Use the Calculator Below to Balance Chemical Equations

Enter Chemical Equation:

Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
AgNO3 + HCl = HNO3 + AgClAgNO3 + HCl = HNO3 + AgCl
Al2(SO4)3+BaCl2=BaSO4+AlCl3Al2(SO4)3 + 3BaCl2 = 3BaSO4 + 2AlCl3
Al(OH)3=Al(OH)2+OHAl(OH)3 = Al(OH)2 + OH
Al + H2O=Al(OH)3 + H22Al + 6H2O = 2Al(OH)3 + 3H2
Al + H2O = Al(OH)3 + H22Al + 6H2O = 2Al(OH)3 + 3H2
Al2O3 + C+ Cl2 = CO+ AlCl3Al2O3 + 3C + 3Cl2 = 3CO + 2AlCl3
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlCl3 + AgNO3 = AgCl + Al(NO3)3AlCl3 + 3AgNO3 = 3AgCl + Al(NO3)3
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al(s)+Cl2(g)=AlCl3(s)2Al(s) + 3Cl2(g) = 2AlCl3(s)
Al(s)+HCl(aq)=AlCl3(aq)+H2(g)2Al(s) + 6HCl(aq) = 2AlCl3(aq) + 3H2(g)
Al(NO3)3 + H2 SO4 = HNO3 + Al2(SO4)32Al(NO3)3 + 3H2SO4 = 6HNO3 + Al2(SO4)3
Al + O = Al2O32Al + 3O = Al2O3
AgNO3 + CuCl2 = AgCl + Cu(NO3)22AgNO3 + CuCl2 = 2AgCl + Cu(NO3)2
Al(OH)3 + H2S = Al2S3 + H2O2Al(OH)3 + 3H2S = Al2S3 + 6H2O
Al2(SO4)3+K2CrO4=Al2(CrO4)3+K2SO4Al2(SO4)3 + 3K2CrO4 = Al2(CrO4)3 + 3K2SO4
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
AgNO3+H2SO4=Ag2SO4+HNO32AgNO3 + H2SO4 = Ag2SO4 + 2HNO3
Al(OH)3+HCl=AlCl3+H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Au2S3+H2=Au+H2SAu2S3 + 3H2 = 2Au + 3H2S
Al2(SO4)3 + NaOH = Al(OH)3 + Na2SO4 Al2(SO4)3 + 6NaOH = 2Al(OH)3 + 3Na2SO4
Al2O3 + H2SO4 = Al2(SO4)3 + H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
Al2O3 = Al + O22Al2O3 = 4Al + 3O2
AgNO3 + K3PO4 = Ag3PO4 + KNO33AgNO3 + K3PO4 = Ag3PO4 + 3KNO3
AlBr3 + Cl2 = AlCl3 + Br22AlBr3 + 3Cl2 = 2AlCl3 + 3Br2
Al2O3 = Al + O22Al2O3 = 4Al + 3O2
Ag(NO3)+NaCl=AgCl+Na(NO3)Ag(NO3) + NaCl = AgCl + Na(NO3)
AgNO3(aq) + LiF(aq)= AgF+LiNO3AgNO3(aq) + LiF(aq) = AgF + LiNO3
Al(NO3)3 (aq) + K2CO3 (aq) = Al2(CO3)3 (s) + KNO3 (aq)2Al(NO3)3(aq) + 3K2CO3(aq) = Al2(CO3)3(s) + 6KNO3(aq)
Ag + H2S + O2 = Ag2S + H2O4Ag + 2H2S + O2 = 2Ag2S + 2H2O
AgNO3 + CaCl2 = AgCl + Ca(NO3)22AgNO3 + CaCl2 = 2AgCl + Ca(NO3)2
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlCl3 + AgNO3 = AgCl + Al(NO3)3AlCl3 + 3AgNO3 = 3AgCl + Al(NO3)3
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al3+CuO=Cu2+Al2O34Al3 + 18CuO = 9Cu2 + 6Al2O3
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
AgNO3+H2SO4=Ag2SO4+HNO32AgNO3 + H2SO4 = Ag2SO4 + 2HNO3
Al(OH)3+ HCl=AlCl3+H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Au2S3+H2=Au+H2SAu2S3 + 3H2 = 2Au + 3H2S
Ag+S=AgSAg + S = AgS
AG+HNO3=AGNO3+NO+H2O3AG + 4HNO3 = 3AGNO3 + NO + 2H2O
Ag + H2SO4 = Ag2SO4 + SO2 + H22Ag + H2SO4 = Ag2SO4 + 0SO2 + H2
Al+Fe2O3=Fe+Al2O32Al + Fe2O3 = 2Fe + Al2O3
Al + Fe(NO2)2= Fe + Al(NO2)3 2Al + 3Fe(NO2)2 = 3Fe + 2Al(NO2)3
Al(OH)3 + H2S = Al2S3 + H2O2Al(OH)3 + 3H2S = Al2S3 + 6H2O
AgNO3 (aq) + PbBr2 (s) = AgBr (s) + Pb(NO3)2 (aq)2AgNO3(aq) + PbBr2(s) = 2AgBr(s) + Pb(NO3)2(aq)
Al+Cr2O3=Al2O3+Cr2Al + Cr2O3 = Al2O3 + 2Cr
AgNO3+H2SO4=Ag2SO4+HNO32AgNO3 + H2SO4 = Ag2SO4 + 2HNO3
Al(OH)3+HCl=AlCl3+H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Al2O3 + C + Cl2 = CO + AlCl3Al2O3 + 3C + 3Cl2 = 3CO + 2AlCl3
Al(s) + 3Zn(NO3)2(aq) = Al(NO3)3(aq) + Zn(s)2Al(s) + 3Zn(NO3)2(aq) = 2Al(NO3)3(aq) + 3Zn(s)
Au2S3 + H2 = Au + H2SAu2S3 + 3H2 = 2Au + 3H2S
Au2S3+H2=Au+H2SAu2S3 + 3H2 = 2Au + 3H2S
AgCrO4 + NaCl = AgCl + NaCrO4AgCrO4 + NaCl = AgCl + NaCrO4
Al+HBr=AlBr3+H22Al + 6HBr = 2AlBr3 + 3H2
AgNO3+H2S=Ag2S+HNO32AgNO3 + H2S = Ag2S + 2HNO3
Al+Sn(NO3)2=Al(NO3)3+Sn2Al + 3Sn(NO3)2 = 2Al(NO3)3 + 3Sn
Al+HCl=AlCl3+HAl + 3HCl = AlCl3 + 3H
Al+HCl=AlCl+HAl + HCl = AlCl + H
Al+HCL=AlCL+HAl + HCL = AlCL + H
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
Al4 C3 + H2O = CH4 + Al(OH)3Al4C3 + 12H2O = 3CH4 + 4Al(OH)3
AgNO3+Ca=AgCa+NO3AgNO3 + Ca = AgCa + NO3
As2O3+HNO3+H2O=H3AsO4+NO2As2O3 + 4HNO3 + H2O = 2H3AsO4 + 4NO2
