Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
2KCl + Ag2SO4 = K2SO4 + 2AgCl2KCl + Ag2SO4 = K2SO4 + 2AgCl
2HCl + 2KMnO4 = Cl2 + MnO2 + 2H2O + 2KCl8HCl + 2KMnO4 = 3Cl2 + 2MnO2 + 4H2O + 2KCl
2N2H4(g)+2NO2(g)=3N2(g)+4H2O(g)2N2H4(g) + 2NO2(g) = 3N2(g) + 4H2O(g)
2Fe + 3Cu(NO3)2 = 2Fe(NO3)3 + 3Cu2Fe + 3Cu(NO3)2 = 2Fe(NO3)3 + 3Cu
2C5H12 + O2 = 10CO2 + 12H2OC5H12 + 8O2 = 5CO2 + 6H2O
2 C5H12 + O2 = 10 CO2 + 12 H2OC5H12 + 8O2 = 5CO2 + 6H2O
2AgNO3+Ca=Ca(NO3)2+Ag2AgNO3 + Ca = Ca(NO3)2 + 2Ag
2Cu+2Cl2=3CuCl2Cu + Cl2 = CuCl2
2C2H4O2 + Cu = Cu(C2H3O2)2 + H22C2H4O2 + Cu = Cu(C2H3O2)2 + H2
2CH4 + H2O = CO + 2H2CH4 + H2O = CO + 3H2
2KMnO4+5Zn+3H2SO4=2MnSO4+5ZnSO4+K2SO4+H2O2KMnO4 + 5Zn + 8H2SO4 = 2MnSO4 + 5ZnSO4 + K2SO4 + 8H2O
2Fe+3Cl2=2FeCl32Fe + 3Cl2 = 2FeCl3
2Fe + 3 Cl2 = 2FeCl32Fe + 3Cl2 = 2FeCl3
2Fe + 3Cl2 = 2FeCl32Fe + 3Cl2 = 2FeCl3
2Fe + 3Cl2 = 2FeCl32Fe + 3Cl2 = 2FeCl3
2CH4 + H2O= 2CO + 3H2CH4 + H2O = CO + 3H2
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2Na+ O2 +H2 =NaOH2Na + O2 + H2 = 2NaOH
2Na+ O2 +H2 =2NaOH2Na + O2 + H2 = 2NaOH
2K+2H2O=2KOH+H22K + 2H2O = 2KOH + H2
2 CO + O2 = 2 CO22CO + O2 = 2CO2
2 SO2 + O2 = 2 SO32SO2 + O2 = 2SO3
2 KNO3 + 10 K = 5 K2O + N22KNO3 + 10K = 6K2O + N2
2Br2O5=2Br2+5O22Br2O5 = 2Br2 + 5O2
2H + 2OH = 2H2OH + OH = H2O
2H + 2OH = H2OH + OH = H2O
2SO2+O2=2SO32SO2 + O2 = 2SO3
2KNO3+10K= 5K2O+N22KNO3 + 10K = 6K2O + N2
2KNO3+10K= 5K2O+N22KNO3 + 10K = 6K2O + N2
2Ca+Cl2=2CaCl2Ca + Cl2 = 2CaCl
2Ca+Cl2=2CaCl2Ca + Cl2 = 2CaCl
2LiOH+2HBr=2LiBr+2H2OLiOH + HBr = LiBr + H2O
2Al(s)+2NaOH(aq)+6H2O = 2Na(Al(OH4) ) (aq)+3 H2(g)-2Al(s) - 2NaOH(aq) + 0H2O = -2Na(Al(OH4))(aq) + 3H2(g)
2 H2(g) + O2(g) = 2 H2O(l) 2H2(g) + O2(g) = 2H2O(l)
2LiCl+F2=2LiF+Cl22LiCl + F2 = 2LiF + Cl2
2NaCl=2Na+Cl22NaCl = 2Na + Cl2
2PbO2 (s) = 2PbO(s) + O2 (g) 2PbO2(s) = 2PbO(s) + O2(g)
2CH4 + O2 = 2CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Na+Br2 = 2NaBr2Na + Br2 = 2NaBr
2N2 + 2H2 = 2NH3N2 + 3H2 = 2NH3
2Ca+O2=CaO2Ca + O2 = 2CaO
2Fe2O3 + Co = 2Fe3O4 + Co20Fe2O3 + 2Co = 0Fe3O4 + Co2
2Fe2O3 + Co = 2Fe3O4 + Co20Fe2O3 + 2Co = 0Fe3O4 + Co2
2FeO3 + Co = 2Fe3O4 + Co20FeO3 + 2Co = 0Fe3O4 + Co2
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2H2(l)+1O2(l)=H2O(l)2H2(l) + O2(l) = 2H2O(l)
2Al (s)+ 3CaCl2(aq)=2AlCl3(aq) + 3Ca(s)2Al(s) + 3CaCl2(aq) = 2AlCl3(aq) + 3Ca(s)
2SO2(g) + O2(g) = 2SO3(g)2SO2(g) + O2(g) = 2SO3(g)
2H2+O2=2H2O2H2 + O2 = 2H2O
2H2+O2=2H2O2H2 + O2 = 2H2O
2Al(OH)3= Al2O3 + 3H2O2Al(OH)3 = Al2O3 + 3H2O
2H2 + 1O2 = 2H2O2H2 + O2 = 2H2O
2H2 + 1O2 = 2H2O2H2 + O2 = 2H2O
2H2 + 1O2 = 2H2O2H2 + O2 = 2H2O
2H3(PO4)2+ (Zn)2SO4 =H2SO4 + Zn3(PO4)22H3(PO4)2 + 3(Zn)2SO4 = 3H2SO4 + 2Zn3(PO4)2
2Tl+H2O=TlOH+H22Tl + 2H2O = 2TlOH + H2
2CH6+37O2=6OH2+4CO22CH6 + 5O2 = 6OH2 + 2CO2
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2CHO = CHOCHO = CHO
2 HCl + Mg2 = 2HCl Mg2HCl + Mg2 = HClMg2
2Cu+1Cl2=2CuCl2Cu + Cl2 = CuCl2
2Cu+1Cl2=2CuCl2Cu + Cl2 = CuCl2
2AgO=4Ag+O22AgO = 2Ag + O2
2Ag2O=4Ag+O22Ag2O = 4Ag + O2
2AgO=4Ag+O22AgO = 2Ag + O2
2C4H10+13O2=8CO2+10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2Ag2O=4Ag+O22Ag2O = 4Ag + O2
2Li+O2=Li2O4Li + O2 = 2Li2O
2C3H6+9O2=6CO2+6H2O2C3H6 + 9O2 = 6CO2 + 6H2O
2NaOH (aq) + H2SO4 (aq) = Na2SO4 (aq) + 2H2O 2NaOH(aq) + H2SO4(aq) = Na2SO4(aq) + 2H2O
2P4O6 + H2O = H3PO3P4O6 + 6H2O = 4H3PO3
2P4O6 + H2O = H3PO3P4O6 + 6H2O = 4H3PO3
2Al (s) + 3Cl2 (g) = 2AlCl3 (s)2Al(s) + 3Cl2(g) = 2AlCl3(s)
