Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:

Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
2Ca3(PO4)2 + 6SiO2 = P4O10 + CaSiO32Ca3(PO4)2 + 6SiO2 = P4O10 + 6CaSiO3
2 Ga + 3 S = Ga2S32Ga + 3S = Ga2S3
2PbS(s)+3O2(g) = 2Pb(s)+2SO2(g)PbS(s) + O2(g) = Pb(s) + SO2(g)
2PbS(s)+3O2(g) = 2Pb(s)+2SO2(g)PbS(s) + O2(g) = Pb(s) + SO2(g)
2 Na + 2 H2O = 2 NaOH + H22Na + 2H2O = 2NaOH + H2
2 KNO3 + 10 K = 5 K2O + N22KNO3 + 10K = 6K2O + N2
2 SO2 + O2 = 2 SO32SO2 + O2 = 2SO3
2 CO + O2 = 2 CO22CO + O2 = 2CO2
2Na + Ni(NO3)2 = Ni + 2NaNO32Na + Ni(NO3)2 = Ni + 2NaNO3
2C2H6(g)+7O2(g)= 4CO2(g)+ 6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2C2H6(g)+7O2(g)= 4CO2(g)+ 6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2HBr +2H2O = 2H3O + BrHBr + H2O = H3O + Br
2C5H11OH + 15O2 = 10CO + 12H2OC5H11OH + 5O2 = 5CO + 6H2O
2C5H11OH + 15O2 = 10CO + 12 H2OC5H11OH + 5O2 = 5CO + 6H2O
2C8H18 + 25O2 = 16CO +18H2O2C8H18 + 17O2 = 16CO + 18H2O
2Fe(s)+3CuCl2(aq)=2FeCl3(aq)+3Cu(s)2Fe(s) + 3CuCl2(aq) = 2FeCl3(aq) + 3Cu(s)
2FeC2O4*2H2O + H2C2O4+ 3K2C2O4+ H2O2=2K3Fe(C2O4)3*3H2O2FeC2O4*2H2O + H2C2O4 + 3K2C2O4 + H2O2 = 2K3Fe(C2O4)3*3H2O
2C2H2 + 5O2 = 4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2NaCl+MnO2 +2H2SO4 = Cl2+Mn2++2H2O+2Na++2SO42--70NaCl + 156MnO2 + 8H2SO4 = -35Cl2 + 78Mn2+ + 8H2O - 70Na+ + 8SO42-
2K3PO4(aq)+3MgCl2(aq)=Mg3(PO4)2(s)+6KCl(aq)2K3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6KCl(aq)
2Na3PO4(aq) + 3Mn(C2H3O2)(aq)= Na3(C2H3O2) + MnPO4Na3PO4(aq) + Mn(C2H3O2)(aq) = Na3(C2H3O2) + MnPO4
2 Na3PO4(aq) + 3 Mn(C2H3O2)(aq)= Na3(C2H3O2) + MnPO4Na3PO4(aq) + Mn(C2H3O2)(aq) = Na3(C2H3O2) + MnPO4
2AuCl3(aq)+3Ni(s) = 3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2AuCl3(aq)+3Ni(s) = 3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2 SnO2 + H2 = 2Sn + H2OSnO2 + 2H2 = Sn + 2H2O
2CO + O2= 2CO22CO + O2 = 2CO2
2C3H8O + O2= 6CO2 + 8H2O2C3H8O + 9O2 = 6CO2 + 8H2O
2HCl(aq)+Ba(OH)2(aq)=BaCl2(aq)+2H2O(l)2HCl(aq) + Ba(OH)2(aq) = BaCl2(aq) + 2H2O(l)
2H2(g)+O2(g)=2H2O(l)2H2(g) + O2(g) = 2H2O(l)
2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(l)2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(l)
2Xe + 2F2 = 2XeF2 Xe + F2 = XeF2
2K+O2=2KO 2K + O2 = 2KO
2Ca+F2=CaF2Ca + F2 = CaF2
2NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2HCl+CaCO3 = CaCl2+H2O+CO22HCl + CaCO3 = CaCl2 + H2O + CO2
2NaI(aq)+Br2(l)=2NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2 P4 + 12 H2 =8 PH3P4 + 6H2 = 4PH3
2Na+ Cl2 =2NaCl2Na + Cl2 = 2NaCl
2Na + 2H2O= 2NaOH + H2 2Na + 2H2O = 2NaOH + H2
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Na+MgF2=2NaF+Mg2Na + MgF2 = 2NaF + Mg
2K3PO4(aq)+3MgCl2(aq)=Mg3(PO4)2(s)+6KCl(aq)2K3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6KCl(aq)
2C6H6 + 15O2 = 12CO2 + 6H2O2C6H6 + 15O2 = 12CO2 + 6H2O
2K3PO4(aq)+3MgCl2(aq)=Mg3(PO4)2(s)+6KCl(aq)2K3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6KCl(aq)
2K3PO4(aq)+3MgCl2(aq)=Mg3(PO4)2(s)+6KCl(aq)2K3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6KCl(aq)
2NH4Cl(aq) + Ba(OH)2(aq) = 2H2O(l) + BaCl2(aq) + 2NH3(aq) 2NH4Cl(aq) + Ba(OH)2(aq) = 2H2O(l) + BaCl2(aq) + 2NH3(aq)
2Al+6HNO3=2Al(NO3)3+3H22Al + 6HNO3 = 2Al(NO3)3 + 3H2
2Al+6HNO3=2Al(NO3)3=3H22Al + 6HNO3 = 2Al(NO3)3 + 3H2
2AuCl3(aq)+3Sn(s) = 3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2NaOH + MgCl2=Mg(OH)2(s) + 2NaCl2NaOH + MgCl2 = Mg(OH)2(s) + 2NaCl
2AuCl3 + 3Sn= 3SnCl2 + 2Au2AuCl3 + 3Sn = 3SnCl2 + 2Au
2SO4 + O2 + 2H2O = H2SO42SO4 - O2 + 2H2O = 2H2SO4
2NaHCO3 = Na2CO3 +CO2+ H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2NaHCO3 =Na2CO3 +CO2+ H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2Cr +6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2Cr +6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2Cr +6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2 C3H6O + 2 O2 = 3 C02 + 6 H2O2C3H6O + 2O2 = 3C02 + 6H2O