As2O3+HNO3+H2O=H3AsO4+NO2As2O3 + 4HNO3 + H2O = 2H3AsO4 + 4NO2
As2O3+HNO3+H2O=H3AsO4+NO2As2O3 + 4HNO3 + H2O = 2H3AsO4 + 4NO2
Al(OH)3+H2SO4=Al2(SO4)3+H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
Al + O2 = Al2O3 4Al + 3O2 = 2Al2O3
AgNO3 + BaCl2 = AgCl + Ba(NO3)2 2AgNO3 + BaCl2 = 2AgCl + Ba(NO3)2
Ag+HNO3=NO+H2O+AgNO33Ag + 4HNO3 = NO + 2H2O + 3AgNO3
Al(OH)3 + HNO3=Al(NO3)3 + H2O Al(OH)3 + 3HNO3 = Al(NO3)3 + 3H2O
AgNO3+MgCl2=AgCl+Mg(NO3)22AgNO3 + MgCl2 = 2AgCl + Mg(NO3)2
AgNO3+MgCl2=AgCl+Mg(NO3)22AgNO3 + MgCl2 = 2AgCl + Mg(NO3)2
Al + HNO3 = Al(NO3)3 + N2O + H2O8Al + 30HNO3 = 8Al(NO3)3 + 3N2O + 15H2O
Al + HNO3 = Al(NO3)3 + NH4NO3 + H2O8Al + 30HNO3 = 8Al(NO3)3 + 3NH4NO3 + 9H2O
Al + HNO3 = Al(NO3)3 + N2 + H2O10Al + 36HNO3 = 10Al(NO3)3 + 3N2 + 18H2O
AgNO3=Ag+NO2+O22AgNO3 = 2Ag + 2NO2 + O2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al(OH)3 + H2S = Al2S3 + H2O2Al(OH)3 + 3H2S = Al2S3 + 6H2O
Al(OH)3 + H2SO4 = Al2(SO4)3 +H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
Al(s) + O2(g) = Al2O3(s)4Al(s) + 3O2(g) = 2Al2O3(s)
Au2S3 + H2 = Au + H2SAu2S3 + 3H2 = 2Au + 3H2S
Ag + HNO3 = AgNO3 + H2 =2Ag + 2HNO3 = 2AgNO3 + H2
Al2O3 = Al + O22Al2O3 = 4Al + 3O2
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
As2O3 + Cl2 + H2O = H3AsO4 + HClAs2O3 + 2Cl2 + 5H2O = 2H3AsO4 + 4HCl
AgNO3 + BaS = Ag2S + Ba(NO3)22AgNO3 + BaS = Ag2S + Ba(NO3)2
A4C3+H2O=A(OH)3+CH4A4C3 + 12H2O = 4A(OH)3 + 3CH4
Al + H2SO4 = Al2 (SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al + O2 = AlO2Al + O2 = AlO2
Ag +HNO3 = NO +H2O+AgNO33Ag + 4HNO3 = NO + 2H2O + 3AgNO3
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al+Fe2O3=Al2O3+Fe2Al + Fe2O3 = Al2O3 + 2Fe
Al2O3 + C + Cl2 = CO + AlCl3Al2O3 + 3C + 3Cl2 = 3CO + 2AlCl3
AgClO3 + Na2S = AgS + Na2ClO3AgClO3 + Na2S = AgS + Na2ClO3
Al + HCl = AlCl + H22Al + 2HCl = 2AlCl + H2
Al + Fe(NO2)2 = Fe + Al(NO2)32Al + 3Fe(NO2)2 = 3Fe + 2Al(NO2)3
Al + ZnCl2 = Zn + AlCl32Al + 3ZnCl2 = 3Zn + 2AlCl3
Au + 3NO3- + 6H+ = Au+++ + NO2 + H2OAu + 3NO3- + 6H+ = Au+++ + 3NO2 + 3H2O
AgNO3(aq) + BaS(aq) = BaNO3(aq) + AgS(aq)AgNO3(aq) + BaS(aq) = BaNO3(aq) + AgS(aq)
Al(OH)3+HCl=AlCl3+H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Al(OH)3+HCl=AlCl3+H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Al + Cl2 = AlCl32Al + 3Cl2 = 2AlCl3
Al(s) + O2(g) = Al2 O3(s)4Al(s) + 3O2(g) = 2Al2O3(s)
Al(s) + Zn(aq)++ = Al(aq)+++ + Zn(s)2Al(s) + 3Zn(aq)++ = 2Al(aq)+++ + 3Zn(s)
Al2(SO4)3+Ca(OH)2 = CaSO4+Al(OH)3Al2(SO4)3 + 3Ca(OH)2 = 3CaSO4 + 2Al(OH)3
Al2(SO4)3+Ca(OH)2+H2O = CaSO4+Al(OH)3Al2(SO4)3 + 3Ca(OH)2 + 0H2O = 3CaSO4 + 2Al(OH)3
Al2(SO)4+Ca(OH)+H20 = CaSO4+Al(OH)3+H2O-10Al2(SO)4 - 40Ca(OH) + 13H20 = -40CaSO4 - 20Al(OH)3 + 140H2O
Al4 C3 + H2 O = Al (O H)3 + C H4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Ag N O3 + Na2 S O4 = Ag 2S O4 + Na N O32AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO3
Ag N O3 + Na2 S O4 = Ag 2S O4 + Na N O32AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO3
Ag N O3 + Na2 S O4 = Ag 2S O4 + Na N O32AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO3
Ag N O3 + Na2 S O4 = Ag 2S O4 + Na N O32AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO3
Al (O H)3 + H Cl O4 = Al (Cl O4)3 + H2 O Al(OH)3 + 3HClO4 = Al(ClO4)3 + 3H2O
AgNO3 + BaCl2 = AgCl + Ba(NO3)22AgNO3 + BaCl2 = 2AgCl + Ba(NO3)2
AgNO3 + Ca = Ca(NO3)2 + Ag2AgNO3 + Ca = Ca(NO3)2 + 2Ag
AlO2 = Al + O2AlO2 = Al + O2
Ag + Cl = AgClAg + Cl = AgCl
Al + HCl = AlCl3 + HAl + 3HCl = AlCl3 + 3H
Au + HCl = AuCl + HAu + HCl = AuCl + H
Al + H2SO4 = AlSO4 + 2HAl + H2SO4 = AlSO4 + 2H
AgNO3(aq)+BaS(aq)=BaNO3(aq)+AgS(aq)AgNO3(aq) + BaS(aq) = BaNO3(aq) + AgS(aq)
AuCl3 + Ag = AgCl + AuAuCl3 + 3Ag = 3AgCl + Au
Al(s) + 3Zn(NO3)2(aq) =Al(NO3)3(aq) +Zn(s)2Al(s) + 3Zn(NO3)2(aq) = 2Al(NO3)3(aq) + 3Zn(s)
