 2 Bi(NO3)3(aq) = Bi2S3(s) + 6 HNO3(aq)3H2S(aq) + 2Bi(NO3)3(aq) = Bi2S3(s) + 6HNO3(aq)
3 Ba(OH)2(aq) + 2 H3PO4(aq) = Ba3(PO4)2(s) + 6 H2O(l)3Ba(OH)2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) + 6H2O(l)
3Ag + 4HNO3 = 3AgNO3 +NO + 2H2020Ag + 20HNO3 = 20AgNO3 + 0NO + H20
3 H2O = H2 + 3 O22H2O = 2H2 + O2
3Sr(OH)2(aq) + 2H3PO4(aq)= Sr3(PO4)2 + 6H2O(l)3Sr(OH)2(aq) + 2H3PO4(aq) = Sr3(PO4)2 + 6H2O(l)
3Sr(OH)2(aq) + 2H3PO4(aq)= Sr3(PO4)2 + 6H2O(l)3Sr(OH)2(aq) + 2H3PO4(aq) = Sr3(PO4)2 + 6H2O(l)
3Sr(OH)2 + 2H3PO4 = Sr3(PO4)2 + 6H2O3Sr(OH)2 + 2H3PO4 = Sr3(PO4)2 + 6H2O
3CaCO3+H3PO4=Ca3(PO4)2+CO2+H2O3CaCO3 + 2H3PO4 = Ca3(PO4)2 + 3CO2 + 3H2O
3H2 + N2 = 2NH33H2 + N2 = 2NH3
3O2 + 4H2 = H2OO2 + 2H2 = 2H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+4H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3S + 2Al = Al2S33S + 2Al = Al2S3
3 H20 + 30 CO2 = 5 C6H12O6 + 15 O23H20 + 30CO2 = 5C6H12O6 + 15O2
3C+HNO3=CO2+2H2O+NO3C + 4HNO3 = 3CO2 + 2H2O + 4NO
3CH4+3N2Cl4=6H2+3CCl4+3N2CH4 + N2Cl4 = 2H2 + CCl4 + N2
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3 CaCl2+2 NaPO4=Ca(PO4)2+6 NaClCaCl2 + 2NaPO4 = Ca(PO4)2 + 2NaCl
3 CaCl2+2 NaPO4=Ca(PO4)2+6 NaClCaCl2 + 2NaPO4 = Ca(PO4)2 + 2NaCl
3CaCl2+2NaPO4=Ca(PO4)2+6NaClCaCl2 + 2NaPO4 = Ca(PO4)2 + 2NaCl
3Ba(NO3)2 (aq) + Al2(SO4)3 (aq) = 3BaSO4 (s) + 2Al(NO3)3 (aq)3Ba(NO3)2(aq) + Al2(SO4)3(aq) = 3BaSO4(s) + 2Al(NO3)3(aq)
3CH4+3N2Cl4 = 3CCl4+3N2+6H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
3 LiOH + Al(NO3)3 = Al(OH)3 + 3 LiNO33LiOH + Al(NO3)3 = Al(OH)3 + 3LiNO3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3NO2+H2O2=2HNO32NO2 + H2O2 = 2HNO3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Mg + N2 = Mg3N23Mg + N2 = Mg3N2
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=3Cu(NO3)2+8NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 12HNO3 = 3Cu(NO3)2 + 6H2O + 3NO3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
3CO2+4H2O=H2CO3CO2 + H2O = H2CO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3NO2 + H2O = NO + 2HNO33NO2 + H2O = NO + 2HNO3
3 H2S(aq) + 2 Bi(NO3)3(aq) = Bi2S3(s) + 6 HNO3(aq)3H2S(aq) + 2Bi(NO3)3(aq) = Bi2S3(s) + 6HNO3(aq)
