Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:





Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
2H2O=H2OH2O = H2O
2Al+3Ag2S=6Ag+Al2S32Al + 3Ag2S = 6Ag + Al2S3
2HCl(g) = H2(g)+Cl2(g)2HCl(g) = H2(g) + Cl2(g)
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2 CH3CH2CH3 + 7 O2 = 6 CO + 8 H2O2CH3CH2CH3 + 7O2 = 6CO + 8H2O
2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl2Na3PO4 + 3CaCl2 = Ca3(PO4)2 + 6NaCl
2H2O(l) + 2CO2(g) = 2H2CO3(aq)H2O(l) + CO2(g) = H2CO3(aq)
2K3PO4 (aq) + 3 Ba(NO3)2(aq) = Ba3(PO4)2(s) + 6KNO3(aq)2K3PO4(aq) + 3Ba(NO3)2(aq) = Ba3(PO4)2(s) + 6KNO3(aq)
2C3H8S + 13O2 = CO2 + H2O + SO32C3H8S + 13O2 = 6CO2 + 8H2O + 2SO3
2C3H8S + 13O2 = CO2 + H2O + SO32C3H8S + 13O2 = 6CO2 + 8H2O + 2SO3
2C3H8S + 13O2 = CO2 + H2O + SO32C3H8S + 13O2 = 6CO2 + 8H2O + 2SO3
2Zn + HNO3 = 2Zn(NO3)2 + NH4NO3 + H2010Zn + 20HNO3 = 10Zn(NO3)2 + 0NH4NO3 + H20
2N2 + 6H2 = 2NH3N2 + 3H2 = 2NH3
2N2 + 6H2 = 2NH3N2 + 3H2 = 2NH3
2FeO +3C =3CO + 2FeFeO + C = CO + Fe
2K3PO4 (aq) + Ba(NO3)2(aq)=Ba3(PO4)2(s) + 6KNO3(aq)2K3PO4(aq) + 3Ba(NO3)2(aq) = Ba3(PO4)2(s) + 6KNO3(aq)
2K3PO4 (aq) + 3 Ba(NO3)2(aq)=Ba3(PO4)2(s) + 6KNO3(aq)2K3PO4(aq) + 3Ba(NO3)2(aq) = Ba3(PO4)2(s) + 6KNO3(aq)
2 L2 + 4 Na2S2O3 = 4NaL + 2 Na2S4O6L2 + 2Na2S2O3 = 2NaL + Na2S4O6
2Mg + 2HCl = 2MgCl+H22Mg + 2HCl = 2MgCl + H2
2K+2HCl=2KCl+H22K + 2HCl = 2KCl + H2
2K+2HCl=2KCl=H22K + 2HCl = 2KCl + H2
2K+2HCl=2KCl=H22K + 2HCl = 2KCl + H2
2K+2HCl=2KCl=H22K + 2HCl = 2KCl + H2
2 KBr + 3 O2= 2 KBrO32KBr + 3O2 = 2KBrO3
2 Al + 3Cu (NO3)2 = 2 Al(NO3)3 + 3Cu2Al + 3Cu(NO3)2 = 2Al(NO3)3 + 3Cu
2P4 + 5O2 = P4O10P4 + 5O2 = P4O10
2P4 + 5O2 = P4O10P4 + 5O2 = P4O10
2KCLO3 = 2KCL + 3O22KCLO3 = 2KCL + 3O2
2C2H6 + 7O2 =4CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + 7O2 =4CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + 7O2 =4CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6 + 7O2 = 4CO2 + H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2HCLO+Ca(OH)2 = 2H2O + Ca(CLO)22HCLO + Ca(OH)2 = 2H2O + Ca(CLO)2
2N2 + 2H2 = 2NH3N2 + 3H2 = 2NH3
2C16H34+O2=CO2+H2O2C16H34 + 49O2 = 32CO2 + 34H2O
2NaNO3(s)=2NaNO2(g)+O2(g)2NaNO3(s) = 2NaNO2(g) + O2(g)
2NaNO3(s)=2NaNO2(g)+O2(g)2NaNO3(s) = 2NaNO2(g) + O2(g)
2KCl=2K+Cl22KCl = 2K + Cl2
2CO3+Cr3(PO4)2=PO4+CrCO33CO3 + Cr3(PO4)2 = 2PO4 + 3CrCO3
2KOH + HCl = KCl + H2OKOH + HCl = KCl + H2O
2 KMNO4 + 10 FeSO4 + 8 H2SO4 = K2SO4 + 2 MNSO4 + 5 Fe2(SO4)3 + 8 H2O2KMNO4 + 10FeSO4 + 8H2SO4 = K2SO4 + 2MNSO4 + 5Fe2(SO4)3 + 8H2O
2CO(g) + 2O2(g) = 2CO2(g)2CO(g) + O2(g) = 2CO2(g)
2CO(g) + O2(g) =2CO2(g)2CO(g) + O2(g) = 2CO2(g)
2Na + O2 =Na2O4Na + O2 = 2Na2O
2Na + O2 =Na2O4Na + O2 = 2Na2O
2N2O5+NO=4NO2N2O5 + NO = 3NO2
2C + O2 = 2CO2C + O2 = 2CO
2MgNH4PO4=Mg2P2O7 +2NH3 +H2O2MgNH4PO4 = Mg2P2O7 + 2NH3 + H2O
2 Fe(OH)3 = 1 Fe2O3 + 3 H2O2Fe(OH)3 = Fe2O3 + 3H2O
2NaNO3 = 3NaNO2 + O22NaNO3 = 2NaNO2 + O2
2CuSO4+4NaHCO3= CuCO3Cu(OH)2+2Na2SO4+3CO2+H2O2CuSO4 + 4NaHCO3 = CuCO3Cu(OH)2 + 2Na2SO4 + 3CO2 + H2O
2CuSO4+4NaHCO3= CuCO3 Cu(OH)2+2Na2SO4+3CO2+H2O2CuSO4 + 4NaHCO3 = CuCO3Cu(OH)2 + 2Na2SO4 + 3CO2 + H2O
2NaH+2KNO2=2NO+H2+K2O+Na2O2NaH + 2KNO2 = 2NO + H2 + K2O + Na2O
2NaH+2KNO2=2NO+H2+K2O+NaO2NaH + 4KNO2 = 4NO + H2 + 2K2O + 2NaO
2NaH+2KNO2=2NO+H2+K2O+Na2O2NaH + 2KNO2 = 2NO + H2 + K2O + Na2O
2HCl(g) = H2(g)+Cl2(g) 2HCl(g) = H2(g) + Cl2(g)
2Mg + O2 = 2MgO2Mg + O2 = MgO2
2AgCl+NH4OH=AgClNH3+H2OAgCl + NH4OH = AgClNH3 + H2O