2Ca+3Cl2 = 2 CaCl2Ca + Cl2 = CaCl2
2Ca+3Cl2 = 2 CaCl2Ca + Cl2 = CaCl2
2K+O2=K2O4K + O2 = 2K2O
2H2O2 = 2H2O + O22H2O2 = 2H2O + O2
2K + 2Br2 = 2KBr2K + Br2 = 2KBr
2HNO3 + 6HBr=2NO + 3Br2 + 4H2O2HNO3 + 6HBr = 2NO + 3Br2 + 4H2O
2 Na + 2 H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
2 H2 + O2 = 2 H2O2H2 + O2 = 2H2O
2N2+10H2= NH3N2 + 3H2 = 2NH3
2K+CO2=K2O+C4K + CO2 = 2K2O + C
2H2O2 (Aq)=2H2O(l)+O2(g)2H2O2(Aq) = 2H2O(l) + O2(g)
2CaCO3+3HCl=CaCl2+CO2+H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
2NaOH + H2CO3 = Na2CO3 + 2H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
2Ag2O(s)+C(s)=CO2(g)+4Ag(s)2Ag2O(s) + C(s) = CO2(g) + 4Ag(s)
2C8H18 + 25O = 16CO2 + 18H2OC8H18 + 25O = 8CO2 + 9H2O
2C8H18 + 25O = 16CO2 + 18H2OC8H18 + 25O = 8CO2 + 9H2O
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2 Ag + S = Ag2S2Ag + S = Ag2S
2Al(C2H3O2)3 + 3BaSO4 =Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2HCl = Cl2 + H22HCl = Cl2 + H2
2C2H2+5O2=4CO2+2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2Ca+O2= 2CaO2Ca + O2 = 2CaO
2Al + 6HCl = 2AlCl3 + 3H22Al + 6HCl = 2AlCl3 + 3H2
2 C6H20O5 + 17 O2 = 12 CO2 + 20 H2O2C6H20O5 + 17O2 = 12CO2 + 20H2O
2Mg+2Cl=2Cl4MgMg + 4Cl = Cl4Mg
2Na + H2O = 3NaOH + 1H22Na + 2H2O = 2NaOH + H2
2H2 + 2O2 = 2H2O2H2 + O2 = 2H2O
2AgNO3 + Fe = Fe(NO3)2 + 2Ag2AgNO3 + Fe = Fe(NO3)2 + 2Ag
2AgNO3 + Fe = Fe(NO3)2 + 2Ag2AgNO3 + Fe = Fe(NO3)2 + 2Ag
2AgNO3 + Fe = Fe(NO3)2 + 2Ag2AgNO3 + Fe = Fe(NO3)2 + 2Ag
2NaOH+Mg(OH)2=Na2MgO2+H2O2NaOH + Mg(OH)2 = Na2MgO2 + 2H2O
2NH4Br = 2NH4 + Br22NH4Br = 2NH4 + Br2
2CO+O2=2CO22CO + O2 = 2CO2
2C2H6 + 7O = 4CO2 + 6H2OC2H6 + 7O = 2CO2 + 3H2O
2C8H8 + 25O2 =8CO2 + 18H2OC8H8 + 10O2 = 8CO2 + 4H2O
2S+3O2=2SO32S + 3O2 = 2SO3
2HgO=2Hg+O22HgO = 2Hg + O2
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2SO2+O2=2SO32SO2 + O2 = 2SO3
2K+2H2O=2KOH+H22K + 2H2O = 2KOH + H2
2CO+O2=2CO22CO + O2 = 2CO2
2KClO3=2KCl=3O22KClO3 = 2KCl + 3O2
2WO3+2H++2e- = W2O5 +H2O2WO3 + 2H+ + e- = W2O5 + H2O
2K2Cr2O7 + 3SnCl2 + 22HCl = 4CrCl3 + 3SnCl4 + 4KCl + H2OK2Cr2O7 + 3SnCl2 + 14HCl = 2CrCl3 + 3SnCl4 + 2KCl + 7H2O
2H2S+O2=SO2+2H2O2H2S + 3O2 = 2SO2 + 2H2O
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2N2 + 2H2 = 2NH3N2 + 3H2 = 2NH3
2Na+O2=2Na2O4Na + O2 = 2Na2O
2KI (aq)+Br2 (l)=2KBr (aq)+I2 (s)2KI(aq) + Br2(l) = 2KBr(aq) + I2(s)
2CO2 + 2H2O = 2HCO2 + 1O24CO2 + 2H2O = 4HCO2 + O2
2CO2 + 2H2O = 2HCO2 + 1O24CO2 + 2H2O = 4HCO2 + O2
2HNO3 + 2Tl=2TlNO3 + H22HNO3 + 2Tl = 2TlNO3 + H2
2HNO3 + 2Tl=2TlNO3 + H22HNO3 + 2Tl = 2TlNO3 + H2
2HNO3 + 2Tl=2TlNO3 + 3H22HNO3 + 2Tl = 2TlNO3 + H2
2Ca(OH)2 + 4NO2 = Ca(NO3)2 + Ca(NO2)2 +2H2O 2Ca(OH)2 + 4NO2 = Ca(NO3)2 + Ca(NO2)2 + 2H2O
2HNO3(aq)+Ca(OH)2(aq)=Ca(NO3)2(aq)+2H2O(l)2HNO3(aq) + Ca(OH)2(aq) = Ca(NO3)2(aq) + 2H2O(l)
2NaCl(aq)+FeI2(aq)=2NaI(s)+FeCl2(s)2NaCl(aq) + FeI2(aq) = 2NaI(s) + FeCl2(s)
2NaCl(aq)+FeI2(aq)=2NaI(s)+FeCl2(aq)2NaCl(aq) + FeI2(aq) = 2NaI(s) + FeCl2(aq)
2Ca+2HCl=2CaCl+H22Ca + 2HCl = 2CaCl + H2
2SN+2H2SO4=2SNSO4=SO2+4H2OSN + 2H2SO4 = SNSO4 + SO2 + 2H2O
2 HBr (aq) + Co(OH)2 (aq) = CoBr2 (aq) + 2 H2O (l)2HBr(aq) + Co(OH)2(aq) = CoBr2(aq) + 2H2O(l)
2 HBr (aq) + Co(OH)2 (aq) = CoBr2 (aq) + 2 H2O (l)2HBr(aq) + Co(OH)2(aq) = CoBr2(aq) + 2H2O(l)
2HI (aq) + Ca (OH)2 (aq) = CaI2 (aq) + H2O (l)2HI(aq) + Ca(OH)2(aq) = CaI2(aq) + 2H2O(l)
2Fe2O3+3C=4Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
2Al(s)+3Cl2(g)=2AlCl3(s)2Al(s) + 3Cl2(g) = 2AlCl3(s)