3Cu+8HNO3=Cu (NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3N2Cl4+3CH4=3CCl4+3N2+6H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ag(s)+Au(NO3)3(aq)=Au(s)+3AgNO3(aq)3Ag(s) + Au(NO3)3(aq) = Au(s) + 3AgNO3(aq)
3Na+Cl2=3NaCl2Na + Cl2 = 2NaCl
3NO+4O2=NO22NO + O2 = 2NO2
3NH3(OH)(aq) + H3PO4(aq)=(NH3)3PO4(aq) + 3H2O(l)3NH3(OH)(aq) + H3PO4(aq) = (NH3)3PO4(aq) + 3H2O(l)
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3 BACl2 + Al2(SO4)3 = 3 BASO4 + 2 AlCl33BACl2 + Al2(SO4)3 = 3BASO4 + 2AlCl3
3 BACl2 + Al2(SO4)3 = 3 BASO4 + 2 AlCl33BACl2 + Al2(SO4)3 = 3BASO4 + 2AlCl3
3 BACl2 + Al2(SO4)3 = 3 BASO4 + 2 AlCl33BACl2 + Al2(SO4)3 = 3BASO4 + 2AlCl3
3 BACl2 + Al2(SO4)3 = 3 BASO4 + 2 AlCl33BACl2 + Al2(SO4)3 = 3BASO4 + 2AlCl3
3CH3 Cl+2NH3=N2+3CH4+3HCl3CH3Cl + 2NH3 = N2 + 3CH4 + 3HCl
3 LiOH + H 3 PO 4 =Li 3 PO 4 + 3 H 2 O3LiOH + H3PO4 = Li3PO4 + 3H2O
3 LiOH + H 3 PO 4 = 3 LiH + (OH) 3 PO 43LiOH + H3PO4 = 3LiH + (OH)3PO4
3 LiOH + H 3 PO 4 = Li 3 P + 2 H 2 O + H 3 O 521LiOH + 7H3PO4 = 7Li3P + 9H2O + 8H3O5
3 LiOH + H 3 PO 4 = Li 3 PO 4 + 3 H 2 O3LiOH + H3PO4 = Li3PO4 + 3H2O
3 LiOH + H 3 PO 4 = 3 LiH + (OH) 3 PO 43LiOH + H3PO4 = 3LiH + (OH)3PO4
3FeCl3 +2O2 = Fe2O3 +Cl4FeCl3 + 3O2 = 2Fe2O3 + 12Cl
3NO2(g)+H2O(l)=NO(g)+2HNO3(aq)3NO2(g) + H2O(l) = NO(g) + 2HNO3(aq)
3Fe + 6 H2O = Fe3O4 +2H23Fe + 4H2O = Fe3O4 + 4H2
3H2SO4 (aq) + 2Fe(s) =Fe2(SO4)3(aq) + H2(g)3H2SO4(aq) + 2Fe(s) = Fe2(SO4)3(aq) + 3H2(g)
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Na+ 3H2O = 3NaOH + H2 2Na + 2H2O = 2NaOH + H2
3Na2CrO4 + 2FeCl3 =Fe2(CrO4)3 (s) + 6NaCl (aq)3Na2CrO4 + 2FeCl3 = Fe2(CrO4)3(s) + 6NaCl(aq)
3MgBr2+2FeCl3=3MgCl2+2FeBr3 3MgBr2 + 2FeCl3 = 3MgCl2 + 2FeBr3
3CuSO4+2Al=Al2(SO4)3+3Cu3CuSO4 + 2Al = Al2(SO4)3 + 3Cu
3 Fe + 4H2O =Fe3O4 + 4H23Fe + 4H2O = Fe3O4 + 4H2
3Ca + 2LuF3 = Lu + CaF23Ca + 2LuF3 = 2Lu + 3CaF2
3Ca + 2ScF3 = Sc + 3CaF23Ca + 2ScF3 = 2Sc + 3CaF2
3Ca + 2CeF3 = 2Ce + CaF23Ca + 2CeF3 = 2Ce + 3CaF2
3Mg+2Fe(NO3)3=3Mg(NO3)2+2Fe3Mg + 2Fe(NO3)3 = 3Mg(NO3)2 + 2Fe
3 AgNo3 + AlCl3 = 3 AgCl + Al(No3)33AgNo3 + AlCl3 = 3AgCl + Al(No3)3
3Li + YCl3 = Y + 3LiCl3Li + YCl3 = Y + 3LiCl
3Li + YCl = Y + 3LiClLi + YCl = Y + LiCl
3Cu+8HNO =Cu(NO3)2+NO+H2O-1Cu + 8HNO = -1Cu(NO3)2 + 10NO + 4H2O