2K+ Cl2 = 2KCl2K + Cl2 = 2KCl
2NaOH + MgCl2 = Mg(OH)2(s) + 2NaCl2NaOH + MgCl2 = Mg(OH)2(s) + 2NaCl
2KNO3+C12H22O11=N2+CO2+H2O+K2CO348KNO3 + 5C12H22O11 = 24N2 + 36CO2 + 55H2O + 24K2CO3
2KNO3+C12H22O11=N2+CO2+H2O+K2CO348KNO3 + 5C12H22O11 = 24N2 + 36CO2 + 55H2O + 24K2CO3
2 LiCLO3(s) = 2 LiCL(s) + 3 O2(g)2LiCLO3(s) = 2LiCL(s) + 3O2(g)
2 LiCLO3(s) = 2 LiCL(s) + 3 O2(g)2LiCLO3(s) = 2LiCL(s) + 3O2(g)
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2Fe + 3H2SO4 = 3H2 + Fe2(SO4)32Fe + 3H2SO4 = 3H2 + Fe2(SO4)3
2NaHCO3=Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2N+2O=4O2NN + 2O = O2N
2HI + K2SO4 = H2SO4 + 2KI2HI + K2SO4 = H2SO4 + 2KI
2C6H6+15H2O=12CO2+6H2O0C6H6 + H2O = 0CO2 + H2O
2C6H6+15H2O=12CO2+6H2O0C6H6 + H2O = 0CO2 + H2O
2C6H6+15H2O=12CO2+6H2O0C6H6 + H2O = 0CO2 + H2O
2FeI3(aq) + 3Na2CO3(aq) = Fe2(CO3)3(s) + 6NaI(aq)2FeI3(aq) + 3Na2CO3(aq) = Fe2(CO3)3(s) + 6NaI(aq)
2FeI3(aq) + 3Na2CO3(aq)= Fe2(CO3)3(s) + 6NaI(aq)2FeI3(aq) + 3Na2CO3(aq) = Fe2(CO3)3(s) + 6NaI(aq)
2CO(g) + O2(g)=2CO2(g) 2CO(g) + O2(g) = 2CO2(g)
2CO(g) + 2O2(g)=2CO2(g)2CO(g) + O2(g) = 2CO2(g)
2K3(PO4)+Na2CO3= 6K+CO3+2Na(PO4)2K3(PO4) + Na2CO3 = 6K + CO3 + 2Na(PO4)
2Na+HNO3=NaNO3+H22Na + 2HNO3 = 2NaNO3 + H2
2Mg(s)+O2(g) = 2MgO(s)2Mg(s) + O2(g) = 2MgO(s)
2AgNO 3 (aq)+Sn(s)=Sn(NO 3 ) 2 (aq)+2Ag(s) 2AgNO3(aq) + Sn(s) = Sn(NO3)2(aq) + 2Ag(s)
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2SO2(g)+O2(g)=2SO3(g)2SO2(g) + O2(g) = 2SO3(g)
2Fe + O2 (g) + 2H2O = 2Fe(OH)2 (s) 2Fe + O2(g) + 2H2O = 2Fe(OH)2(s)
2AgNO3+CuI2=2AgI+Cu(NO3)22AgNO3 + CuI2 = 2AgI + Cu(NO3)2
2AgNO3+CuI2=2AgI+Cu(NO3)22AgNO3 + CuI2 = 2AgI + Cu(NO3)2
2AgNO3+CuI2=2AgI+Cu(NO3)22AgNO3 + CuI2 = 2AgI + Cu(NO3)2
2Ag+SO3=Ag2SO32Ag + SO3 = Ag2SO3
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Cr+6HCl= 2CrCl3+3H22Cr + 6HCl = 2CrCl3 + 3H2
2C2H6(g) + O2(g)= 4CO2(g) + 6H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
2 Fe + 6 HCl = 2 FeCl3 + 3 H2 2Fe + 6HCl = 2FeCl3 + 3H2
2NaBr(s)+Cl2(g)=2NaCl+Br22NaBr(s) + Cl2(g) = 2NaCl + Br2
2 SO2 + O2 + 2 H2O = 2 H2SO42SO2 + O2 + 2H2O = 2H2SO4
2Al(OH)3(s)+ 3H2SO4(aq)= 6H2O(l)+ Al2(SO4)3(aq)2Al(OH)3(s) + 3H2SO4(aq) = 6H2O(l) + Al2(SO4)3(aq)
2HNO3+8H+8e=N2O+5H20HNO3 + 2H + 0e = 0N2O + H2
2Bi(OH)3 + 2K2SnO2 = 3Bi + K2SnO3 + H2O2Bi(OH)3 + 3K2SnO2 = 2Bi + 3K2SnO3 + 3H2O
2NaI+Br2=2NaBr+I2NaI + Br2 = 2NaBr + 2I
2AuCl2+3Ni=3NiCl2+2AuAuCl2 + Ni = NiCl2 + Au
2H2 +Br2 = HBrH2 + Br2 = 2HBr
2HI=H2+I22HI = H2 + I2
2BaO +2H2O = Ba(OH)2BaO + H2O = Ba(OH)2
2Na+Cl=NaClNa + Cl = NaCl
2Ag2O=Ag+O22Ag2O = 4Ag + O2
2C6H12O6=2O2+2H2O+2CO2C6H12O6 = -6O2 + 6H2O + 6CO2
2Na+S=2NaSNa + S = NaS
2 MnCl 2 + O 2(g) + 4 OH - + 4 I - -= 2 MnO(OH) 2(s) + 4 I - + 2 Cl2MnCl2 + O2(g) + 4OH- - 4I-- = 2MnO(OH)2(s) - 4I- + 4Cl
2HBr(aq)+Ba(OH)2(aq)=2H2O(l)+BaBr2(aq)2HBr(aq) + Ba(OH)2(aq) = 2H2O(l) + BaBr2(aq)
2HBr(aq)+Ba(OH)2(aq)=2H2O(l)+BaBr2(aq)2HBr(aq) + Ba(OH)2(aq) = 2H2O(l) + BaBr2(aq)
2Na3(PO4) +3BaS = Ba3(PO4)2 +3Na2S2Na3(PO4) + 3BaS = Ba3(PO4)2 + 3Na2S
2 AgNO3(aq) + MnBr2(aq) = 2 AgBr(s) + Mn(NO3)2(aq)2AgNO3(aq) + MnBr2(aq) = 2AgBr(s) + Mn(NO3)2(aq)
2Ag(NO3)+NH4(CO3)=Ag(CO3)+3NH4(NO3)Ag(NO3) + NH4(CO3) = Ag(CO3) + NH4(NO3)
2Al + NaOH + H2O = NaAl(OH)4 + 3H22Al + 2NaOH + 6H2O = 2NaAl(OH)4 + 3H2
2LiNO3+Na2S=Li2S+2NaNO32LiNO3 + Na2S = Li2S + 2NaNO3
2LiNO3+Na2S=Li2S+2NaNO32LiNO3 + Na2S = Li2S + 2NaNO3
2AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO32AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO3
2AgNO3 + (NH4)2CO3 = Ag2CO3 + 2(NH4)NO32AgNO3 + (NH4)2CO3 = Ag2CO3 + 2(NH4)NO3
2K3PO4(aq)+3MgCl2(aq)=Mg3(PO4)2(s)+6KCl(aq)2K3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6KCl(aq)
2 HNO3 + (NH4)2CO3 = 2NH4NO3 + H2CO32HNO3 + (NH4)2CO3 = 2NH4NO3 + H2CO3
2CH3OH + O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2HNO3 + Na2SO4 = 2NaNO3 + H2SO42HNO3 + Na2SO4 = 2NaNO3 + H2SO4
