Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
2KOH+NiSO4=Ni(OH)2+K2SO42KOH + NiSO4 = Ni(OH)2 + K2SO4
2 NO(g) + 2 O2(g) = 2 NO2(g)2NO(g) + O2(g) = 2NO2(g)
2H2O2(l)+N2H4(l)=4H2O(g)+N2(g)2H2O2(l) + N2H4(l) = 4H2O(g) + N2(g)
2Rb(s) + Cl2(g) + 3O2(g) = 2RbClO32Rb(s) + Cl2(g) + 3O2(g) = 2RbClO3
2F + 2H3O = 2HF + H2OF + H3O = HF + H2O
2F + 2H3O = HF + H2OF + H3O = HF + H2O
2Ca+Cl2=2CaCl2Ca + Cl2 = 2CaCl
2C4H10+13 O2=8 CO2+10 H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2 HCl + CA = H2 + CACl22HCl + CA = H2 + CACl2
2KCIO3=2KCI(s)=O2(g)2KCIO3 = 2KCI(s) + 3O2(g)
2CH3OH+3O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CH3OH+3O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CH3OH+3O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2NaN3(s) = 3N2(g) + 2Na(s)2NaN3(s) = 3N2(g) + 2Na(s)
2NaN3(s) = 3N2(g) + 2Na(s)2NaN3(s) = 3N2(g) + 2Na(s)
2SnO2+4H2=2Sn+4H2OSnO2 + 2H2 = Sn + 2H2O
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g) 2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2 NO(g) + 2 O2(g) = 2 NO2(g)2NO(g) + O2(g) = 2NO2(g)
2Ca + 2HNO3 = Ca(NO3)2 + H2Ca + 2HNO3 = Ca(NO3)2 + H2
2K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
2HClO(aq)+Ca(OH)2(aq) = Ca(ClO)2(aq)+2H2O(l)2HClO(aq) + Ca(OH)2(aq) = Ca(ClO)2(aq) + 2H2O(l)
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2Fe2O3(s) + 6CO(g) =4Fe(s) + 6CO2(g)Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
2HBr+ZnCO3=ZnBr+HCO3HBr + ZnCO3 = ZnBr + HCO3
2Al(s)+3Cu(NO3)2(aq)=2Al(NO3 )3(aq)+3Cu(s)2Al(s) + 3Cu(NO3)2(aq) = 2Al(NO3)3(aq) + 3Cu(s)
2Na(OH)+H2(SO4)=2H2O+Na2(SO4)2Na(OH) + H2(SO4) = 2H2O + Na2(SO4)
2H2S(aq)+H2SO3(aq)=3S(s)+3H2O(l)2H2S(aq) + H2SO3(aq) = 3S(s) + 3H2O(l)
2NH3 + H2O2 = N2H4 + 2H2O2NH3 + H2O2 = N2H4 + 2H2O
2H2S+O2=2S+2H2O2H2S + O2 = 2S + 2H2O
2H3PO4 + 3Mg(OH)2 = Mg3(PO4)2 + 6H2O 2H3PO4 + 3Mg(OH)2 = Mg3(PO4)2 + 6H2O
2H3PO4 (aq) + 3Mg(OH)2 (s) = Mg3(PO4)2 + 6H2O (l)2H3PO4(aq) + 3Mg(OH)2(s) = Mg3(PO4)2 + 6H2O(l)
2KClO3(s)=2KCl(s)+O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
2 K2O(aq) + 1 Pb(C2H3O2)4(aq) = 1 PbO2(s) + 4 KC2H3O2(aq)2K2O(aq) + Pb(C2H3O2)4(aq) = PbO2(s) + 4KC2H3O2(aq)
2NaCl + BeF2 = NaF + BeCl22NaCl + BeF2 = 2NaF + BeCl2
2Na(s)+Cl2(g)=2NaCl(s)2Na(s) + Cl2(g) = 2NaCl(s)
2Zn+4HCl=2ZnCl2+2H2Zn + 2HCl = ZnCl2 + H2
2Al + 6HCl = 2AlCl3 +3H22Al + 6HCl = 2AlCl3 + 3H2
2C + 3H2(g) + 2O2(g) = C2H5OH4C + 6H2(g) + O2(g) = 2C2H5OH
2Al+3 Cl2=2 AlCl32Al + 3Cl2 = 2AlCl3
2N2 + H2 = NH3 N2 + 3H2 = 2NH3
2CO(g) + 2O2(g) = 2CO2(g) 2CO(g) + O2(g) = 2CO2(g)
2ZnS+3O2=2ZnO+2SO22ZnS + 3O2 = 2ZnO + 2SO2
2Fe(s) + 3Cl2(g) = 2FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
2Fe(s) + 3Cl2(g) = 2FeCl3(s)2Fe(s) + 3Cl2(g) = 2FeCl3(s)
2H2+4O2= H2O2H2 + O2 = 2H2O
2 C4H10+ 13 O2= 8 CO2+ 10 H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2 C2H6(g) + 5 O2(g) = 4 CO (g) + 6 H2O (g)2C2H6(g) + 5O2(g) = 4CO(g) + 6H2O(g)
2 C2H6(g) + 5 O2(g) = 4 CO(g) + 6 H2O(g) 2C2H6(g) + 5O2(g) = 4CO(g) + 6H2O(g)
2KI + CoCl2 = 2KCl + CoI22KI + CoCl2 = 2KCl + CoI2
2 AuCl3(aq)+3 Ni(s)=3 NiCl2(aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2 AuCl3(aq)+3 Ni(s) = 3 NiCl2(aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2 AuCl3(aq)+3 Ni(s) = 3 NiCl2(aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2 AuCl3(aq)+3 Ni(s) = 3 NiCl2(aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2KMnO4 = K2MnO4 + MnO2 + O22KMnO4 = K2MnO4 + MnO2 + O2
2C8H18 + 25O2 = 16CO2 + 18H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2C8H18 + 25O2 = 16CO2 + 18H2C8H18 + 8O2 = 8CO2 + 9H2