3 (NH4)2S + 2 FePO4 = 2 (NH4)3PO4 + Fe2S33(NH4)2S + 2FePO4 = 2(NH4)3PO4 + Fe2S3
3KOH(s)+HCl(l)= KCl(s)+H2O(l)KOH(s) + HCl(l) = KCl(s) + H2O(l)
3CaI2 + 2(NH4)3PO4=Ca3(PO4)2 + 6NH4I3CaI2 + 2(NH4)3PO4 = Ca3(PO4)2 + 6NH4I
3CaI2 + 2(NH4)3PO4=Ca3(PO4)2 + 6NH4I3CaI2 + 2(NH4)3PO4 = Ca3(PO4)2 + 6NH4I
3CaI2(aq) + 2(NH4)3PO4(aq) =Ca3(PO4)2(s) + 6NH4I(aq)3CaI2(aq) + 2(NH4)3PO4(aq) = Ca3(PO4)2(s) + 6NH4I(aq)
3FeCl2 + 2H3PO4 = Fe3(PO4)2 + 6HCl3FeCl2 + 2H3PO4 = Fe3(PO4)2 + 6HCl
3Hg(OH)2 + 4H3PO4= 3Hg3(PO4)2 + 6H2O3Hg(OH)2 + 2H3PO4 = Hg3(PO4)2 + 6H2O
3Ba(OH)2(aq) + 2Fe(NO3)3(aq)= 2Fe(OH)3(s) + 3Ba(NO3)2(aq) 3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq) 3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq) 3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3H2+N2=NH33H2 + N2 = 2NH3
3Ba(OH)2(aq) + 2Fe(NO3)3(aq)=2Fe(OH)3(s) + 3Ba(NO3)2(aq) 3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3Ba(OH)2(aq) + 2Fe(NO3)3(aq)=2Fe(OH)3(s) + 3Ba(NO3)2(aq) 3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3Ba(OH)2(aq) + 2Fe(NO3)3(aq)=2Fe(OH)3(s) + 3Ba(NO3)2(aq) 3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3KOH+H3PO4=K3PO4+2H2O3KOH + H3PO4 = K3PO4 + 3H2O
3KOH+H3PO4=K3PO4+2H2O3KOH + H3PO4 = K3PO4 + 3H2O
3Li + 2H2O = 2LiOH + H22Li + 2H2O = 2LiOH + H2
3Fe + 2H3PO4 = Fe3(PO4)2 + 3H23Fe + 2H3PO4 = Fe3(PO4)2 + 3H2
3Fe + 2H3PO4 = Fe3(PO4)2 + 3H23Fe + 2H3PO4 = Fe3(PO4)2 + 3H2
3Cu(NO3)2 + 2Cr = Cr(NO3)2 + CuCu(NO3)2 + Cr = Cr(NO3)2 + Cu
3Cu(NO3)2 + 2Cr = Cr(NO3)2 + CuCu(NO3)2 + Cr = Cr(NO3)2 + Cu
3C+3(O2)=3(CO2)C + (O2) = (CO2)
3Cu(NO3)2(aq) + 2Cr(s) = 2Cr(NO3)2 + 3CuCu(NO3)2(aq) + Cr(s) = Cr(NO3)2 + Cu
3AgNO3+(NH4)3PO4=Ag3PO4+3NH4NO33AgNO3 + (NH4)3PO4 = Ag3PO4 + 3NH4NO3
3Ba(OH)2 + 2Fe(NO3)3 = 2Fe(OH)3 + 3Ba(NO3)23Ba(OH)2 + 2Fe(NO3)3 = 2Fe(OH)3 + 3Ba(NO3)2
3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)3Ba(OH)2(aq) + 2Fe(NO3)3(aq) = 2Fe(OH)3(s) + 3Ba(NO3)2(aq)
3Cu+8HNO3=3Cu(NO3)2+8NO+4H26O51Cu + 104HNO3 = 51Cu(NO3)2 + 2NO + 4H26O
3Pb(NO3)2+2AlCl3=2Al(NO3)3+PbCl23Pb(NO3)2 + 2AlCl3 = 2Al(NO3)3 + 3PbCl2
3Ba+2H3AsO4=3H2+Ba3(AsO4)23Ba + 2H3AsO4 = 3H2 + Ba3(AsO4)2
3Al(s) + 3Br2(l) = Al3Br3 (s)6Al(s) + 3Br2(l) = 2Al3Br3(s)
3SrO + 2Al = 3Sr + Al2O33SrO + 2Al = 3Sr + Al2O3