Al2O3(s)+C(s)+Cl2(g)=AlCl3(s)+CO(g) Al2O3(s) + 3C(s) + 3Cl2(g) = 2AlCl3(s) + 3CO(g)
Al + 3Br2 = AlBr32Al + 3Br2 = 2AlBr3
AgNO3 + NH4H2PO4 = AgPO4 + NH4NO3 + H2AgNO3 + NH4H2PO4 = AgPO4 + NH4NO3 + H2
AgBr (s) + MgS2O3( aq) = MgBr2 (aq) + Ag2S2O3 (aq)2AgBr(s) + MgS2O3(aq) = MgBr2(aq) + Ag2S2O3(aq)
Al2O3+H2O=Al(OH)3Al2O3 + 3H2O = 2Al(OH)3
Al+KOH+H2O=KAl(OH)4+H22Al + 2KOH + 6H2O = 2KAl(OH)4 + 3H2
Al + I2 = Al+++ + I-2Al + 3I2 = 2Al+++ + 6I-
Ag(NH3)2+ + 2HNO3 + Cl- = AgCl + 2NH4+ + 2NO3-Ag(NH3)2+ + 2HNO3 + Cl- = AgCl + 2NH4+ + 2NO3-
AgCl + 2NH4OH = Ag(NH3)2Cl + 2H2OAgCl + 2NH4OH = Ag(NH3)2Cl + 2H2O
AgCl+NH4OH=Ag(NH3)2Cl+H2OAgCl + 2NH4OH = Ag(NH3)2Cl + 2H2O
AgNO3 (aq) + PbBr2 (s) = AgBr (s) + Pb(NO3)2 (aq)2AgNO3(aq) + PbBr2(s) = 2AgBr(s) + Pb(NO3)2(aq)
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Al(OH)3 + HCl = AlCl3 + H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Al2O3 + NaOH + HF = Na3AlF6 + H2OAl2O3 + 6NaOH + 12HF = 2Na3AlF6 + 9H2O
Al2O3 + NaOH + HF = Na3AlF6 + H2OAl2O3 + 6NaOH + 12HF = 2Na3AlF6 + 9H2O
Al2(SO4)3(aq)+K3PO4(aq)=AlPO4(s)+K2SO4(aq)Al2(SO4)3(aq) + 2K3PO4(aq) = 2AlPO4(s) + 3K2SO4(aq)
AlP+H2O=AlO+H2PAlP + H2O = AlO + H2P
AlP+H2O=AlO+H2PAlP + H2O = AlO + H2P
AlF3 + CaO = Al2O3 + CaF2 2AlF3 + 3CaO = Al2O3 + 3CaF2
Al2S3+H2O =Al(OH)3 + 3H2S Al2S3 + 6H2O = 2Al(OH)3 + 3H2S
Ag+Br=AgBrAg + Br = AgBr
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
AgNO3 + PbBr2 = AgBr + Pb(NO3)22AgNO3 + PbBr2 = 2AgBr + Pb(NO3)2
AgNO3 + PbBr2 = AgBr + Pb(NO3)22AgNO3 + PbBr2 = 2AgBr + Pb(NO3)2
Al + TiO2 = Al2O3 + Ti4Al + 3TiO2 = 2Al2O3 + 3Ti
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
Al2S3 + HCl = AlCl3 + H2SAl2S3 + 6HCl = 2AlCl3 + 3H2S
Al + CaS = Al2S3 + Ca2Al + 3CaS = Al2S3 + 3Ca
AgNO3+LiOH=AgOH+LiNO3AgNO3 + LiOH = AgOH + LiNO3
AL(OH)3+HNO3 =AL(NO3)3+H2OAL(OH)3 + 3HNO3 = AL(NO3)3 + 3H2O
Al+CuO=Al2O3+Cu2Al + 3CuO = Al2O3 + 3Cu
Al+K2Cr2O7+H2SO4=Al2(SO4)3+Cr2(SO4)3+K2SO4+H2O2Al + K2Cr2O7 + 7H2SO4 = Al2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O
Al2O3=Al2+O3Al2O3 = Al2 + O3
Al+NaOH=Na3AlO3+H22Al + 6NaOH = 2Na3AlO3 + 3H2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al+H2SO4=Al2(SO4)2+H22Al + 2H2SO4 = Al2(SO4)2 + 2H2
AgNO3+BaCl2=AgCl+Ba(NO3)22AgNO3 + BaCl2 = 2AgCl + Ba(NO3)2
Al + C = Al4C34Al + 3C = Al4C3
Al2(CO3)3 = Al2O3 + CO2Al2(CO3)3 = Al2O3 + 3CO2
Al(s) + Cl2(g) = AlCl3(s)2Al(s) + 3Cl2(g) = 2AlCl3(s)
Al+Fe2O3=Al2O3+Fe2Al + Fe2O3 = Al2O3 + 2Fe
Al(OH)3+H2CO3=Al2(CO3)3+H2O2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O
Ag + NH4OH = Ag(NH3)2 + H2OAg + 2NH4OH = Ag(NH3)2 + 2H2O
AgI + NH4OH = AgOH + INH4AgI + NH4OH = AgOH + INH4
AgI + NH4OH = AgOH + INH4AgI + NH4OH = AgOH + INH4
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al(s)+Fe2O3(s)=Al2O3(l)+Fe(l)2Al(s) + Fe2O3(s) = Al2O3(l) + 2Fe(l)
Al2S3+H2O=Al(OH)3+H2SAl2S3 + 6H2O = 2Al(OH)3 + 3H2S
AgBr = Ag2Br + Br24AgBr = 2Ag2Br + Br2
Al(OH)3 + H2S=Al2S3 + H2O2Al(OH)3 + 3H2S = Al2S3 + 6H2O
Al + Br2 = Al Br3 2Al + 3Br2 = 2AlBr3
Al4C3 + H2O = Al(OH)3 + CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
As2S3+HNO3=H3AsO4+SO2+NO2+H2OAs2S3 + 22HNO3 = 2H3AsO4 + 3SO2 + 22NO2 + 8H2O
Al2(SO4)3(aq) + NaOH(aq) = Na2SO4(aq) + Al(OH)3(s)Al2(SO4)3(aq) + 6NaOH(aq) = 3Na2SO4(aq) + 2Al(OH)3(s)
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
Au(NO3)3 +K2CrO4=Au2(CrO4)3 + KNO32Au(NO3)3 + 3K2CrO4 = Au2(CrO4)3 + 6KNO3
Al+Cd(C2H3O2)2=Al(C2H3O2)3+ Cd2Al + 3Cd(C2H3O2)2 = 2Al(C2H3O2)3 + 3Cd
AgClO3 = AgCl + O22AgClO3 = 2AgCl + 3O2
Al2O3+C+Cl2=CO+AlCl3Al2O3 + 3C + 3Cl2 = 3CO + 2AlCl3
Al2O3+C+Cl2=CO+AlCl3Al2O3 + 3C + 3Cl2 = 3CO + 2AlCl3
Al(NO3)3 + H2SO4 = Al2(SO4)3 + HNO32Al(NO3)3 + 3H2SO4 = Al2(SO4)3 + 6HNO3
AlS + O2 = AlO2 + SAlS + O2 = AlO2 + S