2LiBr + F2 = 2Li + 2FBr2LiBr + F2 = 2Li + 2FBr
2LiBr + F2 = 2Li + 2FBr2LiBr + F2 = 2Li + 2FBr
2AlBr3 + Cl2 = AlCl3 + 3Br22AlBr3 + 3Cl2 = 2AlCl3 + 3Br2
2Mg + 2HCl = H2 + MgCl2Mg + 2HCl = H2 + MgCl2
2NO + O2 = 2NO22NO + O2 = 2NO2
2KCl + Pb(NO3)2 = 2KNO3 + PbCl22KCl + Pb(NO3)2 = 2KNO3 + PbCl2
2C3H8 + O2 = H2O+ CO2C3H8 + 5O2 = 4H2O + 3CO2
2KBr + Pb(NO3)2 = 2KNO3 + PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2KBr + Pb(NO3)2 = 2KNO3 + PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2NaHCO3 + 4C12H22O11 = Na2CO3 + H2O + CO372NaHCO3 - C12H22O11 = 36Na2CO3 + 25H2O + 24CO3
2NaHCO3 + 4C12H22O11 = Na2CO3 + H2O + CO372NaHCO3 - C12H22O11 = 36Na2CO3 + 25H2O + 24CO3
2NaHCO3 + C12H22O11 = Na2CO3 + H2O + CO372NaHCO3 - C12H22O11 = 36Na2CO3 + 25H2O + 24CO3
2NaHCO3 + C12H22O11 = Na2CO3 + H2O + CO372NaHCO3 - C12H22O11 = 36Na2CO3 + 25H2O + 24CO3
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2Na3(PO4) +3CaCl2 = Ca3(PO4)2 + 6NaCl2Na3(PO4) + 3CaCl2 = Ca3(PO4)2 + 6NaCl
2Na3(PO4) +3CaCl2 = Ca3(PO4)2 + 6NaCl2Na3(PO4) + 3CaCl2 = Ca3(PO4)2 + 6NaCl
2HCl + Na2CO3 = 2NaCl + H2O + CO22HCl + Na2CO3 = 2NaCl + H2O + CO2
2Fe+3O2=2Fe2O34Fe + 3O2 = 2Fe2O3
2Fe+3O2=2Fe2O34Fe + 3O2 = 2Fe2O3
2Fe+3O2=2Fe2O34Fe + 3O2 = 2Fe2O3
2BN+3F2=2BF3+N2BN + 3F2 = 2BF3 + 2N
2Fe+3Br2=2FeBr2Fe + Br2 = 2FeBr
2C5H8O2+CoCO3=2C5H7O2+2HCoCO3C5H8O2 + CoCO3 = C5H7O2 + HCoCO3
2C5H8O2+CoCO3=2C5H7O2+HCoCO3C5H8O2 + CoCO3 = C5H7O2 + HCoCO3
2C5H8O2+CoCO3=C5H7O2+HCoCO3C5H8O2 + CoCO3 = C5H7O2 + HCoCO3
2CH3OH+3O2=2CO2+4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CH3OH+3O2=2CO2+4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2CH3OH+3O2=2CO2+4H2O2CH3OH + 3O2 = 2CO2 + 4H2O
2ZnS (s) + 2HCl (aq)=4ZnCl2 (aq) + H2S (g)ZnS(s) + 2HCl(aq) = ZnCl2(aq) + H2S(g)
2H2O = 4H2 + O22H2O = 2H2 + O2
2CaS + 3O2 = 2CaO + 2SO22CaS + 3O2 = 2CaO + 2SO2
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2CaO + 2SO2 + O2 = 2CaSO42CaO + 2SO2 + O2 = 2CaSO4
2Cl2 + O2 = 2Cl2O2Cl2 + O2 = 2Cl2O
2Cl2 + O2 = 2Cl2O2Cl2 + O2 = 2Cl2O
2 Al + 6 HCl = 2 AlCl3 + 3 H22Al + 6HCl = 2AlCl3 + 3H2
2 Al(s) + 6 HCl(aq) = 2 AlCl3(aq) + 3 H2(g)2Al(s) + 6HCl(aq) = 2AlCl3(aq) + 3H2(g)
2AgNO3 + Mg = 2Ag + Mg(NO3)22AgNO3 + Mg = 2Ag + Mg(NO3)2
2NaHCO3 = Na2O + H2O + 2CO22NaHCO3 = Na2O + H2O + 2CO2
2ZnS (s) + 2HCl (aq) = 4ZnCl2 (aq) + H2S (g)ZnS(s) + 2HCl(aq) = ZnCl2(aq) + H2S(g)
2Fe2+3O2=2Fe2O32Fe2 + 3O2 = 2Fe2O3
2Fe+3O2=2Fe2O34Fe + 3O2 = 2Fe2O3
2NO (g) + 5H2 (g) = 2NH3 (g) + 2H2O (g)2NO(g) + 5H2(g) = 2NH3(g) + 2H2O(g)
2Na+Cl2=2NaCl2Na + Cl2 = 2NaCl
2 KMnO4 + 5 Na2C2O4 + 8 H2SO4 =K2SO4 + 2 MnSO4 + 5 Na2SO4 + 10 CO2 + 8H2O2KMnO4 + 5Na2C2O4 + 8H2SO4 = K2SO4 + 2MnSO4 + 5Na2SO4 + 10CO2 + 8H2O
2H2S (g) + O2 (g) = SO2 (g) + 2H2O (g)2H2S(g) + 3O2(g) = 2SO2(g) + 2H2O(g)
2K3PO4 (aq) + 3CuSO4 (aq) = Cu3(PO4)2 (aq) + 3K2SO42K3PO4(aq) + 3CuSO4(aq) = Cu3(PO4)2(aq) + 3K2SO4
2K3PO4 (aq) + 3CuSO4 (aq) = Cu3(PO4)2 (aq) + 3K2SO42K3PO4(aq) + 3CuSO4(aq) = Cu3(PO4)2(aq) + 3K2SO4
2Sb2O3 + 24HCl = 4H3SbCl6 + 6H2OSb2O3 + 12HCl = 2H3SbCl6 + 3H2O
2LiCl + Na2O = Li2O + 2NaCl2LiCl + Na2O = Li2O + 2NaCl
2 NaHSO3 + 2 S2Cl2 + H2O = 2H2SO4 + 2NaCl+ HSO32NaHSO3 + S2Cl2 - 4H2O = -10H2SO4 + 2NaCl + 14HSO3
2Fe + 3O2 =Fe2O34Fe + 3O2 = 2Fe2O3
2Fe + 3O2 =Fe2O34Fe + 3O2 = 2Fe2O3
2CaCO3+4HCl=2CaCl2+3CO2+2H2OCaCO3 + 2HCl = CaCl2 + CO2 + H2O
2Li + 2H2O = LiOH + H22Li + 2H2O = 2LiOH + H2
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2H2S + O2 = SO2 + 2H2O2H2S + 3O2 = 2SO2 + 2H2O
