Enter Chemical Equation:

Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
0N2 + 0H2 = 0NH3N2 + 3H2 = 2NH3
0N2 + 0H2 = 0NH3N2 + 3H2 = 2NH3
0KBr(aq) + AgNO3(aq) = KNO3(aq) + AgBr(s)KBr(aq) + AgNO3(aq) = KNO3(aq) + AgBr(s)
0C2H2+0O2=0CO2+0H2O2C2H2 + 5O2 = 4CO2 + 2H2O
0CO2+0H2O=0C2H6+0O24CO2 + 6H2O = 2C2H6 + 7O2
0C2H5OH+0O2=0OCO2 +0H2OC2H5OH + 4O2 = 2OCO2 + 3H2O
0NO2+0H2O=0NH3+0O24NO2 + 6H2O = 4NH3 + 7O2
0NH3+0O2=0N2+0H2O4NH3 + 3O2 = 2N2 + 6H2O
0Ca3(PO4)2(s)+SiO2(s)+C(s) = CaSiO3(s)+P4(s)+CO(g)2Ca3(PO4)2(s) + 6SiO2(s) + 10C(s) = 6CaSiO3(s) + P4(s) + 10CO(g)
0CO2 + 0H20 = 0C2H6 + 0O220CO2 + 3H20 = 10C2H6 + 20O2
0CO2 + 0H20 = 0C2H6 + 0O220CO2 + 3H20 = 10C2H6 + 20O2
0CO2 + 0H20 = 0C2H6 + 0O220CO2 + 3H20 = 10C2H6 + 20O2
0NH3 + 0O2 = 0N2 + 0H2O4NH3 + 3O2 = 2N2 + 6H2O
0C2H2 + 0O2 = 0CO2 + 0H2O2C2H2 + 5O2 = 4CO2 + 2H2O
0C2H5OH +0O2 = 0CO2 + 0H2OC2H5OH + 3O2 = 2CO2 + 3H2O
0N2 + H2O = 0NH3 + 0NO5N2 + 6H2O = 4NH3 + 6NO
0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000100111Ag3NO3(aq) + FeCl3(aq) = Ag3Cl(s) + Fe(NO3)3(aq)3Ag3NO3(aq) + FeCl3(aq) = 3Ag3Cl(s) + Fe(NO3)3(aq)
0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000100111Ag3NO3(aq) + FeCl3(aq) = Ag3Cl(s) + Fe(NO3)3(aq)3Ag3NO3(aq) + FeCl3(aq) = 3Ag3Cl(s) + Fe(NO3)3(aq)
0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000100111Ag3NO3(aq) + FeCl3(aq) = Ag3Cl(s) + Fe(NO3)3(aq)3Ag3NO3(aq) + FeCl3(aq) = 3Ag3Cl(s) + Fe(NO3)3(aq)
000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000010011Ag3NO3(aq) + FeCl3(aq) = Ag3Cl(s) + Fe(NO3)3(aq)3Ag3NO3(aq) + FeCl3(aq) = 3Ag3Cl(s) + Fe(NO3)3(aq)
0 P4 + 6 H2 = 4 PH3P4 + 6H2 = 4PH3
0CH4 + N2CL4 = 0H2 + N2 + CL40CH4 + N2CL4 = 0H2 + N2 + CL4
0ZnO +CO = Zn + CO2ZnO + CO = Zn + CO2
0 NH3 + 3 SO2 = 0 (NH4)2 + 3 S + 2 O30NH3 + 3SO2 = 0(NH4)2 + 3S + 2O3
0C6H4(CH3)2 + C3H6O = C3H6O0C6H4(CH3)2 + C3H6O = C3H6O
0S2O3 + Br2 = 0S2O6 + 2Br0S2O3 + Br2 = 0S2O6 + 2Br
0FeSO4 +7 H2O(s) + 0MgO(s) = 0Fe2O3(s) + 0MgSO4(s) + H2O(g)0FeSO4 + H2O(s) + 0MgO(s) = 0Fe2O3(s) + 0MgSO4(s) + H2O(g)
0N2 + 0H2 = 0NH3N2 + 3H2 = 2NH3
0N2+0H2=0NH3N2 + 3H2 = 2NH3
0 Fe2O3(s) + H2(g) = Fe(s) + H2O(g)Fe2O3(s) + 3H2(g) = 2Fe(s) + 3H2O(g)
0N2+H2=NH3N2 + 3H2 = 2NH3
0CH4+0O2=0CO2+0H2OCH4 + 2O2 = CO2 + 2H2O
0H2O=0H2+0O22H2O = 2H2 + O2
0N2+0H2=0NH3N2 + 3H2 = 2NH3
0H2 + 0O2 = 0H2O2H2 + O2 = 2H2O
0H2O = 0H2 + 0O22H2O = 2H2 + O2
0N2 + 0H2 = 0NH3N2 + 3H2 = 2NH3
00000000H2SO4 + V2O3 = V2(SO4)3 + H2O3H2SO4 + V2O3 = V2(SO4)3 + 3H2O
00000000H2SO4 + V2O3 = V2(SO4)3 + H2O3H2SO4 + V2O3 = V2(SO4)3 + 3H2O
00CaBr2+F2=2Br+CaF2CaBr2 + F2 = 4Br + 2CaF
06 CO2 + 16 HNO3 + H3PO4 + H2O = C106H175O42N16P + O2106CO2 + 16HNO3 + H3PO4 + 78H2O = C106H175O42N16P + 150O2

This program was created with a lot of help from:

Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer

Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.