2Al(s)+3Cl2(g)=2AlCl3(s)2Al(s) + 3Cl2(g) = 2AlCl3(s)
2NaHCO3 = 1 Na2CO3+ 1 CO2+ H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2H2(g) + O2(g) = 2H2O(g)2H2(g) + O2(g) = 2H2O(g)
2H2(g) + O2(g) = 2H2O(g)2H2(g) + O2(g) = 2H2O(g)
2Mg(s) + O2(g) = 2MgO(s)2Mg(s) + O2(g) = 2MgO(s)
2C3H7OH + O2 = CO2 + 8H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
2C6H6O2 + O2 =12CO + H2O2C6H6O2 + 7O2 = 12CO + 6H2O
2C10H22 + O2 = 20CO2 + H2O2C10H22 + 31O2 = 20CO2 + 22H2O
2H2SO4+2BaO2=2 BaSO4+2H2O+O22H2SO4 + 2BaO2 = 2BaSO4 + 2H2O + O2
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2CH4 + O2 = 2CO + H2O2CH4 + 3O2 = 2CO + 4H2O
2Na+2H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
2Al(C2H3O2)3 + 3BaSO4= Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2HClO3=HCl+3O22HClO3 = 2HCl + 3O2
2FeOH(SO4)3 + 3CaCO3 = Fe2(SO4)3 + 3CaSO4 + 3CO2(g) + H2O + 2O2(g)2FeOH(SO4)3 + 3CaCO3 = Fe2(SO4)3 + 3CaSO4 + 3CO2(g) + H2O + 2O2(g)
2SO2+O2=2SO32SO2 + O2 = 2SO3
2K + O2 = K2O22K + O2 = K2O2
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2NH3+CO2=(NH2)2CO+H2O2NH3 + CO2 = (NH2)2CO + H2O
2Fe2 SiO4 + 6H2O + O2 = 4FeO(OH)+ 2H4SiO42Fe2SiO4 + 6H2O + O2 = 4FeO(OH) + 2H4SiO4
2 Al2O3 = 2 Al + 3 O22Al2O3 = 4Al + 3O2
2Na+2HNO3=2NaNO3+H22Na + 2HNO3 = 2NaNO3 + H2
2 Al2O3 = 2 Al + 3 O22Al2O3 = 4Al + 3O2
2 Na3PO4(aq) + 3 Ba(NO3)2(aq) = Ba3(PO4)2(s) + 6 NaNO3(aq) 2Na3PO4(aq) + 3Ba(NO3)2(aq) = Ba3(PO4)2(s) + 6NaNO3(aq)
2NaOH+Cu(NO3)2= 2NaNO3+Cu(OH)22NaOH + Cu(NO3)2 = 2NaNO3 + Cu(OH)2
2H2O2=2H2O+O22H2O2 = 2H2O + O2
2H2O2=2H2O+O22H2O2 = 2H2O + O2
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2HNO3+SO2 = H2SO4+2NO22HNO3 + SO2 = H2SO4 + 2NO2
2Fe(OH)2+H2O2=Fe (OH)2Fe(OH)2 - H2O2 = 2Fe(OH)
2 Al + 3 FeCO3 =Al2(CO3)3 + 3 Fe2Al + 3FeCO3 = Al2(CO3)3 + 3Fe
2C2H2(g) +5O2(g) = 4CO2(g) + 2H2O(s)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(s)
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2NaOH + NiCl2 = Ni(OH)2 + 2NaCl 2NaOH + NiCl2 = Ni(OH)2 + 2NaCl
2HBr+Ba(OH)2 = BaBr2+2H2O2HBr + Ba(OH)2 = BaBr2 + 2H2O
2Ca+O2=2CaO2Ca + O2 = 2CaO
2Ca + O2=2CaO2Ca + O2 = 2CaO
2Ca + O2=2CaO2Ca + O2 = 2CaO
2Cu + O2 = 2CuO2Cu + O2 = 2CuO
2Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
2Fe2O3 + C = Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
2H2O + 2O2 = 2 H2OH2O + 0O2 = H2O
2H20 + O2 = 2 H2OH20 + 5O2 = 10H2O
2H2 + O2 = H2O2H2 + O2 = 2H2O
2H2 + O2 =2 H2O 2H2 + O2 = 2H2O
2NaCl + Sr(NO3)2 = 2NaNO3 + SrCl22NaCl + Sr(NO3)2 = 2NaNO3 + SrCl2
2NaCl + Sr(NO3)2 = 2NaNO3 + SrCl22NaCl + Sr(NO3)2 = 2NaNO3 + SrCl2
2NaCl + Sr(NO3)2 = 2NaNO3 + SrCl22NaCl + Sr(NO3)2 = 2NaNO3 + SrCl2
2C2H6+5O2=2CO+6H2O2C2H6 + 5O2 = 4CO + 6H2O
2I2+KIO3+6HCI=5ICI+KCI+3H2O2I2 + KIO3 + 6HCI = 5ICI + KCI + 3H2O
2Fe + CuSO4 = 2FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
2H2 + O2 = 6H2O2H2 + O2 = 2H2O
2NaOH+MgCl2= Mg(OH)2(s)+2NaCl 2NaOH + MgCl2 = Mg(OH)2(s) + 2NaCl
2ZnS (s) + 2HCl (aq) = 4ZnCl2 (aq) + H2S (g) ZnS(s) + 2HCl(aq) = ZnCl2(aq) + H2S(g)
2Fe2O3+3C=4Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
2S(s)+2O2(g)=2SO2(g)S(s) + O2(g) = SO2(g)
2H2O2 + O2 =2H2O2H2O2 - O2 = 2H2O
2 NaOH + H2CO3 =2 H2O + Na2CO3 2NaOH + H2CO3 = 2H2O + Na2CO3
2 NaOH + H2CO3 =2 H2O + Na2CO3 2NaOH + H2CO3 = 2H2O + Na2CO3
2 NaOH + H2CO3 =2 H2O + Na2CO3 2NaOH + H2CO3 = 2H2O + Na2CO3
2C2H6+O2= 4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Li(s)+Br2(l) = 2LiBr(s)2Li(s) + Br2(l) = 2LiBr(s)