2 C4H10(g) + 13 O2(g)= 8 CO2(g) + 10 H2O(l)2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(l)
2 H2S ( g ) + 3 O2 ( g ) = 2 H2O ( l ) + 2 SO2 ( g )2H2S(g) + 3O2(g) = 2H2O(l) + 2SO2(g)
2HNO3+2NaOH=2NaNO3+H2OHNO3 + NaOH = NaNO3 + H2O
2HNO3+2NaOH=2NaNO3+H2OHNO3 + NaOH = NaNO3 + H2O
2NaHCO3+4H2O2+H2S = Na2SO4+6H2O+2CO22NaHCO3 + 4H2O2 + H2S = Na2SO4 + 6H2O + 2CO2
2I2+KIO3+6HCl=5ICl+KCl+3H2O2I2 + KIO3 + 6HCl = 5ICl + KCl + 3H2O
2Fe3+3S2=3Fe22S344Fe3 + 9S2 = 6Fe22S3
2N2 + 9H2 = 2NH3N2 + 3H2 = 2NH3
2HI = 2H + 2IHI = H + I
2H2+O2=H2O2H2 + O2 = 2H2O
2 NaOH + Ca(HCO3)2 = Ca(OH)2 + 2 NaHCO32NaOH + Ca(HCO3)2 = Ca(OH)2 + 2NaHCO3
2Li + 2H2O = 2LiOH+ H22Li + 2H2O = 2LiOH + H2
2 AgNO3 + K2S = Ag2S + 2 KNO32AgNO3 + K2S = Ag2S + 2KNO3
2V + O3 = V2O32V + O3 = V2O3
2 Fe(s) + 3 H2SO4(aq) = Fe2(SO4)3(aq) + 3 H2 (aq)2Fe(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) + 3H2(aq)
2K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
2Na+1Cl2=2NaCl2Na + Cl2 = 2NaCl
2Sn + 2H2SO4 = 2SnSO4 + SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2 Sn + 2H2SO4 = 2SnSO4 + SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Sn + 2H2SO4 = 2SnSO4 + SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Sn + 2H2SO4 = 2SnSO4 + SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2LiOH + CO2 = Li2CO3 + H2O2LiOH + CO2 = Li2CO3 + H2O
2Ag + 2CrO = AgCrOAg + CrO = AgCrO
2Al + Cl2 = 2AlCl32Al + 3Cl2 = 2AlCl3
2Zn+HNO3=2Zn(NO3)2+NH4NO3+H2O4Zn + 10HNO3 = 4Zn(NO3)2 + NH4NO3 + 3H2O
2 HCI+Na2SO4=2 NaCI+H2SO42HCI + Na2SO4 = 2NaCI + H2SO4
2C6H4Cl2 + 7O2 = CO + H2O + HCl2C6H4Cl2 + 7O2 = 12CO + 2H2O + 4HCl
2C6H4Cl2 + 7O2 = CO + H2O + HCl2C6H4Cl2 + 7O2 = 12CO + 2H2O + 4HCl
2KBr+Pb(NO3)2=2KNO3+PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2C2H3Br + 3O2 =CO + H2O + HBr2C2H3Br + 3O2 = 4CO + 2H2O + 2HBr
2C2H3Br + 3O2 =CO + H2O + HBr2C2H3Br + 3O2 = 4CO + 2H2O + 2HBr
2Mg + O2 = MgO2Mg + O2 = 2MgO
2Na + H2O = NaOH + H22Na + 2H2O = 2NaOH + H2
2Na+2H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2LiOH + 2HBr = 2LiBr + 2H2OLiOH + HBr = LiBr + H2O
2C10H12O + 25O2 = 20 CO2 + 12 H2O2C10H12O + 25O2 = 20CO2 + 12H2O
2NI3=N2+3I22NI3 = N2 + 3I2
2Pb(NO3)2 = 2PbO + 4NO2 + O22Pb(NO3)2 = 2PbO + 4NO2 + O2
2AI+3I2=2AII32AI + 3I2 = 2AII3
2HI=H2+I22HI = H2 + I2
2NI3=N2+3I22NI3 = N2 + 3I2
2NH3=3N2+2H22NH3 = N2 + 3H2
2Sn + 2H2SO4 = 2SnSO4 + SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2NI3=N2+3I22NI3 = N2 + 3I2
2NH3=3N2+2H22NH3 = N2 + 3H2
2CO+O2=2CO22CO + O2 = 2CO2
2Na Cl+H2=NaH+Cl22NaCl + H2 = 2NaH + Cl2
2K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4K2CrO4 + Pb(NO3)2 = 2KNO3 + PbCrO4
2NaN3+Fe2O3=Na2O+2Fe+3N26NaN3 + Fe2O3 = 3Na2O + 2Fe + 9N2
2NH4NO3 = 2N2 + O2 + 4H2O 2NH4NO3 = 2N2 + O2 + 4H2O
2NaOH+CuSO4=2Na+Cu(OH)2+SO42NaOH + CuSO4 = 2Na + Cu(OH)2 + SO4
2H2 + O2 = 2 H2O2H2 + O2 = 2H2O
2Al + Cl2 = 2AlCl32Al + 3Cl2 = 2AlCl3
2 KI + 2 H2O = H2 + I2 + KOH 2KI + 2H2O = H2 + I2 + 2KOH
2 KI + 2 H2O = H2 + I2 + 2 KOH 2KI + 2H2O = H2 + I2 + 2KOH
2NaN3(s) = 3 N2+ 2 Na2NaN3(s) = 3N2 + 2Na
2NaN3(s) = 3 N2+ 2 Na2NaN3(s) = 3N2 + 2Na
2NaCl+H2SO4=Na2SO4+2HCl2NaCl + H2SO4 = Na2SO4 + 2HCl
2CaO+H2O=Ca(OH)2CaO + H2O = Ca(OH)2
2Al+6HCl=3H2+2AlCl32Al + 6HCl = 3H2 + 2AlCl3
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2H2O2=2H2O+O22H2O2 = 2H2O + O2
2H2O2=2H2O+O22H2O2 = 2H2O + O2
2H2O2=2H2O+O22H2O2 = 2H2O + O2
