Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
2KBr(aq)+Na2CO3(aq)=K2CO3 + 2NaBr2KBr(aq) + Na2CO3(aq) = K2CO3 + 2NaBr
2Na+Cl2 = NaCl2Na + Cl2 = 2NaCl
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2 C4H10 + 13 O2 = 10 H2O + 8 CO22C4H10 + 13O2 = 10H2O + 8CO2
2CH3COOH(aq)+Zn(s)=Zn(CH3COO)2(aq)+H2(g)2CH3COOH(aq) + Zn(s) = Zn(CH3COO)2(aq) + H2(g)
2HCl + Mg = MgCl2 + H22HCl + Mg = MgCl2 + H2
2C8H18+50O2=16CO2+18H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2 Na3PO4 + 3 Mg(NO3)2 = Mg3(PO4)2 + 6 NaNO32Na3PO4 + 3Mg(NO3)2 = Mg3(PO4)2 + 6NaNO3
2 H2 + O2 = 2 H2O2H2 + O2 = 2H2O
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2 HCl + 2NaHCO3 = NaCl + CO2 +H2OHCl + NaHCO3 = NaCl + CO2 + H2O
2HC2H3O2(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaC2H3O2(aq)2HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaC2H3O2(aq)
2Al(s) + S(s) = 3Al2S3(s) 2Al(s) + 3S(s) = Al2S3(s)
2C6H6 + 17O2= 12CO2 + 6H2010C6H6 + 60O2 = 60CO2 + 3H20
2UO2(NO3)2+3NH3+3H2O=U2O7(NH4)2+4HNO32UO2(NO3)2 + 2NH3 + 3H2O = U2O7(NH4)2 + 4HNO3
2UO2(NO3)2+3NH3+3H2O=U2O7(NH4)2+4HNO32UO2(NO3)2 + 2NH3 + 3H2O = U2O7(NH4)2 + 4HNO3
2Pb(NO3)2+3KBr=PbBr+K(NO3)2Pb(NO3)2 + KBr = PbBr + K(NO3)2
2Pb(NO3)2+3KBr=PbBr+K(NO3)2Pb(NO3)2 + KBr = PbBr + K(NO3)2
2AgNO3(aq)+CaBr2(aq) = 2AgBr(s)+Ca(NO3)2(aq)2AgNO3(aq) + CaBr2(aq) = 2AgBr(s) + Ca(NO3)2(aq)
2PbO= 2Pb + O22PbO = 2Pb + O2
2Mg+O2=2MgO2Mg + O2 = 2MgO
2N2H4(l) +N2O4(l) = 3N2(g) + 4H2O(g)2N2H4(l) + N2O4(l) = 3N2(g) + 4H2O(g)
2Na + Ba(HCO3)2 = 2NaHCO3 + Ba2Na + Ba(HCO3)2 = 2NaHCO3 + Ba
2NaI + CoCl2 = CoI2 + 2NaCl2NaI + CoCl2 = CoI2 + 2NaCl
2 SO2(g) + O2(g) + 2 H2O = 2 H2SO42SO2(g) + O2(g) + 2H2O = 2H2SO4
2C7H6O2 + 15O2 = 14CO2 + 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2C7H6O2 + 15O2 = 14CO2 + 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2C7H6O2 + 15O2 = 14CO2 + 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2C7H6O2 + 15O2 = 14CO2 + 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2C7H6O2 + 15O2=14CO2 + 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2LiBr + F2 = 2Li + 2FBr2LiBr + F2 = 2Li + 2FBr
2NaI(aq)+Br2(I)=2NaBr(aq)+I2(s)4NaI(aq) + 2Br2(I) = 4NaBr(aq) + 3I2(s)
2 C4H10( g) + 13 O2( g)H8 = CO2( g) + 10 H2O(l )-2C4H10(g) + 13O2(g)H8 = -8CO2(g) + 42H2O(l)
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2HBr(aq)+Mg(s)=H2(g)+MgBr2(aq)2HBr(aq) + Mg(s) = H2(g) + MgBr2(aq)
2Li + H2SO4 = Li2SO4 + H22Li + H2SO4 = Li2SO4 + H2
2Li + H2SO4 = Li2SO4 + H22Li + H2SO4 = Li2SO4 + H2
2K + O2 = K2O4K + O2 = 2K2O
2H2+O2=H2O2H2 + O2 = 2H2O
2HC2H3O2(aq)+Zn(s)=Zn(C2H3O2)2(aq)+H2(g)2HC2H3O2(aq) + Zn(s) = Zn(C2H3O2)2(aq) + H2(g)
2HCl + FeS= H2S +FeCl22HCl + FeS = H2S + FeCl2
2AgNO3 + MgCl2=Mg(NO3)2+ 2AgCl 2AgNO3 + MgCl2 = Mg(NO3)2 + 2AgCl
2NaI(aq) + Hg(C2H3O2)2 = 2Na(C2H3O2)(aq) + HgI2(s)2NaI(aq) + Hg(C2H3O2)2 = 2Na(C2H3O2)(aq) + HgI2(s)
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2 Mg + H2So4 = Mg2So4 + H22Mg + H2So4 = Mg2So4 + H2
2 Mg + H2So4 = Mg2So4 + H22Mg + H2So4 = Mg2So4 + H2
2 Mg + H2So4 = Mg2So4 + H22Mg + H2So4 = Mg2So4 + H2
2NaOH(s)+2Al(s)+6H20(l)=2NaAl(OH)4(s)+3H2(g)0NaOH(s) + 0Al(s) + H20(l) = 0NaAl(OH)4(s) + 10H2(g)
2Cl- + 2H2O = Cl2 H2 + 2OH-2Cl- + 2H2O = Cl2H2 + 2OH-
2AlCl3 = 2Al+3Cl22AlCl3 = 2Al + 3Cl2
2Pb(NO3)2+3KBr=PbBr+K(NO3)2Pb(NO3)2 + KBr = PbBr + K(NO3)2
2Pb(NO3)2+3KBr=PbBr+K(NO3)2Pb(NO3)2 + KBr = PbBr + K(NO3)2
2Pb(NO3)2+3KBr=PbBr+K(NO3)2Pb(NO3)2 + KBr = PbBr + K(NO3)2
2Ca(OH)2+HCl= CaCl2+H2OCa(OH)2 + 2HCl = CaCl2 + 2H2O
2HCl + 2KMnO4 = Cl2 + MnO2 + 2H2O + 2KCl8HCl + 2KMnO4 = 3Cl2 + 2MnO2 + 4H2O + 2KCl
2Li + CO2 +3H2O = LiHCO3 + 2H22Li + 2CO2 + 2H2O = 2LiHCO3 + H2