3KOH +AlCl3 = Al(OH)3 + 3KCl3KOH + AlCl3 = Al(OH)3 + 3KCl
3 Cu + 2 Au(NO3)3 = 3 Cu(NO3)2 + 2 Au3Cu + 2Au(NO3)3 = 3Cu(NO3)2 + 2Au
3Ba (NO3)2 + 2H3PO4 = Ba3 (PO4)2 +6HNO33Ba(NO3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNO3
3 NH3(OH) + H3PO4 = (NH3)3PO4 + 3 H2O3NH3(OH) + H3PO4 = (NH3)3PO4 + 3H2O
3N2+2H2=6NH3N2 + 3H2 = 2NH3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ra + N2 = Ra3N23Ra + N2 = Ra3N2
3Ra + N2 = Ra3N23Ra + N2 = Ra3N2
3 AgNO3 + K3PO4 = Ag3PO4 + 3 KNO33AgNO3 + K3PO4 = Ag3PO4 + 3KNO3
3CH4+3N2Cl4=3CCl4+6H2+3N2CH4 + N2Cl4 = CCl4 + 2H2 + N2
3N2Cl4+3CH4 = H2+N2+CClN2Cl4 + 4CH4 = 8H2 + N2 + 4CCl
3Fe(s) + 2 CuSO4(aq)= Fe2(SO4)3(aq) + 3Cu(s)2Fe(s) + 3CuSO4(aq) = Fe2(SO4)3(aq) + 3Cu(s)
3Pb (NO3)2 +2K3PO4 = 6KNO3 + Pb3 (PO4)23Pb(NO3)2 + 2K3PO4 = 6KNO3 + Pb3(PO4)2
3H+ + 3F- + AlO(OH) = AlF3 + 2H2O3H+ + 3F- + AlO(OH) = AlF3 + 2H2O
3Pb(NO3)2 (aq) + 2CrCl3 (aq) =3PbCl2 (s) + 2Cr(NO3)3 (aq)3Pb(NO3)2(aq) + 2CrCl3(aq) = 3PbCl2(s) + 2Cr(NO3)3(aq)
3N2Cl4+3CH4 = 3CCl4+6H2+3N2N2Cl4 + CH4 = CCl4 + 2H2 + N2
3I2 + 2P = 2PI33I2 + 2P = 2PI3
3I2 + 2P = 2PI33I2 + 2P = 2PI3
3I2(s) + 2P(s) = 2PI33I2(s) + 2P(s) = 2PI3
3I2(s) + 2P(s) = 2PI3(s)3I2(s) + 2P(s) = 2PI3(s)
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Ba(OH)2+H3PO3=Ba3(PO3)2+H2O3Ba(OH)2 + 2H3PO3 = Ba3(PO3)2 + 6H2O
3 Ba + 2 H3AsO4 = 3 H2 + Ba3(AsO4)2 3Ba + 2H3AsO4 = 3H2 + Ba3(AsO4)2
3 N2H4(l) = 4 NH3(s) + N2(g)3N2H4(l) = 4NH3(s) + N2(g)
3 N2H4(l) = 4 NH3(s) + N2(g)3N2H4(l) = 4NH3(s) + N2(g)
3Sn(s) + 2O(g)= SnO(aq)Sn(s) + O(g) = SnO(aq)
3Cu + 2Au(NO3)3 = 3Cu(NO3) + 2Au3Cu + Au(NO3)3 = 3Cu(NO3) + Au
3Ca + ErF3 = 2Er + 3CaF23Ca + 2ErF3 = 2Er + 3CaF2
3NH3 + H3PO4 = (NH4)3PO43NH3 + H3PO4 = (NH4)3PO4
3NaNO2=NaNO3+2NO+Na2O3NaNO2 = NaNO3 + 2NO + Na2O
3Cu + 8HNO3 = Cu(NO3)2 + NO +H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3N2+O2=2N2O2N2 + O2 = 2N2O
3Cu+8HNO3= Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3 Cu (s) + Al2O3 (s)= 3 CuO (s) + 2 Al (s)3Cu(s) + Al2O3(s) = 3CuO(s) + 2Al(s)
3MgCO3 + 2H3PO4 = 3H2CO3 + Mg3(PO4)23MgCO3 + 2H3PO4 = 3H2CO3 + Mg3(PO4)2
3 Cu+2Au(NO3)3= 3Cu(NO3)2+ 2Au3Cu + 2Au(NO3)3 = 3Cu(NO3)2 + 2Au
3SO2 + 3O2 = SO32SO2 + O2 = 2SO3