Ag+H2SO4=Ag2SO4+SO2+H2O2Ag + 2H2SO4 = Ag2SO4 + SO2 + 2H2O
Au2O3 = Au + O22Au2O3 = 4Au + 3O2
Al2S3(s)+H2O(l)=2Al(OH)3(s)+3H2S(g)Al2S3(s) + 6H2O(l) = 2Al(OH)3(s) + 3H2S(g)
AgNO3+Na2Co3=Ag2NO3+Na2Co30AgNO3 + Na2Co3 = 0Ag2NO3 + Na2Co3
Al(OH)3+H2SO4=Al2(SO4)3+H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
Ag(s) +S(g) = Ag2S(s)2Ag(s) + S(g) = Ag2S(s)
Al2(CH3)6 + 3N2O = Al2O3 + 4CH4 + 3N2 +2CHAl2(CH3)6 + 3N2O = Al2O3 + 4CH4 + 3N2 + 2CH
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Al(OH)3+Fe2O3+KOH+SO4=KAl(SO4)2+12H2O+Fe-3Al(OH)3 + 2Fe2O3 - 3KOH - 6SO4 = -3KAl(SO4)2 - 6H2O + 4Fe
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al + ZnCl2 = Zn + AlCl32Al + 3ZnCl2 = 3Zn + 2AlCl3
Al + Pb(NO3)2 = Pb + Al(NO3)32Al + 3Pb(NO3)2 = 3Pb + 2Al(NO3)3
Al + ZnCl2 = Zn + AlCl32Al + 3ZnCl2 = 3Zn + 2AlCl3
Al + Pb(NO3)2 = Pb + Al(NO3)32Al + 3Pb(NO3)2 = 3Pb + 2Al(NO3)3
Al + Zn Cl2 = Zn + Al Cl32Al + 3ZnCl2 = 3Zn + 2AlCl3
Al + H Cl = Al Cl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Al(s) + 3Zn(NO3)2(aq) =Al(NO3)3(aq) +Zn(s)2Al(s) + 3Zn(NO3)2(aq) = 2Al(NO3)3(aq) + 3Zn(s)
Al(NO3)3=Al2O3 + NO2 + O24Al(NO3)3 = 2Al2O3 + 12NO2 + 3O2
Al(NO3)= Al2O3 + NO2 + O2-4Al(NO3) = -2Al2O3 - 4NO2 + O2
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Al + NH4 (SCN) = Al(SCN) + NH4Al + NH4(SCN) = Al(SCN) + NH4
Al + Ag (NO3) = AlNO3 + AgAl + Ag(NO3) = AlNO3 + Ag
Al + Fe Cl3 = AlCl3 + FeAl + FeCl3 = AlCl3 + Fe
Al + K4 Fe (CN)6 = AlFe (CN)6 + K4Al + K4Fe(CN)6 = AlFe(CN)6 + K4
Al + K4 Fe (CN)6 = AlFe (CN)6 + 4KAl + K4Fe(CN)6 = AlFe(CN)6 + 4K
Al + 2Na (OH) = Al(OH)2 + 2NaAl + 2Na(OH) = Al(OH)2 + 2Na
Al + 2NH4 (SCN) = Al(SCN) + 2NH4Al + NH4(SCN) = Al(SCN) + NH4
Al + Na2 CO3 = AlCO3 + 2NaAl + Na2CO3 = AlCO3 + 2Na
Al + Hg Cl2 = AlCl2 + HgAl + HgCl2 = AlCl2 + Hg
Al3 + Hg Cl2 = Al Cl2 + HgAl3 + 3HgCl2 = 3AlCl2 + 3Hg
Al3 + Na2 CO3 = Al CO3 + 2NaAl3 + 3Na2CO3 = 3AlCO3 + 6Na
AgCl = Ag + Cl22AgCl = 2Ag + Cl2
AlN + H2O = Al(OH)3 + NH3 AlN + 3H2O = Al(OH)3 + NH3
Al2(SO4)3 + NaOH = Al(OH)3 + Na2SO4 Al2(SO4)3 + 6NaOH = 2Al(OH)3 + 3Na2SO4
Al4C3+H2O=Al(OH)3+CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Al+O2=Al2O34Al + 3O2 = 2Al2O3
AgCl = Ag + Cl22AgCl = 2Ag + Cl2
AgNO3 + Ni= Ni(NO3)2 + Ag2AgNO3 + Ni = Ni(NO3)2 + 2Ag
Ag(NH3) + HCl = AgCl + HNH3Ag(NH3) + HCl = AgCl + HNH3
Al + HNO3 = Al(NO3)3 + NO2 +H2OAl + 6HNO3 = Al(NO3)3 + 3NO2 + 3H2O
Al + HNO3 = Al(NO3)3 + NO2 +H2OAl + 6HNO3 = Al(NO3)3 + 3NO2 + 3H2O
Al+HCl=H2+AlCl32Al + 6HCl = 3H2 + 2AlCl3
Ag2NO3+Ni=Ni2NO3+AgAg2NO3 + 2Ni = Ni2NO3 + 2Ag
AlBr3+K2SO4=KBr+Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
Al+Br2=AlBr32Al + 3Br2 = 2AlBr3
AgNO3+Cu=Cu(NO3)2+Ag2AgNO3 + Cu = Cu(NO3)2 + 2Ag
Al+ZnO=Al2O3+Zn2Al + 3ZnO = Al2O3 + 3Zn
Al+O2=Al2O34Al + 3O2 = 2Al2O3
AgNo3+PbBr2=AgBr+Pb(No3)22AgNo3 + PbBr2 = 2AgBr + Pb(No3)2
Al+MnO=Al2O3+Mn2Al + 3MnO = Al2O3 + 3Mn
Ag+HNO3=AgNO3+H2O+NO2Ag + 2HNO3 = AgNO3 + H2O + NO2
Ag+HNO3=AgNO3+H2O+NO2Ag + 2HNO3 = AgNO3 + H2O + NO2
Al2(CO3)3=Al2O3 + CO2 Al2(CO3)3 = Al2O3 + 3CO2
AgNO3+KCl=AgCl+KNO3AgNO3 + KCl = AgCl + KNO3
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al+NiBr2=AlBr3+Ni2Al + 3NiBr2 = 2AlBr3 + 3Ni
Al+Br2=AlBr32Al + 3Br2 = 2AlBr3
Al + CaS = Al2S3 + Ca2Al + 3CaS = Al2S3 + 3Ca
Al2S3 + HCl = AlCl3 + H2SAl2S3 + 6HCl = 2AlCl3 + 3H2S
Al2(SO4)3+KOH=K2SO4+Al(OH)3Al2(SO4)3 + 6KOH = 3K2SO4 + 2Al(OH)3
Al(OH)3+HCl=AlCl3+H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Al2O3=Al+O22Al2O3 = 4Al + 3O2
Al + CaS = Al2S3 + Ca2Al + 3CaS = Al2S3 + 3Ca
Al +Cr2O3 = Al2O3 + Cr2Al + Cr2O3 = Al2O3 + 2Cr
Ag2 So4 (Aq) +AlCl3 (aq) = AgCl(s) + Al2(So4)3 (Aq)3Ag2So4(Aq) + 2AlCl3(aq) = 6AgCl(s) + Al2(So4)3(Aq)
AgNO3+MgCl2=AgCl+Mg(NO3)22AgNO3 + MgCl2 = 2AgCl + Mg(NO3)2
Al2O3 + C = Al + CO22Al2O3 + 3C = 4Al + 3CO2