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2 HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2 NaC2H3O2(aq)2HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaC2H3O2(aq)
2Ca3(PO4)2+5H2SO4=5 CaSO4+Ca(H2PO4)2Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
2KOH+H2SO4=K2SO4+H2O2KOH + H2SO4 = K2SO4 + 2H2O
2SO2+O2=2SO32SO2 + O2 = 2SO3
2KNO3 + 10 K =5K2O+N22KNO3 + 10K = 6K2O + N2
2 CO + O2=2CO22CO + O2 = 2CO2
2C2H6+5O2=2CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2 NaCl(aq) + Hg2(C2H3O2)2(aq) = 2 HgCl(s) + 2 Na(C2H3O2)(aq)2NaCl(aq) + Hg2(C2H3O2)2(aq) = 2HgCl(s) + 2Na(C2H3O2)(aq)
2(CO2) + 2(H2O) = CH3COOH + O22(CO2) + 2(H2O) = CH3COOH + 2O2
2N2 + O2 = 2NO2N2 + 2O2 = 2NO2
2HBr(aq)+Ca(s)=CaBr2(aq)+H2(g)2HBr(aq) + Ca(s) = CaBr2(aq) + H2(g)
2HBr + H2SO4 = 2 H2O + SO2 +Br22HBr + H2SO4 = 2H2O + SO2 + Br2
2AuCl3(aq)+3Ni(s)=3NiCl2(aq)+2Au(s)2AuCl3(aq) + 3Ni(s) = 3NiCl2(aq) + 2Au(s)
2ALOH+2HCL=2ALCL+2H2OALOH + HCL = ALCL + H2O
2ALOH+2HCL=2ALCL+2H2OALOH + HCL = ALCL + H2O
2XeF2 + 2H2O = 2Xe + O2 + 4HF2XeF2 + 2H2O = 2Xe + O2 + 4HF
2Na+2HCl=2NaCl+H22Na + 2HCl = 2NaCl + H2
2KI(aq)+Pb(NO3)2(aq)=PbI2(s)+2KNO3(aq)2KI(aq) + Pb(NO3)2(aq) = PbI2(s) + 2KNO3(aq)
2KI(aq)+Pb(NO3)2(aq)=PbI2(s)+2KNO3(aq)2KI(aq) + Pb(NO3)2(aq) = PbI2(s) + 2KNO3(aq)
2HgO=2Hg+O22HgO = 2Hg + O2
2Al+FeO3=Al2O3+Fe24Al + 2FeO3 = 2Al2O3 + Fe2
2Al+FeO3=Al2O3+Fe24Al + 2FeO3 = 2Al2O3 + Fe2
2AsI3(s)= 2As(s) + 3I2(s)2AsI3(s) = 2As(s) + 3I2(s)
2Fe+3H2SO4=1Fe2(SO4)3+3H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
2CaCO3 + 3HCl = CaCl2 + 2CO2 + 2H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
2CaCO3 + 3HCl = CaCl2 + 2CO2 + 2H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
2CaCO3 + 3HCl = CaCl2 + CO2 + H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
2NH4CH3COO + 2AGNO3 = 2NH4NO3 + 2AGCH3COONH4CH3COO + AGNO3 = NH4NO3 + AGCH3COO
2HCl+K2CO3=KCl+H2O+CO22HCl + K2CO3 = 2KCl + H2O + CO2
2Fe2O3(s) + 3C(s)=4Fe(s)+3CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
2 NaBr + 4 HCl + MnO2=MnBr2+2 H2O + 2 NaCl + MnCl2-2NaBr + 0HCl + 0MnO2 = -1MnBr2 + 0H2O - 2NaCl + MnCl2
2Mn-2 + 5BiO + 14H2O = 2MnO4 + 5Bi+3 + 21H2O0Mn-2 + 0BiO + H2O = 0MnO4 + 0Bi+3 + H2O
2K + Cl2 = 2KCl2K + Cl2 = 2KCl
2Al(NO3)3 + 3Mg = 3Mg(NO3)2 + 2Al 2Al(NO3)3 + 3Mg = 3Mg(NO3)2 + 2Al
2KI + Na2SO4 = 2NaI + K2SO42KI + Na2SO4 = 2NaI + K2SO4
2HgO + Cl2 = 2HgCl + O22HgO + Cl2 = 2HgCl + O2
2Na3PO4 + 6KOH = 6NaOH + 2K3PO4Na3PO4 + 3KOH = 3NaOH + K3PO4
2C2H6+5O2=2CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
2C6H10+17O2=12CO2+10H2O2C6H10 + 17O2 = 12CO2 + 10H2O
2C3H6O + 9O2 = 6CO2 + 6H2OC3H6O + 4O2 = 3CO2 + 3H2O
2C3H6O + 9O2 = 6CO2 + 6H2OC3H6O + 4O2 = 3CO2 + 3H2O
2Cl (aq) + 2Ag (aq) = 2AgCl (s)Cl(aq) + Ag(aq) = AgCl(s)
2KNO3 = KNO2+O22KNO3 = 2KNO2 + O2
2Na + Cl2 = 2NaCl2Na + Cl2 = 2NaCl
2N2 + 6H2 = 2NH3 N2 + 3H2 = 2NH3
2H2O=H2+2O22H2O = 2H2 + O2
2 Na3PO4 + 3 Ca(NO3)2 = Ca3(PO4)2 + 6 NaNO32Na3PO4 + 3Ca(NO3)2 = Ca3(PO4)2 + 6NaNO3
2Cu2O(s) + C(s) = Cu(s) + CO2(g)2Cu2O(s) + C(s) = 4Cu(s) + CO2(g)
2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
2Na3PO4 + 3CaI2 = 6NaI + Ca3(PO4)22Na3PO4 + 3CaI2 = 6NaI + Ca3(PO4)2
2H2O2 = 2H2O + O22H2O2 = 2H2O + O2
2C2H2 + 5O2 = 4CO2 + 2H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
2K + 2Br2 = 2KBr2K + Br2 = 2KBr
2C7H6O2 + 15O2 = 14CO2 + 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2Al + 3FeO= Al2O3 + 3Fe2Al + 3FeO = Al2O3 + 3Fe
2Na + 2H2O = 2NaOH + H2 2Na + 2H2O = 2NaOH + H2
2SO2 + O2 = 2SO32SO2 + O2 = 2SO3
2C2H2 + 5O2 = 4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2C2H6(g)+5O2(g)=2CO2(g)+6H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