3 Na2Co3 + 2 Al(No3)3 = Al2(Co3)3 + 6 NaNo33Na2Co3 + 2Al(No3)3 = Al2(Co3)3 + 6NaNo3
3Br2+2FeI3=3I2+2FeBr33Br2 + 2FeI3 = 3I2 + 2FeBr3
3Br+2FeI3=3I2+2FeBr36Br + 2FeI3 = 3I2 + 2FeBr3
3 H2SO4 + 2Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3Ba(C2H3O2)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(C2H3O2)3 3Ba(C2H3O2)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(C2H3O2)3
3 PB(NO3)2 + 2 AlCl3 = 3 PBCl2 + 2 Al(NO3)33PB(NO3)2 + 2AlCl3 = 3PBCl2 + 2Al(NO3)3
3Cu(NO3)2 + 2Cr = Cu + Cr(NO3)Cu(NO3)2 + 2Cr = Cu + 2Cr(NO3)
3Cu(NO3)2 + 2Cr = Cu + Cr(NO3)Cu(NO3)2 + 2Cr = Cu + 2Cr(NO3)
3Cu(NO3)2 + 2Cr = Cu + 2Cr(NO3)Cu(NO3)2 + 2Cr = Cu + 2Cr(NO3)
3Cu(NO3)2 + 2Cr = 3 Cu + 2Cr(NO3)Cu(NO3)2 + 2Cr = Cu + 2Cr(NO3)
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3 = Cu(NO3)2 +NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3CH4 + 3N2Cl4 = 3CCl4 + 3N2 + 6H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
3CuO + 2NH3 = 3Cu + 3H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
3FeI2(aq) + 2K3PO4(aq)=Fe3(PO4)2(s) + 6KI(aq)3FeI2(aq) + 2K3PO4(aq) = Fe3(PO4)2(s) + 6KI(aq)
3Ca + 2LaF3 = La + CaF23Ca + 2LaF3 = 2La + 3CaF2
3BaBr2(aq) + 2(NH4)3PO4(aq)=Ba3(PO4)2(s) + 6NH4Br(aq)3BaBr2(aq) + 2(NH4)3PO4(aq) = Ba3(PO4)2(s) + 6NH4Br(aq)
3 CuBr2 + 2 AlCl3 = 3 CuCl2 + 2 AlBr3 3CuBr2 + 2AlCl3 = 3CuCl2 + 2AlBr3
3Al + 3O2 = 2Al2O34Al + 3O2 = 2Al2O3
3 Ca(PO3)2 + 10 C = Ca3(PO4)2 + 10 CO + P43Ca(PO3)2 + 10C = Ca3(PO4)2 + 10CO + P4
3O2 + CS2 = CO2 + SO23O2 + CS2 = CO2 + 2SO2
3Ca + 2YbF3 = 2Yb + CaF23Ca + 2YbF3 = 2Yb + 3CaF2
3NH3 + 6O2 = NO + H2O4NH3 + 5O2 = 4NO + 6H2O
3N2Cl4 + 3CH2 = 3CCl4 + 6H2 + 3N2N2Cl4 + CH2 = CCl4 + H2 + N2
3Pb(OH)2 + H2SO4 = 3Pb SO4 + 6H2OPb(OH)2 + H2SO4 = PbSO4 + 2H2O
3Zn + 2AlCl = 3Zn(AlCl)2Zn + 2AlCl = Zn(AlCl)2
3Zn + AlCl = 3Zn(AlCl)2Zn + 2AlCl = Zn(AlCl)2
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3H2 + N2 = NH3 3H2 + N2 = 2NH3
3H2 + N2 = NH33H2 + N2 = 2NH3
3H2 + N2 = NH33H2 + N2 = 2NH3
3H2 + N2 = NH33H2 + N2 = 2NH3
3H2 + N2 = NH33H2 + N2 = 2NH3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3N2Cl4+3CH4=CCl4+N2+H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
3Al(OH)3=1Al2O3+2H2O2Al(OH)3 = Al2O3 + 3H2O