2HNO3 + (NH4)2CO3 = 2NH4NO3 + H2CO32HNO3 + (NH4)2CO3 = 2NH4NO3 + H2CO3
2Fe(NO3)3 + 3Na2SO4 = Fe2(SO4)3 + 6 NaNO32Fe(NO3)3 + 3Na2SO4 = Fe2(SO4)3 + 6NaNO3
2 Zn + Pb2O3 = Zn2O3 + 2Pb2Zn + Pb2O3 = Zn2O3 + 2Pb
2C6H14+19O2=12C02+14 H2O2C6H14 + 7O2 = 6C02 + 14H2O
2 C6H14 + 19 O2=12 C02 +14 H2O2C6H14 + 7O2 = 6C02 + 14H2O
2FeO3 + 3C = 4Fe + 3CO22FeO3 + 3C = 2Fe + 3CO2
2FeO3 + 3C = 4Fe + 3CO22FeO3 + 3C = 2Fe + 3CO2
2HgO = 2Hg+O22HgO = 2Hg + O2
2C4H10(g)+13O2(g)=9CO2(g)+10H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2C4H10(g)+13O2(g)=8CO2(g)+10H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2NaCl+K2SO4=KCl+Na2SO42NaCl + K2SO4 = 2KCl + Na2SO4
2HCl(aq) + Mg(OH)2 = MgCl2(aq) + 2H2O(l)2HCl(aq) + Mg(OH)2 = MgCl2(aq) + 2H2O(l)
2HCl(aq) + Mg(OH)2 = MgCl2(aq) + 2H2O(l)2HCl(aq) + Mg(OH)2 = MgCl2(aq) + 2H2O(l)
2Ag+S=Ag2S2Ag + S = Ag2S
2Cl+Na=NaClCl + Na = NaCl
2Zn+O2=ZnO2Zn + O2 = 2ZnO
2Na+Cl2=NaCl2Na + Cl2 = 2NaCl
2B(OH)3(s) = B2O3(s) + 3H2O(g)2B(OH)3(s) = B2O3(s) + 3H2O(g)
2 KOH (aq) + SrCl2 (aq) = Sr(OH)2 (s) + 2 KCl (aq)2KOH(aq) + SrCl2(aq) = Sr(OH)2(s) + 2KCl(aq)
2 FeBr3 + 3 K2S = Fe2S3 + 6 KBr2FeBr3 + 3K2S = Fe2S3 + 6KBr
2Cr (s) + 6HCl (aq) = 2CrCl3 (aq) + 3H2 (g)2Cr(s) + 6HCl(aq) = 2CrCl3(aq) + 3H2(g)
2Ag+H2S=Ag2S+H22Ag + H2S = Ag2S + H2
2H3PO4(aq) + 3Ba(OH)2(aq) = Ba3(PO4)2(s) + 6H2O(l)2H3PO4(aq) + 3Ba(OH)2(aq) = Ba3(PO4)2(s) + 6H2O(l)
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2Al(OH)3+H2CO3 =Al2(CO3)3+ H2O 2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O
2Sr + O2 = 2SrO2Sr + O2 = 2SrO
2AgNO3 (aq) + CuBr2 (aq) = 2AgBr (s) + Cu(NO3)2 (aq)2AgNO3(aq) + CuBr2(aq) = 2AgBr(s) + Cu(NO3)2(aq)
2 HCl + Cu(OH)2 = CuCl2 + 2 H2O2HCl + Cu(OH)2 = CuCl2 + 2H2O
2NH3 (g) + Mg (s)= 3H2 (g) + Mg3N2 (s) 2NH3(g) + 3Mg(s) = 3H2(g) + Mg3N2(s)
2NH3 (g) + Mg (s)= 3H2 (g) + Mg3N2 (s) 2NH3(g) + 3Mg(s) = 3H2(g) + Mg3N2(s)
2NH3 (g) + Mg (s)= 3H2 (g) + Mg3N2 (s) 2NH3(g) + 3Mg(s) = 3H2(g) + Mg3N2(s)
2NH3 (g) + Mg (s)= 3H2 (g) + Mg3N2 (s) 2NH3(g) + 3Mg(s) = 3H2(g) + Mg3N2(s)
2NH4NO3 = 2N2 + 4H2O = O22NH4NO3 = 2N2 + 4H2O + O2
2NH4NO3 = 2N2 + 4H2O = O22NH4NO3 = 2N2 + 4H2O + O2
2 IO3- + 5 HSO3 = I2 + 5 SO42- + H2O + 3 H+-78IO3- - 5HSO3 = -39I2 - 5SO42- - 39H2O + 73H+
2Fe(OH)2 + Si+ 2OH- = 2Fe + SiO32-+ 3H2O63Fe(OH)2 + 2Si + 2OH- = 63Fe + 2SiO32- + 64H2O
2Fe+4H2O=Fe3O4+H23Fe + 4H2O = Fe3O4 + 4H2
2 Li2S + Sn(ClO4)4 = SnS2 + 4 LiClO4 2Li2S + Sn(ClO4)4 = SnS2 + 4LiClO4
2 Na2SO4 + 3 Bi(NO3)3 = Bi2(SO4)3 + 9 NaNO33Na2SO4 + 2Bi(NO3)3 = Bi2(SO4)3 + 6NaNO3
2KI+H2SO4=K2SO4+2HI2KI + H2SO4 = K2SO4 + 2HI
2KI+H2SO4=K2SO4+2HI2KI + H2SO4 = K2SO4 + 2HI
2Mg+O2=2MgO2Mg + O2 = MgO2
2Mg+O2=MgO2Mg + O2 = MgO2
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Fe2O3+3C=4Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
2Cr(s) + 3O2(g)= Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Cr(s) + 3O2(g)= Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Fe + Cl2 = 2FeCl32Fe + 3Cl2 = 2FeCl3
2HBrO3=2HBr+3O22HBrO3 = 2HBr + 3O2
2NH4NO3= 2N2+O2+4H2O2NH4NO3 = 2N2 + O2 + 4H2O
2NaOH(aq)+Zn(NO3)2(aq)=Zn(OH)2(s)+2NaNO3(aq)2NaOH(aq) + Zn(NO3)2(aq) = Zn(OH)2(s) + 2NaNO3(aq)
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2NaOCl+2KI+2H2O = I2+2NaCl+2KOHNaOCl + 2KI + H2O = I2 + NaCl + 2KOH
2H2O = 2H2 + O22H2O = 2H2 + O2
2HCl + Mg = MgCl2 + H22HCl + Mg = MgCl2 + H2
2HO = H2O22HO = H2O2
2KNO3+2H2O=K2+O2+2H2NO32KNO3 + 2H2O = K2 + O2 + 2H2NO3
2NH3 + NaOCl = N2H4 + NaCl + H2O2NH3 + NaOCl = N2H4 + NaCl + H2O
2NH3 + NaOCl = N2H4 + NaCl + H2O2NH3 + NaOCl = N2H4 + NaCl + H2O
2KHC4H4O6 + O2= CO2 + K2O + H2O2KHC4H4O6 + 5O2 = 8CO2 + K2O + 5H2O
2C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2C8H18 + O2 = CO2 + H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2C4H10 + O2 = CO2 + H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2HNO3 (aq)+ Sr(OH)2 = 2H2O (l) + Sr(NO3)22HNO3(aq) + Sr(OH)2 = 2H2O(l) + Sr(NO3)2