2C8H18 + 25O2 = 16CO2 + 18H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2 C2H6(g)+5 O2(g) = 2 CO2(g)+6 H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2 AuC l 3 (aq)+3 Ni(s) = NiC l 2 (aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2C2H6+5O2=2CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6+5O2=2CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + O2 = 4CO2 + 6H2010C2H6 + 20O2 = 20CO2 + 3H20
2C2H6(g)+5O2(g) = 2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2 Au3+ + 3 Sn = 3 Sn2+ + 2 AuAu3+ + 2Sn = Sn2+ + 3Au
2 C2H6(g)+5 O2(g) =2 CO2(g)+6 H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2 AuCl3(aq)+3 Ni(s) = 3 NiCl2(aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2 AuCl3(aq)+3 Ni(s) = 3 NiCl2(aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2 C2H6(g)+5 O2(g) = 2 CO2(g)+6 H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Cr(s)+3O2(g)=Cr2O4Cr(s) + O2(g) = 2Cr2O
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2Cr + 6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2NH3 + 7O2 = 2NO2 + 3H2O4NH3 + 7O2 = 4NO2 + 6H2O
2KCl(aq)+Pb( NO 3 ) 2 (aq)=PbCl 2 (s)+2 KNO 3 (aq)2KCl(aq) + Pb(NO3)2(aq) = PbCl2(s) + 2KNO3(aq)
2KCl(aq)+Pb( NO 3 ) 2 (aq)=PbCl 2 (s)+2 KNO 3 (aq)2KCl(aq) + Pb(NO3)2(aq) = PbCl2(s) + 2KNO3(aq)
2KCl(aq)+Pb( NO 3 ) 2 (aq)=PbCl 2 (s)+2 KNO 3 (aq)2KCl(aq) + Pb(NO3)2(aq) = PbCl2(s) + 2KNO3(aq)
2Co(NO3)3 + 3(NH4)2S = Co2S3 + 3NH4NO32Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
2 NaI(aq)+Br2(l) = 2 NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2H2+O2=H2O2H2 + O2 = 2H2O
2NaC2H3O2(aq)+Pb(NO3)2(aq) = Pb(C2H3O2)2 + 2NaNO32NaC2H3O2(aq) + Pb(NO3)2(aq) = Pb(C2H3O2)2 + 2NaNO3
2H + VO2 = V + H2O4H + VO2 = V + 2H2O
2Na + 2H2O = 2NaOH + H22Na + 2H2O = 2NaOH + H2
2 C2H6(g)+5 O2(g) = 2 CO2(g)+6 H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
2LiOH + CaBr2 = 2 LiBr + Ca(OH)22LiOH + CaBr2 = 2LiBr + Ca(OH)2
2BaBr2 + 2H2SO4 = 2BaSO4 + 4HBrBaBr2 + H2SO4 = BaSO4 + 2HBr
2Cr + 3Br2 = 2CrBr32Cr + 3Br2 = 2CrBr3
2Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3 2Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3
2Al + 6H2O = 2Al(OH)3 + 3H2 2Al + 6H2O = 2Al(OH)3 + 3H2
2HClO4(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaClO4(aq)2HClO4(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaClO4(aq)
2NH 4 NO 3 ( s ) = 2N 2 ( g ) + 4H 2 O ( g ) + O 2 ( g )2NH4NO3(s) = 2N2(g) + 4H2O(g) + O2(g)
2HC2H3O2 + Pb(OH)2 = H2O + Pb(C2H3O2)22HC2H3O2 + Pb(OH)2 = 2H2O + Pb(C2H3O2)2
2 AuCl3(aq)+3 Sn(s) = 3 SnCl2(aq)+2 Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2 PbS(s) + 3 O2(g) = 2 PbO(s) + 2 SO2(g)2PbS(s) + 3O2(g) = 2PbO(s) + 2SO2(g)
2KO2+S=K2SO42KO2 + S = K2SO4
2H2O + 3C = 2CH2 + O22H2O + 2C = 2CH2 + O2
2AL(s)+6HBr(aq)=2ALBr3(aq)+3H22AL(s) + 6HBr(aq) = 2ALBr3(aq) + 3H2
2AL(s)+6HBr(aq)=2ALBr3(aq)+3H22AL(s) + 6HBr(aq) = 2ALBr3(aq) + 3H2
2NaCO3+H2O=CO2+NaOH+H2O0NaCO3 + H2O = 0CO2 + 0NaOH + H2O
2C+O2=2CO2C + O2 = 2CO
2H2O=H2+O22H2O = 2H2 + O2
2Fe+O2=2FeO2Fe + O2 = 2FeO
2H2O2=2H2O+2O22H2O2 = 2H2O + O2
2C2H2+5O2 = 4CO2+ 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2C7H6O2 + 15O2= 14CO2+ 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2C7H6O2 + 15O2 = 14CO2 + 6 H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2Na +2H2O = 2NaOH +2H22Na + 2H2O = 2NaOH + H2
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2NaOH+Cl2=NaCl+H2O+NaClO2NaOH + Cl2 = NaCl + H2O + NaClO
2Al(s)+O2(g)=2AlO(aq)2Al(s) + O2(g) = 2AlO(aq)
2Al(s)+O(g)=2AlO(aq)Al(s) + O(g) = AlO(aq)
2K(s)+Cl2(g)=2KCl(aq)2K(s) + Cl2(g) = 2KCl(aq)
2Mg+Cl2=MgCl(aq)2Mg + Cl2 = 2MgCl(aq)
20Ca + O2 = CaO2Ca + O2 = 2CaO
2Fe + CuSO4 = 2FeSO4 + CuFe + CuSO4 = FeSO4 + Cu
2H2O=2H2 + O22H2O = 2H2 + O2
2NaOH(s)+CO2(g)=Na2CO3(s)+H2O(l)2NaOH(s) + CO2(g) = Na2CO3(s) + H2O(l)