3Zn + 2PO4= Zn3(PO4)23Zn + 2PO4 = Zn3(PO4)2
3Zn + 2PO4= ZnPO4Zn + PO4 = ZnPO4
3Zn + PO4= ZnPO4Zn + PO4 = ZnPO4
3Pb(NO3)2 (aq) + 2AlI3 (aq) = 3PbI2 (s) + 2Al(NO3)3 (aq)3Pb(NO3)2(aq) + 2AlI3(aq) = 3PbI2(s) + 2Al(NO3)3(aq)
3Cu+8HNO3 =Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3CH3OH+4O2= 3CO2+5H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
3CH3OH+4O2= 3CO2+5H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
3CH4 + 3N2Cl4 = 3CCl4 + 3N2 +6H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
3Ca+2PO4=Ca3(PO4)3Ca + PO4 = Ca3(PO4)
3Ca+2PO4=Ca3(PO4)3Ca + PO4 = Ca3(PO4)
3KMnO4 = 2K3MnO4+MnO2+O23KMnO4 = K3MnO4 + 2MnO2 + 2O2
3 H2SO4 + 2Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3CuO + 2NH3=3Cu + 3H2O + N23CuO + 2NH3 = 3Cu + 3H2O + N2
3Fe+2Au(NO3)3=3Fe(NO3)2+2Au3Fe + 2Au(NO3)3 = 3Fe(NO3)2 + 2Au
3 Mg(ClO3)2 + 2 K3PO4 = Mg3(PO4)2 + 6KClO33Mg(ClO3)2 + 2K3PO4 = Mg3(PO4)2 + 6KClO3
3 Mg(ClO3)2 + 2 K3PO4 = Mg3(PO4)2 + 6KClO33Mg(ClO3)2 + 2K3PO4 = Mg3(PO4)2 + 6KClO3
3Fe+2Au(NO3)3=3Fe(NO3)2+2Au3Fe + 2Au(NO3)3 = 3Fe(NO3)2 + 2Au
3H2+2O2=4H2O2H2 + O2 = 2H2O
3 H2SO4 + Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3PbO+2NH3=3Pb+N2+3H2O3PbO + 2NH3 = 3Pb + N2 + 3H2O
3Pb(NO3)2 (aq) + 2FeBr3 (aq) = 3PbBr2 (s) + 2Fe(NO3)3 (aq)3Pb(NO3)2(aq) + 2FeBr3(aq) = 3PbBr2(s) + 2Fe(NO3)3(aq)
3CH4+3N2Cl4=CCl4+N2+H2CH4 + N2Cl4 = CCl4 + N2 + 2H2
3Pb(OH)2 + H2SO4 =3PbSO4 + 6H2OPb(OH)2 + H2SO4 = PbSO4 + 2H2O
3Pb(OH)2 + H2SO4 = 3PbSO4 + 6H2OPb(OH)2 + H2SO4 = PbSO4 + 2H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3F2+2AlCl3=2AlF3+3Cl2 3F2 + 2AlCl3 = 2AlF3 + 3Cl2
3CO + 7H2 = C3H8 + H2O3CO + 7H2 = C3H8 + 3H2O
3CO2+4H2O=H2CO3CO2 + H2O = H2CO3
3KClO3(s) + C6H12O6(s) = 3KCl(s) + 6H2O(g) + 6CO2(g)4KClO3(s) + C6H12O6(s) = 4KCl(s) + 6H2O(g) + 6CO2(g)
3 H2SO4+2Al=Al2(SO4)3+3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3H+1O2=H2O4H + O2 = 2H2O
3H+O2=H2O4H + O2 = 2H2O
3 Na2S(aq) + 2 FeCl3(aq) = 6 NaCl(aq) + Fe2S3(s)3Na2S(aq) + 2FeCl3(aq) = 6NaCl(aq) + Fe2S3(s)
3N2Cl4 + 3CH4 = 2N2 + 6H2 + 3CCl4N2Cl4 + CH4 = N2 + 2H2 + CCl4
3N2Cl4+3C3H4=3Cl4C+6H2+3N23N2Cl4 + C3H4 = 3Cl4C + 2H2 + 3N2
3N2Cl4+3C3H4=3Cl4C+6H2+3N23N2Cl4 + C3H4 = 3Cl4C + 2H2 + 3N2