Al4C3 + H2O = Al(OH)3 + CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Ag2SO4+NH4Cl=AgCl+(NH4)2SO4Ag2SO4 + 2NH4Cl = 2AgCl + (NH4)2SO4
Al + O2 = AlO2Al + O2 = 2AlO
Al2S3=Al+SAl2S3 = 2Al + 3S
Al+HCl=AlCl+HAl + HCl = AlCl + H
AlF+HSO4=HF+AlSO4AlF + HSO4 = HF + AlSO4
Al+Fe3O2=AlO2+FeAl + Fe3O2 = AlO2 + 3Fe
Al(OH)3=Al2O3+H2O2Al(OH)3 = Al2O3 + 3H2O
AgNO3+K2SO4=Ag2SO4+KNO32AgNO3 + K2SO4 = Ag2SO4 + 2KNO3
AgNO3+KSO4=AgSO4+KNO3AgNO3 + KSO4 = AgSO4 + KNO3
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al2S3=Al+SAl2S3 = 2Al + 3S
Al2S3+H2O=2 Al(OH)3+3 H2SAl2S3 + 6H2O = 2Al(OH)3 + 3H2S
AlBr3 + CaCr2O7 + H3PO4 = Br2 + CrPO4 + Ca3(PO4)2 + AlPO4 + H2O6AlBr3 + 3CaCr2O7 + 14H3PO4 = 9Br2 + 6CrPO4 + Ca3(PO4)2 + 6AlPO4 + 21H2O
Al + O2 = Al2O3 ?4Al + 3O2 = 2Al2O3
Au+NaCN+O2+H2O=Na(Au(CN)2)+NaOH4Au + 8NaCN + O2 + 2H2O = 4Na(Au(CN)2) + 4NaOH
Al(OH)3+H4SiO4=Al4(SiO4)3+H2O4Al(OH)3 + 3H4SiO4 = Al4(SiO4)3 + 12H2O
Al2O3+H2SO4=Al2(SO4)3+H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
Al+H2SO4=H2+Al2(SO4)32Al + 3H2SO4 = 3H2 + Al2(SO4)3
Al2O3+H2SO4=Al2(SO4)3+H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
Al + 2O2=Al2O34Al + 3O2 = 2Al2O3
AlPo4 +Na2S = Al2S3 + Na3Po42AlPo4 + 3Na2S = Al2S3 + 2Na3Po4
Al(OH)3 + Mg3(PO4)2 = AlPO4 + Mg(OH)2 2Al(OH)3 + Mg3(PO4)2 = 2AlPO4 + 3Mg(OH)2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
AgCl+NH4H=Ag (NH3)2Cl+H2AgCl + 2NH4H = Ag(NH3)2Cl + 2H2
Al+H2SO4=Al2 (SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al2S3 + HCl = AlCl3 + H2SAl2S3 + 6HCl = 2AlCl3 + 3H2S
Al + CaS = Al2S3 + Ca2Al + 3CaS = Al2S3 + 3Ca
Al2S3+H2O=2Al(OH)3+3H2SAl2S3 + 6H2O = 2Al(OH)3 + 3H2S
As2O5(s) + Ca(OH)2(aq) = Ca3(AsO4)2(s) + H2O(l)As2O5(s) + 3Ca(OH)2(aq) = Ca3(AsO4)2(s) + 3H2O(l)
Ag2SO3 + 2NaCl = 2AgCl + Na2SO3Ag2SO3 + 2NaCl = 2AgCl + Na2SO3
Al(NO3)3 + H2SO4 = Al2(SO4)3 + HNO32Al(NO3)3 + 3H2SO4 = Al2(SO4)3 + 6HNO3
Au2S3(s) + H2 (g)=Au (s)+H2S (g)Au2S3(s) + 3H2(g) = 2Au(s) + 3H2S(g)
Al(NO3)3 + H2SO4 = Al2(SO4)3 + HNO3 2Al(NO3)3 + 3H2SO4 = Al2(SO4)3 + 6HNO3
Al(NO3)3 + H2SO4 = Al2(SO4)3 + HNO3 2Al(NO3)3 + 3H2SO4 = Al2(SO4)3 + 6HNO3
Al2O3 + H2SO4 = Al2(SO4)3 + H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
Al (s) + Fe2O3(s)= Al2O3 (l) + Fe (l)2Al(s) + Fe2O3(s) = Al2O3(l) + 2Fe(l)
Al (s) + Fe2O3(s)= Al2O3 (l) + Fe (l)2Al(s) + Fe2O3(s) = Al2O3(l) + 2Fe(l)
AgF+Na2S=AgS+Na2FAgF + Na2S = AgS + Na2F
Al( s ) + HCl( aq ) =AlCl 3 ( aq ) + H 2 ( g )2Al(s) + 6HCl(aq) = 2AlCl3(aq) + 3H2(g)
Al(OH)3 + NaNO3 = Al(NO3)3 + NaOHAl(OH)3 + 3NaNO3 = Al(NO3)3 + 3NaOH
Al(OH) + NaNO3 = Al(NO3) + NaOHAl(OH) + NaNO3 = Al(NO3) + NaOH
Al(OH)3 + NaNO3 = Al(NO3)3 + NaOHAl(OH)3 + 3NaNO3 = Al(NO3)3 + 3NaOH
AlOH + NaNO3 = AlNO3 + NaOHAlOH + NaNO3 = AlNO3 + NaOH
Al + CuCl2 = AlCl3 + Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
AlSO4 + BaCl = AlCl + BaSO4AlSO4 + BaCl = AlCl + BaSO4
Al4C3 + H2O = Al(OH)3 + CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Al(NO3)3(aq)+NH3(aq)+H2O(l)=Al(OH)3(s)+NH4NO3(aq)Al(NO3)3(aq) + 3NH3(aq) + 3H2O(l) = Al(OH)3(s) + 3NH4NO3(aq)
Al+3Br2=AlBr32Al + 3Br2 = 2AlBr3
Al + Fe(NO2)2 = Fe + Al(NO2)32Al + 3Fe(NO2)2 = 3Fe + 2Al(NO2)3
AgBr+GaPO4=Ag3PO4+GaBr33AgBr + GaPO4 = Ag3PO4 + GaBr3
AgBr+GaPO4=Ag3PO4+GaBr33AgBr + GaPO4 = Ag3PO4 + GaBr3
Al + 3Br2 = AlBr32Al + 3Br2 = 2AlBr3
Al2S3(s)+H2O(l)=2Al(OH)3(s)+3H2S(g)Al2S3(s) + 6H2O(l) = 2Al(OH)3(s) + 3H2S(g)
Ag + HCl = AgCl + H22Ag + 2HCl = 2AgCl + H2
As2 O3 + H I O3 + H2O = H3 As O4 +I25As2O3 + 4HIO3 + 13H2O = 10H3AsO4 + 2I2
As2 O3 + H I O3 + H2O = H3 As O4 +I25As2O3 + 4HIO3 + 13H2O = 10H3AsO4 + 2I2
As2 O4 + H I O3 + H2O = H3 As O4 +I25As2O4 + 2HIO3 + 14H2O = 10H3AsO4 + I2
Al + I2 = Al+++ + I-2Al + 3I2 = 2Al+++ + 6I-
Al(NO3)3 + Na2S = Al2S3 + NaNO32Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3