2NaCl + CuSO4 =Na2SO4 + CuCl22NaCl + CuSO4 = Na2SO4 + CuCl2
2NaCl + CuSO4 = Na2SO4 + CuCl22NaCl + CuSO4 = Na2SO4 + CuCl2
2Al(s) + 3CuSO4(aq) = 3Cu(s) + Al2(SO4)3(aq) 2Al(s) + 3CuSO4(aq) = 3Cu(s) + Al2(SO4)3(aq)
2Ca (s) + O2 (g) = 2CaO (s)2Ca(s) + O2(g) = 2CaO(s)
2SO2+O2 = 2SO32SO2 + O2 = 2SO3
2 C3H7OH (l) + 9 O2 (g) = 6 CO2 (g) + 8 H2O (g)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
2H2S+SO2=2H2O+3S2H2S + SO2 = 2H2O + 3S
2NH4Fe(SO4)2 + 2HCl = 2NH4Cl(aq) + Fe2(SO4)3(aq) + H2SO4(aq)2NH4Fe(SO4)2 + 2HCl = 2NH4Cl(aq) + Fe2(SO4)3(aq) + H2SO4(aq)
2 LiOH + CO2 = Li2CO3 + H2O2LiOH + CO2 = Li2CO3 + H2O
2Al(C2H3O2)3 + 3BaSO4 =Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2Al(OH)3 = Al2O3 + 3H2O 2Al(OH)3 = Al2O3 + 3H2O
2H = HH = H
2HNO3+Cu=2NO+Cu(NO3)+H2O4HNO3 + 3Cu = NO + 3Cu(NO3) + 2H2O
2HNO3+Cu=2NO+Cu(NO3)+H2O4HNO3 + 3Cu = NO + 3Cu(NO3) + 2H2O
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Ca3(PO4)2 + C + 6SiO2 = CaSiO3 + P4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2 KOH + H3PO4 = K3PO4 + H2O3KOH + H3PO4 = K3PO4 + 3H2O
2Fe2O3+ 3C = 4Fe + 3CO22Fe2O3 + 3C = 4Fe + 3CO2
2FeO3+ 3C = 4Fe + 3CO22FeO3 + 3C = 2Fe + 3CO2
2FeO3+ 3C = 4Fe + 3CO22FeO3 + 3C = 2Fe + 3CO2
2B + 3I2=2BI32B + 3I2 = 2BI3
2CO2 + 2H2 = 2CH4 + 2H2OCO2 + 4H2 = CH4 + 2H2O
2 C7H15OH + 21 O2 = 14 CO2 + 16 H2O2C7H15OH + 21O2 = 14CO2 + 16H2O
2H2C2O4 + O2 = 2H2O + 4CO22H2C2O4 + O2 = 2H2O + 4CO2
2H2+O2 = 2H2O2H2 + O2 = 2H2O
2 LiOH + CO2 = Li2CO3 + H2O2LiOH + CO2 = Li2CO3 + H2O
2 LiOH + CO2 =Li2CO3 + H2O2LiOH + CO2 = Li2CO3 + H2O
2 LiOH + CO2 =Li2CO3 + H2O2LiOH + CO2 = Li2CO3 + H2O
2Li+2H2O=2LiOH+H22Li + 2H2O = 2LiOH + H2
2Li+2H2O=2LiOH+H22Li + 2H2O = 2LiOH + H2
2Al+6HCl=2AlCl3+3H22Al + 6HCl = 2AlCl3 + 3H2
25CO2+H2 = CO+10H2OCO2 + H2 = CO + H2O
25CO2+H2 = CO+10H2OCO2 + H2 = CO + H2O
2 C3H7OH (l) + 9 O2 (g) = 6 CO2 (g) + 8 H2O (g)2C3H7OH(l) + 9O2(g) = 6CO2(g) + 8H2O(g)
2Na(s) + 2 H2O(l) = NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
2Na(s) + 2 H2O(l) = 2 NaOH(aq) + H2(g)2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
2Al+3Sn(NO3)2= 3Sn+2Al(NO3)32Al + 3Sn(NO3)2 = 3Sn + 2Al(NO3)3
2Hg2(NO3)2 + 2H2O + 4HCl = 2Hg2Cl2 + 4HNO3Hg2(NO3)2 + 0H2O + 2HCl = Hg2Cl2 + 2HNO3
2I2O5(s) + 10NO(g) = 3N2O4(g) + 2I2(s) 2I2O5(s) + 10NO(g) = 5N2O4(g) + 2I2(s)
2HNO3(aq) + 6HI(aq) = 2NO(g) + 3I2(s) +4H2O(l)2HNO3(aq) + 6HI(aq) = 2NO(g) + 3I2(s) + 4H2O(l)
2HNO3(aq) + 6HI(aq) = 2NO(g) + 3I2(s) +4H2O(l)2HNO3(aq) + 6HI(aq) = 2NO(g) + 3I2(s) + 4H2O(l)
2Cr + 3CuSO4 = Cr2(SO4)3 + 3Cu2Cr + 3CuSO4 = Cr2(SO4)3 + 3Cu
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2LiCl+1Br2=2LiBr+1Cl22LiCl + Br2 = 2LiBr + Cl2
2LiCl+1Br2=2LiBr+1Cl22LiCl + Br2 = 2LiBr + Cl2
2 SO2 + 2 H2O + O2 = 2 H2SO42SO2 + 2H2O + O2 = 2H2SO4
2NO+2H2=N2+2H2O2NO + 2H2 = N2 + 2H2O
2NO+2H2=N2+2H2O2NO + 2H2 = N2 + 2H2O
2Na2CO3(s) + 4HCl(aq) = 4NaCl(aq) + CO2(g) + 2H2O(l) Na2CO3(s) + 2HCl(aq) = 2NaCl(aq) + CO2(g) + H2O(l)
2HNO2(aq) + 2HI(aq)=2NO(g) + 2I2(aq) + 2H2O(l)2HNO2(aq) + 2HI(aq) = 2NO(g) + I2(aq) + 2H2O(l)
2HNO2(aq) + 2HI(aq)= 2NO(g) + 2I2(aq) + 2H2O(l)2HNO2(aq) + 2HI(aq) = 2NO(g) + I2(aq) + 2H2O(l)
2HNO2(aq) + 2HI(aq)=2NO(g) + 2I2(aq) + 2H2O(l)2HNO2(aq) + 2HI(aq) = 2NO(g) + I2(aq) + 2H2O(l)
2NaOH(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)2NaOH(s) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l)
2Al(s)+3Cl2(g)=2AlCl3(s) 2Al(s) + 3Cl2(g) = 2AlCl3(s)