2C2H6(g)+5O2(g)=2CO2(g)+6H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
2C2H6(g)+5O2(g)=2CO2(g)+6H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
2HC2H3O2+Na2CO3=H2O+CO2+2NaC2H3O22HC2H3O2 + Na2CO3 = H2O + CO2 + 2NaC2H3O2
2Fe2O3+3C=4Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
2KHCO3+ H2SO4= K2SO4+ H2O +CO22KHCO3 + H2SO4 = K2SO4 + 2H2O + 2CO2
2KHCO3+ H2SO4= K2SO4+ 2H2O +2CO22KHCO3 + H2SO4 = K2SO4 + 2H2O + 2CO2
2 Co(NO3)3(aq) + 3 (NH4)2S(aq) = Co2S3(s) + 3 NH4NO3(aq)2Co(NO3)3(aq) + 3(NH4)2S(aq) = Co2S3(s) + 6NH4NO3(aq)
2AgNO3 + CaBr2= 2AgBr+Ca(NO3)22AgNO3 + CaBr2 = 2AgBr + Ca(NO3)2
2FeO4 + O2 = 3Fe2O34FeO4 - 5O2 = 2Fe2O3
2Al + 3H2SO4 = Al2(SO4)3 + 3H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
2NH3 + H2C2O4 = (NH4)2C2O42NH3 + H2C2O4 = (NH4)2C2O4
2Fe+O2+3H2O=2Fe(OH)34Fe + 3O2 + 6H2O = 4Fe(OH)3
2N2H4(g)+N2O4(g)=3N2(g)+10H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2AlBr3 + 3K2SO4= 6KBr + Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
2Na2S+2O2+H2O=Na2S2O3+2NaOH2Na2S + 2O2 + H2O = Na2S2O3 + 2NaOH
2 C4H10 + 13 O2 = 8 CO2 + 10 H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2 Ag2O = 4 Ag + O22Ag2O = 4Ag + O2
2HNO3+Mg(OH)2=2H2O+Mg(NO3)22HNO3 + Mg(OH)2 = 2H2O + Mg(NO3)2
2Cr(s)+3O2(g)=Cr2O3(s)4Cr(s) + 3O2(g) = 2Cr2O3(s)
2O2 = O33O2 = 2O3
2 Al + 6 HCl = 2 AlCl3 + 3 H22Al + 6HCl = 2AlCl3 + 3H2
2Li2S(aq)+Pb(NO3)4(aq)=4LiNO3(aq)+PbS2(s)2Li2S(aq) + Pb(NO3)4(aq) = 4LiNO3(aq) + PbS2(s)
2K+ZnCl2=KCl+Zn2K + ZnCl2 = 2KCl + Zn
2AgNO3(aq)+Fe(s)=Fe(NO3)2(aq)+2Ag(s)2AgNO3(aq) + Fe(s) = Fe(NO3)2(aq) + 2Ag(s)
2KI(aq)+Br2(l)=2KBr(aq)+I2(s)2KI(aq) + Br2(l) = 2KBr(aq) + I2(s)
2C4H10 + 13O2 = 8CO2 + 10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2C2H6(g)+5O2(g)=2CO2(g)+6H2O2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O
2AuCl3(aq)+3Sn(s)=3SnCl2(aq)+2Au(s)2AuCl3(aq) + 3Sn(s) = 3SnCl2(aq) + 2Au(s)
2Al(s) + 3Fe(NO3)2(aq) = 3Fe(s) + 2Al(NO3)3(aq)2Al(s) + 3Fe(NO3)2(aq) = 3Fe(s) + 2Al(NO3)3(aq)
2KOH + NiSO4 = K2SO4 + Ni(OH)22KOH + NiSO4 = K2SO4 + Ni(OH)2
2H2 + O2 = H2O2H2 + O2 = 2H2O
2P4O10+H2O = H3PO4P4O10 + 6H2O = 4H3PO4
2LiBr(aq)+F2(g)=2Li(s)+2FBr(g)2LiBr(aq) + F2(g) = 2Li(s) + 2FBr(g)
2LiBr(aq)+F2(g)=2Li(s)+2FBr(g)2LiBr(aq) + F2(g) = 2Li(s) + 2FBr(g)
2Cr(s)+3F2(g)=2CrF3(s)2Cr(s) + 3F2(g) = 2CrF3(s)
2 KMnO4 + 16 HCl = 2 KCl + MnCl2 + 8 H2O + 5 Cl2 2KMnO4 + 16HCl = 2KCl + 2MnCl2 + 8H2O + 5Cl2
2I-+2Fe3+=I2+Fe2+-2I- + 4Fe3+ = -1I2 + 6Fe2+
2FeCl3 +SnCl2 =2FeCl2+ SnCl42FeCl3 + SnCl2 = 2FeCl2 + SnCl4
2FeCl3(aq) +SnCl2(aq)=2FeCl2(aq)+SnCl4(aq)2FeCl3(aq) + SnCl2(aq) = 2FeCl2(aq) + SnCl4(aq)
2Al+6HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
2Na+H2O=NaOH+H22Na + 2H2O = 2NaOH + H2
2CH3OH + 4O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
20 Zn + 12 H + 2NO3- = 10 Zn2+ + N2 + 6H2O-4Zn + 12H + 2NO3- = -2Zn2+ + N2 + 6H2O
2H2O=H2+O22H2O = 2H2 + O2
2N2+ 6Cl2=N2Cl2N2 + Cl2 = N2Cl2
2KCLO3=2KCL+O22KCLO3 = 2KCL + 3O2
2KF + Mg(CH3COO)2=2KCH3COO+MgF22KF + Mg(CH3COO)2 = 2KCH3COO + MgF2
2Na(S)+MgCl2(I)=2NaCl2(I)+Mg(S)Na(S) + MgCl2(I) = NaCl2(I) + Mg(S)
2CH4 + O2 = 2CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
2H2O2=2H2O + O22H2O2 = 2H2O + O2
2C2H2 + 5O2=4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2K + 2Br2=2KBr2K + Br2 = 2KBr
2C7H6O2 + 15O2=14CO2 + 6H2O2C7H6O2 + 15O2 = 14CO2 + 6H2O
2NaCl+Co(NO3)2=CoCl2+2NaNO32NaCl + Co(NO3)2 = CoCl2 + 2NaNO3
2KClO3=KCl + 3OKClO3 = KCl + 3O
2Li + N2 = 2LiN2Li + N2 = 2LiN
2 HCl + 2NaHCO3 = NaCl + CO2 +H2OHCl + NaHCO3 = NaCl + CO2 + H2O