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2KMnO4+H2SO4=K2SO4+ Mn2O7+H2O2KMnO4 + H2SO4 = K2SO4 + Mn2O7 + H2O
2Cr + 6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2Cr + 6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2MgCl2 + 2Mg = 4MgClMgCl2 + Mg = 2MgCl
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2K3PO4+3MgCl2 = Mg3(PO4)2 +6KCl2K3PO4 + 3MgCl2 = Mg3(PO4)2 + 6KCl
2K3PO4+3MgCl2 = Mg3(PO4)2 +6KCl2K3PO4 + 3MgCl2 = Mg3(PO4)2 + 6KCl
2AgNO3 (aq) + MnI2 (aq) = 2 AgI (s) + Mn(NO3)2 (aq)2AgNO3(aq) + MnI2(aq) = 2AgI(s) + Mn(NO3)2(aq)
2AgNO3 (aq) + MnI2 (aq) = 2 AgI (s) + Mn(NO3)2 (aq)2AgNO3(aq) + MnI2(aq) = 2AgI(s) + Mn(NO3)2(aq)
2P4O6+H2O=H3PO3P4O6 + 6H2O = 4H3PO3
2Ni + H2SO4=NiSO4 + 2HNi + H2SO4 = NiSO4 + 2H
2HCl(aq)+Ba(OH)2(aq)= BaCl2(aq)+2H2O(l)2HCl(aq) + Ba(OH)2(aq) = BaCl2(aq) + 2H2O(l)
2AgNO3 (aq) + CuBr2 (aq)= 2AgBr (s) + Cu(NO3)2 (aq)2AgNO3(aq) + CuBr2(aq) = 2AgBr(s) + Cu(NO3)2(aq)
2 AgNO3 + K2CO3 = Ag2CO3 + 2 KNO32AgNO3 + K2CO3 = Ag2CO3 + 2KNO3
2C3H6+9O2=6CO2+6H2O2C3H6 + 9O2 = 6CO2 + 6H2O
2N(g)+2H2(g)=2NH3(g)2N(g) + 3H2(g) = 2NH3(g)
2C 2 H 2 (g)+5O 2 (g)=4CO 2 (g)+2H2O(g) 2C2H2(g) + 5O2(g) = 4CO2(g) + 2H2O(g)
2AgNO3+MgBr2=2AgBr+Mg(NO3)22AgNO3 + MgBr2 = 2AgBr + Mg(NO3)2
2KMnO4 + HCl = MnCl2 + Cl2 + 8H2O + KCl2KMnO4 + 16HCl = 2MnCl2 + 5Cl2 + 8H2O + 2KCl
2C2H6+7O2=4CO2+6H2O22C2H6 + 35O2 = 2CO2 + 3H2O22
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2AgCl+H2SO4+Zn=2Ag+2HCl+ZnSO42AgCl + H2SO4 + Zn = 2Ag + 2HCl + ZnSO4
2AgCL+H2SO4+Zn=2Ag+2HCL+ZnSO42AgCL + H2SO4 + Zn = 2Ag + 2HCL + ZnSO4
2LiBr=2Li+Br22LiBr = 2Li + Br2
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2H2S + O2 = H2O + SO22H2S + 3O2 = 2H2O + 2SO2
2 HgNO3(aq) + 2 NaCl(aq)= Hg2Cl2(s) + 2NaNO3(aq)2HgNO3(aq) + 2NaCl(aq) = Hg2Cl2(s) + 2NaNO3(aq)
2 HgO=2Hg+O22HgO = 2Hg + O2
2AuCl3+3Ni=3NiCl2+2Au2AuCl3 + 3Ni = 3NiCl2 + 2Au
2NH4OH+ZnF2=NH4F+Zn(OH)22NH4OH + ZnF2 = 2NH4F + Zn(OH)2
2PH3+O2=P2O5+H2O2PH3 + 4O2 = P2O5 + 3H2O
2MgSO4 + 2BaCl2 = MgCl2 + BaSO4MgSO4 + BaCl2 = MgCl2 + BaSO4
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2Al+O2=Al2O34Al + 3O2 = 2Al2O3
2Mg(s) + O2(g) = MgO(s)2Mg(s) + O2(g) = 2MgO(s)
2(C2H6)+7(O2)=4(CO2)+6(H2O)2(C2H6) + 7(O2) = 4(CO2) + 6(H2O)
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2FeCl3(aq)+SnCl2(aq)=2FeCl2(aq)+SnCl4(aq)2FeCl3(aq) + SnCl2(aq) = 2FeCl2(aq) + SnCl4(aq)
2AgNO3(aq)+Fe(s)=Fe(NO3)2(aq)+2Ag(s)2AgNO3(aq) + Fe(s) = Fe(NO3)2(aq) + 2Ag(s)
2FeC2O4*2H2O + H2C2O4+ 3K2C2O4+ H2O2 = 2K3(Fe(C2O4)3)*3H2O2FeC2O4*2H2O + H2C2O4 + 3K2C2O4 + H2O2 = 2K3(Fe(C2O4)3)*3H2O
2NaI(aq)+Br2(l)=2NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2 Mn(s) + Pb(C2H3O2)2(aq) = 2 MnC2H3O2 + Pb2Mn(s) + Pb(C2H3O2)2(aq) = 2MnC2H3O2 + Pb
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2Ag+HNO3=H+AgNO3Ag + HNO3 = H + AgNO3
2Hg(NO3)2 = 2HgO(s) + 4NO2(g) + O2(g)2Hg(NO3)2 = 2HgO(s) + 4NO2(g) + O2(g)
2FeCl3(aq) + 3(NH4)2CO3(aq)= Fe2(CO3)3(s) + 6NH4Cl(aq)2FeCl3(aq) + 3(NH4)2CO3(aq) = Fe2(CO3)3(s) + 6NH4Cl(aq)
2HNO3(aq)+K2CO3(aq)=2KNO3(aq)+H2O(l)+CO2(g)2HNO3(aq) + K2CO3(aq) = 2KNO3(aq) + H2O(l) + CO2(g)
2Ag+S=Ag2S2Ag + S = Ag2S
2(H2) + O2 = H2O2(H2) + O2 = 2H2O
2NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
2Al + 6HCl = H2 + 2AlCl32Al + 6HCl = 3H2 + 2AlCl3
2H2O2 = 2H2O + O22H2O2 = 2H2O + O2
2Al2O3 = 4Al + 3O22Al2O3 = 4Al + 3O2
2C + H2 = CH4C + 2H2 = CH4
2NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
2NaF + Br2 =2 NaBr + F22NaF + Br2 = 2NaBr + F2
2H2O2= 2H2O + O22H2O2 = 2H2O + O2
2Al2O3 = 4Al + 3O22Al2O3 = 4Al + 3O2
2C + H2= CH4C + 2H2 = CH4
2Al + 6HCl=3H2+2AlCl32Al + 6HCl = 3H2 + 2AlCl3
2Mg +2HCl = 2MgCl +H22Mg + 2HCl = 2MgCl + H2
2Mg +2HCl = 2MgCl +H22Mg + 2HCl = 2MgCl + H2
2K + 2HCl = 2KCl +H22K + 2HCl = 2KCl + H2