3Fe(s)+4H2O(g)= 1 Fe3O4(s)+4H2(g)3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
3F2+2AlI3=3I2+2AlF33F2 + 2AlI3 = 3I2 + 2AlF3
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu+8HNO3=Cu(NO3)2+NO+H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3CH4 + 3N2Cl4 = 6H2+ 4N2+ 3CCl4CH4 + N2Cl4 = 2H2 + N2 + CCl4
3CH4 + 3N2Cl4 = 6H2+ 4N2+ 3CCl4CH4 + N2Cl4 = 2H2 + N2 + CCl4
3MgS+2Fe(C2H3O2)3=3Mg(C2H3O2)2+Fe2S33MgS + 2Fe(C2H3O2)3 = 3Mg(C2H3O2)2 + Fe2S3
3MgS+2Fe(C2H3O2)3=3Mg(C2H3O2)2+Fe2S33MgS + 2Fe(C2H3O2)3 = 3Mg(C2H3O2)2 + Fe2S3
3HC2H3O2(aq)+Al(OH)3(s)=Al(C2H3O2)3(aq)+3H2O(l)3HC2H3O2(aq) + Al(OH)3(s) = Al(C2H3O2)3(aq) + 3H2O(l)
3H2SO4+2Al=Al2(SO4)3+3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3CuSO4 (aq) + Na3(C6H5O7) (aq) = Cu3(C6H5O7) (s) + 3NaSO4 (aq)3CuSO4(aq) + Na3(C6H5O7)(aq) = Cu3(C6H5O7)(s) + 3NaSO4(aq)
3 H2SO4(aq) + 2 Fe(NO3)3(aq) = 6 HNO3(aq) + Fe2(SO4)3(aq)3H2SO4(aq) + 2Fe(NO3)3(aq) = 6HNO3(aq) + Fe2(SO4)3(aq)
3H2SO4+2Al=Al2(SO4)3+3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3H2SO4+2Al= Al2(SO4)3+3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3CH4+3N2CL4=3CCL4+3N2+6H2CH4 + N2CL4 = CCL4 + N2 + 2H2
3Ca +2 Al(NO3)3 = 2Al + 3Ca(NO3)2 3Ca + 2Al(NO3)3 = 2Al + 3Ca(NO3)2
3H2 + N2 = NH33H2 + N2 = 2NH3
3NO(g) + 6H2(g) = 3NH3(g) + 3H2O(g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
3CH4 + 3NCl4= 3CCl4 +3N2 + 6H22CH4 + 2NCl4 = 2CCl4 + N2 + 4H2
3CuO+2NH3 = 3Cu+3H2O+2N23CuO + 2NH3 = 3Cu + 3H2O + N2
3CuO+2NH3 = 3Cu+3H2O+2N23CuO + 2NH3 = 3Cu + 3H2O + N2
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3N2Cl + 3CH4 = 3CCl4 + N2+ 6H24N2Cl + CH4 = CCl4 + 4N2 + 2H2
3MgCl2=Mg+ClMgCl2 = Mg + 2Cl
3H2 + N2 = 2 NH33H2 + N2 = 2NH3
3Cu+8HNO3 = Cu(NO3)2 + NO + H2010Cu + 20HNO3 = 10Cu(NO3)2 + 0NO + H20
3 H2SO4+2Al=Al2(SO4)3+3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3 H2SO4 + 2A1 = A14(SO4)3 + 3H23H2SO4 + 14A1 = A14(SO4)3 + 3H2
3Cu+8HNO3= Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3NiI2(aq) + 2(NH4)3PO4(aq) =Ni3(PO4)2(s) + 6NH4I(aq)3NiI2(aq) + 2(NH4)3PO4(aq) = Ni3(PO4)2(s) + 6NH4I(aq)
3Cu(NO3)2(aq) + 2K3PO4(aq)= Cu3(PO4)2(s) + 6KNO3(aq)3Cu(NO3)2(aq) + 2K3PO4(aq) = Cu3(PO4)2(s) + 6KNO3(aq)
3N2H4 = 4NH3 + N23N2H4 = 4NH3 + N2