2O+H2O=H2O2O + H2O = H2O2
2O+H2O=H2O2O + H2O = H2O2
2O+Hg=HgOO + Hg = HgO
2Ca+O2=2CaO2Ca + O2 = 2CaO
2AgCl=Ag +Cl2 2AgCl = 2Ag + Cl2
2C4H10(g)+13O2(g)=8CO2(g)+10H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2C4H10(g)+13O2(g)=8CO2(g)+10H2O(l) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2 C2H4O + 5 O2 = 4 CO2 + 4 H2O2C2H4O + 5O2 = 4CO2 + 4H2O
2NaHCO3 + 2HCl = 4H2 + 2CO3 + 2NaClNaHCO3 + HCl = H2 + CO3 + NaCl
2HI (aq) + Ca (OH)2 (aq) = CaI2 (aq) + H2O (l)2HI(aq) + Ca(OH)2(aq) = CaI2(aq) + 2H2O(l)
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2H2+O2=H2O2H2 + O2 = 2H2O
2Fe+O2=2Fe+2+2O-22Fe + O2 = 2Fe+2 + 2O-2
2KCLO3 = 2KCL +3O22KCLO3 = 2KCL + 3O2
2Cu (s) + O2 (g) = 2CuO (s)2Cu(s) + O2(g) = 2CuO(s)
2HNO2+2H++3I-=2NO+I3-+2H2O2HNO2 + 2H+ + 3I- = 2NO + I3- + 2H2O
2NH4NO3 = 2NH3 + O2 + H2O-1NH4NO3 = -2NH3 - 2O2 + H2O
2H+ + F2 + S = F- + H2S2H+ - F2 + S = -2F- + H2S
2CH3OH + 3O2 =2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2ZnS (s) + 2HCl (aq) = 4ZnCl2 (aq) + H2S (g) ZnS(s) + 2HCl(aq) = ZnCl2(aq) + H2S(g)
2Ca3(PO4)2 + C + 6SiO2 = CaSiO3 + P4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2NH4NO3=2N2+O2+4H2O2NH4NO3 = 2N2 + O2 + 4H2O
2NaBr + Ca (NO3)2 = 2NaNO3 + CaBr22NaBr + Ca(NO3)2 = 2NaNO3 + CaBr2
2NaF + Ca(C2H3O2)2(aq) = CaF2(s) + 2Na(C2H3O2)(aq)2NaF + Ca(C2H3O2)2(aq) = CaF2(s) + 2Na(C2H3O2)(aq)
2H2S+2NO3=2S+2NO+4HH2S + 0NO3 = S + 0NO + 2H
2 HNOH3 + 4Fe+3 = 4Fe+2 + N2O + H2O + 6H2HNOH3 + 0Fe+3 = 0Fe+2 + N2O + H2O + 6H
2FeCl3+3Zn=3ZnCl2+2Fe2FeCl3 + 3Zn = 3ZnCl2 + 2Fe
2H2+O2 =2H2O2H2 + O2 = 2H2O
2N2 + 2H2 =4NH3N2 + 3H2 = 2NH3
2N2 + 2H2 =4NH3N2 + 3H2 = 2NH3
2Ca3(PO4)2 +C + 6SiO2=CaSiO3 + P4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2KMnO4 +5SO2 +2H2O=K2SO4 +2MnSO4 +2H2SO4 2KMnO4 + 5SO2 + 2H2O = K2SO4 + 2MnSO4 + 2H2SO4
2HI(aq)+2Pb(NO3)2(aq)= PbI2+2HNO3(aq)2HI(aq) + Pb(NO3)2(aq) = PbI2 + 2HNO3(aq)
2C4H10(g)+13O2(g)=8CO2(g)+10H2O(l) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2KI(aq)+Br2(l)=2KBr(aq)+I2(s)2KI(aq) + Br2(l) = 2KBr(aq) + I2(s)
2KI(aq)+Br2(l)=2KBr(aq)+I2(s)2KI(aq) + Br2(l) = 2KBr(aq) + I2(s)
2C4H10(g)+13O2(g)=8CO2(g)+10H2O(l) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2NaI(aq)+Br2(l)=2NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2FeSO4= Fe2O3 + 2SO3 + O2-4FeSO4 = -2Fe2O3 - 4SO3 + O2
2 HC2H3O2(aq) + Na2SO3(s) = H2O(l) + SO2(g) + 2 NaC2H3O2(aq)2HC2H3O2(aq) + Na2SO3(s) = H2O(l) + SO2(g) + 2NaC2H3O2(aq)
2NaOH+H2SO4=Na2SO4+2OH22NaOH + H2SO4 = Na2SO4 + 2OH2
2KClO = 2KCl + 5O22KClO = 2KCl + O2
2HI (aq) + Ca (OH)2 (aq) = CaI2 (aq) + H2O (l)2HI(aq) + Ca(OH)2(aq) = CaI2(aq) + 2H2O(l)
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2CH6+O2 = 2CO +12H2CH6 + O2 = 2CO + 12H
2C4H10 (g)+13O2 (g)=8CO2= 10H2O (l)2C4H10(g) + 13O2(g) = 8CO2 + 10H2O(l)
2AI + 3NiBr2 = 2AIBr3 + 3Ni2AI + 3NiBr2 = 2AIBr3 + 3Ni
2NH4F + Pb(NO3)2 =2NH4NO3 + PbF22NH4F + Pb(NO3)2 = 2NH4NO3 + PbF2
2KMnO4 + KI + H2O = 2MnO2 + KIO3 + 2KOH2KMnO4 + KI + H2O = 2MnO2 + KIO3 + 2KOH
2 SrCl2 + 2 H2SO4 = 2 SrSO4 + 4 HClSrCl2 + H2SO4 = SrSO4 + 2HCl
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2ZnS + 2HCl = 4ZnCl2 + H2SZnS + 2HCl = ZnCl2 + H2S
2Ag(s)+S(s)=Ag2S(s)2Ag(s) + S(s) = Ag2S(s)
2HBr+Cl2 = 2HCl+Br2HBr + Cl2 = 2HCl + 2Br
2CO+2NO=2CO2+N22CO + 2NO = 2CO2 + N2
2Al(s) + 3Cu(No3)2(aq) = 3Cu(s) + 2Al(No3)3(aq)2Al(s) + 3Cu(No3)2(aq) = 3Cu(s) + 2Al(No3)3(aq)