Al + Cr2O2 = Al2O3 + Cr4Al + 3Cr2O2 = 2Al2O3 + 6Cr
Al + Cr2O2 = Al2O3 + Cr4Al + 3Cr2O2 = 2Al2O3 + 6Cr
AlCl3+K= Al+KClAlCl3 + 3K = Al + 3KCl
Al (s) + H2SO4 (aq) = Al2 (SO4)3(aq) + H2 (g)2Al(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 3H2(g)
AgBr (s) + MgS2O3( aq) =MgBr2 (aq) + Ag2S2O3 (aq)2AgBr(s) + MgS2O3(aq) = MgBr2(aq) + Ag2S2O3(aq)
Ag2SO3+NaCl=AgCl+Na2SO3Ag2SO3 + 2NaCl = 2AgCl + Na2SO3
AgNO3+ OH = AgO +HNO3AgNO3 + OH = AgO + HNO3
Al + I2 = Al+++ + I-2Al + 3I2 = 2Al+++ + 6I-
Al+Fe2 O3=Al2O3+Fe2Al + Fe2O3 = Al2O3 + 2Fe
Al2+Fe O3=Al2O3+FeAl2 + FeO3 = Al2O3 + Fe
Al4C3+H2O=Al(OH)3+CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Al(s) + F2(g) = AlF2Al(s) + F2(g) = AlF2
Al(s) + 3Zn(NO3)2(aq)=Al(NO3)3(aq) +Zn(s)2Al(s) + 3Zn(NO3)2(aq) = 2Al(NO3)3(aq) + 3Zn(s)
AlPO4+ MgCl2= Mg3(PO4)2 + 2AlCl32AlPO4 + 3MgCl2 = Mg3(PO4)2 + 2AlCl3
Al(OH)3+NaHCO3 = Al+Na+H2O+CO2-1Al(OH)3 + 3NaHCO3 = -1Al + 3Na + 0H2O + 3CO2
Al(OH)3(s)+H2SO4(l)=Al2(SO4)3(aq)+H2O(l)2Al(OH)3(s) + 3H2SO4(l) = Al2(SO4)3(aq) + 6H2O(l)
Al3+ HCl=H+AlCl3Al3 + 9HCl = 9H + 3AlCl3
Al3+ Mg(NO3) 2= Mg2+Al(NO3)34Al3 + 18Mg(NO3)2 = 9Mg2 + 12Al(NO3)3
AgNO3+Na2CrO4=Ag2CrO4+NaNO32AgNO3 + Na2CrO4 = Ag2CrO4 + 2NaNO3
Al +3H+ = Al3+ + 3H26Al + 2H+ = 2Al3+ + H2
Al(s)+Cl2(g)=AlCl3(s)2Al(s) + 3Cl2(g) = 2AlCl3(s)
Al(OH)3 + HCl = AlCl3 + H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Al+S=AlSAl + S = AlS
AlCl3 + 3H2O + 3NH3 = Al(OH)3 + 3NH4ClAlCl3 + 3H2O + 3NH3 = Al(OH)3 + 3NH4Cl
Al + H2SO4 = H2 + Al (SO4)3Al + 3H2SO4 = 3H2 + Al(SO4)3
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al + H2O = Al(OH)3 + H2O0Al + H2O = 0Al(OH)3 + H2O
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
Al2(SO4)3+NaOH=Al(OH)3+Na2SO4Al2(SO4)3 + 6NaOH = 2Al(OH)3 + 3Na2SO4
Al2+(SO4)3+NaOH=Al(OH)3+Na2SO4Al2 + (SO4)3 + 6NaOH = 2Al(OH)3 + 3Na2SO4
AlBr2(aq) +Cl2(aq) = AlCl2(aq)+ Br2(s)AlBr2(aq) + Cl2(aq) = AlCl2(aq) + Br2(s)
AgNO3+CuSO4=AgSO4+CuNO3AgNO3 + CuSO4 = AgSO4 + CuNO3
AgNO3+CuSO4=AgSO4+CuNO3AgNO3 + CuSO4 = AgSO4 + CuNO3
AgNO3+BaCl2=AgCl+Ba(NO3)22AgNO3 + BaCl2 = 2AgCl + Ba(NO3)2
AgNO3(aq)+Zn(s)=Ag(s)+Zn(NO3)2(aq)2AgNO3(aq) + Zn(s) = 2Ag(s) + Zn(NO3)2(aq)
AgCl(s)=Ag(s)+Cl2(g)2AgCl(s) = 2Ag(s) + Cl2(g)
AgNO3 + HCl=AgCl + HNO3AgNO3 + HCl = AgCl + HNO3
AgNO3 + HCl = AgCl + HNO3AgNO3 + HCl = AgCl + HNO3
AgNO3 = Ag + NO2 + O22AgNO3 = 2Ag + 2NO2 + O2
AlCl3 + SCl2 =Al2S + Cl22AlCl3 + SCl2 = Al2S + 4Cl2
Al2C6+H2O=Al(OH)3+C2H2Al2C6 + 6H2O = 2Al(OH)3 + 3C2H2
Al4C3+H2O=Al(OH)3+CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Al+H2SO4=H2+Al2(SO4)32Al + 3H2SO4 = 3H2 + Al2(SO4)3
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlCl+NaPO4=AlPO4+NaClAlCl + NaPO4 = AlPO4 + NaCl
AlCl3(aq)+K2SO4(aq) = AlSO4+K2Cl3AlCl3(aq) + K2SO4(aq) = AlSO4 + K2Cl3
AlO + Fe = Fe2O3 + Al3AlO + 2Fe = Fe2O3 + 3Al
Al + BaO = Al2O3 + Ba2Al + 3BaO = Al2O3 + 3Ba
Al + H2SO4=Al2(SO4) 3 +H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
AlBr3+K2SO4=KBr+Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
As+NaOH=Na3AsO3+H22As + 6NaOH = 2Na3AsO3 + 3H2
Al+HNO3=Al(NO3)3+NO2+H2OAl + 6HNO3 = Al(NO3)3 + 3NO2 + 3H2O
Al+HNO3=AlNO3+NO2+H2OAl + 2HNO3 = AlNO3 + NO2 + H2O
Ag+HNO3=AgNO3+H2O+NO2Ag + 2HNO3 = AgNO3 + H2O + NO2
Al + HCl = AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Al + HCl = AlCl + H22Al + 2HCl = 2AlCl + H2
Al + Pb(NO3)2 = Al(NO3)3 + Pb2Al + 3Pb(NO3)2 = 2Al(NO3)3 + 3Pb
Al + Pb(NO3)2 = Al(NO3)2 + PbAl + Pb(NO3)2 = Al(NO3)2 + Pb
Al(s)+H2SO4(aq)=Al2(SO4)3(aq)+H2(g)2Al(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 3H2(g)
As2S3 +HNO3 +H2O = H2SO4 +H3AsO4 + NO3As2S3 + 28HNO3 + 4H2O = 9H2SO4 + 6H3AsO4 + 28NO
As2O5(s) + Ca(OH)2=Ca3(AsO4)2(s) + H2O(l)As2O5(s) + 3Ca(OH)2 = Ca3(AsO4)2(s) + 3H2O(l)
AgNO3 + BaCl2 = AgCl + Ba(NO3)2 2AgNO3 + BaCl2 = 2AgCl + Ba(NO3)2