2Al2O3=4Al+3O22Al2O3 = 4Al + 3O2
2C+H2=CH4C + 2H2 = CH4
2Na+H2O =Na OH+2H22Na + 2H2O = 2NaOH + H2
2Na + 2H2O =2NaOH + H1Na + H2O = NaOH + H1
2Na + 2H2O =2NaOH + H22Na + 2H2O = 2NaOH + H2
2C2H5OH + 3O2 = 2CO2 +3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2C2H5OH + 3O2 = 2CO2 +3H2OC2H5OH + 3O2 = 2CO2 + 3H2O
2Ca 3 (PO 4 ) 2 + C + 6SiO 2 =CaSiO 3 + P 4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2HCl(aq)+Ca(OH)2(aq) = CaCl2(aq)+2HOH2HCl(aq) + Ca(OH)2(aq) = CaCl2(aq) + 2HOH
2Cu+4H2SO4=2CuSO4+2SO2+4H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
2Cu+4H2SO4=2CuSO4+2SO2+4H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
2Cu+4H2SO4=2CuSO4+2SO2+4H2OCu + 2H2SO4 = CuSO4 + SO2 + 2H2O
2Na + 2H2O = 2NaOH +H22Na + 2H2O = 2NaOH + H2
2KCl + Pb(NO3)2 = 2KNO3 + PbCl22KCl + Pb(NO3)2 = 2KNO3 + PbCl2
2HNO2 + 2NaClO2 = 2NaNO3 + Cl2 + H2O22HNO2 + 2NaClO2 = 2NaNO3 + Cl2 + H2O2
2N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
2NaHCO3+H2SO4=CO2+H2O+Na2SO42NaHCO3 + H2SO4 = 2CO2 + 2H2O + Na2SO4
2NaHCO3+2H2SO4=CO2+H2O+Na2SO42NaHCO3 + H2SO4 = 2CO2 + 2H2O + Na2SO4
2HI(aq)+2Pb(NO3)2(aq)=PbI2(s)+2H(NO3)2HI(aq) + Pb(NO3)2(aq) = PbI2(s) + 2H(NO3)
2ZnS + 2HCl = 4ZnCl2 +H2SZnS + 2HCl = ZnCl2 + H2S
2H2 + O2 = H2O2H2 + O2 = 2H2O
2N2 + O2 = N2O2N2 + O2 = 2N2O
2Al+3CuCl2=2AlCl3+3Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
2Zn+HNO3=2Zn(NO3)2+NH4NO3+H2O4Zn + 10HNO3 = 4Zn(NO3)2 + NH4NO3 + 3H2O
2CO+O2 = 2CO22CO + O2 = 2CO2
2HCl + CuO = CuCl2 + H2O2HCl + CuO = CuCl2 + H2O
2H2 + O2 == 2H2O2H2 + O2 = 2H2O
2H2+O2=H2O2H2 + O2 = 2H2O
2H2+O2=H2O2H2 + O2 = 2H2O
2MnO2+4KOH=2K2MnO4+2H2MnO2 + 2KOH = K2MnO4 + H2
2NH4Br(aq)+Pb(C2H3O2)2(aq)=PbBr2(s)+2NH4C2H3O2(aq)2NH4Br(aq) + Pb(C2H3O2)2(aq) = PbBr2(s) + 2NH4C2H3O2(aq)
2H2 + O2 = H2O2H2 + O2 = 2H2O
2H2 + O2 = H2O2H2 + O2 = 2H2O
2Na+H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Na+H2O=2NaOH+H22Na + 2H2O = 2NaOH + H2
2Ba + SO4 = BaSO4Ba + SO4 = BaSO4
2Fe2O3 + 2Al = 2Fe + 2Al2O3Fe2O3 + 2Al = 2Fe + Al2O3
2HClO + Ca(OH)2 = 2H2O + Ca(ClO)22HClO + Ca(OH)2 = 2H2O + Ca(ClO)2
2Na + 2H2O =2NaOH + H22Na + 2H2O = 2NaOH + H2
2Al + HSO4 = Al2(SO4)3 + H24Al + 6HSO4 = 2Al2(SO4)3 + 3H2
2BN+3F2=2BF3+N22BN + 3F2 = 2BF3 + N2
2Fe+3Br2=2FeBr2Fe + Br2 = 2FeBr
2Cr(CO)6+4KOH=KHCr2(CO)10+K2CO3+KHOO+H2O2Cr(CO)6 + 4KOH = KHCr2(CO)10 + 2K2CO3 - KHOO + 2H2O
2Al+6NaOH= 2Na3AlO3+2H22Al + 6NaOH = 2Na3AlO3 + 3H2
2HCl(aq) + Cu(s) = CuCl2 (aq) + 2H2(g)2HCl(aq) + Cu(s) = CuCl2(aq) + H2(g)
2Fe(OH)3+3H2S= Fe2S3+6H2O2Fe(OH)3 + 3H2S = Fe2S3 + 6H2O
2C4H10 + 13 O2 = 8CO2 + 10H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
2N2 + 3H2=2NH3N2 + 3H2 = 2NH3
2Mg + N2 = Mg3N23Mg + N2 = Mg3N2
2Mg + N2 = Mg3N23Mg + N2 = Mg3N2
2N2 + O2= 2NO2N2 + 2O2 = 2NO2
2Sn + 2H2SO4 = 2Sn SO4 + SO2 + 2H2O Sn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Sn + 2H2SO4 = 2SnSO4 + SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Sn + 2H2SO4 = 2SnSO4+SO2+2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Mg + N2 = Mg3N23Mg + N2 = Mg3N2
2Ca + Cl2 = 2CaCl2Ca + Cl2 = 2CaCl
2Fe + 3H2SO4 = Fe2(SO4)3 + 3H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
2Fe + 3H2SO4 = Fe(SO4)3 + 3H2Fe + 3H2SO4 = Fe(SO4)3 + 3H2
2Fe + 3H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
2Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
2Fe + H2SO4 = FeSO4 + H2Fe + H2SO4 = FeSO4 + H2
2Zn+1H2SO4=1ZnSO4+1H2Zn + H2SO4 = ZnSO4 + H2