2Na+2H2O=2NaO+H2Na + H2O = NaO + H2
2Fe2O3=4Fe+3O22Fe2O3 = 4Fe + 3O2
2H2 + O2=2H2O2H2 + O2 = 2H2O
2KNO2+H2SO3=HNO2+K2SO32KNO2 + H2SO3 = 2HNO2 + K2SO3
2KNO2+H2SO3=HNO2+K2SO32KNO2 + H2SO3 = 2HNO2 + K2SO3
2Mg+2HCI=2MgCI+H22Mg + 2HCI = 2MgCI + H2
2Mg+2HCI=2MgCI+H22Mg + 2HCI = 2MgCI + H2
2K+2HCI=2KCI+H22K + 2HCI = 2KCI + H2
2CuSO4+MgCl2 = 2CuCl+Mg(SO4)22CuSO4 + MgCl2 = 2CuCl + Mg(SO4)2
2CuSO4+MgCl2 = 2CuCl+Mg(SO4)22CuSO4 + MgCl2 = 2CuCl + Mg(SO4)2
2 FeCl3 + 3 Na2SiO3 +6H2O = 6 NaCl + 2 Fe(OH)3 + 3 H2SiO32FeCl3 + 3Na2SiO3 + 6H2O = 6NaCl + 2Fe(OH)3 + 3H2SiO3
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2KOH+MgI2=Mg(OH)2+2KI2KOH + MgI2 = Mg(OH)2 + 2KI
2Co(NO3)3 + 3Na2(SO4) = Co2(SO4)3+6NaNO32Co(NO3)3 + 3Na2(SO4) = Co2(SO4)3 + 6NaNO3
2 NH4Cl + H2O = (NH4)2O + 2 HCl2NH4Cl + H2O = (NH4)2O + 2HCl
2Al + 3ZnCl2 = AlCl3 + Zn2Al + 3ZnCl2 = 2AlCl3 + 3Zn
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2NaHCO3=Na2CO3+CO2+H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2Fe2O3+3C=4Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
2HCl+2Mg = 2MgCl+ H22HCl + 2Mg = 2MgCl + H2
2C2H2 + O2 = 4CO2 + H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
2HBr+Co(OH)2=CoBr2+2H2O2HBr + Co(OH)2 = CoBr2 + 2H2O
2 Li(s) + 2 H2O(l) =  2 LiOH(aq) + H2(g)2Li(s) + 2H2O(l) = 2LiOH(aq) + H2(g)
2KI(aq)+Br2(l)=2KBr(aq)+I2(s)2KI(aq) + Br2(l) = 2KBr(aq) + I2(s)
2CO2(g)+2H2O(g)=C2H5OH(g)+3O2(g)2CO2(g) + 3H2O(g) = C2H5OH(g) + 3O2(g)
2Na+H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Fe2O3 = 4Fe + 3O22Fe2O3 = 4Fe + 3O2
2AgNO3 + 3CaCl2 = 3Ca(NO3)2 + 2AgCl2AgNO3 + CaCl2 = Ca(NO3)2 + 2AgCl
2Al + 3Pb(NO3)2 = Al(NO3)2 + PbAl + Pb(NO3)2 = Al(NO3)2 + Pb
2H2 (g) + O2 (g) = 2 H2O (g)2H2(g) + O2(g) = 2H2O(g)
2Ca(OH)2 + 2CO2 = 2CaCO3 + H2OCa(OH)2 + CO2 = CaCO3 + H2O
2 C3H6 + 9 O2 = 6 CO2 + 6 H2O2C3H6 + 9O2 = 6CO2 + 6H2O
2 Li+ O2 = Li2O4Li + O2 = 2Li2O
2HClO(aq)+Ca(OH)2(aq)=2H2O(l)+Ca(ClO)2(aq)2HClO(aq) + Ca(OH)2(aq) = 2H2O(l) + Ca(ClO)2(aq)
2HNO3 + 6HBr = 3Br2 + 2NO + 4H2O2HNO3 + 6HBr = 3Br2 + 2NO + 4H2O
2Ca3(PO4)2 + C + 6SiO2 = CaSiO3 + P4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2Fe+ 6NO3-+6H+ =Fe2O3+6NO2+3H2O2Fe + 6NO3- + 6H+ = Fe2O3 + 6NO2 + 3H2O
2 Na + 2 H2O = 2 NaOH + H2=2Na + 2H2O = 2NaOH + H2
2 Li + Ca(NO3)2=Ca + 2 LiNO32Li + Ca(NO3)2 = Ca + 2LiNO3
2C2H6SO + 8O2 = 4CO2 + 6H2O + 2SO2C2H6SO + 4O2 = 2CO2 + 3H2O + SO2
2Ca(ClO)2 + 2CO2 = 2CaCO3 + 2Cl2 + O22Ca(ClO)2 + 2CO2 = 2CaCO3 + 2Cl2 + O2
2Ca(ClO)2 + 2CO2 = 2CaCO3 + 2Cl2 + OCa(ClO)2 + CO2 = CaCO3 + Cl2 + O
2Ca(ClO)2 + 2CO2 = 2CaCO3 + 2Cl2 + O22Ca(ClO)2 + 2CO2 = 2CaCO3 + 2Cl2 + O2
2HI (aq) + Ca (OH)2 (aq) = CaI2 (aq) + H2O (l)2HI(aq) + Ca(OH)2(aq) = CaI2(aq) + 2H2O(l)
2 HBr + CaCO3 = CaBr2 + H2O + CO22HBr + CaCO3 = CaBr2 + H2O + CO2
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2Al + 3PbCl2 = Al2Cl3 + 3Pb4Al + 3PbCl2 = 2Al2Cl3 + 3Pb
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2H2+O2 = H2O2H2 + O2 = 2H2O
2MgO+2Br2=O2+2MgBr22MgO + 2Br2 = O2 + 2MgBr2
2 NaBr(aq) + Pb(ClO4)2(aq) = PbBr2(s)+2NaClO4(aq)2NaBr(aq) + Pb(ClO4)2(aq) = PbBr2(s) + 2NaClO4(aq)
2N2 + O2 = N2O2N2 + O2 = 2N2O
2H2 + O2 =H2O2H2 + O2 = 2H2O
2Fe(s) + 2HNO3 = Fe2+ + NO2 + H2O + NO3-2Fe(s) + 2HNO3 = Fe2+ + NO2 + H2O + NO3-
2Fe(s) + 2HNO3 + 2H+ = Fe2+ + 2NO2 + 3H2O2Fe(s) + HNO3 + H+ = Fe2+ + NO2 + H2O
2Al + 3Fe(NO3)2=2Al(NO3)3 + 3Fe2Al + 3Fe(NO3)2 = 2Al(NO3)3 + 3Fe
2NaOH + CO = Na2CO3 +H22NaOH + CO = Na2CO3 + H2