2 HCl + 2NaHCO3 = NaCl + CO2 +H2OHCl + NaHCO3 = NaCl + CO2 + H2O
2H2S=2S2+4H2H2S = S2 + 4H
2C4H10 +O2 = 8CO2 + 10H202C4H10 + 8O2 = 8CO2 + H20
2H2O2 = 2H2O + O22H2O2 = 2H2O + O2
2C2H2 + 5O2 = 4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2K + 2Br2 = 2KBr2K + Br2 = 2KBr
2KClO3 = 2KCl+O22KClO3 = 2KCl + 3O2
2Fe +2O2 =Fe2O3 4Fe + 3O2 = 2Fe2O3
2Fe +2O2 =3Fe2O3 4Fe + 3O2 = 2Fe2O3
2Fe +2O2 =3Fe2O3 4Fe + 3O2 = 2Fe2O3
2Fe +2O2 =3Fe2O3 4Fe + 3O2 = 2Fe2O3
2Fe +2O2 =2Fe2O3 4Fe + 3O2 = 2Fe2O3
2NaCl + H2SO4 = Na2SO4 + 2HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
2Li + Cl2=2LiCl2Li + Cl2 = 2LiCl
2KClO3=KCl + 3O22KClO3 = 2KCl + 3O2
2KClO3=KCl + 3O22KClO3 = 2KCl + 3O2
2KClO3=KCl + 3O22KClO3 = 2KCl + 3O2
2Na2O2 + H2O = 2NaO2 + H2O0Na2O2 + H2O = 0NaO2 + H2O
2Na2O2 + H2O = NaO2 + H2O0Na2O2 + H2O = 0NaO2 + H2O
2FeCl3(aq) + 3K2CO3(aq)=Fe2(CO3)3(s) + 6KCl(aq)2FeCl3(aq) + 3K2CO3(aq) = Fe2(CO3)3(s) + 6KCl(aq)
2Cu+ 3HNO3 = NO2 + 2Cu(NO3)2 + H2OCu + 4HNO3 = 2NO2 + Cu(NO3)2 + 2H2O
2N2+3H2=2NH3N2 + 3H2 = 2NH3
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2C2H5NSCl + O2 = 4CO + H2O + NO + 2SO2 + HCl2C2H5NSCl + 7O2 = 4CO + 4H2O + 2NO + 2SO2 + 2HCl
2NaIO3 + 5NaHSO3 = NaHSO4 + Na2SO4 + H2O + I22NaIO3 + 5NaHSO3 = 3NaHSO4 + 2Na2SO4 + H2O + I2
2F2 + 2H2O = O2 + 4HF2F2 + 2H2O = O2 + 4HF
2Al+ Cr2O3 = Al2O3+Cr2Al + Cr2O3 = Al2O3 + 2Cr
2C3H7OH + O2 = 6CO2 + H2O2C3H7OH + 9O2 = 6CO2 + 8H2O
2Sb2S3 + O2 = 2Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
2Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
2C2H6O2 + O2 =CO2+6H2O2C2H6O2 + 5O2 = 4CO2 + 6H2O
2C2H6O2 + O2 = 4CO2 + 6H2O2C2H6O2 + 5O2 = 4CO2 + 6H2O
2Na + O2 = Na O2Na + O2 = 2NaO
2Pb+H2SO4=PbSO4+H2010Pb + 10H2SO4 = 10PbSO4 + H20
2Pb+O2+H2SO4=PbSO4+H2010Pb + 0O2 + 10H2SO4 = 10PbSO4 + H20
2HC2H3O2(aq)+Zn(s)=Zn(C2H3O2)2(aq)+H2(g)2HC2H3O2(aq) + Zn(s) = Zn(C2H3O2)2(aq) + H2(g)
2CH3OH + 3O2 = 2CO2 + 4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2NaOH(s)+H2SO4(aq)=Na2SO4(aq)+H2O(l)2NaOH(s) + H2SO4(aq) = Na2SO4(aq) + 2H2O(l)
2Li+2H2O=2LiOH+1H22Li + 2H2O = 2LiOH + H2
2N2 + 6I2 = 4NI3N2 + 3I2 = 2NI3
2HC2H3O2(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaC2H3O2(aq)2HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaC2H3O2(aq)
2Na + 2H2O = NaOH + HNa + H2O = NaOH + H
2 Li + O2 = Li2O4Li + O2 = 2Li2O
2 Cu(s) + H2CO3 (aq) = Cu2CO3 (s) + H2 (g) 2Cu(s) + H2CO3(aq) = Cu2CO3(s) + H2(g)
2 Ag2O = 4 Ag + O22Ag2O = 4Ag + O2
2 C2H4O + 5 O2 = 4 CO2 + 4 H2O2C2H4O + 5O2 = 4CO2 + 4H2O
2Al + H2SO4 = Al2 (SO4)3+ H2 2Al + 3H2SO4 = Al2(SO4)3 + 3H2
2H2S + 3O2 = SO2 + H2O2H2S + 3O2 = 2SO2 + 2H2O
2Li2O2 + H2O = 4LiOH + O22Li2O2 + 2H2O = 4LiOH + O2
2NaCl (aq) + K2C2O4 (aq)= Na2C2O4(s) + 2KCl (aq)2NaCl(aq) + K2C2O4(aq) = Na2C2O4(s) + 2KCl(aq)
2NaCl + K2C2O4 = Na2C2O4 + 2KCl2NaCl + K2C2O4 = Na2C2O4 + 2KCl
2C3H8(g)+7O2(g)=6CO(g)+8H2O(g) 2C3H8(g) + 7O2(g) = 6CO(g) + 8H2O(g)
2C3H8 (g)+7O2(g)=6CO(g)+8H2O(g) 2C3H8(g) + 7O2(g) = 6CO(g) + 8H2O(g)
2C3H8 (g)+7O2(g)=6CO(g)+8H2O(g) 2C3H8(g) + 7O2(g) = 6CO(g) + 8H2O(g)
2Na3(PO4)+3CoCl2=Co3(PO4)2+6NaCl2Na3(PO4) + 3CoCl2 = Co3(PO4)2 + 6NaCl
2NaCO3 + CaCl*2H2O = CaCO3 + 2 NaCl + H2ONaCO3 + CaCl*2H2O = CaCO3 + NaCl + 2H2O
2C2H2 + 5O2 = 4CO2 + 2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2Na + Cl2 = 2NaCl2Na + Cl2 = 2NaCl
2 Na2S2O3 + Pb(NO3)2 = 2 Na2NO3 + Pb(S2O3)22Na2S2O3 + Pb(NO3)2 = 2Na2NO3 + Pb(S2O3)2
2 Na2S2O3 + Pb(NO3)2 = 2 Na2NO3 + Pb(S2O3)22Na2S2O3 + Pb(NO3)2 = 2Na2NO3 + Pb(S2O3)2
2 Na2S2O3 + Pb(NO3)2 = 2 Na2NO3 + Pb(S2O3)22Na2S2O3 + Pb(NO3)2 = 2Na2NO3 + Pb(S2O3)2
2 KCrO4+Pb(NO3)2=Pb(CrO4)2+2KNO32KCrO4 + Pb(NO3)2 = Pb(CrO4)2 + 2KNO3