2FeC2O4+2CO2=Fe(C2O4)3FeC2O4 + 4CO2 = Fe(C2O4)3
2N2O5 + NO = 4NO2N2O5 + NO = 3NO2
2SnO2 + 4H2 = Sn + H2OSnO2 + 2H2 = Sn + 2H2O
2 Al3 + 18 HCl = 6 AlCl3 + 9 H22Al3 + 18HCl = 6AlCl3 + 9H2
2Ga2 + 3O2 = 2Ga2O32Ga2 + 3O2 = 2Ga2O3
2Ga2 + 3O2 = 2Ga2O32Ga2 + 3O2 = 2Ga2O3
2Cs+Br2=CsBr2Cs + Br2 = 2CsBr
2Cs+Br2=2CsBr2Cs + Br2 = 2CsBr
2NaI(s)+2H2SO4(aq)+MnO2(s)=Na2SO4(aq)+MnSO4(aq)+I2(g)+2H2O(l)2NaI(s) + 2H2SO4(aq) + MnO2(s) = Na2SO4(aq) + MnSO4(aq) + I2(g) + 2H2O(l)
2KClO3= KClO3KClO3 = KClO3
2KClO3= 2KClO3KClO3 = KClO3
2K(s)+2H2O(l)=2KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
2K(s)+2H2O(l)=2KOH(aq)+H2(g)2K(s) + 2H2O(l) = 2KOH(aq) + H2(g)
2 AgNO3(aq)+Fe(s) = Fe(NO3)2(aq)+2 Ag(s)2AgNO3(aq) + Fe(s) = Fe(NO3)2(aq) + 2Ag(s)
2 C 8 H 18 (g)+25 O 2 (g)=16C O 2 (g)+18 H 2 O(g)2C8H18(g) + 25O2(g) = 16CO2(g) + 18H2O(g)
2NaNO2(s)=2NaNO3(s)+O2(g)-2NaNO2(s) = -2NaNO3(s) + O2(g)
2C4H10 + 26 O 2 = H2O + 8CO22C4H10 + 13O2 = 10H2O + 8CO2
2(HO) + NaCl2 = H3O + NaCl2 0(HO) + NaCl2 = 0H3O + NaCl2
2(HO) + NaCl2 = H3O + NaCl2 0(HO) + NaCl2 = 0H3O + NaCl2
2(HO) + NaCl2 = H2O + NaCl + HCl-1(HO) + NaCl2 = -1H2O + NaCl + HCl
2(HO) + NaCl2 = H2O + NaCl + HCl-1(HO) + NaCl2 = -1H2O + NaCl + HCl
2(HO) + NaCl2 = H2O + NaCl + HCl-1(HO) + NaCl2 = -1H2O + NaCl + HCl
2HO + NaCl2 = H2O + NaCl + HCl-1HO + NaCl2 = -1H2O + NaCl + HCl
2HgO = Hg2 +O22HgO = Hg2 + O2
2 K3PO4 + 3 Ba(OH)2 = Ba3(PO4)2 + 6 KOH2K3PO4 + 3Ba(OH)2 = Ba3(PO4)2 + 6KOH
2 MnO(s) + 5 PbO2(s)+ 10 HNO3(aq) = 2HMnO4(aq) + 5Pb(NO3)2(aq) + 4H2O(l)2MnO(s) + 5PbO2(s) + 10HNO3(aq) = 2HMnO4(aq) + 5Pb(NO3)2(aq) + 4H2O(l)
2HgO = Hg2 +O22HgO = Hg2 + O2
2NaN3 = 2Na + 3N22NaN3 = 2Na + 3N2
2Al + 3H2SO4 = Al2(SO4)3 + 3H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
2N2O5(g)=NO2(g)+O2(g)2N2O5(g) = 4NO2(g) + O2(g)
2Cr + 6HCl = 2ClCr3 + 3H26Cr + 2HCl = 2ClCr3 + H2
2CO + 4H2 = 2 CH4OCO + 2H2 = CH4O
2HCl+F2=Cl2+2HF2HCl + F2 = Cl2 + 2HF
2HCl(aq)+F2(g)=Cl2(g)+2HF(aq)2HCl(aq) + F2(g) = Cl2(g) + 2HF(aq)
2 AuCl3(aq)+3 Ni(s) = 3 NiCl2(aq)+2 Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2C2H2 + 5O2 = 4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2KClO3(s)=2KCl(s)+O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2Na + Br2 = 2NaBr2Na + Br2 = 2NaBr
2 C2H6(g)+5 O2(g) = 2 CO2(g)+6 H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2C3H7OH+9O2=6CO2+8H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
2Al+3Br2=2AlBr32Al + 3Br2 = 2AlBr3
2Na+1Cl2=2NaCl2Na + Cl2 = 2NaCl
2CH3OH+3O2=2CO2+4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2N2+6I2=4NI3N2 + 3I2 = 2NI3
2H2S(aq)+H2SO3(aq)=3S(s)+3H2O(l)2H2S(aq) + H2SO3(aq) = 3S(s) + 3H2O(l)
2C6H14+18O2=12CO2+14H2O2C6H14 + 19O2 = 12CO2 + 14H2O
2Li + H2O = Li2O + H22Li + H2O = Li2O + H2
2C3H7OH+9O2=6CO2+8H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
2Fe+3O2=1Fe2O34Fe + 3O2 = 2Fe2O3
2CH3OH+3O2=2CO2+4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2HClO4(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaClO4(aq)2HClO4(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaClO4(aq)
2NaN3 = 2Na (s) + 3N2 (g) 2NaN3 = 2Na(s) + 3N2(g)
2HC2H3O2 + Pb(OH)2 = H2O + Pb(C2H3O2)22HC2H3O2 + Pb(OH)2 = 2H2O + Pb(C2H3O2)2
2NaBr+ H2O2 +HCl = Br2 + 2NaCl +2 H2O2NaBr + H2O2 + 2HCl = Br2 + 2NaCl + 2H2O
2C2H2+O2=4CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2KClO3=2KCl+3O22KClO3 = 2KCl + 3O2
2P+3Cl2=2PCl32P + 3Cl2 = 2PCl3
2H2(g)+O2(g)=2H2O(l)2H2(g) + O2(g) = 2H2O(l)
2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
2NH4NO3 = 4N2+2O2+2H2O2NH4NO3 = 2N2 + O2 + 4H2O
2Al2O3 + 3S2 =4Al + 3SO32Al2O3 + S2 = 4Al + 2SO3
2KOH(aq)+H2SO4(aq)=K2SO4(aq)+2H2O(l)2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l)