2Mg+2HCl=2MgCl+H22Mg + 2HCl = 2MgCl + H2
2K+2HCl=2KCl+H22K + 2HCl = 2KCl + H2
2Ca + 2HNO3 = Ca(NO3)2 + H2Ca + 2HNO3 = Ca(NO3)2 + H2
2Mg + 2HCl = 2MgCl + H22Mg + 2HCl = 2MgCl + H2
2K + 2HCL = 2KCL + H22K + 2HCL = 2KCL + H2
2NaOH + H2CO3 = Na2CO3 + 2H2O2NaOH + H2CO3 = Na2CO3 + 2H2O
2Ca + 2HNO3 = Ca(NO3)2 + H2Ca + 2HNO3 = Ca(NO3)2 + H2
2HCL + 2Mg = 2MgCL + H22HCL + 2Mg = 2MgCL + H2
2K + 2HCL = 2KCL + H33K + 3HCL = 3KCL + H3
2Na + S = Na2S2Na + S = Na2S
2MnO2+4HCl=Cl2+2MnCl2+2H2OMnO2 + 4HCl = Cl2 + MnCl2 + 2H2O
2MnO2+4HCl=Cl2+2MnCl+2H2O2MnO2 + 8HCl = 3Cl2 + 2MnCl + 4H2O
2MnO2+4HCl=Cl2+2MnCl+2H2O2MnO2 + 8HCl = 3Cl2 + 2MnCl + 4H2O
2Na3PO4 + 3NiCl2 = Ni3(PO4)2 + 6NaCl2Na3PO4 + 3NiCl2 = Ni3(PO4)2 + 6NaCl
2NH4- + OH- + Hg2 = Hg2++(NH3-) + H2ONH4- + OH- - Hg2 = -1Hg2+ + (NH3-) + H2O
2NH4- + OH- + Hg2 = Hg2++(NH3-)2 + H2O2NH4- + 2OH- - 2Hg2 = -2Hg2+ + (NH3-)2 + 2H2O
2Fe3O + CO = Fe + C2O-1Fe3O + 2CO = -3Fe + C2O
2PbCO3 + 2Cr = 2CrCO3 + 2PbPbCO3 + Cr = CrCO3 + Pb
2PbCO3 + 2Cr = 2CrCO3 + 2PbPbCO3 + Cr = CrCO3 + Pb
2NaOH + Pb(ClO3)2= 2NaClO3 + Pb(OH)22NaOH + Pb(ClO3)2 = 2NaClO3 + Pb(OH)2
2H2 + O3= 2H2O3H2 + O3 = 3H2O
2FeCl3(aq)+SnCl2(aq)=2FeCl2(aq)+SnCl4(aq)2FeCl3(aq) + SnCl2(aq) = 2FeCl2(aq) + SnCl4(aq)
2KOH(aq)+H2SO4(aq)=K2SO4(aq)+2H2O(l)2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l)
2CaO + 2SiO2 = 2CaSiO2 + O22CaO + 2SiO2 = 2CaSiO2 + O2
2FeCl3 + FeCl2 + 8NH3 + 4H2O=Fe3O4 + 8NH4Cl2FeCl3 + FeCl2 + 8NH3 + 4H2O = Fe3O4 + 8NH4Cl
2C2H6(g)+5O2(g)=2CO2(g)+6H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
2 Fe (s) + 6 HNO3 (aq) = 2 Fe(NO3)3 (aq) + 3 H2 (g) 2Fe(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) + 3H2(g)
2Cu(NO3)2+K2CO3=Cu2CO3+K2(NO3)42Cu(NO3)2 + K2CO3 = Cu2CO3 + K2(NO3)4
2HCl + Li2CO3 = 2LiCl(aq) + CO2(g) + H2O2HCl + Li2CO3 = 2LiCl(aq) + CO2(g) + H2O
2AgNO3 + ZnCl2 = 2AgCl + Zn(NO3)22AgNO3 + ZnCl2 = 2AgCl + Zn(NO3)2
2 NaHSO3(aq) + H2SO4(aq) = Na2SO4(aq) + 2 SO2(g) + 2 H2O(l)2NaHSO3(aq) + H2SO4(aq) = Na2SO4(aq) + 2SO2(g) + 2H2O(l)
2 NaHSO3(aq) + H2SO4(aq) = Na2SO4(aq) + 2 SO2(g) + 2 H2O(l)2NaHSO3(aq) + H2SO4(aq) = Na2SO4(aq) + 2SO2(g) + 2H2O(l)
2 NaHSO3(aq) + H2SO4(aq) = Na2SO4(aq) + 2 SO2(g) + 2 H2O(l)2NaHSO3(aq) + H2SO4(aq) = Na2SO4(aq) + 2SO2(g) + 2H2O(l)
2AuCl3 (aq) + 3Sn (s) = 3SnCl2 (aq) +2Au2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au
2KOH(aq)+H2SO4(aq)=K2SO4(aq)+2H2O(l)2KOH(aq) + H2SO4(aq) = K2SO4(aq) + 2H2O(l)
2H2S + 3O2 =2SO2 + 2H2O2H2S + 3O2 = 2SO2 + 2H2O
2NaI(aq)+Br2(l)=2NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2NO + O2 = 2NO22NO + O2 = 2NO2
2AgNO3+ZnCl2= 2AgCl(s)+Zn(NO3)22AgNO3 + ZnCl2 = 2AgCl(s) + Zn(NO3)2
2AgNO3+ZnCl2= 2AgCl(s)+Zn(NO3)22AgNO3 + ZnCl2 = 2AgCl(s) + Zn(NO3)2
2HBr + Ca = CaBr2 + H22HBr + Ca = CaBr2 + H2
2HBr + Ca = CaBr2 + H22HBr + Ca = CaBr2 + H2
2NH3 + CO2 = CO (NH2) 2 + H2O2NH3 + CO2 = CO(NH2)2 + H2O
2AgNO3+ZnCl2=2AgCl(s)+Zn(NO3)22AgNO3 + ZnCl2 = 2AgCl(s) + Zn(NO3)2
2 Cr + 3O2 = Cr2O34Cr + 3O2 = 2Cr2O3
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2FeO =2Fe + O22FeO = 2Fe + O2
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2AgNO3+ZnCl2 =2AgCl(s)+Zn(NO3)22AgNO3 + ZnCl2 = 2AgCl(s) + Zn(NO3)2
2AgNO3+ZnCl2 =2AgCl(s)+Zn(NO3)22AgNO3 + ZnCl2 = 2AgCl(s) + Zn(NO3)2
2AgNO3+ZnCl2 =2AgCl(s)+Zn(NO3)22AgNO3 + ZnCl2 = 2AgCl(s) + Zn(NO3)2
2Al+3Br2=2AlBr32Al + 3Br2 = 2AlBr3
2HClO4(aq)+Ba(OH)2(s) = Ba(ClO4)2(s)+2H2O(l)2HClO4(aq) + Ba(OH)2(s) = Ba(ClO4)2(s) + 2H2O(l)
2Zn+20HNO=2Zn(NO3)2+8N2O+H202Zn + 20HNO = 2Zn(NO3)2 + 8N2O + H20
2AlI3(aq) + 3(NH4)2CO3(aq) = Al2(CO3)3(s) + 6NH4I(aq)2AlI3(aq) + 3(NH4)2CO3(aq) = Al2(CO3)3(s) + 6NH4I(aq)
2NH3 + 2NaHCO3 = (NH4)2CO3 + Na2CO32NH3 + 2NaHCO3 = (NH4)2CO3 + Na2CO3
2KI+Pb(NO3)2=2KNO3+PbI22KI + Pb(NO3)2 = 2KNO3 + PbI2
2C4H10(G) + 1302(G) = 8C02(G) + 10 H20(l)2C4H10(G) + 2(G) = 4C02(G) + H20(l)
2Cs + Br2 = 2CsBr2Cs + Br2 = 2CsBr