Al + CuO4S =Cu + Al2(SO4)32Al + 3CuO4S = 3Cu + Al2(SO4)3
Al2(SO4)3 + NH3 +H2O = Al(OH)3 + (NH4)2SO4Al2(SO4)3 + 6NH3 + 6H2O = 2Al(OH)3 + 3(NH4)2SO4
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al4C3 + HCl = AlCl3 + CH4Al4C3 + 12HCl = 4AlCl3 + 3CH4
Al+Cl2=AlCl2Al + Cl2 = 2AlCl
Al(OH)3 +Mg3 (PO4)2 = AlPO4 +Mg(OH)2 2Al(OH)3 + Mg3(PO4)2 = 2AlPO4 + 3Mg(OH)2
As2S3 + 9O2 = 2As2O3 +SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlCl3 +AgNO3 =AgCl + Al(NO3)3AlCl3 + 3AgNO3 = 3AgCl + Al(NO3)3
Al + 3Zn(NO3)2= Al(NO3)3 + Zn2Al + 3Zn(NO3)2 = 2Al(NO3)3 + 3Zn
Al2(SO4)3+CO=Al2S3+CO2Al2(SO4)3 + 12CO = Al2S3 + 12CO2
Al + H+ = H2 + Al+++2Al + 6H+ = 3H2 + 2Al+++
Al + H+ = H2+ Al+++2Al + 6H+ = 3H2 + 2Al+++
Ag+HNO3 = AgNO3+NO+H2O3Ag + 4HNO3 = 3AgNO3 + NO + 2H2O
Al+Fe3O4=Al2O3+Fe8Al + 3Fe3O4 = 4Al2O3 + 9Fe
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Ag + HNO3 = NO + H2O + AgNO33Ag + 4HNO3 = NO + 2H2O + 3AgNO3
Al(NO3)3+AgNO3= AlNO3+AgNO30Al(NO3)3 + AgNO3 = 0AlNO3 + AgNO3
AgNO3 + Na2S = AgS + Na2NO3AgNO3 + Na2S = AgS + Na2NO3
Al2O3 (s) + C (s) + Cl2 (g) = AlCl3 (s) + CO (g)Al2O3(s) + 3C(s) + 3Cl2(g) = 2AlCl3(s) + 3CO(g)
AlBr + Na = NaBr + AlAlBr + Na = NaBr + Al
Al2O3 + C + Cl2 = CO + AlCl3Al2O3 + 3C + 3Cl2 = 3CO + 2AlCl3
Au2S3 (s) + H2 (g) = Au (s) + H2S (g)Au2S3(s) + 3H2(g) = 2Au(s) + 3H2S(g)
Al (s)+Fe2O3 (s) =Al2O3(l) + Fe (l)2Al(s) + Fe2O3(s) = Al2O3(l) + 2Fe(l)
Al+Fe2O3=Al2O3 + Fe2Al + Fe2O3 = Al2O3 + 2Fe
AlCl3 + H2SO4 = Al2(SO4)3 + HCl2AlCl3 + 3H2SO4 = Al2(SO4)3 + 6HCl
Al+CuSO4=Al2(SO4)3+Cu2Al + 3CuSO4 = Al2(SO4)3 + 3Cu
Al2O3(s)+C(s)+ Cl = AlCl3(s)+CO(g)Al2O3(s) + 3C(s) + 6Cl = 2AlCl3(s) + 3CO(g)
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Ag2O(s)=Ag(s)+O2(g)2Ag2O(s) = 4Ag(s) + O2(g)
Al(OH)3(s)+H2SO4(aq)=Al2(SO4)3(aq)+H2O2Al(OH)3(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 6H2O
Al(NO3)3+Na2S=Al2S3+NaNO32Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3
Al + CuSO4 =Cu+ Al2(SO4)32Al + 3CuSO4 = 3Cu + Al2(SO4)3
Al(OH)3 + Mg3(PO4)2 = AlPO4 + Mg(OH)22Al(OH)3 + Mg3(PO4)2 = 2AlPO4 + 3Mg(OH)2
Al+ZnCl2=Zn+AlCl32Al + 3ZnCl2 = 3Zn + 2AlCl3
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
As2O3 + 2VO2+ + H+ =As2O5 + 2VO++ + H2OAs2O3 + 4VO2+ + 4H+ = As2O5 + 4VO++ + 2H2O
Al2(SO4)3 (aq) + 6NaOH (aq) = 2Al(OH)3 (s) + 3Na2SO4 (aq)Al2(SO4)3(aq) + 6NaOH(aq) = 2Al(OH)3(s) + 3Na2SO4(aq)
Ag2S (s) + Al (s) = Al2S3 + Ag 3Ag2S(s) + 2Al(s) = Al2S3 + 6Ag
AlCl3 + NH4OH = Al(OH)3 + NH4ClAlCl3 + 3NH4OH = Al(OH)3 + 3NH4Cl
Al2 (SO4) 3+KCl=K2SO4+AlCl3Al2(SO4)3 + 6KCl = 3K2SO4 + 2AlCl3
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
AgNO3+Na2SO4=Ag2SO4+NaNO32AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO3
Al4C3+H2O=Al(OH)3+CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Al(s)+3Zn(NO3)2(aq)=Al(NO3)3(aq)+Zn(s)2Al(s) + 3Zn(NO3)2(aq) = 2Al(NO3)3(aq) + 3Zn(s)
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Ag+S8=Ag2S16Ag + S8 = 8Ag2S
Al+H2SO4= Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al2O3=Al+O22Al2O3 = 4Al + 3O2
Al+HCl=AlCl3+H(g)Al + 3HCl = AlCl3 + 3H(g)
Al2(CO3)3+HCl=AlCl3+CO2+H2OAl2(CO3)3 + 6HCl = 2AlCl3 + 3CO2 + 3H2O
AgOH+H3PO4=Ag3PO4+H2O3AgOH + H3PO4 = Ag3PO4 + 3H2O
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
Al2(SO4)3 (aq) + KOH (aq) = Al(OH)3 (s) + K2SO4 (aq) Al2(SO4)3(aq) + 6KOH(aq) = 2Al(OH)3(s) + 3K2SO4(aq)
Al2(SO4)3 (aq) + KOH (aq) = Al(OH)3 (s) + K2SO4 (aq) Al2(SO4)3(aq) + 6KOH(aq) = 2Al(OH)3(s) + 3K2SO4(aq)
Al(s)+S8(s)=Al2S3(s)16Al(s) + 3S8(s) = 8Al2S3(s)
Ag+HNO3 = AgNO3 + H2O + NO2 Ag + 2HNO3 = AgNO3 + H2O + NO2
Al + CO2 = Al2O3 + CO2Al + 3CO2 = Al2O3 + 3CO
AL +(H)2(SO)4= (AL)2((SO)4)3+(H)22AL + 3(H)2(SO)4 = (AL)2((SO)4)3 + 3(H)2
AgNO3 + H2S = Ag2S + HNO32AgNO3 + H2S = Ag2S + 2HNO3