2KOH(aq)+H2SO4(aq)=K2SO4(aq)+2H2O(l)2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l)
2 NaI(aq)+B r 2 (l) = 2 NaBr(aq)+ I 2 (s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2Cu2S(s) + 3O2(g)=2Cu2O (s) + 2SO2(g)2Cu2S(s) + 3O2(g) = 2Cu2O(s) + 2SO2(g)
2Na + MgCl2 = Mg + 2NaCl2Na + MgCl2 = Mg + 2NaCl
2KI(s)=2K(s)+I2(s)2KI(s) = 2K(s) + I2(s)
2 NaI(aq)+Br2(l) =2 NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2AuCl3(aq)+3Ni(s)=3NiCl2(aq) + 2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2Ba (C2H3O2)2 + 4H2SO4 = 4BaSO4 + 4 CH3COOHBa(C2H3O2)2 + H2SO4 = BaSO4 + 2CH3COOH
2C8H18 + 25O2 = 16CO2 + 18H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2NaOH + BaCl2 = 2NaCl + Ba(OH)22NaOH + BaCl2 = 2NaCl + Ba(OH)2
2KClO3(s)=2KCl(s)+O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
2KClO3(s)=2KCl(s)+O2(g)2KClO3(s) = 2KCl(s) + 3O2(g)
2C7H6O2+15O2=14CO2+6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2CaBr2 + Cl2 = 2ClBr2 + 2Ca2CaBr2 + Cl2 = 2ClBr2 + 2Ca
2KClO3 =KCl + O22KClO3 = 2KCl + 3O2
2C7H8+18O2=14CO2+8H2OC7H8 + 9O2 = 7CO2 + 4H2O
2HNO + 3Fe = 3Fe(NO3)3 + 2NO + H2O12HNO - Fe = -1Fe(NO3)3 + 15NO + 6H2O
2HNO + 3Fe = 3Fe(NO3)3 + 2NO + H2020HNO + 0Fe = 0Fe(NO3)3 + 20NO + H20
2HNO + 3Fe = 3Fe(NO3)3 + 2NO + H2020HNO + 0Fe = 0Fe(NO3)3 + 20NO + H20
2C6H6+19O2=12CO2+6H2O2C6H6 + 15O2 = 12CO2 + 6H2O
2C2H6+5O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2N2O5 + NO =4NO2N2O5 + NO = 3NO2
2FeCl2 + PbCl4 = 2FeCl3 + PbCl22FeCl2 + PbCl4 = 2FeCl3 + PbCl2
2N2+1O2=2N2O2N2 + O2 = 2N2O
2N2+1O2=2N2O2N2 + O2 = 2N2O
2HCl (aq) + BaCO3 (s) = 2HCO3 + BaClHCl(aq) + BaCO3(s) = HCO3 + BaCl
2HgO(s)=2Hg(l)+ O 2 (g)2HgO(s) = 2Hg(l) + O2(g)
2Al2O3 + 3S2 =4Al + 3SO32Al2O3 + S2 = 4Al + 2SO3
2NaNO3 + CaCl2 =2NaCl + Ca(NO3)2 2NaNO3 + CaCl2 = 2NaCl + Ca(NO3)2
2C+O2= 2CO2C + O2 = 2CO
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2CuCl2 + Al = Cu2Al + 2Cl22CuCl2 + Al = Cu2Al + 2Cl2
2Na+1O2=2Na2O4Na + O2 = 2Na2O
2HCl + Mg = 2H + MgCl22HCl + Mg = 2H + MgCl2
2HCl + 2KMnO4 = Cl2 + MnO2 + 2H2O +2KCl8HCl + 2KMnO4 = 3Cl2 + 2MnO2 + 4H2O + 2KCl
2Fe(s) + O2(g) = 2FeO(s)2Fe(s) + O2(g) = 2FeO(s)
2S(s) + 3O2(g) = 2SO3(g)2S(s) + 3O2(g) = 2SO3(g)
2Ag + S = Ag2S2Ag + S = Ag2S
2SO2 + 2H2O = 2H2SO4 + 2H2O0SO2 + H2O = 0H2SO4 + H2O
2SO2 + 2H2O = 2H2SO4 + H2O0SO2 + H2O = 0H2SO4 + H2O
2SO2 + 2H2O = 2H2SO4 + H2O0SO2 + H2O = 0H2SO4 + H2O
2SO2 + 2H2O = 2H2SO4 + H2O0SO2 + H2O = 0H2SO4 + H2O
2C3H7 = C6H142C3H7 = C6H14
2Al+3FeO=3Fe+Al2O32Al + 3FeO = 3Fe + Al2O3
2Al+3FeO=3Fe+Al2O32Al + 3FeO = 3Fe + Al2O3
2NaCl + LiS = NaS + 2LiClNaCl + LiS = NaS + LiCl
2CaCO3+3Al(PO4)= Ca2(PO4)3+Al3(CO3)22CaCO3 + 3Al(PO4) = Ca2(PO4)3 + Al3(CO3)2
2Na2S + 1Mg(NO3)2  =  2Na2NO3 + 1MgS2 2Na2S + Mg(NO3)2 = 2Na2NO3 + MgS2
2Al + 2N2 = AlN2Al + N2 = 2AlN
2 NH4OH + Ni(NO3)2 = 2 NH4(NO3) + Ni(OH)22NH4OH + Ni(NO3)2 = 2NH4(NO3) + Ni(OH)2
2Li(s)+Br2(l)=2LiBr(s)2Li(s) + Br2(l) = 2LiBr(s)
2Li(s)+Br2(l)=2LiBr(s)2Li(s) + Br2(l) = 2LiBr(s)
2NaCl (aq) + CuSO4 (aq)= CuCl2 + Na2SO42NaCl(aq) + CuSO4(aq) = CuCl2 + Na2SO4
2NaCl + CuSO4 = CuCl2 + Na2SO42NaCl + CuSO4 = CuCl2 + Na2SO4
2H +NaBr + NaClO = Br2 + NaCl + H2O2H + 0NaBr + NaClO = 0Br2 + NaCl + H2O
2K + 2H2O = 2KOH + H22K + 2H2O = 2KOH + H2
2Al(s) + 3Pb(NO3)2(aq) = 2Al (NO3)3(aq) + 3Pb(s)2Al(s) + 3Pb(NO3)2(aq) = 2Al(NO3)3(aq) + 3Pb(s)
2Zn + 2HCl = H2(aq) + 2ZnCl(aq) 2Zn + 2HCl = H2(aq) + 2ZnCl(aq)
2KI(aq) + Pb(NO3)2(aq) = PbI2(s) + 2KNO3(aq)2KI(aq) + Pb(NO3)2(aq) = PbI2(s) + 2KNO3(aq)
2CO+4H2=2CH4OCO + 2H2 = CH4O
2CO+4H2=2CH4OCO + 2H2 = CH4O
2 Al(No3)3 + 3 Li2So4 = Al2(So4)3 + 6 LiNo32Al(No3)3 + 3Li2So4 = Al2(So4)3 + 6LiNo3
2Al+3(O2)=Al2(O2)32Al + 3(O2) = Al2(O2)3
2H2(g)+O2(g)=2H2O(l)2H2(g) + O2(g) = 2H2O(l)