2Na + S = 2NaSNa + S = NaS
2N2 + O2 = 2NO2N2 + 2O2 = 2NO2
2Mg + N2 =Mg3N23Mg + N2 = Mg3N2
2Al + 6HCl = H2 + 2AlCl32Al + 6HCl = 3H2 + 2AlCl3
2NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
2Al + 3NiI2 = 2AlI3 + 3Ni2Al + 3NiI2 = 2AlI3 + 3Ni
2N2 + 6H2 = 2NH3N2 + 3H2 = 2NH3
2Sn+2(H2)3S(O2)=2SnS(O4)+(S4)O2+2(H2)O-6Sn + 14(H2)3S(O2) = -6SnS(O4) + 5(S4)O2 + 42(H2)O
2C + 2O2 = 2CO2C + O2 = CO2
2Li2 + O2 = 2Li2O2Li2 + O2 = 2Li2O
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Ag2O = 2Ag2 + O22Ag2O = 2Ag2 + O2
2ZnS (s) + 2HCl (aq) = 4ZnCl2 (aq) + H2S (g)ZnS(s) + 2HCl(aq) = ZnCl2(aq) + H2S(g)
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2Al + Cl2 = 2AlCl32Al + 3Cl2 = 2AlCl3
2Al + 3S = Al2S32Al + 3S = Al2S3
2Na + S = Na2S2Na + S = Na2S
2Ag2O=Ag + O22Ag2O = 4Ag + O2
2Ag2O=Ag + O22Ag2O = 4Ag + O2
2LiOH + CO2 = Li2CO3 + H2O2LiOH + CO2 = Li2CO3 + H2O
2LiOH + CO2 = Li2CO3 + H2O2LiOH + CO2 = Li2CO3 + H2O
2C2H2 + 5O2 = CO2 + H2010C2H2 + 20O2 = 20CO2 + H20
2NaIO3+CaCl2*2H2O = 2NaCl+Ca(IO3)2+2H2O2NaIO3 + CaCl2*2H2O = 2NaCl + Ca(IO3)2 + 2H2O
2NaIO3+CaCl2*2H2O = 2NaCl+Ca(IO3)2+2H2O2NaIO3 + CaCl2*2H2O = 2NaCl + Ca(IO3)2 + 2H2O
2Ag2O=Ag + O22Ag2O = 4Ag + O2
2N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
2N2 + 3H2 = 2NH3N2 + 3H2 = 2NH3
2Mg + N2 = Mg3N23Mg + N2 = Mg3N2
2N2 + 6H2 = 2NH3N2 + 3H2 = 2NH3
2Ag2O = 4Ag + O22Ag2O = 4Ag + O2
2Ag2O = 4Ag + O22Ag2O = 4Ag + O2
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2C2H6+7O2=4CO2+6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2N2 + O2= 2NO2N2 + 2O2 = 2NO2
2N2 + O2= 2NO2N2 + 2O2 = 2NO2
2C2H2 + O2 = 4CO2 + H2O2C2H2 + 5O2 = 4CO2 + 2H2O
2CH2+3O2=2CO2+2H2O2CH2 + 3O2 = 2CO2 + 2H2O
2CH2+3O2=2CO2+2H2O2CH2 + 3O2 = 2CO2 + 2H2O
2NaCl + Pb(NO3)2 =2 NaNO3 + PbCl22NaCl + Pb(NO3)2 = 2NaNO3 + PbCl2
2KI+Br2=2KBr+I22KI + Br2 = 2KBr + I2
2K(s)+Cl2(g)=2KCl(s)2K(s) + Cl2(g) = 2KCl(s)
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2NaI + 2Br2 = 2NaBr2 + I22NaI + 2Br2 = 2NaBr2 + I2
2FeCl3+3Ca(OH)2=2Fe(OH)3+3CaCl22FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2 Sn + 2 H2SO4 = 2 SnSO4 + SO2 + 2 H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2CH4 + O2 = 2CO +4H22CH4 + O2 = 2CO + 4H2
2Fe + 2CO = 2FeC + O22Fe + 2CO = 2FeC + O2
2KNO3 + 2H2CO3 = 2K2CO3 + 2HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
2C2H6 + 5O2 = 3H2O + 4CO22C2H6 + 7O2 = 6H2O + 4CO2
2H3PO4 + HCl = PCl5 + 3H2OH3PO4 + 5HCl = PCl5 + 4H2O
2 Sn + 2 H2SO4 = 2 SnSO4 +SO2 + 2H2OSn + 2H2SO4 = SnSO4 + SO2 + 2H2O
2 SrCl2 + 2 H2SO4 = 2 SrSO4 + 4 HClSrCl2 + H2SO4 = SrSO4 + 2HCl
2Na(s)+LiCl2(aq)=Li(s)+2NaCl(aq)2Na(s) + LiCl2(aq) = Li(s) + 2NaCl(aq)
2Ag(s)+CuCl2(aq)=Cu(s)+2AgCl(aq)2Ag(s) + CuCl2(aq) = Cu(s) + 2AgCl(aq)
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2NaOH + H2SO4 = Na2SO4 + 2H2O2NaOH + H2SO4 = Na2SO4 + 2H2O
2FeS2 + 3O2 + 2H20 = 2Fe (OH)2 + H2SO410FeS2 + 50O2 + 3H20 = 10Fe(OH)2 + 20H2SO4
2Zn+4HCl = 2ZnCl + 2H22Zn + 2HCl = 2ZnCl + H2
2HNO3+ 2SO2 + H2O =N2O3 +2H2SO42HNO3 + 2SO2 + H2O = N2O3 + 2H2SO4
2HNO3+ 2SO2 + H2O =N2O3 +2H2SO42HNO3 + 2SO2 + H2O = N2O3 + 2H2SO4
2NaN3 + 2HNO2 = 3N2 + 2NO + 2NaOH2NaN3 + 2HNO2 = 3N2 + 2NO + 2NaOH
2Na + 2H2O = 2NaOH + H22Na + 2H2O = 2NaOH + H2
2Cu + 3FeCl2 = 3Fe + 2CuCl3 2Cu + 3FeCl2 = 3Fe + 2CuCl3
2HCl + 2KMnO4=Cl2 + MnO2 + 2H2O + 2KCl8HCl + 2KMnO4 = 3Cl2 + 2MnO2 + 4H2O + 2KCl
2Al+3CuSO4=Cu+AlSO4Al + CuSO4 = Cu + AlSO4