2HC2H3O2(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaC2H3O2(aq)2HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaC2H3O2(aq)
2Al(s)+3Cl2(g)=2AlCl32Al(s) + 3Cl2(g) = 2AlCl3
2KOH(aq)+Ca(NO3)2(aq)=Ca(OH)2(aq)+2KNO3(s)2KOH(aq) + Ca(NO3)2(aq) = Ca(OH)2(aq) + 2KNO3(s)
2KOH+Ca(NO3)2=Ca(OH)2+2KNO32KOH + Ca(NO3)2 = Ca(OH)2 + 2KNO3
2Na2CO3 + HgBr2 = 2NaBr + 2CO3 + HgNa2CO3 + HgBr2 = 2NaBr + CO3 + Hg
2Na2CO3 + Br2 = 2NaBr + 2CO3Na2CO3 + Br2 = 2NaBr + CO3
2H2 + O2=H2O 2H2 + O2 = 2H2O
2H2 + O2=H2O 2H2 + O2 = 2H2O
2H2 + O2=H2O 2H2 + O2 = 2H2O
2H2 + O2=H2O 2H2 + O2 = 2H2O
2 KNO3 + MgCl2 = 2 KCl + Mg(NO3)22KNO3 + MgCl2 = 2KCl + Mg(NO3)2
2Li2SO4(aq) + 4Al(NO3)3(aq) = 4Li(NO3)(aq) + 2Al2(SO4)3(s)3Li2SO4(aq) + 2Al(NO3)3(aq) = 6Li(NO3)(aq) + Al2(SO4)3(s)
2C+O2=2CO2C + O2 = 2CO
2Na2O=4Na+O22Na2O = 4Na + O2
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Na+2H2O=2NaOH+HNa + H2O = NaOH + H
2H2 + O2=H2O 2H2 + O2 = 2H2O
2Na+Cl2=2NaCl2Na + Cl2 = 2NaCl
2 HCl + 2NaHCO3 = NaCl + CO2 +H2OHCl + NaHCO3 = NaCl + CO2 + H2O
2NO + O2 = N2O22NO + 0O2 = N2O2
2 N2H4(g)+N2O4(g)= 3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2NaBr + Mn(NO3)2 = 2NaNO3 + MnBr22NaBr + Mn(NO3)2 = 2NaNO3 + MnBr2
2NO+O2=2NO22NO + O2 = 2NO2
2NO+O2=2NO22NO + O2 = 2NO2
2NO+O2=2NO22NO + O2 = 2NO2
2AgNO3(aq)+Na2CrO4(aq)=Ag2CrO4(s)+2NaNO3(aq)2AgNO3(aq) + Na2CrO4(aq) = Ag2CrO4(s) + 2NaNO3(aq)
2 Al(s) + 3 I2(s) = 2 AlI3(s)2Al(s) + 3I2(s) = 2AlI3(s)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2AgNO3+H2S= Ag2S+HNO32AgNO3 + H2S = Ag2S + 2HNO3
2 K(s) + O2(g) = K2O2(s)2K(s) + O2(g) = K2O2(s)
2Na+2Br2=NaBr2Na + Br2 = 2NaBr
2Na+2Br=NaBrNa + Br = NaBr
2NO2+H2O=HNO3+NO3NO2 + H2O = 2HNO3 + NO
2NH3+2O2=2NO2+3H2O4NH3 + 7O2 = 4NO2 + 6H2O
2AlCl3 = 2Al + 3Cl22AlCl3 = 2Al + 3Cl2
2CH4 + O2 = 2CO2 + H2OCH4 + 2O2 = CO2 + 2H2O
2C10H24O + 31O2 = 24H2O + 20CO22C10H24O + 31O2 = 24H2O + 20CO2
2C2H5OH + O2 = CO2 + H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2 CO(g) + 4 H2(g) = 2 CH4O(g) CO(g) + 2H2(g) = CH4O(g)
2C4H10(g) + 13 O2(g)= 8 CO2(g) + 10 H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2C4H10(g) + 13 O2(g)= 8 CO2(g) + 10 H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2 C4H10(g) + 13 O2(g) = 8 CO2(g) + 10 H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2 Fe + 6 HCl = FeCl3 + H22Fe + 6HCl = 2FeCl3 + 3H2
2 Fe(s) + 6 HCl(aq) = FeCl3(aq) + H2(g)2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
2 C4H10(g) + 13 O2(g) = H8 CO2(g) + 10 H2O(l)-2C4H10(g) + 3O2(g) = -8H8CO2(g) + 22H2O(l)
2 C4H10(g) + 13 O2(g) = H8 CO2(g) + 10 H2O(l)-2C4H10(g) + 3O2(g) = -8H8CO2(g) + 22H2O(l)
2NaOH+H2SO4=Na2SO4+H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
2Al+3Cl2=2AlCl32Al + 3Cl2 = 2AlCl3
2Al+3Cl2=2AlCl32Al + 3Cl2 = 2AlCl3
2SO2+O2=2SO32SO2 + O2 = 2SO3
2Al + 3Mn(NO3)2=2Al(NO3)2 + 3MnAl + Mn(NO3)2 = Al(NO3)2 + Mn
2C2H2+5O2=4CO2+2H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2FeNO3 + NaCO3 = FeCO3 + 2NaNO3FeNO3 + NaCO3 = FeCO3 + NaNO3
2Mg + 2HNO3 = Mg(HNO3)2Mg + 2HNO3 = Mg(HNO3)2
2 CO(g) + 4 H2(g) = 2 CH4O(g)CO(g) + 2H2(g) = CH4O(g)
2Al(OH)3+3C=3H2O+4Al+3CO24Al(OH)3 + 3C = 6H2O + 4Al + 3CO2
2 HCl + 2NaHCO3=NaCl + CO2 +H2OHCl + NaHCO3 = NaCl + CO2 + H2O
2Na2Cr2O7 + 3HCl = 4CrO2Cl2 + 4NaCl + H2ONa2Cr2O7 + 6HCl = 2CrO2Cl2 + 2NaCl + 3H2O
2Na2Cr2O7 + 3HCl = 4CrO2Cl2 + 4NaCl + H2ONa2Cr2O7 + 6HCl = 2CrO2Cl2 + 2NaCl + 3H2O
2Na2Cr2O7 + 3HCl = 4CrO2Cl2 + 4NaCl + H2ONa2Cr2O7 + 6HCl = 2CrO2Cl2 + 2NaCl + 3H2O
2Na2Cr2O7 + 3HCl = 4CrO2Cl2 + 4NaCl + H2ONa2Cr2O7 + 6HCl = 2CrO2Cl2 + 2NaCl + 3H2O
2C2H2+5O2=4CO2+H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2K+2H2O=KOH+H22K + 2H2O = 2KOH + H2