2H2O (l) = 2H2 (g) + O2 (g)2H2O(l) = 2H2(g) + O2(g)
2CH3COOH+Ca(OH)2=2H2O+Ca(CH3COO)22CH3COOH + Ca(OH)2 = 2H2O + Ca(CH3COO)2
2Cr+3O2=Cr2O34Cr + 3O2 = 2Cr2O3
2Cl2(g)+4KBr(aq)=4KCl(aq)+2Br2(g)Cl2(g) + 2KBr(aq) = 2KCl(aq) + Br2(g)
2AgNO3 + BaCl2 = 2AgCl + Ba(NO3)22AgNO3 + BaCl2 = 2AgCl + Ba(NO3)2
2NaCl(s)+Pb(NO3)2(aq)=PbCl2(s)+2NaNO3(aq)2NaCl(s) + Pb(NO3)2(aq) = PbCl2(s) + 2NaNO3(aq)
2Al+3(SO4)=Al2(SO4)32Al + 3(SO4) = Al2(SO4)3
2K + Fe2S3 = K2S2 + 2Fe6K + 2Fe2S3 = 3K2S2 + 4Fe
2K + Fe2S2 = K2S2 + 2Fe2K + Fe2S2 = K2S2 + 2Fe
2K + Fe2S3 = K2S3 + 2Fe2K + Fe2S3 = K2S3 + 2Fe
2 H2 + O2 = 2 H2O2H2 + O2 = 2H2O
2NaOH(aq)+Zn(NO3)2(aq) =Zn(OH)2(s)+2NaNO3(aq)2NaOH(aq) + Zn(NO3)2(aq) = Zn(OH)2(s) + 2NaNO3(aq)
2FeS(s)+3O2(g)=2FeO(s)+2SO2(g) 2FeS(s) + 3O2(g) = 2FeO(s) + 2SO2(g)
2Al + N2 = 2AlN2Al + N2 = 2AlN
2HgO= 2Hg+O22HgO = 2Hg + O2
2Li + Cl2 = 2LiCl2Li + Cl2 = 2LiCl
2Li3N = 6Li + N22Li3N = 6Li + N2
2NaOH+ FeSO3 = Na2SO3 + Fe(OH)22NaOH + FeSO3 = Na2SO3 + Fe(OH)2
2Al+3O2=Al22O344Al + 3O2 = 2Al22O3
2Na+Cl2=2NaCl2Na + Cl2 = 2NaCl
2NaI + Br2 = 2NaBr + I22NaI + Br2 = 2NaBr + I2
2NaI + Br2 = 2NaBr + I22NaI + Br2 = 2NaBr + I2
2NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
2BaCl2(aq)+4AgNO3(aq)=2Ba(NO3)2(aq)+4AgCl(s)BaCl2(aq) + 2AgNO3(aq) = Ba(NO3)2(aq) + 2AgCl(s)
2 SnO2 + 4 H2 = 2 Sn + 4 H2OSnO2 + 2H2 = Sn + 2H2O
2Mg(s) + O2(g) = 2MgO2Mg(s) + O2(g) = 2MgO
2Hg(NO3)2 = 2HgO(s) + 4NO2(g) + O2(g)2Hg(NO3)2 = 2HgO(s) + 4NO2(g) + O2(g)
2Hg(NO3)2 = 2HgO + 4NO2 + O2 2Hg(NO3)2 = 2HgO + 4NO2 + O2
2H2O2= 2H2O+ O22H2O2 = 2H2O + O2
2 CO(g) + O2(g) = 2 CO2(g)2CO(g) + O2(g) = 2CO2(g)
2NO 6 + O2 4 = 2NO26NO6 - O24 = 6NO2
2 NO6 + 4 O2 = 2NO2NO6 - 2O2 = NO2
2 NO6 + O2 4= 6NO412NO6 - O24 = 12NO4
2NO+O2=2NO22NO + O2 = 2NO2
2NO + O2 = 2NO22NO + O2 = 2NO2
2Hg(NO3)2 = 2HgO(s) + 4NO2(g) + O2(g)2Hg(NO3)2 = 2HgO(s) + 4NO2(g) + O2(g)
2Cu(NO3)2=2CuO+4NO2+O22Cu(NO3)2 = 2CuO + 4NO2 + O2
2HNO3 + Ca(OH)2 = Ca(NO3)2 + 2H2O2HNO3 + Ca(OH)2 = Ca(NO3)2 + 2H2O
2NH 3 (aq)+CO 2 (aq)=CH 4 N 2 O(aq)+H 2 O(l)2NH3(aq) + CO2(aq) = CH4N2O(aq) + H2O(l)
2Fe2O3+2CO=Fe+CO2Fe2O3 + 3CO = 2Fe + 3CO2
2KCl(aq)+Pb(NO3)2(aq)=PbCl2(s)+2KNO3(aq)2KCl(aq) + Pb(NO3)2(aq) = PbCl2(s) + 2KNO3(aq)
2 CrO4 + 3 SO2 + 4 H = Cr2(SO4)3 + 2 H2O2CrO4 + 3SO2 + 4H = Cr2(SO4)3 + 2H2O
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2HBr+Na2S=H2S+ 2NaBr2HBr + Na2S = H2S + 2NaBr
2NH4NO3+ Ba(OH)2=2NH3+ 2H2O+Ba(NO3)22NH4NO3 + Ba(OH)2 = 2NH3 + 2H2O + Ba(NO3)2
2NH4NO3+ Ba(OH)2=2NH3+ 2H2O+Ba(NO3)22NH4NO3 + Ba(OH)2 = 2NH3 + 2H2O + Ba(NO3)2
2KF=2K+F22KF = 2K + F2
2P4O6(s) + H2O(l) = H3PO3(aq) P4O6(s) + 6H2O(l) = 4H3PO3(aq)
2P4O6(s) + H2O(l) = H3PO3(aq) P4O6(s) + 6H2O(l) = 4H3PO3(aq)
2GeCl4 + 7Cl2 = GeCl4Cl2GeCl4 + Cl2 = GeCl4Cl2
2GeCl4 + Cl2 = GeCl4Cl2GeCl4 + Cl2 = GeCl4Cl2
2Al + 3CaCO3 = Al2(CO3)3 + 3Ca2Al + 3CaCO3 = Al2(CO3)3 + 3Ca
2Si2C2 + 3C = Si4C2Si2C2 - 3C = Si4C
2Si2C2 + 4C = 6Si4C2Si2C2 - 3C = Si4C
2FeO3 + H2O = FeO3H2OFeO3 + H2O = FeO3H2O
2FeO3 + H2O = 2FeO3H2OFeO3 + H2O = FeO3H2O
2Ni + P4 = 3NiP4Ni + P4 = NiP4
2SO3+H2O=H2SO4SO3 + H2O = H2SO4
2Na + 3H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
2H2+O2=2H2O2H2 + O2 = 2H2O
2NO+O2=NO22NO + O2 = 2NO2
2N2(g)+ O2(g)+2H2O=4HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
2N2(g)+ O2(g)+2H2O=4HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
2N2(g)+ O2(g)+2H2O=4HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
2N2(g)+ O2(g)+2H2O=4HNO3(aq)2N2(g) + 5O2(g) + 2H2O = 4HNO3(aq)
2H2 + O2 = H2O2H2 + O2 = 2H2O
2SO2 + 2 O2 = 3 SO32SO2 + O2 = 2SO3
2Ba(NO3)2 + 2Na2SO4 = Ba2(SO4)2 + 4NaNO32Ba(NO3)2 + 2Na2SO4 = Ba2(SO4)2 + 4NaNO3
2HNO3+Sr(OH)2=2H2O+Sr(NO3)22HNO3 + Sr(OH)2 = 2H2O + Sr(NO3)2
2AgF +( (NH4)2)S = (Ag2)S + 2NH4F2AgF + ((NH4)2)S = (Ag2)S + 2NH4F