2KI(aq)+Pb(NO3)2(aq)=PbI2(s)+2KNO3(aq)2KI(aq) + Pb(NO3)2(aq) = PbI2(s) + 2KNO3(aq)
2HBr + K2SO4 = H2SO4 + 2KBr2HBr + K2SO4 = H2SO4 + 2KBr
2Ca+ 2 N2 = Ca2N4Ca + N2 = 2Ca2N
2(NH4)2Fe(SO4)2*6H2O+3H2C2O4+3K2C2O4+H2O2=2K3Fe(C2O4)3*3H2O+4NH4+4(SO4)2-+8H2O+4H0(NH4)2Fe(SO4)2*6H2O + 0H2C2O4 + 0K2C2O4 - H2O2 = 0K3Fe(C2O4)3*3H2O + 0NH4 + 0(SO4)2- - 2H2O + 2H
2Fe+O2=Fe2O34Fe + 3O2 = 2Fe2O3
2 NH4C2H3O2 + Na2S = (NH4)2S + 2 NaC2H3O2 2NH4C2H3O2 + Na2S = (NH4)2S + 2NaC2H3O2
2 K + ZnCl2 = Zn + KCl 2K + ZnCl2 = Zn + 2KCl
2 K + ZnCl2 = Zn + KCl 2K + ZnCl2 = Zn + 2KCl
2HCl+Ca(OH)2=CaCl2+2H2O2HCl + Ca(OH)2 = CaCl2 + 2H2O
2 Fe + 3 CuSO4 = 3 Cu + Fe2(SO4)3 2Fe + 3CuSO4 = 3Cu + Fe2(SO4)3
2 Fe + 3 H2SO4 = Fe2(SO4)3 + 3 H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
2HClO3(aq) + Sr(OH)2(aq)= Sr(ClO3)2(aq) + 2H2O2HClO3(aq) + Sr(OH)2(aq) = Sr(ClO3)2(aq) + 2H2O
2HClO3(aq) + Sr(OH)2(aq)= Sr(ClO3)2(aq) + 2H2O2HClO3(aq) + Sr(OH)2(aq) = Sr(ClO3)2(aq) + 2H2O
2HClO3(aq) + Sr(OH)2(aq)= Sr(ClO3)2(aq) + 2H2O2HClO3(aq) + Sr(OH)2(aq) = Sr(ClO3)2(aq) + 2H2O
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2Na3PO4+MgCl2=Mg3(PO4)2+6NaCl2Na3PO4 + 3MgCl2 = Mg3(PO4)2 + 6NaCl
2 C7H2 + 23 O2 = 14 CO2 + 18 H2O2C7H2 + 15O2 = 14CO2 + 2H2O
2 C7H + 23 O2 = 14 CO2 + 18 H2O4C7H + 29O2 = 28CO2 + 2H2O
2 C7H18 + 23 O2 = 14 CO2 + 18 H2O2C7H18 + 23O2 = 14CO2 + 18H2O
2FeO3=4FeO+O2FeO3 = FeO + O2
2CH3OH + 3O2 = 2CO2 + 4 H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2 KNO3 + 10 K = 5 K2O + N2 2KNO3 + 10K = 6K2O + N2
2 CO + O2 = 2 CO22CO + O2 = 2CO2
2 SO2 + O2 = 2 SO3 2SO2 + O2 = 2SO3
2KOH+H2SO4=K2SO4+2H2O2KOH + H2SO4 = K2SO4 + 2H2O
2 SO2 + O2=2 SO3 2SO2 + O2 = 2SO3
2 SO2 + O2 = 2 SO3 2SO2 + O2 = 2SO3
2 CO + O2 = 2 CO2 2CO + O2 = 2CO2
2 KNO3 + 10 K = 5 K2O + N2 2KNO3 + 10K = 6K2O + N2
2Al + Fe2O3 = 2Fe + Al2O32Al + Fe2O3 = 2Fe + Al2O3
2H++2OH-= 2H2OH+ + OH- = H2O
2HNO3 +Cu(OH)2 = 2H2O + Cu(NO3)22HNO3 + Cu(OH)2 = 2H2O + Cu(NO3)2
2SO2 + O2 = 2SO32SO2 + O2 = 2SO3
2 HBr (aq) + NiS (s) = NiBr2 (aq) + H2S (g) 2HBr(aq) + NiS(s) = NiBr2(aq) + H2S(g)
2Cr + 6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2Al2O3=4Al+3O22Al2O3 = 4Al + 3O2
2Ga(s)+3H2SO4(aq)=Ga2(SO4)3(aq)+3H2(g)2Ga(s) + 3H2SO4(aq) = Ga2(SO4)3(aq) + 3H2(g)
2C5H10O2 + 13O2 = 10CO2 + 10H2O2C5H10O2 + 13O2 = 10CO2 + 10H2O
2CO+4H2=2CH4OCO + 2H2 = CH4O
2 KOH + H2So4 = K2So4 + 2 H2O2KOH + H2So4 = K2So4 + 2H2O
2Mg+2CuCl2=2Mg Cl2+2CuMg + CuCl2 = MgCl2 + Cu
2Ca(s)+2C(s)+3O(g)=2CaCO3(s)Ca(s) + C(s) + 3O(g) = CaCO3(s)
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2Co(NO3)3(aq) + 3Li2O(aq) = Co2O3(s) + 6LiNO3(aq)2Co(NO3)3(aq) + 3Li2O(aq) = Co2O3(s) + 6LiNO3(aq)
2Co(NO3)3(aq) + 3Li2O(aq) = Co2O3(s) + LiNO3(aq)2Co(NO3)3(aq) + 3Li2O(aq) = Co2O3(s) + 6LiNO3(aq)
2KBr(aq)+Na2CO3(aq)=K2CO3 + 2NaBr 2KBr(aq) + Na2CO3(aq) = K2CO3 + 2NaBr
2KBr(aq)+Na2CO3(aq)=K2CO3 + 2NaBr 2KBr(aq) + Na2CO3(aq) = K2CO3 + 2NaBr
2 NH3(g) + CO2(g) = (NH2)2CO(s) + H2O(l) 2NH3(g) + CO2(g) = (NH2)2CO(s) + H2O(l)
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2AuCl3+3Ni=3NiCl2+2Au2AuCl3 + 3Ni = 3NiCl2 + 2Au
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2NaH+H2O=2NaOH+H2NaH + H2O = NaOH + H2
2Cr+3CO3=Cr2(CO3)32Cr + 3CO3 = Cr2(CO3)3
2 Al + 6 HCl=2 AlCl3 + 3 H22Al + 6HCl = 2AlCl3 + 3H2
2C3H7OH+9O2=6CO2+8H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
2H2O=2HO+2O-1H2O = -2HO + O
2HI+Ba(OH)2=2H2O+BaI22HI + Ba(OH)2 = 2H2O + BaI2
2Na (s) + Cl2 (g) = 2NaCl (s)2Na(s) + Cl2(g) = 2NaCl(s)
2Na + Cl2 = NaCl2Na + Cl2 = 2NaCl
2Ca(s)+O2(g)=2CaO(s)2Ca(s) + O2(g) = 2CaO(s)
2NH3(g)+Mg(s)=3H2(g)+Mg3N2(s)2NH3(g) + 3Mg(s) = 3H2(g) + Mg3N2(s)
2Ca5F(PO4)3+7H2SO4=3Ca(H2PO4)2+7CaSO4+2HF2Ca5F(PO4)3 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
2Ca5F(PO4)3+7H2SO4=3Ca(H2PO4)2+7CaSO4+2HF2Ca5F(PO4)3 + 7H2SO4 = 3Ca(H2PO4)2 + 7CaSO4 + 2HF
2Zn+O2=ZnO2Zn + O2 = 2ZnO