2N2H4+N2O4=3N2+4H2O2N2H4 + N2O4 = 3N2 + 4H2O
2N2H4+N2O4=3N2+4H2O2N2H4 + N2O4 = 3N2 + 4H2O
2 CH3OH(g) + 3 O2(g) = 2 CO2(g) + 4 H2O(g)2CH3OH(g) + 3O2(g) = 2CO2(g) + 4H2O(g)
2Al2O3=4Al+3O22Al2O3 = 4Al + 3O2
2Al2O3=4Al+3O22Al2O3 = 4Al + 3O2
2Al2O3=4Al+3O22Al2O3 = 4Al + 3O2
2AlO3=4Al+3O22AlO3 = 2Al + 3O2
2NaOH + H2So4 = Na2So4 + 2H2O2NaOH + H2So4 = Na2So4 + 2H2O
2C2H5OH+6O2=CO2+6H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2C2H5OH+6O2=CO2+6H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2C2H5OH+6O2=CO2+6H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2C2H5OH+6O2=CO2+6H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2 P2H4 + KOH + H2O = KH2PO2 + 3 PH32P2H4 + KOH + H2O = KH2PO2 + 3PH3
2Fe+O=FeOFe + O = FeO
2 H2 + O2 = 2 H2O2H2 + O2 = 2H2O
2Zn+HNO3=2Zn(NO3)2+NH4NO3=H2O4Zn + 10HNO3 = 4Zn(NO3)2 + NH4NO3 + 3H2O
2HNO3(aq) + Sr(OH)2(aq)=2H2O(l) + Sr(NO3)2(aq)2HNO3(aq) + Sr(OH)2(aq) = 2H2O(l) + Sr(NO3)2(aq)
2Pb(s)+O2(g)+2H2SO4(aq)=2PbSO4(s)+2H2O(l)2Pb(s) + O2(g) + 2H2SO4(aq) = 2PbSO4(s) + 2H2O(l)
2PbS+3O2=2PbO+2SO22PbS + 3O2 = 2PbO + 2SO2
2Na3N + H2O = NH3 + NaOHNa3N + 3H2O = NH3 + 3NaOH
2Na3N + H2O = NH3 + NaOHNa3N + 3H2O = NH3 + 3NaOH
2Na+2Br2=NaBr2Na + Br2 = 2NaBr
2Al + 6HCl = 3AlCl3 +3H22Al + 6HCl = 2AlCl3 + 3H2
2Li+S=Li2S2Li + S = Li2S
2H2 + O2 = H2O2H2 + O2 = 2H2O
2C3H8 + 7O2=6CO + 8H2O2C3H8 + 7O2 = 6CO + 8H2O
2Zn+2HC(l) = H2+2ZnC(l)2Zn + 2HC(l) = H2 + 2ZnC(l)
2CH3OH(l)+3O2(g)=2CO2(g)+4H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
2CH3OH(l)+3O2(g)=2CO2(g)+4H2O(g)2CH3OH(l) + 3O2(g) = 2CO2(g) + 4H2O(g)
2H2 + O2 = H2O 2H2 + O2 = 2H2O
2C4H10 + 9 O2 = 4CO2 + 10 H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2H2O2 = H2O + O22H2O2 = 2H2O + O2
2WO3 + C = 2W + CO22WO3 + 3C = 2W + 3CO2
2C2H5NSCl + 7O2 = CO + H2O + 2NO + SO2 + HCl2C2H5NSCl + 7O2 = 4CO + 4H2O + 2NO + 2SO2 + 2HCl
2C2H5NSCl + 7O2 = CO + H2O + 2NO + SO2 + HCl2C2H5NSCl + 7O2 = 4CO + 4H2O + 2NO + 2SO2 + 2HCl
2Al + S = Al2S32Al + 3S = Al2S3
2MgNH4PO4 = Mg2P2O7 + NH3 + H2O2MgNH4PO4 = Mg2P2O7 + 2NH3 + H2O
2C4H10+O2=CO2+10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2NaNO3=NaNO2+O22NaNO3 = 2NaNO2 + O2
2HO+PbSO = PbSO4+H2O6HO + PbSO = PbSO4 + 3H2O
2KBr+Pb(NO3)2=2KNO3+PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2HCl + CaCO3 =CaCl2 + H2O + CO22HCl + CaCO3 = CaCl2 + H2O + CO2
2C2H6(g) + 7O2(g) = 20000CO2(g) + 6H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
2C2H6(g) + 7O2(g) = 20CO2(g) + 6H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g) 2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(g)
2Mg(s)+O2(g) = 2MgO(s)2Mg(s) + O2(g) = 2MgO(s)
2Mg(s)+O2(g) = 2MgO(s)2Mg(s) + O2(g) = 2MgO(s)
2Mg(s)+O2(g) = 2MgO(s)2Mg(s) + O2(g) = 2MgO(s)
2AgNO3 (aq) + MgI2 (aq) = 2AgI (s) + Mg(NO3)2 (aq)2AgNO3(aq) + MgI2(aq) = 2AgI(s) + Mg(NO3)2(aq)
2Al(s)+6HCl(aq)=2AlCl3(aq)+3H2(g)2Al(s) + 6HCl(aq) = 2AlCl3(aq) + 3H2(g)
2Zn(s) + NH4NO3(s) = Zn2O(s) + N(g) + H2O(g)2Zn(s) + NH4NO3(s) = Zn2O(s) + 2N(g) + 2H2O(g)
2Zn(s) + NH2NO3(s) = 2ZnO(s) + N2(g) + H2O(g)2Zn(s) + NH2NO3(s) = 2ZnO(s) + N2(g) + H2O(g)
2Zn(s) + NH4NO3(s) = Zn2O(s) + N2(g) + 2H2O(g)2Zn(s) + NH4NO3(s) = Zn2O(s) + N2(g) + 2H2O(g)
2C4H10+13O2=8CO2+10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2 CO(g) + 4 H2(g) = 2 CH4O(g) CO(g) + 2H2(g) = CH4O(g)
2CO + O2 = 2CO22CO + O2 = 2CO2
2HgO + S2O32-+ 2OH = 2Hg + 2SO32-+ H2O-1HgO + 0S2O32- + 2OH = -1Hg + 0SO32- + H2O
2Ag2O = Ag + O22Ag2O = 4Ag + O2
2Fe(NO3)3 + 3Na2SO4 = Fe2(SO4) 3 + 6Na(NO3)2Fe(NO3)3 + 3Na2SO4 = Fe2(SO4)3 + 6Na(NO3)
2NaBr + Cl2 = 2NaCl + Br2 2NaBr + Cl2 = 2NaCl + Br2