2NH3 + 7O2 = 2NO2 + 3H2O4NH3 + 7O2 = 4NO2 + 6H2O
2NaNO3+CaCl2=2NaCl+Ca(NO3)22NaNO3 + CaCl2 = 2NaCl + Ca(NO3)2
2Al+6HBr= 2AlBr3+3H22Al + 6HBr = 2AlBr3 + 3H2
2Al+6HBr=2AlBr3+3H22Al + 6HBr = 2AlBr3 + 3H2
2Al+6HBr=2AlBr3+3H22Al + 6HBr = 2AlBr3 + 3H2
2Fe+3O=Fe2O32Fe + 3O = Fe2O3
2H3O+2OH=2H2OH3O + OH = 2H2O
2 CO(g)+ O(g)= 2 CO(g)CO(g) + 0O(g) = CO(g)
2 CO(g)+ O= 2 CO(g)CO(g) + 0O = CO(g)
2Al + 3Br2 = 2AlBr32Al + 3Br2 = 2AlBr3
2NH4NO2=N2+4H2ONH4NO2 = N2 + 2H2O
2NaI + Cl2 = NaCl + I22NaI + Cl2 = 2NaCl + I2
2H2S + 3O2 = 2SO2 + 2H2O2H2S + 3O2 = 2SO2 + 2H2O
2Ca3(PO4)2 + 6SiO2 + 10C =CaSiO3 + P4 + CO2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
2 CO+ O2= 2CO22CO + O2 = 2CO2
2Na + 2H2O = 2NaOH + H22Na + 2H2O = 2NaOH + H2
2C2H6 +7O2 = 4CO2 +6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2H2+O2=H2O2H2 + O2 = 2H2O
2Mn + NiCl=Ni +2MnClMn + NiCl = Ni + MnCl
2HgO=2Hg+O22HgO = 2Hg + O2
2K(S)+MgBr(aq)=2KBr(aq)+Mg(S)K(S) + MgBr(aq) = KBr(aq) + Mg(S)
2K(S)+MgBr(aq)=2KBr(aq)+Mg(S)K(S) + MgBr(aq) = KBr(aq) + Mg(S)
2K(S)+MgBr(aq)=2KBr(aq)+Mg(S)K(S) + MgBr(aq) = KBr(aq) + Mg(S)
2K(S)+MgBr(aq)=2KBr(aq)+Mg(S)K(S) + MgBr(aq) = KBr(aq) + Mg(S)
2K(S)+MgBr(aq)=2KBr(aq)+Mg(S)K(S) + MgBr(aq) = KBr(aq) + Mg(S)
2K(S)+MgBr(aq)=2KBr(aq)+Mg(S)K(S) + MgBr(aq) = KBr(aq) + Mg(S)
2Au(NO3)3(aq) + 2NaI(aq) = 2Au(s) + I2(s) + 2Na(NO3)3(aq)2Au(NO3)3(aq) + 2NaI(aq) = 2Au(s) + I2(s) + 2Na(NO3)3(aq)
2 Au(NO3)3(aq) + 2 NaI(aq) = 2 Au(s) + I2(s) + 2 Na(NO3)3(aq)2Au(NO3)3(aq) + 2NaI(aq) = 2Au(s) + I2(s) + 2Na(NO3)3(aq)
2NaCl + Pb(NO3)2=PbCl2 + 2NaNO32NaCl + Pb(NO3)2 = PbCl2 + 2NaNO3
2P+O2=P2O54P + 5O2 = 2P2O5
2KMnO4+16HCl=2MnCl2+2KCl+4Cl2+8H2O2KMnO4 + 16HCl = 2MnCl2 + 2KCl + 5Cl2 + 8H2O
2H2O2=O2+H2O2H2O2 = O2 + 2H2O
2HC2H3O2(aq) + Zn(s) = ZnC2H3O2(aq) + H2(g)2HC2H3O2(aq) + 2Zn(s) = 2ZnC2H3O2(aq) + H2(g)
2HClO4(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaClO4(aq)2HClO4(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaClO4(aq)
2HClO4(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaClO4(aq)2HClO4(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaClO4(aq)
2NH3 + 5O2 = 3H2O + 2NO4NH3 + 5O2 = 6H2O + 4NO
2Al + 3H2SO4 = Al2(SO4)3 + 3H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
2Fe(NO3)3+3CaSO4= 3Ca(NO3)2+Fe2(SO4)32Fe(NO3)3 + 3CaSO4 = 3Ca(NO3)2 + Fe2(SO4)3
2Fe(OH)3+3(NH4)2S=FeS +S+NH3+H2O2Fe(OH)3 + 3(NH4)2S = 2FeS + S + 6NH3 + 6H2O
2KNO3 + NiCl2 = 2KCl + Ni(NO3)22KNO3 + NiCl2 = 2KCl + Ni(NO3)2
2HCl+CaS=H2S+CaCl22HCl + CaS = H2S + CaCl2
2P+2O2=2P4O58P + 5O2 = 2P4O5
2 HF(aq) + Ca(NO3)2(aq) = CaF2(s) + 2 HNO3(aq)2HF(aq) + Ca(NO3)2(aq) = CaF2(s) + 2HNO3(aq)
2 KNO3 + 10 K = 5 K2O + N22KNO3 + 10K = 6K2O + N2
2 SO2 + O2=2 SO32SO2 + O2 = 2SO3
2 CO + O2= 2 CO22CO + O2 = 2CO2
2 CO + O2 = 2 CO22CO + O2 = 2CO2
2 KIO3(s) =2 KI(s) + 3 O2(g)2KIO3(s) = 2KI(s) + 3O2(g)
2KNO3(s)=2KNO2(s)+O2(g)2KNO3(s) = 2KNO2(s) + O2(g)
2NaOH + H2SO4 =Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
2NO2 + O2 + H2O = 2HNO34NO2 + O2 + 2H2O = 4HNO3
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2Al2(SO4)3 + 3KOH = Al(OH)3 + 3KAl(SO4)22Al2(SO4)3 + 3KOH = Al(OH)3 + 3KAl(SO4)2
2H3O+ + Cu+ 2HNO3 = Cu2+ + 2NO2+ 4H2O H3O+ + 2Cu + HNO3 = Cu2+ + NO2 + 2H2O
2 NO(g)  +  Cl2(g) = NOCl(g) 2NO(g) + Cl2(g) = 2NOCl(g)
2 C + 2H2O=1 CH4+1CO22C + 2H2O = CH4 + CO2
2H2O=H2+O22H2O = 2H2 + O2
2VO+3FeO3=6FeO+V2O54VO + 3FeO3 = 3FeO + 2V2O5
2NO2 + O2 + H2O = 2HNO34NO2 + O2 + 2H2O = 4HNO3
2Na2CO3(s) = Na2O (s) + 2CO2Na2CO3(s) = Na2O(s) + CO2
2H2S + O2 = H2O + 2SO22H2S + 3O2 = 2H2O + 2SO2
2VCl3 + Mg = V + 3MgCl22VCl3 + 3Mg = 2V + 3MgCl2
2C2H4F2 + O2 = 4CO2 + H2O + HF2C2H4F2 + 5O2 = 4CO2 + 2H2O + 4HF