2Na+Cl2=NaCl2Na + Cl2 = 2NaCl
2CsI(aq) + 1Cl2(aq) = 2CsCl(aq) + 1CsI(aq)CsI(aq) + 0Cl2(aq) = 0CsCl(aq) + CsI(aq)
2CsI + 1Cl2 = 2CsCl + 1CsICsI + 0Cl2 = 0CsCl + CsI
2C2H6(g)+5O2(g)=4CO(g)+6H2O(g)2C2H6(g) + 5O2(g) = 4CO(g) + 6H2O(g)
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2K3PO4(aq)+3MgCl2(aq)=Mg3(PO4)2(s)+6KCl(aq)2K3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6KCl(aq)
2NaCl = 4ClNaNaCl = ClNa
2K + Cl2 = 2KCl 2K + Cl2 = 2KCl
2HgNO3(aq) + CaI2(aq) = Hg2I2(s) + Ca(NO3)2(aq) 2HgNO3(aq) + CaI2(aq) = Hg2I2(s) + Ca(NO3)2(aq)
2HgNO3(aq) + CaI2(aq) = Hg2I2(s) + Ca(NO3)2(aq) 2HgNO3(aq) + CaI2(aq) = Hg2I2(s) + Ca(NO3)2(aq)
2HCN(aq)+Ba(OH)2(aq)=2H2O(l)+Ba(CN)2(aq)2HCN(aq) + Ba(OH)2(aq) = 2H2O(l) + Ba(CN)2(aq)
2 H2SO4 + 2 LiOH = H2O + Li2SO4H2SO4 + 2LiOH = 2H2O + Li2SO4
2 H2SO4 + 2 LiOH = 2 H2O + Li2SO4H2SO4 + 2LiOH = 2H2O + Li2SO4
2 H2SO4 + 2 LiOH = 2 H2O + Li2SO4H2SO4 + 2LiOH = 2H2O + Li2SO4
2 Fe + Al2O3 = 2 Al + Fe2O32Fe + Al2O3 = 2Al + Fe2O3
2Al(s) + 3Cl2 (g) = 2AlCl3 (s)2Al(s) + 3Cl2(g) = 2AlCl3(s)
2HC2H302 + Na2CO3 = H2O+CO2+2NaC2H3O216HC2H302 + 311Na2CO3 = 1491H2O - 901CO2 + 622NaC2H3O2
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2HgO=2Hg+O22HgO = 2Hg + O2
2 N2H4 + N2O4 = 3 N2 + 4 H2O2N2H4 + N2O4 = 3N2 + 4H2O
2FeCl3 + FeCl2 + 8NH3 + 4H2O = Fe3O4 + 8NH4Cl 2FeCl3 + FeCl2 + 8NH3 + 4H2O = Fe3O4 + 8NH4Cl
2Cr (s)+3O2 (g)=Cr2O3 (s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2NaI+Br2=2NaBr+I22NaI + Br2 = 2NaBr + I2
2AuCl3+3Ni=3NiCl2+2Au2AuCl3 + 3Ni = 3NiCl2 + 2Au
2C8H18 + 25O2 =16CO2 + 18H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2 Cu(s) + S(s) = Cu2S(s)2Cu(s) + S(s) = Cu2S(s)
2Ca +Au(NO3)3 = 3Ca(NO3)2 +2Au3Ca + 2Au(NO3)3 = 3Ca(NO3)2 + 2Au
2Ca +Au(NO3)3 = 3Ca(NO3)2 +2Au3Ca + 2Au(NO3)3 = 3Ca(NO3)2 + 2Au
2H2S(aq) + O2(g) = 2S(s) + 2H2O(l)2H2S(aq) + O2(g) = 2S(s) + 2H2O(l)
2K3PO4(aq)+3MgCl2(aq)=Mg3(PO4)2(s)+6KCl(aq)2K3PO4(aq) + 3MgCl2(aq) = Mg3(PO4)2(s) + 6KCl(aq)
2 AgNO3(aq) + MnBr2(aq)= 2 AgBr(s) + Mn(NO3)2(aq)2AgNO3(aq) + MnBr2(aq) = 2AgBr(s) + Mn(NO3)2(aq)
2NaCl + BeF2 = NaF + BeCl22NaCl + BeF2 = 2NaF + BeCl2
2Al(OH)3 + H2SO4 = Al2(SO4)3 + 6H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
2Al(OH)3 + H2SO4 = Al2(SO4)3 + 6H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
2AgNO3 + Na2CO3 = Ag2CO3 +2NaNO32AgNO3 + Na2CO3 = Ag2CO3 + 2NaNO3
2SFe + 3O2 = 2Fe O + 2SO22SFe + 3O2 = 2FeO + 2SO2
2Al(OH)3+HBr=AlBr3+H2OAl(OH)3 + 3HBr = AlBr3 + 3H2O
2FeO + O2 = Fe2O34FeO + O2 = 2Fe2O3
2HNO3+Ca(OH)2=Ca(NO3)2+2H2O2HNO3 + Ca(OH)2 = Ca(NO3)2 + 2H2O
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2HCl(aq)+ZnS(s)=ZnCl2(aq)+H2S(g)2HCl(aq) + ZnS(s) = ZnCl2(aq) + H2S(g)
2B(OH)3 = B2O3 + 3H2O2B(OH)3 = B2O3 + 3H2O
2N + HCl=H2 + 2NCl2N + 2HCl = H2 + NCl2
2 Pb(NO3)2 + 4 Kl = Pb2 + 4 Kl(NO3)2Pb(NO3)2 + 4Kl = Pb2 + 4Kl(NO3)
2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O
2NH4Cl + Ca(OH)2 =CaCl2 + 2NH3 + 2H2O 2NH4Cl + Ca(OH)2 = CaCl2 + 2NH3 + 2H2O
2AuCl3+3Ni=3NiCl2+2Au2AuCl3 + 3Ni = 3NiCl2 + 2Au
2FeCl3+FeCl2+8NH3+4H2O=Fe3O4+8NH4Cl2FeCl3 + FeCl2 + 8NH3 + 4H2O = Fe3O4 + 8NH4Cl
2C2H6 + 7O2 = 4CO2 + 6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + 7O2 = 4CO2 + 6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2Li(S)+Br2(g)=2LiBr(S)2Li(S) + Br2(g) = 2LiBr(S)
2Li(S)+Br2(g)=2LiBr(S)2Li(S) + Br2(g) = 2LiBr(S)
2Li(S)+Br2(g)=2LiBr(S)2Li(S) + Br2(g) = 2LiBr(S)
2 KOH + Cl2 = KCl + KClO + H2O2KOH + Cl2 = KCl + KClO + H2O
2N2H4+N2O4=N2+H2O2N2H4 + N2O4 = 3N2 + 4H2O
2Rb+S8=2Rb2S16Rb + S8 = 8Rb2S
2CH3OH + 3O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CH3OH + 3O2 = 2CO2 +4 H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CH3OH +3O2 = 2CO2 +4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CH3OH +3O2 = 2CO2 +4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2 HC2H3O2 + Mg(OH)2 = 2 H2O + Mg(C2H3O2)22HC2H3O2 + Mg(OH)2 = 2H2O + Mg(C2H3O2)2