2Al+3CuSO4=Cu+AlSO4Al + CuSO4 = Cu + AlSO4
2NaHSO4 + Ca(NO3)2 = 2HNO3 + CaSO4 + Na2SO4 2NaHSO4 + Ca(NO3)2 = 2HNO3 + CaSO4 + Na2SO4
2NaHSO4 + Ca(NO3)2 = 2HNO3 +CaSO4 (s) + Na2SO4 2NaHSO4 + Ca(NO3)2 = 2HNO3 + CaSO4(s) + Na2SO4
2H2S(g) + O2 = 2H2O(g) + 2S88H2S(g) + 4O2 = 8H2O(g) + S8
2K+Cl2=2KCl2K + Cl2 = 2KCl
2K+Cl=2KClK + Cl = KCl
2K+Cl=2KClK + Cl = KCl
2 CuSO4*5H2O + C6H12O6 = C6H12O7 + Cu2O + 2 H2SO4 + 8 H2O2CuSO4*5H2O + C6H12O6 = C6H12O7 + Cu2O + 2H2SO4 + 8H2O
2C6H6S2 + O2 = CO2 + H20 + 4SO310C6H6S2 + 90O2 = 60CO2 + 3H20 + 20SO3
2 Ag + CuS = 2AgCuSAg + CuS = AgCuS
2Ca+H2SO4====Ca2SO4+2H2Ca + H2SO4 = Ca2SO4 + 2H
2Fe2O3+3C=4Fe+3CO22Fe2O3 + 3C = 4Fe + 3CO2
2CH3(CH2)16COOK+MgCl2=Mg(C17H35CO2)2 +2KCl2CH3(CH2)16COOK + MgCl2 = Mg(C17H35CO2)2 + 2KCl
2CO(g)+O2(g)=2CO2(g)2CO(g) + O2(g) = 2CO2(g)
2CO(g)+O2(g)=2CO2(g)2CO(g) + O2(g) = 2CO2(g)
2H + 2O=H2O22H + 2O = H2O2
2H+O=H2O22H + 2O = H2O2
2H+O=H2O2H + O = H2O
2NaN3=Na+3N22NaN3 = 2Na + 3N2
2K + I2 = 2KI2K + I2 = 2KI
2 NH3 + 3 NO = N2 + 3 H2O4NH3 + 6NO = 5N2 + 6H2O
2Ca(OH)2 + 3SO2 = Ca2O10H4S32Ca(OH)2 + 3SO2 = Ca2O10H4S3
2N2+6H2=2NH3N2 + 3H2 = 2NH3
2Al2 (CO3)3 = Al2O3 + 6CO2Al2(CO3)3 = Al2O3 + 3CO2
2NaN3=Na+3N22NaN3 = 2Na + 3N2
2AlBr3+Fe2O3=Al2O3+2FeBr32AlBr3 + Fe2O3 = Al2O3 + 2FeBr3
2Ag2O = Ag + O2 2Ag2O = 4Ag + O2
2CaOH(aq) + CO2 (g) = H2O(l) + Ca2CO3 (s)2CaOH(aq) + CO2(g) = H2O(l) + Ca2CO3(s)
2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + NaCl2Na3PO4 + 3BaCl2 = Ba3(PO4)2 + 6NaCl
2HCl + Ca(OH)2 = CaCl2 + H2O2HCl + Ca(OH)2 = CaCl2 + 2H2O
2Na(s) + Br2(l) = 2NaBr(s)2Na(s) + Br2(l) = 2NaBr(s)
2KCIO3= KCI+3O22KCIO3 = 2KCI + 3O2
2HCl + 2Ca(OH)2=2CaCl2 + 2H2O2HCl + Ca(OH)2 = CaCl2 + 2H2O
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2Al+3Cl2=2AlCl32Al + 3Cl2 = 2AlCl3
2Fe2O3=4Fe+3O22Fe2O3 = 4Fe + 3O2
2Sb2OS2 + 10O2 =2Sb2O5 + 4SO3Sb2OS2 + 5O2 = Sb2O5 + 2SO3
2Sb2OS2 + 10O2 = 2Sb2O5 + 4SO3Sb2OS2 + 5O2 = Sb2O5 + 2SO3
2Al(OH)3 + H2CO3 = Al2(CO3)3 + 6H2O2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O
2 FeS + 3 H2O2 = S + 2 Fe(OH)32FeS + 3H2O2 = 2S + 2Fe(OH)3
2AlBr3 +3K2SO4 = 6KBr +Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
2AlBr3 +3K2SO4 = 6KBr +Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
2AlBr3 +3K2SO4 = 6KBr +Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
2N2 + 4O2 + H2O = 4HNO32N2 + 5O2 + 2H2O = 4HNO3
2AgNO3+ MgCl2=Mg(NO3)2+2AgCl2AgNO3 + MgCl2 = Mg(NO3)2 + 2AgCl
2Al + 6NaOH = 2Na3AlO3 + 2H22Al + 6NaOH = 2Na3AlO3 + 3H2
2NaBH4 + 2HI = B2H6 + 2NaI + 2H22NaBH4 + 2HI = B2H6 + 2NaI + 2H2
2NaBH4 + 2HI = B2H6 + 2NaI + 2H22NaBH4 + 2HI = B2H6 + 2NaI + 2H2
2NaN3 = Na + 3N22NaN3 = 2Na + 3N2
2Ag2O = 2Ag + O22Ag2O = 4Ag + O2
2A1+Fe2O3=2Fe+A1O3A1 + Fe2O3 = 2Fe + A1O3
2Mg + N2= Mg3N23Mg + N2 = Mg3N2
2N2 + O2 =2NO2N2 + 2O2 = 2NO2
2 Ca + 2 H2O = 2 CaOH 1 + 2 H22Ca + 2H2O = 2CaOH1 + H2
2ZnS (s) + 2HCl (aq) = 4ZnCl2 (aq) + H2S (g)ZnS(s) + 2HCl(aq) = ZnCl2(aq) + H2S(g)
2KCLO3=2KCL+3O22KCLO3 = 2KCL + 3O2
2Li3PO4+3MgSO4=Mg3(PO4)2 + 3Li2SO4 2Li3PO4 + 3MgSO4 = Mg3(PO4)2 + 3Li2SO4
2Li3PO4+3MgSO4=Mg3(PO4)2 + 3Li2SO4 2Li3PO4 + 3MgSO4 = Mg3(PO4)2 + 3Li2SO4
2Li3PO4+3MgSO4= Mg3(PO4)2 + 3Li2SO42Li3PO4 + 3MgSO4 = Mg3(PO4)2 + 3Li2SO4
2KI+Pb(NO3)2=PbI2+2KNO32KI + Pb(NO3)2 = PbI2 + 2KNO3
2CO+Fe2O3=2Fe+2CO23CO + Fe2O3 = 2Fe + 3CO2
2NA+Br2 = 2NABr 2NA + Br2 = 2NABr
2NA+Br2 = 2NABr 2NA + Br2 = 2NABr
2HCl + Pb(NO3)2 = 2HNO3 + PbCl2(s)2HCl + Pb(NO3)2 = 2HNO3 + PbCl2(s)