2NaCl(aq) + Hg(NO3)2(aq) = 2NaNO3(aq) + HgCl2(s)2NaCl(aq) + Hg(NO3)2(aq) = 2NaNO3(aq) + HgCl2(s)
2Mg +O2 = 2MgO2Mg + O2 = 2MgO
2Zn(OH)2+HNO3=2Zn(NO3)2+H2OZn(OH)2 + 2HNO3 = Zn(NO3)2 + 2H2O
2H2S+O2=2H2O+2S2H2S + O2 = 2H2O + 2S
2H2S+O2=2H2O+2S2H2S + O2 = 2H2O + 2S
2FeCl2+Cl2=2FeCl32FeCl2 + Cl2 = 2FeCl3
2HC1+NaOH=NaC1+H2OHC1 + NaOH = NaC1 + H2O
2HC1+NaOH=NaC1+H2OHC1 + NaOH = NaC1 + H2O
2HC1+NaOH=NaC1+H2OHC1 + NaOH = NaC1 + H2O
2HC1+NaOH=NaC1+H2OHC1 + NaOH = NaC1 + H2O
2H+S2=H2S4H + S2 = 2H2S
2Fe2O3(s)+3C(s)=4Fe(s)+3CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
2Fe+3Cl2=2FeCl32Fe + 3Cl2 = 2FeCl3
2CH3OH + 3O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2AgI+Na2S = 2Ag2S+2NaI2AgI + Na2S = Ag2S + 2NaI
2AgI+Na2S = 2Ag2S+2NaI2AgI + Na2S = Ag2S + 2NaI
2NaNO3(aq)+Pb(C2H3O2)2(aq)=2NaC2H3O2(aq)+Pb(NO3)2(s)2NaNO3(aq) + Pb(C2H3O2)2(aq) = 2NaC2H3O2(aq) + Pb(NO3)2(s)
2HClO4(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaClO4(aq)2HClO4(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaClO4(aq)
2 N 2 H 4 (g)+ N 2 O 4 (g)=3 N 2 (g)+4 H 2 O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2AlCl3(s) + Ca3N2(s) = 2AlN(s) + 3CaCl2(s)2AlCl3(s) + Ca3N2(s) = 2AlN(s) + 3CaCl2(s)
2S + 3O2 = 2SO2S + O2 = 2SO
2NH4OH + CoCl2 = Co(OH)2 + 2NH4Cl2NH4OH + CoCl2 = Co(OH)2 + 2NH4Cl
2Li2O+H2O=LiOHLi2O + H2O = 2LiOH
2 CH4(g) + O2(g) =2 CH3OH(g) 2CH4(g) + O2(g) = 2CH3OH(g)
2 K3PO4 + 3 FeBr2 = 6 KBr + Fe3(PO4)22K3PO4 + 3FeBr2 = 6KBr + Fe3(PO4)2
2Mg(OH)2(s) +4HCl(aq)=2MgCl2(aq)+4H2O(l)Mg(OH)2(s) + 2HCl(aq) = MgCl2(aq) + 2H2O(l)
2Fe(OH)3+3H2SO4 = Fe2(SO4)3 + 6H2O2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
2H + O2 = H2O4H + O2 = 2H2O
2C4H10+9O2=8CO2+10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2  C 2 H 6 (g)+5  O 2 (g) =2 C O 2 (g)+6  H 2 O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2Fe+3PbO=3Pb+2FeOFe + PbO = Pb + FeO
2Fe+3PbO=Pb+FeOFe + PbO = Pb + FeO
2AlCl3 + 3H2SO4=Al2(SO4)3+ 6HCl2AlCl3 + 3H2SO4 = Al2(SO4)3 + 6HCl
2AlCl3 + 3H2SO4=Al2(SO4)3+ 6HCl2AlCl3 + 3H2SO4 = Al2(SO4)3 + 6HCl
2 HCl(aq) + Ca(s) = CaCl2(aq) + H2(g)2HCl(aq) + Ca(s) = CaCl2(aq) + H2(g)
2Ca+ O2=2CaO2Ca + O2 = 2CaO
2Ca+ O2=2CaO2Ca + O2 = 2CaO
2KI + 4HNO3 = I2 + 2NO2 + 2KNO3 + 2H2O2KI + 4HNO3 = I2 + 2NO2 + 2KNO3 + 2H2O
2KI + 4HNO3= I2 + 2NO2 + 2KNO3 + 2H2O2KI + 4HNO3 = I2 + 2NO2 + 2KNO3 + 2H2O
2KIO3 + 12HCl = I2 + 5Cl2 + 2KCl + 6H2O2KIO3 + 12HCl = I2 + 5Cl2 + 2KCl + 6H2O
2Cu+S=Cu2S2Cu + S = Cu2S
2 C8H18 + 25 O2 = 16 CO2 +18 H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2Na + 2H2O=2NaOH + H22Na + 2H2O = 2NaOH + H2
2C4H8 + 8O2 = 4CO2 + 8H2OC4H8 + 6O2 = 4CO2 + 4H2O
2HgO(s)=2Hg(l)+O2(g)2HgO(s) = 2Hg(l) + O2(g)
2HgO(s)=2Hg(l)+O2(g)2HgO(s) = 2Hg(l) + O2(g)
2 C3H8+10O2=6CO2+8H2OC3H8 + 5O2 = 3CO2 + 4H2O
2C3H6(g)+9O2(g)=6CO2+6H2O2C3H6(g) + 9O2(g) = 6CO2 + 6H2O
2HPO3+3Ca=Ca3P2+H2O+3O24HPO3 + 6Ca = 2Ca3P2 + 2H2O + 5O2
2Zn(OH)2+HNO3=2Zn(NO3)2+H2OZn(OH)2 + 2HNO3 = Zn(NO3)2 + 2H2O
2H2S+O2=2H2O+2S2H2S + O2 = 2H2O + 2S
2FeCl2+Cl2=2FeCl32FeCl2 + Cl2 = 2FeCl3
2Fe + 2H2O = Fe3O4 + 4H23Fe + 4H2O = Fe3O4 + 4H2
2AgNO3+ZnBr2=Zn+2(NO3)+2AgBr2AgNO3 + ZnBr2 = Zn + 2(NO3) + 2AgBr
2AgNO3+ZnBr2=Zn+2(NO3)+2AgBr2AgNO3 + ZnBr2 = Zn + 2(NO3) + 2AgBr
2 NH4Fe(SO4)2 + 6 KSCN = 2 Fe(SCN)3 + 3 K2SO4 + (NH4)2SO42NH4Fe(SO4)2 + 6KSCN = 2Fe(SCN)3 + 3K2SO4 + (NH4)2SO4
2C4H10 + 12O2 = 6CO2 + 8H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2FeCl3(aq)+3(NH4)2 S(aq)=Fe2S3+6NH4Cl(aq)2FeCl3(aq) + 3(NH4)2S(aq) = Fe2S3 + 6NH4Cl(aq)
2FeCl3(aq)+3(NH4)2S(aq)=Fe2S3+6NH4Cl(aq)2FeCl3(aq) + 3(NH4)2S(aq) = Fe2S3 + 6NH4Cl(aq)
2 P4 (s) + 10 O2 (g)=2 P4O10 (s)P4(s) + 5O2(g) = P4O10(s)
2H2S + SO2 = 3S + 2H2O2H2S + SO2 = 3S + 2H2O
2H2O = 2H2 + O22H2O = 2H2 + O2