2AgNO3 + 3CaCl2 = 3Ca(NO3)2 + 2AgCl2AgNO3 + CaCl2 = Ca(NO3)2 + 2AgCl
2 Pb (s) + TiO2 (s) = 2 PbO (s) + Ti (s)2Pb(s) + TiO2(s) = 2PbO(s) + Ti(s)
2NO+2CO = N2+ 2CO22NO + 2CO = N2 + 2CO2
2C8H18+O2=CO2+18H2O2C8H18 + 25O2 = 16CO2 + 18H2O
2H2(s)+O2(g)=2H2O(g)2H2(s) + O2(g) = 2H2O(g)
2NH3+CO2=CO (NH2) 2+H2O2NH3 + CO2 = CO(NH2)2 + H2O
2C2H6O+3O2=2CO2+3H2OC2H6O + 3O2 = 2CO2 + 3H2O
2CO(g)+O2(g)=2CO2(g)2CO(g) + O2(g) = 2CO2(g)
2C4H10 + 13O2 = 8CO2 +10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2 BaBr2 + 2 H2SO4= 2 BaSO4 + 4 HBrBaBr2 + H2SO4 = BaSO4 + 2HBr
2MgS+3O2 = 2MgO+2SO22MgS + 3O2 = 2MgO + 2SO2
2AlBr3 + 3Na2CO3 =Al2(CO3)3 +6NaBr2AlBr3 + 3Na2CO3 = Al2(CO3)3 + 6NaBr
2Cr(NO3)3 + 3FeSO4 = Cr2(SO4)3 + 3Fe(NO3)22Cr(NO3)3 + 3FeSO4 = Cr2(SO4)3 + 3Fe(NO3)2
2Cr(NO3)3 + 3FeSO4 = Cr2(SO4)3 + 3Fe(NO3)22Cr(NO3)3 + 3FeSO4 = Cr2(SO4)3 + 3Fe(NO3)2
2C6H12 + 5O2 = 2C6H10O4 + 2H2O2C6H12 + 5O2 = 2C6H10O4 + 2H2O
2VO+3Fe2O3=V2O5+6FeO2VO + 3Fe2O3 = V2O5 + 6FeO
2VO+3Fe2O3=V2O5+6FeO2VO + 3Fe2O3 = V2O5 + 6FeO
2Li + F2 = 2LiF2Li + F2 = 2LiF
2(NH4)3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NH4Cl2(NH4)3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NH4Cl
2K2CrO4+Pb(NO3)2=2KNO3+PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
2Zn + O2 = 2ZnO2Zn + O2 = 2ZnO
2Na + 2H2O =2NaOH + H22Na + 2H2O = 2NaOH + H2
2 Cu(OH)2 + 2 H3PO4 =Cu3(PO4)2 + 6 H2O3Cu(OH)2 + 2H3PO4 = Cu3(PO4)2 + 6H2O
2NaOH + Ca(NO3)2 = 2NaNO3 + Ca(OH)22NaOH + Ca(NO3)2 = 2NaNO3 + Ca(OH)2
2NaOH + Ca(NO3) 2 = 2NaNO3 + Ca(OH)22NaOH + Ca(NO3)2 = 2NaNO3 + Ca(OH)2
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2NH4NO3=2N2 + O2 + 4H2O2NH4NO3 = 2N2 + O2 + 4H2O
2SO2 + O2 = 2SO3 2SO2 + O2 = 2SO3
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2C2H6(g)+5O2(g)=2CO2(g)+6H2O(l)2C2H6(g) + 7O2(g) = 4CO2(g) + 6H2O(l)
2H2O2=2H2O+O2(g)2H2O2 = 2H2O + O2(g)
2MnO4 + 5H2C2O4+ 6H+ = 10 CO2 + 2Mn2 + 8H2O2MnO4 + 8H2C2O4 + 0H+ = 16CO2 + Mn2 + 8H2O
2 KOH + BaCl2 = Ba(OH)2 + 2 KCl2KOH + BaCl2 = Ba(OH)2 + 2KCl
2CH3CH2OH +6 O2 = 4 CO2 + 6 H2O CH3CH2OH + 3O2 = 2CO2 + 3H2O
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2 Sr + O2 = 2 SrO2Sr + O2 = 2SrO
2KI + (NH4)2S2O4 = I2 + K2SO4 + (NH4)2S2KI + (NH4)2S2O4 = I2 + K2SO4 + (NH4)2S
2BaO + O2 = 2BaO22BaO + O2 = 2BaO2
2KMnO4 + Ca = Ca(MnO4)2 + 2K2KMnO4 + Ca = Ca(MnO4)2 + 2K
2NH4HF2+H3BO3=NH4BF4+NH3+3H2O2NH4HF2 + H3BO3 = NH4BF4 + NH3 + 3H2O
2 Al(s) + 2 NaOH(aq) + 6 H2O(l) = 2 NaAl(OH)4(aq) + 3 H2(g)2Al(s) + 2NaOH(aq) + 6H2O(l) = 2NaAl(OH)4(aq) + 3H2(g)
2 K(s) + H2SO4(aq) = K2SO4 + H22K(s) + H2SO4(aq) = K2SO4 + H2
2FeBr3+3K2S=Fe2S3+6KBr2FeBr3 + 3K2S = Fe2S3 + 6KBr
2FeBr3+3K2S=Fe2S3+6KBr2FeBr3 + 3K2S = Fe2S3 + 6KBr
2C4H10O2+11O2=8CO+10H2O2C4H10O2 + 7O2 = 8CO + 10H2O
2C4H10O2+11O2=8CO+10H2O2C4H10O2 + 7O2 = 8CO + 10H2O
2Zn+HNO3=2Zn(NO3)2+NH4NO3+H2O4Zn + 10HNO3 = 4Zn(NO3)2 + NH4NO3 + 3H2O
2NaCl (s) + H2O (l) = Na2O + 2HCl2NaCl(s) + H2O(l) = Na2O + 2HCl
2NaCl (s) + H2O (l) = Na2O (aq)+ 2HCl (aq)2NaCl(s) + H2O(l) = Na2O(aq) + 2HCl(aq)
2 Bi(NO3)3 + 3 H2S = Bi2S3 + 6 HNO32Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3
2 SO2 + 2 H2O + O2 = 2 H2SO42SO2 + 2H2O + O2 = 2H2SO4
2C+2O=CO2C + 2O = CO2
2O2+3Ca= CaOO2 + 2Ca = 2CaO
2Na + 2H2O=2NaOH + H22Na + 2H2O = 2NaOH + H2
2K2CrO4+Pb(NO3)2=2KNO3+PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
2Cu+8HCl=CuCl+HCu + HCl = CuCl + H
2HC2H3O2(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaC2H3O2(aq)2HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaC2H3O2(aq)
2 H3PO4 + 3 Cu = Cu3(PO4)2 + 3 H22H3PO4 + 3Cu = Cu3(PO4)2 + 3H2
2C2H6 + 4O2 = 4CO2 + 6H2010C2H6 + 20O2 = 20CO2 + 3H20