2Na + 2H2O = H2 + 2NaOH2Na + 2H2O = H2 + 2NaOH
2C2H8+O2=CO2+H2OC2H8 + 4O2 = 2CO2 + 4H2O
2KOH + 4F2 = 2KF + F2O + H2O 2KOH + 2F2 = 2KF + F2O + H2O
2C2H6 + 7O2 = 4CO2 + 6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2Li2CO3(aq) + 2HNO3(aq) = H2O(l) + CO2(g) + 2LiNO3(aq)Li2CO3(aq) + 2HNO3(aq) = H2O(l) + CO2(g) + 2LiNO3(aq)
2NaCl+2H2O =2NaOH+Cl2 +H22NaCl + 2H2O = 2NaOH + Cl2 + H2
2Sb2S3 + O2 = 2Sb2O3 + SO22Sb2S3 + 9O2 = 2Sb2O3 + 6SO2
2C2H5NSCl + 7O2 = 4CO + H2O + NO + SO2 + HCl2C2H5NSCl + 7O2 = 4CO + 4H2O + 2NO + 2SO2 + 2HCl
2C4H10O2 + O2 = CO2 + 10H2O2C4H10O2 + 11O2 = 8CO2 + 10H2O
2C4H10O2 + O2 = CO2 + 10H2O2C4H10O2 + 11O2 = 8CO2 + 10H2O
2Al(OH)3 + H2CO3= Al2(CO3)3 + H2O2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O
2Na + 2H2O = H2 + NaOH2Na + 2H2O = H2 + 2NaOH
2LiOH=H2O+Li2O2LiOH = H2O + Li2O
2LiOH=H2O+Li2O2LiOH = H2O + Li2O
2Al+3Br2=2AlBr2Al + Br2 = 2AlBr
2As + 6NaOH = 2Na3AsO3 + 3H22As + 6NaOH = 2Na3AsO3 + 3H2
2C2H3O2F+O2=4CO+2H2O+2HF2C2H3O2F + O2 = 4CO + 2H2O + 2HF
2C2H3O2F+O2=4CO+2H2O+2HF2C2H3O2F + O2 = 4CO + 2H2O + 2HF
2C4H10+13O2=CO2+10H2O2C4H10 + 13O2 = 8CO2 + 10H2O
2(ClC2CH2)2S + O2 = HCl + SO2 + CO2 + H2O2(ClC2CH2)2S + 15O2 = 4HCl + 2SO2 + 12CO2 + 2H2O
2H2+O2=H2O2H2 + O2 = 2H2O
2H2+O2=2H2O2H2 + O2 = 2H2O
2Al3(ClO3)3 = AlCl + O22Al3(ClO3)3 = 6AlCl + 9O2
2Al3(ClO3)3 = 6AlCl + 9O22Al3(ClO3)3 = 6AlCl + 9O2
2Ca + 4H2O = 2Ca(OH)2 + 2H2Ca + 2H2O = Ca(OH)2 + H2
2Ca + Al(NO3)3 =2 Ca(NO3)3 + AlCa + Al(NO3)3 = Ca(NO3)3 + Al
2Ca + Al(NO3)3 = Ca(NO3)3 + AlCa + Al(NO3)3 = Ca(NO3)3 + Al
2C6H14+O2=12CO2+14H2O2C6H14 + 19O2 = 12CO2 + 14H2O
2NCl3 = N2 + Cl22NCl3 = N2 + 3Cl2
2C6H14+O2=12CO2+14H2O2C6H14 + 19O2 = 12CO2 + 14H2O
2Na+3H2O=NaOH+2H22Na + 2H2O = 2NaOH + H2
2H2+O2=2H2O2H2 + O2 = 2H2O
2AgCl+Mg=2Ag+MgCl22AgCl + Mg = 2Ag + MgCl2
2Ag + SO4 = Ag2SO42Ag + SO4 = Ag2SO4
2HCl + Pb(NO3)2 = PbCl2 + 2HNO3 2HCl + Pb(NO3)2 = PbCl2 + 2HNO3
2N2+O2=2N2O2N2 + O2 = 2N2O
2H2 + O2 = 2H2O2H2 + O2 = 2H2O
2BaO2=2BaO+O22BaO2 = 2BaO + O2
2BaO2=2BaO+O22BaO2 = 2BaO + O2
2KNO3 + H2CO3 = K2CO3 + 2HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
2KNO3 + H2CO3 = K2CO3 + 2HNO32KNO3 + H2CO3 = K2CO3 + 2HNO3
2NaCl+Ba(NO3)2 = 2NaNO3 + BaCl22NaCl + Ba(NO3)2 = 2NaNO3 + BaCl2
2Fe+2H2SO4=Fe2(SO4)3+3H22Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
2H2O2 = H2O + O22H2O2 = 2H2O + O2
2H2+1O2=2H2O2H2 + O2 = 2H2O
2H2+O2 = 2H2O2H2 + O2 = 2H2O
2CaBr = 2Ca+Br22CaBr = 2Ca + Br2
2Na3AsO4 + 3MgCl2 = Mg3(AsO4)2 + 6NaCl2Na3AsO4 + 3MgCl2 = Mg3(AsO4)2 + 6NaCl
2Sb(NO3)3 + 3H2S = Sb2S3 + 6HNO32Sb(NO3)3 + 3H2S = Sb2S3 + 6HNO3
2Ag2O = 4Ag + O22Ag2O = 4Ag + O2
2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
2Cu2(SO4)2 + 2Fe = Fe2(SO4)3 + 4Cu3Cu2(SO4)2 + 4Fe = 2Fe2(SO4)3 + 6Cu
2NH3 + 3NO = N2 + 3H2O4NH3 + 6NO = 5N2 + 6H2O
2K + 2H2O = KOH + H22K + 2H2O = 2KOH + H2
2NaCI+2AgNO3=2NaNO3+2AgCINaCI + AgNO3 = NaNO3 + AgCI
2LiOH(aq) + 2HBr(aq) = 2LiBr(aq) + 2H2OLiOH(aq) + HBr(aq) = LiBr(aq) + H2O
2Ca(CNO)2 + Ca(OCl)2 + H2O = CaCl2 +2N2 + 2Ca(HCO3)22Ca(CNO)2 + 3Ca(OCl)2 + 2H2O = 3CaCl2 + 2N2 + 2Ca(HCO3)2
2NaF + Br2 = NaBr + F22NaF + Br2 = 2NaBr + F2
2NaCl(aq)+Br2(l)=2NaBr(aq)+Cl2(s)2NaCl(aq) + Br2(l) = 2NaBr(aq) + Cl2(s)
2NaI(aq)+Br2(l)=2NaBr(aq)+I2(s)2NaI(aq) + Br2(l) = 2NaBr(aq) + I2(s)
2Ag(s)+CaSO4(aq)=Ag2SO4(aq)+Ca(s)2Ag(s) + CaSO4(aq) = Ag2SO4(aq) + Ca(s)
2K(s)+Zn(NO3)2(aq)=2KNO3(aq)+Zn(s)2K(s) + Zn(NO3)2(aq) = 2KNO3(aq) + Zn(s)