2MgO+2H2O=2Mg(OH)2MgO + H2O = Mg(OH)2
2C3H6 + O2 = 2C3H6O2C3H6 + O2 = 2C3H6O
2AlCl3(aq)+3Pb(NO3)2(aq)=3PbCl2+2Al(NO3)32AlCl3(aq) + 3Pb(NO3)2(aq) = 3PbCl2 + 2Al(NO3)3
2H + 3 OH = 3H2OH + OH = H2O
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2HCl + 2KMnO4 =Cl2 + MnO2 + 2H2O + 2KCl8HCl + 2KMnO4 = 3Cl2 + 2MnO2 + 4H2O + 2KCl
2HCl + 2KMnO4 =Cl2 + MnO2 + 2H2O + 2KCl8HCl + 2KMnO4 = 3Cl2 + 2MnO2 + 4H2O + 2KCl
2 C8H18(l) + 25 O2(g) =CO2(g) + 18 H2O(g)2C8H18(l) + 25O2(g) = 16CO2(g) + 18H2O(g)
2H2O2=2H2O+1O22H2O2 = 2H2O + O2
2Cu2O+1C=3Cu+1CO22Cu2O + C = 4Cu + CO2
2Ca+1O2=2CaO2Ca + O2 = 2CaO
2Ba + O2=2BaO2Ba + O2 = 2BaO
2H2+ 2C + 3O2 = 2H2CO32H2 + 2C + 3O2 = 2H2CO3
2Al(s) + 3H2SO4(aq) = Al2(SO4)3(s) + 3H2(g)2Al(s) + 3H2SO4(aq) = Al2(SO4)3(s) + 3H2(g)
2HNO3 = N2O5 + H2O2HNO3 = N2O5 + H2O
2HNO3 = N2O5 + H2O2HNO3 = N2O5 + H2O
2NaOH = Na2O + H2O2NaOH = Na2O + H2O
2Ca(OH)2 = 2CaO + 2H2OCa(OH)2 = CaO + H2O
2C2H6 + 7O2 = 4CO2 + 6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2CuSO4 + Na2CrO4 = Cu2CrO4 + 2NaSO42CuSO4 + Na2CrO4 = Cu2CrO4 + 2NaSO4
2K+2H2O=2KOH+H22K + 2H2O = 2KOH + H2
2K+2H2O=2KOH+H22K + 2H2O = 2KOH + H2
2Al(s)+2H3PO4(aq)=2AlPO4(s)+3H22Al(s) + 2H3PO4(aq) = 2AlPO4(s) + 3H2
2CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
2CH4+O2=CO2+H2OCH4 + 2O2 = CO2 + 2H2O
2CuSO4+CoCl2=2CuCl+Co(SO4)22CuSO4 + CoCl2 = 2CuCl + Co(SO4)2
2C4H10S2 + O2 = CO2 + H2O + 4SO32C4H10S2 + 19O2 = 8CO2 + 10H2O + 4SO3
2N2O = N2 + O22N2O = 2N2 + O2
2Fe2O3 + C = 4Fe + CO22Fe2O3 + 3C = 4Fe + 3CO2
2C6H6OS + O2 = 12CO + H2O + SO32C6H6OS + 11O2 = 12CO + 6H2O + 2SO3
2Fe(s)+3S(s)=Fe2S3(s)2Fe(s) + 3S(s) = Fe2S3(s)
2C4H10+13O2=8CO2+10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2C4H10+12O2=8CO2+10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2Cl + 2NaBr = 2Br + 2NaClCl + NaBr = Br + NaCl
2AlCl3+3Pb(NO3)2 = 3PbCl2 + 2Al(NO3)32AlCl3 + 3Pb(NO3)2 = 3PbCl2 + 2Al(NO3)3
2 Al(s) + 6 H2SO4(aq) = Al2(SO4)3(aq) + 3 SO2(aq) + 6 H2O(l) 2Al(s) + 6H2SO4(aq) = Al2(SO4)3(aq) + 3SO2(aq) + 6H2O(l)
2 Al(s) + 6 H2SO4(aq) = Al2(SO4)3(aq) + 3 SO2(aq) + 6 H2O(l) 2Al(s) + 6H2SO4(aq) = Al2(SO4)3(aq) + 3SO2(aq) + 6H2O(l)
2H2 + O2 = H2O2H2 + O2 = 2H2O
2H + O2 = H2O4H + O2 = 2H2O
2H + O2 = H2O4H + O2 = 2H2O
2H + O2 = H2O4H + O2 = 2H2O
2 Ag(s) + 2 H2SO4(aq) = Ag2SO4(aq) + SO2(aq) + 2 H2O(l) 2Ag(s) + 2H2SO4(aq) = Ag2SO4(aq) + SO2(aq) + 2H2O(l)
2 NaN3 (s)=2 Na (s) + 3 N2 (g)2NaN3(s) = 2Na(s) + 3N2(g)
2 AlCl3 (aq) + 3 Cu (s) = 2 Al (s) + 3 CuCl2 (aq)2AlCl3(aq) + 3Cu(s) = 2Al(s) + 3CuCl2(aq)
2HBr(aq) +Ba(OH)2(aq)= 2H2O(l) +BaBr2(aq)2HBr(aq) + Ba(OH)2(aq) = 2H2O(l) + BaBr2(aq)
2 AlCl3 + 3 Na2So4 = Al2(So4)3 + 6 NaCl2AlCl3 + 3Na2So4 = Al2(So4)3 + 6NaCl
2Ni(NO3)2(aq)+4NaOH(aq)=2Ni(OH)2(s)+H2O(l)+4NaNO3(aq)Ni(NO3)2(aq) + 2NaOH(aq) = Ni(OH)2(s) + 0H2O(l) + 2NaNO3(aq)
2 BaCl2 + 2 H2SO4 = 2 BaSO4 + 4 HClBaCl2 + H2SO4 = BaSO4 + 2HCl
2C4H10 + 12O2 = 6CO2 + 8H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2C4H10 + 12O2 = 6CO2 + 8H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2AlBr3 + 3Cl2(l)= Br2 + AlCl32AlBr3 + 3Cl2(l) = 3Br2 + 2AlCl3
2AlBr3 + 3Cl2= Br2 + AlCl32AlBr3 + 3Cl2 = 3Br2 + 2AlCl3
2H(NO3)+Ba(OH)2=2H(OH)+Ba(NO3)22H(NO3) + Ba(OH)2 = 2H(OH) + Ba(NO3)2
2 SrCl2 + 2 H2SO4 = 2 SrSO4 + 4 HClSrCl2 + H2SO4 = SrSO4 + 2HCl
2SrBr2 + 2H2SO4 = 2SrSO4 + 4HBrSrBr2 + H2SO4 = SrSO4 + 2HBr
2Cr(s)+3 O 2 (g)=C r 2 O 3 (s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Cr(s)+3 O 2 (g)= Cr 2 O 3 (s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2HCl O 4 (aq)+ N a 2 CO 3 (aq)= H 2 O(l)+ CO 2 (g)+2 NaClO 4 (aq) 2HClO4(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaClO4(aq)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.