2HCl+NaCO3=NaO + Cl + H2CO22HCl + NaCO3 = NaO + 2Cl + H2CO2
2CO + 2H2 = 2H2O + 2CCO + H2 = H2O + C
2AlCl3= 3Al + 3Cl22AlCl3 = 2Al + 3Cl2
2Fe2O3=4Fe + O22Fe2O3 = 4Fe + 3O2
2C6H6S + O2 = CO + 6H2O + SO22C6H6S + 11O2 = 12CO + 6H2O + 2SO2
2KMnO4 + H2SO4=2MnO2 + K2SO4 + 2H + 2SO2-2KMnO4 + H2SO4 = -2MnO2 - K2SO4 + 2H + 2SO2
2KCLO3=2KCL+3O22KCLO3 = 2KCL + 3O2
2C2H5OH+6O2=4CO2+6H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2CO2+O2=2CO2CO2 + 0O2 = CO2
2H2 + O2 =2H2O2H2 + O2 = 2H2O
2Na+Br2= 2NaBr2Na + Br2 = 2NaBr
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2 C5H10O(l) + 15 O2(g) = 10 CO2(g) + 10 H2O(l)C5H10O(l) + 7O2(g) = 5CO2(g) + 5H2O(l)
2MnO2+ 4KOH+O2+CI2= 2KMnO4 + 2KCI + 2 H2O4MnO2 + 4KOH + 3O2 + 0CI2 = 4KMnO4 + 0KCI + 2H2O
2PCl5 + 2H2O =2HCl + H3 PO4PCl5 + 4H2O = 5HCl + H3PO4
2PCl5 + 2H2O =2HCl + H3 PO4PCl5 + 4H2O = 5HCl + H3PO4
2 KMnO4 + 2 NaOH + KNO2 = K2MnO4 + Na2MnO4 + KNO3 + H2O2KMnO4 + 2NaOH + KNO2 = K2MnO4 + Na2MnO4 + KNO3 + H2O
2 KMnO4 + 2 NaOH + KNO2 = K2MnO4 + Na2MnO4 + KNO3 + H2O2KMnO4 + 2NaOH + KNO2 = K2MnO4 + Na2MnO4 + KNO3 + H2O
2H2+1O2=2H2O2H2 + O2 = 2H2O
2CO2+9H2O+2e-=C2H5OH+12OH2CO2 + 9H2O + 0e- = C2H5OH + 12OH
2CO2+9H2O=C2H5OH+12OH2CO2 + 9H2O = C2H5OH + 12OH
2H2O+OH=H2O20H2O + 2OH = H2O2
2H2O=H2O2+2OH0H2O = -1H2O2 + 2OH
2NH4NO3(aq) + 2MgSO4 + H2SO4(aq) + 5NaOH = 2Mg(OH)2 + NaNO3 + 2Na2SO40NH4NO3(aq) + MgSO4 + 0H2SO4(aq) + 2NaOH = Mg(OH)2 + 0NaNO3 + Na2SO4
2NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2Na+H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2NH4Fe(SO4)2 + 2HNO3 = 2NH4NO3(aq) + Fe2(SO4)3(aq) + H2SO4(aq)2NH4Fe(SO4)2 + 2HNO3 = 2NH4NO3(aq) + Fe2(SO4)3(aq) + H2SO4(aq)
2N2H4+9N2O4=3N2+4H2O2N2H4 + N2O4 = 3N2 + 4H2O
2C3H6O+9O2=6CO2+6H2OC3H6O + 4O2 = 3CO2 + 3H2O
2Ba+O2=2BaO2Ba + O2 = 2BaO
2CH+O2=H2O+2CO24CH + 5O2 = 2H2O + 4CO2
2B+3CuCl2=2BCl3+3Cu2B + 3CuCl2 = 2BCl3 + 3Cu
2K+H2O=2H2+KOH2K + 2H2O = H2 + 2KOH
2LiNO3 = 2LiNO2 + O22LiNO3 = 2LiNO2 + O2
2(NH4)Cl + Mg(OH)2 = MgCl2 + 2H2O + 2NH32(NH4)Cl + Mg(OH)2 = MgCl2 + 2H2O + 2NH3
2FeCl3+3(NH4)2S = Fe2S3+6NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2NaHSO3 + Na2Cr2O7+ 2H2O + 2HCl = 2Cr(OH)3 + Na2SO4 + 2NaCl-3NaHSO3 - Na2Cr2O7 - 2H2O + HCl = -2Cr(OH)3 - 3Na2SO4 + NaCl
2Ca3(PO4)2 +C + 6SiO2 = CaSiO3 + P4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2HCl+Mg=MgCl2+H22HCl + Mg = MgCl2 + H2
2 N2H4(g) + 2 NO2(g) = 3 N2(g) + 4 H2O(g)2N2H4(g) + 2NO2(g) = 3N2(g) + 4H2O(g)
2AI+6H=2AI3+H20AI + 2H = 0AI3 + H2
2H2+ N2 = N2H42H2 + N2 = N2H4
2HCl + Mg = MgCl 2 + H 22HCl + Mg = MgCl2 + H2
2NO2 + H2O = HNO3 + HNO3 0NO2 + 0H2O = -1HNO3 + HNO3
2SO2 + H2O = H2SO3SO2 + H2O = H2SO3
2Al2O3+3C=Al+COAl2O3 + 3C = 2Al + 3CO
2As+3Cl2=2AsCl32As + 3Cl2 = 2AsCl3
2NH3+O2= N2+3H2O4NH3 + 3O2 = 2N2 + 6H2O
2FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
2H2S(g) + O2(g) = 2SO2(g) + 2H2O(g)2H2S(g) + 3O2(g) = 2SO2(g) + 2H2O(g)
2H2S(g) + O2(g) = 2SO2(g) + 2H2O(g)2H2S(g) + 3O2(g) = 2SO2(g) + 2H2O(g)
2H3PO4 + 3H2SO4 = H3O + HSO4 +H2PO4H3PO4 - H2SO4 = 0H3O - HSO4 + H2PO4
2H2S(g) + 3O2(g) = 2SO2(g) + 2H2O(g)2H2S(g) + 3O2(g) = 2SO2(g) + 2H2O(g)
2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)22Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2NO = N2 + O22NO = N2 + O2
2NO(g) = N2(g) + O2(g)2NO(g) = N2(g) + O2(g)
2NO(g) = N2(g) + O2(g)2NO(g) = N2(g) + O2(g)
2NO(g) = N2(g)+O2(g)2NO(g) = N2(g) + O2(g)