2BaCl2 (aq) + 2AgNO3(aq) = 2Ba(NO3) + 2AgCl2BaCl2(aq) + AgNO3(aq) = Ba(NO3) + AgCl2
2Mg3N2+6HCl=3MgCl2+4NH3Mg3N2 + 6HCl = 3MgCl2 + 2NH3
2HCl + Zn = ZnCl2 + H22HCl + Zn = ZnCl2 + H2
2H2+MnO2=MnO+2H2OH2 + MnO2 = MnO + H2O
2Mg+Cl2= MgCl2Mg + Cl2 = MgCl2
2SO2+ O2 = 2SO3 2SO2 + O2 = 2SO3
2SO2(g) + O2 (g) = 2SO3 (g)2SO2(g) + O2(g) = 2SO3(g)
2HCl+2NaHCO3=NaCl+CO2+H2OHCl + NaHCO3 = NaCl + CO2 + H2O
2 HCl + 2NaHCO3 = NaCl + CO2 +H2OHCl + NaHCO3 = NaCl + CO2 + H2O
2NaI(aq)+Br2(l)=2NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2NaI(aq)+Br2(l)=2NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2HCN(aq)+Sr(OH)2(aq)=2H2O(l)+Sr(CN)2(aq)2HCN(aq) + Sr(OH)2(aq) = 2H2O(l) + Sr(CN)2(aq)
2C6H12O2+15O2 = 12CO2+12H2OC6H12O2 + 8O2 = 6CO2 + 6H2O
2KI + 4HCl + MnO2 = 2ClI +2H2O + 2KCl + MnCl2KI + 4HCl + MnO2 = ClI + 2H2O + KCl + MnCl2
2NaHCO3 = Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2Cr + 6HCl = 2CrCl3 + 3H22Cr + 6HCl = 2CrCl3 + 3H2
2Al(OH)3(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 6H2O(l)2Al(OH)3(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 6H2O(l)
2Al(OH)3 + 3H2SO4 = Al2(SO4)3+ 6H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
2Al(OH)3 + 3H2SO4 = Al2(SO4)3+ 6H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
2Al(OH)3(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 6H2O(l)2Al(OH)3(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 6H2O(l)
2C6H12O6=C12H22O11+2H2O2C6H12O6 = C12H22O11 + H2O
2HCN(aq)+Ba(OH)2(aq)=Ba(CN)2(aq)+2H2O(l)2HCN(aq) + Ba(OH)2(aq) = Ba(CN)2(aq) + 2H2O(l)
2PbO2 + HNO3 = 2Pb(NO3)2 + H2O + O22PbO2 + 4HNO3 = 2Pb(NO3)2 + 2H2O + O2
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2H2S(aq)+H2SO3(aq)=3S(s)+3H2O(l)2H2S(aq) + H2SO3(aq) = 3S(s) + 3H2O(l)
2NaOH+H2SO4=Na2SO4+HOH2NaOH + H2SO4 = Na2SO4 + 2HOH
2Cr2O72- +16 H+ +3CH3-CH2OH = 4 Cr3+ + 11 H2O+ 3 CH3COOH15Cr2O72- + 452H+ + 427CH3-CH2OH = 10Cr3+ + 653H2O + 427CH3COOH
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2Na3PO4+3CoBr2=6NaBr+Co3(PO4)22Na3PO4 + 3CoBr2 = 6NaBr + Co3(PO4)2
2C 2 H 6 +7O 2 =4CO 2 +6H 2 O 2C2H6 + 7O2 = 4CO2 + 6H2O
2Al+O 2=Al 2 O 3 4Al + 3O2 = 2Al2O3
2Ag + 2HNO3 = 2AgNO3 +H22Ag + 2HNO3 = 2AgNO3 + H2
2Fe(NO3)3 + 3H2S = Fe2S3(s) + 6HNO32Fe(NO3)3 + 3H2S = Fe2S3(s) + 6HNO3
2CH3OH+3O2=2CO2+4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CO2+9H2O=C2H5OH+12OH2CO2 + 9H2O = C2H5OH + 12OH
2Ni2O3=4Ni+3O22Ni2O3 = 4Ni + 3O2
2H2S + 3O2 = 2SO2 + 2H2O2H2S + 3O2 = 2SO2 + 2H2O
2PbS+3O2=2PbO+2SO22PbS + 3O2 = 2PbO + 2SO2
2 FeCl3 + FeCl2 + 8 NH3 + 4 H2O = Fe3O4 + 8 NH4Cl2FeCl3 + FeCl2 + 8NH3 + 4H2O = Fe3O4 + 8NH4Cl
2Bi+ 3F2 = 2BiF32Bi + 3F2 = 2BiF3
2 Fe (s) + 3 H2O (l) = Fe(OH)3 (aq) + H2 (g)2Fe(s) + 6H2O(l) = 2Fe(OH)3(aq) + 3H2(g)
2 Fe (s) + 3 H2O (l) = Fe(OH)3 (aq) + H2 (g)2Fe(s) + 6H2O(l) = 2Fe(OH)3(aq) + 3H2(g)
2Cu(CO3) + 3O2 = CO2 +Cu2Cu(CO3) - O2 = 2CO2 + 2Cu
2Fe2O3+C = Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
2Fe2O3+C = Fe+CO22Fe2O3 + 3C = 4Fe + 3CO2
2Na + 2H2O = 2NaOH + H22Na + 2H2O = 2NaOH + H2
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Na+2H2O=2NaOH+H33Na + 3H2O = 3NaOH + H3
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2CH4OH+3O2=2CO2+4H2O4CH4OH + 7O2 = 4CO2 + 10H2O
2Ag(aq)+SO3=Ag2SO3(s)2Ag(aq) + SO3 = Ag2SO3(s)
2 Na3PO4 + 3 Co(NO3)2 = 6 NaNO3 + Co3(PO4)22Na3PO4 + 3Co(NO3)2 = 6NaNO3 + Co3(PO4)2
2 KCl(aq) + Pb(C2H3O2)2(aq) = 2 KC2H3O2(aq) + PbCl2(s)2KCl(aq) + Pb(C2H3O2)2(aq) = 2KC2H3O2(aq) + PbCl2(s)
2C2H2 + 5O2= 4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2Na+2H2O= 2NaOH +H22Na + 2H2O = 2NaOH + H2
2Na+2H2O= 2NaOH +H22Na + 2H2O = 2NaOH + H2

This program was created with a lot of help from:

Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer

Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.