2Mg + O2 = MgO2Mg + O2 = 2MgO
2 AlCl3 + K2Cr2O7 + 7 H2SO4= Cr2(SO4)3 + K2SO4 + 7 H2O + 3 Cl2 + Al2(SO4)32AlCl3 + K2Cr2O7 + 7H2SO4 = Cr2(SO4)3 + K2SO4 + 7H2O + 3Cl2 + Al2(SO4)3
2Fe2O3=4Fe2O3Fe2O3 = Fe2O3
2Fe2O3=Fe2O3Fe2O3 = Fe2O3
2 NaNO3 + PbO=Pb(NO3)2 +Na2O 2NaNO3 + PbO = Pb(NO3)2 + Na2O
2AgF + CaCl2 = 2AgCl + CaF22AgF + CaCl2 = 2AgCl + CaF2
2NH3 (g) + Mg (s) = 3H2 (g) + Mg3N2 (s)2NH3(g) + 3Mg(s) = 3H2(g) + Mg3N2(s)
2Na (s) + MgF2 = 2NaF (s) + Mg (s)2Na(s) + MgF2 = 2NaF(s) + Mg(s)
2Li+2H2O=Li2O+2H22Li + H2O = Li2O + H2
2C2H4O + NO3 = 2CH3COOH + NO2C2H4O + NO3 = 2CH3COOH + NO
2LiBr+F2=2Li+2FBr2LiBr + F2 = 2Li + 2FBr
2P+3Br2=2PBr32P + 3Br2 = 2PBr3
2LiOH(aq) + 2HBr(aq) =2LiBr(aq) + 2H2OLiOH(aq) + HBr(aq) = LiBr(aq) + H2O
2Ca(s) + Cl2(g) = 2CaCl(aq)2Ca(s) + Cl2(g) = 2CaCl(aq)
2Ca + Cl2 = 2CaCl2Ca + Cl2 = 2CaCl
2LiOH + 2HBr = 2LiBr + 2H2OLiOH + HBr = LiBr + H2O
2LiOH + 2HBr=2LiBr + 2H2OLiOH + HBr = LiBr + H2O
2Ag2O = Ag + O22Ag2O = 4Ag + O2
2Al + 6NaOH = 3H 2 + 2Na 3 AlO 32Al + 6NaOH = 3H2 + 2Na3AlO3
2Mg + 2Cl2 = 2MgCl2Mg + Cl2 = MgCl2
2Ca 3 (PO 4 ) 2 + C + 6SiO 2 = CaSiO 3 + P 4 + CO2Ca3(PO4)2 + 10C + 6SiO2 = 6CaSiO3 + P4 + 10CO
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2KClO3 = 2KCl + 3O22KClO3 = 2KCl + 3O2
2H2+ O2= H2O2H2 + O2 = 2H2O
2N2 + 2O = NO2N2 + 4O = 2NO2
2HCl+Ba(OH)2=BaCl2+H2O2HCl + Ba(OH)2 = BaCl2 + 2H2O
2Cr+3O2=Cr2O34Cr + 3O2 = 2Cr2O3
2Ca + Cl2 = 2CaCl2Ca + Cl2 = 2CaCl
2Al+3CO3=AlCO3Al + CO3 = AlCO3
2Al+3CO3=AlCO3Al + CO3 = AlCO3
2Al+3CO3=AlCO3Al + CO3 = AlCO3
2LiOH + 2HBr = 2LiBr + 2H2OLiOH + HBr = LiBr + H2O
2Ca + Cl2 = 2CaCl2Ca + Cl2 = 2CaCl
2Na2O2+H2O=4NaOH+O22Na2O2 + 2H2O = 4NaOH + O2
2KBr + Pb(NO3)2 = 2KNO3 + PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2KBr + Pb(NO3)2 = 2KNO3 + PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2KBr+Pb(NO3)2=2KNO3+PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2Mg + O2 = 2 MgO2Mg + O2 = 2MgO
2Al+3F2=2AlF32Al + 3F2 = 2AlF3
2 C 7 H 10 N + 21 O 2 =14 CO 2 + 10 H 2 O + 2 NO 22C7H10N + 21O2 = 14CO2 + 10H2O + 2NO2
2KBr + Pb(NO3)2 = 2KNO3+ PbBr22KBr + Pb(NO3)2 = 2KNO3 + PbBr2
2Mg+2HCl=2MgCl+H2 2Mg + 2HCl = 2MgCl + H2
2FeCl3 + 2H2S = 2FeS + 4 HCl + Cl22FeCl3 + 2H2S = 2FeS + 4HCl + Cl2
2ZnS (s) + 2HCl (aq) = 4ZnCl2 (aq) + H2S (g)ZnS(s) + 2HCl(aq) = ZnCl2(aq) + H2S(g)
2NH3+6NO=5N2+6H2O4NH3 + 6NO = 5N2 + 6H2O
2NH3+6NO=5N2+6H2O4NH3 + 6NO = 5N2 + 6H2O
2H2S + O2 = SO2 + 2H2O2H2S + 3O2 = 2SO2 + 2H2O
2H2+2Cl2 =HClH2 + Cl2 = 2HCl
2Ca+Cl2=CaCl2Ca + Cl2 = CaCl2
2Ca+Cl2=CaCl2Ca + Cl2 = CaCl2
2 LiOH + 1 H2 SO4 = 1 Li2SO4 + 1 H2O2LiOH + H2SO4 = Li2SO4 + 2H2O
2P+O2=P2O54P + 5O2 = 2P2O5
2Ca + Cl2 = CaCl2Ca + Cl2 = 2CaCl
2Ca + Cl2 = CaCl2Ca + Cl2 = 2CaCl
2Ca + Cl2 = 2CaCl2Ca + Cl2 = 2CaCl
2Ca + Cl2 = 2 CaCl2Ca + Cl2 = 2CaCl
2Pb(OH)2 + HCl = H2O + PbCl2Pb(OH)2 + 2HCl = 2H2O + PbCl2
2N2 + 6H2 = 2NH3N2 + 3H2 = 2NH3
2Al2O3=3Al+3O22Al2O3 = 4Al + 3O2
2LiOH(aq) + 2HBr(aq) = 2LiBr(aq) + 2H2OLiOH(aq) + HBr(aq) = LiBr(aq) + H2O
2C2H6 + 5O2 = 2CO2 + 6H2O2C2H6 + 7O2 = 4CO2 + 6H2O
2Cu+4H2(SO4)=2Cu(SO4)2+4H2O+SO2Cu + 4H2(SO4) = Cu(SO4)2 + 4H2O + 2SO2
2Cu+4H2(SO4)=2Cu(SO4)2+4H2O+SO2Cu + 4H2(SO4) = Cu(SO4)2 + 4H2O + 2SO2
2LiBr + F2=2Li + 2FBr2LiBr + F2 = 2Li + 2FBr

This program was created with a lot of help from:




Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer





Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.