2Li2SO4+2H2O=2Li2O+2H2SO4Li2SO4 + H2O = Li2O + H2SO4
2 Cr + 3 O2 = Cr2O34Cr + 3O2 = 2Cr2O3
2Cu + O2 = 2CuO2Cu + O2 = 2CuO
2Al(C2H3O2)3 + 3BaSO4=Al2(SO4)3 + 3Ba(C2H3O2)2 2Al(C2H3O2)3 + 3BaSO4 = Al2(SO4)3 + 3Ba(C2H3O2)2
2Na2S2O3+6I2=Na2S4O6+12NaI2Na2S2O3 + I2 = Na2S4O6 + 2NaI
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2CO2 + H2O + 3PbO= Pb3 (CO3) 2 (OH) 22CO2 + H2O + 3PbO = Pb3(CO3)2(OH)2
2CO2 + H2O + 3PbO= Pb3 (CO3) 2 (OH) 22CO2 + H2O + 3PbO = Pb3(CO3)2(OH)2
2CO2 + H2O + 3 PbO= Pb3 (CO3) 2 (OH) 22CO2 + H2O + 3PbO = Pb3(CO3)2(OH)2
2AI+2NaOH+2H2O=2NaAIO2+3H22AI + 2NaOH + 2H2O = 2NaAIO2 + 3H2
2CaCl2+2H2O=CaO+HCl CaCl2 + H2O = CaO + 2HCl
2CaCl2+H2O=CaO+HCl CaCl2 + H2O = CaO + 2HCl
2LiNO3 = 2LiNO2 + O22LiNO3 = 2LiNO2 + O2
2Al(s)+FeO3(s)=Al2O3(s)+2Fe(s)2Al(s) + FeO3(s) = Al2O3(s) + Fe(s)
2Ca+H2O=Ca(HO)2+H2Ca + 2H2O = Ca(HO)2 + H2
2Fe2O3=4Fe+3O22Fe2O3 = 4Fe + 3O2
2 AgNo3+Ni = Ni(No3)2+2Ag2AgNo3 + Ni = Ni(No3)2 + 2Ag
2Li+ H2O=2LiHO+H22Li + 2H2O = 2LiHO + H2
2Ca3(PO4)2 + C + 6SiO2 = CaSiO3 + P4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2LiNO=2LiNO2+O2-2LiNO = -2LiNO2 + O2
2Cu2O + C = 4Cu + CO22Cu2O + C = 4Cu + CO2
2K2O + 2H2O = 2KOHK2O + H2O = 2KOH
2HgO = O2 + 2Hg2HgO = O2 + 2Hg
2Fe(NO3)3(aq) + 3 NaOH(aq) + H2O2 = Fe2O3(s) + 3NaNO3(aq) + H2O2Fe(NO3)3(aq) + 6NaOH(aq) + 0H2O2 = Fe2O3(s) + 6NaNO3(aq) + 3H2O
2C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2CH3CHO +O2 = 2CH3COOH2CH3CHO + O2 = 2CH3COOH
2 Na3PO4(aq) + 3 Fe(NO3)2(aq) = 1 Fe3(PO4)2(s) + 6 NaNO3(aq)2Na3PO4(aq) + 3Fe(NO3)2(aq) = Fe3(PO4)2(s) + 6NaNO3(aq)
2HC2H3O2(aq) + Ca(OH)2(aq) = Ca(C2H3O2)2(aq) + 2 H2O(l)2HC2H3O2(aq) + Ca(OH)2(aq) = Ca(C2H3O2)2(aq) + 2H2O(l)
2N2O5 + NO = 4NO2 N2O5 + NO = 3NO2
2C2H2 + 5O2 = 4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2C2H6O + 7O2 = 4CO2 + 6H2OC2H6O + 3O2 = 2CO2 + 3H2O
2NaOH + CaBr2 = Ca(OH)2 + 2NaBr2NaOH + CaBr2 = Ca(OH)2 + 2NaBr
2Al+3Cl2=2AlCl32Al + 3Cl2 = 2AlCl3
2CaH2+2H2O=Ca2(OH)2+3H22CaH2 + 2H2O = Ca2(OH)2 + 3H2
2CaH2+2H2O=Ca2(OH)2+3H22CaH2 + 2H2O = Ca2(OH)2 + 3H2
2CaH2+8H2O=4Ca(OH)2+8H2CaH2 + 2H2O = Ca(OH)2 + 2H2
2Al(s) + 6HCl(g) = 2AlCl3 (aq) + 3H2(g)2Al(s) + 6HCl(g) = 2AlCl3(aq) + 3H2(g)
2NaOH+H2CO3=2H2O + 2NaHCO3NaOH + H2CO3 = H2O + NaHCO3
2HNO2+O2=2NO3-+2H+2HNO2 + O2 = 2NO3- + 2H+
2HI(aq) + Na2CO3(s) = 2NaI(aq) + CO2(g) + H2O(l)2HI(aq) + Na2CO3(s) = 2NaI(aq) + CO2(g) + H2O(l)
2 C2H4O + 5 O2= 4 CO2 + 4 H2O2C2H4O + 5O2 = 4CO2 + 4H2O
2HgO=2Hg+O22HgO = 2Hg + O2
2KClO3=2KCl+3O22KClO3 = 2KCl + 3O2
2N2(g) + 5O2 = 2N2O5 (g)2N2(g) + 5O2 = 2N2O5(g)
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2O3=3O22O3 = 3O2
2Mn 7+ + 10I- = 2Mn 2+ + 5I2 -4Mn7+ + 10I- = -14Mn2+ + 5I2
2Mn7+ + 10I- = 2Mn2+ + 5I2-4Mn7+ + 10I- = -14Mn2+ + 5I2
2MnO4- + 10I- = 2Mn2+ + 5I2 + O24MnO4- - 6I- = 2Mn2+ - 3I2 + 8O2
2Cu3(PO4)2 + 2Li2SO4 = 2CuSO4 + 3Li3PO4Cu3(PO4)2 + 3Li2SO4 = 3CuSO4 + 2Li3PO4
2Cu3(PO4)2 + 3Li2SO4 = 3CuSO4 + 2Li3PO4Cu3(PO4)2 + 3Li2SO4 = 3CuSO4 + 2Li3PO4
2AgNO3+Na2S2O3=Ag2S2O3+2NaNO32AgNO3 + Na2S2O3 = Ag2S2O3 + 2NaNO3
2AgNO3+Na2S2O3=Ag2S2O3+2NaNO32AgNO3 + Na2S2O3 = Ag2S2O3 + 2NaNO3
2CO2 + H2O + 3PbO = Pb3 (CO3) 2 (OH) 22CO2 + H2O + 3PbO = Pb3(CO3)2(OH)2
2CO2 + H2O + 3PbO= Pb3 (CO3) 2 (OH) 22CO2 + H2O + 3PbO = Pb3(CO3)2(OH)2
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2NO+O2=2NO22NO + O2 = 2NO2
2Ag+S=Ag2S2Ag + S = Ag2S
2Bi(NO3)3 + 3H2S =Bi2S3 + 6HNO32Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.