Al(s)+Fe2O3(s)=Al2O3(l)+Fe(l)2Al(s) + Fe2O3(s) = Al2O3(l) + 2Fe(l)
Al + MnO2=Al2O3 + Mn4Al + 3MnO2 = 2Al2O3 + 3Mn
Al + NaOH + H2O= NaAlO2 + H22Al + 2NaOH + 2H2O = 2NaAlO2 + 3H2
AgNO3 + AlBr3 = AgBr + Al(NO3)33AgNO3 + AlBr3 = 3AgBr + Al(NO3)3
Al(s)+SnSO4(aq)=AlSO4(aq)+Sn(s)Al(s) + SnSO4(aq) = AlSO4(aq) + Sn(s)
AgNO3+Zn=Ag+Zn(NO3)22AgNO3 + Zn = 2Ag + Zn(NO3)2
AgCl=Ag+Cl22AgCl = 2Ag + Cl2
AsCl3+H2S=As2S3+HCl2AsCl3 + 3H2S = As2S3 + 6HCl
Al(NO3)3 + Na3PO4 = AlPO4 + NaNO3Al(NO3)3 + Na3PO4 = AlPO4 + 3NaNO3
Al2 (SO4) 3 + NH4OH = Al (OH) 3 + (NH4) 2SO4Al2(SO4)3 + 6NH4OH = 2Al(OH)3 + 3(NH4)2SO4
Ag(aq) + 2 NO3(aq) + H2O(l) = Ag2O(s) + 2 HNO3 2Ag(aq) + 2NO3(aq) + H2O(l) = Ag2O(s) + 2HNO3
Ag(aq) + 2 NO3(aq) + 2 H2O(l) = AgO(s) + 2 HNO3 Ag(aq) + 2NO3(aq) + H2O(l) = AgO(s) + 2HNO3
Ag(aq) + 2 NO3(aq) + 2 H2O(l) = AgO(s) + 2 HNO3 Ag(aq) + 2NO3(aq) + H2O(l) = AgO(s) + 2HNO3
Ag(aq) + 2 NO3(aq) + H2O(l) = AgO(s) + 2 HNO3 Ag(aq) + 2NO3(aq) + H2O(l) = AgO(s) + 2HNO3
Ag(aq) + NO3(aq) + 2 H2O(l) = AgO(s) + 2 HNO3Ag(aq) + 2NO3(aq) + H2O(l) = AgO(s) + 2HNO3
Al+H2O=Al(OH)3+H22Al + 6H2O = 2Al(OH)3 + 3H2
Al4C3 + H2O = Al(OH)3 + CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
AlCl3+NH4OH=Al(OH)3+NH4ClAlCl3 + 3NH4OH = Al(OH)3 + 3NH4Cl
Al2(SO4)3 + Ba(NO3)2 = Al(NO3)3 + BaSO4Al2(SO4)3 + 3Ba(NO3)2 = 2Al(NO3)3 + 3BaSO4
AgNO3+Na2SO4=Ag2SO4+NaNO32AgNO3 + Na2SO4 = Ag2SO4 + 2NaNO3
Al(OH)3+H2SO4=Al2(SO4)3+H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
Al(s)+HCl(aq)=AlCl3(aq)+H2(g)2Al(s) + 6HCl(aq) = 2AlCl3(aq) + 3H2(g)
Al+HCl=H2+AlCl32Al + 6HCl = 3H2 + 2AlCl3
AlBr3+K2SO4=KBr+Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
AgNO3+Cu=Cu(NO3)2+Ag2AgNO3 + Cu = Cu(NO3)2 + 2Ag
Al + HCl = H2 + AlCl32Al + 6HCl = 3H2 + 2AlCl3
Al2O3 + H2SO4 = Al2(SO4)3 + H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
Al + HNO3 = Al(NO3)3 + H22Al + 6HNO3 = 2Al(NO3)3 + 3H2
Al + HCl = AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Ag3AsO4 + Zn + H2SO4 = AsH3 + Ag +ZnSO4 +H2O 2Ag3AsO4 + 11Zn + 11H2SO4 = 2AsH3 + 6Ag + 11ZnSO4 + 8H2O
A + 2B = AB2A + 2B = AB2
Ag2O = Ag + O22Ag2O = 4Ag + O2
Al3+3NO3 = AlNO3(s)Al3 + 3NO3 = 3AlNO3(s)
Al+NO3= AlNO3Al + NO3 = AlNO3
Al + HCl = H2 + AlCl32Al + 6HCl = 3H2 + 2AlCl3
Al2O3 + Cl2 + C = AlCl3 + COAl2O3 + 3Cl2 + 3C = 2AlCl3 + 3CO
Al(s)+H2O(l)=Al(OH)3(s)+H2(g)2Al(s) + 6H2O(l) = 2Al(OH)3(s) + 3H2(g)
AgNO3+CaCl2=AgCl+Ca(NO3)22AgNO3 + CaCl2 = 2AgCl + Ca(NO3)2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
AgNO3+CaCl2=AgCl+Ca(NO3)22AgNO3 + CaCl2 = 2AgCl + Ca(NO3)2
Al+H2SO4=Al(SO4)3+H2Al + 3H2SO4 = Al(SO4)3 + 3H2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Al+HCl=H2+AlCl32Al + 6HCl = 3H2 + 2AlCl3
AgCl=Ag+Cl22AgCl = 2Ag + Cl2
AgCl=Ag+Cl22AgCl = 2Ag + Cl2
AgNO3+2N=Ag+2N(NO3)22AgNO3 + N = 2Ag + N(NO3)2
As2S5+HNO3=H3AsO4+H2SO4+NO2+H2OAs2S5 + 40HNO3 = 2H3AsO4 + 5H2SO4 + 40NO2 + 12H2O
As2S5+NHO3=H3AsO4+H2SO4+NO2+H2OAs2S5 + 40NHO3 = 2H3AsO4 + 5H2SO4 + 40NO2 + 12H2O
Ag + HNO3 = NO + AgNO3 + H2O3Ag + 4HNO3 = NO + 3AgNO3 + 2H2O
Al + H2O = Al2O3 + H22Al + 3H2O = Al2O3 + 3H2
Ag2SO3 + H2O = H2SO4 + AgAg2SO3 + H2O = H2SO4 + 2Ag
As + NaOH = Na3AsO3 + H22As + 6NaOH = 2Na3AsO3 + 3H2
AgHCO3=Ag2CO3+CO2+H2O2AgHCO3 = Ag2CO3 + CO2 + H2O
As2S3+9O2=2As2O3+SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlCl3+AgNO3=AgCl+Al(NO3)3AlCl3 + 3AgNO3 = 3AgCl + Al(NO3)3
Al2S3 + H2O = 2Al(OH)3 + 3H2SAl2S3 + 6H2O = 2Al(OH)3 + 3H2S
Al(s)+O2(g)=Al2O3(s)4Al(s) + 3O2(g) = 2Al2O3(s)
AlCl3 + H2SO4=Al2(SO4)3 + HCl2AlCl3 + 3H2SO4 = Al2(SO4)3 + 6HCl

This program was created with a lot of help from:

Biology Flashcards

FDA Drug Database
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher
Please read my Disclaimer

Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.