3C3H8 + 10 O2 = CO2 + H2OC3H8 + 5O2 = 3CO2 + 4H2O
3Rb2SO4 + 2AlBr3 = Al2(SO4)3 + 6RbBr3Rb2SO4 + 2AlBr3 = Al2(SO4)3 + 6RbBr
3Na2Cl4+3CH4= 3CCl4+3Na2+6H2Na2Cl4 + CH4 = CCl4 + Na2 + 2H2
3N2Cl4+3CH4 =3CCl4 + 3N2 + 6H2N2Cl4 + CH4 = CCl4 + N2 + 2H2
3Cu+8HNO3=Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Fe(s) + 2O2(g) = Fe3O4(s)3Fe(s) + 2O2(g) = Fe3O4(s)
3Zn(NO3)2(aq) + 2Na3PO4(aq) =Zn3(PO4)2(s) + 6NaNO3(aq)3Zn(NO3)2(aq) + 2Na3PO4(aq) = Zn3(PO4)2(s) + 6NaNO3(aq)
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3H2SO4 +2Al=Al2(SO4)3+3H2 3H2SO4 + 2Al = Al2(SO4)3 + 3H2
3H2SO4 +Al=Al2(SO4)3+3H2 3H2SO4 + 2Al = Al2(SO4)3 + 3H2
3CuO+2NH3=3Cu+3H2O+2N2 3CuO + 2NH3 = 3Cu + 3H2O + N2
3MgO+2Fe=Fe2O3+3Mg3MgO + 2Fe = Fe2O3 + 3Mg
3 H2SO4 + 2Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3 H2SO4 + 2Al = Al2(SO4)3 + 3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3Cu+8HNO3 = Cu(NO3)2+NO+H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3MnSO4(aq) + 2K3PO4(aq)= Mn3(PO4)2(s) + 3K2SO4(aq)3MnSO4(aq) + 2K3PO4(aq) = Mn3(PO4)2(s) + 3K2SO4(aq)
3CO + 2Fe2O3 = Fe+ 3CO23CO + Fe2O3 = 2Fe + 3CO2
3 Pb(NO3)2 (aq) + K3PO4(aq) = Pb3(PO4)2 (s) + KNO3 (aq)3Pb(NO3)2(aq) + 2K3PO4(aq) = Pb3(PO4)2(s) + 6KNO3(aq)
3K2CO3+2Mn (NO3)3 = 6KNO3+1Mn2(CO3)33K2CO3 + 2Mn(NO3)3 = 6KNO3 + Mn2(CO3)3
3N2 + 4O2 = 2NO2N2 + 2O2 = 2NO2
3N2 + 42O = 2NO2N2 + 4O = 2NO2
3H2SO4+2Al=Al2 (SO4)3+3H23H2SO4 + 2Al = Al2(SO4)3 + 3H2
3Cu + 8HNO3 = Cu(NO3)2 + NO + H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
3Cu + 2AlCl3 = 3CuCl2 + 2Al3Cu + 2AlCl3 = 3CuCl2 + 2Al
3Fe(NO2)2 + 2K3PO4=Fe3(PO4)2 + 6 KNO2 3Fe(NO2)2 + 2K3PO4 = Fe3(PO4)2 + 6KNO2
3NH4OH + Al(NO3)3 = NH4NO3 + Al(OH)33NH4OH + Al(NO3)3 = 3NH4NO3 + Al(OH)3
3Na + Al(NO3)3 = 3Al + 3NaNO33Na + Al(NO3)3 = Al + 3NaNO3
3Na + Al(NO3)3 = 3Al + 3NaNO33Na + Al(NO3)3 = Al + 3NaNO3
3Na + Al(NO3)3 = 3Al + 3NaNO33Na + Al(NO3)3 = Al + 3NaNO3
3HBr + 2NaOH = NaBr + H2OHBr + NaOH = NaBr + H2O
3Mg(ClO4)2 + Al2O3 = MgO + Al(ClO4)33Mg(ClO4)2 + Al2O3 = 3MgO + 2Al(ClO4)3
3Na2CrO4 + 2Cr(NO3)3 = 6NaNO3 + Cr2(CrO4)3 3Na2CrO4 + 2Cr(NO3)3 = 6NaNO3 + Cr2(CrO4)3
3Cu+ 8HNO3 = Cu(NO3)2+ NO+ H2O3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.