2NO2(g) +5O2(g) = N2O54NO2(g) + O2(g) = 2N2O5
2Al(s) + S(s)=3Al2S3(s)2Al(s) + 3S(s) = Al2S3(s)
2C16H34 + O2 = CO2 + H2O 2C16H34 + 49O2 = 32CO2 + 34H2O
2NH3+O2=N2O4+H2O4NH3 + 7O2 = 2N2O4 + 6H2O
2 AgNO3(aq) + CuI2(aq) = 2 AgI(s) + Cu(NO3)2(aq)2AgNO3(aq) + CuI2(aq) = 2AgI(s) + Cu(NO3)2(aq)
2H2O2= 2H2O+ O22H2O2 = 2H2O + O2
2Fe + 3CuSO4 = Fe2(SO4)3 + 3Cu 2Fe + 3CuSO4 = Fe2(SO4)3 + 3Cu
2Fe + 3CuSO4 = Fe2(SO4)3 + 3Cu 2Fe + 3CuSO4 = Fe2(SO4)3 + 3Cu
2HCl+2Na=2NaCl+H22HCl + 2Na = 2NaCl + H2
2HCl+2Na=NaCl2+H22HCl + Na = NaCl2 + H2
2HCl+Na=NaCl2+H22HCl + Na = NaCl2 + H2
2AlI3 + 3HgCl2 = 2AlCl3 + 3HgI22AlI3 + 3HgCl2 = 2AlCl3 + 3HgI2
2NaHCO3 =Na2CO3 + CO2 + H2O2NaHCO3 = Na2CO3 + CO2 + H2O
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2P2O5 + 6H2O = 4H3PO4P2O5 + 3H2O = 2H3PO4
2H2+O2=H2O2H2 + O2 = 2H2O
2HC2H3O2+K2CO3=H2O+CO2+2KC2H3O22HC2H3O2 + K2CO3 = H2O + CO2 + 2KC2H3O2
2SO2+O2=2SO2SO2 + 0O2 = SO2
2HCl+2NaHCO3=NaCl+CO2+H2OHCl + NaHCO3 = NaCl + CO2 + H2O
23CH2+52O2=CO2+H2O2CH2 + 3O2 = 2CO2 + 2H2O
23CH2+52O2=CO2+H2O2CH2 + 3O2 = 2CO2 + 2H2O
23CH2+52O2=CO2+H2O2CH2 + 3O2 = 2CO2 + 2H2O
23CH2+52O2=CO2+H2O2CH2 + 3O2 = 2CO2 + 2H2O
2 AlCl3 + 3 CaBr2 = 2 AlBr3 + 3 CaCl22AlCl3 + 3CaBr2 = 2AlBr3 + 3CaCl2
2AgNO3+Na2S=Ag2S+2NaNO32AgNO3 + Na2S = Ag2S + 2NaNO3
2 NaCl(aq) + Hg2(C2H3O2)2(aq) = 2 Na(C2H3O2)(aq) + 2 HgCl(aq)2NaCl(aq) + Hg2(C2H3O2)2(aq) = 2Na(C2H3O2)(aq) + 2HgCl(aq)
2KClO3=2KCl+3O22KClO3 = 2KCl + 3O2
2H2S+4LiOH=2Li2S+2H2OH2S + 2LiOH = Li2S + 2H2O
2Zn+I2=2ZnI2Zn + I2 = 2ZnI
2Na2SO4(aq) + CaCl2(aq) = CaSO4(s) + 2NaCl(aq)Na2SO4(aq) + CaCl2(aq) = CaSO4(s) + 2NaCl(aq)
2(NH3)2 + 7H2O = 2NO2 + 2H2O2-1(NH3)2 + 10H2O = -2NO2 + 7H2O2
2CaO+C=CaC2+CO22CaO + 5C = 2CaC2 + CO2
2 KCl = 2 K + Cl22KCl = 2K + Cl2
2N2H4(g)+N2O4(g)=3N2(g)+4H2O(g)2N2H4(g) + N2O4(g) = 3N2(g) + 4H2O(g)
2 HgO(s) = 2 Hg(l) + O2(g)2HgO(s) = 2Hg(l) + O2(g)
2 SnBr2 + 2 H2S = Sn2S2 + 4 HBr2SnBr2 + 2H2S = Sn2S2 + 4HBr
2HCl + 2KMnO4 = Cl2 + MnO2 + 2H2O + 2KCl8HCl + 2KMnO4 = 3Cl2 + 2MnO2 + 4H2O + 2KCl
2CCl3F + 4CaCO3 = 3CaCl2 + CaF2 + 6CO22CCl3F + 4CaCO3 = 3CaCl2 + CaF2 + 6CO2
2Na + 2H2O = 2NaOH + H22Na + 2H2O = 2NaOH + H2
2C2H6+4O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6+O2=4CO2+6H2010C2H6 + 20O2 = 20CO2 + 3H20
2C2H6+O2=4CO2+6H2010C2H6 + 20O2 = 20CO2 + 3H20
2NaBr+Ca(OH)2=CaBr2 +2NaOH2NaBr + Ca(OH)2 = CaBr2 + 2NaOH
2Al + 6HCl = 2AlCl3 + 3H22Al + 6HCl = 2AlCl3 + 3H2
2Al + 6HCl = 2AlCl3 + 3H22Al + 6HCl = 2AlCl3 + 3H2
2Mg(ClO3)2 = 2MgCl2 + 3O2Mg(ClO3)2 = MgCl2 + 3O2
2H2O2=2H2O+O22H2O2 = 2H2O + O2
2C4H10 + 13O2 = 8CO2 + 10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2Sr + O2 = 2SrO2Sr + O2 = 2SrO
2NaCl+MgO=Na2O+MgCl22NaCl + MgO = Na2O + MgCl2
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6+7O2=4CO2+6H2010C2H6 + 20O2 = 20CO2 + 3H20
2CO+O2=2CO22CO + O2 = 2CO2
2KBr+ Pb(NO3)2=2KNO3+PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2Al+ Cl2=2AlCl32Al + 3Cl2 = 2AlCl3
2 Sr(OH)2 + 2 FeCl2 = 2 Fe(OH)2 + SrCl2Sr(OH)2 + FeCl2 = Fe(OH)2 + SrCl2
2Na + Br2 = 2NaBr2Na + Br2 = 2NaBr
2HC2H3O2(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaC2H3O2(aq)2HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaC2H3O2(aq)
2HC2H3O2(aq)+Na2CO3(aq)=H2O(l)+CO2(g)+2NaC2H3O2(aq)2HC2H3O2(aq) + Na2CO3(aq) = H2O(l) + CO2(g) + 2NaC2H3O2(aq)
2C3H6O2 + O2 = 6CO2 + H2O 2C3H6O2 + 7O2 = 6CO2 + 6H2O
2C3H6O2 + O2 = 6CO2 + H2O 2C3H6O2 + 7O2 = 6CO2 + 6H2O
2C4H10 + 12O2 = 8CO2 + 10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2Li(s) + At2(g) = LiAt(s)2Li(s) + At2(g) = 2LiAt(s)
2Li(s) + At2(g) = LiAt(s)2Li(s) + At2(g) = 2LiAt(s)

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.